/src/gdal/ogr/ogrsf_frmts/mitab/mitab_feature.cpp
Line | Count | Source |
1 | | /********************************************************************** |
2 | | * |
3 | | * Name: mitab_feature.cpp |
4 | | * Project: MapInfo TAB Read/Write library |
5 | | * Language: C++ |
6 | | * Purpose: Implementation of the feature classes specific to MapInfo files. |
7 | | * Author: Daniel Morissette, dmorissette@dmsolutions.ca |
8 | | * |
9 | | ********************************************************************** |
10 | | * Copyright (c) 1999-2002, Daniel Morissette |
11 | | * Copyright (c) 2014, Even Rouault <even.rouault at spatialys.com> |
12 | | * |
13 | | * SPDX-License-Identifier: MIT |
14 | | **********************************************************************/ |
15 | | |
16 | | #include "cpl_port.h" |
17 | | #include "mitab.h" |
18 | | #include "mitab_geometry.h" |
19 | | #include "mitab_utils.h" |
20 | | |
21 | | #include <cctype> |
22 | | #include <cmath> |
23 | | #include <cstdio> |
24 | | #include <cstdlib> |
25 | | #include <cstring> |
26 | | #include <algorithm> |
27 | | #include <utility> |
28 | | |
29 | | #include "cpl_conv.h" |
30 | | #include "cpl_error.h" |
31 | | #include "cpl_string.h" |
32 | | #include "cpl_vsi.h" |
33 | | #include "mitab.h" |
34 | | #include "mitab_geometry.h" |
35 | | #include "mitab_priv.h" |
36 | | #include "mitab_utils.h" |
37 | | #include "ogr_core.h" |
38 | | #include "ogr_feature.h" |
39 | | #include "ogr_featurestyle.h" |
40 | | #include "ogr_geometry.h" |
41 | | |
42 | | /*===================================================================== |
43 | | * class TABFeature |
44 | | *====================================================================*/ |
45 | | |
46 | | /********************************************************************** |
47 | | * TABFeature::TABFeature() |
48 | | * |
49 | | * Constructor. |
50 | | **********************************************************************/ |
51 | | TABFeature::TABFeature(const OGRFeatureDefn *poDefnIn) |
52 | 1.20M | : OGRFeature(poDefnIn), m_nMapInfoType(TAB_GEOM_NONE), m_dXMin(0), |
53 | 1.20M | m_dYMin(0), m_dXMax(0), m_dYMax(0), m_bDeletedFlag(FALSE), m_nXMin(0), |
54 | 1.20M | m_nYMin(0), m_nXMax(0), m_nYMax(0), m_nComprOrgX(0), m_nComprOrgY(0) |
55 | 1.20M | { |
56 | 1.20M | } |
57 | | |
58 | | /********************************************************************** |
59 | | * TABFeature::~TABFeature() |
60 | | * |
61 | | * Destructor. |
62 | | **********************************************************************/ |
63 | | TABFeature::~TABFeature() |
64 | 1.20M | { |
65 | 1.20M | } |
66 | | |
67 | | /********************************************************************** |
68 | | * TABFeature::CreateFromMapInfoType() |
69 | | * |
70 | | * Factory that creates a TABFeature of the right class for the specified |
71 | | * MapInfo Type |
72 | | * |
73 | | **********************************************************************/ |
74 | | TABFeature *TABFeature::CreateFromMapInfoType(int nMapInfoType, |
75 | | OGRFeatureDefn *poDefn) |
76 | 31.7k | { |
77 | 31.7k | TABFeature *poFeature = nullptr; |
78 | | |
79 | | /*----------------------------------------------------------------- |
80 | | * Create new feature object of the right type |
81 | | *----------------------------------------------------------------*/ |
82 | 31.7k | switch (nMapInfoType) |
83 | 31.7k | { |
84 | 30.9k | case TAB_GEOM_NONE: |
85 | 30.9k | poFeature = new TABFeature(poDefn); |
86 | 30.9k | break; |
87 | 0 | case TAB_GEOM_SYMBOL_C: |
88 | 81 | case TAB_GEOM_SYMBOL: |
89 | 81 | poFeature = new TABPoint(poDefn); |
90 | 81 | break; |
91 | 2 | case TAB_GEOM_FONTSYMBOL_C: |
92 | 75 | case TAB_GEOM_FONTSYMBOL: |
93 | 75 | poFeature = new TABFontPoint(poDefn); |
94 | 75 | break; |
95 | 0 | case TAB_GEOM_CUSTOMSYMBOL_C: |
96 | 70 | case TAB_GEOM_CUSTOMSYMBOL: |
97 | 70 | poFeature = new TABCustomPoint(poDefn); |
98 | 70 | break; |
99 | 1 | case TAB_GEOM_LINE_C: |
100 | 193 | case TAB_GEOM_LINE: |
101 | 193 | case TAB_GEOM_PLINE_C: |
102 | 193 | case TAB_GEOM_PLINE: |
103 | 238 | case TAB_GEOM_MULTIPLINE_C: |
104 | 238 | case TAB_GEOM_MULTIPLINE: |
105 | 238 | case TAB_GEOM_V450_MULTIPLINE_C: |
106 | 240 | case TAB_GEOM_V450_MULTIPLINE: |
107 | 240 | case TAB_GEOM_V800_MULTIPLINE_C: |
108 | 240 | case TAB_GEOM_V800_MULTIPLINE: |
109 | 240 | poFeature = new TABPolyline(poDefn); |
110 | 240 | break; |
111 | 0 | case TAB_GEOM_ARC_C: |
112 | 74 | case TAB_GEOM_ARC: |
113 | 74 | poFeature = new TABArc(poDefn); |
114 | 74 | break; |
115 | | |
116 | 42 | case TAB_GEOM_REGION_C: |
117 | 109 | case TAB_GEOM_REGION: |
118 | 109 | case TAB_GEOM_V450_REGION_C: |
119 | 109 | case TAB_GEOM_V450_REGION: |
120 | 109 | case TAB_GEOM_V800_REGION_C: |
121 | 109 | case TAB_GEOM_V800_REGION: |
122 | 109 | poFeature = new TABRegion(poDefn); |
123 | 109 | break; |
124 | 0 | case TAB_GEOM_RECT_C: |
125 | 41 | case TAB_GEOM_RECT: |
126 | 41 | case TAB_GEOM_ROUNDRECT_C: |
127 | 83 | case TAB_GEOM_ROUNDRECT: |
128 | 83 | poFeature = new TABRectangle(poDefn); |
129 | 83 | break; |
130 | 0 | case TAB_GEOM_ELLIPSE_C: |
131 | 37 | case TAB_GEOM_ELLIPSE: |
132 | 37 | poFeature = new TABEllipse(poDefn); |
133 | 37 | break; |
134 | 0 | case TAB_GEOM_TEXT_C: |
135 | 33 | case TAB_GEOM_TEXT: |
136 | 33 | poFeature = new TABText(poDefn); |
137 | 33 | break; |
138 | 20 | case TAB_GEOM_MULTIPOINT_C: |
139 | 21 | case TAB_GEOM_MULTIPOINT: |
140 | 21 | case TAB_GEOM_V800_MULTIPOINT_C: |
141 | 21 | case TAB_GEOM_V800_MULTIPOINT: |
142 | 21 | poFeature = new TABMultiPoint(poDefn); |
143 | 21 | break; |
144 | 7 | case TAB_GEOM_COLLECTION_C: |
145 | 20 | case TAB_GEOM_COLLECTION: |
146 | 20 | case TAB_GEOM_V800_COLLECTION_C: |
147 | 20 | case TAB_GEOM_V800_COLLECTION: |
148 | 20 | poFeature = new TABCollection(poDefn); |
149 | 20 | break; |
150 | 0 | default: |
151 | | /*------------------------------------------------------------- |
152 | | * Unsupported feature type... we still return a valid feature |
153 | | * with NONE geometry after producing a Warning. |
154 | | * Callers can trap that case by checking CPLGetLastErrorNo() |
155 | | * against TAB_WarningFeatureTypeNotSupported |
156 | | *------------------------------------------------------------*/ |
157 | | // poFeature = new TABDebugFeature(poDefn); |
158 | 0 | poFeature = new TABFeature(poDefn); |
159 | |
|
160 | 0 | CPLError( |
161 | 0 | CE_Warning, |
162 | 0 | static_cast<CPLErrorNum>(TAB_WarningFeatureTypeNotSupported), |
163 | 0 | "Unsupported object type %d (0x%2.2x). Feature will be " |
164 | 0 | "returned with NONE geometry.", |
165 | 0 | nMapInfoType, nMapInfoType); |
166 | 31.7k | } |
167 | | |
168 | 31.7k | return poFeature; |
169 | 31.7k | } |
170 | | |
171 | | /********************************************************************** |
172 | | * TABFeature::CopyTABFeatureBase() |
173 | | * |
174 | | * Used by CloneTABFeature() to copy the basic (fields, geometry, etc.) |
175 | | * TABFeature members. |
176 | | * |
177 | | * The newly created feature is owned by the caller, and will have its own |
178 | | * reference to the OGRFeatureDefn. |
179 | | * |
180 | | * It is possible to create the clone with a different OGRFeatureDefn, |
181 | | * in this case, the fields won't be copied of course. |
182 | | * |
183 | | **********************************************************************/ |
184 | | void TABFeature::CopyTABFeatureBase(TABFeature *poDestFeature) |
185 | 10.4k | { |
186 | | /*----------------------------------------------------------------- |
187 | | * Copy fields only if OGRFeatureDefn is the same |
188 | | *----------------------------------------------------------------*/ |
189 | 10.4k | const OGRFeatureDefn *poThisDefnRef = GetDefnRef(); |
190 | | |
191 | 10.4k | if (poThisDefnRef == poDestFeature->GetDefnRef()) |
192 | 0 | { |
193 | 0 | for (int i = 0; i < poThisDefnRef->GetFieldCount(); i++) |
194 | 0 | { |
195 | 0 | poDestFeature->SetField(i, GetRawFieldRef(i)); |
196 | 0 | } |
197 | 0 | } |
198 | | |
199 | | /*----------------------------------------------------------------- |
200 | | * Copy the geometry |
201 | | *----------------------------------------------------------------*/ |
202 | 10.4k | poDestFeature->SetGeometry(GetGeometryRef()); |
203 | | |
204 | 10.4k | double dXMin = 0.0; |
205 | 10.4k | double dYMin = 0.0; |
206 | 10.4k | double dXMax = 0.0; |
207 | 10.4k | double dYMax = 0.0; |
208 | 10.4k | GetMBR(dXMin, dYMin, dXMax, dYMax); |
209 | 10.4k | poDestFeature->SetMBR(dXMin, dYMin, dXMax, dYMax); |
210 | | |
211 | 10.4k | GInt32 nXMin = 0; |
212 | 10.4k | GInt32 nYMin = 0; |
213 | 10.4k | GInt32 nXMax = 0; |
214 | 10.4k | GInt32 nYMax = 0; |
215 | 10.4k | GetIntMBR(nXMin, nYMin, nXMax, nYMax); |
216 | 10.4k | poDestFeature->SetIntMBR(nXMin, nYMin, nXMax, nYMax); |
217 | | |
218 | | // m_nMapInfoType is not carried but it is not required anyways. |
219 | | // it will default to TAB_GEOM_NONE |
220 | 10.4k | } |
221 | | |
222 | | /********************************************************************** |
223 | | * TABFeature::CloneTABFeature() |
224 | | * |
225 | | * Duplicate feature, including stuff specific to each TABFeature type. |
226 | | * |
227 | | * The newly created feature is owned by the caller, and will have its own |
228 | | * reference to the OGRFeatureDefn. |
229 | | * |
230 | | * It is possible to create the clone with a different OGRFeatureDefn, |
231 | | * in this case, the fields won't be copied of course. |
232 | | * |
233 | | * This method calls the generic TABFeature::CopyTABFeatureBase() and |
234 | | * then copies any members specific to its own type. |
235 | | **********************************************************************/ |
236 | | TABFeature * |
237 | | TABFeature::CloneTABFeature(const OGRFeatureDefn *poNewDefn /*=NULL*/) |
238 | 10.4k | { |
239 | | /*----------------------------------------------------------------- |
240 | | * Alloc new feature and copy the base stuff |
241 | | *----------------------------------------------------------------*/ |
242 | 10.4k | TABFeature *poNew = new TABFeature(poNewDefn ? poNewDefn : GetDefnRef()); |
243 | | |
244 | 10.4k | CopyTABFeatureBase(poNew); |
245 | | |
246 | | /*----------------------------------------------------------------- |
247 | | * And members specific to this class |
248 | | *----------------------------------------------------------------*/ |
249 | | // Nothing to do for this class |
250 | | |
251 | 10.4k | return poNew; |
252 | 10.4k | } |
253 | | |
254 | | /********************************************************************** |
255 | | * TABFeature::SetMBR() |
256 | | * |
257 | | * Set the values for the MBR corners for this feature. |
258 | | **********************************************************************/ |
259 | | void TABFeature::SetMBR(double dXMin, double dYMin, double dXMax, double dYMax) |
260 | 478k | { |
261 | 478k | m_dXMin = std::min(dXMin, dXMax); |
262 | 478k | m_dYMin = std::min(dYMin, dYMax); |
263 | 478k | m_dXMax = std::max(dXMin, dXMax); |
264 | 478k | m_dYMax = std::max(dYMin, dYMax); |
265 | 478k | } |
266 | | |
267 | | /********************************************************************** |
268 | | * TABFeature::GetMBR() |
269 | | * |
270 | | * Return the values for the MBR corners for this feature. |
271 | | **********************************************************************/ |
272 | | void TABFeature::GetMBR(double &dXMin, double &dYMin, double &dXMax, |
273 | | double &dYMax) |
274 | 148k | { |
275 | 148k | dXMin = m_dXMin; |
276 | 148k | dYMin = m_dYMin; |
277 | 148k | dXMax = m_dXMax; |
278 | 148k | dYMax = m_dYMax; |
279 | 148k | } |
280 | | |
281 | | /********************************************************************** |
282 | | * TABFeature::SetIntMBR() |
283 | | * |
284 | | * Set the integer coordinates values of the MBR of this feature. |
285 | | **********************************************************************/ |
286 | | void TABFeature::SetIntMBR(GInt32 nXMin, GInt32 nYMin, GInt32 nXMax, |
287 | | GInt32 nYMax) |
288 | 11.1k | { |
289 | 11.1k | m_nXMin = nXMin; |
290 | 11.1k | m_nYMin = nYMin; |
291 | 11.1k | m_nXMax = nXMax; |
292 | 11.1k | m_nYMax = nYMax; |
293 | 11.1k | } |
294 | | |
295 | | /********************************************************************** |
296 | | * TABFeature::GetIntMBR() |
297 | | * |
298 | | * Return the integer coordinates values of the MBR of this feature. |
299 | | **********************************************************************/ |
300 | | void TABFeature::GetIntMBR(GInt32 &nXMin, GInt32 &nYMin, GInt32 &nXMax, |
301 | | GInt32 &nYMax) |
302 | 26.8k | { |
303 | 26.8k | nXMin = m_nXMin; |
304 | 26.8k | nYMin = m_nYMin; |
305 | 26.8k | nXMax = m_nXMax; |
306 | 26.8k | nYMax = m_nYMax; |
307 | 26.8k | } |
308 | | |
309 | | /********************************************************************** |
310 | | * TABFeature::ReadRecordFromDATFile() |
311 | | * |
312 | | * Fill the fields part of the feature from the contents of the |
313 | | * table record pointed to by poDATFile. |
314 | | * |
315 | | * It is assumed that poDATFile currently points to the beginning of |
316 | | * the table record and that this feature's OGRFeatureDefn has been |
317 | | * properly initialized for this table. |
318 | | **********************************************************************/ |
319 | | int TABFeature::ReadRecordFromDATFile(TABDATFile *poDATFile) |
320 | 31.7k | { |
321 | 31.7k | CPLAssert(poDATFile); |
322 | | |
323 | 31.7k | const int numFields = poDATFile->GetNumFields(); |
324 | | |
325 | 280k | for (int iField = 0; iField < numFields; iField++) |
326 | 249k | { |
327 | 249k | switch (poDATFile->GetFieldType(iField)) |
328 | 249k | { |
329 | 11.6k | case TABFChar: |
330 | 11.6k | { |
331 | 11.6k | int iWidth(poDATFile->GetFieldWidth(iField)); |
332 | 11.6k | CPLString osValue(poDATFile->ReadCharField(iWidth)); |
333 | | |
334 | 11.6k | if (!poDATFile->GetEncoding().empty()) |
335 | 0 | { |
336 | 0 | osValue.Recode(poDATFile->GetEncoding(), CPL_ENC_UTF8); |
337 | 0 | } |
338 | 11.6k | SetField(iField, osValue); |
339 | 11.6k | break; |
340 | 0 | } |
341 | 842 | case TABFDecimal: |
342 | 842 | { |
343 | 842 | const double dValue = poDATFile->ReadDecimalField( |
344 | 842 | poDATFile->GetFieldWidth(iField)); |
345 | 842 | SetField(iField, dValue); |
346 | 842 | break; |
347 | 0 | } |
348 | 10.9k | case TABFInteger: |
349 | 10.9k | { |
350 | 10.9k | const int nValue = poDATFile->ReadIntegerField( |
351 | 10.9k | poDATFile->GetFieldWidth(iField)); |
352 | 10.9k | SetField(iField, nValue); |
353 | 10.9k | break; |
354 | 0 | } |
355 | 0 | case TABFSmallInt: |
356 | 0 | { |
357 | 0 | const int nValue = poDATFile->ReadSmallIntField( |
358 | 0 | poDATFile->GetFieldWidth(iField)); |
359 | 0 | SetField(iField, nValue); |
360 | 0 | break; |
361 | 0 | } |
362 | 0 | case TABFLargeInt: |
363 | 0 | { |
364 | 0 | const GInt64 nValue = poDATFile->ReadLargeIntField( |
365 | 0 | poDATFile->GetFieldWidth(iField)); |
366 | 0 | SetField(iField, nValue); |
367 | 0 | break; |
368 | 0 | } |
369 | 0 | case TABFFloat: |
370 | 0 | { |
371 | 0 | const double dValue = |
372 | 0 | poDATFile->ReadFloatField(poDATFile->GetFieldWidth(iField)); |
373 | 0 | SetField(iField, dValue); |
374 | 0 | break; |
375 | 0 | } |
376 | 0 | case TABFLogical: |
377 | 0 | { |
378 | 0 | const bool bValue = poDATFile->ReadLogicalField( |
379 | 0 | poDATFile->GetFieldWidth(iField)); |
380 | 0 | SetField(iField, bValue ? 1 : 0); |
381 | 0 | break; |
382 | 0 | } |
383 | 12.0k | case TABFDate: |
384 | 12.0k | { |
385 | 12.0k | #ifdef MITAB_USE_OFTDATETIME |
386 | 12.0k | int nYear = 0; |
387 | 12.0k | int nMonth = 0; |
388 | 12.0k | int nDay = 0; |
389 | 12.0k | const int status = poDATFile->ReadDateField( |
390 | 12.0k | poDATFile->GetFieldWidth(iField), &nYear, &nMonth, &nDay); |
391 | 12.0k | if (status == 0) |
392 | 11.6k | { |
393 | 11.6k | SetField(iField, nYear, nMonth, nDay, 0, 0, 0, 0); |
394 | 11.6k | } |
395 | | #else |
396 | | const char *pszValue = |
397 | | poDATFile->ReadDateField(poDATFile->GetFieldWidth(iField)); |
398 | | SetField(iField, pszValue); |
399 | | #endif |
400 | 12.0k | break; |
401 | 0 | } |
402 | 7.49k | case TABFTime: |
403 | 7.49k | { |
404 | 7.49k | #ifdef MITAB_USE_OFTDATETIME |
405 | 7.49k | int nHour = 0; |
406 | 7.49k | int nMin = 0; |
407 | 7.49k | int nMS = 0; |
408 | 7.49k | int nSec = 0; |
409 | 7.49k | const int status = |
410 | 7.49k | poDATFile->ReadTimeField(poDATFile->GetFieldWidth(iField), |
411 | 7.49k | &nHour, &nMin, &nSec, &nMS); |
412 | 7.49k | if (status == 0) |
413 | 191 | { |
414 | 191 | int nYear = 0; |
415 | 191 | int nMonth = 0; |
416 | 191 | int nDay = 0; |
417 | 191 | SetField(iField, nYear, nMonth, nDay, nHour, nMin, |
418 | 191 | nSec + nMS / 1000.0f, 0); |
419 | 191 | } |
420 | | #else |
421 | | const char *pszValue = |
422 | | poDATFile->ReadTimeField(poDATFile->GetFieldWidth(iField)); |
423 | | SetField(iField, pszValue); |
424 | | #endif |
425 | 7.49k | break; |
426 | 0 | } |
427 | 0 | case TABFDateTime: |
428 | 0 | { |
429 | 0 | #ifdef MITAB_USE_OFTDATETIME |
430 | 0 | int nYear = 0; |
431 | 0 | int nMonth = 0; |
432 | 0 | int nDay = 0; |
433 | 0 | int nHour = 0; |
434 | 0 | int nMin = 0; |
435 | 0 | int nMS = 0; |
436 | 0 | int nSec = 0; |
437 | 0 | const int status = poDATFile->ReadDateTimeField( |
438 | 0 | poDATFile->GetFieldWidth(iField), &nYear, &nMonth, &nDay, |
439 | 0 | &nHour, &nMin, &nSec, &nMS); |
440 | 0 | if (status == 0) |
441 | 0 | { |
442 | 0 | SetField(iField, nYear, nMonth, nDay, nHour, nMin, |
443 | 0 | nSec + nMS / 1000.0f, 0); |
444 | 0 | } |
445 | | #else |
446 | | const char *pszValue = poDATFile->ReadDateTimeField( |
447 | | poDATFile->GetFieldWidth(iField)); |
448 | | SetField(iField, pszValue); |
449 | | #endif |
450 | 0 | break; |
451 | 0 | } |
452 | 205k | default: |
453 | | // Other type??? Impossible! |
454 | 205k | CPLError(CE_Failure, CPLE_AssertionFailed, |
455 | 205k | "Unsupported field type for field %d!", iField); |
456 | 249k | } |
457 | 249k | } |
458 | | |
459 | 31.7k | return 0; |
460 | 31.7k | } |
461 | | |
462 | | /********************************************************************** |
463 | | * TABFeature::WriteRecordToDATFile() |
464 | | * |
465 | | * Write the attribute part of the feature to the .DAT file. |
466 | | * |
467 | | * It is assumed that poDATFile currently points to the beginning of |
468 | | * the table record and that this feature's OGRFeatureDefn has been |
469 | | * properly initialized for this table. |
470 | | * |
471 | | * Returns 0 on success, -1 on error. |
472 | | **********************************************************************/ |
473 | | int TABFeature::WriteRecordToDATFile(TABDATFile *poDATFile, |
474 | | TABINDFile *poINDFile, int *panIndexNo) |
475 | 481k | { |
476 | 481k | #ifdef MITAB_USE_OFTDATETIME |
477 | 481k | int nYear = 0; |
478 | 481k | int nMon = 0; |
479 | 481k | int nDay = 0; |
480 | 481k | int nHour = 0; |
481 | 481k | int nMin = 0; |
482 | 481k | int nTZFlag = 0; |
483 | 481k | float fSec = 0.0f; |
484 | 481k | #endif |
485 | | |
486 | 481k | CPLAssert(poDATFile); |
487 | | |
488 | 481k | const int numFields = poDATFile->GetNumFields(); |
489 | | |
490 | 481k | poDATFile->MarkRecordAsExisting(); |
491 | | |
492 | 481k | int nStatus = 0; |
493 | 1.81M | for (int iField = 0; nStatus == 0 && iField < numFields; iField++) |
494 | 1.33M | { |
495 | | // Hack for "extra" introduced field. |
496 | 1.33M | if (iField >= GetDefnRef()->GetFieldCount()) |
497 | 14 | { |
498 | 14 | CPLAssert(poDATFile->GetFieldType(iField) == TABFInteger && |
499 | 14 | iField == 0); |
500 | 14 | nStatus = poDATFile->WriteIntegerField(static_cast<int>(GetFID()), |
501 | 14 | poINDFile, 0); |
502 | 14 | continue; |
503 | 14 | } |
504 | 1.33M | CPLAssert(panIndexNo != nullptr); |
505 | | |
506 | 1.33M | switch (poDATFile->GetFieldType(iField)) |
507 | 1.33M | { |
508 | 1.32M | case TABFChar: |
509 | 1.32M | { |
510 | 1.32M | CPLString osValue(GetFieldAsString(iField)); |
511 | 1.32M | if (!poDATFile->GetEncoding().empty()) |
512 | 0 | { |
513 | 0 | osValue.Recode(CPL_ENC_UTF8, poDATFile->GetEncoding()); |
514 | 0 | } |
515 | 1.32M | nStatus = poDATFile->WriteCharField( |
516 | 1.32M | osValue, poDATFile->GetFieldWidth(iField), poINDFile, |
517 | 1.32M | panIndexNo[iField]); |
518 | 1.32M | } |
519 | 1.32M | break; |
520 | 0 | case TABFDecimal: |
521 | 0 | nStatus = poDATFile->WriteDecimalField( |
522 | 0 | GetFieldAsDouble(iField), poDATFile->GetFieldWidth(iField), |
523 | 0 | poDATFile->GetFieldPrecision(iField), poINDFile, |
524 | 0 | panIndexNo[iField]); |
525 | 0 | break; |
526 | 2.27k | case TABFInteger: |
527 | 2.27k | nStatus = poDATFile->WriteIntegerField( |
528 | 2.27k | GetFieldAsInteger(iField), poINDFile, panIndexNo[iField]); |
529 | 2.27k | break; |
530 | 0 | case TABFSmallInt: |
531 | 0 | nStatus = poDATFile->WriteSmallIntField( |
532 | 0 | static_cast<GInt16>(GetFieldAsInteger(iField)), poINDFile, |
533 | 0 | panIndexNo[iField]); |
534 | 0 | break; |
535 | 0 | case TABFLargeInt: |
536 | 0 | nStatus = poDATFile->WriteLargeIntField( |
537 | 0 | static_cast<GInt64>(GetFieldAsInteger64(iField)), poINDFile, |
538 | 0 | panIndexNo[iField]); |
539 | 0 | break; |
540 | 2.10k | case TABFFloat: |
541 | 2.10k | nStatus = poDATFile->WriteFloatField( |
542 | 2.10k | GetFieldAsDouble(iField), poINDFile, panIndexNo[iField]); |
543 | 2.10k | break; |
544 | 0 | case TABFLogical: |
545 | 0 | nStatus = |
546 | 0 | poDATFile->WriteLogicalField(GetFieldAsInteger(iField) == 1, |
547 | 0 | poINDFile, panIndexNo[iField]); |
548 | 0 | break; |
549 | 0 | case TABFDate: |
550 | 0 | #ifdef MITAB_USE_OFTDATETIME |
551 | 0 | if (IsFieldSetAndNotNull(iField)) |
552 | 0 | { |
553 | 0 | GetFieldAsDateTime(iField, &nYear, &nMon, &nDay, &nHour, |
554 | 0 | &nMin, &fSec, &nTZFlag); |
555 | 0 | } |
556 | 0 | else |
557 | 0 | { |
558 | 0 | nYear = 0; |
559 | 0 | nMon = 0; |
560 | 0 | nDay = 0; |
561 | 0 | } |
562 | |
|
563 | 0 | nStatus = poDATFile->WriteDateField( |
564 | 0 | nYear, nMon, nDay, poINDFile, panIndexNo[iField]); |
565 | | #else |
566 | | nStatus = poDATFile->WriteDateField( |
567 | | GetFieldAsString(iField), poINDFile, panIndexNo[iField]); |
568 | | #endif |
569 | 0 | break; |
570 | 0 | case TABFTime: |
571 | 0 | #ifdef MITAB_USE_OFTDATETIME |
572 | 0 | if (IsFieldSetAndNotNull(iField)) |
573 | 0 | { |
574 | 0 | GetFieldAsDateTime(iField, &nYear, &nMon, &nDay, &nHour, |
575 | 0 | &nMin, &fSec, &nTZFlag); |
576 | 0 | } |
577 | 0 | else |
578 | 0 | { |
579 | | // Put negative values, so that WriteTimeField() forges |
580 | | // a negative value, and ultimately write -1 in the binary |
581 | | // field |
582 | 0 | nHour = -1; |
583 | 0 | nMin = -1; |
584 | 0 | fSec = -1; |
585 | 0 | } |
586 | 0 | nStatus = poDATFile->WriteTimeField( |
587 | 0 | nHour, nMin, static_cast<int>(fSec), OGR_GET_MS(fSec), |
588 | 0 | poINDFile, panIndexNo[iField]); |
589 | |
|
590 | | #else |
591 | | nStatus = poDATFile->WriteTimeField( |
592 | | GetFieldAsString(iField), poINDFile, panIndexNo[iField]); |
593 | | #endif |
594 | 0 | break; |
595 | 0 | case TABFDateTime: |
596 | 0 | #ifdef MITAB_USE_OFTDATETIME |
597 | 0 | if (IsFieldSetAndNotNull(iField)) |
598 | 0 | { |
599 | 0 | GetFieldAsDateTime(iField, &nYear, &nMon, &nDay, &nHour, |
600 | 0 | &nMin, &fSec, &nTZFlag); |
601 | 0 | } |
602 | 0 | else |
603 | 0 | { |
604 | 0 | nYear = 0; |
605 | 0 | nMon = 0; |
606 | 0 | nDay = 0; |
607 | 0 | nHour = 0; |
608 | 0 | nMin = 0; |
609 | 0 | fSec = 0; |
610 | 0 | } |
611 | |
|
612 | 0 | nStatus = poDATFile->WriteDateTimeField( |
613 | 0 | nYear, nMon, nDay, nHour, nMin, static_cast<int>(fSec), |
614 | 0 | OGR_GET_MS(fSec), poINDFile, panIndexNo[iField]); |
615 | | #else |
616 | | nStatus = poDATFile->WriteDateTimeField( |
617 | | GetFieldAsString(iField), poINDFile, panIndexNo[iField]); |
618 | | #endif |
619 | 0 | break; |
620 | 0 | default: |
621 | | // Other type??? Impossible! |
622 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
623 | 0 | "Unsupported field type!"); |
624 | 1.33M | } |
625 | 1.33M | } |
626 | | |
627 | 481k | if (nStatus != 0) |
628 | 0 | return nStatus; |
629 | | |
630 | 481k | if (poDATFile->CommitRecordToFile() != 0) |
631 | 0 | return -1; |
632 | | |
633 | 481k | return 0; |
634 | 481k | } |
635 | | |
636 | | /********************************************************************** |
637 | | * TABFeature::ReadGeometryFromMAPFile() |
638 | | * |
639 | | * In derived classes, this method should be reimplemented to |
640 | | * fill the geometry and representation (color, etc...) part of the |
641 | | * feature from the contents of the .MAP object pointed to by poMAPFile. |
642 | | * |
643 | | * It is assumed that before calling ReadGeometryFromMAPFile(), poMAPFile |
644 | | * currently points to the beginning of a map object. |
645 | | * |
646 | | * bCoordBlockDataOnly=TRUE is used when this method is called to copy only |
647 | | * the CoordBlock data during splitting of object blocks. In this case we |
648 | | * need to process only the information related to the CoordBlock. One |
649 | | * important thing to avoid is reading/writing pen/brush/symbol definitions |
650 | | * as that would screw up their ref counters. |
651 | | * |
652 | | * ppoCoordBlock is used by TABCollection and by index splitting code |
653 | | * to provide a CoordBlock to use instead of the one from the poMAPFile and |
654 | | * return the current pointer at the end of the call. |
655 | | * |
656 | | * The current implementation does nothing since instances of TABFeature |
657 | | * objects contain no geometry (i.e. TAB_GEOM_NONE). |
658 | | * |
659 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
660 | | * been called. |
661 | | **********************************************************************/ |
662 | | int TABFeature::ReadGeometryFromMAPFile( |
663 | | TABMAPFile * /*poMapFile*/, TABMAPObjHdr * /*poObjHdr*/, |
664 | | GBool /*bCoordBlockDataOnly=FALSE*/, |
665 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
666 | 30.9k | { |
667 | | // Nothing to do. Instances of TABFeature objects contain no geometry. |
668 | 30.9k | return 0; |
669 | 30.9k | } |
670 | | |
671 | | /********************************************************************** |
672 | | * TABFeature::UpdateMBR() |
673 | | * |
674 | | * Fetch envelope of poGeom and update MBR. |
675 | | * Integer coord MBR is updated only if poMapFile is not NULL. |
676 | | * |
677 | | * Returns 0 on success, or -1 if there is no geometry in object |
678 | | **********************************************************************/ |
679 | | int TABFeature::UpdateMBR(TABMAPFile *poMapFile /*=NULL*/) |
680 | 21.7k | { |
681 | 21.7k | OGRGeometry *poGeom = GetGeometryRef(); |
682 | | |
683 | 21.7k | if (poGeom) |
684 | 21.7k | { |
685 | 21.7k | OGREnvelope oEnv; |
686 | 21.7k | poGeom->getEnvelope(&oEnv); |
687 | | |
688 | 21.7k | m_dXMin = oEnv.MinX; |
689 | 21.7k | m_dYMin = oEnv.MinY; |
690 | 21.7k | m_dXMax = oEnv.MaxX; |
691 | 21.7k | m_dYMax = oEnv.MaxY; |
692 | | |
693 | 21.7k | if (poMapFile) |
694 | 21.7k | { |
695 | 21.7k | poMapFile->Coordsys2Int(oEnv.MinX, oEnv.MinY, m_nXMin, m_nYMin); |
696 | 21.7k | poMapFile->Coordsys2Int(oEnv.MaxX, oEnv.MaxY, m_nXMax, m_nYMax); |
697 | | // Coordsy2Int can transform a min value to a max one and vice |
698 | | // versa. |
699 | 21.7k | if (m_nXMin > m_nXMax) |
700 | 0 | { |
701 | 0 | std::swap(m_nXMin, m_nXMax); |
702 | 0 | } |
703 | 21.7k | if (m_nYMin > m_nYMax) |
704 | 0 | { |
705 | 0 | std::swap(m_nYMin, m_nYMax); |
706 | 0 | } |
707 | 21.7k | } |
708 | | |
709 | 21.7k | return 0; |
710 | 21.7k | } |
711 | | |
712 | 0 | return -1; |
713 | 21.7k | } |
714 | | |
715 | | /********************************************************************** |
716 | | * TABFeature::ValidateCoordType() |
717 | | * |
718 | | * Checks the feature envelope to establish if the feature should be |
719 | | * written using Compressed coordinates or not and adjust m_nMapInfoType |
720 | | * accordingly. Calling this method also sets (initializes) m_nXMin, m_nYMin, |
721 | | * m_nXMax, m_nYMax |
722 | | * |
723 | | * This function should be used only by the ValidateMapInfoType() |
724 | | * implementations. |
725 | | * |
726 | | * Returns TRUE if coord. should be compressed, FALSE otherwise |
727 | | **********************************************************************/ |
728 | | GBool TABFeature::ValidateCoordType(TABMAPFile *poMapFile) |
729 | 16.2k | { |
730 | 16.2k | GBool bCompr = FALSE; |
731 | | |
732 | | /*------------------------------------------------------------- |
733 | | * Decide if coordinates should be compressed or not. |
734 | | *------------------------------------------------------------*/ |
735 | 16.2k | if (UpdateMBR(poMapFile) == 0) |
736 | 16.2k | { |
737 | | /* Test for max range < 65535 here instead of < 65536 to avoid |
738 | | * compressed coordinate overflows in some boundary situations |
739 | | */ |
740 | 16.2k | if ((static_cast<GIntBig>(m_nXMax) - m_nXMin) < 65535 && |
741 | 15.1k | (static_cast<GIntBig>(m_nYMax) - m_nYMin) < 65535) |
742 | 14.8k | { |
743 | 14.8k | bCompr = TRUE; |
744 | 14.8k | } |
745 | 16.2k | m_nComprOrgX = |
746 | 16.2k | static_cast<int>((static_cast<GIntBig>(m_nXMin) + m_nXMax) / 2); |
747 | 16.2k | m_nComprOrgY = |
748 | 16.2k | static_cast<int>((static_cast<GIntBig>(m_nYMin) + m_nYMax) / 2); |
749 | 16.2k | } |
750 | | |
751 | | /*------------------------------------------------------------- |
752 | | * Adjust native type |
753 | | *------------------------------------------------------------*/ |
754 | 16.2k | if (bCompr && ((m_nMapInfoType % 3) == 2)) |
755 | 9.57k | m_nMapInfoType = static_cast<TABGeomType>(m_nMapInfoType - |
756 | 9.57k | 1); // compr = 1, 4, 7, ... |
757 | 6.64k | else if (!bCompr && ((m_nMapInfoType % 3) == 1)) |
758 | 0 | m_nMapInfoType = static_cast<TABGeomType>( |
759 | 0 | m_nMapInfoType + 1); // non-compr = 2, 5, 8, ... |
760 | | |
761 | 16.2k | return bCompr; |
762 | 16.2k | } |
763 | | |
764 | | /********************************************************************** |
765 | | * TABFeature::ForceCoordTypeAndOrigin() |
766 | | * |
767 | | * This function is used by TABCollection::ValidateMapInfoType() to force |
768 | | * the coord type and compressed origin of all members of a collection |
769 | | * to be the same. (A replacement for ValidateCoordType() for this |
770 | | * specific case) |
771 | | **********************************************************************/ |
772 | | void TABFeature::ForceCoordTypeAndOrigin(TABGeomType nMapInfoType, GBool bCompr, |
773 | | GInt32 nComprOrgX, GInt32 nComprOrgY, |
774 | | GInt32 nXMin, GInt32 nYMin, |
775 | | GInt32 nXMax, GInt32 nYMax) |
776 | 0 | { |
777 | | /*------------------------------------------------------------- |
778 | | * Set Compressed Origin and adjust native type |
779 | | *------------------------------------------------------------*/ |
780 | 0 | m_nComprOrgX = nComprOrgX; |
781 | 0 | m_nComprOrgY = nComprOrgY; |
782 | |
|
783 | 0 | m_nMapInfoType = nMapInfoType; |
784 | |
|
785 | 0 | if (bCompr && ((m_nMapInfoType % 3) == 2)) |
786 | 0 | m_nMapInfoType = static_cast<TABGeomType>(m_nMapInfoType - |
787 | 0 | 1); // compr = 1, 4, 7, ... |
788 | 0 | else if (!bCompr && ((m_nMapInfoType % 3) == 1)) |
789 | 0 | m_nMapInfoType = static_cast<TABGeomType>( |
790 | 0 | m_nMapInfoType + 1); // non-compr = 2, 5, 8, ... |
791 | |
|
792 | 0 | m_nXMin = nXMin; |
793 | 0 | m_nYMin = nYMin; |
794 | 0 | m_nXMax = nXMax; |
795 | 0 | m_nYMax = nYMax; |
796 | 0 | } |
797 | | |
798 | | /********************************************************************** |
799 | | * TABFeature::WriteGeometryToMAPFile() |
800 | | * |
801 | | * |
802 | | * In derived classes, this method should be reimplemented to |
803 | | * write the geometry and representation (color, etc...) part of the |
804 | | * feature to the .MAP object pointed to by poMAPFile. |
805 | | * |
806 | | * It is assumed that before calling WriteGeometryToMAPFile(), poMAPFile |
807 | | * currently points to a valid map object. |
808 | | * |
809 | | * bCoordBlockDataOnly=TRUE is used when this method is called to copy only |
810 | | * the CoordBlock data during splitting of object blocks. In this case we |
811 | | * need to process only the information related to the CoordBlock. One |
812 | | * important thing to avoid is reading/writing pen/brush/symbol definitions |
813 | | * as that would screw up their ref counters. |
814 | | * |
815 | | * ppoCoordBlock is used by TABCollection and by index splitting code |
816 | | * to provide a CoordBlock to use instead of the one from the poMAPFile and |
817 | | * return the current pointer at the end of the call. |
818 | | * |
819 | | * The current implementation does nothing since instances of TABFeature |
820 | | * objects contain no geometry (i.e. TAB_GEOM_NONE). |
821 | | * |
822 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
823 | | * been called. |
824 | | **********************************************************************/ |
825 | | int TABFeature::WriteGeometryToMAPFile( |
826 | | TABMAPFile * /* poMapFile*/, TABMAPObjHdr * /*poObjHdr*/, |
827 | | GBool /*bCoordBlockDataOnly=FALSE*/, |
828 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
829 | 459k | { |
830 | | /*----------------------------------------------------------------- |
831 | | * Nothing to do... instances of TABFeature objects contain no geometry. |
832 | | *----------------------------------------------------------------*/ |
833 | | |
834 | 459k | return 0; |
835 | 459k | } |
836 | | |
837 | | /********************************************************************** |
838 | | * TABFeature::DumpMID() |
839 | | * |
840 | | * Dump feature attributes in a format similar to .MID data records. |
841 | | **********************************************************************/ |
842 | | void TABFeature::DumpMID(FILE *fpOut /*=NULL*/) |
843 | 0 | { |
844 | 0 | const OGRFeatureDefn *l_poDefn = GetDefnRef(); |
845 | |
|
846 | 0 | if (fpOut == nullptr) |
847 | 0 | fpOut = stdout; |
848 | |
|
849 | 0 | for (int iField = 0; iField < l_poDefn->GetFieldCount(); iField++) |
850 | 0 | { |
851 | 0 | const OGRFieldDefn *poFDefn = l_poDefn->GetFieldDefn(iField); |
852 | |
|
853 | 0 | fprintf(fpOut, " %s (%s) = %s\n", poFDefn->GetNameRef(), |
854 | 0 | OGRFieldDefn::GetFieldTypeName(poFDefn->GetType()), |
855 | 0 | GetFieldAsString(iField)); |
856 | 0 | } |
857 | |
|
858 | 0 | fflush(fpOut); |
859 | 0 | } |
860 | | |
861 | | /********************************************************************** |
862 | | * TABFeature::DumpMIF() |
863 | | * |
864 | | * Dump feature geometry in a format similar to .MIF files. |
865 | | **********************************************************************/ |
866 | | void TABFeature::DumpMIF(FILE *fpOut /*=NULL*/) |
867 | 0 | { |
868 | 0 | if (fpOut == nullptr) |
869 | 0 | fpOut = stdout; |
870 | | |
871 | | /*----------------------------------------------------------------- |
872 | | * Generate output... not much to do, feature contains no geometry. |
873 | | *----------------------------------------------------------------*/ |
874 | 0 | fprintf(fpOut, "NONE\n"); |
875 | |
|
876 | 0 | fflush(fpOut); |
877 | 0 | } |
878 | | |
879 | | /*===================================================================== |
880 | | * class TABPoint |
881 | | *====================================================================*/ |
882 | | |
883 | | /********************************************************************** |
884 | | * TABPoint::TABPoint() |
885 | | * |
886 | | * Constructor. |
887 | | **********************************************************************/ |
888 | 66.2k | TABPoint::TABPoint(const OGRFeatureDefn *poDefnIn) : TABFeature(poDefnIn) |
889 | 66.2k | { |
890 | 66.2k | } |
891 | | |
892 | | /********************************************************************** |
893 | | * TABPoint::~TABPoint() |
894 | | * |
895 | | * Destructor. |
896 | | **********************************************************************/ |
897 | | TABPoint::~TABPoint() |
898 | 66.2k | { |
899 | 66.2k | } |
900 | | |
901 | | /********************************************************************** |
902 | | * TABPoint::CloneTABFeature() |
903 | | * |
904 | | * Duplicate feature, including stuff specific to each TABFeature type. |
905 | | * |
906 | | * This method calls the generic TABFeature::CloneTABFeature() and |
907 | | * then copies any members specific to its own type. |
908 | | **********************************************************************/ |
909 | | TABFeature *TABPoint::CloneTABFeature(const OGRFeatureDefn *poNewDefn /*=NULL*/) |
910 | 1 | { |
911 | | /*----------------------------------------------------------------- |
912 | | * Alloc new feature and copy the base stuff |
913 | | *----------------------------------------------------------------*/ |
914 | 1 | TABPoint *poNew = new TABPoint(poNewDefn ? poNewDefn : GetDefnRef()); |
915 | | |
916 | 1 | CopyTABFeatureBase(poNew); |
917 | | |
918 | | /*----------------------------------------------------------------- |
919 | | * And members specific to this class |
920 | | *----------------------------------------------------------------*/ |
921 | | // ITABFeatureSymbol |
922 | 1 | *(poNew->GetSymbolDefRef()) = *GetSymbolDefRef(); |
923 | | |
924 | 1 | return poNew; |
925 | 1 | } |
926 | | |
927 | | /********************************************************************** |
928 | | * TABPoint::ValidateMapInfoType() |
929 | | * |
930 | | * Check the feature's geometry part and return the corresponding |
931 | | * mapinfo object type code. The m_nMapInfoType member will also |
932 | | * be updated for further calls to GetMapInfoType(); |
933 | | * |
934 | | * Returns TAB_GEOM_NONE if the geometry is not compatible with what |
935 | | * is expected for this object class. |
936 | | **********************************************************************/ |
937 | | TABGeomType TABPoint::ValidateMapInfoType(TABMAPFile *poMapFile /*=NULL*/) |
938 | 5.19k | { |
939 | | /*----------------------------------------------------------------- |
940 | | * Fetch and validate geometry |
941 | | * __TODO__ For now we always write in uncompressed format (until we |
942 | | * find that this is not correct... note that at this point the |
943 | | * decision to use compressed/uncompressed will likely be based on |
944 | | * the distance between the point and the object block center in |
945 | | * integer coordinates being > 32767 or not... remains to be verified) |
946 | | *----------------------------------------------------------------*/ |
947 | 5.19k | OGRGeometry *poGeom = GetGeometryRef(); |
948 | 5.19k | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint) |
949 | 5.19k | { |
950 | 5.19k | switch (GetFeatureClass()) |
951 | 5.19k | { |
952 | 0 | case TABFCFontPoint: |
953 | 0 | m_nMapInfoType = TAB_GEOM_FONTSYMBOL; |
954 | 0 | break; |
955 | 0 | case TABFCCustomPoint: |
956 | 0 | m_nMapInfoType = TAB_GEOM_CUSTOMSYMBOL; |
957 | 0 | break; |
958 | 5.19k | case TABFCPoint: |
959 | 5.19k | default: |
960 | 5.19k | m_nMapInfoType = TAB_GEOM_SYMBOL; |
961 | 5.19k | break; |
962 | 5.19k | } |
963 | 5.19k | } |
964 | 0 | else |
965 | 0 | { |
966 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
967 | 0 | "TABPoint: Missing or Invalid Geometry!"); |
968 | 0 | m_nMapInfoType = TAB_GEOM_NONE; |
969 | 0 | } |
970 | | |
971 | 5.19k | UpdateMBR(poMapFile); |
972 | | |
973 | 5.19k | return m_nMapInfoType; |
974 | 5.19k | } |
975 | | |
976 | | /********************************************************************** |
977 | | * TABPoint::ReadGeometryFromMAPFile() |
978 | | * |
979 | | * Fill the geometry and representation (color, etc...) part of the |
980 | | * feature from the contents of the .MAP object pointed to by poMAPFile. |
981 | | * |
982 | | * It is assumed that poMAPFile currently points to the beginning of |
983 | | * a map object. |
984 | | * |
985 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
986 | | * been called. |
987 | | **********************************************************************/ |
988 | | int TABPoint::ReadGeometryFromMAPFile( |
989 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
990 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
991 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
992 | 81 | { |
993 | | /* Nothing to do for bCoordBlockDataOnly (used by index splitting) */ |
994 | 81 | if (bCoordBlockDataOnly) |
995 | 0 | return 0; |
996 | | |
997 | | /*----------------------------------------------------------------- |
998 | | * Fetch and validate geometry type |
999 | | *----------------------------------------------------------------*/ |
1000 | 81 | m_nMapInfoType = poObjHdr->m_nType; |
1001 | | |
1002 | 81 | if (m_nMapInfoType != TAB_GEOM_SYMBOL && |
1003 | 0 | m_nMapInfoType != TAB_GEOM_SYMBOL_C) |
1004 | 0 | { |
1005 | 0 | CPLError( |
1006 | 0 | CE_Failure, CPLE_AssertionFailed, |
1007 | 0 | "ReadGeometryFromMAPFile(): unsupported geometry type %d (0x%2.2x)", |
1008 | 0 | m_nMapInfoType, m_nMapInfoType); |
1009 | 0 | return -1; |
1010 | 0 | } |
1011 | | |
1012 | | /*----------------------------------------------------------------- |
1013 | | * Read object information |
1014 | | *----------------------------------------------------------------*/ |
1015 | 81 | TABMAPObjPoint *poPointHdr = cpl::down_cast<TABMAPObjPoint *>(poObjHdr); |
1016 | | |
1017 | 81 | m_nSymbolDefIndex = poPointHdr->m_nSymbolId; // Symbol index |
1018 | | |
1019 | 81 | poMapFile->ReadSymbolDef(m_nSymbolDefIndex, &m_sSymbolDef); |
1020 | | |
1021 | | /*----------------------------------------------------------------- |
1022 | | * Create and fill geometry object |
1023 | | *----------------------------------------------------------------*/ |
1024 | 81 | double dX = 0.0; |
1025 | 81 | double dY = 0.0; |
1026 | | |
1027 | 81 | poMapFile->Int2Coordsys(poPointHdr->m_nX, poPointHdr->m_nY, dX, dY); |
1028 | 81 | OGRGeometry *poGeometry = new OGRPoint(dX, dY); |
1029 | | |
1030 | 81 | SetGeometryDirectly(poGeometry); |
1031 | | |
1032 | 81 | SetMBR(dX, dY, dX, dY); |
1033 | 81 | SetIntMBR(poObjHdr->m_nMinX, poObjHdr->m_nMinY, poObjHdr->m_nMaxX, |
1034 | 81 | poObjHdr->m_nMaxY); |
1035 | | |
1036 | 81 | return 0; |
1037 | 81 | } |
1038 | | |
1039 | | /********************************************************************** |
1040 | | * TABPoint::WriteGeometryToMAPFile() |
1041 | | * |
1042 | | * Write the geometry and representation (color, etc...) part of the |
1043 | | * feature to the .MAP object pointed to by poMAPFile. |
1044 | | * |
1045 | | * It is assumed that poMAPFile currently points to a valid map object. |
1046 | | * |
1047 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
1048 | | * been called. |
1049 | | **********************************************************************/ |
1050 | | int TABPoint::WriteGeometryToMAPFile(TABMAPFile *poMapFile, |
1051 | | TABMAPObjHdr *poObjHdr, |
1052 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
1053 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
1054 | 5.19k | { |
1055 | | /* Nothing to do for bCoordBlockDataOnly (used by index splitting) */ |
1056 | 5.19k | if (bCoordBlockDataOnly) |
1057 | 0 | return 0; |
1058 | | |
1059 | | /*----------------------------------------------------------------- |
1060 | | * We assume that ValidateMapInfoType() was called already and that |
1061 | | * the type in poObjHdr->m_nType is valid. |
1062 | | *----------------------------------------------------------------*/ |
1063 | 5.19k | CPLAssert(m_nMapInfoType == poObjHdr->m_nType); |
1064 | | |
1065 | | /*----------------------------------------------------------------- |
1066 | | * Fetch and validate geometry |
1067 | | *----------------------------------------------------------------*/ |
1068 | 5.19k | OGRGeometry *poGeom = GetGeometryRef(); |
1069 | 5.19k | OGRPoint *poPoint = nullptr; |
1070 | 5.19k | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint) |
1071 | 5.19k | poPoint = poGeom->toPoint(); |
1072 | 0 | else |
1073 | 0 | { |
1074 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
1075 | 0 | "TABPoint: Missing or Invalid Geometry!"); |
1076 | 0 | return -1; |
1077 | 0 | } |
1078 | | |
1079 | 5.19k | GInt32 nX = 0; |
1080 | 5.19k | GInt32 nY = 0; |
1081 | 5.19k | poMapFile->Coordsys2Int(poPoint->getX(), poPoint->getY(), nX, nY); |
1082 | | |
1083 | | /*----------------------------------------------------------------- |
1084 | | * Copy object information |
1085 | | *----------------------------------------------------------------*/ |
1086 | 5.19k | TABMAPObjPoint *poPointHdr = cpl::down_cast<TABMAPObjPoint *>(poObjHdr); |
1087 | | |
1088 | 5.19k | poPointHdr->m_nX = nX; |
1089 | 5.19k | poPointHdr->m_nY = nY; |
1090 | 5.19k | poPointHdr->SetMBR(nX, nY, nX, nY); |
1091 | | |
1092 | 5.19k | m_nSymbolDefIndex = poMapFile->WriteSymbolDef(&m_sSymbolDef); |
1093 | 5.19k | poPointHdr->m_nSymbolId = |
1094 | 5.19k | static_cast<GByte>(m_nSymbolDefIndex); // Symbol index |
1095 | | |
1096 | 5.19k | if (CPLGetLastErrorType() == CE_Failure) |
1097 | 0 | return -1; |
1098 | | |
1099 | 5.19k | return 0; |
1100 | 5.19k | } |
1101 | | |
1102 | | /********************************************************************** |
1103 | | * TABPoint::GetX() |
1104 | | * |
1105 | | * Return this point's X coordinate. |
1106 | | **********************************************************************/ |
1107 | | double TABPoint::GetX() |
1108 | 0 | { |
1109 | | |
1110 | | /*----------------------------------------------------------------- |
1111 | | * Fetch and validate geometry |
1112 | | *----------------------------------------------------------------*/ |
1113 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
1114 | 0 | OGRPoint *poPoint = nullptr; |
1115 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint) |
1116 | 0 | poPoint = poGeom->toPoint(); |
1117 | 0 | else |
1118 | 0 | { |
1119 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
1120 | 0 | "TABPoint: Missing or Invalid Geometry!"); |
1121 | 0 | return 0.0; |
1122 | 0 | } |
1123 | | |
1124 | 0 | return poPoint->getX(); |
1125 | 0 | } |
1126 | | |
1127 | | /********************************************************************** |
1128 | | * TABPoint::GetY() |
1129 | | * |
1130 | | * Return this point's Y coordinate. |
1131 | | **********************************************************************/ |
1132 | | double TABPoint::GetY() |
1133 | 0 | { |
1134 | | /*----------------------------------------------------------------- |
1135 | | * Fetch and validate geometry |
1136 | | *----------------------------------------------------------------*/ |
1137 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
1138 | 0 | OGRPoint *poPoint = nullptr; |
1139 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint) |
1140 | 0 | poPoint = poGeom->toPoint(); |
1141 | 0 | else |
1142 | 0 | { |
1143 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
1144 | 0 | "TABPoint: Missing or Invalid Geometry!"); |
1145 | 0 | return 0.0; |
1146 | 0 | } |
1147 | | |
1148 | 0 | return poPoint->getY(); |
1149 | 0 | } |
1150 | | |
1151 | | /********************************************************************** |
1152 | | * TABPoint::GetStyleString() const |
1153 | | * |
1154 | | * Return style string for this feature. |
1155 | | * |
1156 | | * Style String is built only once during the first call to GetStyleString(). |
1157 | | **********************************************************************/ |
1158 | | const char *TABPoint::GetStyleString() const |
1159 | 0 | { |
1160 | 0 | if (m_pszStyleString == nullptr) |
1161 | 0 | { |
1162 | 0 | m_pszStyleString = CPLStrdup(GetSymbolStyleString()); |
1163 | 0 | } |
1164 | |
|
1165 | 0 | return m_pszStyleString; |
1166 | 0 | } |
1167 | | |
1168 | | /********************************************************************** |
1169 | | * TABPoint::DumpMIF() |
1170 | | * |
1171 | | * Dump feature geometry in a format similar to .MIF POINTs. |
1172 | | **********************************************************************/ |
1173 | | void TABPoint::DumpMIF(FILE *fpOut /*=NULL*/) |
1174 | 0 | { |
1175 | 0 | if (fpOut == nullptr) |
1176 | 0 | fpOut = stdout; |
1177 | | |
1178 | | /*----------------------------------------------------------------- |
1179 | | * Fetch and validate geometry |
1180 | | *----------------------------------------------------------------*/ |
1181 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
1182 | 0 | OGRPoint *poPoint = nullptr; |
1183 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint) |
1184 | 0 | poPoint = poGeom->toPoint(); |
1185 | 0 | else |
1186 | 0 | { |
1187 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
1188 | 0 | "TABPoint: Missing or Invalid Geometry!"); |
1189 | 0 | return; |
1190 | 0 | } |
1191 | | |
1192 | | /*----------------------------------------------------------------- |
1193 | | * Generate output |
1194 | | *----------------------------------------------------------------*/ |
1195 | 0 | fprintf(fpOut, "POINT %.15g %.15g\n", poPoint->getX(), poPoint->getY()); |
1196 | |
|
1197 | 0 | DumpSymbolDef(fpOut); |
1198 | | |
1199 | | /*----------------------------------------------------------------- |
1200 | | * Handle stuff specific to derived classes |
1201 | | *----------------------------------------------------------------*/ |
1202 | | // cppcheck-suppress knownConditionTrueFalse |
1203 | 0 | if (GetFeatureClass() == TABFCFontPoint) |
1204 | 0 | { |
1205 | 0 | TABFontPoint *poFeature = cpl::down_cast<TABFontPoint *>(this); |
1206 | 0 | fprintf(fpOut, " m_nFontStyle = 0x%2.2x (%d)\n", |
1207 | 0 | poFeature->GetFontStyleTABValue(), |
1208 | 0 | poFeature->GetFontStyleTABValue()); |
1209 | |
|
1210 | 0 | poFeature->DumpFontDef(fpOut); |
1211 | 0 | } |
1212 | | // cppcheck-suppress knownConditionTrueFalse |
1213 | 0 | if (GetFeatureClass() == TABFCCustomPoint) |
1214 | 0 | { |
1215 | 0 | TABCustomPoint *poFeature = cpl::down_cast<TABCustomPoint *>(this); |
1216 | |
|
1217 | 0 | fprintf(fpOut, " m_nUnknown_ = 0x%2.2x (%d)\n", |
1218 | 0 | poFeature->m_nUnknown_, poFeature->m_nUnknown_); |
1219 | 0 | fprintf(fpOut, " m_nCustomStyle = 0x%2.2x (%d)\n", |
1220 | 0 | poFeature->GetCustomSymbolStyle(), |
1221 | 0 | poFeature->GetCustomSymbolStyle()); |
1222 | |
|
1223 | 0 | poFeature->DumpFontDef(fpOut); |
1224 | 0 | } |
1225 | |
|
1226 | 0 | fflush(fpOut); |
1227 | 0 | } |
1228 | | |
1229 | | /*===================================================================== |
1230 | | * class TABFontPoint |
1231 | | *====================================================================*/ |
1232 | | |
1233 | | /********************************************************************** |
1234 | | * TABFontPoint::TABFontPoint() |
1235 | | * |
1236 | | * Constructor. |
1237 | | **********************************************************************/ |
1238 | | TABFontPoint::TABFontPoint(const OGRFeatureDefn *poDefnIn) |
1239 | 15.8k | : TABPoint(poDefnIn), m_dAngle(0.0), m_nFontStyle(0) |
1240 | 15.8k | { |
1241 | 15.8k | } |
1242 | | |
1243 | | /********************************************************************** |
1244 | | * TABFontPoint::~TABFontPoint() |
1245 | | * |
1246 | | * Destructor. |
1247 | | **********************************************************************/ |
1248 | | TABFontPoint::~TABFontPoint() |
1249 | 15.8k | { |
1250 | 15.8k | } |
1251 | | |
1252 | | /********************************************************************** |
1253 | | * TABFontPoint::CloneTABFeature() |
1254 | | * |
1255 | | * Duplicate feature, including stuff specific to each TABFeature type. |
1256 | | * |
1257 | | * This method calls the generic TABFeature::CloneTABFeature() and |
1258 | | * then copies any members specific to its own type. |
1259 | | **********************************************************************/ |
1260 | | TABFeature * |
1261 | | TABFontPoint::CloneTABFeature(const OGRFeatureDefn *poNewDefn /*=NULL*/) |
1262 | 0 | { |
1263 | | /*----------------------------------------------------------------- |
1264 | | * Alloc new feature and copy the base stuff |
1265 | | *----------------------------------------------------------------*/ |
1266 | 0 | TABFontPoint *poNew = |
1267 | 0 | new TABFontPoint(poNewDefn ? poNewDefn : GetDefnRef()); |
1268 | |
|
1269 | 0 | CopyTABFeatureBase(poNew); |
1270 | | |
1271 | | /*----------------------------------------------------------------- |
1272 | | * And members specific to this class |
1273 | | *----------------------------------------------------------------*/ |
1274 | | // ITABFeatureSymbol |
1275 | 0 | *(poNew->GetSymbolDefRef()) = *GetSymbolDefRef(); |
1276 | | |
1277 | | // ITABFeatureFont |
1278 | 0 | *(poNew->GetFontDefRef()) = *GetFontDefRef(); |
1279 | |
|
1280 | 0 | poNew->SetSymbolAngle(GetSymbolAngle()); |
1281 | 0 | poNew->SetFontStyleTABValue(GetFontStyleTABValue()); |
1282 | |
|
1283 | 0 | return poNew; |
1284 | 0 | } |
1285 | | |
1286 | | /********************************************************************** |
1287 | | * TABFontPoint::ReadGeometryFromMAPFile() |
1288 | | * |
1289 | | * Fill the geometry and representation (color, etc...) part of the |
1290 | | * feature from the contents of the .MAP object pointed to by poMAPFile. |
1291 | | * |
1292 | | * It is assumed that poMAPFile currently points to the beginning of |
1293 | | * a map object. |
1294 | | * |
1295 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
1296 | | * been called. |
1297 | | **********************************************************************/ |
1298 | | int TABFontPoint::ReadGeometryFromMAPFile( |
1299 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
1300 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
1301 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
1302 | 75 | { |
1303 | | /* Nothing to do for bCoordBlockDataOnly (used by index splitting) */ |
1304 | 75 | if (bCoordBlockDataOnly) |
1305 | 0 | return 0; |
1306 | | |
1307 | | /*----------------------------------------------------------------- |
1308 | | * Fetch and validate geometry type |
1309 | | *----------------------------------------------------------------*/ |
1310 | 75 | m_nMapInfoType = poObjHdr->m_nType; |
1311 | | |
1312 | 75 | if (m_nMapInfoType != TAB_GEOM_FONTSYMBOL && |
1313 | 2 | m_nMapInfoType != TAB_GEOM_FONTSYMBOL_C) |
1314 | 0 | { |
1315 | 0 | CPLError( |
1316 | 0 | CE_Failure, CPLE_AssertionFailed, |
1317 | 0 | "ReadGeometryFromMAPFile(): unsupported geometry type %d (0x%2.2x)", |
1318 | 0 | m_nMapInfoType, m_nMapInfoType); |
1319 | 0 | return -1; |
1320 | 0 | } |
1321 | | |
1322 | | /*----------------------------------------------------------------- |
1323 | | * Read object information |
1324 | | * NOTE: This symbol type does not contain a reference to a |
1325 | | * SymbolDef block in the file, but we still use the m_sSymbolDef |
1326 | | * structure to store the information inside the class so that the |
1327 | | * ITABFeatureSymbol methods work properly for the class user. |
1328 | | *----------------------------------------------------------------*/ |
1329 | 75 | TABMAPObjFontPoint *poPointHdr = |
1330 | 75 | cpl::down_cast<TABMAPObjFontPoint *>(poObjHdr); |
1331 | | |
1332 | 75 | m_nSymbolDefIndex = -1; |
1333 | 75 | m_sSymbolDef.nRefCount = 0; |
1334 | | |
1335 | 75 | m_sSymbolDef.nSymbolNo = poPointHdr->m_nSymbolId; // shape |
1336 | 75 | m_sSymbolDef.nPointSize = poPointHdr->m_nPointSize; // point size |
1337 | | |
1338 | 75 | m_nFontStyle = poPointHdr->m_nFontStyle; // font style |
1339 | | |
1340 | 75 | m_sSymbolDef.rgbColor = poPointHdr->m_nR * 256 * 256 + |
1341 | 75 | poPointHdr->m_nG * 256 + poPointHdr->m_nB; |
1342 | | |
1343 | | /*------------------------------------------------------------- |
1344 | | * Symbol Angle, in tenths of degree. |
1345 | | * Contrary to arc start/end angles, no conversion based on |
1346 | | * origin quadrant is required here. |
1347 | | *------------------------------------------------------------*/ |
1348 | 75 | m_dAngle = poPointHdr->m_nAngle / 10.0; |
1349 | | |
1350 | 75 | m_nFontDefIndex = poPointHdr->m_nFontId; // Font name index |
1351 | | |
1352 | 75 | poMapFile->ReadFontDef(m_nFontDefIndex, &m_sFontDef); |
1353 | | |
1354 | | /*----------------------------------------------------------------- |
1355 | | * Create and fill geometry object |
1356 | | *----------------------------------------------------------------*/ |
1357 | 75 | double dX = 0.0; |
1358 | 75 | double dY = 0.0; |
1359 | 75 | poMapFile->Int2Coordsys(poPointHdr->m_nX, poPointHdr->m_nY, dX, dY); |
1360 | 75 | OGRGeometry *poGeometry = new OGRPoint(dX, dY); |
1361 | | |
1362 | 75 | SetGeometryDirectly(poGeometry); |
1363 | | |
1364 | 75 | SetMBR(dX, dY, dX, dY); |
1365 | 75 | SetIntMBR(poObjHdr->m_nMinX, poObjHdr->m_nMinY, poObjHdr->m_nMaxX, |
1366 | 75 | poObjHdr->m_nMaxY); |
1367 | | |
1368 | 75 | return 0; |
1369 | 75 | } |
1370 | | |
1371 | | /********************************************************************** |
1372 | | * TABFontPoint::WriteGeometryToMAPFile() |
1373 | | * |
1374 | | * Write the geometry and representation (color, etc...) part of the |
1375 | | * feature to the .MAP object pointed to by poMAPFile. |
1376 | | * |
1377 | | * It is assumed that poMAPFile currently points to a valid map object. |
1378 | | * |
1379 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
1380 | | * been called. |
1381 | | **********************************************************************/ |
1382 | | int TABFontPoint::WriteGeometryToMAPFile( |
1383 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
1384 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
1385 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
1386 | 0 | { |
1387 | | /* Nothing to do for bCoordBlockDataOnly (used by index splitting) */ |
1388 | 0 | if (bCoordBlockDataOnly) |
1389 | 0 | return 0; |
1390 | | |
1391 | | /*----------------------------------------------------------------- |
1392 | | * We assume that ValidateMapInfoType() was called already and that |
1393 | | * the type in poObjHdr->m_nType is valid. |
1394 | | *----------------------------------------------------------------*/ |
1395 | 0 | CPLAssert(m_nMapInfoType == poObjHdr->m_nType); |
1396 | | |
1397 | | /*----------------------------------------------------------------- |
1398 | | * Fetch and validate geometry |
1399 | | *----------------------------------------------------------------*/ |
1400 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
1401 | 0 | OGRPoint *poPoint = nullptr; |
1402 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint) |
1403 | 0 | poPoint = poGeom->toPoint(); |
1404 | 0 | else |
1405 | 0 | { |
1406 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
1407 | 0 | "TABFontPoint: Missing or Invalid Geometry!"); |
1408 | 0 | return -1; |
1409 | 0 | } |
1410 | | |
1411 | 0 | GInt32 nX = 0; |
1412 | 0 | GInt32 nY = 0; |
1413 | 0 | poMapFile->Coordsys2Int(poPoint->getX(), poPoint->getY(), nX, nY); |
1414 | | |
1415 | | /*----------------------------------------------------------------- |
1416 | | * Copy object information |
1417 | | * NOTE: This symbol type does not contain a reference to a |
1418 | | * SymbolDef block in the file, but we still use the m_sSymbolDef |
1419 | | * structure to store the information inside the class so that the |
1420 | | * ITABFeatureSymbol methods work properly for the class user. |
1421 | | *----------------------------------------------------------------*/ |
1422 | 0 | TABMAPObjFontPoint *poPointHdr = |
1423 | 0 | cpl::down_cast<TABMAPObjFontPoint *>(poObjHdr); |
1424 | |
|
1425 | 0 | poPointHdr->m_nX = nX; |
1426 | 0 | poPointHdr->m_nY = nY; |
1427 | 0 | poPointHdr->SetMBR(nX, nY, nX, nY); |
1428 | |
|
1429 | 0 | poPointHdr->m_nSymbolId = |
1430 | 0 | static_cast<GByte>(m_sSymbolDef.nSymbolNo); // shape |
1431 | 0 | poPointHdr->m_nPointSize = |
1432 | 0 | static_cast<GByte>(m_sSymbolDef.nPointSize); // point size |
1433 | 0 | poPointHdr->m_nFontStyle = m_nFontStyle; // font style |
1434 | |
|
1435 | 0 | poPointHdr->m_nR = static_cast<GByte>(COLOR_R(m_sSymbolDef.rgbColor)); |
1436 | 0 | poPointHdr->m_nG = static_cast<GByte>(COLOR_G(m_sSymbolDef.rgbColor)); |
1437 | 0 | poPointHdr->m_nB = static_cast<GByte>(COLOR_B(m_sSymbolDef.rgbColor)); |
1438 | | |
1439 | | /*------------------------------------------------------------- |
1440 | | * Symbol Angle, in tenths of degree. |
1441 | | * Contrary to arc start/end angles, no conversion based on |
1442 | | * origin quadrant is required here. |
1443 | | *------------------------------------------------------------*/ |
1444 | 0 | poPointHdr->m_nAngle = static_cast<GInt16>(ROUND_INT(m_dAngle * 10.0)); |
1445 | | |
1446 | | // Write Font Def |
1447 | 0 | m_nFontDefIndex = poMapFile->WriteFontDef(&m_sFontDef); |
1448 | 0 | poPointHdr->m_nFontId = |
1449 | 0 | static_cast<GByte>(m_nFontDefIndex); // Font name index |
1450 | |
|
1451 | 0 | if (CPLGetLastErrorType() == CE_Failure) |
1452 | 0 | return -1; |
1453 | | |
1454 | 0 | return 0; |
1455 | 0 | } |
1456 | | |
1457 | | /********************************************************************** |
1458 | | * TABFontPoint::QueryFontStyle() |
1459 | | * |
1460 | | * Return TRUE if the specified font style attribute is turned ON, |
1461 | | * or FALSE otherwise. See enum TABFontStyle for the list of styles |
1462 | | * that can be queried on. |
1463 | | **********************************************************************/ |
1464 | | GBool TABFontPoint::QueryFontStyle(TABFontStyle eStyleToQuery) |
1465 | 0 | { |
1466 | 0 | return (m_nFontStyle & static_cast<int>(eStyleToQuery)) ? TRUE : FALSE; |
1467 | 0 | } |
1468 | | |
1469 | | void TABFontPoint::ToggleFontStyle(TABFontStyle eStyleToToggle, GBool bStyleOn) |
1470 | 0 | { |
1471 | 0 | if (bStyleOn) |
1472 | 0 | m_nFontStyle |= static_cast<int>(eStyleToToggle); |
1473 | 0 | else |
1474 | 0 | m_nFontStyle &= ~static_cast<int>(eStyleToToggle); |
1475 | 0 | } |
1476 | | |
1477 | | /********************************************************************** |
1478 | | * TABFontPoint::GetFontStyleMIFValue() |
1479 | | * |
1480 | | * Return the Font Style value for this object using the style values |
1481 | | * that are used in a MIF FONT() clause. See MIF specs (appendix A). |
1482 | | * |
1483 | | * The reason why we have to differentiate between the TAB and the MIF font |
1484 | | * style values is that in TAB, TABFSBox is included in the style value |
1485 | | * as code 0x100, but in MIF it is not included, instead it is implied by |
1486 | | * the presence of the BG color in the FONT() clause (the BG color is |
1487 | | * present only when TABFSBox or TABFSHalo is set). |
1488 | | * This also has the effect of shifting all the other style values > 0x100 |
1489 | | * by 1 byte. |
1490 | | * |
1491 | | * NOTE: Even if there is no BG color for font symbols, we inherit this |
1492 | | * problem because Font Point styles use the same codes as Text Font styles. |
1493 | | **********************************************************************/ |
1494 | | int TABFontPoint::GetFontStyleMIFValue() |
1495 | 0 | { |
1496 | | // The conversion is simply to remove bit 0x100 from the value and shift |
1497 | | // down all values past this bit. |
1498 | 0 | return (m_nFontStyle & 0xff) + (m_nFontStyle & (0xff00 - 0x0100)) / 2; |
1499 | 0 | } |
1500 | | |
1501 | | void TABFontPoint::SetFontStyleMIFValue(int nStyle) |
1502 | 15.7k | { |
1503 | 15.7k | m_nFontStyle = static_cast<GByte>((nStyle & 0xff) + (nStyle & 0x7f00) * 2); |
1504 | 15.7k | } |
1505 | | |
1506 | | /********************************************************************** |
1507 | | * TABFontPoint::SetSymbolAngle() |
1508 | | * |
1509 | | * Set the symbol angle value in degrees, making sure the value is |
1510 | | * always in the range [0..360] |
1511 | | **********************************************************************/ |
1512 | | void TABFontPoint::SetSymbolAngle(double dAngle) |
1513 | 15.7k | { |
1514 | 15.7k | dAngle = fmod(dAngle, 360.0); |
1515 | 15.7k | if (dAngle < 0.0) |
1516 | 1.80k | dAngle += 360.0; |
1517 | | |
1518 | 15.7k | m_dAngle = dAngle; |
1519 | 15.7k | } |
1520 | | |
1521 | | /********************************************************************** |
1522 | | * TABFontPoint::GetSymbolStyleString() |
1523 | | * |
1524 | | * Return a Symbol() string. All representations info for the Symbol are here. |
1525 | | **********************************************************************/ |
1526 | | const char *TABFontPoint::GetSymbolStyleString(double dfAngle) const |
1527 | 0 | { |
1528 | | /* Get the SymbolStyleString, and add the outline Color |
1529 | | (halo/border in MapInfo Symbol terminology) */ |
1530 | 0 | const char *outlineColor = nullptr; |
1531 | 0 | if (m_nFontStyle & 16) |
1532 | 0 | outlineColor = ",o:#000000"; |
1533 | 0 | else if (m_nFontStyle & 512) |
1534 | 0 | outlineColor = ",o:#ffffff"; |
1535 | 0 | else |
1536 | 0 | outlineColor = ""; |
1537 | |
|
1538 | 0 | int nAngle = static_cast<int>(dfAngle); |
1539 | 0 | const char *pszStyle; |
1540 | |
|
1541 | 0 | pszStyle = CPLSPrintf( |
1542 | 0 | "SYMBOL(a:%d,c:#%6.6x,s:%dpt,id:\"font-sym-%d,ogr-sym-9\"%s,f:\"%s\")", |
1543 | 0 | nAngle, m_sSymbolDef.rgbColor, m_sSymbolDef.nPointSize, |
1544 | 0 | m_sSymbolDef.nSymbolNo, outlineColor, GetFontNameRef()); |
1545 | 0 | return pszStyle; |
1546 | 0 | } |
1547 | | |
1548 | | /********************************************************************** |
1549 | | * TABFontPoint::GetStyleString() const |
1550 | | * |
1551 | | * Return style string for this feature. |
1552 | | * |
1553 | | * Style String is built only once during the first call to GetStyleString(). |
1554 | | **********************************************************************/ |
1555 | | const char *TABFontPoint::GetStyleString() const |
1556 | 0 | { |
1557 | 0 | if (m_pszStyleString == nullptr) |
1558 | 0 | { |
1559 | 0 | m_pszStyleString = CPLStrdup(GetSymbolStyleString(GetSymbolAngle())); |
1560 | 0 | } |
1561 | |
|
1562 | 0 | return m_pszStyleString; |
1563 | 0 | } |
1564 | | |
1565 | | /********************************************************************** |
1566 | | * TABFontPoint::SetSymbolFromStyle() |
1567 | | * |
1568 | | * Set all Symbol var from a OGRStyleSymbol. |
1569 | | **********************************************************************/ |
1570 | | void TABFontPoint::SetSymbolFromStyle(OGRStyleSymbol *poSymbolStyle) |
1571 | 0 | { |
1572 | 0 | ITABFeatureSymbol::SetSymbolFromStyle(poSymbolStyle); |
1573 | |
|
1574 | 0 | GBool bIsNull = 0; |
1575 | | |
1576 | | // Try to set font glyph number |
1577 | 0 | const char *pszSymbolId = poSymbolStyle->Id(bIsNull); |
1578 | 0 | if ((!bIsNull) && pszSymbolId && STARTS_WITH(pszSymbolId, "font-sym-")) |
1579 | 0 | { |
1580 | 0 | const int nSymbolId = atoi(pszSymbolId + 9); |
1581 | 0 | SetSymbolNo(static_cast<GInt16>(nSymbolId)); |
1582 | 0 | } |
1583 | |
|
1584 | 0 | const char *pszFontName = poSymbolStyle->FontName(bIsNull); |
1585 | 0 | if ((!bIsNull) && pszFontName) |
1586 | 0 | { |
1587 | 0 | SetFontName(pszFontName); |
1588 | 0 | } |
1589 | 0 | } |
1590 | | |
1591 | | /*===================================================================== |
1592 | | * class TABCustomPoint |
1593 | | *====================================================================*/ |
1594 | | |
1595 | | /********************************************************************** |
1596 | | * TABCustomPoint::TABCustomPoint() |
1597 | | * |
1598 | | * Constructor. |
1599 | | **********************************************************************/ |
1600 | | TABCustomPoint::TABCustomPoint(const OGRFeatureDefn *poDefnIn) |
1601 | 13.6k | : TABPoint(poDefnIn), m_nCustomStyle(0), m_nUnknown_(0) |
1602 | 13.6k | { |
1603 | 13.6k | } |
1604 | | |
1605 | | /********************************************************************** |
1606 | | * TABCustomPoint::~TABCustomPoint() |
1607 | | * |
1608 | | * Destructor. |
1609 | | **********************************************************************/ |
1610 | | TABCustomPoint::~TABCustomPoint() |
1611 | 13.6k | { |
1612 | 13.6k | } |
1613 | | |
1614 | | /********************************************************************** |
1615 | | * TABCustomPoint::CloneTABFeature() |
1616 | | * |
1617 | | * Duplicate feature, including stuff specific to each TABFeature type. |
1618 | | * |
1619 | | * This method calls the generic TABFeature::CloneTABFeature() and |
1620 | | * then copies any members specific to its own type. |
1621 | | **********************************************************************/ |
1622 | | TABFeature * |
1623 | | TABCustomPoint::CloneTABFeature(const OGRFeatureDefn *poNewDefn /*=NULL*/) |
1624 | 0 | { |
1625 | | /*----------------------------------------------------------------- |
1626 | | * Alloc new feature and copy the base stuff |
1627 | | *----------------------------------------------------------------*/ |
1628 | 0 | TABCustomPoint *poNew = |
1629 | 0 | new TABCustomPoint(poNewDefn ? poNewDefn : GetDefnRef()); |
1630 | |
|
1631 | 0 | CopyTABFeatureBase(poNew); |
1632 | | |
1633 | | /*----------------------------------------------------------------- |
1634 | | * And members specific to this class |
1635 | | *----------------------------------------------------------------*/ |
1636 | | // ITABFeatureSymbol |
1637 | 0 | *(poNew->GetSymbolDefRef()) = *GetSymbolDefRef(); |
1638 | | |
1639 | | // ITABFeatureFont |
1640 | 0 | *(poNew->GetFontDefRef()) = *GetFontDefRef(); |
1641 | |
|
1642 | 0 | poNew->SetCustomSymbolStyle(GetCustomSymbolStyle()); |
1643 | |
|
1644 | 0 | return poNew; |
1645 | 0 | } |
1646 | | |
1647 | | /********************************************************************** |
1648 | | * TABCustomPoint::ReadGeometryFromMAPFile() |
1649 | | * |
1650 | | * Fill the geometry and representation (color, etc...) part of the |
1651 | | * feature from the contents of the .MAP object pointed to by poMAPFile. |
1652 | | * |
1653 | | * It is assumed that poMAPFile currently points to the beginning of |
1654 | | * a map object. |
1655 | | * |
1656 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
1657 | | * been called. |
1658 | | **********************************************************************/ |
1659 | | int TABCustomPoint::ReadGeometryFromMAPFile( |
1660 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
1661 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
1662 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
1663 | 70 | { |
1664 | | /* Nothing to do for bCoordBlockDataOnly (used by index splitting) */ |
1665 | 70 | if (bCoordBlockDataOnly) |
1666 | 0 | return 0; |
1667 | | |
1668 | | /*----------------------------------------------------------------- |
1669 | | * Fetch and validate geometry type |
1670 | | *----------------------------------------------------------------*/ |
1671 | 70 | m_nMapInfoType = poObjHdr->m_nType; |
1672 | | |
1673 | 70 | if (m_nMapInfoType != TAB_GEOM_CUSTOMSYMBOL && |
1674 | 0 | m_nMapInfoType != TAB_GEOM_CUSTOMSYMBOL_C) |
1675 | 0 | { |
1676 | 0 | CPLError( |
1677 | 0 | CE_Failure, CPLE_AssertionFailed, |
1678 | 0 | "ReadGeometryFromMAPFile(): unsupported geometry type %d (0x%2.2x)", |
1679 | 0 | m_nMapInfoType, m_nMapInfoType); |
1680 | 0 | return -1; |
1681 | 0 | } |
1682 | | |
1683 | | /*----------------------------------------------------------------- |
1684 | | * Read object information |
1685 | | *----------------------------------------------------------------*/ |
1686 | 70 | TABMAPObjCustomPoint *poPointHdr = |
1687 | 70 | cpl::down_cast<TABMAPObjCustomPoint *>(poObjHdr); |
1688 | | |
1689 | 70 | m_nUnknown_ = poPointHdr->m_nUnknown_; // ??? |
1690 | 70 | m_nCustomStyle = poPointHdr->m_nCustomStyle; // 0x01=Show BG, |
1691 | | // 0x02=Apply Color |
1692 | | |
1693 | 70 | m_nSymbolDefIndex = poPointHdr->m_nSymbolId; // Symbol index |
1694 | 70 | poMapFile->ReadSymbolDef(m_nSymbolDefIndex, &m_sSymbolDef); |
1695 | | |
1696 | 70 | m_nFontDefIndex = poPointHdr->m_nFontId; // Font index |
1697 | 70 | poMapFile->ReadFontDef(m_nFontDefIndex, &m_sFontDef); |
1698 | | |
1699 | | /*----------------------------------------------------------------- |
1700 | | * Create and fill geometry object |
1701 | | *----------------------------------------------------------------*/ |
1702 | 70 | double dX = 0.0; |
1703 | 70 | double dY = 0.0; |
1704 | 70 | poMapFile->Int2Coordsys(poPointHdr->m_nX, poPointHdr->m_nY, dX, dY); |
1705 | 70 | OGRGeometry *poGeometry = new OGRPoint(dX, dY); |
1706 | | |
1707 | 70 | SetGeometryDirectly(poGeometry); |
1708 | | |
1709 | 70 | SetMBR(dX, dY, dX, dY); |
1710 | 70 | SetIntMBR(poObjHdr->m_nMinX, poObjHdr->m_nMinY, poObjHdr->m_nMaxX, |
1711 | 70 | poObjHdr->m_nMaxY); |
1712 | | |
1713 | 70 | return 0; |
1714 | 70 | } |
1715 | | |
1716 | | /********************************************************************** |
1717 | | * TABCustomPoint::WriteGeometryToMAPFile() |
1718 | | * |
1719 | | * Write the geometry and representation (color, etc...) part of the |
1720 | | * feature to the .MAP object pointed to by poMAPFile. |
1721 | | * |
1722 | | * It is assumed that poMAPFile currently points to a valid map object. |
1723 | | * |
1724 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
1725 | | * been called. |
1726 | | **********************************************************************/ |
1727 | | int TABCustomPoint::WriteGeometryToMAPFile( |
1728 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
1729 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
1730 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
1731 | 0 | { |
1732 | | /* Nothing to do for bCoordBlockDataOnly (used by index splitting) */ |
1733 | 0 | if (bCoordBlockDataOnly) |
1734 | 0 | return 0; |
1735 | | |
1736 | | /*----------------------------------------------------------------- |
1737 | | * We assume that ValidateMapInfoType() was called already and that |
1738 | | * the type in poObjHdr->m_nType is valid. |
1739 | | *----------------------------------------------------------------*/ |
1740 | 0 | CPLAssert(m_nMapInfoType == poObjHdr->m_nType); |
1741 | | |
1742 | | /*----------------------------------------------------------------- |
1743 | | * Fetch and validate geometry |
1744 | | *----------------------------------------------------------------*/ |
1745 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
1746 | 0 | OGRPoint *poPoint = nullptr; |
1747 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint) |
1748 | 0 | poPoint = poGeom->toPoint(); |
1749 | 0 | else |
1750 | 0 | { |
1751 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
1752 | 0 | "TABCustomPoint: Missing or Invalid Geometry!"); |
1753 | 0 | return -1; |
1754 | 0 | } |
1755 | | |
1756 | 0 | GInt32 nX = 0; |
1757 | 0 | GInt32 nY = 0; |
1758 | 0 | poMapFile->Coordsys2Int(poPoint->getX(), poPoint->getY(), nX, nY); |
1759 | | |
1760 | | /*----------------------------------------------------------------- |
1761 | | * Copy object information |
1762 | | *----------------------------------------------------------------*/ |
1763 | 0 | TABMAPObjCustomPoint *poPointHdr = |
1764 | 0 | cpl::down_cast<TABMAPObjCustomPoint *>(poObjHdr); |
1765 | |
|
1766 | 0 | poPointHdr->m_nX = nX; |
1767 | 0 | poPointHdr->m_nY = nY; |
1768 | 0 | poPointHdr->SetMBR(nX, nY, nX, nY); |
1769 | 0 | poPointHdr->m_nUnknown_ = m_nUnknown_; |
1770 | 0 | poPointHdr->m_nCustomStyle = m_nCustomStyle; // 0x01=Show BG, |
1771 | | // 0x02=Apply Color |
1772 | |
|
1773 | 0 | m_nSymbolDefIndex = poMapFile->WriteSymbolDef(&m_sSymbolDef); |
1774 | 0 | poPointHdr->m_nSymbolId = |
1775 | 0 | static_cast<GByte>(m_nSymbolDefIndex); // Symbol index |
1776 | |
|
1777 | 0 | m_nFontDefIndex = poMapFile->WriteFontDef(&m_sFontDef); |
1778 | 0 | poPointHdr->m_nFontId = static_cast<GByte>(m_nFontDefIndex); // Font index |
1779 | |
|
1780 | 0 | if (CPLGetLastErrorType() == CE_Failure) |
1781 | 0 | return -1; |
1782 | | |
1783 | 0 | return 0; |
1784 | 0 | } |
1785 | | |
1786 | | /********************************************************************** |
1787 | | * TABCustomPoint::GetSymbolStyleString() |
1788 | | * |
1789 | | * Return a Symbol() string. All representations info for the Symbol are here. |
1790 | | **********************************************************************/ |
1791 | | const char *TABCustomPoint::GetSymbolStyleString(double dfAngle) const |
1792 | 0 | { |
1793 | | /* Get the SymbolStyleString, and add the color if m_nCustomStyle contains |
1794 | | * "apply color". */ |
1795 | 0 | const char *color = nullptr; |
1796 | 0 | if (m_nCustomStyle & 0x02) |
1797 | 0 | color = CPLSPrintf(",c:#%6.6x", m_sSymbolDef.rgbColor); |
1798 | 0 | else |
1799 | 0 | color = ""; |
1800 | |
|
1801 | 0 | int nAngle = static_cast<int>(dfAngle); |
1802 | 0 | const char *pszStyle; |
1803 | 0 | const std::string osExt = CPLGetExtensionSafe(GetSymbolNameRef()); |
1804 | 0 | char szLowerExt[8] = ""; |
1805 | 0 | const char *pszPtr = osExt.c_str(); |
1806 | 0 | int i; |
1807 | |
|
1808 | 0 | for (i = 0; i < 7 && *pszPtr != '\0' && *pszPtr != ' '; i++, pszPtr++) |
1809 | 0 | { |
1810 | 0 | szLowerExt[i] = |
1811 | 0 | static_cast<char>(CPLTolower(static_cast<unsigned char>(*pszPtr))); |
1812 | 0 | } |
1813 | 0 | szLowerExt[i] = '\0'; |
1814 | |
|
1815 | 0 | pszStyle = CPLSPrintf( |
1816 | 0 | "SYMBOL(a:%d%s,s:%dpt,id:\"mapinfo-custom-sym-%d-%s,%s-%s,ogr-sym-9\")", |
1817 | 0 | nAngle, color, m_sSymbolDef.nPointSize, m_nCustomStyle, |
1818 | 0 | GetSymbolNameRef(), szLowerExt, GetSymbolNameRef()); |
1819 | 0 | return pszStyle; |
1820 | 0 | } |
1821 | | |
1822 | | /********************************************************************** |
1823 | | * TABCustomPoint::SetSymbolFromStyle() |
1824 | | * |
1825 | | * Set all Symbol var from a OGRStyleSymbol. |
1826 | | **********************************************************************/ |
1827 | | void TABCustomPoint::SetSymbolFromStyle(OGRStyleSymbol *poSymbolStyle) |
1828 | 0 | { |
1829 | 0 | ITABFeatureSymbol::SetSymbolFromStyle(poSymbolStyle); |
1830 | |
|
1831 | 0 | GBool bIsNull = 0; |
1832 | | |
1833 | | // Try to set font glyph number |
1834 | 0 | const char *pszSymbolId = poSymbolStyle->Id(bIsNull); |
1835 | 0 | if ((!bIsNull) && pszSymbolId && |
1836 | 0 | STARTS_WITH(pszSymbolId, "mapinfo-custom-sym-")) |
1837 | 0 | { |
1838 | 0 | const int nSymbolStyle = atoi(pszSymbolId + 19); |
1839 | 0 | SetCustomSymbolStyle(static_cast<GByte>(nSymbolStyle)); |
1840 | |
|
1841 | 0 | const char *pszPtr = pszSymbolId + 19; |
1842 | 0 | while (*pszPtr != '-') |
1843 | 0 | { |
1844 | 0 | pszPtr++; |
1845 | 0 | } |
1846 | 0 | pszPtr++; |
1847 | |
|
1848 | 0 | char szSymbolName[256] = ""; |
1849 | 0 | int i; |
1850 | 0 | for (i = 0; |
1851 | 0 | i < 255 && *pszPtr != '\0' && *pszPtr != ',' && *pszPtr != '"'; |
1852 | 0 | i++, pszPtr++) |
1853 | 0 | { |
1854 | 0 | szSymbolName[i] = *pszPtr; |
1855 | 0 | } |
1856 | 0 | szSymbolName[i] = '\0'; |
1857 | 0 | SetSymbolName(szSymbolName); |
1858 | 0 | } |
1859 | 0 | } |
1860 | | |
1861 | | /********************************************************************** |
1862 | | * TABCustomPoint::GetStyleString() const |
1863 | | * |
1864 | | * Return style string for this feature. |
1865 | | * |
1866 | | * Style String is built only once during the first call to GetStyleString(). |
1867 | | **********************************************************************/ |
1868 | | const char *TABCustomPoint::GetStyleString() const |
1869 | 0 | { |
1870 | 0 | if (m_pszStyleString == nullptr) |
1871 | 0 | { |
1872 | 0 | m_pszStyleString = CPLStrdup(GetSymbolStyleString()); |
1873 | 0 | } |
1874 | |
|
1875 | 0 | return m_pszStyleString; |
1876 | 0 | } |
1877 | | |
1878 | | /*===================================================================== |
1879 | | * class TABPolyline |
1880 | | *====================================================================*/ |
1881 | | |
1882 | | /********************************************************************** |
1883 | | * TABPolyline::TABPolyline() |
1884 | | * |
1885 | | * Constructor. |
1886 | | **********************************************************************/ |
1887 | | TABPolyline::TABPolyline(const OGRFeatureDefn *poDefnIn) |
1888 | 92.9k | : TABFeature(poDefnIn), m_bCenterIsSet(FALSE), m_dCenterX(0.0), |
1889 | 92.9k | m_dCenterY(0.0), m_bWriteTwoPointLineAsPolyline(FALSE), m_bSmooth(FALSE) |
1890 | 92.9k | { |
1891 | 92.9k | } |
1892 | | |
1893 | | /********************************************************************** |
1894 | | * TABPolyline::~TABPolyline() |
1895 | | * |
1896 | | * Destructor. |
1897 | | **********************************************************************/ |
1898 | | TABPolyline::~TABPolyline() |
1899 | 92.9k | { |
1900 | 92.9k | } |
1901 | | |
1902 | | /********************************************************************** |
1903 | | * TABPolyline::CloneTABFeature() |
1904 | | * |
1905 | | * Duplicate feature, including stuff specific to each TABFeature type. |
1906 | | * |
1907 | | * This method calls the generic TABFeature::CloneTABFeature() and |
1908 | | * then copies any members specific to its own type. |
1909 | | **********************************************************************/ |
1910 | | TABFeature * |
1911 | | TABPolyline::CloneTABFeature(const OGRFeatureDefn *poNewDefn /*=NULL*/) |
1912 | 0 | { |
1913 | | /*----------------------------------------------------------------- |
1914 | | * Alloc new feature and copy the base stuff |
1915 | | *----------------------------------------------------------------*/ |
1916 | 0 | TABPolyline *poNew = new TABPolyline(poNewDefn ? poNewDefn : GetDefnRef()); |
1917 | |
|
1918 | 0 | CopyTABFeatureBase(poNew); |
1919 | | |
1920 | | /*----------------------------------------------------------------- |
1921 | | * And members specific to this class |
1922 | | *----------------------------------------------------------------*/ |
1923 | | // ITABFeaturePen |
1924 | 0 | *(poNew->GetPenDefRef()) = *GetPenDefRef(); |
1925 | |
|
1926 | 0 | poNew->m_bSmooth = m_bSmooth; |
1927 | 0 | poNew->m_bCenterIsSet = m_bCenterIsSet; |
1928 | 0 | poNew->m_dCenterX = m_dCenterX; |
1929 | 0 | poNew->m_dCenterY = m_dCenterY; |
1930 | |
|
1931 | 0 | return poNew; |
1932 | 0 | } |
1933 | | |
1934 | | /********************************************************************** |
1935 | | * TABPolyline::GetNumParts() |
1936 | | * |
1937 | | * Return the total number of parts in this object. |
1938 | | * |
1939 | | * Returns 0 if the geometry contained in the object is invalid or missing. |
1940 | | **********************************************************************/ |
1941 | | int TABPolyline::GetNumParts() |
1942 | 0 | { |
1943 | 0 | int numParts = 0; |
1944 | |
|
1945 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
1946 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbLineString) |
1947 | 0 | { |
1948 | | /*------------------------------------------------------------- |
1949 | | * Simple polyline |
1950 | | *------------------------------------------------------------*/ |
1951 | 0 | numParts = 1; |
1952 | 0 | } |
1953 | 0 | else if (poGeom && |
1954 | 0 | wkbFlatten(poGeom->getGeometryType()) == wkbMultiLineString) |
1955 | 0 | { |
1956 | | /*------------------------------------------------------------- |
1957 | | * Multiple polyline |
1958 | | *------------------------------------------------------------*/ |
1959 | 0 | OGRMultiLineString *poMultiLine = poGeom->toMultiLineString(); |
1960 | 0 | numParts = poMultiLine->getNumGeometries(); |
1961 | 0 | } |
1962 | |
|
1963 | 0 | return numParts; |
1964 | 0 | } |
1965 | | |
1966 | | /********************************************************************** |
1967 | | * TABPolyline::GetPartRef() |
1968 | | * |
1969 | | * Returns a reference to the specified OGRLineString number, hiding the |
1970 | | * complexity of dealing with OGRMultiLineString vs OGRLineString cases. |
1971 | | * |
1972 | | * Returns NULL if the geometry contained in the object is invalid or |
1973 | | * missing or if the specified part index is invalid. |
1974 | | **********************************************************************/ |
1975 | | OGRLineString *TABPolyline::GetPartRef(int nPartIndex) |
1976 | 0 | { |
1977 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
1978 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbLineString && |
1979 | 0 | nPartIndex == 0) |
1980 | 0 | { |
1981 | | /*------------------------------------------------------------- |
1982 | | * Simple polyline |
1983 | | *------------------------------------------------------------*/ |
1984 | 0 | return poGeom->toLineString(); |
1985 | 0 | } |
1986 | 0 | else if (poGeom && |
1987 | 0 | wkbFlatten(poGeom->getGeometryType()) == wkbMultiLineString) |
1988 | 0 | { |
1989 | | /*------------------------------------------------------------- |
1990 | | * Multiple polyline |
1991 | | *------------------------------------------------------------*/ |
1992 | 0 | OGRMultiLineString *poMultiLine = poGeom->toMultiLineString(); |
1993 | 0 | if (nPartIndex >= 0 && nPartIndex < poMultiLine->getNumGeometries()) |
1994 | 0 | { |
1995 | 0 | return poMultiLine->getGeometryRef(nPartIndex); |
1996 | 0 | } |
1997 | 0 | else |
1998 | 0 | return nullptr; |
1999 | 0 | } |
2000 | | |
2001 | 0 | return nullptr; |
2002 | 0 | } |
2003 | | |
2004 | | /********************************************************************** |
2005 | | * TABPolyline::ValidateMapInfoType() |
2006 | | * |
2007 | | * Check the feature's geometry part and return the corresponding |
2008 | | * mapinfo object type code. The m_nMapInfoType member will also |
2009 | | * be updated for further calls to GetMapInfoType(); |
2010 | | * |
2011 | | * Returns TAB_GEOM_NONE if the geometry is not compatible with what |
2012 | | * is expected for this object class. |
2013 | | **********************************************************************/ |
2014 | | TABGeomType TABPolyline::ValidateMapInfoType(TABMAPFile *poMapFile /*=NULL*/) |
2015 | 12.6k | { |
2016 | | /*----------------------------------------------------------------- |
2017 | | * Fetch and validate geometry |
2018 | | *----------------------------------------------------------------*/ |
2019 | 12.6k | OGRGeometry *poGeom = GetGeometryRef(); |
2020 | 12.6k | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbLineString) |
2021 | 7.17k | { |
2022 | | /*------------------------------------------------------------- |
2023 | | * Simple polyline |
2024 | | *------------------------------------------------------------*/ |
2025 | 7.17k | OGRLineString *poLine = poGeom->toLineString(); |
2026 | 7.17k | if (TAB_REGION_PLINE_REQUIRES_V800(1, poLine->getNumPoints())) |
2027 | 0 | { |
2028 | 0 | m_nMapInfoType = TAB_GEOM_V800_MULTIPLINE; |
2029 | 0 | } |
2030 | 7.17k | else if (poLine->getNumPoints() > TAB_REGION_PLINE_300_MAX_VERTICES) |
2031 | 0 | { |
2032 | 0 | m_nMapInfoType = TAB_GEOM_V450_MULTIPLINE; |
2033 | 0 | } |
2034 | 7.17k | else if (poLine->getNumPoints() > 2) |
2035 | 1.54k | { |
2036 | 1.54k | m_nMapInfoType = TAB_GEOM_PLINE; |
2037 | 1.54k | } |
2038 | 5.63k | else if ((poLine->getNumPoints() == 2) && |
2039 | 323 | (m_bWriteTwoPointLineAsPolyline == TRUE)) |
2040 | 0 | { |
2041 | 0 | m_nMapInfoType = TAB_GEOM_PLINE; |
2042 | 0 | } |
2043 | 5.63k | else if ((poLine->getNumPoints() == 2) && |
2044 | 323 | (m_bWriteTwoPointLineAsPolyline == FALSE)) |
2045 | 323 | { |
2046 | 323 | m_nMapInfoType = TAB_GEOM_LINE; |
2047 | 323 | } |
2048 | 5.30k | else |
2049 | 5.30k | { |
2050 | 5.30k | CPLError(CE_Failure, CPLE_AssertionFailed, |
2051 | 5.30k | "TABPolyline: Geometry must contain at least 2 points."); |
2052 | 5.30k | m_nMapInfoType = TAB_GEOM_NONE; |
2053 | 5.30k | } |
2054 | 7.17k | } |
2055 | 5.46k | else if (poGeom && |
2056 | 5.46k | wkbFlatten(poGeom->getGeometryType()) == wkbMultiLineString) |
2057 | 5.46k | { |
2058 | | /*------------------------------------------------------------- |
2059 | | * Multiple polyline... validate all components |
2060 | | *------------------------------------------------------------*/ |
2061 | 5.46k | GInt32 numPointsTotal = 0; |
2062 | 5.46k | OGRMultiLineString *poMultiLine = poGeom->toMultiLineString(); |
2063 | 5.46k | int numLines = poMultiLine->getNumGeometries(); |
2064 | | |
2065 | 5.46k | m_nMapInfoType = TAB_GEOM_MULTIPLINE; |
2066 | | |
2067 | 5.55k | for (int iLine = 0; iLine < numLines; iLine++) |
2068 | 92 | { |
2069 | 92 | poGeom = poMultiLine->getGeometryRef(iLine); |
2070 | 92 | if (poGeom == nullptr || |
2071 | 92 | wkbFlatten(poGeom->getGeometryType()) != wkbLineString) |
2072 | 0 | { |
2073 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
2074 | 0 | "TABPolyline: Object contains an invalid Geometry!"); |
2075 | 0 | m_nMapInfoType = TAB_GEOM_NONE; |
2076 | 0 | numPointsTotal = 0; |
2077 | 0 | break; |
2078 | 0 | } |
2079 | 92 | OGRLineString *poLine = poGeom->toLineString(); |
2080 | 92 | numPointsTotal += poLine->getNumPoints(); |
2081 | 92 | } |
2082 | | |
2083 | 5.46k | if (TAB_REGION_PLINE_REQUIRES_V800(numLines, numPointsTotal)) |
2084 | 0 | m_nMapInfoType = TAB_GEOM_V800_MULTIPLINE; |
2085 | 5.46k | else if (numPointsTotal > TAB_REGION_PLINE_300_MAX_VERTICES) |
2086 | 0 | m_nMapInfoType = TAB_GEOM_V450_MULTIPLINE; |
2087 | 5.46k | } |
2088 | 0 | else |
2089 | 0 | { |
2090 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
2091 | 0 | "TABPolyline: Missing or Invalid Geometry!"); |
2092 | 0 | m_nMapInfoType = TAB_GEOM_NONE; |
2093 | 0 | } |
2094 | | |
2095 | | /*----------------------------------------------------------------- |
2096 | | * Decide if coordinates should be compressed or not. |
2097 | | * |
2098 | | * __TODO__ We never write type LINE (2 points line) as compressed |
2099 | | * for the moment. If we ever do it, then the decision to write |
2100 | | * a 2 point line in compressed coordinates or not should take into |
2101 | | * account the location of the object block MBR, so this would be |
2102 | | * better handled directly by TABMAPObjLine::WriteObject() since the |
2103 | | * object block center is not known until it is written to disk. |
2104 | | *----------------------------------------------------------------*/ |
2105 | 12.6k | if (m_nMapInfoType != TAB_GEOM_LINE) |
2106 | 12.3k | { |
2107 | 12.3k | ValidateCoordType(poMapFile); |
2108 | 12.3k | } |
2109 | 323 | else |
2110 | 323 | { |
2111 | 323 | UpdateMBR(poMapFile); |
2112 | 323 | } |
2113 | | |
2114 | 12.6k | return m_nMapInfoType; |
2115 | 12.6k | } |
2116 | | |
2117 | | /********************************************************************** |
2118 | | * TABPolyline::ReadGeometryFromMAPFile() |
2119 | | * |
2120 | | * Fill the geometry and representation (color, etc...) part of the |
2121 | | * feature from the contents of the .MAP object pointed to by poMAPFile. |
2122 | | * |
2123 | | * It is assumed that poMAPFile currently points to the beginning of |
2124 | | * a map object. |
2125 | | * |
2126 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
2127 | | * been called. |
2128 | | **********************************************************************/ |
2129 | | int TABPolyline::ReadGeometryFromMAPFile( |
2130 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
2131 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
2132 | | TABMAPCoordBlock **ppoCoordBlock /*=NULL*/) |
2133 | 241 | { |
2134 | 241 | GInt32 nX = 0; |
2135 | 241 | GInt32 nY = 0; |
2136 | 241 | double dX = 0.0; |
2137 | 241 | double dY = 0.0; |
2138 | 241 | double dXMin = 0.0; |
2139 | 241 | double dYMin = 0.0; |
2140 | 241 | double dXMax = 0.0; |
2141 | 241 | double dYMax = 0.0; |
2142 | 241 | OGRGeometry *poGeometry = nullptr; |
2143 | 241 | GBool bComprCoord = poObjHdr->IsCompressedType(); |
2144 | 241 | TABMAPCoordBlock *poCoordBlock = nullptr; |
2145 | | |
2146 | | /*----------------------------------------------------------------- |
2147 | | * Fetch and validate geometry type |
2148 | | *----------------------------------------------------------------*/ |
2149 | 241 | m_nMapInfoType = poObjHdr->m_nType; |
2150 | | |
2151 | 241 | if (m_nMapInfoType == TAB_GEOM_LINE || m_nMapInfoType == TAB_GEOM_LINE_C) |
2152 | 192 | { |
2153 | | /*============================================================= |
2154 | | * LINE (2 vertices) |
2155 | | *============================================================*/ |
2156 | 192 | TABMAPObjLine *poLineHdr = cpl::down_cast<TABMAPObjLine *>(poObjHdr); |
2157 | | |
2158 | 192 | m_bSmooth = FALSE; |
2159 | | |
2160 | 192 | auto poLine = new OGRLineString(); |
2161 | 192 | poGeometry = poLine; |
2162 | 192 | poLine->setNumPoints(2); |
2163 | | |
2164 | 192 | poMapFile->Int2Coordsys(poLineHdr->m_nX1, poLineHdr->m_nY1, dXMin, |
2165 | 192 | dYMin); |
2166 | 192 | poLine->setPoint(0, dXMin, dYMin); |
2167 | | |
2168 | 192 | poMapFile->Int2Coordsys(poLineHdr->m_nX2, poLineHdr->m_nY2, dXMax, |
2169 | 192 | dYMax); |
2170 | 192 | poLine->setPoint(1, dXMax, dYMax); |
2171 | | |
2172 | 192 | if (!bCoordBlockDataOnly) |
2173 | 192 | { |
2174 | 192 | m_nPenDefIndex = poLineHdr->m_nPenId; // Pen index |
2175 | 192 | poMapFile->ReadPenDef(m_nPenDefIndex, &m_sPenDef); |
2176 | 192 | } |
2177 | 192 | } |
2178 | 49 | else if (m_nMapInfoType == TAB_GEOM_PLINE || |
2179 | 49 | m_nMapInfoType == TAB_GEOM_PLINE_C) |
2180 | 0 | { |
2181 | | /*============================================================= |
2182 | | * PLINE ( > 2 vertices) |
2183 | | *============================================================*/ |
2184 | | |
2185 | | /*------------------------------------------------------------- |
2186 | | * Copy data from poObjHdr |
2187 | | *------------------------------------------------------------*/ |
2188 | 0 | TABMAPObjPLine *poPLineHdr = cpl::down_cast<TABMAPObjPLine *>(poObjHdr); |
2189 | |
|
2190 | 0 | GInt32 nCoordBlockPtr = poPLineHdr->m_nCoordBlockPtr; |
2191 | 0 | const GUInt32 nCoordDataSize = poPLineHdr->m_nCoordDataSize; |
2192 | 0 | if (nCoordDataSize > 1024 * 1024 && |
2193 | 0 | nCoordDataSize > poMapFile->GetFileSize()) |
2194 | 0 | { |
2195 | 0 | CPLError(CE_Failure, CPLE_AppDefined, "Too big nCoordDataSize = %u", |
2196 | 0 | nCoordDataSize); |
2197 | 0 | return -1; |
2198 | 0 | } |
2199 | | // numLineSections = poPLineHdr->m_numLineSections; // Always 1 |
2200 | 0 | m_bSmooth = poPLineHdr->m_bSmooth; |
2201 | | |
2202 | | // Centroid/label point |
2203 | 0 | poMapFile->Int2Coordsys(poPLineHdr->m_nLabelX, poPLineHdr->m_nLabelY, |
2204 | 0 | dX, dY); |
2205 | 0 | SetCenter(dX, dY); |
2206 | | |
2207 | | // Compressed coordinate origin (useful only in compressed case!) |
2208 | 0 | m_nComprOrgX = poPLineHdr->m_nComprOrgX; |
2209 | 0 | m_nComprOrgY = poPLineHdr->m_nComprOrgY; |
2210 | | |
2211 | | // MBR |
2212 | 0 | poMapFile->Int2Coordsys(poPLineHdr->m_nMinX, poPLineHdr->m_nMinY, dXMin, |
2213 | 0 | dYMin); |
2214 | 0 | poMapFile->Int2Coordsys(poPLineHdr->m_nMaxX, poPLineHdr->m_nMaxY, dXMax, |
2215 | 0 | dYMax); |
2216 | |
|
2217 | 0 | if (!bCoordBlockDataOnly) |
2218 | 0 | { |
2219 | 0 | m_nPenDefIndex = poPLineHdr->m_nPenId; // Pen index |
2220 | 0 | poMapFile->ReadPenDef(m_nPenDefIndex, &m_sPenDef); |
2221 | 0 | } |
2222 | | |
2223 | | /*------------------------------------------------------------- |
2224 | | * Create Geometry and read coordinates |
2225 | | *------------------------------------------------------------*/ |
2226 | 0 | const int numPoints = nCoordDataSize / (bComprCoord ? 4 : 8); |
2227 | |
|
2228 | 0 | if (ppoCoordBlock != nullptr && *ppoCoordBlock != nullptr) |
2229 | 0 | poCoordBlock = *ppoCoordBlock; |
2230 | 0 | else |
2231 | 0 | poCoordBlock = poMapFile->GetCoordBlock(nCoordBlockPtr); |
2232 | 0 | if (poCoordBlock == nullptr) |
2233 | 0 | { |
2234 | 0 | CPLError(CE_Failure, CPLE_FileIO, |
2235 | 0 | "Can't access coordinate block at offset %d", |
2236 | 0 | nCoordBlockPtr); |
2237 | 0 | return -1; |
2238 | 0 | } |
2239 | | |
2240 | 0 | poCoordBlock->SetComprCoordOrigin(m_nComprOrgX, m_nComprOrgY); |
2241 | |
|
2242 | 0 | auto poLine = new OGRLineString(); |
2243 | 0 | poGeometry = poLine; |
2244 | 0 | poLine->setNumPoints(numPoints); |
2245 | |
|
2246 | 0 | int nStatus = 0; |
2247 | 0 | for (int i = 0; nStatus == 0 && i < numPoints; i++) |
2248 | 0 | { |
2249 | 0 | nStatus = poCoordBlock->ReadIntCoord(bComprCoord, nX, nY); |
2250 | 0 | if (nStatus != 0) |
2251 | 0 | break; |
2252 | 0 | poMapFile->Int2Coordsys(nX, nY, dX, dY); |
2253 | 0 | poLine->setPoint(i, dX, dY); |
2254 | 0 | } |
2255 | |
|
2256 | 0 | if (nStatus != 0) |
2257 | 0 | { |
2258 | | // Failed ... error message has already been produced |
2259 | 0 | delete poGeometry; |
2260 | 0 | return nStatus; |
2261 | 0 | } |
2262 | 0 | } |
2263 | 49 | else if (m_nMapInfoType == TAB_GEOM_MULTIPLINE || |
2264 | 49 | m_nMapInfoType == TAB_GEOM_MULTIPLINE_C || |
2265 | 5 | m_nMapInfoType == TAB_GEOM_V450_MULTIPLINE || |
2266 | 3 | m_nMapInfoType == TAB_GEOM_V450_MULTIPLINE_C || |
2267 | 0 | m_nMapInfoType == TAB_GEOM_V800_MULTIPLINE || |
2268 | 0 | m_nMapInfoType == TAB_GEOM_V800_MULTIPLINE_C) |
2269 | 49 | { |
2270 | | /*============================================================= |
2271 | | * PLINE MULTIPLE |
2272 | | *============================================================*/ |
2273 | 49 | const int nVersion = TAB_GEOM_GET_VERSION(m_nMapInfoType); |
2274 | | |
2275 | | /*------------------------------------------------------------- |
2276 | | * Copy data from poObjHdr |
2277 | | *------------------------------------------------------------*/ |
2278 | 49 | TABMAPObjPLine *poPLineHdr = cpl::down_cast<TABMAPObjPLine *>(poObjHdr); |
2279 | | |
2280 | 49 | GInt32 nCoordBlockPtr = poPLineHdr->m_nCoordBlockPtr; |
2281 | | /* GInt32 nCoordDataSize = poPLineHdr->m_nCoordDataSize; */ |
2282 | 49 | GInt32 numLineSections = poPLineHdr->m_numLineSections; |
2283 | 49 | m_bSmooth = poPLineHdr->m_bSmooth; |
2284 | | |
2285 | | // Centroid/label point |
2286 | 49 | poMapFile->Int2Coordsys(poPLineHdr->m_nLabelX, poPLineHdr->m_nLabelY, |
2287 | 49 | dX, dY); |
2288 | 49 | SetCenter(dX, dY); |
2289 | | |
2290 | | // Compressed coordinate origin (useful only in compressed case!) |
2291 | 49 | m_nComprOrgX = poPLineHdr->m_nComprOrgX; |
2292 | 49 | m_nComprOrgY = poPLineHdr->m_nComprOrgY; |
2293 | | |
2294 | | // MBR |
2295 | 49 | poMapFile->Int2Coordsys(poPLineHdr->m_nMinX, poPLineHdr->m_nMinY, dXMin, |
2296 | 49 | dYMin); |
2297 | 49 | poMapFile->Int2Coordsys(poPLineHdr->m_nMaxX, poPLineHdr->m_nMaxY, dXMax, |
2298 | 49 | dYMax); |
2299 | | |
2300 | 49 | if (!bCoordBlockDataOnly) |
2301 | 49 | { |
2302 | 49 | m_nPenDefIndex = poPLineHdr->m_nPenId; // Pen index |
2303 | 49 | poMapFile->ReadPenDef(m_nPenDefIndex, &m_sPenDef); |
2304 | 49 | } |
2305 | | |
2306 | 49 | const int nMinSizeOfSection = 24; |
2307 | 49 | if (numLineSections > INT_MAX / nMinSizeOfSection) |
2308 | 0 | { |
2309 | 0 | CPLError(CE_Failure, CPLE_AppDefined, "Too many numLineSections"); |
2310 | 0 | return -1; |
2311 | 0 | } |
2312 | 49 | const GUInt32 nMinimumBytesForSections = |
2313 | 49 | nMinSizeOfSection * numLineSections; |
2314 | 49 | if (nMinimumBytesForSections > 1024 * 1024 && |
2315 | 0 | nMinimumBytesForSections > poMapFile->GetFileSize()) |
2316 | 0 | { |
2317 | 0 | CPLError(CE_Failure, CPLE_AppDefined, "Too many numLineSections"); |
2318 | 0 | return -1; |
2319 | 0 | } |
2320 | | |
2321 | | /*------------------------------------------------------------- |
2322 | | * Read data from the coord. block |
2323 | | *------------------------------------------------------------*/ |
2324 | 49 | TABMAPCoordSecHdr *pasSecHdrs = static_cast<TABMAPCoordSecHdr *>( |
2325 | 49 | VSI_MALLOC2_VERBOSE(numLineSections, sizeof(TABMAPCoordSecHdr))); |
2326 | 49 | if (pasSecHdrs == nullptr) |
2327 | 0 | return -1; |
2328 | | |
2329 | 49 | if (ppoCoordBlock != nullptr && *ppoCoordBlock != nullptr) |
2330 | 3 | poCoordBlock = *ppoCoordBlock; |
2331 | 46 | else |
2332 | 46 | poCoordBlock = poMapFile->GetCoordBlock(nCoordBlockPtr); |
2333 | | |
2334 | 49 | GInt32 numPointsTotal = 0; |
2335 | 49 | if (poCoordBlock == nullptr || |
2336 | 42 | poCoordBlock->ReadCoordSecHdrs(bComprCoord, nVersion, |
2337 | 42 | numLineSections, pasSecHdrs, |
2338 | 42 | numPointsTotal) != 0) |
2339 | 9 | { |
2340 | 9 | CPLError(CE_Failure, CPLE_FileIO, |
2341 | 9 | "Failed reading coordinate data at offset %d", |
2342 | 9 | nCoordBlockPtr); |
2343 | 9 | CPLFree(pasSecHdrs); |
2344 | 9 | return -1; |
2345 | 9 | } |
2346 | | |
2347 | 40 | const GUInt32 nMinimumBytesForPoints = |
2348 | 40 | (bComprCoord ? 4 : 8) * numPointsTotal; |
2349 | 40 | if (nMinimumBytesForPoints > 1024 * 1024 && |
2350 | 0 | nMinimumBytesForPoints > poMapFile->GetFileSize()) |
2351 | 0 | { |
2352 | 0 | CPLError(CE_Failure, CPLE_AppDefined, "Too many numPointsTotal"); |
2353 | 0 | CPLFree(pasSecHdrs); |
2354 | 0 | return -1; |
2355 | 0 | } |
2356 | | |
2357 | 40 | poCoordBlock->SetComprCoordOrigin(m_nComprOrgX, m_nComprOrgY); |
2358 | | |
2359 | 40 | GInt32 *panXY = static_cast<GInt32 *>( |
2360 | 40 | VSI_MALLOC2_VERBOSE(numPointsTotal, 2 * sizeof(GInt32))); |
2361 | 40 | if (panXY == nullptr) |
2362 | 1 | { |
2363 | 1 | CPLFree(pasSecHdrs); |
2364 | 1 | return -1; |
2365 | 1 | } |
2366 | | |
2367 | 39 | if (poCoordBlock->ReadIntCoords(bComprCoord, numPointsTotal, panXY) != |
2368 | 39 | 0) |
2369 | 1 | { |
2370 | 1 | CPLError(CE_Failure, CPLE_FileIO, |
2371 | 1 | "Failed reading coordinate data at offset %d", |
2372 | 1 | nCoordBlockPtr); |
2373 | 1 | CPLFree(pasSecHdrs); |
2374 | 1 | CPLFree(panXY); |
2375 | 1 | return -1; |
2376 | 1 | } |
2377 | | |
2378 | | /*------------------------------------------------------------- |
2379 | | * Create a Geometry collection with one line geometry for |
2380 | | * each coordinates section |
2381 | | * If object contains only one section, then return a simple LineString |
2382 | | *------------------------------------------------------------*/ |
2383 | 38 | OGRMultiLineString *poMultiLine = nullptr; |
2384 | 38 | if (numLineSections > 1) |
2385 | 36 | { |
2386 | 36 | poMultiLine = new OGRMultiLineString(); |
2387 | 36 | poGeometry = poMultiLine; |
2388 | 36 | } |
2389 | | |
2390 | 112 | for (int iSection = 0; iSection < numLineSections; iSection++) |
2391 | 74 | { |
2392 | 74 | const int numSectionVertices = pasSecHdrs[iSection].numVertices; |
2393 | 74 | GInt32 *pnXYPtr = panXY + (pasSecHdrs[iSection].nVertexOffset * 2); |
2394 | | |
2395 | 74 | auto poLine = new OGRLineString(); |
2396 | 74 | poLine->setNumPoints(numSectionVertices); |
2397 | | |
2398 | 220 | for (int i = 0; i < numSectionVertices; i++) |
2399 | 146 | { |
2400 | 146 | poMapFile->Int2Coordsys(*pnXYPtr, *(pnXYPtr + 1), dX, dY); |
2401 | 146 | poLine->setPoint(i, dX, dY); |
2402 | 146 | pnXYPtr += 2; |
2403 | 146 | } |
2404 | | |
2405 | 74 | if (poGeometry == nullptr) |
2406 | 2 | poGeometry = poLine; |
2407 | 72 | else if (poMultiLine->addGeometryDirectly(poLine) != OGRERR_NONE) |
2408 | 0 | { |
2409 | 0 | CPLAssert(false); // Just in case lower-level lib is modified |
2410 | 0 | } |
2411 | 74 | } |
2412 | | |
2413 | 38 | CPLFree(pasSecHdrs); |
2414 | 38 | CPLFree(panXY); |
2415 | 38 | } |
2416 | 0 | else |
2417 | 0 | { |
2418 | 0 | CPLError( |
2419 | 0 | CE_Failure, CPLE_AssertionFailed, |
2420 | 0 | "ReadGeometryFromMAPFile(): unsupported geometry type %d (0x%2.2x)", |
2421 | 0 | m_nMapInfoType, m_nMapInfoType); |
2422 | 0 | return -1; |
2423 | 0 | } |
2424 | | |
2425 | 230 | SetGeometryDirectly(poGeometry); |
2426 | | |
2427 | 230 | SetMBR(dXMin, dYMin, dXMax, dYMax); |
2428 | 230 | SetIntMBR(poObjHdr->m_nMinX, poObjHdr->m_nMinY, poObjHdr->m_nMaxX, |
2429 | 230 | poObjHdr->m_nMaxY); |
2430 | | |
2431 | | /* Return a ref to coord block so that caller can continue reading |
2432 | | * after the end of this object (used by TABCollection and index splitting) |
2433 | | */ |
2434 | 230 | if (ppoCoordBlock) |
2435 | 2 | *ppoCoordBlock = poCoordBlock; |
2436 | | |
2437 | 230 | return 0; |
2438 | 241 | } |
2439 | | |
2440 | | /********************************************************************** |
2441 | | * TABPolyline::WriteGeometryToMAPFile() |
2442 | | * |
2443 | | * Write the geometry and representation (color, etc...) part of the |
2444 | | * feature to the .MAP object pointed to by poMAPFile. |
2445 | | * |
2446 | | * It is assumed that poMAPFile currently points to a valid map object. |
2447 | | * |
2448 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
2449 | | * been called. |
2450 | | **********************************************************************/ |
2451 | | int TABPolyline::WriteGeometryToMAPFile( |
2452 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
2453 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
2454 | | TABMAPCoordBlock **ppoCoordBlock /*=NULL*/) |
2455 | 7.33k | { |
2456 | 7.33k | GInt32 nX = 0; |
2457 | 7.33k | GInt32 nY = 0; |
2458 | 7.33k | OGRLineString *poLine = nullptr; |
2459 | 7.33k | TABMAPCoordBlock *poCoordBlock = nullptr; |
2460 | | |
2461 | | /*----------------------------------------------------------------- |
2462 | | * We assume that ValidateMapInfoType() was called already and that |
2463 | | * the type in poObjHdr->m_nType is valid. |
2464 | | *----------------------------------------------------------------*/ |
2465 | 7.33k | CPLAssert(m_nMapInfoType == poObjHdr->m_nType); |
2466 | 7.33k | CPLErrorReset(); |
2467 | | |
2468 | | /*----------------------------------------------------------------- |
2469 | | * Fetch and validate geometry |
2470 | | *----------------------------------------------------------------*/ |
2471 | 7.33k | OGRGeometry *poGeom = GetGeometryRef(); |
2472 | | |
2473 | 7.33k | if ((m_nMapInfoType == TAB_GEOM_LINE || |
2474 | 7.00k | m_nMapInfoType == TAB_GEOM_LINE_C) && |
2475 | 323 | poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbLineString && |
2476 | 323 | (poLine = poGeom->toLineString())->getNumPoints() == 2) |
2477 | 323 | { |
2478 | | /*============================================================= |
2479 | | * LINE (2 vertices) |
2480 | | *============================================================*/ |
2481 | 323 | TABMAPObjLine *poLineHdr = cpl::down_cast<TABMAPObjLine *>(poObjHdr); |
2482 | | |
2483 | 323 | poMapFile->Coordsys2Int(poLine->getX(0), poLine->getY(0), |
2484 | 323 | poLineHdr->m_nX1, poLineHdr->m_nY1); |
2485 | 323 | poMapFile->Coordsys2Int(poLine->getX(1), poLine->getY(1), |
2486 | 323 | poLineHdr->m_nX2, poLineHdr->m_nY2); |
2487 | 323 | poLineHdr->SetMBR(poLineHdr->m_nX1, poLineHdr->m_nY1, poLineHdr->m_nX2, |
2488 | 323 | poLineHdr->m_nY2); |
2489 | | |
2490 | 323 | if (!bCoordBlockDataOnly) |
2491 | 323 | { |
2492 | 323 | m_nPenDefIndex = poMapFile->WritePenDef(&m_sPenDef); |
2493 | 323 | poLineHdr->m_nPenId = |
2494 | 323 | static_cast<GByte>(m_nPenDefIndex); // Pen index |
2495 | 323 | } |
2496 | 323 | } |
2497 | 7.00k | else if ((m_nMapInfoType == TAB_GEOM_PLINE || |
2498 | 6.06k | m_nMapInfoType == TAB_GEOM_PLINE_C) && |
2499 | 1.54k | poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbLineString) |
2500 | 1.54k | { |
2501 | | /*============================================================= |
2502 | | * PLINE ( > 2 vertices and less than 32767 vertices) |
2503 | | *============================================================*/ |
2504 | 1.54k | GBool bCompressed = poObjHdr->IsCompressedType(); |
2505 | | |
2506 | | /*------------------------------------------------------------- |
2507 | | * Process geometry first... |
2508 | | *------------------------------------------------------------*/ |
2509 | 1.54k | poLine = poGeom->toLineString(); |
2510 | 1.54k | const int numPoints = poLine->getNumPoints(); |
2511 | 1.54k | CPLAssert(numPoints <= TAB_REGION_PLINE_300_MAX_VERTICES); |
2512 | | |
2513 | 1.54k | if (ppoCoordBlock != nullptr && *ppoCoordBlock != nullptr) |
2514 | 0 | poCoordBlock = *ppoCoordBlock; |
2515 | 1.54k | else |
2516 | 1.54k | poCoordBlock = poMapFile->GetCurCoordBlock(); |
2517 | 1.54k | poCoordBlock->StartNewFeature(); |
2518 | 1.54k | const GInt32 nCoordBlockPtr = poCoordBlock->GetCurAddress(); |
2519 | 1.54k | poCoordBlock->SetComprCoordOrigin(m_nComprOrgX, m_nComprOrgY); |
2520 | | |
2521 | 1.54k | int nStatus = 0; |
2522 | 14.4k | for (int i = 0; nStatus == 0 && i < numPoints; i++) |
2523 | 12.9k | { |
2524 | 12.9k | poMapFile->Coordsys2Int(poLine->getX(i), poLine->getY(i), nX, nY); |
2525 | 12.9k | if ((nStatus = poCoordBlock->WriteIntCoord(nX, nY, bCompressed)) != |
2526 | 12.9k | 0) |
2527 | 0 | { |
2528 | | // Failed ... error message has already been produced |
2529 | 0 | return nStatus; |
2530 | 0 | } |
2531 | 12.9k | } |
2532 | | |
2533 | 1.54k | const GUInt32 nCoordDataSize = poCoordBlock->GetFeatureDataSize(); |
2534 | | |
2535 | | /*------------------------------------------------------------- |
2536 | | * Copy info to poObjHdr |
2537 | | *------------------------------------------------------------*/ |
2538 | 1.54k | TABMAPObjPLine *poPLineHdr = cpl::down_cast<TABMAPObjPLine *>(poObjHdr); |
2539 | | |
2540 | 1.54k | poPLineHdr->m_nCoordBlockPtr = nCoordBlockPtr; |
2541 | 1.54k | poPLineHdr->m_nCoordDataSize = nCoordDataSize; |
2542 | 1.54k | poPLineHdr->m_numLineSections = 1; |
2543 | | |
2544 | 1.54k | poPLineHdr->m_bSmooth = m_bSmooth; |
2545 | | |
2546 | | // MBR |
2547 | 1.54k | poPLineHdr->SetMBR(m_nXMin, m_nYMin, m_nXMax, m_nYMax); |
2548 | | |
2549 | | // Polyline center/label point |
2550 | 1.54k | double dX = 0.0; |
2551 | 1.54k | double dY = 0.0; |
2552 | 1.54k | if (GetCenter(dX, dY) != -1) |
2553 | 1.54k | { |
2554 | 1.54k | poMapFile->Coordsys2Int(dX, dY, poPLineHdr->m_nLabelX, |
2555 | 1.54k | poPLineHdr->m_nLabelY); |
2556 | 1.54k | } |
2557 | 0 | else |
2558 | 0 | { |
2559 | 0 | poPLineHdr->m_nLabelX = m_nComprOrgX; |
2560 | 0 | poPLineHdr->m_nLabelY = m_nComprOrgY; |
2561 | 0 | } |
2562 | | |
2563 | | // Compressed coordinate origin (useful only in compressed case!) |
2564 | 1.54k | poPLineHdr->m_nComprOrgX = m_nComprOrgX; |
2565 | 1.54k | poPLineHdr->m_nComprOrgY = m_nComprOrgY; |
2566 | | |
2567 | 1.54k | if (!bCoordBlockDataOnly) |
2568 | 1.54k | { |
2569 | 1.54k | m_nPenDefIndex = poMapFile->WritePenDef(&m_sPenDef); |
2570 | 1.54k | poPLineHdr->m_nPenId = |
2571 | 1.54k | static_cast<GByte>(m_nPenDefIndex); // Pen index |
2572 | 1.54k | } |
2573 | 1.54k | } |
2574 | 5.46k | else if ((m_nMapInfoType == TAB_GEOM_MULTIPLINE || |
2575 | 5.43k | m_nMapInfoType == TAB_GEOM_MULTIPLINE_C || |
2576 | 0 | m_nMapInfoType == TAB_GEOM_V450_MULTIPLINE || |
2577 | 0 | m_nMapInfoType == TAB_GEOM_V450_MULTIPLINE_C || |
2578 | 0 | m_nMapInfoType == TAB_GEOM_V800_MULTIPLINE || |
2579 | 0 | m_nMapInfoType == TAB_GEOM_V800_MULTIPLINE_C) && |
2580 | 5.46k | poGeom && |
2581 | 5.46k | (wkbFlatten(poGeom->getGeometryType()) == wkbMultiLineString || |
2582 | 0 | wkbFlatten(poGeom->getGeometryType()) == wkbLineString)) |
2583 | 5.46k | { |
2584 | | /*============================================================= |
2585 | | * PLINE MULTIPLE (or single PLINE with more than 32767 vertices) |
2586 | | *============================================================*/ |
2587 | | |
2588 | 5.46k | CPLAssert(m_nMapInfoType == TAB_GEOM_MULTIPLINE || |
2589 | 5.46k | m_nMapInfoType == TAB_GEOM_MULTIPLINE_C || |
2590 | 5.46k | m_nMapInfoType == TAB_GEOM_V450_MULTIPLINE || |
2591 | 5.46k | m_nMapInfoType == TAB_GEOM_V450_MULTIPLINE_C || |
2592 | 5.46k | m_nMapInfoType == TAB_GEOM_V800_MULTIPLINE || |
2593 | 5.46k | m_nMapInfoType == TAB_GEOM_V800_MULTIPLINE_C); |
2594 | | |
2595 | 5.46k | int nStatus = 0; |
2596 | 5.46k | OGREnvelope sEnvelope; |
2597 | 5.46k | GBool bCompressed = poObjHdr->IsCompressedType(); |
2598 | | |
2599 | | /*------------------------------------------------------------- |
2600 | | * Process geometry first... |
2601 | | *------------------------------------------------------------*/ |
2602 | 5.46k | if (ppoCoordBlock != nullptr && *ppoCoordBlock != nullptr) |
2603 | 0 | poCoordBlock = *ppoCoordBlock; |
2604 | 5.46k | else |
2605 | 5.46k | poCoordBlock = poMapFile->GetCurCoordBlock(); |
2606 | 5.46k | poCoordBlock->StartNewFeature(); |
2607 | 5.46k | const GInt32 nCoordBlockPtr = poCoordBlock->GetCurAddress(); |
2608 | 5.46k | poCoordBlock->SetComprCoordOrigin(m_nComprOrgX, m_nComprOrgY); |
2609 | | |
2610 | 5.46k | OGRMultiLineString *poMultiLine = nullptr; |
2611 | 5.46k | GInt32 numLines = 1; |
2612 | 5.46k | if (wkbFlatten(poGeom->getGeometryType()) == wkbMultiLineString) |
2613 | 5.46k | { |
2614 | 5.46k | poMultiLine = poGeom->toMultiLineString(); |
2615 | 5.46k | numLines = poMultiLine->getNumGeometries(); |
2616 | 5.46k | } |
2617 | | // else |
2618 | | // { |
2619 | | // poMultiLine = NULL; |
2620 | | // numLines = 1; |
2621 | | // } |
2622 | | |
2623 | | /*------------------------------------------------------------- |
2624 | | * Build and write array of coord sections headers |
2625 | | *------------------------------------------------------------*/ |
2626 | 5.46k | TABMAPCoordSecHdr *pasSecHdrs = static_cast<TABMAPCoordSecHdr *>( |
2627 | 5.46k | VSI_CALLOC_VERBOSE(numLines, sizeof(TABMAPCoordSecHdr))); |
2628 | 5.46k | if (pasSecHdrs == nullptr) |
2629 | 0 | { |
2630 | 0 | return -1; |
2631 | 0 | } |
2632 | | |
2633 | | /*------------------------------------------------------------- |
2634 | | * In calculation of nDataOffset, we have to take into account that |
2635 | | * V450 header section uses int32 instead of int16 for numVertices |
2636 | | * and we add another 2 bytes to align with a 4 bytes boundary. |
2637 | | *------------------------------------------------------------*/ |
2638 | 5.46k | int nVersion = TAB_GEOM_GET_VERSION(m_nMapInfoType); |
2639 | | |
2640 | 5.46k | const int nTotalHdrSizeUncompressed = |
2641 | 5.46k | (nVersion >= 450 ? 28 : 24) * numLines; |
2642 | | |
2643 | 5.46k | GInt32 numPointsTotal = 0; |
2644 | 5.55k | for (int iLine = 0; iLine < numLines; iLine++) |
2645 | 92 | { |
2646 | 92 | if (poMultiLine) |
2647 | 92 | poGeom = poMultiLine->getGeometryRef(iLine); |
2648 | | |
2649 | 92 | if (poGeom && |
2650 | 92 | wkbFlatten(poGeom->getGeometryType()) == wkbLineString) |
2651 | 92 | { |
2652 | 92 | poLine = poGeom->toLineString(); |
2653 | 92 | const GInt32 numPoints = poLine->getNumPoints(); |
2654 | 92 | poLine->getEnvelope(&sEnvelope); |
2655 | | |
2656 | 92 | pasSecHdrs[iLine].numVertices = poLine->getNumPoints(); |
2657 | 92 | pasSecHdrs[iLine].numHoles = 0; // It is a line! |
2658 | | |
2659 | 92 | poMapFile->Coordsys2Int(sEnvelope.MinX, sEnvelope.MinY, |
2660 | 92 | pasSecHdrs[iLine].nXMin, |
2661 | 92 | pasSecHdrs[iLine].nYMin); |
2662 | 92 | poMapFile->Coordsys2Int(sEnvelope.MaxX, sEnvelope.MaxY, |
2663 | 92 | pasSecHdrs[iLine].nXMax, |
2664 | 92 | pasSecHdrs[iLine].nYMax); |
2665 | 92 | pasSecHdrs[iLine].nDataOffset = |
2666 | 92 | nTotalHdrSizeUncompressed + numPointsTotal * 4 * 2; |
2667 | 92 | pasSecHdrs[iLine].nVertexOffset = numPointsTotal; |
2668 | | |
2669 | 92 | numPointsTotal += numPoints; |
2670 | 92 | } |
2671 | 0 | else |
2672 | 0 | { |
2673 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
2674 | 0 | "TABPolyline: Object contains an invalid Geometry!"); |
2675 | 0 | nStatus = -1; |
2676 | 0 | } |
2677 | 92 | } |
2678 | | |
2679 | 5.46k | if (nStatus == 0) |
2680 | 5.46k | nStatus = poCoordBlock->WriteCoordSecHdrs(nVersion, numLines, |
2681 | 5.46k | pasSecHdrs, bCompressed); |
2682 | | |
2683 | 5.46k | CPLFree(pasSecHdrs); |
2684 | 5.46k | pasSecHdrs = nullptr; |
2685 | | |
2686 | 5.46k | if (nStatus != 0) |
2687 | 0 | return nStatus; // Error has already been reported. |
2688 | | |
2689 | | /*------------------------------------------------------------- |
2690 | | * Then write the coordinates themselves... |
2691 | | *------------------------------------------------------------*/ |
2692 | 5.55k | for (int iLine = 0; nStatus == 0 && iLine < numLines; iLine++) |
2693 | 92 | { |
2694 | 92 | if (poMultiLine) |
2695 | 92 | poGeom = poMultiLine->getGeometryRef(iLine); |
2696 | | |
2697 | 92 | if (poGeom && |
2698 | 92 | wkbFlatten(poGeom->getGeometryType()) == wkbLineString) |
2699 | 92 | { |
2700 | 92 | poLine = poGeom->toLineString(); |
2701 | 92 | GInt32 numPoints = poLine->getNumPoints(); |
2702 | | |
2703 | 377 | for (int i = 0; nStatus == 0 && i < numPoints; i++) |
2704 | 285 | { |
2705 | 285 | poMapFile->Coordsys2Int(poLine->getX(i), poLine->getY(i), |
2706 | 285 | nX, nY); |
2707 | 285 | if ((nStatus = poCoordBlock->WriteIntCoord( |
2708 | 285 | nX, nY, bCompressed)) != 0) |
2709 | 0 | { |
2710 | | // Failed ... error message has already been produced |
2711 | 0 | return nStatus; |
2712 | 0 | } |
2713 | 285 | } |
2714 | 92 | } |
2715 | 0 | else |
2716 | 0 | { |
2717 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
2718 | 0 | "TABPolyline: Object contains an invalid Geometry!"); |
2719 | 0 | return -1; |
2720 | 0 | } |
2721 | 92 | } |
2722 | | |
2723 | 5.46k | const GUInt32 nCoordDataSize = poCoordBlock->GetFeatureDataSize(); |
2724 | | |
2725 | | /*------------------------------------------------------------- |
2726 | | * ... and finally copy info to poObjHdr |
2727 | | *------------------------------------------------------------*/ |
2728 | 5.46k | TABMAPObjPLine *poPLineHdr = cpl::down_cast<TABMAPObjPLine *>(poObjHdr); |
2729 | | |
2730 | 5.46k | poPLineHdr->m_nCoordBlockPtr = nCoordBlockPtr; |
2731 | 5.46k | poPLineHdr->m_nCoordDataSize = nCoordDataSize; |
2732 | 5.46k | poPLineHdr->m_numLineSections = numLines; |
2733 | | |
2734 | 5.46k | poPLineHdr->m_bSmooth = m_bSmooth; |
2735 | | |
2736 | | // MBR |
2737 | 5.46k | poPLineHdr->SetMBR(m_nXMin, m_nYMin, m_nXMax, m_nYMax); |
2738 | | |
2739 | | // Polyline center/label point |
2740 | 5.46k | double dX = 0.0; |
2741 | 5.46k | double dY = 0.0; |
2742 | 5.46k | if (GetCenter(dX, dY) != -1) |
2743 | 36 | { |
2744 | 36 | poMapFile->Coordsys2Int(dX, dY, poPLineHdr->m_nLabelX, |
2745 | 36 | poPLineHdr->m_nLabelY); |
2746 | 36 | } |
2747 | 5.42k | else |
2748 | 5.42k | { |
2749 | 5.42k | poPLineHdr->m_nLabelX = m_nComprOrgX; |
2750 | 5.42k | poPLineHdr->m_nLabelY = m_nComprOrgY; |
2751 | 5.42k | } |
2752 | | |
2753 | | // Compressed coordinate origin (useful only in compressed case!) |
2754 | 5.46k | poPLineHdr->m_nComprOrgX = m_nComprOrgX; |
2755 | 5.46k | poPLineHdr->m_nComprOrgY = m_nComprOrgY; |
2756 | | |
2757 | 5.46k | if (!bCoordBlockDataOnly) |
2758 | 5.46k | { |
2759 | 5.46k | m_nPenDefIndex = poMapFile->WritePenDef(&m_sPenDef); |
2760 | 5.46k | poPLineHdr->m_nPenId = |
2761 | 5.46k | static_cast<GByte>(m_nPenDefIndex); // Pen index |
2762 | 5.46k | } |
2763 | 5.46k | } |
2764 | 0 | else |
2765 | 0 | { |
2766 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
2767 | 0 | "TABPolyline: Object contains an invalid Geometry!"); |
2768 | 0 | return -1; |
2769 | 0 | } |
2770 | | |
2771 | 7.33k | if (CPLGetLastErrorType() == CE_Failure) |
2772 | 0 | return -1; |
2773 | | |
2774 | | /* Return a ref to coord block so that caller can continue writing |
2775 | | * after the end of this object (used by index splitting) |
2776 | | */ |
2777 | 7.33k | if (ppoCoordBlock) |
2778 | 0 | *ppoCoordBlock = poCoordBlock; |
2779 | | |
2780 | 7.33k | return 0; |
2781 | 7.33k | } |
2782 | | |
2783 | | /********************************************************************** |
2784 | | * TABPolyline::GetStyleString() const |
2785 | | * |
2786 | | * Return style string for this feature. |
2787 | | * |
2788 | | * Style String is built only once during the first call to GetStyleString(). |
2789 | | **********************************************************************/ |
2790 | | const char *TABPolyline::GetStyleString() const |
2791 | 0 | { |
2792 | 0 | if (m_pszStyleString == nullptr) |
2793 | 0 | { |
2794 | 0 | m_pszStyleString = CPLStrdup(GetPenStyleString()); |
2795 | 0 | } |
2796 | |
|
2797 | 0 | return m_pszStyleString; |
2798 | 0 | } |
2799 | | |
2800 | | /********************************************************************** |
2801 | | * TABPolyline::DumpMIF() |
2802 | | * |
2803 | | * Dump feature geometry in a format similar to .MIF PLINEs. |
2804 | | **********************************************************************/ |
2805 | | void TABPolyline::DumpMIF(FILE *fpOut /*=NULL*/) |
2806 | 0 | { |
2807 | 0 | OGRMultiLineString *poMultiLine = nullptr; |
2808 | 0 | OGRLineString *poLine = nullptr; |
2809 | 0 | int i, numPoints; |
2810 | |
|
2811 | 0 | if (fpOut == nullptr) |
2812 | 0 | fpOut = stdout; |
2813 | | |
2814 | | /*----------------------------------------------------------------- |
2815 | | * Fetch and validate geometry |
2816 | | *----------------------------------------------------------------*/ |
2817 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
2818 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbLineString) |
2819 | 0 | { |
2820 | | /*------------------------------------------------------------- |
2821 | | * Generate output for simple polyline |
2822 | | *------------------------------------------------------------*/ |
2823 | 0 | poLine = poGeom->toLineString(); |
2824 | 0 | numPoints = poLine->getNumPoints(); |
2825 | 0 | fprintf(fpOut, "PLINE %d\n", numPoints); |
2826 | 0 | for (i = 0; i < numPoints; i++) |
2827 | 0 | fprintf(fpOut, "%.15g %.15g\n", poLine->getX(i), poLine->getY(i)); |
2828 | 0 | } |
2829 | 0 | else if (poGeom && |
2830 | 0 | wkbFlatten(poGeom->getGeometryType()) == wkbMultiLineString) |
2831 | 0 | { |
2832 | | /*------------------------------------------------------------- |
2833 | | * Generate output for multiple polyline |
2834 | | *------------------------------------------------------------*/ |
2835 | 0 | int iLine, numLines; |
2836 | 0 | poMultiLine = poGeom->toMultiLineString(); |
2837 | 0 | numLines = poMultiLine->getNumGeometries(); |
2838 | 0 | fprintf(fpOut, "PLINE MULTIPLE %d\n", numLines); |
2839 | 0 | for (iLine = 0; iLine < numLines; iLine++) |
2840 | 0 | { |
2841 | 0 | poGeom = poMultiLine->getGeometryRef(iLine); |
2842 | 0 | if (poGeom && |
2843 | 0 | wkbFlatten(poGeom->getGeometryType()) == wkbLineString) |
2844 | 0 | { |
2845 | 0 | poLine = poGeom->toLineString(); |
2846 | 0 | numPoints = poLine->getNumPoints(); |
2847 | 0 | fprintf(fpOut, " %d\n", numPoints); |
2848 | 0 | for (i = 0; i < numPoints; i++) |
2849 | 0 | fprintf(fpOut, "%.15g %.15g\n", poLine->getX(i), |
2850 | 0 | poLine->getY(i)); |
2851 | 0 | } |
2852 | 0 | else |
2853 | 0 | { |
2854 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
2855 | 0 | "TABPolyline: Object contains an invalid Geometry!"); |
2856 | 0 | return; |
2857 | 0 | } |
2858 | 0 | } |
2859 | 0 | } |
2860 | 0 | else |
2861 | 0 | { |
2862 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
2863 | 0 | "TABPolyline: Missing or Invalid Geometry!"); |
2864 | 0 | return; |
2865 | 0 | } |
2866 | | |
2867 | 0 | if (m_bCenterIsSet) |
2868 | 0 | fprintf(fpOut, "Center %.15g %.15g\n", m_dCenterX, m_dCenterY); |
2869 | | |
2870 | | // Finish with PEN/BRUSH/etc. clauses |
2871 | 0 | DumpPenDef(); |
2872 | |
|
2873 | 0 | fflush(fpOut); |
2874 | 0 | } |
2875 | | |
2876 | | /********************************************************************** |
2877 | | * TABPolyline::GetCenter() |
2878 | | * |
2879 | | * Returns the center point of the line. Compute one if it was not |
2880 | | * explicitly set: |
2881 | | * |
2882 | | * In MapInfo, for a simple or multiple polyline (pline), the center point |
2883 | | * in the object definition is supposed to be either the center point of |
2884 | | * the pline or the first section of a multiple pline (if an odd number of |
2885 | | * points in the pline or first section), or the midway point between the |
2886 | | * two central points (if an even number of points involved). |
2887 | | * |
2888 | | * Returns 0 on success, -1 on error. |
2889 | | **********************************************************************/ |
2890 | | int TABPolyline::GetCenter(double &dX, double &dY) |
2891 | 7.00k | { |
2892 | 7.00k | if (!m_bCenterIsSet) |
2893 | 7.00k | { |
2894 | 7.00k | OGRLineString *poLine = nullptr; |
2895 | | |
2896 | 7.00k | OGRGeometry *poGeom = GetGeometryRef(); |
2897 | 7.00k | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbLineString) |
2898 | 1.54k | { |
2899 | 1.54k | poLine = poGeom->toLineString(); |
2900 | 1.54k | } |
2901 | 5.46k | else if (poGeom && |
2902 | 5.46k | wkbFlatten(poGeom->getGeometryType()) == wkbMultiLineString) |
2903 | 5.46k | { |
2904 | 5.46k | OGRMultiLineString *poMultiLine = poGeom->toMultiLineString(); |
2905 | 5.46k | if (poMultiLine->getNumGeometries() > 0) |
2906 | 92 | poLine = poMultiLine->getGeometryRef(0); |
2907 | 5.46k | } |
2908 | | |
2909 | 7.00k | if (poLine && poLine->getNumPoints() > 0) |
2910 | 1.58k | { |
2911 | 1.58k | int i = poLine->getNumPoints() / 2; |
2912 | 1.58k | if (poLine->getNumPoints() % 2 == 0) |
2913 | 249 | { |
2914 | | // Return the midway between the 2 center points |
2915 | 249 | m_dCenterX = (poLine->getX(i - 1) + poLine->getX(i)) / 2.0; |
2916 | 249 | m_dCenterY = (poLine->getY(i - 1) + poLine->getY(i)) / 2.0; |
2917 | 249 | } |
2918 | 1.33k | else |
2919 | 1.33k | { |
2920 | | // Return the center point |
2921 | 1.33k | m_dCenterX = poLine->getX(i); |
2922 | 1.33k | m_dCenterY = poLine->getY(i); |
2923 | 1.33k | } |
2924 | 1.58k | m_bCenterIsSet = TRUE; |
2925 | 1.58k | } |
2926 | 7.00k | } |
2927 | | |
2928 | 7.00k | if (!m_bCenterIsSet) |
2929 | 5.42k | return -1; |
2930 | | |
2931 | 1.58k | dX = m_dCenterX; |
2932 | 1.58k | dY = m_dCenterY; |
2933 | 1.58k | return 0; |
2934 | 7.00k | } |
2935 | | |
2936 | | /********************************************************************** |
2937 | | * TABPolyline::SetCenter() |
2938 | | * |
2939 | | * Set the X,Y coordinates to use as center point for the line. |
2940 | | **********************************************************************/ |
2941 | | void TABPolyline::SetCenter(double dX, double dY) |
2942 | 49 | { |
2943 | 49 | m_dCenterX = dX; |
2944 | 49 | m_dCenterY = dY; |
2945 | 49 | m_bCenterIsSet = TRUE; |
2946 | 49 | } |
2947 | | |
2948 | | /********************************************************************** |
2949 | | * TABPolyline::TwoPointLineAsPolyline() |
2950 | | * |
2951 | | * Returns the value of m_bWriteTwoPointLineAsPolyline |
2952 | | **********************************************************************/ |
2953 | | GBool TABPolyline::TwoPointLineAsPolyline() |
2954 | 0 | { |
2955 | 0 | return m_bWriteTwoPointLineAsPolyline; |
2956 | 0 | } |
2957 | | |
2958 | | /********************************************************************** |
2959 | | * TABPolyline::TwoPointLineAsPolyline() |
2960 | | * |
2961 | | * Sets the value of m_bWriteTwoPointLineAsPolyline |
2962 | | **********************************************************************/ |
2963 | | void TABPolyline::TwoPointLineAsPolyline(GBool bTwoPointLineAsPolyline) |
2964 | 0 | { |
2965 | 0 | m_bWriteTwoPointLineAsPolyline = bTwoPointLineAsPolyline; |
2966 | 0 | } |
2967 | | |
2968 | | /*===================================================================== |
2969 | | * class TABRegion |
2970 | | *====================================================================*/ |
2971 | | |
2972 | | /********************************************************************** |
2973 | | * TABRegion::TABRegion() |
2974 | | * |
2975 | | * Constructor. |
2976 | | **********************************************************************/ |
2977 | | TABRegion::TABRegion(const OGRFeatureDefn *poDefnIn) |
2978 | 195k | : TABFeature(poDefnIn), m_bSmooth(FALSE), m_bCenterIsSet(FALSE), |
2979 | 195k | m_dCenterX(0.0), m_dCenterY(0.0) |
2980 | 195k | { |
2981 | 195k | } |
2982 | | |
2983 | | /********************************************************************** |
2984 | | * TABRegion::~TABRegion() |
2985 | | * |
2986 | | * Destructor. |
2987 | | **********************************************************************/ |
2988 | | TABRegion::~TABRegion() |
2989 | 195k | { |
2990 | 195k | } |
2991 | | |
2992 | | /********************************************************************** |
2993 | | * TABRegion::CloneTABFeature() |
2994 | | * |
2995 | | * Duplicate feature, including stuff specific to each TABFeature type. |
2996 | | * |
2997 | | * This method calls the generic TABFeature::CopyTABFeatureBase() and |
2998 | | * then copies any members specific to its own type. |
2999 | | **********************************************************************/ |
3000 | | TABFeature * |
3001 | | TABRegion::CloneTABFeature(const OGRFeatureDefn *poNewDefn /*=NULL*/) |
3002 | 0 | { |
3003 | | /*----------------------------------------------------------------- |
3004 | | * Alloc new feature and copy the base stuff |
3005 | | *----------------------------------------------------------------*/ |
3006 | 0 | TABRegion *poNew = new TABRegion(poNewDefn ? poNewDefn : GetDefnRef()); |
3007 | |
|
3008 | 0 | CopyTABFeatureBase(poNew); |
3009 | | |
3010 | | /*----------------------------------------------------------------- |
3011 | | * And members specific to this class |
3012 | | *----------------------------------------------------------------*/ |
3013 | | // ITABFeaturePen |
3014 | 0 | *(poNew->GetPenDefRef()) = *GetPenDefRef(); |
3015 | | |
3016 | | // ITABFeatureBrush |
3017 | 0 | *(poNew->GetBrushDefRef()) = *GetBrushDefRef(); |
3018 | |
|
3019 | 0 | poNew->m_bSmooth = m_bSmooth; |
3020 | 0 | poNew->m_bCenterIsSet = m_bCenterIsSet; |
3021 | 0 | poNew->m_dCenterX = m_dCenterX; |
3022 | 0 | poNew->m_dCenterY = m_dCenterY; |
3023 | |
|
3024 | 0 | return poNew; |
3025 | 0 | } |
3026 | | |
3027 | | /********************************************************************** |
3028 | | * TABRegion::ValidateMapInfoType() |
3029 | | * |
3030 | | * Check the feature's geometry part and return the corresponding |
3031 | | * mapinfo object type code. The m_nMapInfoType member will also |
3032 | | * be updated for further calls to GetMapInfoType(); |
3033 | | * |
3034 | | * Returns TAB_GEOM_NONE if the geometry is not compatible with what |
3035 | | * is expected for this object class. |
3036 | | **********************************************************************/ |
3037 | | TABGeomType TABRegion::ValidateMapInfoType(TABMAPFile *poMapFile /*=NULL*/) |
3038 | 3.90k | { |
3039 | | /*----------------------------------------------------------------- |
3040 | | * Fetch and validate geometry |
3041 | | *----------------------------------------------------------------*/ |
3042 | 3.90k | OGRGeometry *poGeom = GetGeometryRef(); |
3043 | 3.90k | if (poGeom && (wkbFlatten(poGeom->getGeometryType()) == wkbPolygon || |
3044 | 779 | wkbFlatten(poGeom->getGeometryType()) == wkbMultiPolygon)) |
3045 | 3.90k | { |
3046 | 3.90k | GInt32 numPointsTotal = 0; |
3047 | 3.90k | GInt32 numRings = GetNumRings(); |
3048 | 8.21k | for (int i = 0; i < numRings; i++) |
3049 | 4.30k | { |
3050 | 4.30k | OGRLinearRing *poRing = GetRingRef(i); |
3051 | 4.30k | if (poRing) |
3052 | 3.53k | numPointsTotal += poRing->getNumPoints(); |
3053 | 4.30k | } |
3054 | 3.90k | if (TAB_REGION_PLINE_REQUIRES_V800(numRings, numPointsTotal)) |
3055 | 0 | m_nMapInfoType = TAB_GEOM_V800_REGION; |
3056 | 3.90k | else if (numPointsTotal > TAB_REGION_PLINE_300_MAX_VERTICES) |
3057 | 0 | m_nMapInfoType = TAB_GEOM_V450_REGION; |
3058 | 3.90k | else |
3059 | 3.90k | m_nMapInfoType = TAB_GEOM_REGION; |
3060 | 3.90k | } |
3061 | 0 | else |
3062 | 0 | { |
3063 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
3064 | 0 | "TABRegion: Missing or Invalid Geometry!"); |
3065 | 0 | m_nMapInfoType = TAB_GEOM_NONE; |
3066 | 0 | } |
3067 | | |
3068 | | /*----------------------------------------------------------------- |
3069 | | * Decide if coordinates should be compressed or not. |
3070 | | *----------------------------------------------------------------*/ |
3071 | 3.90k | ValidateCoordType(poMapFile); |
3072 | | |
3073 | 3.90k | return m_nMapInfoType; |
3074 | 3.90k | } |
3075 | | |
3076 | | /********************************************************************** |
3077 | | * TABRegion::ReadGeometryFromMAPFile() |
3078 | | * |
3079 | | * Fill the geometry and representation (color, etc...) part of the |
3080 | | * feature from the contents of the .MAP object pointed to by poMAPFile. |
3081 | | * |
3082 | | * It is assumed that poMAPFile currently points to the beginning of |
3083 | | * a map object. |
3084 | | * |
3085 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
3086 | | * been called. |
3087 | | **********************************************************************/ |
3088 | | int TABRegion::ReadGeometryFromMAPFile( |
3089 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
3090 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
3091 | | TABMAPCoordBlock **ppoCoordBlock /*=NULL*/) |
3092 | 113 | { |
3093 | 113 | double dXMin = 0.0; |
3094 | 113 | double dYMin = 0.0; |
3095 | 113 | double dXMax = 0.0; |
3096 | 113 | double dYMax = 0.0; |
3097 | 113 | OGRGeometry *poGeometry = nullptr; |
3098 | 113 | TABMAPCoordBlock *poCoordBlock = nullptr; |
3099 | | |
3100 | | /*----------------------------------------------------------------- |
3101 | | * Fetch and validate geometry type |
3102 | | *----------------------------------------------------------------*/ |
3103 | 113 | m_nMapInfoType = poObjHdr->m_nType; |
3104 | | |
3105 | 113 | if (m_nMapInfoType == TAB_GEOM_REGION || |
3106 | 47 | m_nMapInfoType == TAB_GEOM_REGION_C || |
3107 | 5 | m_nMapInfoType == TAB_GEOM_V450_REGION || |
3108 | 4 | m_nMapInfoType == TAB_GEOM_V450_REGION_C || |
3109 | 0 | m_nMapInfoType == TAB_GEOM_V800_REGION || |
3110 | 0 | m_nMapInfoType == TAB_GEOM_V800_REGION_C) |
3111 | 113 | { |
3112 | | /*============================================================= |
3113 | | * REGION (Similar to PLINE MULTIPLE) |
3114 | | *============================================================*/ |
3115 | 113 | GInt32 /* nCoordDataSize, */ numPointsTotal; |
3116 | 113 | OGRMultiPolygon *poMultiPolygon = nullptr; |
3117 | 113 | OGRPolygon *poPolygon = nullptr; |
3118 | 113 | GBool bComprCoord = poObjHdr->IsCompressedType(); |
3119 | 113 | int nVersion = TAB_GEOM_GET_VERSION(m_nMapInfoType); |
3120 | | |
3121 | | /*------------------------------------------------------------- |
3122 | | * Copy data from poObjHdr |
3123 | | *------------------------------------------------------------*/ |
3124 | 113 | TABMAPObjPLine *poPLineHdr = cpl::down_cast<TABMAPObjPLine *>(poObjHdr); |
3125 | | |
3126 | 113 | GInt32 nCoordBlockPtr = poPLineHdr->m_nCoordBlockPtr; |
3127 | | /* nCoordDataSize = poPLineHdr->m_nCoordDataSize; */ |
3128 | 113 | GInt32 numLineSections = poPLineHdr->m_numLineSections; |
3129 | 113 | m_bSmooth = poPLineHdr->m_bSmooth; |
3130 | | |
3131 | | // Centroid/label point |
3132 | 113 | double dX = 0.0; |
3133 | 113 | double dY = 0.0; |
3134 | 113 | poMapFile->Int2Coordsys(poPLineHdr->m_nLabelX, poPLineHdr->m_nLabelY, |
3135 | 113 | dX, dY); |
3136 | 113 | SetCenter(dX, dY); |
3137 | | |
3138 | | // Compressed coordinate origin (useful only in compressed case!) |
3139 | 113 | m_nComprOrgX = poPLineHdr->m_nComprOrgX; |
3140 | 113 | m_nComprOrgY = poPLineHdr->m_nComprOrgY; |
3141 | | |
3142 | | // MBR |
3143 | 113 | poMapFile->Int2Coordsys(poPLineHdr->m_nMinX, poPLineHdr->m_nMinY, dXMin, |
3144 | 113 | dYMin); |
3145 | 113 | poMapFile->Int2Coordsys(poPLineHdr->m_nMaxX, poPLineHdr->m_nMaxY, dXMax, |
3146 | 113 | dYMax); |
3147 | | |
3148 | 113 | if (!bCoordBlockDataOnly) |
3149 | 113 | { |
3150 | 113 | m_nPenDefIndex = poPLineHdr->m_nPenId; // Pen index |
3151 | 113 | poMapFile->ReadPenDef(m_nPenDefIndex, &m_sPenDef); |
3152 | 113 | m_nBrushDefIndex = poPLineHdr->m_nBrushId; // Brush index |
3153 | 113 | poMapFile->ReadBrushDef(m_nBrushDefIndex, &m_sBrushDef); |
3154 | 113 | } |
3155 | | |
3156 | | /*------------------------------------------------------------- |
3157 | | * Read data from the coord. block |
3158 | | *------------------------------------------------------------*/ |
3159 | | |
3160 | 113 | const int nMinSizeOfSection = 24; |
3161 | 113 | if (numLineSections > INT_MAX / nMinSizeOfSection) |
3162 | 0 | { |
3163 | 0 | CPLError(CE_Failure, CPLE_AppDefined, "Too many numLineSections"); |
3164 | 0 | return -1; |
3165 | 0 | } |
3166 | 113 | const GUInt32 nMinimumBytesForSections = |
3167 | 113 | nMinSizeOfSection * numLineSections; |
3168 | 113 | if (nMinimumBytesForSections > 1024 * 1024 && |
3169 | 0 | nMinimumBytesForSections > poMapFile->GetFileSize()) |
3170 | 0 | { |
3171 | 0 | CPLError(CE_Failure, CPLE_AppDefined, "Too many numLineSections"); |
3172 | 0 | return -1; |
3173 | 0 | } |
3174 | | |
3175 | 113 | TABMAPCoordSecHdr *pasSecHdrs = static_cast<TABMAPCoordSecHdr *>( |
3176 | 113 | VSI_MALLOC2_VERBOSE(numLineSections, sizeof(TABMAPCoordSecHdr))); |
3177 | 113 | if (pasSecHdrs == nullptr) |
3178 | 0 | return -1; |
3179 | | |
3180 | 113 | if (ppoCoordBlock != nullptr && *ppoCoordBlock != nullptr) |
3181 | 5 | poCoordBlock = *ppoCoordBlock; |
3182 | 108 | else |
3183 | 108 | poCoordBlock = poMapFile->GetCoordBlock(nCoordBlockPtr); |
3184 | | |
3185 | 113 | if (poCoordBlock) |
3186 | 107 | poCoordBlock->SetComprCoordOrigin(m_nComprOrgX, m_nComprOrgY); |
3187 | | |
3188 | 113 | if (poCoordBlock == nullptr || |
3189 | 107 | poCoordBlock->ReadCoordSecHdrs(bComprCoord, nVersion, |
3190 | 107 | numLineSections, pasSecHdrs, |
3191 | 107 | numPointsTotal) != 0) |
3192 | 21 | { |
3193 | 21 | CPLError(CE_Failure, CPLE_FileIO, |
3194 | 21 | "Failed reading coordinate data at offset %d", |
3195 | 21 | nCoordBlockPtr); |
3196 | 21 | CPLFree(pasSecHdrs); |
3197 | 21 | return -1; |
3198 | 21 | } |
3199 | | |
3200 | 92 | const GUInt32 nMinimumBytesForPoints = |
3201 | 92 | (bComprCoord ? 4 : 8) * numPointsTotal; |
3202 | 92 | if (nMinimumBytesForPoints > 1024 * 1024 && |
3203 | 0 | nMinimumBytesForPoints > poMapFile->GetFileSize()) |
3204 | 0 | { |
3205 | 0 | CPLError(CE_Failure, CPLE_AppDefined, "Too many numPointsTotal"); |
3206 | 0 | CPLFree(pasSecHdrs); |
3207 | 0 | return -1; |
3208 | 0 | } |
3209 | | |
3210 | 92 | GInt32 *panXY = static_cast<GInt32 *>( |
3211 | 92 | VSI_MALLOC2_VERBOSE(numPointsTotal, 2 * sizeof(GInt32))); |
3212 | 92 | if (panXY == nullptr) |
3213 | 0 | { |
3214 | 0 | CPLFree(pasSecHdrs); |
3215 | 0 | return -1; |
3216 | 0 | } |
3217 | | |
3218 | 92 | if (poCoordBlock->ReadIntCoords(bComprCoord, numPointsTotal, panXY) != |
3219 | 92 | 0) |
3220 | 5 | { |
3221 | 5 | CPLError(CE_Failure, CPLE_FileIO, |
3222 | 5 | "Failed reading coordinate data at offset %d", |
3223 | 5 | nCoordBlockPtr); |
3224 | 5 | CPLFree(pasSecHdrs); |
3225 | 5 | CPLFree(panXY); |
3226 | 5 | return -1; |
3227 | 5 | } |
3228 | | |
3229 | | /*------------------------------------------------------------- |
3230 | | * Decide if we should return an OGRPolygon or an OGRMultiPolygon |
3231 | | * depending on the number of outer rings found in CoordSecHdr blocks. |
3232 | | * The CoodSecHdr block for each outer ring in the region has a flag |
3233 | | * indicating the number of inner rings that follow. |
3234 | | * In older versions of the format, the count of inner rings was |
3235 | | * always zero, so in this case we would always return MultiPolygons. |
3236 | | * |
3237 | | * Note: The current implementation assumes that there cannot be |
3238 | | * holes inside holes (i.e. multiple levels of inner rings)... if |
3239 | | * that case was encountered then we would return an OGRMultiPolygon |
3240 | | * in which the topological relationship between the rings would |
3241 | | * be lost. |
3242 | | *------------------------------------------------------------*/ |
3243 | 87 | int numOuterRings = 0; |
3244 | 180 | for (int iSection = 0; iSection < numLineSections; iSection++) |
3245 | 93 | { |
3246 | | // Count this as an outer ring. |
3247 | 93 | numOuterRings++; |
3248 | | // Skip inner rings... so loop continues on an outer ring. |
3249 | 93 | iSection += pasSecHdrs[iSection].numHoles; |
3250 | 93 | } |
3251 | | |
3252 | 87 | if (numOuterRings > 1) |
3253 | 6 | { |
3254 | 6 | poMultiPolygon = new OGRMultiPolygon; |
3255 | 6 | poGeometry = poMultiPolygon; |
3256 | 6 | } |
3257 | 81 | else |
3258 | 81 | { |
3259 | 81 | poGeometry = nullptr; // Will be set later |
3260 | 81 | } |
3261 | | |
3262 | | /*------------------------------------------------------------- |
3263 | | * OK, build the OGRGeometry object. |
3264 | | *------------------------------------------------------------*/ |
3265 | 87 | int numHolesToRead = 0; |
3266 | 87 | poPolygon = nullptr; |
3267 | 180 | for (int iSection = 0; iSection < numLineSections; iSection++) |
3268 | 93 | { |
3269 | | |
3270 | 93 | if (poPolygon == nullptr) |
3271 | 93 | poPolygon = new OGRPolygon(); |
3272 | | |
3273 | 93 | if (numHolesToRead < 1) |
3274 | 93 | numHolesToRead = pasSecHdrs[iSection].numHoles; |
3275 | 0 | else |
3276 | 0 | numHolesToRead--; |
3277 | | |
3278 | 93 | int numSectionVertices = pasSecHdrs[iSection].numVertices; |
3279 | 93 | GInt32 *pnXYPtr = panXY + (pasSecHdrs[iSection].nVertexOffset * 2); |
3280 | | |
3281 | 93 | OGRLinearRing *poRing = new OGRLinearRing(); |
3282 | 93 | poRing->setNumPoints(numSectionVertices); |
3283 | | |
3284 | 1.73k | for (int i = 0; i < numSectionVertices; i++) |
3285 | 1.63k | { |
3286 | 1.63k | poMapFile->Int2Coordsys(*pnXYPtr, *(pnXYPtr + 1), dX, dY); |
3287 | 1.63k | poRing->setPoint(i, dX, dY); |
3288 | 1.63k | pnXYPtr += 2; |
3289 | 1.63k | } |
3290 | | |
3291 | 93 | poPolygon->addRingDirectly(poRing); |
3292 | 93 | poRing = nullptr; |
3293 | | |
3294 | 93 | if (numHolesToRead < 1) |
3295 | 87 | { |
3296 | 87 | if (numOuterRings > 1) |
3297 | 6 | { |
3298 | 6 | poMultiPolygon->addGeometryDirectly(poPolygon); |
3299 | 6 | } |
3300 | 81 | else |
3301 | 81 | { |
3302 | 81 | poGeometry = poPolygon; |
3303 | 81 | CPLAssert(iSection == numLineSections - 1); |
3304 | 81 | } |
3305 | | |
3306 | 87 | poPolygon = nullptr; // We'll alloc a new polygon next loop. |
3307 | 87 | } |
3308 | 93 | } |
3309 | 87 | delete poPolygon; // should only trigger on corrupted files |
3310 | | |
3311 | 87 | CPLFree(pasSecHdrs); |
3312 | 87 | CPLFree(panXY); |
3313 | 87 | } |
3314 | 0 | else |
3315 | 0 | { |
3316 | 0 | CPLError( |
3317 | 0 | CE_Failure, CPLE_AssertionFailed, |
3318 | 0 | "ReadGeometryFromMAPFile(): unsupported geometry type %d (0x%2.2x)", |
3319 | 0 | m_nMapInfoType, m_nMapInfoType); |
3320 | 0 | return -1; |
3321 | 0 | } |
3322 | | |
3323 | 87 | SetGeometryDirectly(poGeometry); |
3324 | | |
3325 | 87 | SetMBR(dXMin, dYMin, dXMax, dYMax); |
3326 | 87 | SetIntMBR(poObjHdr->m_nMinX, poObjHdr->m_nMinY, poObjHdr->m_nMaxX, |
3327 | 87 | poObjHdr->m_nMaxY); |
3328 | | |
3329 | | /* Return a ref to coord block so that caller can continue reading |
3330 | | * after the end of this object (used by TABCollection and index splitting) |
3331 | | */ |
3332 | 87 | if (ppoCoordBlock) |
3333 | 3 | *ppoCoordBlock = poCoordBlock; |
3334 | | |
3335 | 87 | return 0; |
3336 | 113 | } |
3337 | | |
3338 | | /********************************************************************** |
3339 | | * TABRegion::WriteGeometryToMAPFile() |
3340 | | * |
3341 | | * Write the geometry and representation (color, etc...) part of the |
3342 | | * feature to the .MAP object pointed to by poMAPFile. |
3343 | | * |
3344 | | * It is assumed that poMAPFile currently points to a valid map object. |
3345 | | * |
3346 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
3347 | | * been called. |
3348 | | **********************************************************************/ |
3349 | | int TABRegion::WriteGeometryToMAPFile( |
3350 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
3351 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
3352 | | TABMAPCoordBlock **ppoCoordBlock /*=NULL*/) |
3353 | 3.90k | { |
3354 | | /*----------------------------------------------------------------- |
3355 | | * We assume that ValidateMapInfoType() was called already and that |
3356 | | * the type in poObjHdr->m_nType is valid. |
3357 | | *----------------------------------------------------------------*/ |
3358 | 3.90k | CPLAssert(m_nMapInfoType == poObjHdr->m_nType); |
3359 | | |
3360 | | /*----------------------------------------------------------------- |
3361 | | * Fetch and validate geometry |
3362 | | *----------------------------------------------------------------*/ |
3363 | 3.90k | OGRGeometry *poGeom = GetGeometryRef(); |
3364 | 3.90k | TABMAPCoordBlock *poCoordBlock = nullptr; |
3365 | | |
3366 | 3.90k | if ((m_nMapInfoType == TAB_GEOM_REGION || |
3367 | 3.54k | m_nMapInfoType == TAB_GEOM_REGION_C || |
3368 | 0 | m_nMapInfoType == TAB_GEOM_V450_REGION || |
3369 | 0 | m_nMapInfoType == TAB_GEOM_V450_REGION_C || |
3370 | 0 | m_nMapInfoType == TAB_GEOM_V800_REGION || |
3371 | 0 | m_nMapInfoType == TAB_GEOM_V800_REGION_C) && |
3372 | 3.90k | poGeom && |
3373 | 3.90k | (wkbFlatten(poGeom->getGeometryType()) == wkbPolygon || |
3374 | 779 | wkbFlatten(poGeom->getGeometryType()) == wkbMultiPolygon)) |
3375 | 3.90k | { |
3376 | | /*============================================================= |
3377 | | * REGIONs are similar to PLINE MULTIPLE |
3378 | | * |
3379 | | * We accept both OGRPolygons (with one or multiple rings) and |
3380 | | * OGRMultiPolygons as input. |
3381 | | *============================================================*/ |
3382 | 3.90k | GBool bCompressed = poObjHdr->IsCompressedType(); |
3383 | | |
3384 | | /*------------------------------------------------------------- |
3385 | | * Process geometry first... |
3386 | | *------------------------------------------------------------*/ |
3387 | 3.90k | if (ppoCoordBlock != nullptr && *ppoCoordBlock != nullptr) |
3388 | 0 | poCoordBlock = *ppoCoordBlock; |
3389 | 3.90k | else |
3390 | 3.90k | poCoordBlock = poMapFile->GetCurCoordBlock(); |
3391 | 3.90k | poCoordBlock->StartNewFeature(); |
3392 | 3.90k | GInt32 nCoordBlockPtr = poCoordBlock->GetCurAddress(); |
3393 | 3.90k | poCoordBlock->SetComprCoordOrigin(m_nComprOrgX, m_nComprOrgY); |
3394 | | |
3395 | | #ifdef TABDUMP |
3396 | | printf(/*ok*/ |
3397 | | "TABRegion::WriteGeometryToMAPFile(): ComprOrgX,Y= (%d,%d)\n", |
3398 | | m_nComprOrgX, m_nComprOrgY); |
3399 | | #endif |
3400 | | /*------------------------------------------------------------- |
3401 | | * Fetch total number of rings and build array of coord |
3402 | | * sections headers. |
3403 | | *------------------------------------------------------------*/ |
3404 | 3.90k | TABMAPCoordSecHdr *pasSecHdrs = nullptr; |
3405 | 3.90k | int numRingsTotal = ComputeNumRings(&pasSecHdrs, poMapFile); |
3406 | 3.90k | int nStatus = numRingsTotal == 0 ? -1 : 0; |
3407 | | |
3408 | | /*------------------------------------------------------------- |
3409 | | * Write the Coord. Section Header |
3410 | | *------------------------------------------------------------*/ |
3411 | 3.90k | const int nVersion = TAB_GEOM_GET_VERSION(m_nMapInfoType); |
3412 | | |
3413 | 3.90k | if (nStatus == 0) |
3414 | 2.89k | nStatus = poCoordBlock->WriteCoordSecHdrs(nVersion, numRingsTotal, |
3415 | 2.89k | pasSecHdrs, bCompressed); |
3416 | | |
3417 | 3.90k | CPLFree(pasSecHdrs); |
3418 | 3.90k | pasSecHdrs = nullptr; |
3419 | | |
3420 | 3.90k | if (nStatus != 0) |
3421 | 1.01k | return nStatus; // Error has already been reported. |
3422 | | |
3423 | | /*------------------------------------------------------------- |
3424 | | * Go through all the rings in our OGRMultiPolygon or OGRPolygon |
3425 | | * to write the coordinates themselves... |
3426 | | *------------------------------------------------------------*/ |
3427 | | |
3428 | 2.89k | GInt32 nX = 0, nY = 0; |
3429 | 6.42k | for (int iRing = 0; iRing < numRingsTotal; iRing++) |
3430 | 3.53k | { |
3431 | 3.53k | OGRLinearRing *poRing = GetRingRef(iRing); |
3432 | 3.53k | if (poRing == nullptr) |
3433 | 0 | { |
3434 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
3435 | 0 | "TABRegion: Object Geometry contains NULL rings!"); |
3436 | 0 | return -1; |
3437 | 0 | } |
3438 | | |
3439 | 3.53k | int numPoints = poRing->getNumPoints(); |
3440 | | |
3441 | 5.25k | for (int i = 0; nStatus == 0 && i < numPoints; i++) |
3442 | 1.72k | { |
3443 | 1.72k | poMapFile->Coordsys2Int(poRing->getX(i), poRing->getY(i), nX, |
3444 | 1.72k | nY); |
3445 | 1.72k | if ((nStatus = |
3446 | 1.72k | poCoordBlock->WriteIntCoord(nX, nY, bCompressed)) != 0) |
3447 | 0 | { |
3448 | | // Failed ... error message has already been produced |
3449 | 0 | return nStatus; |
3450 | 0 | } |
3451 | 1.72k | } |
3452 | 3.53k | } /* for iRing*/ |
3453 | | |
3454 | 2.89k | GUInt32 nCoordDataSize = poCoordBlock->GetFeatureDataSize(); |
3455 | | |
3456 | | /*------------------------------------------------------------- |
3457 | | * ... and finally copy info to poObjHdr |
3458 | | *------------------------------------------------------------*/ |
3459 | 2.89k | TABMAPObjPLine *poPLineHdr = cpl::down_cast<TABMAPObjPLine *>(poObjHdr); |
3460 | | |
3461 | 2.89k | poPLineHdr->m_nCoordBlockPtr = nCoordBlockPtr; |
3462 | 2.89k | poPLineHdr->m_nCoordDataSize = nCoordDataSize; |
3463 | 2.89k | poPLineHdr->m_numLineSections = numRingsTotal; |
3464 | | |
3465 | 2.89k | poPLineHdr->m_bSmooth = m_bSmooth; |
3466 | | |
3467 | | // MBR |
3468 | 2.89k | poPLineHdr->SetMBR(m_nXMin, m_nYMin, m_nXMax, m_nYMax); |
3469 | | |
3470 | | // Region center/label point |
3471 | 2.89k | double dX = 0.0; |
3472 | 2.89k | double dY = 0.0; |
3473 | 2.89k | if (GetCenter(dX, dY) != -1) |
3474 | 2.89k | { |
3475 | 2.89k | poMapFile->Coordsys2Int(dX, dY, poPLineHdr->m_nLabelX, |
3476 | 2.89k | poPLineHdr->m_nLabelY); |
3477 | 2.89k | } |
3478 | 0 | else |
3479 | 0 | { |
3480 | 0 | poPLineHdr->m_nLabelX = m_nComprOrgX; |
3481 | 0 | poPLineHdr->m_nLabelY = m_nComprOrgY; |
3482 | 0 | } |
3483 | | |
3484 | | // Compressed coordinate origin (useful only in compressed case!) |
3485 | 2.89k | poPLineHdr->m_nComprOrgX = m_nComprOrgX; |
3486 | 2.89k | poPLineHdr->m_nComprOrgY = m_nComprOrgY; |
3487 | | |
3488 | 2.89k | if (!bCoordBlockDataOnly) |
3489 | 2.89k | { |
3490 | 2.89k | m_nPenDefIndex = poMapFile->WritePenDef(&m_sPenDef); |
3491 | 2.89k | poPLineHdr->m_nPenId = |
3492 | 2.89k | static_cast<GByte>(m_nPenDefIndex); // Pen index |
3493 | | |
3494 | 2.89k | m_nBrushDefIndex = poMapFile->WriteBrushDef(&m_sBrushDef); |
3495 | 2.89k | poPLineHdr->m_nBrushId = |
3496 | 2.89k | static_cast<GByte>(m_nBrushDefIndex); // Brush index |
3497 | 2.89k | } |
3498 | 2.89k | } |
3499 | 0 | else |
3500 | 0 | { |
3501 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
3502 | 0 | "TABRegion: Object contains an invalid Geometry!"); |
3503 | 0 | return -1; |
3504 | 0 | } |
3505 | | |
3506 | 2.89k | if (CPLGetLastErrorType() == CE_Failure) |
3507 | 0 | return -1; |
3508 | | |
3509 | | /* Return a ref to coord block so that caller can continue writing |
3510 | | * after the end of this object (used by index splitting) |
3511 | | */ |
3512 | 2.89k | if (ppoCoordBlock) |
3513 | 0 | *ppoCoordBlock = poCoordBlock; |
3514 | | |
3515 | 2.89k | return 0; |
3516 | 2.89k | } |
3517 | | |
3518 | | /********************************************************************** |
3519 | | * TABRegion::GetNumRings() |
3520 | | * |
3521 | | * Return the total number of rings in this object making it look like |
3522 | | * all parts of the OGRMultiPolygon (or OGRPolygon) are a single collection |
3523 | | * of rings... hides the complexity of handling OGRMultiPolygons vs |
3524 | | * OGRPolygons, etc. |
3525 | | * |
3526 | | * Returns 0 if the geometry contained in the object is invalid or missing. |
3527 | | **********************************************************************/ |
3528 | | int TABRegion::GetNumRings() |
3529 | 3.94k | { |
3530 | 3.94k | return ComputeNumRings(nullptr, nullptr); |
3531 | 3.94k | } |
3532 | | |
3533 | | int TABRegion::ComputeNumRings(TABMAPCoordSecHdr **ppasSecHdrs, |
3534 | | TABMAPFile *poMapFile) |
3535 | 7.84k | { |
3536 | 7.84k | int numRingsTotal = 0; |
3537 | 7.84k | int iLastSect = 0; |
3538 | | |
3539 | 7.84k | if (ppasSecHdrs) |
3540 | 3.90k | *ppasSecHdrs = nullptr; |
3541 | | |
3542 | 7.84k | OGRGeometry *poGeom = GetGeometryRef(); |
3543 | | |
3544 | 7.84k | if (poGeom && (wkbFlatten(poGeom->getGeometryType()) == wkbPolygon || |
3545 | 1.56k | wkbFlatten(poGeom->getGeometryType()) == wkbMultiPolygon)) |
3546 | 7.84k | { |
3547 | | /*------------------------------------------------------------- |
3548 | | * Calculate total number of rings... |
3549 | | *------------------------------------------------------------*/ |
3550 | 7.84k | if (wkbFlatten(poGeom->getGeometryType()) == wkbMultiPolygon) |
3551 | 1.56k | { |
3552 | 1.56k | for (auto &&poPolygon : *(poGeom->toMultiPolygon())) |
3553 | 1.08k | { |
3554 | 1.08k | numRingsTotal += poPolygon->getNumInteriorRings() + 1; |
3555 | | |
3556 | 1.08k | if (ppasSecHdrs && poMapFile) |
3557 | 541 | { |
3558 | 541 | if (AppendSecHdrs(poPolygon, *ppasSecHdrs, poMapFile, |
3559 | 541 | iLastSect) != 0) |
3560 | 13 | return 0; // An error happened, return count=0 |
3561 | 541 | } |
3562 | 1.08k | } // for |
3563 | 1.56k | } |
3564 | 6.28k | else |
3565 | 6.28k | { |
3566 | 6.28k | OGRPolygon *poPolygon = poGeom->toPolygon(); |
3567 | 6.28k | numRingsTotal = poPolygon->getNumInteriorRings() + 1; |
3568 | | |
3569 | 6.28k | if (ppasSecHdrs && poMapFile) |
3570 | 3.12k | { |
3571 | 3.12k | if (AppendSecHdrs(poPolygon, *ppasSecHdrs, poMapFile, |
3572 | 3.12k | iLastSect) != 0) |
3573 | 759 | return 0; // An error happened, return count=0 |
3574 | 3.12k | } |
3575 | 6.28k | } |
3576 | 7.84k | } |
3577 | | |
3578 | | /*----------------------------------------------------------------- |
3579 | | * If we're generating section header blocks, then init the |
3580 | | * coordinate offset values. |
3581 | | * |
3582 | | * In calculation of nDataOffset, we have to take into account that |
3583 | | * V450 header section uses int32 instead of int16 for numVertices |
3584 | | * and we add another 2 bytes to align with a 4 bytes boundary. |
3585 | | *------------------------------------------------------------*/ |
3586 | 7.07k | const int nTotalHdrSizeUncompressed = |
3587 | 7.07k | (m_nMapInfoType == TAB_GEOM_V450_REGION || |
3588 | 7.07k | m_nMapInfoType == TAB_GEOM_V450_REGION_C || |
3589 | 7.07k | m_nMapInfoType == TAB_GEOM_V800_REGION || |
3590 | 7.07k | m_nMapInfoType == TAB_GEOM_V800_REGION_C) |
3591 | 7.07k | ? 28 * numRingsTotal |
3592 | 7.07k | : 24 * numRingsTotal; |
3593 | | |
3594 | 7.07k | if (ppasSecHdrs) |
3595 | 3.13k | { |
3596 | 3.13k | int numPointsTotal = 0; |
3597 | 3.13k | CPLAssert(iLastSect == numRingsTotal); |
3598 | 6.66k | for (int iRing = 0; iRing < numRingsTotal; iRing++) |
3599 | 3.53k | { |
3600 | 3.53k | (*ppasSecHdrs)[iRing].nDataOffset = |
3601 | 3.53k | nTotalHdrSizeUncompressed + numPointsTotal * 4 * 2; |
3602 | 3.53k | (*ppasSecHdrs)[iRing].nVertexOffset = numPointsTotal; |
3603 | | |
3604 | 3.53k | numPointsTotal += (*ppasSecHdrs)[iRing].numVertices; |
3605 | 3.53k | } |
3606 | 3.13k | } |
3607 | | |
3608 | 7.07k | return numRingsTotal; |
3609 | 7.84k | } |
3610 | | |
3611 | | /********************************************************************** |
3612 | | * TABRegion::AppendSecHdrs() |
3613 | | * |
3614 | | * (Private method) |
3615 | | * |
3616 | | * Add a TABMAPCoordSecHdr for each ring in the specified polygon. |
3617 | | **********************************************************************/ |
3618 | | int TABRegion::AppendSecHdrs(OGRPolygon *poPolygon, |
3619 | | TABMAPCoordSecHdr *&pasSecHdrs, |
3620 | | TABMAPFile *poMapFile, int &iLastRing) |
3621 | 3.66k | { |
3622 | | /*------------------------------------------------------------- |
3623 | | * Add a pasSecHdrs[] entry for each ring in this polygon. |
3624 | | * Note that the structs won't be fully initialized. |
3625 | | *------------------------------------------------------------*/ |
3626 | 3.66k | int numRingsInPolygon = poPolygon->getNumInteriorRings() + 1; |
3627 | | |
3628 | 3.66k | pasSecHdrs = static_cast<TABMAPCoordSecHdr *>( |
3629 | 3.66k | CPLRealloc(pasSecHdrs, (iLastRing + numRingsInPolygon) * |
3630 | 3.66k | sizeof(TABMAPCoordSecHdr))); |
3631 | | |
3632 | 7.20k | for (int iRing = 0; iRing < numRingsInPolygon; iRing++) |
3633 | 4.30k | { |
3634 | 4.30k | OGRLinearRing *poRing = nullptr; |
3635 | 4.30k | OGREnvelope sEnvelope; |
3636 | | |
3637 | 4.30k | if (iRing == 0) |
3638 | 3.66k | poRing = poPolygon->getExteriorRing(); |
3639 | 645 | else |
3640 | 645 | poRing = poPolygon->getInteriorRing(iRing - 1); |
3641 | | |
3642 | 4.30k | if (poRing == nullptr) |
3643 | 772 | { |
3644 | 772 | CPLError(CE_Failure, CPLE_AssertionFailed, |
3645 | 772 | "Assertion Failed: Encountered NULL ring in OGRPolygon"); |
3646 | 772 | return -1; |
3647 | 772 | } |
3648 | | |
3649 | 3.53k | poRing->getEnvelope(&sEnvelope); |
3650 | | |
3651 | 3.53k | pasSecHdrs[iLastRing].numVertices = poRing->getNumPoints(); |
3652 | | |
3653 | 3.53k | if (iRing == 0) |
3654 | 2.89k | pasSecHdrs[iLastRing].numHoles = numRingsInPolygon - 1; |
3655 | 645 | else |
3656 | 645 | pasSecHdrs[iLastRing].numHoles = 0; |
3657 | | |
3658 | 3.53k | poMapFile->Coordsys2Int(sEnvelope.MinX, sEnvelope.MinY, |
3659 | 3.53k | pasSecHdrs[iLastRing].nXMin, |
3660 | 3.53k | pasSecHdrs[iLastRing].nYMin); |
3661 | 3.53k | poMapFile->Coordsys2Int(sEnvelope.MaxX, sEnvelope.MaxY, |
3662 | 3.53k | pasSecHdrs[iLastRing].nXMax, |
3663 | 3.53k | pasSecHdrs[iLastRing].nYMax); |
3664 | | |
3665 | 3.53k | iLastRing++; |
3666 | 3.53k | } /* for iRing*/ |
3667 | | |
3668 | 2.89k | return 0; |
3669 | 3.66k | } |
3670 | | |
3671 | | /********************************************************************** |
3672 | | * TABRegion::GetRingRef() |
3673 | | * |
3674 | | * Returns a reference to the specified ring number making it look like |
3675 | | * all parts of the OGRMultiPolygon (or OGRPolygon) are a single collection |
3676 | | * of rings... hides the complexity of handling OGRMultiPolygons vs |
3677 | | * OGRPolygons, etc. |
3678 | | * |
3679 | | * Returns NULL if the geometry contained in the object is invalid or |
3680 | | * missing or if the specified ring index is invalid. |
3681 | | **********************************************************************/ |
3682 | | OGRLinearRing *TABRegion::GetRingRef(int nRequestedRingIndex) |
3683 | 7.91k | { |
3684 | 7.91k | OGRLinearRing *poRing = nullptr; |
3685 | | |
3686 | 7.91k | OGRGeometry *poGeom = GetGeometryRef(); |
3687 | | |
3688 | 7.91k | if (poGeom && (wkbFlatten(poGeom->getGeometryType()) == wkbPolygon || |
3689 | 1.06k | wkbFlatten(poGeom->getGeometryType()) == wkbMultiPolygon)) |
3690 | 7.91k | { |
3691 | | /*------------------------------------------------------------- |
3692 | | * Establish number of polygons based on geometry type |
3693 | | *------------------------------------------------------------*/ |
3694 | 7.91k | OGRMultiPolygon *poMultiPolygon = nullptr; |
3695 | 7.91k | int iCurRing = 0; |
3696 | 7.91k | int numOGRPolygons = 0; |
3697 | | |
3698 | 7.91k | if (wkbFlatten(poGeom->getGeometryType()) == wkbMultiPolygon) |
3699 | 1.06k | { |
3700 | 1.06k | poMultiPolygon = poGeom->toMultiPolygon(); |
3701 | 1.06k | numOGRPolygons = poMultiPolygon->getNumGeometries(); |
3702 | 1.06k | } |
3703 | 6.84k | else |
3704 | 6.84k | { |
3705 | 6.84k | numOGRPolygons = 1; |
3706 | 6.84k | } |
3707 | | |
3708 | | /*------------------------------------------------------------- |
3709 | | * Loop through polygons until we find the requested ring. |
3710 | | *------------------------------------------------------------*/ |
3711 | 7.91k | iCurRing = 0; |
3712 | 15.8k | for (int iPoly = 0; poRing == nullptr && iPoly < numOGRPolygons; |
3713 | 7.91k | iPoly++) |
3714 | 7.91k | { |
3715 | 7.91k | OGRPolygon *poPolygon = nullptr; |
3716 | 7.91k | if (poMultiPolygon) |
3717 | 1.06k | poPolygon = poMultiPolygon->getGeometryRef(iPoly); |
3718 | 6.84k | else |
3719 | 6.84k | poPolygon = poGeom->toPolygon(); |
3720 | | |
3721 | 7.91k | int numIntRings = poPolygon->getNumInteriorRings(); |
3722 | | |
3723 | 7.91k | if (iCurRing == nRequestedRingIndex) |
3724 | 6.59k | { |
3725 | 6.59k | poRing = poPolygon->getExteriorRing(); |
3726 | 6.59k | } |
3727 | 1.32k | else if (nRequestedRingIndex > iCurRing && |
3728 | 1.32k | nRequestedRingIndex - (iCurRing + 1) < numIntRings) |
3729 | 1.32k | { |
3730 | 1.32k | poRing = poPolygon->getInteriorRing(nRequestedRingIndex - |
3731 | 1.32k | (iCurRing + 1)); |
3732 | 1.32k | } |
3733 | 7.91k | iCurRing += numIntRings + 1; |
3734 | 7.91k | } |
3735 | 7.91k | } |
3736 | | |
3737 | 7.91k | return poRing; |
3738 | 7.91k | } |
3739 | | |
3740 | | /********************************************************************** |
3741 | | * TABRegion::RingIsHole() |
3742 | | * |
3743 | | * Return false if the requested ring index is the first of a polygon |
3744 | | **********************************************************************/ |
3745 | | GBool TABRegion::IsInteriorRing(int nRequestedRingIndex) |
3746 | 0 | { |
3747 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
3748 | |
|
3749 | 0 | if (poGeom && (wkbFlatten(poGeom->getGeometryType()) == wkbPolygon || |
3750 | 0 | wkbFlatten(poGeom->getGeometryType()) == wkbMultiPolygon)) |
3751 | 0 | { |
3752 | | /*------------------------------------------------------------- |
3753 | | * Establish number of polygons based on geometry type |
3754 | | *------------------------------------------------------------*/ |
3755 | 0 | OGRMultiPolygon *poMultiPolygon = nullptr; |
3756 | 0 | int iCurRing = 0; |
3757 | 0 | int numOGRPolygons = 0; |
3758 | |
|
3759 | 0 | if (wkbFlatten(poGeom->getGeometryType()) == wkbMultiPolygon) |
3760 | 0 | { |
3761 | 0 | poMultiPolygon = poGeom->toMultiPolygon(); |
3762 | 0 | numOGRPolygons = poMultiPolygon->getNumGeometries(); |
3763 | 0 | } |
3764 | 0 | else |
3765 | 0 | { |
3766 | 0 | numOGRPolygons = 1; |
3767 | 0 | } |
3768 | | |
3769 | | /*------------------------------------------------------------- |
3770 | | * Loop through polygons until we find the requested ring. |
3771 | | *------------------------------------------------------------*/ |
3772 | 0 | iCurRing = 0; |
3773 | 0 | for (int iPoly = 0; iPoly < numOGRPolygons; iPoly++) |
3774 | 0 | { |
3775 | 0 | OGRPolygon *poPolygon = nullptr; |
3776 | 0 | if (poMultiPolygon) |
3777 | 0 | poPolygon = poMultiPolygon->getGeometryRef(iPoly); |
3778 | 0 | else |
3779 | 0 | poPolygon = poGeom->toPolygon(); |
3780 | |
|
3781 | 0 | int numIntRings = poPolygon->getNumInteriorRings(); |
3782 | |
|
3783 | 0 | if (iCurRing == nRequestedRingIndex) |
3784 | 0 | { |
3785 | 0 | return FALSE; |
3786 | 0 | } |
3787 | 0 | else if (nRequestedRingIndex > iCurRing && |
3788 | 0 | nRequestedRingIndex - (iCurRing + 1) < numIntRings) |
3789 | 0 | { |
3790 | 0 | return TRUE; |
3791 | 0 | } |
3792 | 0 | iCurRing += numIntRings + 1; |
3793 | 0 | } |
3794 | 0 | } |
3795 | | |
3796 | 0 | return FALSE; |
3797 | 0 | } |
3798 | | |
3799 | | /********************************************************************** |
3800 | | * TABRegion::GetStyleString() const |
3801 | | * |
3802 | | * Return style string for this feature. |
3803 | | * |
3804 | | * Style String is built only once during the first call to GetStyleString(). |
3805 | | **********************************************************************/ |
3806 | | const char *TABRegion::GetStyleString() const |
3807 | 0 | { |
3808 | 0 | if (m_pszStyleString == nullptr) |
3809 | 0 | { |
3810 | | // Since GetPen/BrushStyleString() use CPLSPrintf(), we need |
3811 | | // to use temporary buffers |
3812 | 0 | char *pszPen = CPLStrdup(GetPenStyleString()); |
3813 | 0 | char *pszBrush = CPLStrdup(GetBrushStyleString()); |
3814 | |
|
3815 | 0 | m_pszStyleString = CPLStrdup(CPLSPrintf("%s;%s", pszBrush, pszPen)); |
3816 | |
|
3817 | 0 | CPLFree(pszPen); |
3818 | 0 | CPLFree(pszBrush); |
3819 | 0 | } |
3820 | |
|
3821 | 0 | return m_pszStyleString; |
3822 | 0 | } |
3823 | | |
3824 | | /********************************************************************** |
3825 | | * TABRegion::DumpMIF() |
3826 | | * |
3827 | | * Dump feature geometry in a format similar to .MIF REGIONs. |
3828 | | **********************************************************************/ |
3829 | | void TABRegion::DumpMIF(FILE *fpOut /*=NULL*/) |
3830 | 0 | { |
3831 | 0 | if (fpOut == nullptr) |
3832 | 0 | fpOut = stdout; |
3833 | | |
3834 | | /*----------------------------------------------------------------- |
3835 | | * Fetch and validate geometry |
3836 | | *----------------------------------------------------------------*/ |
3837 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
3838 | 0 | if (poGeom && (wkbFlatten(poGeom->getGeometryType()) == wkbPolygon || |
3839 | 0 | wkbFlatten(poGeom->getGeometryType()) == wkbMultiPolygon)) |
3840 | 0 | { |
3841 | | /*------------------------------------------------------------- |
3842 | | * Generate output for region |
3843 | | * |
3844 | | * Note that we want to handle both OGRPolygons and OGRMultiPolygons |
3845 | | * that's why we use the GetNumRings()/GetRingRef() interface. |
3846 | | *------------------------------------------------------------*/ |
3847 | 0 | int numRingsTotal = GetNumRings(); |
3848 | |
|
3849 | 0 | fprintf(fpOut, "REGION %d\n", numRingsTotal); |
3850 | |
|
3851 | 0 | for (int iRing = 0; iRing < numRingsTotal; iRing++) |
3852 | 0 | { |
3853 | 0 | OGRLinearRing *poRing = GetRingRef(iRing); |
3854 | |
|
3855 | 0 | if (poRing == nullptr) |
3856 | 0 | { |
3857 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
3858 | 0 | "TABRegion: Object Geometry contains NULL rings!"); |
3859 | 0 | return; |
3860 | 0 | } |
3861 | | |
3862 | 0 | const int numPoints = poRing->getNumPoints(); |
3863 | 0 | fprintf(fpOut, " %d\n", numPoints); |
3864 | 0 | for (int i = 0; i < numPoints; i++) |
3865 | 0 | fprintf(fpOut, "%.15g %.15g\n", poRing->getX(i), |
3866 | 0 | poRing->getY(i)); |
3867 | 0 | } |
3868 | 0 | } |
3869 | 0 | else |
3870 | 0 | { |
3871 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
3872 | 0 | "TABRegion: Missing or Invalid Geometry!"); |
3873 | 0 | return; |
3874 | 0 | } |
3875 | | |
3876 | 0 | if (m_bCenterIsSet) |
3877 | 0 | fprintf(fpOut, "Center %.15g %.15g\n", m_dCenterX, m_dCenterY); |
3878 | | |
3879 | | // Finish with PEN/BRUSH/etc. clauses |
3880 | 0 | DumpPenDef(); |
3881 | 0 | DumpBrushDef(); |
3882 | |
|
3883 | 0 | fflush(fpOut); |
3884 | 0 | } |
3885 | | |
3886 | | /********************************************************************** |
3887 | | * TABRegion::GetCenter() |
3888 | | * |
3889 | | * Returns the center/label point of the region. |
3890 | | * Compute one using OGRPolygonLabelPoint() if it was not explicitly set |
3891 | | * before. |
3892 | | * |
3893 | | * Returns 0 on success, -1 on error. |
3894 | | **********************************************************************/ |
3895 | | int TABRegion::GetCenter(double &dX, double &dY) |
3896 | 2.89k | { |
3897 | 2.89k | if (!m_bCenterIsSet) |
3898 | 2.89k | { |
3899 | | /*------------------------------------------------------------- |
3900 | | * Calculate label point. If we have a multipolygon then we use |
3901 | | * the first OGRPolygon in the feature to calculate the point. |
3902 | | *------------------------------------------------------------*/ |
3903 | 2.89k | OGRGeometry *poGeom = GetGeometryRef(); |
3904 | 2.89k | if (poGeom == nullptr) |
3905 | 0 | return -1; |
3906 | | |
3907 | 2.89k | OGRPolygon *poPolygon = nullptr; |
3908 | | |
3909 | 2.89k | if (wkbFlatten(poGeom->getGeometryType()) == wkbMultiPolygon) |
3910 | 528 | { |
3911 | 528 | OGRMultiPolygon *poMultiPolygon = poGeom->toMultiPolygon(); |
3912 | 528 | if (poMultiPolygon->getNumGeometries() > 0) |
3913 | 528 | poPolygon = poMultiPolygon->getGeometryRef(0); |
3914 | 528 | } |
3915 | 2.36k | else if (wkbFlatten(poGeom->getGeometryType()) == wkbPolygon) |
3916 | 2.36k | { |
3917 | 2.36k | poPolygon = poGeom->toPolygon(); |
3918 | 2.36k | } |
3919 | | |
3920 | 2.89k | OGRPoint oLabelPoint; |
3921 | 2.89k | if (poPolygon != nullptr && |
3922 | 2.89k | OGRPolygonLabelPoint(poPolygon, &oLabelPoint) == OGRERR_NONE) |
3923 | 226 | { |
3924 | 226 | m_dCenterX = oLabelPoint.getX(); |
3925 | 226 | m_dCenterY = oLabelPoint.getY(); |
3926 | 226 | } |
3927 | 2.66k | else |
3928 | 2.66k | { |
3929 | 2.66k | OGREnvelope oEnv; |
3930 | 2.66k | poGeom->getEnvelope(&oEnv); |
3931 | 2.66k | m_dCenterX = (oEnv.MaxX + oEnv.MinX) / 2.0; |
3932 | 2.66k | m_dCenterY = (oEnv.MaxY + oEnv.MinY) / 2.0; |
3933 | 2.66k | } |
3934 | | |
3935 | 2.89k | m_bCenterIsSet = TRUE; |
3936 | 2.89k | } |
3937 | | |
3938 | 2.89k | if (!m_bCenterIsSet) |
3939 | 0 | return -1; |
3940 | | |
3941 | 2.89k | dX = m_dCenterX; |
3942 | 2.89k | dY = m_dCenterY; |
3943 | 2.89k | return 0; |
3944 | 2.89k | } |
3945 | | |
3946 | | /********************************************************************** |
3947 | | * TABRegion::SetCenter() |
3948 | | * |
3949 | | * Set the X,Y coordinates to use as center/label point for the region. |
3950 | | **********************************************************************/ |
3951 | | void TABRegion::SetCenter(double dX, double dY) |
3952 | 7.62k | { |
3953 | 7.62k | m_dCenterX = dX; |
3954 | 7.62k | m_dCenterY = dY; |
3955 | 7.62k | m_bCenterIsSet = TRUE; |
3956 | 7.62k | } |
3957 | | |
3958 | | /*===================================================================== |
3959 | | * class TABRectangle |
3960 | | *====================================================================*/ |
3961 | | |
3962 | | /********************************************************************** |
3963 | | * TABRectangle::TABRectangle() |
3964 | | * |
3965 | | * Constructor. |
3966 | | **********************************************************************/ |
3967 | | TABRectangle::TABRectangle(const OGRFeatureDefn *poDefnIn) |
3968 | 59.2k | : TABFeature(poDefnIn), m_bRoundCorners(FALSE), m_dRoundXRadius(0.0), |
3969 | 59.2k | m_dRoundYRadius(0.0) |
3970 | 59.2k | { |
3971 | 59.2k | } |
3972 | | |
3973 | | /********************************************************************** |
3974 | | * TABRectangle::~TABRectangle() |
3975 | | * |
3976 | | * Destructor. |
3977 | | **********************************************************************/ |
3978 | | TABRectangle::~TABRectangle() |
3979 | 59.2k | { |
3980 | 59.2k | } |
3981 | | |
3982 | | /********************************************************************** |
3983 | | * TABRectangle::CloneTABFeature() |
3984 | | * |
3985 | | * Duplicate feature, including stuff specific to each TABFeature type. |
3986 | | * |
3987 | | * This method calls the generic TABFeature::CopyTABFeatureBase() and |
3988 | | * then copies any members specific to its own type. |
3989 | | **********************************************************************/ |
3990 | | TABFeature * |
3991 | | TABRectangle::CloneTABFeature(const OGRFeatureDefn *poNewDefn /*=NULL*/) |
3992 | 0 | { |
3993 | | /*----------------------------------------------------------------- |
3994 | | * Alloc new feature and copy the base stuff |
3995 | | *----------------------------------------------------------------*/ |
3996 | 0 | TABRectangle *poNew = |
3997 | 0 | new TABRectangle(poNewDefn ? poNewDefn : GetDefnRef()); |
3998 | |
|
3999 | 0 | CopyTABFeatureBase(poNew); |
4000 | | |
4001 | | /*----------------------------------------------------------------- |
4002 | | * And members specific to this class |
4003 | | *----------------------------------------------------------------*/ |
4004 | | // ITABFeaturePen |
4005 | 0 | *(poNew->GetPenDefRef()) = *GetPenDefRef(); |
4006 | | |
4007 | | // ITABFeatureBrush |
4008 | 0 | *(poNew->GetBrushDefRef()) = *GetBrushDefRef(); |
4009 | |
|
4010 | 0 | poNew->m_bRoundCorners = m_bRoundCorners; |
4011 | 0 | poNew->m_dRoundXRadius = m_dRoundXRadius; |
4012 | 0 | poNew->m_dRoundYRadius = m_dRoundYRadius; |
4013 | |
|
4014 | 0 | return poNew; |
4015 | 0 | } |
4016 | | |
4017 | | /********************************************************************** |
4018 | | * TABRectangle::ValidateMapInfoType() |
4019 | | * |
4020 | | * Check the feature's geometry part and return the corresponding |
4021 | | * mapinfo object type code. The m_nMapInfoType member will also |
4022 | | * be updated for further calls to GetMapInfoType(); |
4023 | | * |
4024 | | * Returns TAB_GEOM_NONE if the geometry is not compatible with what |
4025 | | * is expected for this object class. |
4026 | | **********************************************************************/ |
4027 | | TABGeomType TABRectangle::ValidateMapInfoType(TABMAPFile *poMapFile /*=NULL*/) |
4028 | 0 | { |
4029 | | /*----------------------------------------------------------------- |
4030 | | * Fetch and validate geometry |
4031 | | *----------------------------------------------------------------*/ |
4032 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
4033 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPolygon) |
4034 | 0 | { |
4035 | 0 | if (m_bRoundCorners && m_dRoundXRadius != 0.0 && m_dRoundYRadius != 0.0) |
4036 | 0 | m_nMapInfoType = TAB_GEOM_ROUNDRECT; |
4037 | 0 | else |
4038 | 0 | m_nMapInfoType = TAB_GEOM_RECT; |
4039 | 0 | } |
4040 | 0 | else |
4041 | 0 | { |
4042 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
4043 | 0 | "TABRectangle: Missing or Invalid Geometry!"); |
4044 | 0 | m_nMapInfoType = TAB_GEOM_NONE; |
4045 | 0 | } |
4046 | | |
4047 | | /*----------------------------------------------------------------- |
4048 | | * Decide if coordinates should be compressed or not. |
4049 | | *----------------------------------------------------------------*/ |
4050 | | // __TODO__ For now we always write uncompressed for this class... |
4051 | | // ValidateCoordType(poMapFile); |
4052 | 0 | UpdateMBR(poMapFile); |
4053 | |
|
4054 | 0 | return m_nMapInfoType; |
4055 | 0 | } |
4056 | | |
4057 | | /********************************************************************** |
4058 | | * TABRectangle::UpdateMBR() |
4059 | | * |
4060 | | * Update the feature MBR members using the geometry |
4061 | | * |
4062 | | * Returns 0 on success, or -1 if there is no geometry in object |
4063 | | **********************************************************************/ |
4064 | | int TABRectangle::UpdateMBR(TABMAPFile *poMapFile /*=NULL*/) |
4065 | 0 | { |
4066 | 0 | OGREnvelope sEnvelope; |
4067 | | |
4068 | | /*----------------------------------------------------------------- |
4069 | | * Fetch and validate geometry |
4070 | | *----------------------------------------------------------------*/ |
4071 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
4072 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPolygon) |
4073 | 0 | poGeom->getEnvelope(&sEnvelope); |
4074 | 0 | else |
4075 | 0 | { |
4076 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
4077 | 0 | "TABRectangle: Missing or Invalid Geometry!"); |
4078 | 0 | return -1; |
4079 | 0 | } |
4080 | | |
4081 | | /*----------------------------------------------------------------- |
4082 | | * Note that we will simply use the rectangle's MBR and don't really |
4083 | | * read the polygon geometry... this should be OK unless the |
4084 | | * polygon geometry was not really a rectangle. |
4085 | | *----------------------------------------------------------------*/ |
4086 | 0 | m_dXMin = sEnvelope.MinX; |
4087 | 0 | m_dYMin = sEnvelope.MinY; |
4088 | 0 | m_dXMax = sEnvelope.MaxX; |
4089 | 0 | m_dYMax = sEnvelope.MaxY; |
4090 | |
|
4091 | 0 | if (poMapFile) |
4092 | 0 | { |
4093 | 0 | poMapFile->Coordsys2Int(m_dXMin, m_dYMin, m_nXMin, m_nYMin); |
4094 | 0 | poMapFile->Coordsys2Int(m_dXMax, m_dYMax, m_nXMax, m_nYMax); |
4095 | 0 | } |
4096 | |
|
4097 | 0 | return 0; |
4098 | 0 | } |
4099 | | |
4100 | | /********************************************************************** |
4101 | | * TABRectangle::ReadGeometryFromMAPFile() |
4102 | | * |
4103 | | * Fill the geometry and representation (color, etc...) part of the |
4104 | | * feature from the contents of the .MAP object pointed to by poMAPFile. |
4105 | | * |
4106 | | * It is assumed that poMAPFile currently points to the beginning of |
4107 | | * a map object. |
4108 | | * |
4109 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
4110 | | * been called. |
4111 | | **********************************************************************/ |
4112 | | int TABRectangle::ReadGeometryFromMAPFile( |
4113 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
4114 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
4115 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
4116 | 83 | { |
4117 | | /* Nothing to do for bCoordBlockDataOnly (used by index splitting) */ |
4118 | 83 | if (bCoordBlockDataOnly) |
4119 | 0 | return 0; |
4120 | | |
4121 | | /*----------------------------------------------------------------- |
4122 | | * Fetch and validate geometry type |
4123 | | *----------------------------------------------------------------*/ |
4124 | 83 | m_nMapInfoType = poObjHdr->m_nType; |
4125 | | |
4126 | 83 | if (m_nMapInfoType != TAB_GEOM_RECT && m_nMapInfoType != TAB_GEOM_RECT_C && |
4127 | 42 | m_nMapInfoType != TAB_GEOM_ROUNDRECT && |
4128 | 0 | m_nMapInfoType != TAB_GEOM_ROUNDRECT_C) |
4129 | 0 | { |
4130 | 0 | CPLError( |
4131 | 0 | CE_Failure, CPLE_AssertionFailed, |
4132 | 0 | "ReadGeometryFromMAPFile(): unsupported geometry type %d (0x%2.2x)", |
4133 | 0 | m_nMapInfoType, m_nMapInfoType); |
4134 | 0 | return -1; |
4135 | 0 | } |
4136 | | |
4137 | | /*----------------------------------------------------------------- |
4138 | | * Read object information |
4139 | | *----------------------------------------------------------------*/ |
4140 | 83 | TABMAPObjRectEllipse *poRectHdr = |
4141 | 83 | cpl::down_cast<TABMAPObjRectEllipse *>(poObjHdr); |
4142 | | |
4143 | | // Read the corners radius |
4144 | | |
4145 | 83 | if (m_nMapInfoType == TAB_GEOM_ROUNDRECT || |
4146 | 41 | m_nMapInfoType == TAB_GEOM_ROUNDRECT_C) |
4147 | 42 | { |
4148 | | // Read the corner's diameters |
4149 | 42 | poMapFile->Int2CoordsysDist(poRectHdr->m_nCornerWidth, |
4150 | 42 | poRectHdr->m_nCornerHeight, m_dRoundXRadius, |
4151 | 42 | m_dRoundYRadius); |
4152 | | |
4153 | | // Divide by 2 since we store the corner's radius |
4154 | 42 | m_dRoundXRadius /= 2.0; |
4155 | 42 | m_dRoundYRadius /= 2.0; |
4156 | | |
4157 | 42 | m_bRoundCorners = TRUE; |
4158 | 42 | } |
4159 | 41 | else |
4160 | 41 | { |
4161 | 41 | m_bRoundCorners = FALSE; |
4162 | 41 | m_dRoundXRadius = 0.0; |
4163 | 41 | m_dRoundYRadius = 0.0; |
4164 | 41 | } |
4165 | | |
4166 | | // A rectangle is defined by its MBR |
4167 | | |
4168 | 83 | double dXMin = 0.0; |
4169 | 83 | double dYMin = 0.0; |
4170 | 83 | double dXMax = 0.0; |
4171 | 83 | double dYMax = 0.0; |
4172 | 83 | poMapFile->Int2Coordsys(poRectHdr->m_nMinX, poRectHdr->m_nMinY, dXMin, |
4173 | 83 | dYMin); |
4174 | 83 | poMapFile->Int2Coordsys(poRectHdr->m_nMaxX, poRectHdr->m_nMaxY, dXMax, |
4175 | 83 | dYMax); |
4176 | | |
4177 | 83 | m_nPenDefIndex = poRectHdr->m_nPenId; // Pen index |
4178 | 83 | poMapFile->ReadPenDef(m_nPenDefIndex, &m_sPenDef); |
4179 | | |
4180 | 83 | m_nBrushDefIndex = poRectHdr->m_nBrushId; // Brush index |
4181 | 83 | poMapFile->ReadBrushDef(m_nBrushDefIndex, &m_sBrushDef); |
4182 | | |
4183 | | /*----------------------------------------------------------------- |
4184 | | * Call SetMBR() and GetMBR() now to make sure that min values are |
4185 | | * really smaller than max values. |
4186 | | *----------------------------------------------------------------*/ |
4187 | 83 | SetMBR(dXMin, dYMin, dXMax, dYMax); |
4188 | 83 | GetMBR(dXMin, dYMin, dXMax, dYMax); |
4189 | | |
4190 | | /* Copy int MBR to feature class members */ |
4191 | 83 | SetIntMBR(poObjHdr->m_nMinX, poObjHdr->m_nMinY, poObjHdr->m_nMaxX, |
4192 | 83 | poObjHdr->m_nMaxY); |
4193 | | |
4194 | | /*----------------------------------------------------------------- |
4195 | | * Create and fill geometry object |
4196 | | *----------------------------------------------------------------*/ |
4197 | 83 | OGRPolygon *poPolygon = new OGRPolygon; |
4198 | 83 | OGRLinearRing *poRing = new OGRLinearRing(); |
4199 | 83 | if (m_bRoundCorners && m_dRoundXRadius != 0.0 && m_dRoundYRadius != 0.0) |
4200 | 38 | { |
4201 | | /*------------------------------------------------------------- |
4202 | | * For rounded rectangles, we generate arcs with 45 line |
4203 | | * segments for each corner. We start with lower-left corner |
4204 | | * and proceed counterclockwise |
4205 | | * We also have to make sure that rounding radius is not too |
4206 | | * large for the MBR in the generated polygon... however, we |
4207 | | * always return the true X/Y radius (not adjusted) since this |
4208 | | * is the way MapInfo seems to do it when a radius bigger than |
4209 | | * the MBR is passed from TBA to MIF. |
4210 | | *------------------------------------------------------------*/ |
4211 | 38 | const double dXRadius = |
4212 | 38 | std::min(m_dRoundXRadius, (dXMax - dXMin) / 2.0); |
4213 | 38 | const double dYRadius = |
4214 | 38 | std::min(m_dRoundYRadius, (dYMax - dYMin) / 2.0); |
4215 | 38 | TABGenerateArc(poRing, 45, dXMin + dXRadius, dYMin + dYRadius, dXRadius, |
4216 | 38 | dYRadius, M_PI, 3.0 * M_PI / 2.0); |
4217 | 38 | TABGenerateArc(poRing, 45, dXMax - dXRadius, dYMin + dYRadius, dXRadius, |
4218 | 38 | dYRadius, 3.0 * M_PI / 2.0, 2.0 * M_PI); |
4219 | 38 | TABGenerateArc(poRing, 45, dXMax - dXRadius, dYMax - dYRadius, dXRadius, |
4220 | 38 | dYRadius, 0.0, M_PI / 2.0); |
4221 | 38 | TABGenerateArc(poRing, 45, dXMin + dXRadius, dYMax - dYRadius, dXRadius, |
4222 | 38 | dYRadius, M_PI / 2.0, M_PI); |
4223 | | |
4224 | 38 | TABCloseRing(poRing); |
4225 | 38 | } |
4226 | 45 | else |
4227 | 45 | { |
4228 | 45 | poRing->addPoint(dXMin, dYMin); |
4229 | 45 | poRing->addPoint(dXMax, dYMin); |
4230 | 45 | poRing->addPoint(dXMax, dYMax); |
4231 | 45 | poRing->addPoint(dXMin, dYMax); |
4232 | 45 | poRing->addPoint(dXMin, dYMin); |
4233 | 45 | } |
4234 | | |
4235 | 83 | poPolygon->addRingDirectly(poRing); |
4236 | 83 | SetGeometryDirectly(poPolygon); |
4237 | | |
4238 | 83 | return 0; |
4239 | 83 | } |
4240 | | |
4241 | | /********************************************************************** |
4242 | | * TABRectangle::WriteGeometryToMAPFile() |
4243 | | * |
4244 | | * Write the geometry and representation (color, etc...) part of the |
4245 | | * feature to the .MAP object pointed to by poMAPFile. |
4246 | | * |
4247 | | * It is assumed that poMAPFile currently points to a valid map object. |
4248 | | * |
4249 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
4250 | | * been called. |
4251 | | **********************************************************************/ |
4252 | | int TABRectangle::WriteGeometryToMAPFile( |
4253 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
4254 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
4255 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
4256 | 0 | { |
4257 | | /* Nothing to do for bCoordBlockDataOnly (used by index splitting) */ |
4258 | 0 | if (bCoordBlockDataOnly) |
4259 | 0 | return 0; |
4260 | | |
4261 | | /*----------------------------------------------------------------- |
4262 | | * We assume that ValidateMapInfoType() was called already and that |
4263 | | * the type in poObjHdr->m_nType is valid. |
4264 | | *----------------------------------------------------------------*/ |
4265 | 0 | CPLAssert(m_nMapInfoType == poObjHdr->m_nType); |
4266 | | |
4267 | | /*----------------------------------------------------------------- |
4268 | | * Fetch and validate geometry and update MBR |
4269 | | * Note that we will simply use the geometry's MBR and don't really |
4270 | | * read the polygon geometry... this should be OK unless the |
4271 | | * polygon geometry was not really a rectangle. |
4272 | | *----------------------------------------------------------------*/ |
4273 | 0 | if (UpdateMBR(poMapFile) != 0) |
4274 | 0 | return -1; /* Error already reported */ |
4275 | | |
4276 | | /*----------------------------------------------------------------- |
4277 | | * Copy object information |
4278 | | *----------------------------------------------------------------*/ |
4279 | 0 | TABMAPObjRectEllipse *poRectHdr = |
4280 | 0 | cpl::down_cast<TABMAPObjRectEllipse *>(poObjHdr); |
4281 | |
|
4282 | 0 | if (m_nMapInfoType == TAB_GEOM_ROUNDRECT || |
4283 | 0 | m_nMapInfoType == TAB_GEOM_ROUNDRECT_C) |
4284 | 0 | { |
4285 | 0 | poMapFile->Coordsys2IntDist( |
4286 | 0 | m_dRoundXRadius * 2.0, m_dRoundYRadius * 2.0, |
4287 | 0 | poRectHdr->m_nCornerWidth, poRectHdr->m_nCornerHeight); |
4288 | 0 | } |
4289 | 0 | else |
4290 | 0 | { |
4291 | 0 | poRectHdr->m_nCornerWidth = 0; |
4292 | 0 | poRectHdr->m_nCornerHeight = 0; |
4293 | 0 | } |
4294 | | |
4295 | | // A rectangle is defined by its MBR (values were set in UpdateMBR()) |
4296 | 0 | poRectHdr->m_nMinX = m_nXMin; |
4297 | 0 | poRectHdr->m_nMinY = m_nYMin; |
4298 | 0 | poRectHdr->m_nMaxX = m_nXMax; |
4299 | 0 | poRectHdr->m_nMaxY = m_nYMax; |
4300 | |
|
4301 | 0 | m_nPenDefIndex = poMapFile->WritePenDef(&m_sPenDef); |
4302 | 0 | poRectHdr->m_nPenId = static_cast<GByte>(m_nPenDefIndex); // Pen index |
4303 | |
|
4304 | 0 | m_nBrushDefIndex = poMapFile->WriteBrushDef(&m_sBrushDef); |
4305 | 0 | poRectHdr->m_nBrushId = |
4306 | 0 | static_cast<GByte>(m_nBrushDefIndex); // Brush index |
4307 | |
|
4308 | 0 | if (CPLGetLastErrorType() == CE_Failure) |
4309 | 0 | return -1; |
4310 | | |
4311 | 0 | return 0; |
4312 | 0 | } |
4313 | | |
4314 | | /********************************************************************** |
4315 | | * TABRectangle::GetStyleString() const |
4316 | | * |
4317 | | * Return style string for this feature. |
4318 | | * |
4319 | | * Style String is built only once during the first call to GetStyleString(). |
4320 | | **********************************************************************/ |
4321 | | const char *TABRectangle::GetStyleString() const |
4322 | 0 | { |
4323 | 0 | if (m_pszStyleString == nullptr) |
4324 | 0 | { |
4325 | | // Since GetPen/BrushStyleString() use CPLSPrintf(), we need |
4326 | | // to use temporary buffers |
4327 | 0 | char *pszPen = CPLStrdup(GetPenStyleString()); |
4328 | 0 | char *pszBrush = CPLStrdup(GetBrushStyleString()); |
4329 | |
|
4330 | 0 | m_pszStyleString = CPLStrdup(CPLSPrintf("%s;%s", pszBrush, pszPen)); |
4331 | |
|
4332 | 0 | CPLFree(pszPen); |
4333 | 0 | CPLFree(pszBrush); |
4334 | 0 | } |
4335 | |
|
4336 | 0 | return m_pszStyleString; |
4337 | 0 | } |
4338 | | |
4339 | | /********************************************************************** |
4340 | | * TABRectangle::DumpMIF() |
4341 | | * |
4342 | | * Dump feature geometry in a format similar to .MIF REGIONs. |
4343 | | **********************************************************************/ |
4344 | | void TABRectangle::DumpMIF(FILE *fpOut /*=NULL*/) |
4345 | 0 | { |
4346 | 0 | if (fpOut == nullptr) |
4347 | 0 | fpOut = stdout; |
4348 | | |
4349 | | /*----------------------------------------------------------------- |
4350 | | * Output RECT or ROUNDRECT parameters |
4351 | | *----------------------------------------------------------------*/ |
4352 | 0 | double dXMin = 0.0; |
4353 | 0 | double dYMin = 0.0; |
4354 | 0 | double dXMax = 0.0; |
4355 | 0 | double dYMax = 0.0; |
4356 | 0 | GetMBR(dXMin, dYMin, dXMax, dYMax); |
4357 | |
|
4358 | 0 | if (m_bRoundCorners) |
4359 | 0 | fprintf(fpOut, "(ROUNDRECT %.15g %.15g %.15g %.15g %.15g %.15g)\n", |
4360 | 0 | dXMin, dYMin, dXMax, dYMax, m_dRoundXRadius, m_dRoundYRadius); |
4361 | 0 | else |
4362 | 0 | fprintf(fpOut, "(RECT %.15g %.15g %.15g %.15g)\n", dXMin, dYMin, dXMax, |
4363 | 0 | dYMax); |
4364 | | |
4365 | | /*----------------------------------------------------------------- |
4366 | | * Fetch and validate geometry |
4367 | | *----------------------------------------------------------------*/ |
4368 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
4369 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPolygon) |
4370 | 0 | { |
4371 | | /*------------------------------------------------------------- |
4372 | | * Generate rectangle output as a region |
4373 | | * We could also output as a RECT or ROUNDRECT in a real MIF generator |
4374 | | *------------------------------------------------------------*/ |
4375 | 0 | OGRPolygon *poPolygon = poGeom->toPolygon(); |
4376 | 0 | int numIntRings = poPolygon->getNumInteriorRings(); |
4377 | 0 | fprintf(fpOut, "REGION %d\n", numIntRings + 1); |
4378 | | // In this loop, iRing=-1 for the outer ring. |
4379 | 0 | for (int iRing = -1; iRing < numIntRings; iRing++) |
4380 | 0 | { |
4381 | 0 | OGRLinearRing *poRing = nullptr; |
4382 | |
|
4383 | 0 | if (iRing == -1) |
4384 | 0 | poRing = poPolygon->getExteriorRing(); |
4385 | 0 | else |
4386 | 0 | poRing = poPolygon->getInteriorRing(iRing); |
4387 | |
|
4388 | 0 | if (poRing == nullptr) |
4389 | 0 | { |
4390 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
4391 | 0 | "TABRectangle: Object Geometry contains NULL rings!"); |
4392 | 0 | return; |
4393 | 0 | } |
4394 | | |
4395 | 0 | const int numPoints = poRing->getNumPoints(); |
4396 | 0 | fprintf(fpOut, " %d\n", numPoints); |
4397 | 0 | for (int i = 0; i < numPoints; i++) |
4398 | 0 | fprintf(fpOut, "%.15g %.15g\n", poRing->getX(i), |
4399 | 0 | poRing->getY(i)); |
4400 | 0 | } |
4401 | 0 | } |
4402 | 0 | else |
4403 | 0 | { |
4404 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
4405 | 0 | "TABRectangle: Missing or Invalid Geometry!"); |
4406 | 0 | return; |
4407 | 0 | } |
4408 | | |
4409 | | // Finish with PEN/BRUSH/etc. clauses |
4410 | 0 | DumpPenDef(); |
4411 | 0 | DumpBrushDef(); |
4412 | |
|
4413 | 0 | fflush(fpOut); |
4414 | 0 | } |
4415 | | |
4416 | | /*===================================================================== |
4417 | | * class TABEllipse |
4418 | | *====================================================================*/ |
4419 | | |
4420 | | /********************************************************************** |
4421 | | * TABEllipse::TABEllipse() |
4422 | | * |
4423 | | * Constructor. |
4424 | | **********************************************************************/ |
4425 | | TABEllipse::TABEllipse(const OGRFeatureDefn *poDefnIn) |
4426 | 19.8k | : TABFeature(poDefnIn), m_dCenterX(0.0), m_dCenterY(0.0), m_dXRadius(0.0), |
4427 | 19.8k | m_dYRadius(0.0) |
4428 | 19.8k | { |
4429 | 19.8k | } |
4430 | | |
4431 | | /********************************************************************** |
4432 | | * TABEllipse::~TABEllipse() |
4433 | | * |
4434 | | * Destructor. |
4435 | | **********************************************************************/ |
4436 | | TABEllipse::~TABEllipse() |
4437 | 19.8k | { |
4438 | 19.8k | } |
4439 | | |
4440 | | /********************************************************************** |
4441 | | * TABEllipse::CloneTABFeature() |
4442 | | * |
4443 | | * Duplicate feature, including stuff specific to each TABFeature type. |
4444 | | * |
4445 | | * This method calls the generic TABFeature::CopyTABFeatureBase() and |
4446 | | * then copies any members specific to its own type. |
4447 | | **********************************************************************/ |
4448 | | TABFeature * |
4449 | | TABEllipse::CloneTABFeature(const OGRFeatureDefn *poNewDefn /*=NULL*/) |
4450 | 0 | { |
4451 | | /*----------------------------------------------------------------- |
4452 | | * Alloc new feature and copy the base stuff |
4453 | | *----------------------------------------------------------------*/ |
4454 | 0 | TABEllipse *poNew = new TABEllipse(poNewDefn ? poNewDefn : GetDefnRef()); |
4455 | |
|
4456 | 0 | CopyTABFeatureBase(poNew); |
4457 | | |
4458 | | /*----------------------------------------------------------------- |
4459 | | * And members specific to this class |
4460 | | *----------------------------------------------------------------*/ |
4461 | | // ITABFeaturePen |
4462 | 0 | *(poNew->GetPenDefRef()) = *GetPenDefRef(); |
4463 | | |
4464 | | // ITABFeatureBrush |
4465 | 0 | *(poNew->GetBrushDefRef()) = *GetBrushDefRef(); |
4466 | |
|
4467 | 0 | poNew->m_dCenterX = m_dCenterX; |
4468 | 0 | poNew->m_dCenterY = m_dCenterY; |
4469 | 0 | poNew->m_dXRadius = m_dXRadius; |
4470 | 0 | poNew->m_dYRadius = m_dYRadius; |
4471 | |
|
4472 | 0 | return poNew; |
4473 | 0 | } |
4474 | | |
4475 | | /********************************************************************** |
4476 | | * TABEllipse::ValidateMapInfoType() |
4477 | | * |
4478 | | * Check the feature's geometry part and return the corresponding |
4479 | | * mapinfo object type code. The m_nMapInfoType member will also |
4480 | | * be updated for further calls to GetMapInfoType(); |
4481 | | * |
4482 | | * Returns TAB_GEOM_NONE if the geometry is not compatible with what |
4483 | | * is expected for this object class. |
4484 | | **********************************************************************/ |
4485 | | TABGeomType TABEllipse::ValidateMapInfoType(TABMAPFile *poMapFile /*=NULL*/) |
4486 | 0 | { |
4487 | | /*----------------------------------------------------------------- |
4488 | | * Fetch and validate geometry |
4489 | | *----------------------------------------------------------------*/ |
4490 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
4491 | 0 | if ((poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPolygon) || |
4492 | 0 | (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint)) |
4493 | 0 | { |
4494 | 0 | m_nMapInfoType = TAB_GEOM_ELLIPSE; |
4495 | 0 | } |
4496 | 0 | else |
4497 | 0 | { |
4498 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
4499 | 0 | "TABEllipse: Missing or Invalid Geometry!"); |
4500 | 0 | m_nMapInfoType = TAB_GEOM_NONE; |
4501 | 0 | } |
4502 | | |
4503 | | /*----------------------------------------------------------------- |
4504 | | * Decide if coordinates should be compressed or not. |
4505 | | *----------------------------------------------------------------*/ |
4506 | | // __TODO__ For now we always write uncompressed for this class... |
4507 | | // ValidateCoordType(poMapFile); |
4508 | 0 | UpdateMBR(poMapFile); |
4509 | |
|
4510 | 0 | return m_nMapInfoType; |
4511 | 0 | } |
4512 | | |
4513 | | /********************************************************************** |
4514 | | * TABEllipse::UpdateMBR() |
4515 | | * |
4516 | | * Update the feature MBR members using the geometry |
4517 | | * |
4518 | | * Returns 0 on success, or -1 if there is no geometry in object |
4519 | | **********************************************************************/ |
4520 | | int TABEllipse::UpdateMBR(TABMAPFile *poMapFile /*=NULL*/) |
4521 | 0 | { |
4522 | 0 | OGREnvelope sEnvelope; |
4523 | | |
4524 | | /*----------------------------------------------------------------- |
4525 | | * Fetch and validate geometry... Polygon and point are accepted. |
4526 | | * Note that we will simply use the ellipse's MBR and don't really |
4527 | | * read the polygon geometry... this should be OK unless the |
4528 | | * polygon geometry was not really an ellipse. |
4529 | | *----------------------------------------------------------------*/ |
4530 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
4531 | 0 | if ((poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPolygon) || |
4532 | 0 | (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint)) |
4533 | 0 | poGeom->getEnvelope(&sEnvelope); |
4534 | 0 | else |
4535 | 0 | { |
4536 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
4537 | 0 | "TABEllipse: Missing or Invalid Geometry!"); |
4538 | 0 | return -1; |
4539 | 0 | } |
4540 | | |
4541 | | /*----------------------------------------------------------------- |
4542 | | * We use the center of the MBR as the ellipse center, and the |
4543 | | * X/Y radius to define the MBR size. If X/Y radius are null then |
4544 | | * we'll try to use the MBR to recompute them. |
4545 | | *----------------------------------------------------------------*/ |
4546 | 0 | const double dXCenter = (sEnvelope.MaxX + sEnvelope.MinX) / 2.0; |
4547 | 0 | const double dYCenter = (sEnvelope.MaxY + sEnvelope.MinY) / 2.0; |
4548 | 0 | if (m_dXRadius == 0.0 && m_dYRadius == 0.0) |
4549 | 0 | { |
4550 | 0 | m_dXRadius = std::abs(sEnvelope.MaxX - sEnvelope.MinX) / 2.0; |
4551 | 0 | m_dYRadius = std::abs(sEnvelope.MaxY - sEnvelope.MinY) / 2.0; |
4552 | 0 | } |
4553 | |
|
4554 | 0 | m_dXMin = dXCenter - m_dXRadius; |
4555 | 0 | m_dYMin = dYCenter - m_dYRadius; |
4556 | 0 | m_dXMax = dXCenter + m_dXRadius; |
4557 | 0 | m_dYMax = dYCenter + m_dYRadius; |
4558 | |
|
4559 | 0 | if (poMapFile) |
4560 | 0 | { |
4561 | 0 | poMapFile->Coordsys2Int(m_dXMin, m_dYMin, m_nXMin, m_nYMin); |
4562 | 0 | poMapFile->Coordsys2Int(m_dXMax, m_dYMax, m_nXMax, m_nYMax); |
4563 | 0 | } |
4564 | |
|
4565 | 0 | return 0; |
4566 | 0 | } |
4567 | | |
4568 | | /********************************************************************** |
4569 | | * TABEllipse::ReadGeometryFromMAPFile() |
4570 | | * |
4571 | | * Fill the geometry and representation (color, etc...) part of the |
4572 | | * feature from the contents of the .MAP object pointed to by poMAPFile. |
4573 | | * |
4574 | | * It is assumed that poMAPFile currently points to the beginning of |
4575 | | * a map object. |
4576 | | * |
4577 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
4578 | | * been called. |
4579 | | **********************************************************************/ |
4580 | | int TABEllipse::ReadGeometryFromMAPFile( |
4581 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
4582 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
4583 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
4584 | 37 | { |
4585 | | /* Nothing to do for bCoordBlockDataOnly (used by index splitting) */ |
4586 | 37 | if (bCoordBlockDataOnly) |
4587 | 0 | return 0; |
4588 | | |
4589 | | /*----------------------------------------------------------------- |
4590 | | * Fetch and validate geometry type |
4591 | | *----------------------------------------------------------------*/ |
4592 | 37 | m_nMapInfoType = poObjHdr->m_nType; |
4593 | | |
4594 | 37 | if (m_nMapInfoType != TAB_GEOM_ELLIPSE && |
4595 | 0 | m_nMapInfoType != TAB_GEOM_ELLIPSE_C) |
4596 | 0 | { |
4597 | 0 | CPLError( |
4598 | 0 | CE_Failure, CPLE_AssertionFailed, |
4599 | 0 | "ReadGeometryFromMAPFile(): unsupported geometry type %d (0x%2.2x)", |
4600 | 0 | m_nMapInfoType, m_nMapInfoType); |
4601 | 0 | return -1; |
4602 | 0 | } |
4603 | | |
4604 | | /*----------------------------------------------------------------- |
4605 | | * Read object information |
4606 | | *----------------------------------------------------------------*/ |
4607 | 37 | TABMAPObjRectEllipse *poRectHdr = |
4608 | 37 | cpl::down_cast<TABMAPObjRectEllipse *>(poObjHdr); |
4609 | | |
4610 | | // An ellipse is defined by its MBR |
4611 | | |
4612 | 37 | double dXMin = 0.0; |
4613 | 37 | double dYMin = 0.0; |
4614 | 37 | double dXMax = 0.0; |
4615 | 37 | double dYMax = 0.0; |
4616 | 37 | poMapFile->Int2Coordsys(poRectHdr->m_nMinX, poRectHdr->m_nMinY, dXMin, |
4617 | 37 | dYMin); |
4618 | 37 | poMapFile->Int2Coordsys(poRectHdr->m_nMaxX, poRectHdr->m_nMaxY, dXMax, |
4619 | 37 | dYMax); |
4620 | | |
4621 | 37 | m_nPenDefIndex = poRectHdr->m_nPenId; // Pen index |
4622 | 37 | poMapFile->ReadPenDef(m_nPenDefIndex, &m_sPenDef); |
4623 | | |
4624 | 37 | m_nBrushDefIndex = poRectHdr->m_nBrushId; // Brush index |
4625 | 37 | poMapFile->ReadBrushDef(m_nBrushDefIndex, &m_sBrushDef); |
4626 | | |
4627 | | /*----------------------------------------------------------------- |
4628 | | * Save info about the ellipse def. inside class members |
4629 | | *----------------------------------------------------------------*/ |
4630 | 37 | m_dCenterX = (dXMin + dXMax) / 2.0; |
4631 | 37 | m_dCenterY = (dYMin + dYMax) / 2.0; |
4632 | 37 | m_dXRadius = std::abs((dXMax - dXMin) / 2.0); |
4633 | 37 | m_dYRadius = std::abs((dYMax - dYMin) / 2.0); |
4634 | | |
4635 | 37 | SetMBR(dXMin, dYMin, dXMax, dYMax); |
4636 | | |
4637 | 37 | SetIntMBR(poObjHdr->m_nMinX, poObjHdr->m_nMinY, poObjHdr->m_nMaxX, |
4638 | 37 | poObjHdr->m_nMaxY); |
4639 | | |
4640 | | /*----------------------------------------------------------------- |
4641 | | * Create and fill geometry object |
4642 | | *----------------------------------------------------------------*/ |
4643 | 37 | OGRPolygon *poPolygon = new OGRPolygon; |
4644 | 37 | OGRLinearRing *poRing = new OGRLinearRing(); |
4645 | | |
4646 | | /*----------------------------------------------------------------- |
4647 | | * For the OGR geometry, we generate an ellipse with 2 degrees line |
4648 | | * segments. |
4649 | | *----------------------------------------------------------------*/ |
4650 | 37 | TABGenerateArc(poRing, 180, m_dCenterX, m_dCenterY, m_dXRadius, m_dYRadius, |
4651 | 37 | 0.0, 2.0 * M_PI); |
4652 | 37 | TABCloseRing(poRing); |
4653 | | |
4654 | 37 | poPolygon->addRingDirectly(poRing); |
4655 | 37 | SetGeometryDirectly(poPolygon); |
4656 | | |
4657 | 37 | return 0; |
4658 | 37 | } |
4659 | | |
4660 | | /********************************************************************** |
4661 | | * TABEllipse::WriteGeometryToMAPFile() |
4662 | | * |
4663 | | * Write the geometry and representation (color, etc...) part of the |
4664 | | * feature to the .MAP object pointed to by poMAPFile. |
4665 | | * |
4666 | | * It is assumed that poMAPFile currently points to a valid map object. |
4667 | | * |
4668 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
4669 | | * been called. |
4670 | | **********************************************************************/ |
4671 | | int TABEllipse::WriteGeometryToMAPFile( |
4672 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
4673 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
4674 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
4675 | 0 | { |
4676 | | /* Nothing to do for bCoordBlockDataOnly (used by index splitting) */ |
4677 | 0 | if (bCoordBlockDataOnly) |
4678 | 0 | return 0; |
4679 | | |
4680 | | /*----------------------------------------------------------------- |
4681 | | * We assume that ValidateMapInfoType() was called already and that |
4682 | | * the type in poObjHdr->m_nType is valid. |
4683 | | *----------------------------------------------------------------*/ |
4684 | 0 | CPLAssert(m_nMapInfoType == poObjHdr->m_nType); |
4685 | | |
4686 | | /*----------------------------------------------------------------- |
4687 | | * Fetch and validate geometry... Polygon and point are accepted. |
4688 | | * Note that we will simply use the ellipse's MBR and don't really |
4689 | | * read the polygon geometry... this should be OK unless the |
4690 | | * polygon geometry was not really an ellipse. |
4691 | | * |
4692 | | * We use the center of the MBR as the ellipse center, and the |
4693 | | * X/Y radius to define the MBR size. If X/Y radius are null then |
4694 | | * we'll try to use the MBR to recompute them. |
4695 | | *----------------------------------------------------------------*/ |
4696 | 0 | if (UpdateMBR(poMapFile) != 0) |
4697 | 0 | return -1; /* Error already reported */ |
4698 | | |
4699 | | /*----------------------------------------------------------------- |
4700 | | * Copy object information |
4701 | | *----------------------------------------------------------------*/ |
4702 | 0 | TABMAPObjRectEllipse *poRectHdr = |
4703 | 0 | cpl::down_cast<TABMAPObjRectEllipse *>(poObjHdr); |
4704 | | |
4705 | | // Reset RoundRect Corner members... just in case (unused for ellipse) |
4706 | 0 | poRectHdr->m_nCornerWidth = 0; |
4707 | 0 | poRectHdr->m_nCornerHeight = 0; |
4708 | | |
4709 | | // An ellipse is defined by its MBR (values were set in UpdateMBR()) |
4710 | 0 | poRectHdr->m_nMinX = m_nXMin; |
4711 | 0 | poRectHdr->m_nMinY = m_nYMin; |
4712 | 0 | poRectHdr->m_nMaxX = m_nXMax; |
4713 | 0 | poRectHdr->m_nMaxY = m_nYMax; |
4714 | |
|
4715 | 0 | m_nPenDefIndex = poMapFile->WritePenDef(&m_sPenDef); |
4716 | 0 | poRectHdr->m_nPenId = static_cast<GByte>(m_nPenDefIndex); // Pen index |
4717 | |
|
4718 | 0 | m_nBrushDefIndex = poMapFile->WriteBrushDef(&m_sBrushDef); |
4719 | 0 | poRectHdr->m_nBrushId = |
4720 | 0 | static_cast<GByte>(m_nBrushDefIndex); // Brush index |
4721 | |
|
4722 | 0 | if (CPLGetLastErrorType() == CE_Failure) |
4723 | 0 | return -1; |
4724 | | |
4725 | 0 | return 0; |
4726 | 0 | } |
4727 | | |
4728 | | /********************************************************************** |
4729 | | * TABEllipse::GetStyleString() const |
4730 | | * |
4731 | | * Return style string for this feature. |
4732 | | * |
4733 | | * Style String is built only once during the first call to GetStyleString(). |
4734 | | **********************************************************************/ |
4735 | | const char *TABEllipse::GetStyleString() const |
4736 | 0 | { |
4737 | 0 | if (m_pszStyleString == nullptr) |
4738 | 0 | { |
4739 | | // Since GetPen/BrushStyleString() use CPLSPrintf(), we need |
4740 | | // to use temporary buffers |
4741 | 0 | char *pszPen = CPLStrdup(GetPenStyleString()); |
4742 | 0 | char *pszBrush = CPLStrdup(GetBrushStyleString()); |
4743 | |
|
4744 | 0 | m_pszStyleString = CPLStrdup(CPLSPrintf("%s;%s", pszBrush, pszPen)); |
4745 | |
|
4746 | 0 | CPLFree(pszPen); |
4747 | 0 | CPLFree(pszBrush); |
4748 | 0 | } |
4749 | |
|
4750 | 0 | return m_pszStyleString; |
4751 | 0 | } |
4752 | | |
4753 | | /********************************************************************** |
4754 | | * TABEllipse::DumpMIF() |
4755 | | * |
4756 | | * Dump feature geometry in a format similar to .MIF REGIONs. |
4757 | | **********************************************************************/ |
4758 | | void TABEllipse::DumpMIF(FILE *fpOut /*=NULL*/) |
4759 | 0 | { |
4760 | 0 | if (fpOut == nullptr) |
4761 | 0 | fpOut = stdout; |
4762 | | |
4763 | | /*----------------------------------------------------------------- |
4764 | | * Output ELLIPSE parameters |
4765 | | *----------------------------------------------------------------*/ |
4766 | 0 | double dXMin = 0.0; |
4767 | 0 | double dYMin = 0.0; |
4768 | 0 | double dXMax = 0.0; |
4769 | 0 | double dYMax = 0.0; |
4770 | 0 | GetMBR(dXMin, dYMin, dXMax, dYMax); |
4771 | 0 | fprintf(fpOut, "(ELLIPSE %.15g %.15g %.15g %.15g)\n", dXMin, dYMin, dXMax, |
4772 | 0 | dYMax); |
4773 | | |
4774 | | /*----------------------------------------------------------------- |
4775 | | * Fetch and validate geometry |
4776 | | *----------------------------------------------------------------*/ |
4777 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
4778 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPolygon) |
4779 | 0 | { |
4780 | | /*------------------------------------------------------------- |
4781 | | * Generate ellipse output as a region |
4782 | | * We could also output as an ELLIPSE in a real MIF generator |
4783 | | *------------------------------------------------------------*/ |
4784 | 0 | OGRPolygon *poPolygon = poGeom->toPolygon(); |
4785 | 0 | int numIntRings = poPolygon->getNumInteriorRings(); |
4786 | 0 | fprintf(fpOut, "REGION %d\n", numIntRings + 1); |
4787 | | // In this loop, iRing=-1 for the outer ring. |
4788 | 0 | for (int iRing = -1; iRing < numIntRings; iRing++) |
4789 | 0 | { |
4790 | 0 | OGRLinearRing *poRing = nullptr; |
4791 | |
|
4792 | 0 | if (iRing == -1) |
4793 | 0 | poRing = poPolygon->getExteriorRing(); |
4794 | 0 | else |
4795 | 0 | poRing = poPolygon->getInteriorRing(iRing); |
4796 | |
|
4797 | 0 | if (poRing == nullptr) |
4798 | 0 | { |
4799 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
4800 | 0 | "TABEllipse: Object Geometry contains NULL rings!"); |
4801 | 0 | return; |
4802 | 0 | } |
4803 | | |
4804 | 0 | int numPoints = poRing->getNumPoints(); |
4805 | 0 | fprintf(fpOut, " %d\n", numPoints); |
4806 | 0 | for (int i = 0; i < numPoints; i++) |
4807 | 0 | fprintf(fpOut, "%.15g %.15g\n", poRing->getX(i), |
4808 | 0 | poRing->getY(i)); |
4809 | 0 | } |
4810 | 0 | } |
4811 | 0 | else |
4812 | 0 | { |
4813 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
4814 | 0 | "TABEllipse: Missing or Invalid Geometry!"); |
4815 | 0 | return; |
4816 | 0 | } |
4817 | | |
4818 | | // Finish with PEN/BRUSH/etc. clauses |
4819 | 0 | DumpPenDef(); |
4820 | 0 | DumpBrushDef(); |
4821 | |
|
4822 | 0 | fflush(fpOut); |
4823 | 0 | } |
4824 | | |
4825 | | /*===================================================================== |
4826 | | * class TABArc |
4827 | | *====================================================================*/ |
4828 | | |
4829 | | /********************************************************************** |
4830 | | * TABArc::TABArc() |
4831 | | * |
4832 | | * Constructor. |
4833 | | **********************************************************************/ |
4834 | | TABArc::TABArc(const OGRFeatureDefn *poDefnIn) |
4835 | 37.0k | : TABFeature(poDefnIn), m_dStartAngle(0.0), m_dEndAngle(0.0), |
4836 | 37.0k | m_dCenterX(0.0), m_dCenterY(0.0), m_dXRadius(0.0), m_dYRadius(0.0) |
4837 | 37.0k | { |
4838 | 37.0k | } |
4839 | | |
4840 | | /********************************************************************** |
4841 | | * TABArc::~TABArc() |
4842 | | * |
4843 | | * Destructor. |
4844 | | **********************************************************************/ |
4845 | | TABArc::~TABArc() |
4846 | 37.0k | { |
4847 | 37.0k | } |
4848 | | |
4849 | | /********************************************************************** |
4850 | | * TABArc::CloneTABFeature() |
4851 | | * |
4852 | | * Duplicate feature, including stuff specific to each TABFeature type. |
4853 | | * |
4854 | | * This method calls the generic TABFeature::CopyTABFeatureBase() and |
4855 | | * then copies any members specific to its own type. |
4856 | | **********************************************************************/ |
4857 | | TABFeature *TABArc::CloneTABFeature(const OGRFeatureDefn *poNewDefn /*=NULL*/) |
4858 | 0 | { |
4859 | | /*----------------------------------------------------------------- |
4860 | | * Alloc new feature and copy the base stuff |
4861 | | *----------------------------------------------------------------*/ |
4862 | 0 | TABArc *poNew = new TABArc(poNewDefn ? poNewDefn : GetDefnRef()); |
4863 | |
|
4864 | 0 | CopyTABFeatureBase(poNew); |
4865 | | |
4866 | | /*----------------------------------------------------------------- |
4867 | | * And members specific to this class |
4868 | | *----------------------------------------------------------------*/ |
4869 | | // ITABFeaturePen |
4870 | 0 | *(poNew->GetPenDefRef()) = *GetPenDefRef(); |
4871 | |
|
4872 | 0 | poNew->SetStartAngle(GetStartAngle()); |
4873 | 0 | poNew->SetEndAngle(GetEndAngle()); |
4874 | |
|
4875 | 0 | poNew->m_dCenterX = m_dCenterX; |
4876 | 0 | poNew->m_dCenterY = m_dCenterY; |
4877 | 0 | poNew->m_dXRadius = m_dXRadius; |
4878 | 0 | poNew->m_dYRadius = m_dYRadius; |
4879 | |
|
4880 | 0 | return poNew; |
4881 | 0 | } |
4882 | | |
4883 | | /********************************************************************** |
4884 | | * TABArc::ValidateMapInfoType() |
4885 | | * |
4886 | | * Check the feature's geometry part and return the corresponding |
4887 | | * mapinfo object type code. The m_nMapInfoType member will also |
4888 | | * be updated for further calls to GetMapInfoType(); |
4889 | | * |
4890 | | * Returns TAB_GEOM_NONE if the geometry is not compatible with what |
4891 | | * is expected for this object class. |
4892 | | **********************************************************************/ |
4893 | | TABGeomType TABArc::ValidateMapInfoType(TABMAPFile *poMapFile /*=NULL*/) |
4894 | 0 | { |
4895 | | /*----------------------------------------------------------------- |
4896 | | * Fetch and validate geometry |
4897 | | *----------------------------------------------------------------*/ |
4898 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
4899 | 0 | if ((poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbLineString) || |
4900 | 0 | (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint)) |
4901 | 0 | { |
4902 | 0 | m_nMapInfoType = TAB_GEOM_ARC; |
4903 | 0 | } |
4904 | 0 | else |
4905 | 0 | { |
4906 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
4907 | 0 | "TABArc: Missing or Invalid Geometry!"); |
4908 | 0 | m_nMapInfoType = TAB_GEOM_NONE; |
4909 | 0 | } |
4910 | | |
4911 | | /*----------------------------------------------------------------- |
4912 | | * Decide if coordinates should be compressed or not. |
4913 | | *----------------------------------------------------------------*/ |
4914 | | // __TODO__ For now we always write uncompressed for this class... |
4915 | | // ValidateCoordType(poMapFile); |
4916 | 0 | UpdateMBR(poMapFile); |
4917 | |
|
4918 | 0 | return m_nMapInfoType; |
4919 | 0 | } |
4920 | | |
4921 | | /********************************************************************** |
4922 | | * TABArc::UpdateMBR() |
4923 | | * |
4924 | | * Update the feature MBR members using the geometry |
4925 | | * |
4926 | | * Returns 0 on success, or -1 if there is no geometry in object |
4927 | | **********************************************************************/ |
4928 | | int TABArc::UpdateMBR(TABMAPFile *poMapFile /*=NULL*/) |
4929 | 0 | { |
4930 | 0 | OGREnvelope sEnvelope; |
4931 | |
|
4932 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
4933 | 0 | if ((poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbLineString)) |
4934 | 0 | { |
4935 | | /*------------------------------------------------------------- |
4936 | | * POLYGON geometry: |
4937 | | * Note that we will simply use the ellipse's MBR and don't really |
4938 | | * read the polygon geometry... this should be OK unless the |
4939 | | * polygon geometry was not really an ellipse. |
4940 | | * In the case of a polygon geometry. the m_dCenterX/Y values MUST |
4941 | | * have been set by the caller. |
4942 | | *------------------------------------------------------------*/ |
4943 | 0 | poGeom->getEnvelope(&sEnvelope); |
4944 | 0 | } |
4945 | 0 | else if ((poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint)) |
4946 | 0 | { |
4947 | | /*------------------------------------------------------------- |
4948 | | * In the case of a POINT GEOMETRY, we will make sure the |
4949 | | * feature's m_dCenterX/Y are in sync with the point's X,Y coords. |
4950 | | * |
4951 | | * In this case we have to reconstruct the arc inside a temporary |
4952 | | * geometry object in order to find its real MBR. |
4953 | | *------------------------------------------------------------*/ |
4954 | 0 | OGRPoint *poPoint = poGeom->toPoint(); |
4955 | 0 | m_dCenterX = poPoint->getX(); |
4956 | 0 | m_dCenterY = poPoint->getY(); |
4957 | |
|
4958 | 0 | OGRLineString oTmpLine; |
4959 | 0 | int numPts = 0; |
4960 | 0 | if (m_dEndAngle < m_dStartAngle) |
4961 | 0 | numPts = static_cast<int>( |
4962 | 0 | std::abs(((m_dEndAngle + 360) - m_dStartAngle) / 2) + 1); |
4963 | 0 | else |
4964 | 0 | numPts = static_cast<int>( |
4965 | 0 | std::abs((m_dEndAngle - m_dStartAngle) / 2) + 1); |
4966 | 0 | numPts = std::max(2, numPts); |
4967 | |
|
4968 | 0 | TABGenerateArc(&oTmpLine, numPts, m_dCenterX, m_dCenterY, m_dXRadius, |
4969 | 0 | m_dYRadius, m_dStartAngle * M_PI / 180.0, |
4970 | 0 | m_dEndAngle * M_PI / 180.0); |
4971 | |
|
4972 | 0 | oTmpLine.getEnvelope(&sEnvelope); |
4973 | 0 | } |
4974 | 0 | else |
4975 | 0 | { |
4976 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
4977 | 0 | "TABArc: Missing or Invalid Geometry!"); |
4978 | 0 | return -1; |
4979 | 0 | } |
4980 | | |
4981 | | // Update the Arc's MBR |
4982 | 0 | m_dXMin = sEnvelope.MinX; |
4983 | 0 | m_dYMin = sEnvelope.MinY; |
4984 | 0 | m_dXMax = sEnvelope.MaxX; |
4985 | 0 | m_dYMax = sEnvelope.MaxY; |
4986 | |
|
4987 | 0 | if (poMapFile) |
4988 | 0 | { |
4989 | 0 | poMapFile->Coordsys2Int(m_dXMin, m_dYMin, m_nXMin, m_nYMin); |
4990 | 0 | poMapFile->Coordsys2Int(m_dXMax, m_dYMax, m_nXMax, m_nYMax); |
4991 | 0 | } |
4992 | |
|
4993 | 0 | return 0; |
4994 | 0 | } |
4995 | | |
4996 | | /********************************************************************** |
4997 | | * TABArc::ReadGeometryFromMAPFile() |
4998 | | * |
4999 | | * Fill the geometry and representation (color, etc...) part of the |
5000 | | * feature from the contents of the .MAP object pointed to by poMAPFile. |
5001 | | * |
5002 | | * It is assumed that poMAPFile currently points to the beginning of |
5003 | | * a map object. |
5004 | | * |
5005 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
5006 | | * been called. |
5007 | | **********************************************************************/ |
5008 | | int TABArc::ReadGeometryFromMAPFile(TABMAPFile *poMapFile, |
5009 | | TABMAPObjHdr *poObjHdr, |
5010 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
5011 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
5012 | 74 | { |
5013 | | /* Nothing to do for bCoordBlockDataOnly (used by index splitting) */ |
5014 | 74 | if (bCoordBlockDataOnly) |
5015 | 0 | return 0; |
5016 | | |
5017 | | /*----------------------------------------------------------------- |
5018 | | * Fetch and validate geometry type |
5019 | | *----------------------------------------------------------------*/ |
5020 | 74 | m_nMapInfoType = poObjHdr->m_nType; |
5021 | | |
5022 | 74 | if (m_nMapInfoType != TAB_GEOM_ARC && m_nMapInfoType != TAB_GEOM_ARC_C) |
5023 | 0 | { |
5024 | 0 | CPLError( |
5025 | 0 | CE_Failure, CPLE_AssertionFailed, |
5026 | 0 | "ReadGeometryFromMAPFile(): unsupported geometry type %d (0x%2.2x)", |
5027 | 0 | m_nMapInfoType, m_nMapInfoType); |
5028 | 0 | return -1; |
5029 | 0 | } |
5030 | | |
5031 | | /*----------------------------------------------------------------- |
5032 | | * Read object information |
5033 | | *----------------------------------------------------------------*/ |
5034 | 74 | TABMAPObjArc *poArcHdr = cpl::down_cast<TABMAPObjArc *>(poObjHdr); |
5035 | | |
5036 | | /*------------------------------------------------------------- |
5037 | | * Start/End angles |
5038 | | * Since the angles are specified for integer coordinates, and |
5039 | | * that these coordinates can have the X axis reversed, we have to |
5040 | | * adjust the angle values for the change in the X axis |
5041 | | * direction. |
5042 | | * |
5043 | | * This should be necessary only when X axis is flipped. |
5044 | | * __TODO__ Why is order of start/end values reversed as well??? |
5045 | | *------------------------------------------------------------*/ |
5046 | | |
5047 | | /*------------------------------------------------------------- |
5048 | | * OK, Arc angles again!!!!!!!!!!!! |
5049 | | * After some tests in 1999-11, it appeared that the angle values |
5050 | | * ALWAYS had to be flipped (read order= end angle followed by |
5051 | | * start angle), no matter which quadrant the file is in. |
5052 | | * This does not make any sense, so I suspect that there is something |
5053 | | * that we are missing here! |
5054 | | * |
5055 | | * 2000-01-14.... Again!!! Based on some sample data files: |
5056 | | * File Ver Quadr ReflXAxis Read_Order Adjust_Angle |
5057 | | * test_symb.tab 300 2 1 end,start X=yes Y=no |
5058 | | * alltypes.tab: 300 1 0 start,end X=no Y=no |
5059 | | * arcs.tab: 300 2 0 end,start X=yes Y=no |
5060 | | * |
5061 | | * Until we prove it wrong, the rule would be: |
5062 | | * -> Quadrant 1 and 3, angles order = start, end |
5063 | | * -> Quadrant 2 and 4, angles order = end, start |
5064 | | * + Always adjust angles for x and y axis based on quadrant. |
5065 | | * |
5066 | | * This was confirmed using some more files in which the quadrant was |
5067 | | * manually changed, but whether these are valid results is |
5068 | | * disputable. |
5069 | | * |
5070 | | * The ReflectXAxis flag seems to have no effect here... |
5071 | | *------------------------------------------------------------*/ |
5072 | | |
5073 | | /*------------------------------------------------------------- |
5074 | | * In version 100 .tab files (version 400 .map), it is possible |
5075 | | * to have a quadrant value of 0 and it should be treated the |
5076 | | * same way as quadrant 3 |
5077 | | *------------------------------------------------------------*/ |
5078 | 74 | if (poMapFile->GetHeaderBlock()->m_nCoordOriginQuadrant == 1 || |
5079 | 11 | poMapFile->GetHeaderBlock()->m_nCoordOriginQuadrant == 3 || |
5080 | 11 | poMapFile->GetHeaderBlock()->m_nCoordOriginQuadrant == 0) |
5081 | 67 | { |
5082 | | // Quadrants 1 and 3 ... read order = start, end |
5083 | 67 | m_dStartAngle = poArcHdr->m_nStartAngle / 10.0; |
5084 | 67 | m_dEndAngle = poArcHdr->m_nEndAngle / 10.0; |
5085 | 67 | } |
5086 | 7 | else |
5087 | 7 | { |
5088 | | // Quadrants 2 and 4 ... read order = end, start |
5089 | 7 | m_dStartAngle = poArcHdr->m_nEndAngle / 10.0; |
5090 | 7 | m_dEndAngle = poArcHdr->m_nStartAngle / 10.0; |
5091 | 7 | } |
5092 | | |
5093 | 74 | if (poMapFile->GetHeaderBlock()->m_nCoordOriginQuadrant == 2 || |
5094 | 74 | poMapFile->GetHeaderBlock()->m_nCoordOriginQuadrant == 3 || |
5095 | 74 | poMapFile->GetHeaderBlock()->m_nCoordOriginQuadrant == 0) |
5096 | 4 | { |
5097 | | // X axis direction is flipped... adjust angle |
5098 | 4 | m_dStartAngle = (m_dStartAngle <= 180.0) ? (180.0 - m_dStartAngle) |
5099 | 4 | : (540.0 - m_dStartAngle); |
5100 | 4 | m_dEndAngle = (m_dEndAngle <= 180.0) ? (180.0 - m_dEndAngle) |
5101 | 4 | : (540.0 - m_dEndAngle); |
5102 | 4 | } |
5103 | | |
5104 | 74 | if (fabs(m_dEndAngle - m_dStartAngle) >= 721) |
5105 | 0 | { |
5106 | 0 | CPLError(CE_Failure, CPLE_AppDefined, |
5107 | 0 | "Wrong start and end angles: %f %f", m_dStartAngle, |
5108 | 0 | m_dEndAngle); |
5109 | 0 | return -1; |
5110 | 0 | } |
5111 | | |
5112 | 74 | if (poMapFile->GetHeaderBlock()->m_nCoordOriginQuadrant == 3 || |
5113 | 74 | poMapFile->GetHeaderBlock()->m_nCoordOriginQuadrant == 4 || |
5114 | 74 | poMapFile->GetHeaderBlock()->m_nCoordOriginQuadrant == 0) |
5115 | 4 | { |
5116 | | // Y axis direction is flipped... this reverses angle direction |
5117 | | // Unfortunately we never found any file that contains this case, |
5118 | | // but this should be the behavior to expect!!! |
5119 | | // |
5120 | | // 2000-01-14: some files in which quadrant was set to 3 and 4 |
5121 | | // manually seemed to confirm that this is the right thing to do. |
5122 | 4 | m_dStartAngle = 360.0 - m_dStartAngle; |
5123 | 4 | m_dEndAngle = 360.0 - m_dEndAngle; |
5124 | 4 | } |
5125 | | |
5126 | | // An arc is defined by its defining ellipse's MBR: |
5127 | | |
5128 | 74 | double dXMin = 0.0; |
5129 | 74 | double dYMin = 0.0; |
5130 | 74 | double dXMax = 0.0; |
5131 | 74 | double dYMax = 0.0; |
5132 | | |
5133 | 74 | poMapFile->Int2Coordsys(poArcHdr->m_nArcEllipseMinX, |
5134 | 74 | poArcHdr->m_nArcEllipseMinY, dXMin, dYMin); |
5135 | 74 | poMapFile->Int2Coordsys(poArcHdr->m_nArcEllipseMaxX, |
5136 | 74 | poArcHdr->m_nArcEllipseMaxY, dXMax, dYMax); |
5137 | | |
5138 | 74 | m_dCenterX = (dXMin + dXMax) / 2.0; |
5139 | 74 | m_dCenterY = (dYMin + dYMax) / 2.0; |
5140 | 74 | m_dXRadius = std::abs((dXMax - dXMin) / 2.0); |
5141 | 74 | m_dYRadius = std::abs((dYMax - dYMin) / 2.0); |
5142 | | |
5143 | | // Read the Arc's MBR and use that as this feature's MBR |
5144 | 74 | poMapFile->Int2Coordsys(poArcHdr->m_nMinX, poArcHdr->m_nMinY, dXMin, dYMin); |
5145 | 74 | poMapFile->Int2Coordsys(poArcHdr->m_nMaxX, poArcHdr->m_nMaxY, dXMax, dYMax); |
5146 | 74 | SetMBR(dXMin, dYMin, dXMax, dYMax); |
5147 | | |
5148 | 74 | m_nPenDefIndex = poArcHdr->m_nPenId; // Pen index |
5149 | 74 | poMapFile->ReadPenDef(m_nPenDefIndex, &m_sPenDef); |
5150 | | |
5151 | | /*----------------------------------------------------------------- |
5152 | | * Create and fill geometry object |
5153 | | * For the OGR geometry, we generate an arc with 2 degrees line |
5154 | | * segments. |
5155 | | *----------------------------------------------------------------*/ |
5156 | 74 | OGRLineString *poLine = new OGRLineString; |
5157 | | |
5158 | 74 | const int numPts = std::max( |
5159 | 74 | 2, |
5160 | 74 | (m_dEndAngle < m_dStartAngle |
5161 | 74 | ? static_cast<int>( |
5162 | 7 | std::abs(((m_dEndAngle + 360.0) - m_dStartAngle) / 2.0) + 1) |
5163 | 74 | : static_cast<int>(std::abs((m_dEndAngle - m_dStartAngle) / 2.0) + |
5164 | 67 | 1))); |
5165 | | |
5166 | 74 | TABGenerateArc(poLine, numPts, m_dCenterX, m_dCenterY, m_dXRadius, |
5167 | 74 | m_dYRadius, m_dStartAngle * M_PI / 180.0, |
5168 | 74 | m_dEndAngle * M_PI / 180.0); |
5169 | | |
5170 | 74 | SetGeometryDirectly(poLine); |
5171 | | |
5172 | 74 | return 0; |
5173 | 74 | } |
5174 | | |
5175 | | /********************************************************************** |
5176 | | * TABArc::WriteGeometryToMAPFile() |
5177 | | * |
5178 | | * Write the geometry and representation (color, etc...) part of the |
5179 | | * feature to the .MAP object pointed to by poMAPFile. |
5180 | | * |
5181 | | * It is assumed that poMAPFile currently points to a valid map object. |
5182 | | * |
5183 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
5184 | | * been called. |
5185 | | **********************************************************************/ |
5186 | | int TABArc::WriteGeometryToMAPFile(TABMAPFile *poMapFile, |
5187 | | TABMAPObjHdr *poObjHdr, |
5188 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
5189 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
5190 | 0 | { |
5191 | | /* Nothing to do for bCoordBlockDataOnly (used by index splitting) */ |
5192 | 0 | if (bCoordBlockDataOnly) |
5193 | 0 | return 0; |
5194 | | |
5195 | | /*----------------------------------------------------------------- |
5196 | | * We assume that ValidateMapInfoType() was called already and that |
5197 | | * the type in poObjHdr->m_nType is valid. |
5198 | | *----------------------------------------------------------------*/ |
5199 | 0 | CPLAssert(m_nMapInfoType == poObjHdr->m_nType); |
5200 | | |
5201 | | /*----------------------------------------------------------------- |
5202 | | * Fetch and validate geometry |
5203 | | * In the case of ARCs, this is all done inside UpdateMBR() |
5204 | | *----------------------------------------------------------------*/ |
5205 | 0 | if (UpdateMBR(poMapFile) != 0) |
5206 | 0 | return -1; /* Error already reported */ |
5207 | | |
5208 | | /*----------------------------------------------------------------- |
5209 | | * Copy object information |
5210 | | *----------------------------------------------------------------*/ |
5211 | 0 | TABMAPObjArc *poArcHdr = cpl::down_cast<TABMAPObjArc *>(poObjHdr); |
5212 | | |
5213 | | /*------------------------------------------------------------- |
5214 | | * Start/End angles |
5215 | | * Since we ALWAYS produce files in quadrant 1 then we can |
5216 | | * ignore the special angle conversion required by flipped axis. |
5217 | | * |
5218 | | * See the notes about Arc angles in TABArc::ReadGeometryFromMAPFile() |
5219 | | *------------------------------------------------------------*/ |
5220 | 0 | CPLAssert(poMapFile->GetHeaderBlock()->m_nCoordOriginQuadrant == 1); |
5221 | |
|
5222 | 0 | poArcHdr->m_nStartAngle = ROUND_INT(m_dStartAngle * 10.0); |
5223 | 0 | poArcHdr->m_nEndAngle = ROUND_INT(m_dEndAngle * 10.0); |
5224 | | |
5225 | | // An arc is defined by its defining ellipse's MBR: |
5226 | 0 | poMapFile->Coordsys2Int(m_dCenterX - m_dXRadius, m_dCenterY - m_dYRadius, |
5227 | 0 | poArcHdr->m_nArcEllipseMinX, |
5228 | 0 | poArcHdr->m_nArcEllipseMinY); |
5229 | 0 | poMapFile->Coordsys2Int(m_dCenterX + m_dXRadius, m_dCenterY + m_dYRadius, |
5230 | 0 | poArcHdr->m_nArcEllipseMaxX, |
5231 | 0 | poArcHdr->m_nArcEllipseMaxY); |
5232 | | |
5233 | | // Pass the Arc's actual MBR (values were set in UpdateMBR()) |
5234 | 0 | poArcHdr->m_nMinX = m_nXMin; |
5235 | 0 | poArcHdr->m_nMinY = m_nYMin; |
5236 | 0 | poArcHdr->m_nMaxX = m_nXMax; |
5237 | 0 | poArcHdr->m_nMaxY = m_nYMax; |
5238 | |
|
5239 | 0 | m_nPenDefIndex = poMapFile->WritePenDef(&m_sPenDef); |
5240 | 0 | poArcHdr->m_nPenId = static_cast<GByte>(m_nPenDefIndex); // Pen index |
5241 | |
|
5242 | 0 | if (CPLGetLastErrorType() == CE_Failure) |
5243 | 0 | return -1; |
5244 | | |
5245 | 0 | return 0; |
5246 | 0 | } |
5247 | | |
5248 | | /********************************************************************** |
5249 | | * TABArc::SetStart/EndAngle() |
5250 | | * |
5251 | | * Set the start/end angle values in degrees, making sure the values are |
5252 | | * always in the range [0..360] |
5253 | | **********************************************************************/ |
5254 | | void TABArc::SetStartAngle(double dAngle) |
5255 | 0 | { |
5256 | 0 | dAngle = fmod(dAngle, 360.0); |
5257 | 0 | if (dAngle < 0.0) |
5258 | 0 | dAngle += 360.0; |
5259 | |
|
5260 | 0 | m_dStartAngle = dAngle; |
5261 | 0 | } |
5262 | | |
5263 | | void TABArc::SetEndAngle(double dAngle) |
5264 | 0 | { |
5265 | 0 | dAngle = fmod(dAngle, 360.0); |
5266 | 0 | if (dAngle < 0.0) |
5267 | 0 | dAngle += 360.0; |
5268 | |
|
5269 | 0 | m_dEndAngle = dAngle; |
5270 | 0 | } |
5271 | | |
5272 | | /********************************************************************** |
5273 | | * TABArc::GetStyleString() const |
5274 | | * |
5275 | | * Return style string for this feature. |
5276 | | * |
5277 | | * Style String is built only once during the first call to GetStyleString(). |
5278 | | **********************************************************************/ |
5279 | | const char *TABArc::GetStyleString() const |
5280 | 0 | { |
5281 | 0 | if (m_pszStyleString == nullptr) |
5282 | 0 | { |
5283 | 0 | m_pszStyleString = CPLStrdup(GetPenStyleString()); |
5284 | 0 | } |
5285 | |
|
5286 | 0 | return m_pszStyleString; |
5287 | 0 | } |
5288 | | |
5289 | | /********************************************************************** |
5290 | | * TABArc::DumpMIF() |
5291 | | * |
5292 | | * Dump feature geometry in a format similar to .MIF REGIONs. |
5293 | | **********************************************************************/ |
5294 | | void TABArc::DumpMIF(FILE *fpOut /*=NULL*/) |
5295 | 0 | { |
5296 | 0 | if (fpOut == nullptr) |
5297 | 0 | fpOut = stdout; |
5298 | | |
5299 | | /*----------------------------------------------------------------- |
5300 | | * Output ARC parameters |
5301 | | *----------------------------------------------------------------*/ |
5302 | 0 | fprintf(fpOut, "(ARC %.15g %.15g %.15g %.15g %d %d)\n", |
5303 | 0 | m_dCenterX - m_dXRadius, m_dCenterY - m_dYRadius, |
5304 | 0 | m_dCenterX + m_dXRadius, m_dCenterY + m_dYRadius, |
5305 | 0 | static_cast<int>(m_dStartAngle), static_cast<int>(m_dEndAngle)); |
5306 | | |
5307 | | /*----------------------------------------------------------------- |
5308 | | * Fetch and validate geometry |
5309 | | *----------------------------------------------------------------*/ |
5310 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
5311 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbLineString) |
5312 | 0 | { |
5313 | | /*------------------------------------------------------------- |
5314 | | * Generate arc output as a simple polyline |
5315 | | * We could also output as an ELLIPSE in a real MIF generator |
5316 | | *------------------------------------------------------------*/ |
5317 | 0 | OGRLineString *poLine = poGeom->toLineString(); |
5318 | 0 | const int numPoints = poLine->getNumPoints(); |
5319 | 0 | fprintf(fpOut, "PLINE %d\n", numPoints); |
5320 | 0 | for (int i = 0; i < numPoints; i++) |
5321 | 0 | fprintf(fpOut, "%.15g %.15g\n", poLine->getX(i), poLine->getY(i)); |
5322 | 0 | } |
5323 | 0 | else |
5324 | 0 | { |
5325 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
5326 | 0 | "TABArc: Missing or Invalid Geometry!"); |
5327 | 0 | return; |
5328 | 0 | } |
5329 | | |
5330 | | // Finish with PEN/BRUSH/etc. clauses |
5331 | 0 | DumpPenDef(); |
5332 | |
|
5333 | 0 | fflush(fpOut); |
5334 | 0 | } |
5335 | | |
5336 | | /*===================================================================== |
5337 | | * class TABText |
5338 | | *====================================================================*/ |
5339 | | |
5340 | | /********************************************************************** |
5341 | | * TABText::TABText() |
5342 | | * |
5343 | | * Constructor. |
5344 | | **********************************************************************/ |
5345 | | TABText::TABText(const OGRFeatureDefn *poDefnIn) |
5346 | 81.1k | : TABFeature(poDefnIn), m_pszString(nullptr), m_dAngle(0.0), m_dHeight(0.0), |
5347 | 81.1k | m_dWidth(0.0), m_dfLineEndX(0.0), m_dfLineEndY(0.0), m_bLineEndSet(FALSE), |
5348 | 81.1k | m_rgbForeground(0x000000), m_rgbBackground(0xffffff), |
5349 | 81.1k | m_rgbOutline(0xffffff), m_rgbShadow(0x808080), m_nTextAlignment(0), |
5350 | 81.1k | m_nFontStyle(0) |
5351 | 81.1k | { |
5352 | 81.1k | } |
5353 | | |
5354 | | /********************************************************************** |
5355 | | * TABText::~TABText() |
5356 | | * |
5357 | | * Destructor. |
5358 | | **********************************************************************/ |
5359 | | TABText::~TABText() |
5360 | 81.1k | { |
5361 | 81.1k | CPLFree(m_pszString); |
5362 | 81.1k | } |
5363 | | |
5364 | | /********************************************************************** |
5365 | | * TABText::CloneTABFeature() |
5366 | | * |
5367 | | * Duplicate feature, including stuff specific to each TABFeature type. |
5368 | | * |
5369 | | * This method calls the generic TABFeature::CopyTABFeatureBase() and |
5370 | | * then copies any members specific to its own type. |
5371 | | **********************************************************************/ |
5372 | | TABFeature *TABText::CloneTABFeature(const OGRFeatureDefn *poNewDefn /*=NULL*/) |
5373 | 0 | { |
5374 | | /*----------------------------------------------------------------- |
5375 | | * Alloc new feature and copy the base stuff |
5376 | | *----------------------------------------------------------------*/ |
5377 | 0 | TABText *poNew = new TABText(poNewDefn ? poNewDefn : GetDefnRef()); |
5378 | |
|
5379 | 0 | CopyTABFeatureBase(poNew); |
5380 | | |
5381 | | /*----------------------------------------------------------------- |
5382 | | * And members specific to this class |
5383 | | *----------------------------------------------------------------*/ |
5384 | | // ITABFeaturePen |
5385 | 0 | *(poNew->GetPenDefRef()) = *GetPenDefRef(); |
5386 | | |
5387 | | // ITABFeatureFont |
5388 | 0 | *(poNew->GetFontDefRef()) = *GetFontDefRef(); |
5389 | |
|
5390 | 0 | poNew->SetTextString(GetTextString()); |
5391 | 0 | poNew->SetTextAngle(GetTextAngle()); |
5392 | 0 | poNew->SetTextBoxHeight(GetTextBoxHeight()); |
5393 | 0 | poNew->SetTextBoxWidth(GetTextBoxWidth()); |
5394 | 0 | poNew->SetFontStyleTABValue(GetFontStyleTABValue()); |
5395 | 0 | poNew->SetFontBGColor(GetFontBGColor()); |
5396 | 0 | poNew->SetFontFGColor(GetFontFGColor()); |
5397 | 0 | poNew->SetFontOColor(GetFontOColor()); |
5398 | 0 | poNew->SetFontSColor(GetFontSColor()); |
5399 | |
|
5400 | 0 | poNew->SetTextJustification(GetTextJustification()); |
5401 | 0 | poNew->SetTextSpacing(GetTextSpacing()); |
5402 | | // Note: Text arrow/line coordinates are not transported... but |
5403 | | // we ignore them most of the time anyways. |
5404 | 0 | poNew->SetTextLineType(TABTLNoLine); |
5405 | |
|
5406 | 0 | return poNew; |
5407 | 0 | } |
5408 | | |
5409 | | /********************************************************************** |
5410 | | * TABText::ValidateMapInfoType() |
5411 | | * |
5412 | | * Check the feature's geometry part and return the corresponding |
5413 | | * mapinfo object type code. The m_nMapInfoType member will also |
5414 | | * be updated for further calls to GetMapInfoType(); |
5415 | | * |
5416 | | * Returns TAB_GEOM_NONE if the geometry is not compatible with what |
5417 | | * is expected for this object class. |
5418 | | **********************************************************************/ |
5419 | | TABGeomType TABText::ValidateMapInfoType(TABMAPFile *poMapFile /*=NULL*/) |
5420 | 0 | { |
5421 | | /*----------------------------------------------------------------- |
5422 | | * Fetch and validate geometry |
5423 | | *----------------------------------------------------------------*/ |
5424 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
5425 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint) |
5426 | 0 | { |
5427 | 0 | m_nMapInfoType = TAB_GEOM_TEXT; |
5428 | 0 | } |
5429 | 0 | else |
5430 | 0 | { |
5431 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
5432 | 0 | "TABText: Missing or Invalid Geometry!"); |
5433 | 0 | m_nMapInfoType = TAB_GEOM_NONE; |
5434 | 0 | } |
5435 | | |
5436 | | /*----------------------------------------------------------------- |
5437 | | * Decide if coordinates should be compressed or not. |
5438 | | *----------------------------------------------------------------*/ |
5439 | | // __TODO__ For now we always write uncompressed for this class... |
5440 | | // ValidateCoordType(poMapFile); |
5441 | 0 | UpdateMBR(poMapFile); |
5442 | |
|
5443 | 0 | return m_nMapInfoType; |
5444 | 0 | } |
5445 | | |
5446 | | /********************************************************************** |
5447 | | * TABText::ReadGeometryFromMAPFile() |
5448 | | * |
5449 | | * Fill the geometry and representation (color, etc...) part of the |
5450 | | * feature from the contents of the .MAP object pointed to by poMAPFile. |
5451 | | * |
5452 | | * It is assumed that poMAPFile currently points to the beginning of |
5453 | | * a map object. |
5454 | | * |
5455 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
5456 | | * been called. |
5457 | | **********************************************************************/ |
5458 | | int TABText::ReadGeometryFromMAPFile(TABMAPFile *poMapFile, |
5459 | | TABMAPObjHdr *poObjHdr, |
5460 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
5461 | | TABMAPCoordBlock **ppoCoordBlock /*=NULL*/) |
5462 | 33 | { |
5463 | | /*----------------------------------------------------------------- |
5464 | | * Fetch and validate geometry type |
5465 | | *----------------------------------------------------------------*/ |
5466 | 33 | m_nMapInfoType = poObjHdr->m_nType; |
5467 | | |
5468 | 33 | if (m_nMapInfoType != TAB_GEOM_TEXT && m_nMapInfoType != TAB_GEOM_TEXT_C) |
5469 | 0 | { |
5470 | 0 | CPLError( |
5471 | 0 | CE_Failure, CPLE_AssertionFailed, |
5472 | 0 | "ReadGeometryFromMAPFile(): unsupported geometry type %d (0x%2.2x)", |
5473 | 0 | m_nMapInfoType, m_nMapInfoType); |
5474 | 0 | return -1; |
5475 | 0 | } |
5476 | | |
5477 | | /*============================================================= |
5478 | | * TEXT |
5479 | | *============================================================*/ |
5480 | | |
5481 | | /*----------------------------------------------------------------- |
5482 | | * Read object information |
5483 | | *----------------------------------------------------------------*/ |
5484 | 33 | TABMAPObjText *poTextHdr = cpl::down_cast<TABMAPObjText *>(poObjHdr); |
5485 | | |
5486 | 33 | const GInt32 nCoordBlockPtr = |
5487 | 33 | poTextHdr->m_nCoordBlockPtr; // String position |
5488 | 33 | const int nStringLen = poTextHdr->m_nCoordDataSize; // String length |
5489 | 33 | m_nTextAlignment = poTextHdr->m_nTextAlignment; // just./spacing/arrow |
5490 | | |
5491 | | /*------------------------------------------------------------- |
5492 | | * Text Angle, in tenths of degree. |
5493 | | * Contrary to arc start/end angles, no conversion based on |
5494 | | * origin quadrant is required here. |
5495 | | *------------------------------------------------------------*/ |
5496 | 33 | m_dAngle = poTextHdr->m_nAngle / 10.0; |
5497 | | |
5498 | 33 | m_nFontStyle = poTextHdr->m_nFontStyle; // Font style |
5499 | | |
5500 | 33 | m_rgbForeground = (poTextHdr->m_nFGColorR * 256 * 256 + |
5501 | 33 | poTextHdr->m_nFGColorG * 256 + poTextHdr->m_nFGColorB); |
5502 | 33 | m_rgbBackground = (poTextHdr->m_nBGColorR * 256 * 256 + |
5503 | 33 | poTextHdr->m_nBGColorG * 256 + poTextHdr->m_nBGColorB); |
5504 | 33 | m_rgbOutline = m_rgbBackground; |
5505 | | // In MapInfo, the shadow color is always gray (128,128,128) |
5506 | 33 | m_rgbShadow = 0x808080; |
5507 | | |
5508 | | // arrow endpoint |
5509 | 33 | poMapFile->Int2Coordsys(poTextHdr->m_nLineEndX, poTextHdr->m_nLineEndY, |
5510 | 33 | m_dfLineEndX, m_dfLineEndY); |
5511 | 33 | m_bLineEndSet = TRUE; |
5512 | | |
5513 | | // Text Height |
5514 | 33 | double dJunk = 0.0; |
5515 | 33 | poMapFile->Int2CoordsysDist(0, poTextHdr->m_nHeight, dJunk, m_dHeight); |
5516 | | |
5517 | 33 | if (!bCoordBlockDataOnly) |
5518 | 33 | { |
5519 | 33 | m_nFontDefIndex = poTextHdr->m_nFontId; // Font name index |
5520 | 33 | poMapFile->ReadFontDef(m_nFontDefIndex, &m_sFontDef); |
5521 | 33 | } |
5522 | | |
5523 | | // MBR after rotation |
5524 | 33 | double dXMin = 0.0; |
5525 | 33 | double dYMin = 0.0; |
5526 | 33 | double dXMax = 0.0; |
5527 | 33 | double dYMax = 0.0; |
5528 | 33 | poMapFile->Int2Coordsys(poTextHdr->m_nMinX, poTextHdr->m_nMinY, dXMin, |
5529 | 33 | dYMin); |
5530 | 33 | poMapFile->Int2Coordsys(poTextHdr->m_nMaxX, poTextHdr->m_nMaxY, dXMax, |
5531 | 33 | dYMax); |
5532 | | |
5533 | 33 | if (!bCoordBlockDataOnly) |
5534 | 33 | { |
5535 | 33 | m_nPenDefIndex = poTextHdr->m_nPenId; // Pen index for line |
5536 | 33 | poMapFile->ReadPenDef(m_nPenDefIndex, &m_sPenDef); |
5537 | 33 | } |
5538 | | |
5539 | | /*------------------------------------------------------------- |
5540 | | * Read text string from the coord. block |
5541 | | * Note that the string may contain binary '\n' and '\\' chars |
5542 | | * that we keep to an unescaped form internally. This is to |
5543 | | * be like OGR drivers. See bug 1107 for details. |
5544 | | *------------------------------------------------------------*/ |
5545 | 33 | char *pszTmpString = |
5546 | 33 | static_cast<char *>(CPLMalloc((nStringLen + 1) * sizeof(char))); |
5547 | | |
5548 | 33 | if (nStringLen > 0) |
5549 | 32 | { |
5550 | 32 | TABMAPCoordBlock *poCoordBlock = nullptr; |
5551 | | |
5552 | 32 | if (ppoCoordBlock != nullptr && *ppoCoordBlock != nullptr) |
5553 | 0 | poCoordBlock = *ppoCoordBlock; |
5554 | 32 | else |
5555 | 32 | poCoordBlock = poMapFile->GetCoordBlock(nCoordBlockPtr); |
5556 | 32 | if (poCoordBlock == nullptr || |
5557 | 30 | poCoordBlock->ReadBytes( |
5558 | 30 | nStringLen, reinterpret_cast<GByte *>(pszTmpString)) != 0) |
5559 | 3 | { |
5560 | 3 | CPLError(CE_Failure, CPLE_FileIO, |
5561 | 3 | "Failed reading text string at offset %d", nCoordBlockPtr); |
5562 | 3 | CPLFree(pszTmpString); |
5563 | 3 | return -1; |
5564 | 3 | } |
5565 | | |
5566 | | /* Return a ref to coord block so that caller can continue reading |
5567 | | * after the end of this object (used by index splitting) |
5568 | | */ |
5569 | 29 | if (ppoCoordBlock) |
5570 | 0 | *ppoCoordBlock = poCoordBlock; |
5571 | 29 | } |
5572 | | |
5573 | 30 | pszTmpString[nStringLen] = '\0'; |
5574 | | |
5575 | 30 | if (!poMapFile->GetEncoding().empty()) |
5576 | 0 | { |
5577 | 0 | char *pszUtf8String = |
5578 | 0 | CPLRecode(pszTmpString, poMapFile->GetEncoding(), CPL_ENC_UTF8); |
5579 | 0 | CPLFree(pszTmpString); |
5580 | 0 | pszTmpString = pszUtf8String; |
5581 | 0 | } |
5582 | | |
5583 | 30 | CPLFree(m_pszString); |
5584 | 30 | m_pszString = pszTmpString; // This string was Escaped before 20050714 |
5585 | | |
5586 | | /* Set/retrieve the MBR to make sure Mins are smaller than Maxs |
5587 | | */ |
5588 | 30 | SetMBR(dXMin, dYMin, dXMax, dYMax); |
5589 | 30 | GetMBR(dXMin, dYMin, dXMax, dYMax); |
5590 | | |
5591 | | /* Copy int MBR to feature class members */ |
5592 | 30 | SetIntMBR(poObjHdr->m_nMinX, poObjHdr->m_nMinY, poObjHdr->m_nMaxX, |
5593 | 30 | poObjHdr->m_nMaxY); |
5594 | | |
5595 | | /*----------------------------------------------------------------- |
5596 | | * Create an OGRPoint Geometry... |
5597 | | * The point X,Y values will be the coords of the lower-left corner before |
5598 | | * rotation is applied. (Note that the rotation in MapInfo is done around |
5599 | | * the upper-left corner) |
5600 | | * We need to calculate the true lower left corner of the text based |
5601 | | * on the MBR after rotation, the text height and the rotation angle. |
5602 | | *----------------------------------------------------------------*/ |
5603 | 30 | double dSin = sin(m_dAngle * M_PI / 180.0); |
5604 | 30 | double dCos = cos(m_dAngle * M_PI / 180.0); |
5605 | 30 | double dX = 0.0; |
5606 | 30 | double dY = 0.0; |
5607 | 30 | if (dSin > 0.0 && dCos > 0.0) |
5608 | 29 | { |
5609 | 29 | dX = dXMin + m_dHeight * dSin; |
5610 | 29 | dY = dYMin; |
5611 | 29 | } |
5612 | 1 | else if (dSin > 0.0 && dCos < 0.0) |
5613 | 0 | { |
5614 | 0 | dX = dXMax; |
5615 | 0 | dY = dYMin - m_dHeight * dCos; |
5616 | 0 | } |
5617 | 1 | else if (dSin < 0.0 && dCos < 0.0) |
5618 | 0 | { |
5619 | 0 | dX = dXMax + m_dHeight * dSin; |
5620 | 0 | dY = dYMax; |
5621 | 0 | } |
5622 | 1 | else // dSin < 0 && dCos > 0 |
5623 | 1 | { |
5624 | 1 | dX = dXMin; |
5625 | 1 | dY = dYMax - m_dHeight * dCos; |
5626 | 1 | } |
5627 | | |
5628 | 30 | OGRGeometry *poGeometry = new OGRPoint(dX, dY); |
5629 | | |
5630 | 30 | SetGeometryDirectly(poGeometry); |
5631 | | |
5632 | | /*----------------------------------------------------------------- |
5633 | | * Compute Text Width: the width of the Text MBR before rotation |
5634 | | * in ground units... unfortunately this value is not stored in the |
5635 | | * file, so we have to compute it with the MBR after rotation and |
5636 | | * the height of the MBR before rotation: |
5637 | | * With W = Width of MBR before rotation |
5638 | | * H = Height of MBR before rotation |
5639 | | * dX = Width of MBR after rotation |
5640 | | * dY = Height of MBR after rotation |
5641 | | * teta = rotation angle |
5642 | | * |
5643 | | * For [-PI/4..teta..+PI/4] or [3*PI/4..teta..5*PI/4], we'll use: |
5644 | | * W = H * (dX - H * sin(teta)) / (H * cos(teta)) |
5645 | | * |
5646 | | * and for other teta values, use: |
5647 | | * W = H * (dY - H * cos(teta)) / (H * sin(teta)) |
5648 | | *----------------------------------------------------------------*/ |
5649 | 30 | dSin = std::abs(dSin); |
5650 | 30 | dCos = std::abs(dCos); |
5651 | 30 | if (m_dHeight == 0.0) |
5652 | 0 | m_dWidth = 0.0; |
5653 | 30 | else if (dCos > dSin) |
5654 | 30 | m_dWidth = m_dHeight * ((dXMax - dXMin) - m_dHeight * dSin) / |
5655 | 30 | (m_dHeight * dCos); |
5656 | 0 | else |
5657 | 0 | m_dWidth = m_dHeight * ((dYMax - dYMin) - m_dHeight * dCos) / |
5658 | 0 | (m_dHeight * dSin); |
5659 | 30 | m_dWidth = std::abs(m_dWidth); |
5660 | | |
5661 | 30 | return 0; |
5662 | 33 | } |
5663 | | |
5664 | | /********************************************************************** |
5665 | | * TABText::WriteGeometryToMAPFile() |
5666 | | * |
5667 | | * Write the geometry and representation (color, etc...) part of the |
5668 | | * feature to the .MAP object pointed to by poMAPFile. |
5669 | | * |
5670 | | * It is assumed that poMAPFile currently points to a valid map object. |
5671 | | * |
5672 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
5673 | | * been called. |
5674 | | **********************************************************************/ |
5675 | | int TABText::WriteGeometryToMAPFile(TABMAPFile *poMapFile, |
5676 | | TABMAPObjHdr *poObjHdr, |
5677 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
5678 | | TABMAPCoordBlock **ppoCoordBlock /*=NULL*/) |
5679 | 0 | { |
5680 | 0 | GInt32 nX, nY, nXMin, nYMin, nXMax, nYMax; |
5681 | | |
5682 | | /*----------------------------------------------------------------- |
5683 | | * We assume that ValidateMapInfoType() was called already and that |
5684 | | * the type in poObjHdr->m_nType is valid. |
5685 | | *----------------------------------------------------------------*/ |
5686 | 0 | CPLAssert(m_nMapInfoType == poObjHdr->m_nType); |
5687 | | |
5688 | | /*----------------------------------------------------------------- |
5689 | | * Fetch and validate geometry |
5690 | | *----------------------------------------------------------------*/ |
5691 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
5692 | 0 | OGRPoint *poPoint = nullptr; |
5693 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint) |
5694 | 0 | poPoint = poGeom->toPoint(); |
5695 | 0 | else |
5696 | 0 | { |
5697 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
5698 | 0 | "TABText: Missing or Invalid Geometry!"); |
5699 | 0 | return -1; |
5700 | 0 | } |
5701 | | |
5702 | 0 | poMapFile->Coordsys2Int(poPoint->getX(), poPoint->getY(), nX, nY); |
5703 | | |
5704 | | /*----------------------------------------------------------------- |
5705 | | * Write string to a coord block first... |
5706 | | * Note that the string may contain unescaped '\n' and '\\' |
5707 | | * that we have to keep like that for the MAP file. |
5708 | | * See MapTools bug 1107 for more details. |
5709 | | *----------------------------------------------------------------*/ |
5710 | 0 | TABMAPCoordBlock *poCoordBlock = nullptr; |
5711 | 0 | if (ppoCoordBlock != nullptr && *ppoCoordBlock != nullptr) |
5712 | 0 | poCoordBlock = *ppoCoordBlock; |
5713 | 0 | else |
5714 | 0 | poCoordBlock = poMapFile->GetCurCoordBlock(); |
5715 | 0 | poCoordBlock->StartNewFeature(); |
5716 | 0 | GInt32 nCoordBlockPtr = poCoordBlock->GetCurAddress(); |
5717 | | |
5718 | | // This string was escaped before 20050714 |
5719 | 0 | CPLString oTmpString(m_pszString ? m_pszString : ""); |
5720 | 0 | if (!poMapFile->GetEncoding().empty()) |
5721 | 0 | { |
5722 | 0 | oTmpString.Recode(CPL_ENC_UTF8, poMapFile->GetEncoding()); |
5723 | 0 | } |
5724 | |
|
5725 | 0 | int nStringLen = static_cast<int>(oTmpString.length()); |
5726 | |
|
5727 | 0 | if (nStringLen > 0) |
5728 | 0 | { |
5729 | 0 | poCoordBlock->WriteBytes( |
5730 | 0 | nStringLen, reinterpret_cast<const GByte *>(oTmpString.c_str())); |
5731 | 0 | } |
5732 | 0 | else |
5733 | 0 | { |
5734 | 0 | nCoordBlockPtr = 0; |
5735 | 0 | } |
5736 | | |
5737 | | /*----------------------------------------------------------------- |
5738 | | * Copy object information |
5739 | | *----------------------------------------------------------------*/ |
5740 | 0 | TABMAPObjText *poTextHdr = cpl::down_cast<TABMAPObjText *>(poObjHdr); |
5741 | |
|
5742 | 0 | poTextHdr->m_nCoordBlockPtr = nCoordBlockPtr; // String position |
5743 | 0 | poTextHdr->m_nCoordDataSize = nStringLen; // String length |
5744 | 0 | poTextHdr->m_nTextAlignment = m_nTextAlignment; // just./spacing/arrow |
5745 | | |
5746 | | /*----------------------------------------------------------------- |
5747 | | * Text Angle, (written in tenths of degrees) |
5748 | | * Contrary to arc start/end angles, no conversion based on |
5749 | | * origin quadrant is required here. |
5750 | | *----------------------------------------------------------------*/ |
5751 | 0 | poTextHdr->m_nAngle = ROUND_INT(m_dAngle * 10.0); |
5752 | |
|
5753 | 0 | poTextHdr->m_nFontStyle = m_nFontStyle; // Font style/effect |
5754 | |
|
5755 | 0 | poTextHdr->m_nFGColorR = static_cast<GByte>(COLOR_R(m_rgbForeground)); |
5756 | 0 | poTextHdr->m_nFGColorG = static_cast<GByte>(COLOR_G(m_rgbForeground)); |
5757 | 0 | poTextHdr->m_nFGColorB = static_cast<GByte>(COLOR_B(m_rgbForeground)); |
5758 | |
|
5759 | 0 | poTextHdr->m_nBGColorR = static_cast<GByte>(COLOR_R(m_rgbBackground)); |
5760 | 0 | poTextHdr->m_nBGColorG = static_cast<GByte>(COLOR_G(m_rgbBackground)); |
5761 | 0 | poTextHdr->m_nBGColorB = static_cast<GByte>(COLOR_B(m_rgbBackground)); |
5762 | | |
5763 | | /*----------------------------------------------------------------- |
5764 | | * The OGRPoint's X,Y values were the coords of the lower-left corner |
5765 | | * before rotation was applied. (Note that the rotation in MapInfo is |
5766 | | * done around the upper-left corner) |
5767 | | * The Feature's MBR is the MBR of the text after rotation... that's |
5768 | | * what MapInfo uses to define the text location. |
5769 | | *----------------------------------------------------------------*/ |
5770 | 0 | double dXMin = 0.0; |
5771 | 0 | double dYMin = 0.0; |
5772 | 0 | double dXMax = 0.0; |
5773 | 0 | double dYMax = 0.0; |
5774 | | // Make sure Feature MBR is in sync with other params |
5775 | |
|
5776 | 0 | UpdateMBR(); |
5777 | 0 | GetMBR(dXMin, dYMin, dXMax, dYMax); |
5778 | |
|
5779 | 0 | poMapFile->Coordsys2Int(dXMin, dYMin, nXMin, nYMin); |
5780 | 0 | poMapFile->Coordsys2Int(dXMax, dYMax, nXMax, nYMax); |
5781 | | |
5782 | | // Label line end point |
5783 | 0 | double dX = 0.0; |
5784 | 0 | double dY = 0.0; |
5785 | 0 | GetTextLineEndPoint(dX, dY); // Make sure a default line end point is set |
5786 | 0 | poMapFile->Coordsys2Int(m_dfLineEndX, m_dfLineEndY, poTextHdr->m_nLineEndX, |
5787 | 0 | poTextHdr->m_nLineEndY); |
5788 | | |
5789 | | // Text Height |
5790 | 0 | poMapFile->Coordsys2IntDist(0.0, m_dHeight, nX, nY); |
5791 | 0 | poTextHdr->m_nHeight = nY; |
5792 | |
|
5793 | 0 | if (!bCoordBlockDataOnly) |
5794 | 0 | { |
5795 | | // Font name |
5796 | 0 | m_nFontDefIndex = poMapFile->WriteFontDef(&m_sFontDef); |
5797 | 0 | poTextHdr->m_nFontId = |
5798 | 0 | static_cast<GByte>(m_nFontDefIndex); // Font name index |
5799 | 0 | } |
5800 | | |
5801 | | // MBR after rotation |
5802 | 0 | poTextHdr->SetMBR(nXMin, nYMin, nXMax, nYMax); |
5803 | |
|
5804 | 0 | if (!bCoordBlockDataOnly) |
5805 | 0 | { |
5806 | 0 | m_nPenDefIndex = poMapFile->WritePenDef(&m_sPenDef); |
5807 | 0 | poTextHdr->m_nPenId = |
5808 | 0 | static_cast<GByte>(m_nPenDefIndex); // Pen index for line/arrow |
5809 | 0 | } |
5810 | |
|
5811 | 0 | if (CPLGetLastErrorType() == CE_Failure) |
5812 | 0 | return -1; |
5813 | | |
5814 | | /* Return a ref to coord block so that caller can continue writing |
5815 | | * after the end of this object (used by index splitting) |
5816 | | */ |
5817 | 0 | if (ppoCoordBlock) |
5818 | 0 | *ppoCoordBlock = poCoordBlock; |
5819 | |
|
5820 | 0 | return 0; |
5821 | 0 | } |
5822 | | |
5823 | | /********************************************************************** |
5824 | | * TABText::GetTextString() |
5825 | | * |
5826 | | * Return ref to text string value. |
5827 | | * |
5828 | | * Returned string is a reference to the internal string buffer and should |
5829 | | * not be modified or freed by the caller. |
5830 | | **********************************************************************/ |
5831 | | const char *TABText::GetTextString() const |
5832 | 79.3k | { |
5833 | 79.3k | if (m_pszString == nullptr) |
5834 | 0 | return ""; |
5835 | | |
5836 | 79.3k | return m_pszString; |
5837 | 79.3k | } |
5838 | | |
5839 | | /********************************************************************** |
5840 | | * TABText::SetTextString() |
5841 | | * |
5842 | | * Set new text string value. |
5843 | | * |
5844 | | * Note: The text string may contain "\n" chars or "\\" chars |
5845 | | * and we expect to receive them in a 2 chars escaped form as |
5846 | | * described in the MIF format specs. |
5847 | | **********************************************************************/ |
5848 | | void TABText::SetTextString(const char *pszNewStr) |
5849 | 0 | { |
5850 | 0 | CPLFree(m_pszString); |
5851 | 0 | m_pszString = CPLStrdup(pszNewStr); |
5852 | 0 | } |
5853 | | |
5854 | | /********************************************************************** |
5855 | | * TABText::GetTextAngle() |
5856 | | * |
5857 | | * Return text angle in degrees. |
5858 | | **********************************************************************/ |
5859 | | double TABText::GetTextAngle() const |
5860 | 0 | { |
5861 | 0 | return m_dAngle; |
5862 | 0 | } |
5863 | | |
5864 | | void TABText::SetTextAngle(double dAngle) |
5865 | 37.5k | { |
5866 | | // Make sure angle is in the range [0..360] |
5867 | 37.5k | dAngle = fmod(dAngle, 360.0); |
5868 | 37.5k | if (dAngle < 0.0) |
5869 | 4.91k | dAngle += 360.0; |
5870 | 37.5k | m_dAngle = dAngle; |
5871 | 37.5k | UpdateMBR(); |
5872 | 37.5k | } |
5873 | | |
5874 | | /********************************************************************** |
5875 | | * TABText::GetTextBoxHeight() |
5876 | | * |
5877 | | * Return text height in Y axis coord. units of the text box before rotation. |
5878 | | **********************************************************************/ |
5879 | | double TABText::GetTextBoxHeight() const |
5880 | 0 | { |
5881 | 0 | return m_dHeight; |
5882 | 0 | } |
5883 | | |
5884 | | void TABText::SetTextBoxHeight(double dHeight) |
5885 | 0 | { |
5886 | 0 | m_dHeight = dHeight; |
5887 | 0 | UpdateMBR(); |
5888 | 0 | } |
5889 | | |
5890 | | /********************************************************************** |
5891 | | * TABText::GetTextBoxWidth() |
5892 | | * |
5893 | | * Return text width in X axis coord. units. of the text box before rotation. |
5894 | | * |
5895 | | * If value has not been set, then we force a default value that assumes |
5896 | | * that one char's box width is 60% of its height... and we ignore |
5897 | | * the multiline case. This should not matter when the user PROPERLY sets |
5898 | | * the value. |
5899 | | **********************************************************************/ |
5900 | | double TABText::GetTextBoxWidth() const |
5901 | 0 | { |
5902 | 0 | if (m_dWidth == 0.0 && m_pszString) |
5903 | 0 | { |
5904 | 0 | m_dWidth = 0.6 * m_dHeight * strlen(m_pszString); |
5905 | 0 | } |
5906 | 0 | return m_dWidth; |
5907 | 0 | } |
5908 | | |
5909 | | void TABText::SetTextBoxWidth(double dWidth) |
5910 | 0 | { |
5911 | 0 | m_dWidth = dWidth; |
5912 | 0 | UpdateMBR(); |
5913 | 0 | } |
5914 | | |
5915 | | /********************************************************************** |
5916 | | * TABText::GetTextLineEndPoint() |
5917 | | * |
5918 | | * Return X,Y coordinates of the text label line end point. |
5919 | | * Default is the center of the text MBR. |
5920 | | **********************************************************************/ |
5921 | | void TABText::GetTextLineEndPoint(double &dX, double &dY) |
5922 | 0 | { |
5923 | 0 | if (!m_bLineEndSet) |
5924 | 0 | { |
5925 | | // Set default location at center of text MBR |
5926 | 0 | double dXMin = 0.0; |
5927 | 0 | double dYMin = 0.0; |
5928 | 0 | double dXMax = 0.0; |
5929 | 0 | double dYMax = 0.0; |
5930 | 0 | UpdateMBR(); |
5931 | 0 | GetMBR(dXMin, dYMin, dXMax, dYMax); |
5932 | 0 | m_dfLineEndX = (dXMin + dXMax) / 2.0; |
5933 | 0 | m_dfLineEndY = (dYMin + dYMax) / 2.0; |
5934 | 0 | m_bLineEndSet = TRUE; |
5935 | 0 | } |
5936 | | |
5937 | | // Return values |
5938 | 0 | dX = m_dfLineEndX; |
5939 | 0 | dY = m_dfLineEndY; |
5940 | 0 | } |
5941 | | |
5942 | | void TABText::SetTextLineEndPoint(double dX, double dY) |
5943 | 4.56k | { |
5944 | 4.56k | m_dfLineEndX = dX; |
5945 | 4.56k | m_dfLineEndY = dY; |
5946 | 4.56k | m_bLineEndSet = TRUE; |
5947 | 4.56k | } |
5948 | | |
5949 | | /********************************************************************** |
5950 | | * TABText::UpdateMBR() |
5951 | | * |
5952 | | * Update the feature MBR using the text origin (OGRPoint geometry), the |
5953 | | * rotation angle, and the Width/height before rotation. |
5954 | | * |
5955 | | * This function cannot perform properly unless all the above have been set. |
5956 | | * |
5957 | | * Returns 0 on success, or -1 if there is no geometry in object |
5958 | | **********************************************************************/ |
5959 | | int TABText::UpdateMBR(TABMAPFile *poMapFile /*=NULL*/) |
5960 | 37.5k | { |
5961 | 37.5k | OGRGeometry *poGeom = GetGeometryRef(); |
5962 | 37.5k | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint) |
5963 | 0 | { |
5964 | 0 | OGRPoint *poPoint = poGeom->toPoint(); |
5965 | |
|
5966 | 0 | const double dX0 = poPoint->getX(); |
5967 | 0 | const double dY0 = poPoint->getY(); |
5968 | |
|
5969 | 0 | const double dSin = sin(m_dAngle * M_PI / 180.0); |
5970 | 0 | const double dCos = cos(m_dAngle * M_PI / 180.0); |
5971 | |
|
5972 | 0 | GetTextBoxWidth(); // Force default width value if necessary. |
5973 | |
|
5974 | 0 | const double dX[4] = {dX0, dX0 + m_dWidth, dX0 + m_dWidth, dX0}; |
5975 | 0 | const double dY[4] = {dY0, dY0, dY0 + m_dHeight, dY0 + m_dHeight}; |
5976 | |
|
5977 | 0 | SetMBR(dX0, dY0, dX0, dY0); |
5978 | 0 | for (int i = 0; i < 4; i++) |
5979 | 0 | { |
5980 | | // Rotate one of the box corners |
5981 | 0 | const double dX1 = |
5982 | 0 | dX0 + (dX[i] - dX0) * dCos - (dY[i] - dY0) * dSin; |
5983 | 0 | const double dY1 = |
5984 | 0 | dY0 + (dX[i] - dX0) * dSin + (dY[i] - dY0) * dCos; |
5985 | | |
5986 | | // And update feature MBR with rotated coordinate |
5987 | 0 | if (dX1 < m_dXMin) |
5988 | 0 | m_dXMin = dX1; |
5989 | 0 | if (dX1 > m_dXMax) |
5990 | 0 | m_dXMax = dX1; |
5991 | 0 | if (dY1 < m_dYMin) |
5992 | 0 | m_dYMin = dY1; |
5993 | 0 | if (dY1 > m_dYMax) |
5994 | 0 | m_dYMax = dY1; |
5995 | 0 | } |
5996 | |
|
5997 | 0 | if (poMapFile) |
5998 | 0 | { |
5999 | 0 | poMapFile->Coordsys2Int(m_dXMin, m_dYMin, m_nXMin, m_nYMin); |
6000 | 0 | poMapFile->Coordsys2Int(m_dXMax, m_dYMax, m_nXMax, m_nYMax); |
6001 | 0 | } |
6002 | |
|
6003 | 0 | return 0; |
6004 | 0 | } |
6005 | | |
6006 | 37.5k | return -1; |
6007 | 37.5k | } |
6008 | | |
6009 | | /********************************************************************** |
6010 | | * TABText::GetFontBGColor() |
6011 | | * |
6012 | | * Return background color. |
6013 | | **********************************************************************/ |
6014 | | GInt32 TABText::GetFontBGColor() const |
6015 | 0 | { |
6016 | 0 | return m_rgbBackground; |
6017 | 0 | } |
6018 | | |
6019 | | void TABText::SetFontBGColor(GInt32 rgbColor) |
6020 | 7.42k | { |
6021 | 7.42k | m_rgbBackground = rgbColor; |
6022 | 7.42k | } |
6023 | | |
6024 | | /********************************************************************** |
6025 | | * TABText::GetFontOColor() |
6026 | | * |
6027 | | * Return outline color. |
6028 | | **********************************************************************/ |
6029 | | GInt32 TABText::GetFontOColor() const |
6030 | 0 | { |
6031 | 0 | return m_rgbOutline; |
6032 | 0 | } |
6033 | | |
6034 | | void TABText::SetFontOColor(GInt32 rgbColor) |
6035 | 0 | { |
6036 | 0 | m_rgbOutline = rgbColor; |
6037 | 0 | } |
6038 | | |
6039 | | /********************************************************************** |
6040 | | * TABText::GetFontSColor() |
6041 | | * |
6042 | | * Return shadow color. |
6043 | | **********************************************************************/ |
6044 | | GInt32 TABText::GetFontSColor() const |
6045 | 0 | { |
6046 | 0 | return m_rgbShadow; |
6047 | 0 | } |
6048 | | |
6049 | | void TABText::SetFontSColor(GInt32 rgbColor) |
6050 | 0 | { |
6051 | 0 | m_rgbShadow = rgbColor; |
6052 | 0 | } |
6053 | | |
6054 | | /********************************************************************** |
6055 | | * TABText::GetFontFGColor() |
6056 | | * |
6057 | | * Return foreground color. |
6058 | | **********************************************************************/ |
6059 | | GInt32 TABText::GetFontFGColor() const |
6060 | 0 | { |
6061 | 0 | return m_rgbForeground; |
6062 | 0 | } |
6063 | | |
6064 | | void TABText::SetFontFGColor(GInt32 rgbColor) |
6065 | 10.5k | { |
6066 | 10.5k | m_rgbForeground = rgbColor; |
6067 | 10.5k | } |
6068 | | |
6069 | | /********************************************************************** |
6070 | | * TABText::GetTextJustification() |
6071 | | * |
6072 | | * Return text justification. Default is TABTJLeft |
6073 | | **********************************************************************/ |
6074 | | TABTextJust TABText::GetTextJustification() const |
6075 | 0 | { |
6076 | 0 | TABTextJust eJust = TABTJLeft; |
6077 | |
|
6078 | 0 | if (m_nTextAlignment & 0x0200) |
6079 | 0 | eJust = TABTJCenter; |
6080 | 0 | else if (m_nTextAlignment & 0x0400) |
6081 | 0 | eJust = TABTJRight; |
6082 | |
|
6083 | 0 | return eJust; |
6084 | 0 | } |
6085 | | |
6086 | | void TABText::SetTextJustification(TABTextJust eJustification) |
6087 | 6.89k | { |
6088 | | // Flush current value... default is TABTJLeft |
6089 | 6.89k | m_nTextAlignment &= ~0x0600; |
6090 | | // ... and set new one. |
6091 | 6.89k | if (eJustification == TABTJCenter) |
6092 | 6.60k | m_nTextAlignment |= 0x0200; |
6093 | 288 | else if (eJustification == TABTJRight) |
6094 | 288 | m_nTextAlignment |= 0x0400; |
6095 | 6.89k | } |
6096 | | |
6097 | | /********************************************************************** |
6098 | | * TABText::GetTextSpacing() |
6099 | | * |
6100 | | * Return text vertical spacing factor. Default is TABTSSingle |
6101 | | **********************************************************************/ |
6102 | | TABTextSpacing TABText::GetTextSpacing() const |
6103 | 0 | { |
6104 | 0 | TABTextSpacing eSpacing = TABTSSingle; |
6105 | |
|
6106 | 0 | if (m_nTextAlignment & 0x0800) |
6107 | 0 | eSpacing = TABTS1_5; |
6108 | 0 | else if (m_nTextAlignment & 0x1000) |
6109 | 0 | eSpacing = TABTSDouble; |
6110 | |
|
6111 | 0 | return eSpacing; |
6112 | 0 | } |
6113 | | |
6114 | | void TABText::SetTextSpacing(TABTextSpacing eSpacing) |
6115 | 17.7k | { |
6116 | | // Flush current value... default is TABTSSingle |
6117 | 17.7k | m_nTextAlignment &= ~0x1800; |
6118 | | // ... and set new one. |
6119 | 17.7k | if (eSpacing == TABTS1_5) |
6120 | 9.54k | m_nTextAlignment |= 0x0800; |
6121 | 8.19k | else if (eSpacing == TABTSDouble) |
6122 | 8.19k | m_nTextAlignment |= 0x1000; |
6123 | 17.7k | } |
6124 | | |
6125 | | /********************************************************************** |
6126 | | * TABText::GetTextLineType() |
6127 | | * |
6128 | | * Return text line (arrow) type. Default is TABTLNoLine |
6129 | | **********************************************************************/ |
6130 | | TABTextLineType TABText::GetTextLineType() const |
6131 | 0 | { |
6132 | 0 | TABTextLineType eLine = TABTLNoLine; |
6133 | |
|
6134 | 0 | if (m_nTextAlignment & 0x2000) |
6135 | 0 | eLine = TABTLSimple; |
6136 | 0 | else if (m_nTextAlignment & 0x4000) |
6137 | 0 | eLine = TABTLArrow; |
6138 | |
|
6139 | 0 | return eLine; |
6140 | 0 | } |
6141 | | |
6142 | | void TABText::SetTextLineType(TABTextLineType eLineType) |
6143 | 4.56k | { |
6144 | | // Flush current value... default is TABTLNoLine |
6145 | 4.56k | m_nTextAlignment &= ~0x6000; |
6146 | | // ... and set new one. |
6147 | 4.56k | if (eLineType == TABTLSimple) |
6148 | 4.18k | m_nTextAlignment |= 0x2000; |
6149 | 375 | else if (eLineType == TABTLArrow) |
6150 | 375 | m_nTextAlignment |= 0x4000; |
6151 | 4.56k | } |
6152 | | |
6153 | | /********************************************************************** |
6154 | | * TABText::QueryFontStyle() |
6155 | | * |
6156 | | * Return TRUE if the specified font style attribute is turned ON, |
6157 | | * or FALSE otherwise. See enum TABFontStyle for the list of styles |
6158 | | * that can be queried on. |
6159 | | **********************************************************************/ |
6160 | | GBool TABText::QueryFontStyle(TABFontStyle eStyleToQuery) const |
6161 | 7.42k | { |
6162 | 7.42k | return (m_nFontStyle & static_cast<int>(eStyleToQuery)) ? TRUE : FALSE; |
6163 | 7.42k | } |
6164 | | |
6165 | | void TABText::ToggleFontStyle(TABFontStyle eStyleToToggle, GBool bStyleOn) |
6166 | 6.64k | { |
6167 | 6.64k | if (bStyleOn) |
6168 | 6.64k | m_nFontStyle |= static_cast<int>(eStyleToToggle); |
6169 | 0 | else |
6170 | 0 | m_nFontStyle &= ~static_cast<int>(eStyleToToggle); |
6171 | 6.64k | } |
6172 | | |
6173 | | /********************************************************************** |
6174 | | * TABText::GetFontStyleMIFValue() |
6175 | | * |
6176 | | * Return the Font Style value for this object using the style values |
6177 | | * that are used in a MIF FONT() clause. See MIF specs (appendix A). |
6178 | | * |
6179 | | * The reason why we have to differentiate between the TAB and the MIF font |
6180 | | * style values is that in TAB, TABFSBox is included in the style value |
6181 | | * as code 0x100, but in MIF it is not included, instead it is implied by |
6182 | | * the presence of the BG color in the FONT() clause (the BG color is |
6183 | | * present only when TABFSBox or TABFSHalo is set). |
6184 | | * This also has the effect of shifting all the other style values > 0x100 |
6185 | | * by 1 byte. |
6186 | | **********************************************************************/ |
6187 | | int TABText::GetFontStyleMIFValue() const |
6188 | 0 | { |
6189 | | // The conversion is simply to remove bit 0x100 from the value and shift |
6190 | | // down all values past this bit. |
6191 | 0 | return (m_nFontStyle & 0xff) + (m_nFontStyle & (0xff00 - 0x0100)) / 2; |
6192 | 0 | } |
6193 | | |
6194 | | void TABText::SetFontStyleMIFValue(int nStyle, GBool bBGColorSet) |
6195 | 10.5k | { |
6196 | 10.5k | m_nFontStyle = static_cast<GInt16>((nStyle & 0xff) + (nStyle & 0x7f00) * 2); |
6197 | | // When BG color is set, then either BOX or HALO should be set. |
6198 | 10.5k | if (bBGColorSet && !QueryFontStyle(TABFSHalo)) |
6199 | 6.64k | ToggleFontStyle(TABFSBox, TRUE); |
6200 | 10.5k | } |
6201 | | |
6202 | | int TABText::IsFontBGColorUsed() const |
6203 | 0 | { |
6204 | | // Font BG color is used only when BOX is set. |
6205 | 0 | return QueryFontStyle(TABFSBox); |
6206 | 0 | } |
6207 | | |
6208 | | int TABText::IsFontOColorUsed() const |
6209 | 0 | { |
6210 | | // Font outline color is used only when HALO is set. |
6211 | 0 | return QueryFontStyle(TABFSHalo); |
6212 | 0 | } |
6213 | | |
6214 | | int TABText::IsFontSColorUsed() const |
6215 | 0 | { |
6216 | | // Font shadow color is used only when Shadow is set. |
6217 | 0 | return QueryFontStyle(TABFSShadow); |
6218 | 0 | } |
6219 | | |
6220 | | int TABText::IsFontBold() const |
6221 | 0 | { |
6222 | | // Font bold is used only when Bold is set. |
6223 | 0 | return QueryFontStyle(TABFSBold); |
6224 | 0 | } |
6225 | | |
6226 | | int TABText::IsFontItalic() const |
6227 | 0 | { |
6228 | | // Font italic is used only when Italic is set. |
6229 | 0 | return QueryFontStyle(TABFSItalic); |
6230 | 0 | } |
6231 | | |
6232 | | int TABText::IsFontUnderline() const |
6233 | 0 | { |
6234 | | // Font underline is used only when Underline is set. |
6235 | 0 | return QueryFontStyle(TABFSUnderline); |
6236 | 0 | } |
6237 | | |
6238 | | /********************************************************************** |
6239 | | * TABText::GetLabelStyleString() |
6240 | | * |
6241 | | * This is not the correct location, it should be in ITABFeatureFont, |
6242 | | * but it is really more easy to put it here. This fct return a complete |
6243 | | * string for the representation with the string to display |
6244 | | **********************************************************************/ |
6245 | | const char *TABText::GetLabelStyleString() const |
6246 | 0 | { |
6247 | 0 | const char *pszStyle = nullptr; |
6248 | 0 | int nStringLen = static_cast<int>(strlen(GetTextString())); |
6249 | | // ALL Caps, Extpanded need to modify the string value |
6250 | 0 | char *pszTextString = |
6251 | 0 | static_cast<char *>(CPLMalloc((nStringLen + 1) * sizeof(char))); |
6252 | | /* char szPattern[20]; */ |
6253 | 0 | int nJustification = 1; |
6254 | |
|
6255 | 0 | strcpy(pszTextString, GetTextString()); |
6256 | | /* szPattern[0] = '\0'; */ |
6257 | |
|
6258 | 0 | switch (GetTextJustification()) |
6259 | 0 | { |
6260 | 0 | case TABTJCenter: |
6261 | 0 | nJustification = 2; |
6262 | 0 | break; |
6263 | 0 | case TABTJRight: |
6264 | 0 | nJustification = 3; |
6265 | 0 | break; |
6266 | 0 | case TABTJLeft: |
6267 | 0 | default: |
6268 | 0 | nJustification = 1; |
6269 | 0 | break; |
6270 | 0 | } |
6271 | | |
6272 | | // Compute real font size, taking number of lines ("\\n", "\n") and line |
6273 | | // spacing into account. |
6274 | 0 | int numLines = 1; |
6275 | 0 | for (int i = 0; pszTextString[i]; |
6276 | 0 | numLines += |
6277 | 0 | ((pszTextString[i] == '\n' || |
6278 | 0 | (pszTextString[i] == '\\' && pszTextString[i + 1] == 'n')) && |
6279 | 0 | pszTextString[i + 1] != '\0'), |
6280 | 0 | ++i) |
6281 | 0 | ; |
6282 | |
|
6283 | 0 | double dHeight = GetTextBoxHeight() / numLines; |
6284 | | |
6285 | | // In all cases, take out 20% of font height to account for line spacing |
6286 | 0 | if (numLines > 1) |
6287 | 0 | { |
6288 | 0 | switch (GetTextSpacing()) |
6289 | 0 | { |
6290 | 0 | case TABTS1_5: |
6291 | 0 | dHeight *= (0.80 * 0.69); |
6292 | 0 | break; |
6293 | 0 | case TABTSDouble: |
6294 | 0 | dHeight *= (0.66 * 0.69); |
6295 | 0 | break; |
6296 | 0 | default: |
6297 | 0 | dHeight *= 0.69; |
6298 | 0 | } |
6299 | 0 | } |
6300 | 0 | else |
6301 | 0 | { |
6302 | 0 | dHeight *= 0.69; |
6303 | 0 | } |
6304 | | |
6305 | 0 | if (QueryFontStyle(TABFSAllCaps)) |
6306 | 0 | for (int i = 0; pszTextString[i]; ++i) |
6307 | 0 | if (isalpha(static_cast<unsigned char>(pszTextString[i]))) |
6308 | 0 | pszTextString[i] = static_cast<char>( |
6309 | 0 | CPLToupper(static_cast<unsigned char>(pszTextString[i]))); |
6310 | | |
6311 | | /* Escape the double quote chars and expand the text */ |
6312 | 0 | char *pszTmpTextString = nullptr; |
6313 | |
|
6314 | 0 | if (QueryFontStyle(TABFSExpanded)) |
6315 | 0 | pszTmpTextString = static_cast<char *>( |
6316 | 0 | CPLMalloc(((nStringLen * 4) + 1) * sizeof(char))); |
6317 | 0 | else |
6318 | 0 | pszTmpTextString = static_cast<char *>( |
6319 | 0 | CPLMalloc(((nStringLen * 2) + 1) * sizeof(char))); |
6320 | |
|
6321 | 0 | int j = 0; |
6322 | 0 | for (int i = 0; i < nStringLen; ++i, ++j) |
6323 | 0 | { |
6324 | 0 | if (pszTextString[i] == '"') |
6325 | 0 | { |
6326 | 0 | pszTmpTextString[j] = '\\'; |
6327 | 0 | pszTmpTextString[j + 1] = pszTextString[i]; |
6328 | 0 | ++j; |
6329 | 0 | } |
6330 | 0 | else |
6331 | 0 | pszTmpTextString[j] = pszTextString[i]; |
6332 | |
|
6333 | 0 | if (QueryFontStyle(TABFSExpanded)) |
6334 | 0 | { |
6335 | 0 | pszTmpTextString[j + 1] = ' '; |
6336 | 0 | ++j; |
6337 | 0 | } |
6338 | 0 | } |
6339 | |
|
6340 | 0 | pszTmpTextString[j] = '\0'; |
6341 | 0 | CPLFree(pszTextString); |
6342 | 0 | pszTextString = static_cast<char *>( |
6343 | 0 | CPLMalloc((strlen(pszTmpTextString) + 1) * sizeof(char))); |
6344 | 0 | strcpy(pszTextString, pszTmpTextString); |
6345 | 0 | CPLFree(pszTmpTextString); |
6346 | |
|
6347 | 0 | const char *pszBGColor = |
6348 | 0 | IsFontBGColorUsed() ? CPLSPrintf(",b:#%6.6x", GetFontBGColor()) : ""; |
6349 | 0 | const char *pszOColor = |
6350 | 0 | IsFontOColorUsed() ? CPLSPrintf(",o:#%6.6x", GetFontOColor()) : ""; |
6351 | 0 | const char *pszSColor = |
6352 | 0 | IsFontSColorUsed() ? CPLSPrintf(",h:#%6.6x", GetFontSColor()) : ""; |
6353 | 0 | const char *pszBold = IsFontBold() ? ",bo:1" : ""; |
6354 | 0 | const char *pszItalic = IsFontItalic() ? ",it:1" : ""; |
6355 | 0 | const char *pszUnderline = IsFontUnderline() ? ",un:1" : ""; |
6356 | |
|
6357 | 0 | pszStyle = CPLSPrintf( |
6358 | 0 | "LABEL(t:\"%s\",a:%f,s:%fg,c:#%6.6x%s%s%s%s%s%s,p:%d,f:\"%s\")", |
6359 | 0 | pszTextString, GetTextAngle(), dHeight, GetFontFGColor(), pszBGColor, |
6360 | 0 | pszOColor, pszSColor, pszBold, pszItalic, pszUnderline, nJustification, |
6361 | 0 | GetFontNameRef()); |
6362 | |
|
6363 | 0 | CPLFree(pszTextString); |
6364 | 0 | return pszStyle; |
6365 | 0 | } |
6366 | | |
6367 | | /********************************************************************** |
6368 | | * TABText::GetStyleString() const |
6369 | | * |
6370 | | * Return style string for this feature. |
6371 | | * |
6372 | | * Style String is built only once during the first call to GetStyleString(). |
6373 | | **********************************************************************/ |
6374 | | const char *TABText::GetStyleString() const |
6375 | 0 | { |
6376 | 0 | if (m_pszStyleString == nullptr) |
6377 | 0 | { |
6378 | 0 | m_pszStyleString = CPLStrdup(GetLabelStyleString()); |
6379 | 0 | } |
6380 | |
|
6381 | 0 | return m_pszStyleString; |
6382 | 0 | } |
6383 | | |
6384 | | void TABText::SetLabelFromStyleString(const char *pszStyleString) |
6385 | 0 | { |
6386 | | // Use the Style Manager to retrieve all the information we need. |
6387 | 0 | auto poStyleMgr = std::make_unique<OGRStyleMgr>(nullptr); |
6388 | 0 | std::unique_ptr<OGRStyleTool> poStylePart; |
6389 | | |
6390 | | // Init the StyleMgr with the StyleString. |
6391 | 0 | poStyleMgr->InitStyleString(pszStyleString); |
6392 | | |
6393 | | // Retrieve the Symbol info. |
6394 | 0 | const int numParts = poStyleMgr->GetPartCount(); |
6395 | 0 | for (int i = 0; i < numParts; i++) |
6396 | 0 | { |
6397 | 0 | poStylePart.reset(poStyleMgr->GetPart(i)); |
6398 | 0 | if (poStylePart == nullptr) |
6399 | 0 | { |
6400 | 0 | continue; |
6401 | 0 | } |
6402 | | |
6403 | 0 | if (poStylePart->GetType() == OGRSTCLabel) |
6404 | 0 | { |
6405 | 0 | break; |
6406 | 0 | } |
6407 | 0 | else |
6408 | 0 | { |
6409 | 0 | poStylePart.reset(); |
6410 | 0 | } |
6411 | 0 | } |
6412 | | |
6413 | | // If the no Symbol found, do nothing. |
6414 | 0 | if (poStylePart == nullptr) |
6415 | 0 | { |
6416 | 0 | return; |
6417 | 0 | } |
6418 | | |
6419 | 0 | auto poLabelStyle = cpl::down_cast<OGRStyleLabel *>(poStylePart.get()); |
6420 | |
|
6421 | 0 | GBool bIsNull = 0; |
6422 | 0 | const char *pszText = poLabelStyle->TextString(bIsNull); |
6423 | 0 | if (!bIsNull && pszText) |
6424 | 0 | { |
6425 | 0 | SetTextString(pszText); |
6426 | |
|
6427 | 0 | poLabelStyle->SetUnit(OGRSTUMM); |
6428 | 0 | double dfSize = poLabelStyle->Size(bIsNull); |
6429 | 0 | if (!bIsNull) |
6430 | 0 | { |
6431 | 0 | dfSize /= 1000; |
6432 | | |
6433 | | // Compute text box height, taking number of lines ("\\n", "\n") and |
6434 | | // line spacing into account. |
6435 | 0 | int numLines = 1; |
6436 | 0 | for (int i = 0; pszText[i]; |
6437 | 0 | numLines += ((pszText[i] == '\n' || |
6438 | 0 | (pszText[i] == '\\' && pszText[i + 1] == 'n')) && |
6439 | 0 | pszText[i + 1] != '\0'), |
6440 | 0 | ++i) |
6441 | 0 | ; |
6442 | | |
6443 | | // Cf GetLabelStyleString() for 0.69. We should likely also take |
6444 | | // into account line spacing if we knew how to compute it. |
6445 | 0 | SetTextBoxHeight(dfSize / 0.69 * numLines); |
6446 | 0 | } |
6447 | 0 | } |
6448 | |
|
6449 | 0 | if (poLabelStyle->Bold(bIsNull)) |
6450 | 0 | ToggleFontStyle(TABFSBold, true); |
6451 | |
|
6452 | 0 | if (poLabelStyle->Italic(bIsNull)) |
6453 | 0 | ToggleFontStyle(TABFSItalic, true); |
6454 | |
|
6455 | 0 | if (poLabelStyle->Underline(bIsNull)) |
6456 | 0 | ToggleFontStyle(TABFSUnderline, true); |
6457 | |
|
6458 | 0 | const char *pszFontName = poLabelStyle->FontName(bIsNull); |
6459 | 0 | if (!bIsNull && pszFontName) |
6460 | 0 | SetFontName(pszFontName); |
6461 | | |
6462 | | // Set the ForeColor |
6463 | 0 | const char *pszForeColor = poLabelStyle->ForeColor(bIsNull); |
6464 | 0 | if (bIsNull) |
6465 | 0 | pszForeColor = nullptr; |
6466 | 0 | if (pszForeColor) |
6467 | 0 | { |
6468 | 0 | if (pszForeColor[0] == '#') |
6469 | 0 | pszForeColor++; |
6470 | 0 | CPLString osForeColor(pszForeColor); |
6471 | 0 | if (strlen(pszForeColor) > 6) |
6472 | 0 | osForeColor.resize(6); |
6473 | 0 | const int nColor = static_cast<int>(strtol(osForeColor, nullptr, 16)); |
6474 | 0 | SetFontFGColor(static_cast<GInt32>(nColor)); |
6475 | 0 | } |
6476 | | |
6477 | | // Set the BackgroundColor |
6478 | 0 | const char *pszBackColor = poLabelStyle->BackColor(bIsNull); |
6479 | 0 | if (bIsNull) |
6480 | 0 | pszBackColor = nullptr; |
6481 | 0 | if (pszBackColor) |
6482 | 0 | { |
6483 | 0 | if (pszBackColor[0] == '#') |
6484 | 0 | pszBackColor++; |
6485 | 0 | CPLString osBackColor(pszBackColor); |
6486 | 0 | if (strlen(pszBackColor) > 6) |
6487 | 0 | osBackColor.resize(6); |
6488 | 0 | const int nColor = static_cast<int>(strtol(osBackColor, nullptr, 16)); |
6489 | 0 | ToggleFontStyle(TABFSBox, true); |
6490 | 0 | SetFontBGColor(static_cast<GInt32>(nColor)); |
6491 | 0 | } |
6492 | | |
6493 | | // Set the OutlineColor |
6494 | 0 | const char *pszOutlineColor = poLabelStyle->OutlineColor(bIsNull); |
6495 | 0 | if (bIsNull) |
6496 | 0 | pszOutlineColor = nullptr; |
6497 | 0 | if (pszOutlineColor) |
6498 | 0 | { |
6499 | 0 | if (pszOutlineColor[0] == '#') |
6500 | 0 | pszOutlineColor++; |
6501 | 0 | CPLString osOutlineColor(pszOutlineColor); |
6502 | 0 | if (strlen(pszOutlineColor) > 6) |
6503 | 0 | osOutlineColor.resize(6); |
6504 | 0 | const int nColor = |
6505 | 0 | static_cast<int>(strtol(osOutlineColor, nullptr, 16)); |
6506 | 0 | ToggleFontStyle(TABFSHalo, true); |
6507 | 0 | SetFontOColor(static_cast<GInt32>(nColor)); |
6508 | 0 | } |
6509 | |
|
6510 | | #if 0 |
6511 | | // Commented out since it is hardcoded to 0x808080. |
6512 | | // Set the ShadowColor |
6513 | | const char* pszShadowColor = poLabelStyle->ShadowColor(bIsNull); |
6514 | | if(bIsNull) pszShadowColor = nullptr; |
6515 | | if(pszShadowColor) |
6516 | | { |
6517 | | if(pszShadowColor[0] == '#') |
6518 | | pszShadowColor++; |
6519 | | CPLString osShadowColor(pszShadowColor); |
6520 | | if( strlen(pszShadowColor) > 6 ) |
6521 | | osShadowColor.resize(6); |
6522 | | const int nColor = |
6523 | | static_cast<int>(strtol(osShadowColor, nullptr, 16)); |
6524 | | ToggleFontStyle(TABFSShadow, true); |
6525 | | SetFontSColor(static_cast<GInt32>(nColor)); |
6526 | | } |
6527 | | #endif |
6528 | |
|
6529 | 0 | const double dfAngle = poLabelStyle->Angle(bIsNull); |
6530 | 0 | if (!bIsNull) |
6531 | 0 | SetTextAngle(dfAngle); |
6532 | |
|
6533 | 0 | const int nAnchor = poLabelStyle->Anchor(bIsNull); |
6534 | 0 | if (!bIsNull) |
6535 | 0 | { |
6536 | 0 | switch ((nAnchor - 1) % 3) |
6537 | 0 | { |
6538 | 0 | case 0: |
6539 | 0 | SetTextJustification(TABTJLeft); |
6540 | 0 | break; |
6541 | 0 | case 1: |
6542 | 0 | SetTextJustification(TABTJCenter); |
6543 | 0 | break; |
6544 | 0 | default /* 2 */: |
6545 | 0 | SetTextJustification(TABTJRight); |
6546 | 0 | break; |
6547 | 0 | } |
6548 | 0 | } |
6549 | 0 | } |
6550 | | |
6551 | | /********************************************************************** |
6552 | | * TABText::DumpMIF() |
6553 | | * |
6554 | | * Dump feature geometry in a format similar to .MIF REGIONs. |
6555 | | **********************************************************************/ |
6556 | | void TABText::DumpMIF(FILE *fpOut /*=NULL*/) |
6557 | 0 | { |
6558 | 0 | if (fpOut == nullptr) |
6559 | 0 | fpOut = stdout; |
6560 | | |
6561 | | /*----------------------------------------------------------------- |
6562 | | * Fetch and validate geometry |
6563 | | *----------------------------------------------------------------*/ |
6564 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
6565 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint) |
6566 | 0 | { |
6567 | | /*------------------------------------------------------------- |
6568 | | * Generate output for text object |
6569 | | *------------------------------------------------------------*/ |
6570 | 0 | OGRPoint *poPoint = poGeom->toPoint(); |
6571 | |
|
6572 | 0 | fprintf(fpOut, "TEXT \"%s\" %.15g %.15g\n", |
6573 | 0 | m_pszString ? m_pszString : "", poPoint->getX(), |
6574 | 0 | poPoint->getY()); |
6575 | |
|
6576 | 0 | fprintf(fpOut, " m_pszString = '%s'\n", m_pszString); |
6577 | 0 | fprintf(fpOut, " m_dAngle = %.15g\n", m_dAngle); |
6578 | 0 | fprintf(fpOut, " m_dHeight = %.15g\n", m_dHeight); |
6579 | 0 | fprintf(fpOut, " m_rgbForeground = 0x%6.6x (%d)\n", m_rgbForeground, |
6580 | 0 | m_rgbForeground); |
6581 | 0 | fprintf(fpOut, " m_rgbBackground = 0x%6.6x (%d)\n", m_rgbBackground, |
6582 | 0 | m_rgbBackground); |
6583 | 0 | fprintf(fpOut, " m_nTextAlignment = 0x%4.4x\n", m_nTextAlignment); |
6584 | 0 | fprintf(fpOut, " m_nFontStyle = 0x%4.4x\n", m_nFontStyle); |
6585 | 0 | } |
6586 | 0 | else |
6587 | 0 | { |
6588 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
6589 | 0 | "TABText: Missing or Invalid Geometry!"); |
6590 | 0 | return; |
6591 | 0 | } |
6592 | | |
6593 | | // Finish with PEN/BRUSH/etc. clauses |
6594 | 0 | DumpPenDef(); |
6595 | 0 | DumpFontDef(); |
6596 | |
|
6597 | 0 | fflush(fpOut); |
6598 | 0 | } |
6599 | | |
6600 | | /*===================================================================== |
6601 | | * class TABMultiPoint |
6602 | | *====================================================================*/ |
6603 | | |
6604 | | /********************************************************************** |
6605 | | * TABMultiPoint::TABMultiPoint() |
6606 | | * |
6607 | | * Constructor. |
6608 | | **********************************************************************/ |
6609 | | TABMultiPoint::TABMultiPoint(const OGRFeatureDefn *poDefnIn) |
6610 | 43.2k | : TABFeature(poDefnIn), m_bCenterIsSet(FALSE), m_dCenterX(0.0), |
6611 | 43.2k | m_dCenterY(0.0) |
6612 | 43.2k | { |
6613 | 43.2k | } |
6614 | | |
6615 | | /********************************************************************** |
6616 | | * TABMultiPoint::~TABMultiPoint() |
6617 | | * |
6618 | | * Destructor. |
6619 | | **********************************************************************/ |
6620 | | TABMultiPoint::~TABMultiPoint() |
6621 | 43.2k | { |
6622 | 43.2k | } |
6623 | | |
6624 | | /********************************************************************** |
6625 | | * TABMultiPoint::CloneTABFeature() |
6626 | | * |
6627 | | * Duplicate feature, including stuff specific to each TABFeature type. |
6628 | | * |
6629 | | * This method calls the generic TABFeature::CloneTABFeature() and |
6630 | | * then copies any members specific to its own type. |
6631 | | **********************************************************************/ |
6632 | | TABFeature * |
6633 | | TABMultiPoint::CloneTABFeature(const OGRFeatureDefn *poNewDefn /*=NULL*/) |
6634 | 0 | { |
6635 | | /*----------------------------------------------------------------- |
6636 | | * Alloc new feature and copy the base stuff |
6637 | | *----------------------------------------------------------------*/ |
6638 | 0 | TABMultiPoint *poNew = |
6639 | 0 | new TABMultiPoint(poNewDefn ? poNewDefn : GetDefnRef()); |
6640 | |
|
6641 | 0 | CopyTABFeatureBase(poNew); |
6642 | | |
6643 | | /*----------------------------------------------------------------- |
6644 | | * And members specific to this class |
6645 | | *----------------------------------------------------------------*/ |
6646 | | // ITABFeatureSymbol |
6647 | 0 | *(poNew->GetSymbolDefRef()) = *GetSymbolDefRef(); |
6648 | |
|
6649 | 0 | poNew->m_bCenterIsSet = m_bCenterIsSet; |
6650 | 0 | poNew->m_dCenterX = m_dCenterX; |
6651 | 0 | poNew->m_dCenterY = m_dCenterY; |
6652 | |
|
6653 | 0 | return poNew; |
6654 | 0 | } |
6655 | | |
6656 | | /********************************************************************** |
6657 | | * TABMultiPoint::ValidateMapInfoType() |
6658 | | * |
6659 | | * Check the feature's geometry part and return the corresponding |
6660 | | * mapinfo object type code. The m_nMapInfoType member will also |
6661 | | * be updated for further calls to GetMapInfoType(); |
6662 | | * |
6663 | | * Returns TAB_GEOM_NONE if the geometry is not compatible with what |
6664 | | * is expected for this object class. |
6665 | | **********************************************************************/ |
6666 | | TABGeomType TABMultiPoint::ValidateMapInfoType(TABMAPFile *poMapFile /*=NULL*/) |
6667 | 0 | { |
6668 | | /*----------------------------------------------------------------- |
6669 | | * Fetch and validate geometry |
6670 | | *----------------------------------------------------------------*/ |
6671 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
6672 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbMultiPoint) |
6673 | 0 | { |
6674 | 0 | OGRMultiPoint *poMPoint = poGeom->toMultiPoint(); |
6675 | |
|
6676 | 0 | if (poMPoint->getNumGeometries() > TAB_MULTIPOINT_650_MAX_VERTICES) |
6677 | 0 | m_nMapInfoType = TAB_GEOM_V800_MULTIPOINT; |
6678 | 0 | else |
6679 | 0 | m_nMapInfoType = TAB_GEOM_MULTIPOINT; |
6680 | 0 | } |
6681 | 0 | else |
6682 | 0 | { |
6683 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
6684 | 0 | "TABMultiPoint: Missing or Invalid Geometry!"); |
6685 | 0 | m_nMapInfoType = TAB_GEOM_NONE; |
6686 | 0 | } |
6687 | | |
6688 | | /*----------------------------------------------------------------- |
6689 | | * Decide if coordinates should be compressed or not. |
6690 | | *----------------------------------------------------------------*/ |
6691 | 0 | ValidateCoordType(poMapFile); |
6692 | |
|
6693 | 0 | return m_nMapInfoType; |
6694 | 0 | } |
6695 | | |
6696 | | /********************************************************************** |
6697 | | * TABMultiPoint::ReadGeometryFromMAPFile() |
6698 | | * |
6699 | | * Fill the geometry and representation (color, etc...) part of the |
6700 | | * feature from the contents of the .MAP object pointed to by poMAPFile. |
6701 | | * |
6702 | | * It is assumed that poMAPFile currently points to the beginning of |
6703 | | * a map object. |
6704 | | * |
6705 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
6706 | | * been called. |
6707 | | **********************************************************************/ |
6708 | | int TABMultiPoint::ReadGeometryFromMAPFile( |
6709 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
6710 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
6711 | | TABMAPCoordBlock **ppoCoordBlock /*=NULL*/) |
6712 | 33 | { |
6713 | 33 | double dXMin = 0.0; |
6714 | 33 | double dYMin = 0.0; |
6715 | 33 | double dXMax = 0.0; |
6716 | 33 | double dYMax = 0.0; |
6717 | 33 | OGRGeometry *poGeometry = nullptr; |
6718 | 33 | GBool bComprCoord = poObjHdr->IsCompressedType(); |
6719 | 33 | TABMAPCoordBlock *poCoordBlock = nullptr; |
6720 | | |
6721 | | /*----------------------------------------------------------------- |
6722 | | * Fetch and validate geometry type |
6723 | | *----------------------------------------------------------------*/ |
6724 | 33 | m_nMapInfoType = poObjHdr->m_nType; |
6725 | | |
6726 | | /*----------------------------------------------------------------- |
6727 | | * Read object information |
6728 | | *----------------------------------------------------------------*/ |
6729 | 33 | if (m_nMapInfoType == TAB_GEOM_MULTIPOINT || |
6730 | 22 | m_nMapInfoType == TAB_GEOM_MULTIPOINT_C || |
6731 | 0 | m_nMapInfoType == TAB_GEOM_V800_MULTIPOINT || |
6732 | 0 | m_nMapInfoType == TAB_GEOM_V800_MULTIPOINT_C) |
6733 | 33 | { |
6734 | | /*------------------------------------------------------------- |
6735 | | * Copy data from poObjHdr |
6736 | | *------------------------------------------------------------*/ |
6737 | 33 | TABMAPObjMultiPoint *poMPointHdr = |
6738 | 33 | cpl::down_cast<TABMAPObjMultiPoint *>(poObjHdr); |
6739 | | |
6740 | 33 | const GUInt32 nMinimumBytesForPoints = |
6741 | 33 | (bComprCoord ? 4 : 8) * poMPointHdr->m_nNumPoints; |
6742 | 33 | if (nMinimumBytesForPoints > 1024 * 1024 && |
6743 | 0 | nMinimumBytesForPoints > poMapFile->GetFileSize()) |
6744 | 0 | { |
6745 | 0 | CPLError(CE_Failure, CPLE_AppDefined, "Too many points"); |
6746 | 0 | return -1; |
6747 | 0 | } |
6748 | | |
6749 | | // MBR |
6750 | 33 | poMapFile->Int2Coordsys(poMPointHdr->m_nMinX, poMPointHdr->m_nMinY, |
6751 | 33 | dXMin, dYMin); |
6752 | 33 | poMapFile->Int2Coordsys(poMPointHdr->m_nMaxX, poMPointHdr->m_nMaxY, |
6753 | 33 | dXMax, dYMax); |
6754 | | |
6755 | 33 | if (!bCoordBlockDataOnly) |
6756 | 33 | { |
6757 | 33 | m_nSymbolDefIndex = poMPointHdr->m_nSymbolId; // Symbol index |
6758 | 33 | poMapFile->ReadSymbolDef(m_nSymbolDefIndex, &m_sSymbolDef); |
6759 | 33 | } |
6760 | | |
6761 | 33 | double dX = 0.0; |
6762 | 33 | double dY = 0.0; |
6763 | | // Centroid/label point |
6764 | 33 | poMapFile->Int2Coordsys(poMPointHdr->m_nLabelX, poMPointHdr->m_nLabelY, |
6765 | 33 | dX, dY); |
6766 | 33 | SetCenter(dX, dY); |
6767 | | |
6768 | | // Compressed coordinate origin (useful only in compressed case!) |
6769 | 33 | m_nComprOrgX = poMPointHdr->m_nComprOrgX; |
6770 | 33 | m_nComprOrgY = poMPointHdr->m_nComprOrgY; |
6771 | | |
6772 | | /*------------------------------------------------------------- |
6773 | | * Read Point Coordinates |
6774 | | *------------------------------------------------------------*/ |
6775 | 33 | OGRMultiPoint *poMultiPoint = new OGRMultiPoint(); |
6776 | 33 | poGeometry = poMultiPoint; |
6777 | | |
6778 | 33 | if (ppoCoordBlock != nullptr && *ppoCoordBlock != nullptr) |
6779 | 12 | poCoordBlock = *ppoCoordBlock; |
6780 | 21 | else |
6781 | 21 | poCoordBlock = |
6782 | 21 | poMapFile->GetCoordBlock(poMPointHdr->m_nCoordBlockPtr); |
6783 | 33 | if (poCoordBlock == nullptr) |
6784 | 2 | { |
6785 | 2 | delete poGeometry; |
6786 | 2 | return -1; |
6787 | 2 | } |
6788 | 31 | poCoordBlock->SetComprCoordOrigin(m_nComprOrgX, m_nComprOrgY); |
6789 | | |
6790 | 96 | for (int iPoint = 0; iPoint < poMPointHdr->m_nNumPoints; iPoint++) |
6791 | 66 | { |
6792 | 66 | GInt32 nX = 0; |
6793 | 66 | GInt32 nY = 0; |
6794 | 66 | if (poCoordBlock->ReadIntCoord(bComprCoord, nX, nY) != 0) |
6795 | 1 | { |
6796 | 1 | CPLError(CE_Failure, CPLE_FileIO, |
6797 | 1 | "Failed reading coordinate data at offset %d", |
6798 | 1 | poMPointHdr->m_nCoordBlockPtr); |
6799 | 1 | delete poGeometry; |
6800 | 1 | return -1; |
6801 | 1 | } |
6802 | | |
6803 | 65 | poMapFile->Int2Coordsys(nX, nY, dX, dY); |
6804 | 65 | OGRPoint *poPoint = new OGRPoint(dX, dY); |
6805 | | |
6806 | 65 | if (poMultiPoint->addGeometryDirectly(poPoint) != OGRERR_NONE) |
6807 | 0 | { |
6808 | 0 | CPLAssert(false); // Just in case lower-level lib is modified |
6809 | 0 | } |
6810 | 65 | } |
6811 | 31 | } |
6812 | 0 | else |
6813 | 0 | { |
6814 | 0 | CPLError( |
6815 | 0 | CE_Failure, CPLE_AssertionFailed, |
6816 | 0 | "ReadGeometryFromMAPFile(): unsupported geometry type %d (0x%2.2x)", |
6817 | 0 | m_nMapInfoType, m_nMapInfoType); |
6818 | 0 | return -1; |
6819 | 0 | } |
6820 | | |
6821 | 30 | SetGeometryDirectly(poGeometry); |
6822 | | |
6823 | 30 | SetMBR(dXMin, dYMin, dXMax, dYMax); |
6824 | | |
6825 | | /* Copy int MBR to feature class members */ |
6826 | 30 | SetIntMBR(poObjHdr->m_nMinX, poObjHdr->m_nMinY, poObjHdr->m_nMaxX, |
6827 | 30 | poObjHdr->m_nMaxY); |
6828 | | |
6829 | | /* Return a ref to coord block so that caller can continue reading |
6830 | | * after the end of this object (used by TABCollection and index splitting) |
6831 | | */ |
6832 | 30 | if (ppoCoordBlock) |
6833 | 12 | *ppoCoordBlock = poCoordBlock; |
6834 | | |
6835 | 30 | return 0; |
6836 | 33 | } |
6837 | | |
6838 | | /********************************************************************** |
6839 | | * TABMultiPoint::WriteGeometryToMAPFile() |
6840 | | * |
6841 | | * Write the geometry and representation (color, etc...) part of the |
6842 | | * feature to the .MAP object pointed to by poMAPFile. |
6843 | | * |
6844 | | * It is assumed that poMAPFile currently points to a valid map object. |
6845 | | * |
6846 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
6847 | | * been called. |
6848 | | **********************************************************************/ |
6849 | | int TABMultiPoint::WriteGeometryToMAPFile( |
6850 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
6851 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
6852 | | TABMAPCoordBlock **ppoCoordBlock /*=NULL*/) |
6853 | 0 | { |
6854 | 0 | GInt32 nX, nY; |
6855 | | |
6856 | | /*----------------------------------------------------------------- |
6857 | | * We assume that ValidateMapInfoType() was called already and that |
6858 | | * the type in poObjHdr->m_nType is valid. |
6859 | | *----------------------------------------------------------------*/ |
6860 | 0 | CPLAssert(m_nMapInfoType == poObjHdr->m_nType); |
6861 | |
|
6862 | 0 | TABMAPObjMultiPoint *poMPointHdr = |
6863 | 0 | cpl::down_cast<TABMAPObjMultiPoint *>(poObjHdr); |
6864 | | |
6865 | | /*----------------------------------------------------------------- |
6866 | | * Fetch and validate geometry |
6867 | | *----------------------------------------------------------------*/ |
6868 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
6869 | 0 | OGRMultiPoint *poMPoint = nullptr; |
6870 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbMultiPoint) |
6871 | 0 | poMPoint = poGeom->toMultiPoint(); |
6872 | 0 | else |
6873 | 0 | { |
6874 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
6875 | 0 | "TABMultiPoint: Missing or Invalid Geometry!"); |
6876 | 0 | return -1; |
6877 | 0 | } |
6878 | | |
6879 | 0 | poMPointHdr->m_nNumPoints = poMPoint->getNumGeometries(); |
6880 | | |
6881 | | /*----------------------------------------------------------------- |
6882 | | * Write data to coordinate block |
6883 | | *----------------------------------------------------------------*/ |
6884 | 0 | const GBool bCompressed = poObjHdr->IsCompressedType(); |
6885 | |
|
6886 | 0 | TABMAPCoordBlock *poCoordBlock = nullptr; |
6887 | 0 | if (ppoCoordBlock != nullptr && *ppoCoordBlock != nullptr) |
6888 | 0 | poCoordBlock = *ppoCoordBlock; |
6889 | 0 | else |
6890 | 0 | poCoordBlock = poMapFile->GetCurCoordBlock(); |
6891 | 0 | poCoordBlock->StartNewFeature(); |
6892 | 0 | poMPointHdr->m_nCoordBlockPtr = poCoordBlock->GetCurAddress(); |
6893 | 0 | poCoordBlock->SetComprCoordOrigin(m_nComprOrgX, m_nComprOrgY); |
6894 | |
|
6895 | 0 | for (int iPoint = 0, nStatus = 0; |
6896 | 0 | nStatus == 0 && iPoint < poMPointHdr->m_nNumPoints; iPoint++) |
6897 | 0 | { |
6898 | 0 | poGeom = poMPoint->getGeometryRef(iPoint); |
6899 | |
|
6900 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint) |
6901 | 0 | { |
6902 | 0 | OGRPoint *poPoint = poGeom->toPoint(); |
6903 | |
|
6904 | 0 | poMapFile->Coordsys2Int(poPoint->getX(), poPoint->getY(), nX, nY); |
6905 | 0 | if (iPoint == 0) |
6906 | 0 | { |
6907 | | // Default to the first point, we may use explicit value below |
6908 | 0 | poMPointHdr->m_nLabelX = nX; |
6909 | 0 | poMPointHdr->m_nLabelY = nY; |
6910 | 0 | } |
6911 | |
|
6912 | 0 | if ((nStatus = poCoordBlock->WriteIntCoord(nX, nY, bCompressed)) != |
6913 | 0 | 0) |
6914 | 0 | { |
6915 | | // Failed ... error message has already been produced |
6916 | 0 | return nStatus; |
6917 | 0 | } |
6918 | 0 | } |
6919 | 0 | else |
6920 | 0 | { |
6921 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
6922 | 0 | "TABMultiPoint: Invalid Geometry, expecting OGRPoint!"); |
6923 | 0 | return -1; |
6924 | 0 | } |
6925 | 0 | } |
6926 | | |
6927 | | /*----------------------------------------------------------------- |
6928 | | * Copy object information |
6929 | | *----------------------------------------------------------------*/ |
6930 | | |
6931 | | // Compressed coordinate origin (useful only in compressed case!) |
6932 | 0 | poMPointHdr->m_nComprOrgX = m_nComprOrgX; |
6933 | 0 | poMPointHdr->m_nComprOrgY = m_nComprOrgY; |
6934 | |
|
6935 | 0 | poMPointHdr->m_nCoordDataSize = poCoordBlock->GetFeatureDataSize(); |
6936 | 0 | poMPointHdr->SetMBR(m_nXMin, m_nYMin, m_nXMax, m_nYMax); |
6937 | | |
6938 | | // Center/label point (default value already set above) |
6939 | 0 | double dX = 0.0; |
6940 | 0 | double dY = 0.0; |
6941 | 0 | if (GetCenter(dX, dY) != -1) |
6942 | 0 | { |
6943 | 0 | poMapFile->Coordsys2Int(dX, dY, poMPointHdr->m_nLabelX, |
6944 | 0 | poMPointHdr->m_nLabelY); |
6945 | 0 | } |
6946 | |
|
6947 | 0 | if (!bCoordBlockDataOnly) |
6948 | 0 | { |
6949 | 0 | m_nSymbolDefIndex = poMapFile->WriteSymbolDef(&m_sSymbolDef); |
6950 | 0 | poMPointHdr->m_nSymbolId = |
6951 | 0 | static_cast<GByte>(m_nSymbolDefIndex); // Symbol index |
6952 | 0 | } |
6953 | |
|
6954 | 0 | if (CPLGetLastErrorType() == CE_Failure) |
6955 | 0 | return -1; |
6956 | | |
6957 | | /* Return a ref to coord block so that caller can continue writing |
6958 | | * after the end of this object (used by index splitting) |
6959 | | */ |
6960 | 0 | if (ppoCoordBlock) |
6961 | 0 | *ppoCoordBlock = poCoordBlock; |
6962 | |
|
6963 | 0 | return 0; |
6964 | 0 | } |
6965 | | |
6966 | | /********************************************************************** |
6967 | | * TABMultiPoint::GetXY() |
6968 | | * |
6969 | | * Return this point's X,Y coordinates. |
6970 | | **********************************************************************/ |
6971 | | int TABMultiPoint::GetXY(int i, double &dX, double &dY) |
6972 | 0 | { |
6973 | | /*----------------------------------------------------------------- |
6974 | | * Fetch and validate geometry |
6975 | | *----------------------------------------------------------------*/ |
6976 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
6977 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbMultiPoint) |
6978 | 0 | { |
6979 | 0 | OGRMultiPoint *poMPoint = poGeom->toMultiPoint(); |
6980 | |
|
6981 | 0 | if (i >= 0 && i < poMPoint->getNumGeometries() && |
6982 | 0 | (poGeom = poMPoint->getGeometryRef(i)) != nullptr && |
6983 | 0 | wkbFlatten(poGeom->getGeometryType()) == wkbPoint) |
6984 | 0 | { |
6985 | 0 | OGRPoint *poPoint = poGeom->toPoint(); |
6986 | |
|
6987 | 0 | dX = poPoint->getX(); |
6988 | 0 | dY = poPoint->getY(); |
6989 | 0 | } |
6990 | 0 | } |
6991 | 0 | else |
6992 | 0 | { |
6993 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
6994 | 0 | "TABMultiPoint: Missing or Invalid Geometry!"); |
6995 | 0 | dX = 0.0; |
6996 | 0 | dY = 0.0; |
6997 | 0 | return -1; |
6998 | 0 | } |
6999 | | |
7000 | 0 | return 0; |
7001 | 0 | } |
7002 | | |
7003 | | /********************************************************************** |
7004 | | * TABMultiPoint::GetNumPoints() |
7005 | | * |
7006 | | * Return the number of points in this multipoint object |
7007 | | **********************************************************************/ |
7008 | | int TABMultiPoint::GetNumPoints() |
7009 | 0 | { |
7010 | | /*----------------------------------------------------------------- |
7011 | | * Fetch and validate geometry |
7012 | | *----------------------------------------------------------------*/ |
7013 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
7014 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbMultiPoint) |
7015 | 0 | { |
7016 | 0 | OGRMultiPoint *poMPoint = poGeom->toMultiPoint(); |
7017 | |
|
7018 | 0 | return poMPoint->getNumGeometries(); |
7019 | 0 | } |
7020 | 0 | else |
7021 | 0 | { |
7022 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
7023 | 0 | "TABMultiPoint: Missing or Invalid Geometry!"); |
7024 | 0 | return 0; |
7025 | 0 | } |
7026 | 0 | } |
7027 | | |
7028 | | /********************************************************************** |
7029 | | * TABMultiPoint::GetStyleString() const |
7030 | | * |
7031 | | * Return style string for this feature. |
7032 | | * |
7033 | | * Style String is built only once during the first call to GetStyleString(). |
7034 | | **********************************************************************/ |
7035 | | const char *TABMultiPoint::GetStyleString() const |
7036 | 0 | { |
7037 | 0 | if (m_pszStyleString == nullptr) |
7038 | 0 | { |
7039 | 0 | m_pszStyleString = CPLStrdup(GetSymbolStyleString()); |
7040 | 0 | } |
7041 | |
|
7042 | 0 | return m_pszStyleString; |
7043 | 0 | } |
7044 | | |
7045 | | /********************************************************************** |
7046 | | * TABMultiPoint::GetCenter() |
7047 | | * |
7048 | | * Returns the center point (or label point?) of the object. Compute one |
7049 | | * if it was not explicitly set: |
7050 | | * |
7051 | | * The default seems to be to use the first point in the collection as |
7052 | | * the center.. so we'll use that. |
7053 | | * |
7054 | | * Returns 0 on success, -1 on error. |
7055 | | **********************************************************************/ |
7056 | | int TABMultiPoint::GetCenter(double &dX, double &dY) |
7057 | 0 | { |
7058 | 0 | if (!m_bCenterIsSet && GetNumPoints() > 0) |
7059 | 0 | { |
7060 | | // The default seems to be to use the first point in the collection |
7061 | | // as the center... so we'll use that. |
7062 | 0 | if (GetXY(0, m_dCenterX, m_dCenterY) == 0) |
7063 | 0 | m_bCenterIsSet = TRUE; |
7064 | 0 | } |
7065 | |
|
7066 | 0 | if (!m_bCenterIsSet) |
7067 | 0 | return -1; |
7068 | | |
7069 | 0 | dX = m_dCenterX; |
7070 | 0 | dY = m_dCenterY; |
7071 | 0 | return 0; |
7072 | 0 | } |
7073 | | |
7074 | | /********************************************************************** |
7075 | | * TABMultiPoint::SetCenter() |
7076 | | * |
7077 | | * Set the X,Y coordinates to use as center point (or label point?) |
7078 | | **********************************************************************/ |
7079 | | void TABMultiPoint::SetCenter(double dX, double dY) |
7080 | 19.9k | { |
7081 | 19.9k | m_dCenterX = dX; |
7082 | 19.9k | m_dCenterY = dY; |
7083 | 19.9k | m_bCenterIsSet = TRUE; |
7084 | 19.9k | } |
7085 | | |
7086 | | /********************************************************************** |
7087 | | * TABMultiPoint::DumpMIF() |
7088 | | * |
7089 | | * Dump feature geometry in a format similar to .MIF POINTs. |
7090 | | **********************************************************************/ |
7091 | | void TABMultiPoint::DumpMIF(FILE *fpOut /*=NULL*/) |
7092 | 0 | { |
7093 | 0 | if (fpOut == nullptr) |
7094 | 0 | fpOut = stdout; |
7095 | | |
7096 | | /*----------------------------------------------------------------- |
7097 | | * Fetch and validate geometry |
7098 | | *----------------------------------------------------------------*/ |
7099 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
7100 | 0 | OGRMultiPoint *poMPoint = nullptr; |
7101 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbMultiPoint) |
7102 | 0 | poMPoint = poGeom->toMultiPoint(); |
7103 | 0 | else |
7104 | 0 | { |
7105 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
7106 | 0 | "TABMultiPoint: Missing or Invalid Geometry!"); |
7107 | 0 | return; |
7108 | 0 | } |
7109 | | |
7110 | | /*----------------------------------------------------------------- |
7111 | | * Generate output |
7112 | | *----------------------------------------------------------------*/ |
7113 | 0 | fprintf(fpOut, "MULTIPOINT %d\n", poMPoint->getNumGeometries()); |
7114 | |
|
7115 | 0 | for (int iPoint = 0; iPoint < poMPoint->getNumGeometries(); iPoint++) |
7116 | 0 | { |
7117 | 0 | poGeom = poMPoint->getGeometryRef(iPoint); |
7118 | |
|
7119 | 0 | if (poGeom && wkbFlatten(poGeom->getGeometryType()) == wkbPoint) |
7120 | 0 | { |
7121 | 0 | OGRPoint *poPoint = poGeom->toPoint(); |
7122 | 0 | fprintf(fpOut, " %.15g %.15g\n", poPoint->getX(), poPoint->getY()); |
7123 | 0 | } |
7124 | 0 | else |
7125 | 0 | { |
7126 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
7127 | 0 | "TABMultiPoint: Invalid Geometry, expecting OGRPoint!"); |
7128 | 0 | return; |
7129 | 0 | } |
7130 | 0 | } |
7131 | | |
7132 | 0 | DumpSymbolDef(fpOut); |
7133 | |
|
7134 | 0 | if (m_bCenterIsSet) |
7135 | 0 | fprintf(fpOut, "Center %.15g %.15g\n", m_dCenterX, m_dCenterY); |
7136 | |
|
7137 | 0 | fflush(fpOut); |
7138 | 0 | } |
7139 | | |
7140 | | /*===================================================================== |
7141 | | * class TABCollection |
7142 | | *====================================================================*/ |
7143 | | |
7144 | | /********************************************************************** |
7145 | | * TABCollection::TABCollection() |
7146 | | * |
7147 | | * Constructor. |
7148 | | **********************************************************************/ |
7149 | | TABCollection::TABCollection(const OGRFeatureDefn *poDefnIn) |
7150 | 29.8k | : TABFeature(poDefnIn), m_poRegion(nullptr), m_poPline(nullptr), |
7151 | 29.8k | m_poMpoint(nullptr) |
7152 | 29.8k | { |
7153 | 29.8k | } |
7154 | | |
7155 | | /********************************************************************** |
7156 | | * TABCollection::~TABCollection() |
7157 | | * |
7158 | | * Destructor. |
7159 | | **********************************************************************/ |
7160 | | TABCollection::~TABCollection() |
7161 | 29.8k | { |
7162 | 29.8k | EmptyCollection(); |
7163 | 29.8k | } |
7164 | | |
7165 | | /********************************************************************** |
7166 | | * TABCollection::EmptyCollection() |
7167 | | * |
7168 | | * Delete/free all collection components. |
7169 | | **********************************************************************/ |
7170 | | void TABCollection::EmptyCollection() |
7171 | 59.6k | { |
7172 | | |
7173 | 59.6k | if (m_poRegion) |
7174 | 20.1k | { |
7175 | 20.1k | delete m_poRegion; |
7176 | 20.1k | m_poRegion = nullptr; |
7177 | 20.1k | } |
7178 | | |
7179 | 59.6k | if (m_poPline) |
7180 | 12.2k | { |
7181 | 12.2k | delete m_poPline; |
7182 | 12.2k | m_poPline = nullptr; |
7183 | 12.2k | } |
7184 | | |
7185 | 59.6k | if (m_poMpoint) |
7186 | 16.0k | { |
7187 | 16.0k | delete m_poMpoint; |
7188 | 16.0k | m_poMpoint = nullptr; |
7189 | 16.0k | } |
7190 | | |
7191 | | // Empty OGR Geometry Collection as well |
7192 | 59.6k | SyncOGRGeometryCollection(TRUE, TRUE, TRUE); |
7193 | 59.6k | } |
7194 | | |
7195 | | /********************************************************************** |
7196 | | * TABCollection::CloneTABFeature() |
7197 | | * |
7198 | | * Duplicate feature, including stuff specific to each TABFeature type. |
7199 | | * |
7200 | | * This method calls the generic TABFeature::CloneTABFeature() and |
7201 | | * then copies any members specific to its own type. |
7202 | | **********************************************************************/ |
7203 | | TABFeature * |
7204 | | TABCollection::CloneTABFeature(const OGRFeatureDefn *poNewDefn /*=NULL*/) |
7205 | 0 | { |
7206 | | /*----------------------------------------------------------------- |
7207 | | * Alloc new feature and copy the base stuff |
7208 | | *----------------------------------------------------------------*/ |
7209 | 0 | TABCollection *poNew = |
7210 | 0 | new TABCollection(poNewDefn ? poNewDefn : GetDefnRef()); |
7211 | |
|
7212 | 0 | CopyTABFeatureBase(poNew); |
7213 | | |
7214 | | /*----------------------------------------------------------------- |
7215 | | * And members specific to this class |
7216 | | *----------------------------------------------------------------*/ |
7217 | |
|
7218 | 0 | if (m_poRegion) |
7219 | 0 | poNew->SetRegionDirectly( |
7220 | 0 | cpl::down_cast<TABRegion *>(m_poRegion->CloneTABFeature())); |
7221 | |
|
7222 | 0 | if (m_poPline) |
7223 | 0 | poNew->SetPolylineDirectly( |
7224 | 0 | cpl::down_cast<TABPolyline *>(m_poPline->CloneTABFeature())); |
7225 | |
|
7226 | 0 | if (m_poMpoint) |
7227 | 0 | poNew->SetMultiPointDirectly( |
7228 | 0 | cpl::down_cast<TABMultiPoint *>(m_poMpoint->CloneTABFeature())); |
7229 | |
|
7230 | 0 | return poNew; |
7231 | 0 | } |
7232 | | |
7233 | | /********************************************************************** |
7234 | | * TABCollection::ValidateMapInfoType() |
7235 | | * |
7236 | | * Check the feature's geometry part and return the corresponding |
7237 | | * mapinfo object type code. The m_nMapInfoType member will also |
7238 | | * be updated for further calls to GetMapInfoType(); |
7239 | | * |
7240 | | * Returns TAB_GEOM_NONE if the geometry is not compatible with what |
7241 | | * is expected for this object class. |
7242 | | **********************************************************************/ |
7243 | | TABGeomType TABCollection::ValidateMapInfoType(TABMAPFile *poMapFile /*=NULL*/) |
7244 | 0 | { |
7245 | 0 | int nRegionType = TAB_GEOM_NONE; |
7246 | 0 | int nPLineType = TAB_GEOM_NONE; |
7247 | 0 | int nMPointType = TAB_GEOM_NONE; |
7248 | 0 | int nVersion = 650; |
7249 | | |
7250 | | /*----------------------------------------------------------------- |
7251 | | * Fetch and validate geometry |
7252 | | *----------------------------------------------------------------*/ |
7253 | 0 | OGRGeometry *poGeom = GetGeometryRef(); |
7254 | 0 | if (poGeom && |
7255 | 0 | wkbFlatten(poGeom->getGeometryType()) == wkbGeometryCollection) |
7256 | 0 | { |
7257 | 0 | m_nMapInfoType = TAB_GEOM_COLLECTION; |
7258 | 0 | } |
7259 | 0 | else |
7260 | 0 | { |
7261 | 0 | CPLError(CE_Failure, CPLE_AssertionFailed, |
7262 | 0 | "TABCollection: Missing or Invalid Geometry!"); |
7263 | 0 | m_nMapInfoType = TAB_GEOM_NONE; |
7264 | 0 | } |
7265 | | |
7266 | | /*----------------------------------------------------------------- |
7267 | | * Decide if coordinates should be compressed or not. |
7268 | | *----------------------------------------------------------------*/ |
7269 | 0 | GBool bComprCoord = ValidateCoordType(poMapFile); |
7270 | | |
7271 | | /*----------------------------------------------------------------- |
7272 | | * Since all members of the collection share the same compressed coord |
7273 | | * origin, we should force the compressed origin in all components |
7274 | | * to be the same. |
7275 | | * This also implies that ValidateMapInfoType() should *NOT* be called |
7276 | | * again until the collection components are written by WriteGeom...() |
7277 | | *----------------------------------------------------------------*/ |
7278 | | |
7279 | | // First pass to figure collection type... |
7280 | 0 | if (m_poRegion) |
7281 | 0 | { |
7282 | 0 | m_poRegion->ValidateCoordType(poMapFile); |
7283 | 0 | nRegionType = m_poRegion->ValidateMapInfoType(poMapFile); |
7284 | 0 | if (TAB_GEOM_GET_VERSION(nRegionType) > nVersion) |
7285 | 0 | nVersion = TAB_GEOM_GET_VERSION(nRegionType); |
7286 | 0 | } |
7287 | |
|
7288 | 0 | if (m_poPline) |
7289 | 0 | { |
7290 | 0 | m_poPline->ValidateCoordType(poMapFile); |
7291 | 0 | nPLineType = m_poPline->ValidateMapInfoType(poMapFile); |
7292 | 0 | if (TAB_GEOM_GET_VERSION(nPLineType) > nVersion) |
7293 | 0 | nVersion = TAB_GEOM_GET_VERSION(nPLineType); |
7294 | 0 | } |
7295 | |
|
7296 | 0 | if (m_poMpoint) |
7297 | 0 | { |
7298 | 0 | m_poMpoint->ValidateCoordType(poMapFile); |
7299 | 0 | nMPointType = m_poMpoint->ValidateMapInfoType(poMapFile); |
7300 | 0 | if (TAB_GEOM_GET_VERSION(nMPointType) > nVersion) |
7301 | 0 | nVersion = TAB_GEOM_GET_VERSION(nMPointType); |
7302 | 0 | } |
7303 | | |
7304 | | // Need to upgrade native type of collection? |
7305 | 0 | if (nVersion == 800) |
7306 | 0 | { |
7307 | 0 | m_nMapInfoType = TAB_GEOM_V800_COLLECTION; |
7308 | 0 | } |
7309 | | |
7310 | | // Make another pass updating native type and coordinates type and origin |
7311 | | // of each component |
7312 | 0 | if (m_poRegion && nRegionType != TAB_GEOM_NONE) |
7313 | 0 | { |
7314 | 0 | GInt32 nXMin = 0; |
7315 | 0 | GInt32 nYMin = 0; |
7316 | 0 | GInt32 nXMax = 0; |
7317 | 0 | GInt32 nYMax = 0; |
7318 | 0 | m_poRegion->GetIntMBR(nXMin, nYMin, nXMax, nYMax); |
7319 | 0 | m_poRegion->ForceCoordTypeAndOrigin( |
7320 | 0 | (nVersion == 800 ? TAB_GEOM_V800_REGION : TAB_GEOM_V450_REGION), |
7321 | 0 | bComprCoord, m_nComprOrgX, m_nComprOrgY, nXMin, nYMin, nXMax, |
7322 | 0 | nYMax); |
7323 | 0 | } |
7324 | |
|
7325 | 0 | if (m_poPline && nPLineType != TAB_GEOM_NONE) |
7326 | 0 | { |
7327 | 0 | GInt32 nXMin, nYMin, nXMax, nYMax; |
7328 | 0 | m_poPline->GetIntMBR(nXMin, nYMin, nXMax, nYMax); |
7329 | 0 | m_poPline->ForceCoordTypeAndOrigin( |
7330 | 0 | (nVersion == 800 ? TAB_GEOM_V800_MULTIPLINE |
7331 | 0 | : TAB_GEOM_V450_MULTIPLINE), |
7332 | 0 | bComprCoord, m_nComprOrgX, m_nComprOrgY, nXMin, nYMin, nXMax, |
7333 | 0 | nYMax); |
7334 | 0 | } |
7335 | |
|
7336 | 0 | if (m_poMpoint && nMPointType != TAB_GEOM_NONE) |
7337 | 0 | { |
7338 | 0 | GInt32 nXMin, nYMin, nXMax, nYMax; |
7339 | 0 | m_poMpoint->GetIntMBR(nXMin, nYMin, nXMax, nYMax); |
7340 | 0 | m_poMpoint->ForceCoordTypeAndOrigin( |
7341 | 0 | (nVersion == 800 ? TAB_GEOM_V800_MULTIPOINT : TAB_GEOM_MULTIPOINT), |
7342 | 0 | bComprCoord, m_nComprOrgX, m_nComprOrgY, nXMin, nYMin, nXMax, |
7343 | 0 | nYMax); |
7344 | 0 | } |
7345 | |
|
7346 | 0 | return m_nMapInfoType; |
7347 | 0 | } |
7348 | | |
7349 | | /********************************************************************** |
7350 | | * TABCollection::ReadLabelAndMBR() |
7351 | | * |
7352 | | * Reads the label and MBR elements of the header of a collection component |
7353 | | * |
7354 | | * Returns 0 on success, -1 on failure. |
7355 | | **********************************************************************/ |
7356 | | int TABCollection::ReadLabelAndMBR(TABMAPCoordBlock *poCoordBlock, |
7357 | | GBool bComprCoord, GInt32 nComprOrgX, |
7358 | | GInt32 nComprOrgY, GInt32 &pnMinX, |
7359 | | GInt32 &pnMinY, GInt32 &pnMaxX, |
7360 | | GInt32 &pnMaxY, GInt32 &pnLabelX, |
7361 | | GInt32 &pnLabelY) |
7362 | 20 | { |
7363 | | // |
7364 | | // The sections in the collection's coord blocks start with center/label |
7365 | | // point + MBR that are normally found in the object data blocks |
7366 | | // of regular region/pline/mulitpoint objects. |
7367 | | // |
7368 | | |
7369 | 20 | if (bComprCoord) |
7370 | 9 | { |
7371 | | // Region center/label point, relative to compr. coord. origin |
7372 | | // No it is not relative to the Object block center |
7373 | 9 | pnLabelX = poCoordBlock->ReadInt16(); |
7374 | 9 | pnLabelY = poCoordBlock->ReadInt16(); |
7375 | | |
7376 | 9 | TABSaturatedAdd(pnLabelX, nComprOrgX); |
7377 | 9 | TABSaturatedAdd(pnLabelY, nComprOrgY); |
7378 | | |
7379 | 9 | pnMinX = poCoordBlock->ReadInt16(); // Read MBR |
7380 | 9 | pnMinY = poCoordBlock->ReadInt16(); |
7381 | 9 | pnMaxX = poCoordBlock->ReadInt16(); |
7382 | 9 | pnMaxY = poCoordBlock->ReadInt16(); |
7383 | 9 | TABSaturatedAdd(pnMinX, nComprOrgX); |
7384 | 9 | TABSaturatedAdd(pnMinY, nComprOrgY); |
7385 | 9 | TABSaturatedAdd(pnMaxX, nComprOrgX); |
7386 | 9 | TABSaturatedAdd(pnMaxY, nComprOrgY); |
7387 | 9 | } |
7388 | 11 | else |
7389 | 11 | { |
7390 | | // Region center/label point, relative to compr. coord. origin |
7391 | | // No it is not relative to the Object block center |
7392 | 11 | pnLabelX = poCoordBlock->ReadInt32(); |
7393 | 11 | pnLabelY = poCoordBlock->ReadInt32(); |
7394 | | |
7395 | 11 | pnMinX = poCoordBlock->ReadInt32(); // Read MBR |
7396 | 11 | pnMinY = poCoordBlock->ReadInt32(); |
7397 | 11 | pnMaxX = poCoordBlock->ReadInt32(); |
7398 | 11 | pnMaxY = poCoordBlock->ReadInt32(); |
7399 | 11 | } |
7400 | | |
7401 | 20 | return 0; |
7402 | 20 | } |
7403 | | |
7404 | | /********************************************************************** |
7405 | | * TABCollection::WriteLabelAndMBR() |
7406 | | * |
7407 | | * Writes the label and MBR elements of the header of a collection component |
7408 | | * |
7409 | | * Returns 0 on success, -1 on failure. |
7410 | | **********************************************************************/ |
7411 | | int TABCollection::WriteLabelAndMBR(TABMAPCoordBlock *poCoordBlock, |
7412 | | GBool bComprCoord, GInt32 nMinX, |
7413 | | GInt32 nMinY, GInt32 nMaxX, GInt32 nMaxY, |
7414 | | GInt32 nLabelX, GInt32 nLabelY) |
7415 | 0 | { |
7416 | | // |
7417 | | // The sections in the collection's coord blocks start with center/label |
7418 | | // point + MBR that are normally found in the object data blocks |
7419 | | // of regular region/pline/mulitpoint objects. |
7420 | | // |
7421 | |
|
7422 | 0 | int nStatus = 0; |
7423 | 0 | if ((nStatus = |
7424 | 0 | poCoordBlock->WriteIntCoord(nLabelX, nLabelY, bComprCoord)) != 0 || |
7425 | 0 | (nStatus = poCoordBlock->WriteIntCoord(nMinX, nMinY, bComprCoord)) != |
7426 | 0 | 0 || |
7427 | 0 | (nStatus = poCoordBlock->WriteIntCoord(nMaxX, nMaxY, bComprCoord)) != 0) |
7428 | 0 | { |
7429 | | // Failed ... error message has already been produced |
7430 | 0 | return nStatus; |
7431 | 0 | } |
7432 | | |
7433 | 0 | return 0; |
7434 | 0 | } |
7435 | | |
7436 | | /********************************************************************** |
7437 | | * TABCollection::ReadGeometryFromMAPFile() |
7438 | | * |
7439 | | * Fill the geometry and representation (color, etc...) part of the |
7440 | | * feature from the contents of the .MAP object pointed to by poMAPFile. |
7441 | | * |
7442 | | * It is assumed that poMAPFile currently points to the beginning of |
7443 | | * a map object. |
7444 | | * |
7445 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
7446 | | * been called. |
7447 | | **********************************************************************/ |
7448 | | int TABCollection::ReadGeometryFromMAPFile( |
7449 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
7450 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
7451 | | TABMAPCoordBlock **ppoCoordBlock /*=NULL*/) |
7452 | 20 | { |
7453 | 20 | const GBool bComprCoord = poObjHdr->IsCompressedType(); |
7454 | | |
7455 | | /*----------------------------------------------------------------- |
7456 | | * Fetch and validate geometry type |
7457 | | *----------------------------------------------------------------*/ |
7458 | 20 | m_nMapInfoType = poObjHdr->m_nType; |
7459 | | |
7460 | 20 | if (m_nMapInfoType != TAB_GEOM_COLLECTION && |
7461 | 7 | m_nMapInfoType != TAB_GEOM_COLLECTION_C && |
7462 | 0 | m_nMapInfoType != TAB_GEOM_V800_COLLECTION && |
7463 | 0 | m_nMapInfoType != TAB_GEOM_V800_COLLECTION_C) |
7464 | 0 | { |
7465 | 0 | CPLError( |
7466 | 0 | CE_Failure, CPLE_AssertionFailed, |
7467 | 0 | "ReadGeometryFromMAPFile(): unsupported geometry type %d (0x%2.2x)", |
7468 | 0 | m_nMapInfoType, m_nMapInfoType); |
7469 | 0 | return -1; |
7470 | 0 | } |
7471 | | |
7472 | 20 | int nVersion = TAB_GEOM_GET_VERSION(m_nMapInfoType); |
7473 | | |
7474 | | // Make sure collection is empty |
7475 | 20 | EmptyCollection(); |
7476 | | |
7477 | | /*------------------------------------------------------------- |
7478 | | * Copy data from poObjHdr |
7479 | | *------------------------------------------------------------*/ |
7480 | 20 | TABMAPObjCollection *poCollHdr = |
7481 | 20 | cpl::down_cast<TABMAPObjCollection *>(poObjHdr); |
7482 | | |
7483 | | // MBR |
7484 | 20 | double dXMin = 0.0; |
7485 | 20 | double dYMin = 0.0; |
7486 | 20 | double dXMax = 0.0; |
7487 | 20 | double dYMax = 0.0; |
7488 | 20 | poMapFile->Int2Coordsys(poCollHdr->m_nMinX, poCollHdr->m_nMinY, dXMin, |
7489 | 20 | dYMin); |
7490 | 20 | poMapFile->Int2Coordsys(poCollHdr->m_nMaxX, poCollHdr->m_nMaxY, dXMax, |
7491 | 20 | dYMax); |
7492 | | |
7493 | 20 | SetMBR(dXMin, dYMin, dXMax, dYMax); |
7494 | | |
7495 | 20 | SetIntMBR(poObjHdr->m_nMinX, poObjHdr->m_nMinY, poObjHdr->m_nMaxX, |
7496 | 20 | poObjHdr->m_nMaxY); |
7497 | | |
7498 | 20 | int nCurCoordBlockPtr = poCollHdr->m_nCoordBlockPtr; |
7499 | 20 | TABMAPCoordBlock *poCoordBlock = nullptr; |
7500 | 20 | if (ppoCoordBlock != nullptr && *ppoCoordBlock != nullptr) |
7501 | 0 | poCoordBlock = *ppoCoordBlock; |
7502 | 20 | else |
7503 | 20 | poCoordBlock = poMapFile->GetCoordBlock(nCurCoordBlockPtr); |
7504 | | |
7505 | | // Compressed coordinate origin (useful only in compressed case!) |
7506 | 20 | m_nComprOrgX = poCollHdr->m_nComprOrgX; |
7507 | 20 | m_nComprOrgY = poCollHdr->m_nComprOrgY; |
7508 | | |
7509 | | /*----------------------------------------------------------------- |
7510 | | * Region Component |
7511 | | *----------------------------------------------------------------*/ |
7512 | 20 | if (poCoordBlock != nullptr && poCollHdr->m_nNumRegSections > 0) |
7513 | 5 | { |
7514 | | // |
7515 | | // Build fake coord section header to pass to TABRegion::ReadGeom...() |
7516 | | // |
7517 | 5 | TABMAPObjPLine oRegionHdr; |
7518 | | |
7519 | 5 | oRegionHdr.m_nComprOrgX = poCollHdr->m_nComprOrgX; |
7520 | 5 | oRegionHdr.m_nComprOrgY = poCollHdr->m_nComprOrgY; |
7521 | | |
7522 | | // |
7523 | | // The region section in the coord block starts with center/label |
7524 | | // point + MBR that are normally found in the object data blocks |
7525 | | // of regular region objects. |
7526 | | // |
7527 | | |
7528 | | // In V800 the mini-header starts with a copy of num_parts |
7529 | 5 | if (nVersion >= 800) |
7530 | 0 | { |
7531 | | // int numParts = poCoordBlock->ReadInt32(); |
7532 | 0 | CPLAssert(poCoordBlock->ReadInt32() == |
7533 | 0 | poCollHdr->m_nNumRegSections); |
7534 | 0 | } |
7535 | | |
7536 | 5 | ReadLabelAndMBR(poCoordBlock, bComprCoord, oRegionHdr.m_nComprOrgX, |
7537 | 5 | oRegionHdr.m_nComprOrgY, oRegionHdr.m_nMinX, |
7538 | 5 | oRegionHdr.m_nMinY, oRegionHdr.m_nMaxX, |
7539 | 5 | oRegionHdr.m_nMaxY, oRegionHdr.m_nLabelX, |
7540 | 5 | oRegionHdr.m_nLabelY); |
7541 | | |
7542 | | // Set CoordBlockPtr so that TABRegion continues reading here |
7543 | 5 | oRegionHdr.m_nCoordBlockPtr = poCoordBlock->GetCurAddress(); |
7544 | | |
7545 | 5 | if (bComprCoord) |
7546 | 4 | oRegionHdr.m_nType = TAB_GEOM_V450_REGION_C; |
7547 | 1 | else |
7548 | 1 | oRegionHdr.m_nType = TAB_GEOM_V450_REGION; |
7549 | 5 | if (nVersion == 800) |
7550 | 0 | oRegionHdr.m_nType = static_cast<TABGeomType>( |
7551 | 0 | oRegionHdr.m_nType + |
7552 | 0 | (TAB_GEOM_V800_REGION - TAB_GEOM_V450_REGION)); |
7553 | | |
7554 | 5 | oRegionHdr.m_numLineSections = poCollHdr->m_nNumRegSections; |
7555 | 5 | oRegionHdr.m_nPenId = poCollHdr->m_nRegionPenId; |
7556 | 5 | oRegionHdr.m_nBrushId = poCollHdr->m_nRegionBrushId; |
7557 | 5 | oRegionHdr.m_bSmooth = 0; // TODO |
7558 | | |
7559 | | // |
7560 | | // Use a TABRegion to read/store the Region coord data |
7561 | | // |
7562 | 5 | m_poRegion = new TABRegion(GetDefnRef()); |
7563 | 5 | if (m_poRegion->ReadGeometryFromMAPFile(poMapFile, &oRegionHdr, |
7564 | 5 | bCoordBlockDataOnly, |
7565 | 5 | &poCoordBlock) != 0) |
7566 | 2 | return -1; |
7567 | | |
7568 | | // Set new coord block ptr for next object |
7569 | | /*if (poCoordBlock) |
7570 | | nCurCoordBlockPtr = poCoordBlock->GetCurAddress();*/ |
7571 | 5 | } |
7572 | | |
7573 | | /*----------------------------------------------------------------- |
7574 | | * PLine Component |
7575 | | *----------------------------------------------------------------*/ |
7576 | 18 | if (poCoordBlock != nullptr && poCollHdr->m_nNumPLineSections > 0) |
7577 | 3 | { |
7578 | | // |
7579 | | // Build fake coord section header to pass to TABPolyline::ReadGeom..() |
7580 | | // |
7581 | 3 | TABMAPObjPLine oPLineHdr; |
7582 | | |
7583 | 3 | oPLineHdr.m_nComprOrgX = poCollHdr->m_nComprOrgX; |
7584 | 3 | oPLineHdr.m_nComprOrgY = poCollHdr->m_nComprOrgY; |
7585 | | |
7586 | | // |
7587 | | // The pline section in the coord block starts with center/label |
7588 | | // point + MBR that are normally found in the object data blocks |
7589 | | // of regular pline objects. |
7590 | | // |
7591 | | |
7592 | | // In V800 the mini-header starts with a copy of num_parts |
7593 | 3 | if (nVersion >= 800) |
7594 | 0 | { |
7595 | | // int numParts = poCoordBlock->ReadInt32(); |
7596 | 0 | CPLAssert(poCoordBlock->ReadInt32() == |
7597 | 0 | poCollHdr->m_nNumPLineSections); |
7598 | 0 | } |
7599 | | |
7600 | 3 | ReadLabelAndMBR(poCoordBlock, bComprCoord, oPLineHdr.m_nComprOrgX, |
7601 | 3 | oPLineHdr.m_nComprOrgY, oPLineHdr.m_nMinX, |
7602 | 3 | oPLineHdr.m_nMinY, oPLineHdr.m_nMaxX, oPLineHdr.m_nMaxY, |
7603 | 3 | oPLineHdr.m_nLabelX, oPLineHdr.m_nLabelY); |
7604 | | |
7605 | | // Set CoordBlockPtr so that TABRegion continues reading here |
7606 | 3 | oPLineHdr.m_nCoordBlockPtr = poCoordBlock->GetCurAddress(); |
7607 | | |
7608 | 3 | if (bComprCoord) |
7609 | 3 | oPLineHdr.m_nType = TAB_GEOM_V450_MULTIPLINE_C; |
7610 | 0 | else |
7611 | 0 | oPLineHdr.m_nType = TAB_GEOM_V450_MULTIPLINE; |
7612 | 3 | if (nVersion == 800) |
7613 | 0 | oPLineHdr.m_nType = static_cast<TABGeomType>( |
7614 | 0 | oPLineHdr.m_nType + |
7615 | 0 | (TAB_GEOM_V800_MULTIPLINE - TAB_GEOM_V450_MULTIPLINE)); |
7616 | | |
7617 | 3 | oPLineHdr.m_numLineSections = poCollHdr->m_nNumPLineSections; |
7618 | 3 | oPLineHdr.m_nPenId = poCollHdr->m_nPolylinePenId; |
7619 | 3 | oPLineHdr.m_bSmooth = 0; // TODO |
7620 | | |
7621 | | // |
7622 | | // Use a TABPolyline to read/store the Polyline coord data |
7623 | | // |
7624 | 3 | m_poPline = new TABPolyline(GetDefnRef()); |
7625 | 3 | if (m_poPline->ReadGeometryFromMAPFile( |
7626 | 3 | poMapFile, &oPLineHdr, bCoordBlockDataOnly, &poCoordBlock) != 0) |
7627 | 1 | return -1; |
7628 | | |
7629 | | // Set new coord block ptr for next object |
7630 | | /*if (poCoordBlock) |
7631 | | nCurCoordBlockPtr = poCoordBlock->GetCurAddress();*/ |
7632 | 3 | } |
7633 | | |
7634 | | /*----------------------------------------------------------------- |
7635 | | * MultiPoint Component |
7636 | | *----------------------------------------------------------------*/ |
7637 | 17 | if (poCoordBlock != nullptr && poCollHdr->m_nNumMultiPoints > 0) |
7638 | 12 | { |
7639 | | // |
7640 | | // Build fake coord section header to pass to TABMultiPoint::ReadGeom() |
7641 | | // |
7642 | 12 | TABMAPObjMultiPoint oMPointHdr; |
7643 | | |
7644 | 12 | oMPointHdr.m_nComprOrgX = poCollHdr->m_nComprOrgX; |
7645 | 12 | oMPointHdr.m_nComprOrgY = poCollHdr->m_nComprOrgY; |
7646 | | |
7647 | | // |
7648 | | // The pline section in the coord block starts with center/label |
7649 | | // point + MBR that are normally found in the object data blocks |
7650 | | // of regular pline objects. |
7651 | | // |
7652 | 12 | ReadLabelAndMBR(poCoordBlock, bComprCoord, oMPointHdr.m_nComprOrgX, |
7653 | 12 | oMPointHdr.m_nComprOrgY, oMPointHdr.m_nMinX, |
7654 | 12 | oMPointHdr.m_nMinY, oMPointHdr.m_nMaxX, |
7655 | 12 | oMPointHdr.m_nMaxY, oMPointHdr.m_nLabelX, |
7656 | 12 | oMPointHdr.m_nLabelY); |
7657 | | |
7658 | | // Set CoordBlockPtr so that TABRegion continues reading here |
7659 | 12 | oMPointHdr.m_nCoordBlockPtr = poCoordBlock->GetCurAddress(); |
7660 | | |
7661 | 12 | if (bComprCoord) |
7662 | 2 | oMPointHdr.m_nType = TAB_GEOM_MULTIPOINT_C; |
7663 | 10 | else |
7664 | 10 | oMPointHdr.m_nType = TAB_GEOM_MULTIPOINT; |
7665 | 12 | if (nVersion == 800) |
7666 | 0 | oMPointHdr.m_nType = static_cast<TABGeomType>( |
7667 | 0 | oMPointHdr.m_nType + |
7668 | 0 | (TAB_GEOM_V800_MULTIPOINT - TAB_GEOM_MULTIPOINT)); |
7669 | | |
7670 | 12 | oMPointHdr.m_nNumPoints = poCollHdr->m_nNumMultiPoints; |
7671 | 12 | oMPointHdr.m_nSymbolId = poCollHdr->m_nMultiPointSymbolId; |
7672 | | |
7673 | | // |
7674 | | // Use a TABMultiPoint to read/store the coord data |
7675 | | // |
7676 | 12 | m_poMpoint = new TABMultiPoint(GetDefnRef()); |
7677 | 12 | if (m_poMpoint->ReadGeometryFromMAPFile(poMapFile, &oMPointHdr, |
7678 | 12 | bCoordBlockDataOnly, |
7679 | 12 | &poCoordBlock) != 0) |
7680 | 0 | return -1; |
7681 | | |
7682 | | // Set new coord block ptr for next object (not really useful here) |
7683 | | /*if (poCoordBlock) |
7684 | | nCurCoordBlockPtr = poCoordBlock->GetCurAddress();*/ |
7685 | 12 | } |
7686 | | |
7687 | | /*----------------------------------------------------------------- |
7688 | | * Set the main OGRFeature Geometry |
7689 | | * (this is actually duplicating geometries from each member) |
7690 | | *----------------------------------------------------------------*/ |
7691 | 17 | if (SyncOGRGeometryCollection(TRUE, TRUE, TRUE) != 0) |
7692 | 0 | return -1; |
7693 | | |
7694 | | /* Return a ref to coord block so that caller can continue reading |
7695 | | * after the end of this object (used by index splitting) |
7696 | | */ |
7697 | 17 | if (ppoCoordBlock) |
7698 | 0 | *ppoCoordBlock = poCoordBlock; |
7699 | | |
7700 | 17 | return 0; |
7701 | 17 | } |
7702 | | |
7703 | | /********************************************************************** |
7704 | | * TABCollection::WriteGeometryToMAPFile() |
7705 | | * |
7706 | | * Write the geometry and representation (color, etc...) part of the |
7707 | | * feature to the .MAP object pointed to by poMAPFile. |
7708 | | * |
7709 | | * It is assumed that poMAPFile currently points to a valid map object. |
7710 | | * |
7711 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
7712 | | * been called. |
7713 | | **********************************************************************/ |
7714 | | int TABCollection::WriteGeometryToMAPFile( |
7715 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
7716 | | GBool bCoordBlockDataOnly /*=FALSE*/, |
7717 | | TABMAPCoordBlock **ppoCoordBlock /*=NULL*/) |
7718 | 0 | { |
7719 | | /*----------------------------------------------------------------- |
7720 | | * Note that the current implementation does not allow setting the |
7721 | | * Geometry via OGRFeature::SetGeometry(). The geometries must be set |
7722 | | * via the SetRegion/Pline/MpointDirectly() methods which will take |
7723 | | * care of keeping the OGRFeature's geometry in sync. |
7724 | | * |
7725 | | * TODO: If we ever want to support sync'ing changes from the OGRFeature's |
7726 | | * geometry to the m_poRegion/Pline/Mpoint then a call should be added |
7727 | | * here, or perhaps in ValidateMapInfoType(), or even better in |
7728 | | * custom TABCollection::SetGeometry*()... but then this last option |
7729 | | * won't work unless OGRFeature::SetGeometry*() are made virtual in OGR. |
7730 | | *----------------------------------------------------------------*/ |
7731 | | |
7732 | | /*----------------------------------------------------------------- |
7733 | | * We assume that ValidateMapInfoType() was called already and that |
7734 | | * the type in poObjHdr->m_nType is valid. |
7735 | | *----------------------------------------------------------------*/ |
7736 | 0 | CPLAssert(m_nMapInfoType == poObjHdr->m_nType); |
7737 | |
|
7738 | 0 | TABMAPObjCollection *poCollHdr = |
7739 | 0 | cpl::down_cast<TABMAPObjCollection *>(poObjHdr); |
7740 | | |
7741 | | /*----------------------------------------------------------------- |
7742 | | * Write data to coordinate block for each component... |
7743 | | * |
7744 | | * Note that at this point, the caller (TABFile) has called |
7745 | | * TABCollection::ValidateMapInfoType() which in turn has called |
7746 | | * each component's respective ValidateMapInfoType() and |
7747 | | * ForceCoordTypeAndCoordOrigin() so the objects are ready to have |
7748 | | * their respective WriteGeometryToMapFile() called. |
7749 | | *----------------------------------------------------------------*/ |
7750 | 0 | const GBool bCompressed = poObjHdr->IsCompressedType(); |
7751 | | // TODO: ??? Do we need to track overall collection coord data size??? |
7752 | 0 | int nTotalFeatureDataSize = 0; |
7753 | |
|
7754 | 0 | const int nVersion = TAB_GEOM_GET_VERSION(m_nMapInfoType); |
7755 | |
|
7756 | 0 | TABMAPCoordBlock *poCoordBlock = nullptr; |
7757 | 0 | if (ppoCoordBlock != nullptr && *ppoCoordBlock != nullptr) |
7758 | 0 | poCoordBlock = *ppoCoordBlock; |
7759 | 0 | else |
7760 | 0 | poCoordBlock = poMapFile->GetCurCoordBlock(); |
7761 | 0 | poCoordBlock->StartNewFeature(); |
7762 | 0 | poCollHdr->m_nCoordBlockPtr = poCoordBlock->GetCurAddress(); |
7763 | 0 | poCoordBlock->SetComprCoordOrigin(m_nComprOrgX, m_nComprOrgY); |
7764 | | |
7765 | | /*----------------------------------------------------------------- |
7766 | | * Region component |
7767 | | *----------------------------------------------------------------*/ |
7768 | 0 | if (m_poRegion && m_poRegion->GetMapInfoType() != TAB_GEOM_NONE) |
7769 | 0 | { |
7770 | 0 | CPLAssert(m_poRegion->GetMapInfoType() == TAB_GEOM_V450_REGION || |
7771 | 0 | m_poRegion->GetMapInfoType() == TAB_GEOM_V450_REGION_C || |
7772 | 0 | m_poRegion->GetMapInfoType() == TAB_GEOM_V800_REGION || |
7773 | 0 | m_poRegion->GetMapInfoType() == TAB_GEOM_V800_REGION_C); |
7774 | |
|
7775 | 0 | TABMAPObjPLine *poRegionHdr = cpl::down_cast<TABMAPObjPLine *>( |
7776 | 0 | TABMAPObjHdr::NewObj(m_poRegion->GetMapInfoType(), -1)); |
7777 | | |
7778 | | // Update count of objects by type in header |
7779 | 0 | if (!bCoordBlockDataOnly) |
7780 | 0 | poMapFile->UpdateMapHeaderInfo(m_poRegion->GetMapInfoType()); |
7781 | | |
7782 | | // Write a placeholder for centroid/label point and MBR mini-header |
7783 | | // and we'll come back later to write the real values. |
7784 | | // |
7785 | | // Note that the call to WriteGeometryToMAPFile() below will call |
7786 | | // StartNewFeature() as well, so we need to track the current |
7787 | | // value before calling it |
7788 | |
|
7789 | 0 | poCoordBlock->StartNewFeature(); |
7790 | 0 | int nMiniHeaderPtr = poCoordBlock->GetCurAddress(); |
7791 | | |
7792 | | // In V800 the mini-header starts with a copy of num_parts |
7793 | 0 | if (nVersion >= 800) |
7794 | 0 | { |
7795 | 0 | poCoordBlock->WriteInt32(0); |
7796 | 0 | } |
7797 | 0 | WriteLabelAndMBR(poCoordBlock, bCompressed, 0, 0, 0, 0, 0, 0); |
7798 | 0 | nTotalFeatureDataSize += poCoordBlock->GetFeatureDataSize(); |
7799 | |
|
7800 | 0 | if (m_poRegion->WriteGeometryToMAPFile(poMapFile, poRegionHdr, |
7801 | 0 | bCoordBlockDataOnly, |
7802 | 0 | &poCoordBlock) != 0) |
7803 | 0 | { |
7804 | 0 | CPLError(CE_Failure, CPLE_FileIO, |
7805 | 0 | "Failed writing Region part in collection."); |
7806 | 0 | delete poRegionHdr; |
7807 | 0 | return -1; |
7808 | 0 | } |
7809 | | |
7810 | 0 | nTotalFeatureDataSize += poRegionHdr->m_nCoordDataSize; |
7811 | | |
7812 | | // Come back to write the real values in the mini-header |
7813 | 0 | int nEndOfObjectPtr = poCoordBlock->GetCurAddress(); |
7814 | 0 | poCoordBlock->StartNewFeature(); |
7815 | |
|
7816 | 0 | if (poCoordBlock->GotoByteInFile(nMiniHeaderPtr, TRUE, TRUE) != 0) |
7817 | 0 | { |
7818 | 0 | delete poRegionHdr; |
7819 | 0 | return -1; |
7820 | 0 | } |
7821 | | |
7822 | | // In V800 the mini-header starts with a copy of num_parts |
7823 | 0 | if (nVersion >= 800) |
7824 | 0 | { |
7825 | 0 | poCoordBlock->WriteInt32(poRegionHdr->m_numLineSections); |
7826 | 0 | } |
7827 | 0 | WriteLabelAndMBR(poCoordBlock, bCompressed, poRegionHdr->m_nMinX, |
7828 | 0 | poRegionHdr->m_nMinY, poRegionHdr->m_nMaxX, |
7829 | 0 | poRegionHdr->m_nMaxY, poRegionHdr->m_nLabelX, |
7830 | 0 | poRegionHdr->m_nLabelY); |
7831 | | |
7832 | | // And finally move the pointer back to the end of this component |
7833 | 0 | if (poCoordBlock->GotoByteInFile(nEndOfObjectPtr, TRUE, TRUE) != 0) |
7834 | 0 | { |
7835 | 0 | delete poRegionHdr; |
7836 | 0 | return -1; |
7837 | 0 | } |
7838 | | |
7839 | | // Copy other header members to the main collection header |
7840 | | // TODO: Does m_nRegionDataSize need to include the centroid+mbr |
7841 | | // mini-header??? |
7842 | 0 | poCollHdr->m_nRegionDataSize = poRegionHdr->m_nCoordDataSize; |
7843 | 0 | poCollHdr->m_nNumRegSections = poRegionHdr->m_numLineSections; |
7844 | |
|
7845 | 0 | if (!bCoordBlockDataOnly) |
7846 | 0 | { |
7847 | 0 | poCollHdr->m_nRegionPenId = poRegionHdr->m_nPenId; |
7848 | 0 | poCollHdr->m_nRegionBrushId = poRegionHdr->m_nBrushId; |
7849 | | // TODO: Smooth flag = poRegionHdr->m_bSmooth; |
7850 | 0 | } |
7851 | |
|
7852 | 0 | delete poRegionHdr; |
7853 | 0 | } |
7854 | 0 | else |
7855 | 0 | { |
7856 | | // No Region component. Set corresponding header fields to 0 |
7857 | |
|
7858 | 0 | poCollHdr->m_nRegionDataSize = 0; |
7859 | 0 | poCollHdr->m_nNumRegSections = 0; |
7860 | 0 | poCollHdr->m_nRegionPenId = 0; |
7861 | 0 | poCollHdr->m_nRegionBrushId = 0; |
7862 | 0 | } |
7863 | | |
7864 | | /*----------------------------------------------------------------- |
7865 | | * PLine component |
7866 | | *----------------------------------------------------------------*/ |
7867 | 0 | if (m_poPline && m_poPline->GetMapInfoType() != TAB_GEOM_NONE) |
7868 | 0 | { |
7869 | 0 | CPLAssert(m_poPline->GetMapInfoType() == TAB_GEOM_V450_MULTIPLINE || |
7870 | 0 | m_poPline->GetMapInfoType() == TAB_GEOM_V450_MULTIPLINE_C || |
7871 | 0 | m_poPline->GetMapInfoType() == TAB_GEOM_V800_MULTIPLINE || |
7872 | 0 | m_poPline->GetMapInfoType() == TAB_GEOM_V800_MULTIPLINE_C); |
7873 | |
|
7874 | 0 | TABMAPObjPLine *poPlineHdr = cpl::down_cast<TABMAPObjPLine *>( |
7875 | 0 | TABMAPObjHdr::NewObj(m_poPline->GetMapInfoType(), -1)); |
7876 | | |
7877 | | // Update count of objects by type in header |
7878 | 0 | if (!bCoordBlockDataOnly) |
7879 | 0 | poMapFile->UpdateMapHeaderInfo(m_poPline->GetMapInfoType()); |
7880 | | |
7881 | | // Write a placeholder for centroid/label point and MBR mini-header |
7882 | | // and we'll come back later to write the real values. |
7883 | | // |
7884 | | // Note that the call to WriteGeometryToMAPFile() below will call |
7885 | | // StartNewFeature() as well, so we need to track the current |
7886 | | // value before calling it |
7887 | |
|
7888 | 0 | poCoordBlock->StartNewFeature(); |
7889 | 0 | int nMiniHeaderPtr = poCoordBlock->GetCurAddress(); |
7890 | | |
7891 | | // In V800 the mini-header starts with a copy of num_parts |
7892 | 0 | if (nVersion >= 800) |
7893 | 0 | { |
7894 | 0 | poCoordBlock->WriteInt32(0); |
7895 | 0 | } |
7896 | 0 | WriteLabelAndMBR(poCoordBlock, bCompressed, 0, 0, 0, 0, 0, 0); |
7897 | 0 | nTotalFeatureDataSize += poCoordBlock->GetFeatureDataSize(); |
7898 | |
|
7899 | 0 | if (m_poPline->WriteGeometryToMAPFile( |
7900 | 0 | poMapFile, poPlineHdr, bCoordBlockDataOnly, &poCoordBlock) != 0) |
7901 | 0 | { |
7902 | 0 | CPLError(CE_Failure, CPLE_FileIO, |
7903 | 0 | "Failed writing Region part in collection."); |
7904 | 0 | delete poPlineHdr; |
7905 | 0 | return -1; |
7906 | 0 | } |
7907 | | |
7908 | 0 | nTotalFeatureDataSize += poPlineHdr->m_nCoordDataSize; |
7909 | | |
7910 | | // Come back to write the real values in the mini-header |
7911 | 0 | int nEndOfObjectPtr = poCoordBlock->GetCurAddress(); |
7912 | 0 | poCoordBlock->StartNewFeature(); |
7913 | |
|
7914 | 0 | if (poCoordBlock->GotoByteInFile(nMiniHeaderPtr, TRUE, TRUE) != 0) |
7915 | 0 | { |
7916 | 0 | delete poPlineHdr; |
7917 | 0 | return -1; |
7918 | 0 | } |
7919 | | |
7920 | | // In V800 the mini-header starts with a copy of num_parts |
7921 | 0 | if (nVersion >= 800) |
7922 | 0 | { |
7923 | 0 | poCoordBlock->WriteInt32(poPlineHdr->m_numLineSections); |
7924 | 0 | } |
7925 | 0 | WriteLabelAndMBR(poCoordBlock, bCompressed, poPlineHdr->m_nMinX, |
7926 | 0 | poPlineHdr->m_nMinY, poPlineHdr->m_nMaxX, |
7927 | 0 | poPlineHdr->m_nMaxY, poPlineHdr->m_nLabelX, |
7928 | 0 | poPlineHdr->m_nLabelY); |
7929 | | |
7930 | | // And finally move the pointer back to the end of this component |
7931 | 0 | if (poCoordBlock->GotoByteInFile(nEndOfObjectPtr, TRUE, TRUE) != 0) |
7932 | 0 | { |
7933 | 0 | delete poPlineHdr; |
7934 | 0 | return -1; |
7935 | 0 | } |
7936 | | |
7937 | | // Copy other header members to the main collection header |
7938 | | // TODO: Does m_nRegionDataSize need to include the centroid+mbr |
7939 | | // mini-header??? |
7940 | 0 | poCollHdr->m_nPolylineDataSize = poPlineHdr->m_nCoordDataSize; |
7941 | 0 | poCollHdr->m_nNumPLineSections = poPlineHdr->m_numLineSections; |
7942 | 0 | if (!bCoordBlockDataOnly) |
7943 | 0 | { |
7944 | 0 | poCollHdr->m_nPolylinePenId = poPlineHdr->m_nPenId; |
7945 | | // TODO: Smooth flag = poPlineHdr->m_bSmooth; |
7946 | 0 | } |
7947 | |
|
7948 | 0 | delete poPlineHdr; |
7949 | 0 | } |
7950 | 0 | else |
7951 | 0 | { |
7952 | | // No Polyline component. Set corresponding header fields to 0 |
7953 | |
|
7954 | 0 | poCollHdr->m_nPolylineDataSize = 0; |
7955 | 0 | poCollHdr->m_nNumPLineSections = 0; |
7956 | 0 | poCollHdr->m_nPolylinePenId = 0; |
7957 | 0 | } |
7958 | | |
7959 | | /*----------------------------------------------------------------- |
7960 | | * MultiPoint component |
7961 | | *----------------------------------------------------------------*/ |
7962 | 0 | if (m_poMpoint && m_poMpoint->GetMapInfoType() != TAB_GEOM_NONE) |
7963 | 0 | { |
7964 | 0 | CPLAssert(m_poMpoint->GetMapInfoType() == TAB_GEOM_MULTIPOINT || |
7965 | 0 | m_poMpoint->GetMapInfoType() == TAB_GEOM_MULTIPOINT_C || |
7966 | 0 | m_poMpoint->GetMapInfoType() == TAB_GEOM_V800_MULTIPOINT || |
7967 | 0 | m_poMpoint->GetMapInfoType() == TAB_GEOM_V800_MULTIPOINT_C); |
7968 | |
|
7969 | 0 | TABMAPObjMultiPoint *poMpointHdr = |
7970 | 0 | cpl::down_cast<TABMAPObjMultiPoint *>( |
7971 | 0 | TABMAPObjHdr::NewObj(m_poMpoint->GetMapInfoType(), -1)); |
7972 | | |
7973 | | // Update count of objects by type in header |
7974 | 0 | if (!bCoordBlockDataOnly) |
7975 | 0 | poMapFile->UpdateMapHeaderInfo(m_poMpoint->GetMapInfoType()); |
7976 | | |
7977 | | // Write a placeholder for centroid/label point and MBR mini-header |
7978 | | // and we'll come back later to write the real values. |
7979 | | // |
7980 | | // Note that the call to WriteGeometryToMAPFile() below will call |
7981 | | // StartNewFeature() as well, so we need to track the current |
7982 | | // value before calling it |
7983 | |
|
7984 | 0 | poCoordBlock->StartNewFeature(); |
7985 | 0 | int nMiniHeaderPtr = poCoordBlock->GetCurAddress(); |
7986 | |
|
7987 | 0 | WriteLabelAndMBR(poCoordBlock, bCompressed, 0, 0, 0, 0, 0, 0); |
7988 | 0 | nTotalFeatureDataSize += poCoordBlock->GetFeatureDataSize(); |
7989 | |
|
7990 | 0 | if (m_poMpoint->WriteGeometryToMAPFile(poMapFile, poMpointHdr, |
7991 | 0 | bCoordBlockDataOnly, |
7992 | 0 | &poCoordBlock) != 0) |
7993 | 0 | { |
7994 | 0 | CPLError(CE_Failure, CPLE_FileIO, |
7995 | 0 | "Failed writing Region part in collection."); |
7996 | 0 | delete poMpointHdr; |
7997 | 0 | return -1; |
7998 | 0 | } |
7999 | | |
8000 | 0 | nTotalFeatureDataSize += poMpointHdr->m_nCoordDataSize; |
8001 | | |
8002 | | // Come back to write the real values in the mini-header |
8003 | 0 | int nEndOfObjectPtr = poCoordBlock->GetCurAddress(); |
8004 | 0 | poCoordBlock->StartNewFeature(); |
8005 | |
|
8006 | 0 | if (poCoordBlock->GotoByteInFile(nMiniHeaderPtr, TRUE, TRUE) != 0) |
8007 | 0 | { |
8008 | 0 | delete poMpointHdr; |
8009 | 0 | return -1; |
8010 | 0 | } |
8011 | | |
8012 | 0 | WriteLabelAndMBR(poCoordBlock, bCompressed, poMpointHdr->m_nMinX, |
8013 | 0 | poMpointHdr->m_nMinY, poMpointHdr->m_nMaxX, |
8014 | 0 | poMpointHdr->m_nMaxY, poMpointHdr->m_nLabelX, |
8015 | 0 | poMpointHdr->m_nLabelY); |
8016 | | |
8017 | | // And finally move the pointer back to the end of this component |
8018 | 0 | if (poCoordBlock->GotoByteInFile(nEndOfObjectPtr, TRUE, TRUE) != 0) |
8019 | 0 | { |
8020 | 0 | delete poMpointHdr; |
8021 | 0 | return -1; |
8022 | 0 | } |
8023 | | |
8024 | | // Copy other header members to the main collection header |
8025 | | // TODO: Does m_nRegionDataSize need to include the centroid+mbr |
8026 | | // mini-header??? |
8027 | 0 | poCollHdr->m_nMPointDataSize = poMpointHdr->m_nCoordDataSize; |
8028 | 0 | poCollHdr->m_nNumMultiPoints = poMpointHdr->m_nNumPoints; |
8029 | 0 | if (!bCoordBlockDataOnly) |
8030 | 0 | { |
8031 | 0 | poCollHdr->m_nMultiPointSymbolId = poMpointHdr->m_nSymbolId; |
8032 | 0 | } |
8033 | |
|
8034 | 0 | delete poMpointHdr; |
8035 | 0 | } |
8036 | 0 | else |
8037 | 0 | { |
8038 | | // No Multipoint component. Set corresponding header fields to 0 |
8039 | |
|
8040 | 0 | poCollHdr->m_nMPointDataSize = 0; |
8041 | 0 | poCollHdr->m_nNumMultiPoints = 0; |
8042 | 0 | poCollHdr->m_nMultiPointSymbolId = 0; |
8043 | 0 | } |
8044 | | |
8045 | | /*----------------------------------------------------------------- |
8046 | | * Copy object information |
8047 | | *----------------------------------------------------------------*/ |
8048 | | |
8049 | | // Compressed coordinate origin (useful only in compressed case!) |
8050 | 0 | poCollHdr->m_nComprOrgX = m_nComprOrgX; |
8051 | 0 | poCollHdr->m_nComprOrgY = m_nComprOrgY; |
8052 | |
|
8053 | 0 | poCollHdr->m_nCoordDataSize = nTotalFeatureDataSize; |
8054 | |
|
8055 | 0 | poCollHdr->SetMBR(m_nXMin, m_nYMin, m_nXMax, m_nYMax); |
8056 | |
|
8057 | 0 | if (CPLGetLastErrorType() == CE_Failure) |
8058 | 0 | return -1; |
8059 | | |
8060 | | /* Return a ref to coord block so that caller can continue writing |
8061 | | * after the end of this object (used by index splitting) |
8062 | | */ |
8063 | 0 | if (ppoCoordBlock) |
8064 | 0 | *ppoCoordBlock = poCoordBlock; |
8065 | |
|
8066 | 0 | return 0; |
8067 | 0 | } |
8068 | | |
8069 | | /********************************************************************** |
8070 | | * TABCollection::SyncOGRGeometryCollection() |
8071 | | * |
8072 | | * Copy the region/pline/multipoint's geometries to the OGRFeature's |
8073 | | * geometry. |
8074 | | **********************************************************************/ |
8075 | | int TABCollection::SyncOGRGeometryCollection(GBool bSyncRegion, |
8076 | | GBool bSyncPline, |
8077 | | GBool bSyncMpoint) |
8078 | 59.6k | { |
8079 | 59.6k | OGRGeometry *poThisGeom = GetGeometryRef(); |
8080 | 59.6k | OGRGeometryCollection *poGeomColl = nullptr; |
8081 | | |
8082 | | // poGeometry is defined in the OGRFeature class |
8083 | 59.6k | if (poThisGeom == nullptr) |
8084 | 29.8k | { |
8085 | 29.8k | poGeomColl = new OGRGeometryCollection(); |
8086 | 29.8k | } |
8087 | 29.8k | else if (wkbFlatten(poThisGeom->getGeometryType()) == wkbGeometryCollection) |
8088 | 29.8k | { |
8089 | 29.8k | poGeomColl = poThisGeom->toGeometryCollection(); |
8090 | 29.8k | } |
8091 | 0 | else |
8092 | 0 | { |
8093 | 0 | CPLError( |
8094 | 0 | CE_Failure, CPLE_AssertionFailed, |
8095 | 0 | "TABCollection: Invalid Geometry. Type must be OGRCollection."); |
8096 | 0 | return -1; |
8097 | 0 | } |
8098 | | |
8099 | | /*----------------------------------------------------------------- |
8100 | | * Start by removing geometries that need to be replaced |
8101 | | * In theory there should be a single geometry of each type, but |
8102 | | * just in case, we'll loop over the whole collection and delete all |
8103 | | * instances of each type if there are some. |
8104 | | *----------------------------------------------------------------*/ |
8105 | 59.6k | int numGeometries = poGeomColl->getNumGeometries(); |
8106 | 84.9k | for (int i = 0; i < numGeometries; i++) |
8107 | 25.2k | { |
8108 | 25.2k | OGRGeometry *poGeom = poGeomColl->getGeometryRef(i); |
8109 | 25.2k | if (!poGeom) |
8110 | 0 | continue; |
8111 | | |
8112 | 25.2k | if ((bSyncRegion && |
8113 | 25.2k | (wkbFlatten(poGeom->getGeometryType()) == wkbPolygon || |
8114 | 18.7k | wkbFlatten(poGeom->getGeometryType()) == wkbMultiPolygon)) || |
8115 | 15.1k | (bSyncPline && |
8116 | 15.1k | (wkbFlatten(poGeom->getGeometryType()) == wkbLineString || |
8117 | 11.9k | wkbFlatten(poGeom->getGeometryType()) == wkbMultiLineString)) || |
8118 | 10.6k | (bSyncMpoint && |
8119 | 10.6k | (wkbFlatten(poGeom->getGeometryType()) == wkbMultiPoint))) |
8120 | 25.2k | { |
8121 | | // Remove this geometry |
8122 | 25.2k | poGeomColl->removeGeometry(i); |
8123 | | |
8124 | | // Unless this was the last geometry, we need to restart |
8125 | | // scanning the collection since we modified it |
8126 | 25.2k | if (i != numGeometries - 1) |
8127 | 11.6k | { |
8128 | 11.6k | i = 0; |
8129 | 11.6k | numGeometries = poGeomColl->getNumGeometries(); |
8130 | 11.6k | } |
8131 | 25.2k | } |
8132 | 25.2k | } |
8133 | | |
8134 | | /*----------------------------------------------------------------- |
8135 | | * Copy TAB Feature geometries to OGRGeometryCollection |
8136 | | *----------------------------------------------------------------*/ |
8137 | 59.6k | if (bSyncRegion && m_poRegion && m_poRegion->GetGeometryRef() != nullptr) |
8138 | 2 | poGeomColl->addGeometry(m_poRegion->GetGeometryRef()); |
8139 | | |
8140 | 59.6k | if (bSyncPline && m_poPline && m_poPline->GetGeometryRef() != nullptr) |
8141 | 2 | poGeomColl->addGeometry(m_poPline->GetGeometryRef()); |
8142 | | |
8143 | 59.6k | if (bSyncMpoint && m_poMpoint && m_poMpoint->GetGeometryRef() != nullptr) |
8144 | 10 | poGeomColl->addGeometry(m_poMpoint->GetGeometryRef()); |
8145 | | |
8146 | 59.6k | if (poThisGeom == nullptr) |
8147 | 29.8k | SetGeometryDirectly(poGeomColl); |
8148 | | |
8149 | 59.6k | return 0; |
8150 | 59.6k | } |
8151 | | |
8152 | | /********************************************************************** |
8153 | | * TABCollection::SetRegionDirectly() |
8154 | | * |
8155 | | * Set the region component of the collection, deleting the current |
8156 | | * region component if there is one. The object is then owned by the |
8157 | | * TABCollection object. Passing NULL just deletes it. |
8158 | | * |
8159 | | * Note that an intentional side-effect is that calling this method |
8160 | | * with the same poRegion pointer that is already owned by this object |
8161 | | * will force resync'ing the OGR Geometry member. |
8162 | | **********************************************************************/ |
8163 | | int TABCollection::SetRegionDirectly(TABRegion *poRegion) |
8164 | 0 | { |
8165 | 0 | if (m_poRegion && m_poRegion != poRegion) |
8166 | 0 | delete m_poRegion; |
8167 | 0 | m_poRegion = poRegion; |
8168 | | |
8169 | | // Update OGRGeometryCollection component as well |
8170 | 0 | return SyncOGRGeometryCollection(TRUE, FALSE, FALSE); |
8171 | 0 | } |
8172 | | |
8173 | | /********************************************************************** |
8174 | | * TABCollection::SetPolylineDirectly() |
8175 | | * |
8176 | | * Set the polyline component of the collection, deleting the current |
8177 | | * polyline component if there is one. The object is then owned by the |
8178 | | * TABCollection object. Passing NULL just deletes it. |
8179 | | * |
8180 | | * Note that an intentional side-effect is that calling this method |
8181 | | * with the same poPline pointer that is already owned by this object |
8182 | | * will force resync'ing the OGR Geometry member. |
8183 | | **********************************************************************/ |
8184 | | int TABCollection::SetPolylineDirectly(TABPolyline *poPline) |
8185 | 0 | { |
8186 | 0 | if (m_poPline && m_poPline != poPline) |
8187 | 0 | delete m_poPline; |
8188 | 0 | m_poPline = poPline; |
8189 | | |
8190 | | // Update OGRGeometryCollection component as well |
8191 | 0 | return SyncOGRGeometryCollection(FALSE, TRUE, FALSE); |
8192 | 0 | } |
8193 | | |
8194 | | /********************************************************************** |
8195 | | * TABCollection::SetMultiPointDirectly() |
8196 | | * |
8197 | | * Set the multipoint component of the collection, deleting the current |
8198 | | * multipoint component if there is one. The object is then owned by the |
8199 | | * TABCollection object. Passing NULL just deletes it. |
8200 | | * |
8201 | | * Note that an intentional side-effect is that calling this method |
8202 | | * with the same poMpoint pointer that is already owned by this object |
8203 | | * will force resync'ing the OGR Geometry member. |
8204 | | **********************************************************************/ |
8205 | | int TABCollection::SetMultiPointDirectly(TABMultiPoint *poMpoint) |
8206 | 0 | { |
8207 | 0 | if (m_poMpoint && m_poMpoint != poMpoint) |
8208 | 0 | delete m_poMpoint; |
8209 | 0 | m_poMpoint = poMpoint; |
8210 | | |
8211 | | // Update OGRGeometryCollection component as well |
8212 | 0 | return SyncOGRGeometryCollection(FALSE, FALSE, TRUE); |
8213 | 0 | } |
8214 | | |
8215 | | /********************************************************************** |
8216 | | * TABCollection::GetStyleString() const |
8217 | | * |
8218 | | * Return style string for this feature. |
8219 | | * |
8220 | | * Style String is built only once during the first call to GetStyleString(). |
8221 | | **********************************************************************/ |
8222 | | const char *TABCollection::GetStyleString() const |
8223 | 0 | { |
8224 | 0 | if (m_pszStyleString == nullptr) |
8225 | 0 | { |
8226 | 0 | m_pszStyleString = CPLStrdup(GetSymbolStyleString()); |
8227 | 0 | } |
8228 | |
|
8229 | 0 | return m_pszStyleString; |
8230 | 0 | } |
8231 | | |
8232 | | /********************************************************************** |
8233 | | * TABCollection::DumpMIF() |
8234 | | * |
8235 | | * Dump feature geometry |
8236 | | **********************************************************************/ |
8237 | | void TABCollection::DumpMIF(FILE *fpOut /*=NULL*/) |
8238 | 0 | { |
8239 | 0 | if (fpOut == nullptr) |
8240 | 0 | fpOut = stdout; |
8241 | | |
8242 | | /*----------------------------------------------------------------- |
8243 | | * Generate output |
8244 | | *----------------------------------------------------------------*/ |
8245 | 0 | int numParts = 0; |
8246 | 0 | if (m_poRegion) |
8247 | 0 | numParts++; |
8248 | 0 | if (m_poPline) |
8249 | 0 | numParts++; |
8250 | 0 | if (m_poMpoint) |
8251 | 0 | numParts++; |
8252 | |
|
8253 | 0 | fprintf(fpOut, "COLLECTION %d\n", numParts); |
8254 | |
|
8255 | 0 | if (m_poRegion) |
8256 | 0 | m_poRegion->DumpMIF(fpOut); |
8257 | |
|
8258 | 0 | if (m_poPline) |
8259 | 0 | m_poPline->DumpMIF(fpOut); |
8260 | |
|
8261 | 0 | if (m_poMpoint) |
8262 | 0 | m_poMpoint->DumpMIF(fpOut); |
8263 | |
|
8264 | 0 | DumpSymbolDef(fpOut); |
8265 | |
|
8266 | 0 | fflush(fpOut); |
8267 | 0 | } |
8268 | | |
8269 | | /*===================================================================== |
8270 | | * class TABDebugFeature |
8271 | | *====================================================================*/ |
8272 | | |
8273 | | /********************************************************************** |
8274 | | * TABDebugFeature::TABDebugFeature() |
8275 | | * |
8276 | | * Constructor. |
8277 | | **********************************************************************/ |
8278 | | TABDebugFeature::TABDebugFeature(const OGRFeatureDefn *poDefnIn) |
8279 | 0 | : TABFeature(poDefnIn), m_nSize(0), m_nCoordDataPtr(0), m_nCoordDataSize(0) |
8280 | 0 | { |
8281 | 0 | memset(m_abyBuf, 0, sizeof(m_abyBuf)); |
8282 | 0 | } |
8283 | | |
8284 | | /********************************************************************** |
8285 | | * TABDebugFeature::~TABDebugFeature() |
8286 | | * |
8287 | | * Destructor. |
8288 | | **********************************************************************/ |
8289 | | TABDebugFeature::~TABDebugFeature() |
8290 | | { |
8291 | | } |
8292 | | |
8293 | | /********************************************************************** |
8294 | | * TABDebugFeature::ReadGeometryFromMAPFile() |
8295 | | * |
8296 | | * Fill the geometry and representation (color, etc...) part of the |
8297 | | * feature from the contents of the .MAP object pointed to by poMAPFile. |
8298 | | * |
8299 | | * It is assumed that poMAPFile currently points to the beginning of |
8300 | | * a map object. |
8301 | | * |
8302 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
8303 | | * been called. |
8304 | | **********************************************************************/ |
8305 | | int TABDebugFeature::ReadGeometryFromMAPFile( |
8306 | | TABMAPFile *poMapFile, TABMAPObjHdr *poObjHdr, |
8307 | | GBool /*bCoordBlockDataOnly=FALSE*/, |
8308 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
8309 | 0 | { |
8310 | | /*----------------------------------------------------------------- |
8311 | | * Fetch geometry type |
8312 | | *----------------------------------------------------------------*/ |
8313 | 0 | m_nMapInfoType = poObjHdr->m_nType; |
8314 | |
|
8315 | 0 | TABMAPObjectBlock *poObjBlock = poMapFile->GetCurObjBlock(); |
8316 | 0 | TABMAPHeaderBlock *poHeader = poMapFile->GetHeaderBlock(); |
8317 | | |
8318 | | /*----------------------------------------------------------------- |
8319 | | * If object type has coords in a type 3 block, then its position |
8320 | | * follows |
8321 | | *----------------------------------------------------------------*/ |
8322 | 0 | if (poHeader->MapObjectUsesCoordBlock(m_nMapInfoType)) |
8323 | 0 | { |
8324 | 0 | m_nCoordDataPtr = poObjBlock->ReadInt32(); |
8325 | 0 | m_nCoordDataSize = poObjBlock->ReadInt32(); |
8326 | 0 | } |
8327 | 0 | else |
8328 | 0 | { |
8329 | 0 | m_nCoordDataPtr = -1; |
8330 | 0 | m_nCoordDataSize = 0; |
8331 | 0 | } |
8332 | |
|
8333 | 0 | m_nSize = poHeader->GetMapObjectSize(m_nMapInfoType); |
8334 | 0 | if (m_nSize > 0) |
8335 | 0 | { |
8336 | 0 | poObjBlock->GotoByteRel(-5); // Go back to beginning of header |
8337 | 0 | poObjBlock->ReadBytes( |
8338 | 0 | std::min(m_nSize, static_cast<int>(sizeof(m_abyBuf))), m_abyBuf); |
8339 | 0 | } |
8340 | |
|
8341 | 0 | return 0; |
8342 | 0 | } |
8343 | | |
8344 | | /********************************************************************** |
8345 | | * TABDebugFeature::WriteGeometryToMAPFile() |
8346 | | * |
8347 | | * Write the geometry and representation (color, etc...) part of the |
8348 | | * feature to the .MAP object pointed to by poMAPFile. |
8349 | | * |
8350 | | * It is assumed that poMAPFile currently points to a valid map object. |
8351 | | * |
8352 | | * Returns 0 on success, -1 on error, in which case CPLError() will have |
8353 | | * been called. |
8354 | | **********************************************************************/ |
8355 | | int TABDebugFeature::WriteGeometryToMAPFile( |
8356 | | TABMAPFile * /*poMapFile*/, TABMAPObjHdr * /*poObjHdr*/, |
8357 | | GBool /*bCoordBlockDataOnly=FALSE*/, |
8358 | | TABMAPCoordBlock ** /*ppoCoordBlock=NULL*/) |
8359 | 0 | { |
8360 | | // Nothing to do here! |
8361 | |
|
8362 | 0 | CPLError(CE_Failure, CPLE_NotSupported, |
8363 | 0 | "TABDebugFeature::WriteGeometryToMAPFile() not implemented."); |
8364 | |
|
8365 | 0 | return -1; |
8366 | 0 | } |
8367 | | |
8368 | | /********************************************************************** |
8369 | | * TABDebugFeature::DumpMIF() |
8370 | | * |
8371 | | * Dump feature contents... available only in DEBUG mode. |
8372 | | **********************************************************************/ |
8373 | | void TABDebugFeature::DumpMIF(FILE *fpOut /*=NULL*/) |
8374 | 0 | { |
8375 | 0 | if (fpOut == nullptr) |
8376 | 0 | fpOut = stdout; |
8377 | |
|
8378 | 0 | fprintf(fpOut, "----- TABDebugFeature (type = 0x%2.2x) -----\n", |
8379 | 0 | GetMapInfoType()); |
8380 | 0 | fprintf(fpOut, " Object size: %d bytes\n", m_nSize); |
8381 | 0 | fprintf(fpOut, " m_nCoordDataPtr = %d\n", m_nCoordDataPtr); |
8382 | 0 | fprintf(fpOut, " m_nCoordDataSize = %d\n", m_nCoordDataSize); |
8383 | 0 | fprintf(fpOut, " "); |
8384 | |
|
8385 | 0 | for (int i = 0; i < m_nSize; i++) |
8386 | 0 | fprintf(fpOut, " %2.2x", m_abyBuf[i]); |
8387 | |
|
8388 | 0 | fprintf(fpOut, " \n"); |
8389 | |
|
8390 | 0 | fflush(fpOut); |
8391 | 0 | } |
8392 | | |
8393 | | /*===================================================================== |
8394 | | * class ITABFeaturePen |
8395 | | *====================================================================*/ |
8396 | | |
8397 | | /********************************************************************** |
8398 | | * ITABFeaturePen::ITABFeaturePen() |
8399 | | **********************************************************************/ |
8400 | | |
8401 | | // MI default is PEN(1, 2, 0) |
8402 | | static const TABPenDef MITABcsDefaultPen = MITAB_PEN_DEFAULT; |
8403 | | |
8404 | | ITABFeaturePen::ITABFeaturePen() |
8405 | 486k | : m_nPenDefIndex(-1), m_sPenDef(MITABcsDefaultPen) |
8406 | 486k | { |
8407 | 486k | } |
8408 | | |
8409 | | /********************************************************************** |
8410 | | * ITABFeaturePen::~ITABFeaturePen() |
8411 | | **********************************************************************/ |
8412 | | |
8413 | 486k | ITABFeaturePen::~ITABFeaturePen() = default; |
8414 | | |
8415 | | /********************************************************************** |
8416 | | * ITABFeaturePen::GetPenWidthPixel() |
8417 | | * ITABFeaturePen::SetPenWidthPixel() |
8418 | | * ITABFeaturePen::GetPenWidthPoint() |
8419 | | * ITABFeaturePen::SetPenWidthPoint() |
8420 | | * |
8421 | | * Pen width can be expressed in pixels (value from 1 to 7 pixels) or |
8422 | | * in points (value from 0.1 to 203.7 points). The default pen width |
8423 | | * in MapInfo is 1 pixel. Pen width in points exist only in file version 450. |
8424 | | * |
8425 | | * The following methods hide the way the pen width is stored in the files. |
8426 | | * |
8427 | | * In order to establish if a given pen def had its width specified in |
8428 | | * pixels or in points, one should first call GetPenWidthPoint(), and if |
8429 | | * it returns 0 then the Pixel width should be used instead: |
8430 | | * if (GetPenWidthPoint() == 0) |
8431 | | * ... use pen width in points ... |
8432 | | * else |
8433 | | * ... use Pixel width from GetPenWidthPixel() |
8434 | | * |
8435 | | * Note that the reverse is not true: the default pixel width is always 1, |
8436 | | * even when the pen width was actually set in points. |
8437 | | **********************************************************************/ |
8438 | | |
8439 | | GByte ITABFeaturePen::GetPenWidthPixel() const |
8440 | 0 | { |
8441 | 0 | return m_sPenDef.nPixelWidth; |
8442 | 0 | } |
8443 | | |
8444 | | void ITABFeaturePen::SetPenWidthPixel(GByte val) |
8445 | 0 | { |
8446 | 0 | const GByte nPixelWidthMin = 1; |
8447 | 0 | const GByte nPixelWidthMax = 7; |
8448 | 0 | m_sPenDef.nPixelWidth = |
8449 | 0 | std::min(std::max(val, nPixelWidthMin), nPixelWidthMax); |
8450 | 0 | m_sPenDef.nPointWidth = 0; |
8451 | 0 | } |
8452 | | |
8453 | | double ITABFeaturePen::GetPenWidthPoint() const |
8454 | 0 | { |
8455 | | // We store point width internally as tenths of points |
8456 | 0 | return m_sPenDef.nPointWidth / 10.0; |
8457 | 0 | } |
8458 | | |
8459 | | void ITABFeaturePen::SetPenWidthPoint(double val) |
8460 | 0 | { |
8461 | 0 | m_sPenDef.nPointWidth = |
8462 | 0 | std::min(std::max(static_cast<int>(val * 10), 1), 2037); |
8463 | 0 | m_sPenDef.nPixelWidth = 1; |
8464 | 0 | } |
8465 | | |
8466 | | /********************************************************************** |
8467 | | * ITABFeaturePen::GetPenWidthMIF() |
8468 | | * ITABFeaturePen::SetPenWidthMIF() |
8469 | | * |
8470 | | * The MIF representation for pen width is either a value from 1 to 7 |
8471 | | * for a pen width in pixels, or a value from 11 to 2047 for a pen |
8472 | | * width in points = 10 + (point_width*10) |
8473 | | **********************************************************************/ |
8474 | | int ITABFeaturePen::GetPenWidthMIF() const |
8475 | 167 | { |
8476 | 167 | return (m_sPenDef.nPointWidth > 0 ? (m_sPenDef.nPointWidth + 10) |
8477 | 167 | : m_sPenDef.nPixelWidth); |
8478 | 167 | } |
8479 | | |
8480 | | void ITABFeaturePen::SetPenWidthMIF(int val) |
8481 | 56.6k | { |
8482 | 56.6k | if (val > 10) |
8483 | 6.75k | { |
8484 | 6.75k | m_sPenDef.nPointWidth = std::min((val - 10), 2037); |
8485 | 6.75k | m_sPenDef.nPixelWidth = 0; |
8486 | 6.75k | } |
8487 | 49.9k | else |
8488 | 49.9k | { |
8489 | 49.9k | m_sPenDef.nPixelWidth = |
8490 | 49.9k | static_cast<GByte>(std::min(std::max(val, 1), 7)); |
8491 | 49.9k | m_sPenDef.nPointWidth = 0; |
8492 | 49.9k | } |
8493 | 56.6k | } |
8494 | | |
8495 | | /********************************************************************** |
8496 | | * ITABFeaturePen::GetPenStyleString() |
8497 | | * |
8498 | | * Return a PEN() string. All representations info for the pen are here. |
8499 | | **********************************************************************/ |
8500 | | const char *ITABFeaturePen::GetPenStyleString() const |
8501 | 0 | { |
8502 | 0 | const char *pszStyle = nullptr; |
8503 | 0 | int nOGRStyle = 0; |
8504 | 0 | char szPattern[20]; |
8505 | |
|
8506 | 0 | szPattern[0] = '\0'; |
8507 | | |
8508 | | // For now, I only add the 25 first styles |
8509 | 0 | switch (GetPenPattern()) |
8510 | 0 | { |
8511 | 0 | case 1: |
8512 | 0 | nOGRStyle = 1; |
8513 | 0 | break; |
8514 | 0 | case 2: |
8515 | 0 | nOGRStyle = 0; |
8516 | 0 | break; |
8517 | 0 | case 3: |
8518 | 0 | nOGRStyle = 3; |
8519 | 0 | strcpy(szPattern, "1 1"); |
8520 | 0 | break; |
8521 | 0 | case 4: |
8522 | 0 | nOGRStyle = 3; |
8523 | 0 | strcpy(szPattern, "2 1"); |
8524 | 0 | break; |
8525 | 0 | case 5: |
8526 | 0 | nOGRStyle = 3; |
8527 | 0 | strcpy(szPattern, "3 1"); |
8528 | 0 | break; |
8529 | 0 | case 6: |
8530 | 0 | nOGRStyle = 3; |
8531 | 0 | strcpy(szPattern, "6 1"); |
8532 | 0 | break; |
8533 | 0 | case 7: |
8534 | 0 | nOGRStyle = 4; |
8535 | 0 | strcpy(szPattern, "12 2"); |
8536 | 0 | break; |
8537 | 0 | case 8: |
8538 | 0 | nOGRStyle = 4; |
8539 | 0 | strcpy(szPattern, "24 4"); |
8540 | 0 | break; |
8541 | 0 | case 9: |
8542 | 0 | nOGRStyle = 3; |
8543 | 0 | strcpy(szPattern, "4 3"); |
8544 | 0 | break; |
8545 | 0 | case 10: |
8546 | 0 | nOGRStyle = 5; |
8547 | 0 | strcpy(szPattern, "1 4"); |
8548 | 0 | break; |
8549 | 0 | case 11: |
8550 | 0 | nOGRStyle = 3; |
8551 | 0 | strcpy(szPattern, "4 6"); |
8552 | 0 | break; |
8553 | 0 | case 12: |
8554 | 0 | nOGRStyle = 3; |
8555 | 0 | strcpy(szPattern, "6 4"); |
8556 | 0 | break; |
8557 | 0 | case 13: |
8558 | 0 | nOGRStyle = 4; |
8559 | 0 | strcpy(szPattern, "12 12"); |
8560 | 0 | break; |
8561 | 0 | case 14: |
8562 | 0 | nOGRStyle = 6; |
8563 | 0 | strcpy(szPattern, "8 2 1 2"); |
8564 | 0 | break; |
8565 | 0 | case 15: |
8566 | 0 | nOGRStyle = 6; |
8567 | 0 | strcpy(szPattern, "12 1 1 1"); |
8568 | 0 | break; |
8569 | 0 | case 16: |
8570 | 0 | nOGRStyle = 6; |
8571 | 0 | strcpy(szPattern, "12 1 3 1"); |
8572 | 0 | break; |
8573 | 0 | case 17: |
8574 | 0 | nOGRStyle = 6; |
8575 | 0 | strcpy(szPattern, "24 6 4 6"); |
8576 | 0 | break; |
8577 | 0 | case 18: |
8578 | 0 | nOGRStyle = 7; |
8579 | 0 | strcpy(szPattern, "24 3 3 3 3 3"); |
8580 | 0 | break; |
8581 | 0 | case 19: |
8582 | 0 | nOGRStyle = 7; |
8583 | 0 | strcpy(szPattern, "24 3 3 3 3 3 3 3"); |
8584 | 0 | break; |
8585 | 0 | case 20: |
8586 | 0 | nOGRStyle = 7; |
8587 | 0 | strcpy(szPattern, "6 3 1 3 1 3"); |
8588 | 0 | break; |
8589 | 0 | case 21: |
8590 | 0 | nOGRStyle = 7; |
8591 | 0 | strcpy(szPattern, "12 2 1 2 1 2"); |
8592 | 0 | break; |
8593 | 0 | case 22: |
8594 | 0 | nOGRStyle = 7; |
8595 | 0 | strcpy(szPattern, "12 2 1 2 1 2 1 2"); |
8596 | 0 | break; |
8597 | 0 | case 23: |
8598 | 0 | nOGRStyle = 6; |
8599 | 0 | strcpy(szPattern, "4 1 1 1"); |
8600 | 0 | break; |
8601 | 0 | case 24: |
8602 | 0 | nOGRStyle = 7; |
8603 | 0 | strcpy(szPattern, "4 1 1 1 1"); |
8604 | 0 | break; |
8605 | 0 | case 25: |
8606 | 0 | nOGRStyle = 6; |
8607 | 0 | strcpy(szPattern, "4 1 1 1 2 1 1 1"); |
8608 | 0 | break; |
8609 | | |
8610 | 0 | default: |
8611 | 0 | nOGRStyle = 0; |
8612 | 0 | break; |
8613 | 0 | } |
8614 | | |
8615 | | // note - MapInfo renders all lines using a round pen cap and round pen join |
8616 | | // which are not the default values for OGR pen cap/join styles. So we need |
8617 | | // to explicitly include the cap/j parameters in these strings |
8618 | 0 | if (strlen(szPattern) != 0) |
8619 | 0 | { |
8620 | 0 | if (m_sPenDef.nPointWidth > 0) |
8621 | 0 | pszStyle = CPLSPrintf("PEN(w:%.1fpt,c:#%6.6x,id:\"mapinfo-pen-%d," |
8622 | 0 | "ogr-pen-%d\",p:\"%spx\",cap:r,j:r)", |
8623 | 0 | GetPenWidthPoint(), m_sPenDef.rgbColor, |
8624 | 0 | GetPenPattern(), nOGRStyle, szPattern); |
8625 | 0 | else |
8626 | 0 | pszStyle = CPLSPrintf("PEN(w:%dpx,c:#%6.6x,id:\"mapinfo-pen-%d," |
8627 | 0 | "ogr-pen-%d\",p:\"%spx\",cap:r,j:r)", |
8628 | 0 | GetPenWidthPixel(), m_sPenDef.rgbColor, |
8629 | 0 | GetPenPattern(), nOGRStyle, szPattern); |
8630 | 0 | } |
8631 | 0 | else |
8632 | 0 | { |
8633 | 0 | if (m_sPenDef.nPointWidth > 0) |
8634 | 0 | pszStyle = CPLSPrintf("PEN(w:%.1fpt,c:#%6.6x,id:\"" |
8635 | 0 | "mapinfo-pen-%d,ogr-pen-%d\",cap:r,j:r)", |
8636 | 0 | GetPenWidthPoint(), m_sPenDef.rgbColor, |
8637 | 0 | GetPenPattern(), nOGRStyle); |
8638 | 0 | else |
8639 | 0 | pszStyle = CPLSPrintf("PEN(w:%dpx,c:#%6.6x,id:\"" |
8640 | 0 | "mapinfo-pen-%d,ogr-pen-%d\",cap:r,j:r)", |
8641 | 0 | GetPenWidthPixel(), m_sPenDef.rgbColor, |
8642 | 0 | GetPenPattern(), nOGRStyle); |
8643 | 0 | } |
8644 | |
|
8645 | 0 | return pszStyle; |
8646 | 0 | } |
8647 | | |
8648 | | /********************************************************************** |
8649 | | * ITABFeaturePen::SetPenFromStyleString() |
8650 | | * |
8651 | | * Init the Pen properties from a style string. |
8652 | | **********************************************************************/ |
8653 | | void ITABFeaturePen::SetPenFromStyleString(const char *pszStyleString) |
8654 | 1 | { |
8655 | 1 | GBool bIsNull = 0; |
8656 | | |
8657 | | // Use the Style Manager to retrieve all the information we need. |
8658 | 1 | OGRStyleMgr *poStyleMgr = new OGRStyleMgr(nullptr); |
8659 | 1 | OGRStyleTool *poStylePart = nullptr; |
8660 | | |
8661 | | // Init the StyleMgr with the StyleString. |
8662 | 1 | poStyleMgr->InitStyleString(pszStyleString); |
8663 | | |
8664 | | // Retrieve the Pen info. |
8665 | 1 | const int numParts = poStyleMgr->GetPartCount(); |
8666 | 2 | for (int i = 0; i < numParts; i++) |
8667 | 1 | { |
8668 | 1 | poStylePart = poStyleMgr->GetPart(i); |
8669 | 1 | if (poStylePart == nullptr) |
8670 | 1 | continue; |
8671 | | |
8672 | 0 | if (poStylePart->GetType() == OGRSTCPen) |
8673 | 0 | { |
8674 | 0 | break; |
8675 | 0 | } |
8676 | 0 | else |
8677 | 0 | { |
8678 | 0 | delete poStylePart; |
8679 | 0 | poStylePart = nullptr; |
8680 | 0 | } |
8681 | 0 | } |
8682 | | |
8683 | | // If the no Pen found, do nothing. |
8684 | 1 | if (poStylePart == nullptr) |
8685 | 1 | { |
8686 | 1 | delete poStyleMgr; |
8687 | 1 | return; |
8688 | 1 | } |
8689 | | |
8690 | 0 | OGRStylePen *poPenStyle = cpl::down_cast<OGRStylePen *>(poStylePart); |
8691 | | |
8692 | | // With Pen, we always want to output points or pixels |
8693 | | |
8694 | | // Get the Pen Id or pattern |
8695 | 0 | const char *pszPenName = poPenStyle->Id(bIsNull); |
8696 | 0 | if (bIsNull) |
8697 | 0 | pszPenName = nullptr; |
8698 | | |
8699 | | // Set the width |
8700 | 0 | OGRSTUnitId ePenWidthUnit = OGRSTUGround; |
8701 | | // Respect the original unit if it is points vs pixel. Otherwise convert |
8702 | | // to points. |
8703 | 0 | const double dfPenWidth = poPenStyle->RawWidth(ePenWidthUnit, bIsNull); |
8704 | 0 | if (dfPenWidth != 0.0) |
8705 | 0 | { |
8706 | 0 | if (ePenWidthUnit == OGRSTUPoints) |
8707 | 0 | { |
8708 | 0 | SetPenWidthPoint(dfPenWidth); |
8709 | 0 | } |
8710 | 0 | else if (ePenWidthUnit == OGRSTUPixel) |
8711 | 0 | { |
8712 | 0 | SetPenWidthPixel( |
8713 | 0 | static_cast<GByte>(std::clamp(dfPenWidth + 0.5, 0.0, 255.0))); |
8714 | 0 | } |
8715 | 0 | else |
8716 | 0 | { |
8717 | 0 | poPenStyle->SetUnit(OGRSTUPoints, 1); |
8718 | 0 | SetPenWidthPoint(poPenStyle->Width(bIsNull)); |
8719 | 0 | } |
8720 | 0 | } |
8721 | | |
8722 | | // Set the color |
8723 | 0 | const char *pszPenColor = poPenStyle->Color(bIsNull); |
8724 | 0 | if (pszPenColor != nullptr) |
8725 | 0 | { |
8726 | 0 | if (pszPenColor[0] == '#') |
8727 | 0 | pszPenColor++; |
8728 | | // The Pen color is an Hexa string that need to be convert in a int |
8729 | 0 | const GInt32 nPenColor = |
8730 | 0 | static_cast<int>(strtol(pszPenColor, nullptr, 16)); |
8731 | 0 | SetPenColor(nPenColor); |
8732 | 0 | } |
8733 | |
|
8734 | 0 | const char *pszPenPattern = nullptr; |
8735 | | |
8736 | | // Set the Id of the Pen, use Pattern if necessary. |
8737 | 0 | if (pszPenName && |
8738 | 0 | (strstr(pszPenName, "mapinfo-pen-") || strstr(pszPenName, "ogr-pen-"))) |
8739 | 0 | { |
8740 | 0 | const char *pszPenId = strstr(pszPenName, "mapinfo-pen-"); |
8741 | 0 | if (pszPenId != nullptr) |
8742 | 0 | { |
8743 | 0 | const int nPenId = atoi(pszPenId + 12); |
8744 | 0 | SetPenPattern(static_cast<GByte>(nPenId)); |
8745 | 0 | } |
8746 | 0 | else |
8747 | 0 | { |
8748 | 0 | pszPenId = strstr(pszPenName, "ogr-pen-"); |
8749 | 0 | if (pszPenId != nullptr) |
8750 | 0 | { |
8751 | 0 | int nPenId = atoi(pszPenId + 8); |
8752 | 0 | if (nPenId == 0) |
8753 | 0 | nPenId = 2; |
8754 | 0 | SetPenPattern(static_cast<GByte>(nPenId)); |
8755 | 0 | } |
8756 | 0 | } |
8757 | 0 | } |
8758 | 0 | else |
8759 | 0 | { |
8760 | | // If no Pen Id, use the Pen Pattern to retrieve the Id. |
8761 | 0 | pszPenPattern = poPenStyle->Pattern(bIsNull); |
8762 | 0 | if (bIsNull) |
8763 | 0 | pszPenPattern = nullptr; |
8764 | 0 | else |
8765 | 0 | { |
8766 | 0 | if (strcmp(pszPenPattern, "1 1") == 0) |
8767 | 0 | SetPenPattern(3); |
8768 | 0 | else if (strcmp(pszPenPattern, "2 1") == 0) |
8769 | 0 | SetPenPattern(4); |
8770 | 0 | else if (strcmp(pszPenPattern, "3 1") == 0) |
8771 | 0 | SetPenPattern(5); |
8772 | 0 | else if (strcmp(pszPenPattern, "6 1") == 0) |
8773 | 0 | SetPenPattern(6); |
8774 | 0 | else if (strcmp(pszPenPattern, "12 2") == 0) |
8775 | 0 | SetPenPattern(7); |
8776 | 0 | else if (strcmp(pszPenPattern, "24 4") == 0) |
8777 | 0 | SetPenPattern(8); |
8778 | 0 | else if (strcmp(pszPenPattern, "4 3") == 0) |
8779 | 0 | SetPenPattern(9); |
8780 | 0 | else if (strcmp(pszPenPattern, "1 4") == 0) |
8781 | 0 | SetPenPattern(10); |
8782 | 0 | else if (strcmp(pszPenPattern, "4 6") == 0) |
8783 | 0 | SetPenPattern(11); |
8784 | 0 | else if (strcmp(pszPenPattern, "6 4") == 0) |
8785 | 0 | SetPenPattern(12); |
8786 | 0 | else if (strcmp(pszPenPattern, "12 12") == 0) |
8787 | 0 | SetPenPattern(13); |
8788 | 0 | else if (strcmp(pszPenPattern, "8 2 1 2") == 0) |
8789 | 0 | SetPenPattern(14); |
8790 | 0 | else if (strcmp(pszPenPattern, "12 1 1 1") == 0) |
8791 | 0 | SetPenPattern(15); |
8792 | 0 | else if (strcmp(pszPenPattern, "12 1 3 1") == 0) |
8793 | 0 | SetPenPattern(16); |
8794 | 0 | else if (strcmp(pszPenPattern, "24 6 4 6") == 0) |
8795 | 0 | SetPenPattern(17); |
8796 | 0 | else if (strcmp(pszPenPattern, "24 3 3 3 3 3") == 0) |
8797 | 0 | SetPenPattern(18); |
8798 | 0 | else if (strcmp(pszPenPattern, "24 3 3 3 3 3 3 3") == 0) |
8799 | 0 | SetPenPattern(19); |
8800 | 0 | else if (strcmp(pszPenPattern, "6 3 1 3 1 3") == 0) |
8801 | 0 | SetPenPattern(20); |
8802 | 0 | else if (strcmp(pszPenPattern, "12 2 1 2 1 2") == 0) |
8803 | 0 | SetPenPattern(21); |
8804 | 0 | else if (strcmp(pszPenPattern, "12 2 1 2 1 2 1 2") == 0) |
8805 | 0 | SetPenPattern(22); |
8806 | 0 | else if (strcmp(pszPenPattern, "4 1 1 1") == 0) |
8807 | 0 | SetPenPattern(23); |
8808 | 0 | else if (strcmp(pszPenPattern, "4 1 1 1 1") == 0) |
8809 | 0 | SetPenPattern(24); |
8810 | 0 | else if (strcmp(pszPenPattern, "4 1 1 1 2 1 1 1") == 0) |
8811 | 0 | SetPenPattern(25); |
8812 | 0 | } |
8813 | 0 | } |
8814 | |
|
8815 | 0 | delete poStyleMgr; |
8816 | 0 | delete poStylePart; |
8817 | |
|
8818 | 0 | return; |
8819 | 1 | } |
8820 | | |
8821 | | /********************************************************************** |
8822 | | * ITABFeaturePen::DumpPenDef() |
8823 | | * |
8824 | | * Dump pen definition information. |
8825 | | **********************************************************************/ |
8826 | | void ITABFeaturePen::DumpPenDef(FILE *fpOut /*=NULL*/) |
8827 | 0 | { |
8828 | 0 | if (fpOut == nullptr) |
8829 | 0 | fpOut = stdout; |
8830 | |
|
8831 | 0 | fprintf(fpOut, " m_nPenDefIndex = %d\n", m_nPenDefIndex); |
8832 | 0 | fprintf(fpOut, " m_sPenDef.nRefCount = %d\n", m_sPenDef.nRefCount); |
8833 | 0 | fprintf(fpOut, " m_sPenDef.nPixelWidth = %u\n", m_sPenDef.nPixelWidth); |
8834 | 0 | fprintf(fpOut, " m_sPenDef.nLinePattern = %u\n", m_sPenDef.nLinePattern); |
8835 | 0 | fprintf(fpOut, " m_sPenDef.nPointWidth = %d\n", m_sPenDef.nPointWidth); |
8836 | 0 | fprintf(fpOut, " m_sPenDef.rgbColor = 0x%6.6x (%d)\n", |
8837 | 0 | m_sPenDef.rgbColor, m_sPenDef.rgbColor); |
8838 | |
|
8839 | 0 | fflush(fpOut); |
8840 | 0 | } |
8841 | | |
8842 | | /*===================================================================== |
8843 | | * class ITABFeatureBrush |
8844 | | *====================================================================*/ |
8845 | | |
8846 | | /********************************************************************** |
8847 | | * ITABFeatureBrush::ITABFeatureBrush() |
8848 | | **********************************************************************/ |
8849 | | |
8850 | | // MI default is BRUSH(2, 16777215, 16777215) |
8851 | | static const TABBrushDef MITABcsDefaultBrush = MITAB_BRUSH_DEFAULT; |
8852 | | |
8853 | | ITABFeatureBrush::ITABFeatureBrush() |
8854 | 274k | : m_nBrushDefIndex(-1), m_sBrushDef(MITABcsDefaultBrush) |
8855 | 274k | { |
8856 | 274k | } |
8857 | | |
8858 | | /********************************************************************** |
8859 | | * ITABFeatureBrush::~ITABFeatureBrush() |
8860 | | **********************************************************************/ |
8861 | | |
8862 | 274k | ITABFeatureBrush::~ITABFeatureBrush() = default; |
8863 | | |
8864 | | /********************************************************************** |
8865 | | * ITABFeatureBrush::GetBrushStyleString() |
8866 | | * |
8867 | | * Return a Brush() string. All representations info for the Brush are here. |
8868 | | **********************************************************************/ |
8869 | | const char *ITABFeatureBrush::GetBrushStyleString() const |
8870 | 0 | { |
8871 | 0 | const char *pszStyle = nullptr; |
8872 | 0 | int nOGRStyle = 0; |
8873 | | /* char szPattern[20]; */ |
8874 | | //* szPattern[0] = '\0'; */ |
8875 | |
|
8876 | 0 | if (m_sBrushDef.nFillPattern == 1) |
8877 | 0 | nOGRStyle = 1; |
8878 | 0 | else if (m_sBrushDef.nFillPattern == 3) |
8879 | 0 | nOGRStyle = 2; |
8880 | 0 | else if (m_sBrushDef.nFillPattern == 4) |
8881 | 0 | nOGRStyle = 3; |
8882 | 0 | else if (m_sBrushDef.nFillPattern == 5) |
8883 | 0 | nOGRStyle = 5; |
8884 | 0 | else if (m_sBrushDef.nFillPattern == 6) |
8885 | 0 | nOGRStyle = 4; |
8886 | 0 | else if (m_sBrushDef.nFillPattern == 7) |
8887 | 0 | nOGRStyle = 6; |
8888 | 0 | else if (m_sBrushDef.nFillPattern == 8) |
8889 | 0 | nOGRStyle = 7; |
8890 | |
|
8891 | 0 | if (GetBrushTransparent()) |
8892 | 0 | { |
8893 | | /* Omit BG Color for transparent brushes */ |
8894 | 0 | pszStyle = CPLSPrintf( |
8895 | 0 | "BRUSH(fc:#%6.6x,id:\"mapinfo-brush-%d,ogr-brush-%d\")", |
8896 | 0 | m_sBrushDef.rgbFGColor, m_sBrushDef.nFillPattern, nOGRStyle); |
8897 | 0 | } |
8898 | 0 | else |
8899 | 0 | { |
8900 | 0 | pszStyle = CPLSPrintf( |
8901 | 0 | "BRUSH(fc:#%6.6x,bc:#%6.6x,id:\"mapinfo-brush-%d,ogr-brush-%d\")", |
8902 | 0 | m_sBrushDef.rgbFGColor, m_sBrushDef.rgbBGColor, |
8903 | 0 | m_sBrushDef.nFillPattern, nOGRStyle); |
8904 | 0 | } |
8905 | |
|
8906 | 0 | return pszStyle; |
8907 | 0 | } |
8908 | | |
8909 | | /********************************************************************** |
8910 | | * ITABFeatureBrush::SetBrushFromStyleString() |
8911 | | * |
8912 | | * Set all Brush elements from a StyleString. |
8913 | | * Use StyleMgr to do so. |
8914 | | **********************************************************************/ |
8915 | | void ITABFeatureBrush::SetBrushFromStyleString(const char *pszStyleString) |
8916 | 0 | { |
8917 | 0 | GBool bIsNull = 0; |
8918 | | |
8919 | | // Use the Style Manager to retrieve all the information we need. |
8920 | 0 | OGRStyleMgr *poStyleMgr = new OGRStyleMgr(nullptr); |
8921 | 0 | OGRStyleTool *poStylePart = nullptr; |
8922 | | |
8923 | | // Init the StyleMgr with the StyleString. |
8924 | 0 | poStyleMgr->InitStyleString(pszStyleString); |
8925 | | |
8926 | | // Retrieve the Brush info. |
8927 | 0 | const int numParts = poStyleMgr->GetPartCount(); |
8928 | 0 | for (int i = 0; i < numParts; i++) |
8929 | 0 | { |
8930 | 0 | poStylePart = poStyleMgr->GetPart(i); |
8931 | 0 | if (poStylePart == nullptr) |
8932 | 0 | continue; |
8933 | | |
8934 | 0 | if (poStylePart->GetType() == OGRSTCBrush) |
8935 | 0 | { |
8936 | 0 | break; |
8937 | 0 | } |
8938 | 0 | else |
8939 | 0 | { |
8940 | 0 | delete poStylePart; |
8941 | 0 | poStylePart = nullptr; |
8942 | 0 | } |
8943 | 0 | } |
8944 | | |
8945 | | // If the no Brush found, do nothing. |
8946 | 0 | if (poStylePart == nullptr) |
8947 | 0 | { |
8948 | 0 | delete poStyleMgr; |
8949 | 0 | return; |
8950 | 0 | } |
8951 | | |
8952 | 0 | OGRStyleBrush *poBrushStyle = cpl::down_cast<OGRStyleBrush *>(poStylePart); |
8953 | | |
8954 | | // Set the Brush Id (FillPattern) |
8955 | 0 | const char *pszBrushId = poBrushStyle->Id(bIsNull); |
8956 | 0 | if (bIsNull) |
8957 | 0 | pszBrushId = nullptr; |
8958 | 0 | bool bHasBrushId = false; |
8959 | |
|
8960 | 0 | if (pszBrushId && (strstr(pszBrushId, "mapinfo-brush-") || |
8961 | 0 | strstr(pszBrushId, "ogr-brush-"))) |
8962 | 0 | { |
8963 | 0 | if (strstr(pszBrushId, "mapinfo-brush-")) |
8964 | 0 | { |
8965 | 0 | const int nBrushId = atoi(pszBrushId + 14); |
8966 | 0 | SetBrushPattern(static_cast<GByte>(nBrushId)); |
8967 | 0 | bHasBrushId = true; |
8968 | 0 | } |
8969 | 0 | else if (strstr(pszBrushId, "ogr-brush-")) |
8970 | 0 | { |
8971 | 0 | int nBrushId = atoi(pszBrushId + 10); |
8972 | 0 | if (nBrushId > 1) |
8973 | 0 | nBrushId++; |
8974 | 0 | SetBrushPattern(static_cast<GByte>(nBrushId)); |
8975 | 0 | bHasBrushId = true; |
8976 | 0 | } |
8977 | 0 | } |
8978 | | |
8979 | | // Set the BackColor, if not set, then it is transparent |
8980 | 0 | const char *pszBrushColor = poBrushStyle->BackColor(bIsNull); |
8981 | 0 | if (bIsNull) |
8982 | 0 | pszBrushColor = nullptr; |
8983 | |
|
8984 | 0 | if (pszBrushColor) |
8985 | 0 | { |
8986 | 0 | if (pszBrushColor[0] == '#') |
8987 | 0 | pszBrushColor++; |
8988 | 0 | if (strlen(pszBrushColor) == 8 && pszBrushColor[6] == '0' && |
8989 | 0 | pszBrushColor[7] == '0') |
8990 | 0 | { |
8991 | 0 | SetBrushTransparent(1); |
8992 | 0 | } |
8993 | 0 | else |
8994 | 0 | { |
8995 | 0 | CPLString osBrushColor(pszBrushColor); |
8996 | 0 | if (strlen(pszBrushColor) > 6) |
8997 | 0 | osBrushColor.resize(6); |
8998 | 0 | const int nBrushColor = |
8999 | 0 | static_cast<int>(strtol(osBrushColor, nullptr, 16)); |
9000 | 0 | SetBrushBGColor(static_cast<GInt32>(nBrushColor)); |
9001 | 0 | } |
9002 | 0 | } |
9003 | 0 | else |
9004 | 0 | { |
9005 | 0 | SetBrushTransparent(1); |
9006 | 0 | } |
9007 | | |
9008 | | // Set the ForeColor |
9009 | 0 | pszBrushColor = poBrushStyle->ForeColor(bIsNull); |
9010 | 0 | if (bIsNull) |
9011 | 0 | pszBrushColor = nullptr; |
9012 | |
|
9013 | 0 | if (pszBrushColor) |
9014 | 0 | { |
9015 | 0 | if (pszBrushColor[0] == '#') |
9016 | 0 | pszBrushColor++; |
9017 | 0 | if (strlen(pszBrushColor) == 8 && pszBrushColor[6] == '0' && |
9018 | 0 | pszBrushColor[7] == '0') |
9019 | 0 | { |
9020 | 0 | if (!bHasBrushId) |
9021 | 0 | SetBrushPattern(static_cast<GByte>(1)); // No-fill |
9022 | 0 | } |
9023 | 0 | else |
9024 | 0 | { |
9025 | 0 | if (!bHasBrushId) |
9026 | 0 | SetBrushPattern(static_cast<GByte>(2)); // Solid-fill |
9027 | 0 | } |
9028 | |
|
9029 | 0 | CPLString osBrushColor(pszBrushColor); |
9030 | 0 | if (strlen(pszBrushColor) > 6) |
9031 | 0 | osBrushColor.resize(6); |
9032 | 0 | const int nBrushColor = |
9033 | 0 | static_cast<int>(strtol(osBrushColor, nullptr, 16)); |
9034 | 0 | SetBrushFGColor(static_cast<GInt32>(nBrushColor)); |
9035 | 0 | } |
9036 | |
|
9037 | 0 | delete poStyleMgr; |
9038 | 0 | delete poStylePart; |
9039 | |
|
9040 | 0 | return; |
9041 | 0 | } |
9042 | | |
9043 | | /********************************************************************** |
9044 | | * ITABFeatureBrush::DumpBrushDef() |
9045 | | * |
9046 | | * Dump Brush definition information. |
9047 | | **********************************************************************/ |
9048 | | void ITABFeatureBrush::DumpBrushDef(FILE *fpOut /*=NULL*/) |
9049 | 0 | { |
9050 | 0 | if (fpOut == nullptr) |
9051 | 0 | fpOut = stdout; |
9052 | |
|
9053 | 0 | fprintf(fpOut, " m_nBrushDefIndex = %d\n", m_nBrushDefIndex); |
9054 | 0 | fprintf(fpOut, " m_sBrushDef.nRefCount = %d\n", m_sBrushDef.nRefCount); |
9055 | 0 | fprintf(fpOut, " m_sBrushDef.nFillPattern = %d\n", |
9056 | 0 | static_cast<int>(m_sBrushDef.nFillPattern)); |
9057 | 0 | fprintf(fpOut, " m_sBrushDef.bTransparentFill = %d\n", |
9058 | 0 | static_cast<int>(m_sBrushDef.bTransparentFill)); |
9059 | 0 | fprintf(fpOut, " m_sBrushDef.rgbFGColor = 0x%6.6x (%d)\n", |
9060 | 0 | m_sBrushDef.rgbFGColor, m_sBrushDef.rgbFGColor); |
9061 | 0 | fprintf(fpOut, " m_sBrushDef.rgbBGColor = 0x%6.6x (%d)\n", |
9062 | 0 | m_sBrushDef.rgbBGColor, m_sBrushDef.rgbBGColor); |
9063 | |
|
9064 | 0 | fflush(fpOut); |
9065 | 0 | } |
9066 | | |
9067 | | /*===================================================================== |
9068 | | * class ITABFeatureFont |
9069 | | *====================================================================*/ |
9070 | | |
9071 | | /********************************************************************** |
9072 | | * ITABFeatureFont::ITABFeatureFont() |
9073 | | **********************************************************************/ |
9074 | | |
9075 | | // MI default is Font("Arial", 0, 0, 0) |
9076 | | static const TABFontDef MITABcsDefaultFont = MITAB_FONT_DEFAULT; |
9077 | | |
9078 | | ITABFeatureFont::ITABFeatureFont() |
9079 | 110k | : m_nFontDefIndex(-1), m_sFontDef(MITABcsDefaultFont) |
9080 | 110k | { |
9081 | 110k | } |
9082 | | |
9083 | | /********************************************************************** |
9084 | | * ITABFeatureFont::~ITABFeatureFont() |
9085 | | **********************************************************************/ |
9086 | | |
9087 | 110k | ITABFeatureFont::~ITABFeatureFont() = default; |
9088 | | |
9089 | | /********************************************************************** |
9090 | | * ITABFeatureFont::SetFontName() |
9091 | | **********************************************************************/ |
9092 | | void ITABFeatureFont::SetFontName(const char *pszName) |
9093 | 39.8k | { |
9094 | 39.8k | strncpy(m_sFontDef.szFontName, pszName, sizeof(m_sFontDef.szFontName) - 1); |
9095 | 39.8k | m_sFontDef.szFontName[sizeof(m_sFontDef.szFontName) - 1] = '\0'; |
9096 | 39.8k | } |
9097 | | |
9098 | | /********************************************************************** |
9099 | | * ITABFeatureFont::DumpFontDef() |
9100 | | * |
9101 | | * Dump Font definition information. |
9102 | | **********************************************************************/ |
9103 | | void ITABFeatureFont::DumpFontDef(FILE *fpOut /*=NULL*/) |
9104 | 0 | { |
9105 | 0 | if (fpOut == nullptr) |
9106 | 0 | fpOut = stdout; |
9107 | |
|
9108 | 0 | fprintf(fpOut, " m_nFontDefIndex = %d\n", m_nFontDefIndex); |
9109 | 0 | fprintf(fpOut, " m_sFontDef.nRefCount = %d\n", m_sFontDef.nRefCount); |
9110 | 0 | fprintf(fpOut, " m_sFontDef.szFontName = '%s'\n", m_sFontDef.szFontName); |
9111 | |
|
9112 | 0 | fflush(fpOut); |
9113 | 0 | } |
9114 | | |
9115 | | /*===================================================================== |
9116 | | * class ITABFeatureSymbol |
9117 | | *====================================================================*/ |
9118 | | |
9119 | | /********************************************************************** |
9120 | | * ITABFeatureSymbol::ITABFeatureSymbol() |
9121 | | **********************************************************************/ |
9122 | | |
9123 | | // MI default is Symbol(35, 0, 12) |
9124 | | static const TABSymbolDef MITABcsDefaultSymbol = MITAB_SYMBOL_DEFAULT; |
9125 | | |
9126 | | ITABFeatureSymbol::ITABFeatureSymbol() |
9127 | 139k | : m_nSymbolDefIndex(-1), m_sSymbolDef(MITABcsDefaultSymbol) |
9128 | 139k | { |
9129 | 139k | } |
9130 | | |
9131 | | /********************************************************************** |
9132 | | * ITABFeatureSymbol::GetSymbolStyleString() |
9133 | | * |
9134 | | * Return a Symbol() string. All representations info for the Symbol are here. |
9135 | | **********************************************************************/ |
9136 | | const char *ITABFeatureSymbol::GetSymbolStyleString(double dfAngle) const |
9137 | 0 | { |
9138 | 0 | const char *pszStyle = nullptr; |
9139 | 0 | int nOGRStyle = 0; |
9140 | | /* char szPattern[20]; */ |
9141 | 0 | int nAngle = 0; |
9142 | | /* szPattern[0] = '\0'; */ |
9143 | |
|
9144 | 0 | switch (m_sSymbolDef.nSymbolNo) |
9145 | 0 | { |
9146 | 0 | case 31: |
9147 | | // this is actually a "null" symbol in MapInfo! |
9148 | 0 | nOGRStyle = 0; |
9149 | 0 | break; |
9150 | 0 | case 32: // filled square |
9151 | 0 | nOGRStyle = 5; |
9152 | 0 | break; |
9153 | 0 | case 33: // filled diamond |
9154 | 0 | nAngle = 45; |
9155 | 0 | nOGRStyle = 5; |
9156 | 0 | break; |
9157 | 0 | case 34: // filled circle |
9158 | 0 | nOGRStyle = 3; |
9159 | 0 | break; |
9160 | 0 | case 35: // filled star |
9161 | 0 | nOGRStyle = 9; |
9162 | 0 | break; |
9163 | 0 | case 36: // filled upward pointing triangle |
9164 | 0 | nOGRStyle = 7; |
9165 | 0 | break; |
9166 | 0 | case 37: // filled downward pointing triangle |
9167 | 0 | nAngle = 180; |
9168 | 0 | nOGRStyle = 7; |
9169 | 0 | break; |
9170 | 0 | case 38: // hollow square |
9171 | 0 | nOGRStyle = 4; |
9172 | 0 | break; |
9173 | 0 | case 39: // hollow diamond |
9174 | 0 | nAngle = 45; |
9175 | 0 | nOGRStyle = 4; |
9176 | 0 | break; |
9177 | 0 | case 40: // hollow circle |
9178 | 0 | nOGRStyle = 2; |
9179 | 0 | break; |
9180 | 0 | case 41: // hollow star |
9181 | 0 | nOGRStyle = 8; |
9182 | 0 | break; |
9183 | 0 | case 42: // hollow upward pointing triangle |
9184 | 0 | nOGRStyle = 6; |
9185 | 0 | break; |
9186 | 0 | case 43: // hollow downward pointing triangle |
9187 | 0 | nAngle = 180; |
9188 | 0 | nOGRStyle = 6; |
9189 | 0 | break; |
9190 | 0 | case 44: // filled square (with shadow) |
9191 | 0 | nOGRStyle = 5; |
9192 | 0 | break; |
9193 | 0 | case 45: // filled upward triangle (with shadow) |
9194 | 0 | nOGRStyle = 7; |
9195 | 0 | break; |
9196 | 0 | case 46: // filled circle (with shadow) |
9197 | 0 | nOGRStyle = 3; |
9198 | 0 | break; |
9199 | 0 | case 49: // crossed lines |
9200 | 0 | nOGRStyle = 0; |
9201 | 0 | break; |
9202 | 0 | case 50: // X crossed lines |
9203 | 0 | nOGRStyle = 1; |
9204 | 0 | break; |
9205 | 0 | } |
9206 | | |
9207 | 0 | nAngle += static_cast<int>(dfAngle); |
9208 | |
|
9209 | 0 | pszStyle = CPLSPrintf( |
9210 | 0 | "SYMBOL(a:%d,c:#%6.6x,s:%dpt,id:\"mapinfo-sym-%d,ogr-sym-%d\")", nAngle, |
9211 | 0 | m_sSymbolDef.rgbColor, m_sSymbolDef.nPointSize, m_sSymbolDef.nSymbolNo, |
9212 | 0 | nOGRStyle); |
9213 | |
|
9214 | 0 | return pszStyle; |
9215 | 0 | } |
9216 | | |
9217 | | /********************************************************************** |
9218 | | * ITABFeatureSymbol::SetSymbolFromStyleString() |
9219 | | * |
9220 | | * Set all Symbol var from a OGRStyleSymbol. |
9221 | | **********************************************************************/ |
9222 | | void ITABFeatureSymbol::SetSymbolFromStyle(OGRStyleSymbol *poSymbolStyle) |
9223 | 0 | { |
9224 | 0 | GBool bIsNull = 0; |
9225 | | |
9226 | | // Set the Symbol Id (SymbolNo) |
9227 | 0 | const char *pszSymbolId = poSymbolStyle->Id(bIsNull); |
9228 | 0 | if (bIsNull) |
9229 | 0 | pszSymbolId = nullptr; |
9230 | |
|
9231 | 0 | if (pszSymbolId) |
9232 | 0 | { |
9233 | 0 | if (STARTS_WITH(pszSymbolId, "mapinfo-sym-")) |
9234 | 0 | { |
9235 | 0 | const int nSymbolId = atoi(pszSymbolId + 12); |
9236 | 0 | SetSymbolNo(static_cast<GByte>(nSymbolId)); |
9237 | 0 | } |
9238 | 0 | else if (STARTS_WITH(pszSymbolId, "ogr-sym-")) |
9239 | 0 | { |
9240 | 0 | const int nSymbolId = atoi(pszSymbolId + 8); |
9241 | | |
9242 | | // The OGR symbol is not the MapInfo one |
9243 | | // Here's some mapping |
9244 | 0 | switch (nSymbolId) |
9245 | 0 | { |
9246 | 0 | case 0: |
9247 | 0 | SetSymbolNo(49); |
9248 | 0 | break; |
9249 | 0 | case 1: |
9250 | 0 | SetSymbolNo(50); |
9251 | 0 | break; |
9252 | 0 | case 2: |
9253 | 0 | SetSymbolNo(40); |
9254 | 0 | break; |
9255 | 0 | case 3: |
9256 | 0 | SetSymbolNo(34); |
9257 | 0 | break; |
9258 | 0 | case 4: |
9259 | 0 | SetSymbolNo(38); |
9260 | 0 | break; |
9261 | 0 | case 5: |
9262 | 0 | SetSymbolNo(32); |
9263 | 0 | break; |
9264 | 0 | case 6: |
9265 | 0 | SetSymbolNo(42); |
9266 | 0 | break; |
9267 | 0 | case 7: |
9268 | 0 | SetSymbolNo(36); |
9269 | 0 | break; |
9270 | 0 | case 8: |
9271 | 0 | SetSymbolNo(41); |
9272 | 0 | break; |
9273 | 0 | case 9: |
9274 | 0 | SetSymbolNo(35); |
9275 | 0 | break; |
9276 | 0 | case 10: // vertical bar -- no mapinfo equivalent, so use |
9277 | | // crosshairs as closest match |
9278 | 0 | SetSymbolNo(49); |
9279 | 0 | break; |
9280 | 0 | } |
9281 | 0 | } |
9282 | 0 | } |
9283 | | |
9284 | | // Set SymbolSize |
9285 | 0 | const double dSymbolSize = poSymbolStyle->Size(bIsNull); |
9286 | 0 | if (dSymbolSize != 0.0) |
9287 | 0 | { |
9288 | 0 | SetSymbolSize(static_cast<GInt16>(dSymbolSize)); |
9289 | 0 | } |
9290 | | |
9291 | | // Set Symbol Color |
9292 | 0 | const char *pszSymbolColor = poSymbolStyle->Color(bIsNull); |
9293 | 0 | if (pszSymbolColor) |
9294 | 0 | { |
9295 | 0 | if (pszSymbolColor[0] == '#') |
9296 | 0 | pszSymbolColor++; |
9297 | 0 | int nSymbolColor = |
9298 | 0 | static_cast<int>(strtol(pszSymbolColor, nullptr, 16)); |
9299 | 0 | SetSymbolColor(static_cast<GInt32>(nSymbolColor)); |
9300 | 0 | } |
9301 | 0 | } |
9302 | | |
9303 | | /********************************************************************** |
9304 | | * ITABFeatureSymbol::SetSymbolFromStyleString() |
9305 | | * |
9306 | | * Set all Symbol var from a StyleString. Use StyleMgr to do so. |
9307 | | **********************************************************************/ |
9308 | | void ITABFeatureSymbol::SetSymbolFromStyleString(const char *pszStyleString) |
9309 | 0 | { |
9310 | | // Use the Style Manager to retrieve all the information we need. |
9311 | 0 | OGRStyleMgr *poStyleMgr = new OGRStyleMgr(nullptr); |
9312 | 0 | OGRStyleTool *poStylePart = nullptr; |
9313 | | |
9314 | | // Init the StyleMgr with the StyleString. |
9315 | 0 | poStyleMgr->InitStyleString(pszStyleString); |
9316 | | |
9317 | | // Retrieve the Symbol info. |
9318 | 0 | const int numParts = poStyleMgr->GetPartCount(); |
9319 | 0 | for (int i = 0; i < numParts; i++) |
9320 | 0 | { |
9321 | 0 | poStylePart = poStyleMgr->GetPart(i); |
9322 | 0 | if (poStylePart == nullptr) |
9323 | 0 | continue; |
9324 | | |
9325 | 0 | if (poStylePart->GetType() == OGRSTCSymbol) |
9326 | 0 | { |
9327 | 0 | break; |
9328 | 0 | } |
9329 | 0 | else |
9330 | 0 | { |
9331 | 0 | delete poStylePart; |
9332 | 0 | poStylePart = nullptr; |
9333 | 0 | } |
9334 | 0 | } |
9335 | | |
9336 | | // If the no Symbol found, do nothing. |
9337 | 0 | if (poStylePart == nullptr) |
9338 | 0 | { |
9339 | 0 | delete poStyleMgr; |
9340 | 0 | return; |
9341 | 0 | } |
9342 | | |
9343 | 0 | OGRStyleSymbol *poSymbolStyle = |
9344 | 0 | cpl::down_cast<OGRStyleSymbol *>(poStylePart); |
9345 | | |
9346 | | // With Symbol, we always want to output points |
9347 | | // |
9348 | | // It's very important to set the output unit of the feature. |
9349 | | // The default value is meter. If we don't do it all numerical values |
9350 | | // will be assumed to be converted from the input unit to meter when we |
9351 | | // will get them via GetParam...() functions. |
9352 | | // See OGRStyleTool::Parse() for more details. |
9353 | 0 | poSymbolStyle->SetUnit(OGRSTUPoints, (72.0 * 39.37)); |
9354 | |
|
9355 | 0 | SetSymbolFromStyle(poSymbolStyle); |
9356 | |
|
9357 | 0 | delete poStyleMgr; |
9358 | 0 | delete poStylePart; |
9359 | |
|
9360 | 0 | return; |
9361 | 0 | } |
9362 | | |
9363 | | /********************************************************************** |
9364 | | * ITABFeatureSymbol::GetSymbolFeatureClass() |
9365 | | * |
9366 | | * Return the feature class needed to represent the style string. |
9367 | | **********************************************************************/ |
9368 | | TABFeatureClass |
9369 | | ITABFeatureSymbol::GetSymbolFeatureClass(const char *pszStyleString) |
9370 | 0 | { |
9371 | | // Use the Style Manager to retrieve all the information we need. |
9372 | 0 | OGRStyleMgr *poStyleMgr = new OGRStyleMgr(nullptr); |
9373 | 0 | OGRStyleTool *poStylePart = nullptr; |
9374 | | |
9375 | | // Init the StyleMgr with the StyleString. |
9376 | 0 | poStyleMgr->InitStyleString(pszStyleString); |
9377 | | |
9378 | | // Retrieve the Symbol info. |
9379 | 0 | const int numParts = poStyleMgr->GetPartCount(); |
9380 | 0 | for (int i = 0; i < numParts; i++) |
9381 | 0 | { |
9382 | 0 | poStylePart = poStyleMgr->GetPart(i); |
9383 | 0 | if (poStylePart == nullptr) |
9384 | 0 | { |
9385 | 0 | continue; |
9386 | 0 | } |
9387 | | |
9388 | 0 | if (poStylePart->GetType() == OGRSTCSymbol) |
9389 | 0 | { |
9390 | 0 | break; |
9391 | 0 | } |
9392 | 0 | else |
9393 | 0 | { |
9394 | 0 | delete poStylePart; |
9395 | 0 | poStylePart = nullptr; |
9396 | 0 | } |
9397 | 0 | } |
9398 | |
|
9399 | 0 | TABFeatureClass result = TABFCPoint; |
9400 | | |
9401 | | // If the no Symbol found, do nothing. |
9402 | 0 | if (poStylePart == nullptr) |
9403 | 0 | { |
9404 | 0 | delete poStyleMgr; |
9405 | 0 | return result; |
9406 | 0 | } |
9407 | | |
9408 | 0 | OGRStyleSymbol *poSymbolStyle = |
9409 | 0 | cpl::down_cast<OGRStyleSymbol *>(poStylePart); |
9410 | |
|
9411 | 0 | GBool bIsNull = 0; |
9412 | | |
9413 | | // Set the Symbol Id (SymbolNo) |
9414 | 0 | const char *pszSymbolId = poSymbolStyle->Id(bIsNull); |
9415 | 0 | if (bIsNull) |
9416 | 0 | pszSymbolId = nullptr; |
9417 | |
|
9418 | 0 | if (pszSymbolId) |
9419 | 0 | { |
9420 | 0 | if (STARTS_WITH(pszSymbolId, "font-sym-")) |
9421 | 0 | { |
9422 | 0 | result = TABFCFontPoint; |
9423 | 0 | } |
9424 | 0 | else if (STARTS_WITH(pszSymbolId, "mapinfo-custom-sym-")) |
9425 | 0 | { |
9426 | 0 | result = TABFCCustomPoint; |
9427 | 0 | } |
9428 | 0 | } |
9429 | |
|
9430 | 0 | delete poStyleMgr; |
9431 | 0 | delete poStylePart; |
9432 | |
|
9433 | 0 | return result; |
9434 | 0 | } |
9435 | | |
9436 | | /********************************************************************** |
9437 | | * ITABFeatureSymbol::DumpSymbolDef() |
9438 | | * |
9439 | | * Dump Symbol definition information. |
9440 | | **********************************************************************/ |
9441 | | void ITABFeatureSymbol::DumpSymbolDef(FILE *fpOut /*=NULL*/) |
9442 | 0 | { |
9443 | 0 | if (fpOut == nullptr) |
9444 | 0 | fpOut = stdout; |
9445 | |
|
9446 | 0 | fprintf(fpOut, " m_nSymbolDefIndex = %d\n", m_nSymbolDefIndex); |
9447 | 0 | fprintf(fpOut, " m_sSymbolDef.nRefCount = %d\n", m_sSymbolDef.nRefCount); |
9448 | 0 | fprintf(fpOut, " m_sSymbolDef.nSymbolNo = %d\n", m_sSymbolDef.nSymbolNo); |
9449 | 0 | fprintf(fpOut, " m_sSymbolDef.nPointSize = %d\n", m_sSymbolDef.nPointSize); |
9450 | 0 | fprintf(fpOut, " m_sSymbolDef._unknown_ = %d\n", |
9451 | 0 | static_cast<int>(m_sSymbolDef._nUnknownValue_)); |
9452 | 0 | fprintf(fpOut, " m_sSymbolDef.rgbColor = 0x%6.6x (%d)\n", |
9453 | 0 | m_sSymbolDef.rgbColor, m_sSymbolDef.rgbColor); |
9454 | |
|
9455 | 0 | fflush(fpOut); |
9456 | 0 | } |