package redis
import "context"
type ACLCmdable interface {
ACLDryRun(ctx context.Context, username string, command ...interface{}) *StringCmd
ACLLog(ctx context.Context, count int64) *ACLLogCmd
ACLLogReset(ctx context.Context) *StatusCmd
ACLGenPass(ctx context.Context, bit int) *StringCmd
ACLSetUser(ctx context.Context, username string, rules ...string) *StatusCmd
ACLDelUser(ctx context.Context, username string) *IntCmd
ACLUsers(ctx context.Context) *StringSliceCmd
ACLWhoAmI(ctx context.Context) *StringCmd
ACLList(ctx context.Context) *StringSliceCmd
ACLCat(ctx context.Context) *StringSliceCmd
ACLCatArgs(ctx context.Context, options *ACLCatArgs) *StringSliceCmd
}
type ACLCatArgs struct {
Category string
}
func (c cmdable) ACLDryRun(ctx context.Context, username string, command ...interface{}) *StringCmd {
args := make([]interface{}, 0, 3+len(command))
args = append(args, "acl", "dryrun", username)
args = append(args, command...)
cmd := NewStringCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLLog(ctx context.Context, count int64) *ACLLogCmd {
args := make([]interface{}, 0, 3)
args = append(args, "acl", "log")
if count > 0 {
args = append(args, count)
}
cmd := NewACLLogCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLLogReset(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "acl", "log", "reset")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLDelUser(ctx context.Context, username string) *IntCmd {
cmd := NewIntCmd(ctx, "acl", "deluser", username)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLSetUser(ctx context.Context, username string, rules ...string) *StatusCmd {
args := make([]interface{}, 3+len(rules))
args[0] = "acl"
args[1] = "setuser"
args[2] = username
for i, rule := range rules {
args[i+3] = rule
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLGenPass(ctx context.Context, bit int) *StringCmd {
args := make([]interface{}, 0, 3)
args = append(args, "acl", "genpass")
if bit > 0 {
args = append(args, bit)
}
cmd := NewStringCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLUsers(ctx context.Context) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "acl", "users")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLWhoAmI(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "acl", "whoami")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLList(ctx context.Context) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "acl", "list")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLCat(ctx context.Context) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "acl", "cat")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ACLCatArgs(ctx context.Context, options *ACLCatArgs) *StringSliceCmd {
// if there is a category passed, build new cmd, if there isn't - use the ACLCat method
if options != nil && options.Category != "" {
cmd := NewStringSliceCmd(ctx, "acl", "cat", options.Category)
_ = c(ctx, cmd)
return cmd
}
return c.ACLCat(ctx)
}
package redis
import (
"context"
"errors"
"net"
"time"
"github.com/redis/go-redis/v9/internal/interfaces"
"github.com/redis/go-redis/v9/push"
)
// ErrInvalidCommand is returned when an invalid command is passed to ExecuteCommand.
var ErrInvalidCommand = errors.New("invalid command type")
// ErrInvalidPool is returned when the pool type is not supported.
var ErrInvalidPool = errors.New("invalid pool type")
// newClientAdapter creates a new client adapter for regular Redis clients.
func newClientAdapter(client *baseClient) interfaces.ClientInterface {
return &clientAdapter{client: client}
}
// clientAdapter adapts a Redis client to implement interfaces.ClientInterface.
type clientAdapter struct {
client *baseClient
}
// GetOptions returns the client options.
func (ca *clientAdapter) GetOptions() interfaces.OptionsInterface {
return &optionsAdapter{options: ca.client.opt}
}
// GetPushProcessor returns the client's push notification processor.
func (ca *clientAdapter) GetPushProcessor() interfaces.NotificationProcessor {
return &pushProcessorAdapter{processor: ca.client.pushProcessor}
}
// optionsAdapter adapts Redis options to implement interfaces.OptionsInterface.
type optionsAdapter struct {
options *Options
}
// GetReadTimeout returns the read timeout.
func (oa *optionsAdapter) GetReadTimeout() time.Duration {
return oa.options.ReadTimeout
}
// GetWriteTimeout returns the write timeout.
func (oa *optionsAdapter) GetWriteTimeout() time.Duration {
return oa.options.WriteTimeout
}
// GetNetwork returns the network type.
func (oa *optionsAdapter) GetNetwork() string {
return oa.options.Network
}
// GetAddr returns the connection address.
func (oa *optionsAdapter) GetAddr() string {
return oa.options.Addr
}
// GetNodeAddress returns the address of the Redis node as reported by the server.
// For cluster clients, this is the endpoint from CLUSTER SLOTS before any transformation.
// For standalone clients, this defaults to Addr.
func (oa *optionsAdapter) GetNodeAddress() string {
return oa.options.NodeAddress
}
// IsTLSEnabled returns true if TLS is enabled.
func (oa *optionsAdapter) IsTLSEnabled() bool {
return oa.options.TLSConfig != nil
}
// GetProtocol returns the protocol version.
func (oa *optionsAdapter) GetProtocol() int {
return oa.options.Protocol
}
// GetPoolSize returns the connection pool size.
func (oa *optionsAdapter) GetPoolSize() int {
return oa.options.PoolSize
}
// NewDialer returns a new dialer function for the connection.
func (oa *optionsAdapter) NewDialer() func(context.Context) (net.Conn, error) {
baseDialer := oa.options.NewDialer()
return func(ctx context.Context) (net.Conn, error) {
// Extract network and address from the options
network := oa.options.Network
addr := oa.options.Addr
return baseDialer(ctx, network, addr)
}
}
// pushProcessorAdapter adapts a push.NotificationProcessor to implement interfaces.NotificationProcessor.
type pushProcessorAdapter struct {
processor push.NotificationProcessor
}
// RegisterHandler registers a handler for a specific push notification name.
func (ppa *pushProcessorAdapter) RegisterHandler(pushNotificationName string, handler interface{}, protected bool) error {
if pushHandler, ok := handler.(push.NotificationHandler); ok {
return ppa.processor.RegisterHandler(pushNotificationName, pushHandler, protected)
}
return errors.New("handler must implement push.NotificationHandler")
}
// UnregisterHandler removes a handler for a specific push notification name.
func (ppa *pushProcessorAdapter) UnregisterHandler(pushNotificationName string) error {
return ppa.processor.UnregisterHandler(pushNotificationName)
}
// GetHandler returns the handler for a specific push notification name.
func (ppa *pushProcessorAdapter) GetHandler(pushNotificationName string) interface{} {
return ppa.processor.GetHandler(pushNotificationName)
}
// Package auth package provides authentication-related interfaces and types.
// It also includes a basic implementation of credentials using username and password.
package auth
// StreamingCredentialsProvider is an interface that defines the methods for a streaming credentials provider.
// It is used to provide credentials for authentication.
// The CredentialsListener is used to receive updates when the credentials change.
type StreamingCredentialsProvider interface {
// Subscribe subscribes to the credentials provider for updates.
// It returns the current credentials, a cancel function to unsubscribe from the provider,
// and an error if any.
// TODO(ndyakov): Should we add context to the Subscribe method?
Subscribe(listener CredentialsListener) (Credentials, UnsubscribeFunc, error)
}
// UnsubscribeFunc is a function that is used to cancel the subscription to the credentials provider.
// It is used to unsubscribe from the provider when the credentials are no longer needed.
type UnsubscribeFunc func() error
// CredentialsListener is an interface that defines the methods for a credentials listener.
// It is used to receive updates when the credentials change.
// The OnNext method is called when the credentials change.
// The OnError method is called when an error occurs while requesting the credentials.
type CredentialsListener interface {
OnNext(credentials Credentials)
OnError(err error)
}
// Credentials is an interface that defines the methods for credentials.
// It is used to provide the credentials for authentication.
type Credentials interface {
// BasicAuth returns the username and password for basic authentication.
BasicAuth() (username string, password string)
// RawCredentials returns the raw credentials as a string.
// This can be used to extract the username and password from the raw credentials or
// additional information if present in the token.
RawCredentials() string
}
type basicAuth struct {
username string
password string
}
// RawCredentials returns the raw credentials as a string.
func (b *basicAuth) RawCredentials() string {
return b.username + ":" + b.password
}
// BasicAuth returns the username and password for basic authentication.
func (b *basicAuth) BasicAuth() (username string, password string) {
return b.username, b.password
}
// NewBasicCredentials creates a new Credentials object from the given username and password.
func NewBasicCredentials(username, password string) Credentials {
return &basicAuth{
username: username,
password: password,
}
}
package auth
// ReAuthCredentialsListener is a struct that implements the CredentialsListener interface.
// It is used to re-authenticate the credentials when they are updated.
// It contains:
// - reAuth: a function that takes the new credentials and returns an error if any.
// - onErr: a function that takes an error and handles it.
type ReAuthCredentialsListener struct {
reAuth func(credentials Credentials) error
onErr func(err error)
}
// OnNext is called when the credentials are updated.
// It calls the reAuth function with the new credentials.
// If the reAuth function returns an error, it calls the onErr function with the error.
func (c *ReAuthCredentialsListener) OnNext(credentials Credentials) {
if c.reAuth == nil {
return
}
err := c.reAuth(credentials)
if err != nil {
c.OnError(err)
}
}
// OnError is called when an error occurs.
// It can be called from both the credentials provider and the reAuth function.
func (c *ReAuthCredentialsListener) OnError(err error) {
if c.onErr == nil {
return
}
c.onErr(err)
}
// NewReAuthCredentialsListener creates a new ReAuthCredentialsListener.
// Implements the auth.CredentialsListener interface.
func NewReAuthCredentialsListener(reAuth func(credentials Credentials) error, onErr func(err error)) *ReAuthCredentialsListener {
return &ReAuthCredentialsListener{
reAuth: reAuth,
onErr: onErr,
}
}
// Ensure ReAuthCredentialsListener implements the CredentialsListener interface.
var _ CredentialsListener = (*ReAuthCredentialsListener)(nil)
package redis
import (
"context"
"errors"
)
type BitMapCmdable interface {
GetBit(ctx context.Context, key string, offset int64) *IntCmd
SetBit(ctx context.Context, key string, offset int64, value int) *IntCmd
BitCount(ctx context.Context, key string, bitCount *BitCount) *IntCmd
BitOpAnd(ctx context.Context, destKey string, keys ...string) *IntCmd
BitOpOr(ctx context.Context, destKey string, keys ...string) *IntCmd
BitOpXor(ctx context.Context, destKey string, keys ...string) *IntCmd
BitOpDiff(ctx context.Context, destKey string, keys ...string) *IntCmd
BitOpDiff1(ctx context.Context, destKey string, keys ...string) *IntCmd
BitOpAndOr(ctx context.Context, destKey string, keys ...string) *IntCmd
BitOpOne(ctx context.Context, destKey string, keys ...string) *IntCmd
BitOpNot(ctx context.Context, destKey string, key string) *IntCmd
BitPos(ctx context.Context, key string, bit int64, pos ...int64) *IntCmd
BitPosSpan(ctx context.Context, key string, bit int8, start, end int64, span string) *IntCmd
BitField(ctx context.Context, key string, values ...interface{}) *IntSliceCmd
BitFieldRO(ctx context.Context, key string, values ...interface{}) *IntSliceCmd
}
func (c cmdable) GetBit(ctx context.Context, key string, offset int64) *IntCmd {
cmd := NewIntCmd(ctx, "getbit", key, offset)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SetBit(ctx context.Context, key string, offset int64, value int) *IntCmd {
cmd := NewIntCmd(
ctx,
"setbit",
key,
offset,
value,
)
_ = c(ctx, cmd)
return cmd
}
type BitCount struct {
Start, End int64
Unit string // BYTE(default) | BIT
}
const BitCountIndexByte string = "BYTE"
const BitCountIndexBit string = "BIT"
func (c cmdable) BitCount(ctx context.Context, key string, bitCount *BitCount) *IntCmd {
args := make([]any, 2, 5)
args[0] = "bitcount"
args[1] = key
if bitCount != nil {
args = append(args, bitCount.Start, bitCount.End)
if bitCount.Unit != "" {
if bitCount.Unit != BitCountIndexByte && bitCount.Unit != BitCountIndexBit {
cmd := NewIntCmd(ctx)
cmd.SetErr(errors.New("redis: invalid bitcount index"))
return cmd
}
args = append(args, bitCount.Unit)
}
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) bitOp(ctx context.Context, op, destKey string, keys ...string) *IntCmd {
args := make([]interface{}, 3+len(keys))
args[0] = "bitop"
args[1] = op
args[2] = destKey
for i, key := range keys {
args[3+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BitOpAnd creates a new bitmap in which users are members of all given bitmaps
func (c cmdable) BitOpAnd(ctx context.Context, destKey string, keys ...string) *IntCmd {
return c.bitOp(ctx, "and", destKey, keys...)
}
// BitOpOr creates a new bitmap in which users are member of at least one given bitmap
func (c cmdable) BitOpOr(ctx context.Context, destKey string, keys ...string) *IntCmd {
return c.bitOp(ctx, "or", destKey, keys...)
}
// BitOpXor creates a new bitmap in which users are the result of XORing all given bitmaps
func (c cmdable) BitOpXor(ctx context.Context, destKey string, keys ...string) *IntCmd {
return c.bitOp(ctx, "xor", destKey, keys...)
}
// BitOpNot creates a new bitmap in which users are not members of a given bitmap
func (c cmdable) BitOpNot(ctx context.Context, destKey string, key string) *IntCmd {
return c.bitOp(ctx, "not", destKey, key)
}
// BitOpDiff creates a new bitmap in which users are members of bitmap X but not of any of bitmaps Y1, Y2, …
// Introduced with Redis 8.2
func (c cmdable) BitOpDiff(ctx context.Context, destKey string, keys ...string) *IntCmd {
return c.bitOp(ctx, "diff", destKey, keys...)
}
// BitOpDiff1 creates a new bitmap in which users are members of one or more of bitmaps Y1, Y2, … but not members of bitmap X
// Introduced with Redis 8.2
func (c cmdable) BitOpDiff1(ctx context.Context, destKey string, keys ...string) *IntCmd {
return c.bitOp(ctx, "diff1", destKey, keys...)
}
// BitOpAndOr creates a new bitmap in which users are members of bitmap X and also members of one or more of bitmaps Y1, Y2, …
// Introduced with Redis 8.2
func (c cmdable) BitOpAndOr(ctx context.Context, destKey string, keys ...string) *IntCmd {
return c.bitOp(ctx, "andor", destKey, keys...)
}
// BitOpOne creates a new bitmap in which users are members of exactly one of the given bitmaps
// Introduced with Redis 8.2
func (c cmdable) BitOpOne(ctx context.Context, destKey string, keys ...string) *IntCmd {
return c.bitOp(ctx, "one", destKey, keys...)
}
// BitPos is an API before Redis version 7.0, cmd: bitpos key bit start end
// if you need the `byte | bit` parameter, please use `BitPosSpan`.
func (c cmdable) BitPos(ctx context.Context, key string, bit int64, pos ...int64) *IntCmd {
args := make([]interface{}, 3+len(pos))
args[0] = "bitpos"
args[1] = key
args[2] = bit
switch len(pos) {
case 0:
case 1:
args[3] = pos[0]
case 2:
args[3] = pos[0]
args[4] = pos[1]
default:
cmd := NewIntCmd(ctx)
cmd.SetErr(errors.New("too many arguments"))
return cmd
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BitPosSpan supports the `byte | bit` parameters in redis version 7.0,
// the bitpos command defaults to using byte type for the `start-end` range,
// which means it counts in bytes from start to end. you can set the value
// of "span" to determine the type of `start-end`.
// span = "bit", cmd: bitpos key bit start end bit
// span = "byte", cmd: bitpos key bit start end byte
func (c cmdable) BitPosSpan(ctx context.Context, key string, bit int8, start, end int64, span string) *IntCmd {
cmd := NewIntCmd(ctx, "bitpos", key, bit, start, end, span)
_ = c(ctx, cmd)
return cmd
}
// BitField accepts multiple values:
// - BitField("set", "i1", "offset1", "value1","cmd2", "type2", "offset2", "value2")
// - BitField([]string{"cmd1", "type1", "offset1", "value1","cmd2", "type2", "offset2", "value2"})
// - BitField([]interface{}{"cmd1", "type1", "offset1", "value1","cmd2", "type2", "offset2", "value2"})
func (c cmdable) BitField(ctx context.Context, key string, values ...interface{}) *IntSliceCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "bitfield"
args[1] = key
args = appendArgs(args, values)
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BitFieldRO - Read-only variant of the BITFIELD command.
// It is like the original BITFIELD but only accepts GET subcommand and can safely be used in read-only replicas.
// - BitFieldRO(ctx, key, "<Encoding0>", "<Offset0>", "<Encoding1>","<Offset1>")
func (c cmdable) BitFieldRO(ctx context.Context, key string, values ...interface{}) *IntSliceCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "BITFIELD_RO"
args[1] = key
if len(values)%2 != 0 {
c := NewIntSliceCmd(ctx)
c.SetErr(errors.New("BitFieldRO: invalid number of arguments, must be even"))
return c
}
for i := 0; i < len(values); i += 2 {
args = append(args, "GET", values[i], values[i+1])
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
package redis
import "context"
type ClusterCmdable interface {
ClusterMyShardID(ctx context.Context) *StringCmd
ClusterMyID(ctx context.Context) *StringCmd
ClusterSlots(ctx context.Context) *ClusterSlotsCmd
ClusterShards(ctx context.Context) *ClusterShardsCmd
ClusterLinks(ctx context.Context) *ClusterLinksCmd
ClusterNodes(ctx context.Context) *StringCmd
ClusterMeet(ctx context.Context, host, port string) *StatusCmd
ClusterForget(ctx context.Context, nodeID string) *StatusCmd
ClusterReplicate(ctx context.Context, nodeID string) *StatusCmd
ClusterResetSoft(ctx context.Context) *StatusCmd
ClusterResetHard(ctx context.Context) *StatusCmd
ClusterInfo(ctx context.Context) *StringCmd
ClusterKeySlot(ctx context.Context, key string) *IntCmd
ClusterGetKeysInSlot(ctx context.Context, slot int, count int) *StringSliceCmd
ClusterCountFailureReports(ctx context.Context, nodeID string) *IntCmd
ClusterCountKeysInSlot(ctx context.Context, slot int) *IntCmd
ClusterDelSlots(ctx context.Context, slots ...int) *StatusCmd
ClusterDelSlotsRange(ctx context.Context, min, max int) *StatusCmd
ClusterSaveConfig(ctx context.Context) *StatusCmd
ClusterSlaves(ctx context.Context, nodeID string) *StringSliceCmd
ClusterFailover(ctx context.Context) *StatusCmd
ClusterAddSlots(ctx context.Context, slots ...int) *StatusCmd
ClusterAddSlotsRange(ctx context.Context, min, max int) *StatusCmd
ReadOnly(ctx context.Context) *StatusCmd
ReadWrite(ctx context.Context) *StatusCmd
}
func (c cmdable) ClusterMyShardID(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "cluster", "myshardid")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterMyID(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "cluster", "myid")
_ = c(ctx, cmd)
return cmd
}
// ClusterSlots returns the mapping of cluster slots to nodes.
//
// Deprecated: Use ClusterShards instead as of Redis 7.0.0.
func (c cmdable) ClusterSlots(ctx context.Context) *ClusterSlotsCmd {
cmd := NewClusterSlotsCmd(ctx, "cluster", "slots")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterShards(ctx context.Context) *ClusterShardsCmd {
cmd := NewClusterShardsCmd(ctx, "cluster", "shards")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterLinks(ctx context.Context) *ClusterLinksCmd {
cmd := NewClusterLinksCmd(ctx, "cluster", "links")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterNodes(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "cluster", "nodes")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterMeet(ctx context.Context, host, port string) *StatusCmd {
cmd := NewStatusCmd(ctx, "cluster", "meet", host, port)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterForget(ctx context.Context, nodeID string) *StatusCmd {
cmd := NewStatusCmd(ctx, "cluster", "forget", nodeID)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterReplicate(ctx context.Context, nodeID string) *StatusCmd {
cmd := NewStatusCmd(ctx, "cluster", "replicate", nodeID)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterResetSoft(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "cluster", "reset", "soft")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterResetHard(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "cluster", "reset", "hard")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterInfo(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "cluster", "info")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterKeySlot(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "cluster", "keyslot", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterGetKeysInSlot(ctx context.Context, slot int, count int) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "cluster", "getkeysinslot", slot, count)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterCountFailureReports(ctx context.Context, nodeID string) *IntCmd {
cmd := NewIntCmd(ctx, "cluster", "count-failure-reports", nodeID)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterCountKeysInSlot(ctx context.Context, slot int) *IntCmd {
cmd := NewIntCmd(ctx, "cluster", "countkeysinslot", slot)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterDelSlots(ctx context.Context, slots ...int) *StatusCmd {
args := make([]interface{}, 2+len(slots))
args[0] = "cluster"
args[1] = "delslots"
for i, slot := range slots {
args[2+i] = slot
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterDelSlotsRange(ctx context.Context, min, max int) *StatusCmd {
size := max - min + 1
slots := make([]int, size)
for i := 0; i < size; i++ {
slots[i] = min + i
}
return c.ClusterDelSlots(ctx, slots...)
}
func (c cmdable) ClusterSaveConfig(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "cluster", "saveconfig")
_ = c(ctx, cmd)
return cmd
}
// ClusterSlaves lists the replica nodes of a master node.
//
// Deprecated: Use ClusterReplicas instead as of Redis 5.0.0.
func (c cmdable) ClusterSlaves(ctx context.Context, nodeID string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "cluster", "slaves", nodeID)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterFailover(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "cluster", "failover")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterAddSlots(ctx context.Context, slots ...int) *StatusCmd {
args := make([]interface{}, 2+len(slots))
args[0] = "cluster"
args[1] = "addslots"
for i, num := range slots {
args[2+i] = num
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClusterAddSlotsRange(ctx context.Context, min, max int) *StatusCmd {
size := max - min + 1
slots := make([]int, size)
for i := 0; i < size; i++ {
slots[i] = min + i
}
return c.ClusterAddSlots(ctx, slots...)
}
func (c cmdable) ReadOnly(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "readonly")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ReadWrite(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "readwrite")
_ = c(ctx, cmd)
return cmd
}
package redis
import (
"bufio"
"context"
"fmt"
"maps"
"net"
"regexp"
"strconv"
"strings"
"sync"
"time"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/hscan"
"github.com/redis/go-redis/v9/internal/proto"
"github.com/redis/go-redis/v9/internal/routing"
"github.com/redis/go-redis/v9/internal/util"
)
// keylessCommands contains Redis commands that have empty key specifications (9th slot empty)
// Only includes core Redis commands, excludes FT.*, ts.*, timeseries.*, search.* and subcommands
var keylessCommands = map[string]struct{}{
"acl": {},
"asking": {},
"auth": {},
"bgrewriteaof": {},
"bgsave": {},
"client": {},
"cluster": {},
"config": {},
"debug": {},
"discard": {},
"echo": {},
"exec": {},
"failover": {},
"function": {},
"hello": {},
"hotkeys": {},
"latency": {},
"lolwut": {},
"module": {},
"monitor": {},
"multi": {},
"pfselftest": {},
"ping": {},
"psubscribe": {},
"psync": {},
"publish": {},
"pubsub": {},
"punsubscribe": {},
"quit": {},
"readonly": {},
"readwrite": {},
"replconf": {},
"replicaof": {},
"role": {},
"save": {},
"script": {},
"select": {},
"shutdown": {},
"slaveof": {},
"slowlog": {},
"subscribe": {},
"swapdb": {},
"sync": {},
"time": {},
"unsubscribe": {},
"unwatch": {},
"wait": {},
}
// CmdTyper interface for getting command type
type CmdTyper interface {
GetCmdType() CmdType
}
// CmdTypeGetter interface for getting command type without circular imports
type CmdTypeGetter interface {
GetCmdType() CmdType
}
type CmdType uint8
const (
CmdTypeGeneric CmdType = iota
CmdTypeString
CmdTypeInt
CmdTypeBool
CmdTypeFloat
CmdTypeStringSlice
CmdTypeIntSlice
CmdTypeFloatSlice
CmdTypeBoolSlice
CmdTypeMapStringString
CmdTypeMapStringInt
CmdTypeMapStringInterface
CmdTypeMapStringInterfaceSlice
CmdTypeSlice
CmdTypeStatus
CmdTypeDuration
CmdTypeTime
CmdTypeKeyValueSlice
CmdTypeStringStructMap
CmdTypeXMessageSlice
CmdTypeXStreamSlice
CmdTypeXPending
CmdTypeXPendingExt
CmdTypeXAutoClaim
CmdTypeXAutoClaimJustID
CmdTypeXInfoConsumers
CmdTypeXInfoGroups
CmdTypeXInfoStream
CmdTypeXInfoStreamFull
CmdTypeZSlice
CmdTypeZWithKey
CmdTypeScan
CmdTypeClusterSlots
CmdTypeGeoLocation
CmdTypeGeoSearchLocation
CmdTypeGeoPos
CmdTypeCommandsInfo
CmdTypeSlowLog
CmdTypeMapStringStringSlice
CmdTypeMapMapStringInterface
CmdTypeKeyValues
CmdTypeZSliceWithKey
CmdTypeFunctionList
CmdTypeFunctionStats
CmdTypeLCS
CmdTypeKeyFlags
CmdTypeClusterLinks
CmdTypeClusterShards
CmdTypeRankWithScore
CmdTypeClientInfo
CmdTypeACLLog
CmdTypeInfo
CmdTypeMonitor
CmdTypeJSON
CmdTypeJSONSlice
CmdTypeIntPointerSlice
CmdTypeScanDump
CmdTypeBFInfo
CmdTypeCFInfo
CmdTypeCMSInfo
CmdTypeTopKInfo
CmdTypeTDigestInfo
CmdTypeFTSynDump
CmdTypeAggregate
CmdTypeFTInfo
CmdTypeFTSpellCheck
CmdTypeFTSearch
CmdTypeTSTimestampValue
CmdTypeTSTimestampValueSlice
CmdTypeHotKeys
)
type (
CmdTypeXAutoClaimValue struct {
messages []XMessage
start string
}
CmdTypeXAutoClaimJustIDValue struct {
ids []string
start string
}
CmdTypeScanValue struct {
keys []string
cursor uint64
}
CmdTypeKeyValuesValue struct {
key string
values []string
}
CmdTypeZSliceWithKeyValue struct {
key string
zSlice []Z
}
)
type Cmder interface {
// command name.
// e.g. "set k v ex 10" -> "set", "cluster info" -> "cluster".
Name() string
// full command name.
// e.g. "set k v ex 10" -> "set", "cluster info" -> "cluster info".
FullName() string
// all args of the command.
// e.g. "set k v ex 10" -> "[set k v ex 10]".
Args() []interface{}
// format request and response string.
// e.g. "set k v ex 10" -> "set k v ex 10: OK", "get k" -> "get k: v".
String() string
// Clone creates a copy of the command.
Clone() Cmder
stringArg(int) string
firstKeyPos() int8
SetFirstKeyPos(int8)
stepCount() int8
SetStepCount(int8)
readTimeout() *time.Duration
readReply(rd *proto.Reader) error
readRawReply(rd *proto.Reader) error
SetErr(error)
Err() error
// GetCmdType returns the command type for fast value extraction
GetCmdType() CmdType
}
func setCmdsErr(cmds []Cmder, e error) {
for _, cmd := range cmds {
if cmd.Err() == nil {
cmd.SetErr(e)
}
}
}
func cmdsFirstErr(cmds []Cmder) error {
for _, cmd := range cmds {
if err := cmd.Err(); err != nil {
return err
}
}
return nil
}
func writeCmds(wr *proto.Writer, cmds []Cmder) error {
for _, cmd := range cmds {
if err := writeCmd(wr, cmd); err != nil {
return err
}
}
return nil
}
func writeCmd(wr *proto.Writer, cmd Cmder) error {
return wr.WriteArgs(cmd.Args())
}
// cmdFirstKeyPos returns the position of the first key in the command's arguments.
// If the command does not have a key, it returns 0.
// TODO: Use the data in CommandInfo to determine the first key position.
func cmdFirstKeyPos(cmd Cmder) int {
if pos := cmd.firstKeyPos(); pos != 0 {
return int(pos)
}
name := cmd.Name()
// first check if the command is keyless
if _, ok := keylessCommands[name]; ok {
return 0
}
switch name {
case "eval", "evalsha", "eval_ro", "evalsha_ro":
if cmd.stringArg(2) != "0" {
return 3
}
return 0
case "publish":
return 1
case "memory":
// https://github.com/redis/redis/issues/7493
if cmd.stringArg(1) == "usage" {
return 2
}
}
return 1
}
func cmdString(cmd Cmder, val interface{}) string {
b := make([]byte, 0, 64)
for i, arg := range cmd.Args() {
if i > 0 {
b = append(b, ' ')
}
b = internal.AppendArg(b, arg)
}
if err := cmd.Err(); err != nil {
b = append(b, ": "...)
b = append(b, err.Error()...)
} else if val != nil {
b = append(b, ": "...)
b = internal.AppendArg(b, val)
}
return util.BytesToString(b)
}
//------------------------------------------------------------------------------
type baseCmd struct {
ctx context.Context
args []interface{}
err error
keyPos int8
_stepCount int8
rawVal interface{}
_readTimeout *time.Duration
cmdType CmdType
}
var _ Cmder = (*Cmd)(nil)
func (cmd *baseCmd) Name() string {
if len(cmd.args) == 0 {
return ""
}
// Cmd name must be lower cased.
return internal.ToLower(cmd.stringArg(0))
}
func (cmd *baseCmd) FullName() string {
switch name := cmd.Name(); name {
case "cluster", "command":
if len(cmd.args) == 1 {
return name
}
if s2, ok := cmd.args[1].(string); ok {
return name + " " + s2
}
return name
default:
return name
}
}
func (cmd *baseCmd) Args() []interface{} {
return cmd.args
}
func (cmd *baseCmd) stringArg(pos int) string {
if pos < 0 || pos >= len(cmd.args) {
return ""
}
arg := cmd.args[pos]
switch v := arg.(type) {
case string:
return v
case []byte:
return string(v)
default:
// TODO: consider using appendArg
return fmt.Sprint(v)
}
}
func (cmd *baseCmd) firstKeyPos() int8 {
return cmd.keyPos
}
func (cmd *baseCmd) SetFirstKeyPos(keyPos int8) {
cmd.keyPos = keyPos
}
func (cmd *baseCmd) stepCount() int8 {
return cmd._stepCount
}
func (cmd *baseCmd) SetStepCount(stepCount int8) {
cmd._stepCount = stepCount
}
func (cmd *baseCmd) SetErr(e error) {
cmd.err = e
}
func (cmd *baseCmd) Err() error {
return cmd.err
}
func (cmd *baseCmd) readTimeout() *time.Duration {
return cmd._readTimeout
}
func (cmd *baseCmd) setReadTimeout(d time.Duration) {
cmd._readTimeout = &d
}
func (cmd *baseCmd) readRawReply(rd *proto.Reader) (err error) {
cmd.rawVal, err = rd.ReadReply()
return err
}
func (cmd *baseCmd) GetCmdType() CmdType {
return cmd.cmdType
}
func (cmd *baseCmd) cloneBaseCmd() baseCmd {
var readTimeout *time.Duration
if cmd._readTimeout != nil {
timeout := *cmd._readTimeout
readTimeout = &timeout
}
// Create a copy of args slice
args := make([]interface{}, len(cmd.args))
copy(args, cmd.args)
return baseCmd{
ctx: cmd.ctx,
args: args,
err: cmd.err,
keyPos: cmd.keyPos,
_stepCount: cmd._stepCount,
rawVal: cmd.rawVal,
_readTimeout: readTimeout,
cmdType: cmd.cmdType,
}
}
//------------------------------------------------------------------------------
type Cmd struct {
baseCmd
val interface{}
}
func NewCmd(ctx context.Context, args ...interface{}) *Cmd {
return &Cmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeGeneric,
},
}
}
func (cmd *Cmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *Cmd) SetVal(val interface{}) {
cmd.val = val
}
func (cmd *Cmd) Val() interface{} {
return cmd.val
}
func (cmd *Cmd) Result() (interface{}, error) {
return cmd.val, cmd.err
}
func (cmd *Cmd) Text() (string, error) {
if cmd.err != nil {
return "", cmd.err
}
return toString(cmd.val)
}
func toString(val interface{}) (string, error) {
switch val := val.(type) {
case string:
return val, nil
default:
err := fmt.Errorf("redis: unexpected type=%T for String", val)
return "", err
}
}
func (cmd *Cmd) Int() (int, error) {
if cmd.err != nil {
return 0, cmd.err
}
switch val := cmd.val.(type) {
case int64:
return int(val), nil
case string:
return strconv.Atoi(val)
default:
err := fmt.Errorf("redis: unexpected type=%T for Int", val)
return 0, err
}
}
func (cmd *Cmd) Int64() (int64, error) {
if cmd.err != nil {
return 0, cmd.err
}
return toInt64(cmd.val)
}
func toInt64(val interface{}) (int64, error) {
switch val := val.(type) {
case int64:
return val, nil
case string:
return strconv.ParseInt(val, 10, 64)
default:
err := fmt.Errorf("redis: unexpected type=%T for Int64", val)
return 0, err
}
}
func (cmd *Cmd) Uint64() (uint64, error) {
if cmd.err != nil {
return 0, cmd.err
}
return toUint64(cmd.val)
}
func toUint64(val interface{}) (uint64, error) {
switch val := val.(type) {
case int64:
return uint64(val), nil
case string:
return strconv.ParseUint(val, 10, 64)
default:
err := fmt.Errorf("redis: unexpected type=%T for Uint64", val)
return 0, err
}
}
func (cmd *Cmd) Float32() (float32, error) {
if cmd.err != nil {
return 0, cmd.err
}
return toFloat32(cmd.val)
}
func toFloat32(val interface{}) (float32, error) {
switch val := val.(type) {
case int64:
return float32(val), nil
case string:
f, err := strconv.ParseFloat(val, 32)
if err != nil {
return 0, err
}
return float32(f), nil
default:
err := fmt.Errorf("redis: unexpected type=%T for Float32", val)
return 0, err
}
}
func (cmd *Cmd) Float64() (float64, error) {
if cmd.err != nil {
return 0, cmd.err
}
return toFloat64(cmd.val)
}
func toFloat64(val interface{}) (float64, error) {
switch val := val.(type) {
case int64:
return float64(val), nil
case string:
return strconv.ParseFloat(val, 64)
default:
err := fmt.Errorf("redis: unexpected type=%T for Float64", val)
return 0, err
}
}
func (cmd *Cmd) Bool() (bool, error) {
if cmd.err != nil {
return false, cmd.err
}
return toBool(cmd.val)
}
func toBool(val interface{}) (bool, error) {
switch val := val.(type) {
case bool:
return val, nil
case int64:
return val != 0, nil
case string:
return strconv.ParseBool(val)
default:
err := fmt.Errorf("redis: unexpected type=%T for Bool", val)
return false, err
}
}
func (cmd *Cmd) Slice() ([]interface{}, error) {
if cmd.err != nil {
return nil, cmd.err
}
switch val := cmd.val.(type) {
case []interface{}:
return val, nil
default:
return nil, fmt.Errorf("redis: unexpected type=%T for Slice", val)
}
}
func (cmd *Cmd) StringSlice() ([]string, error) {
slice, err := cmd.Slice()
if err != nil {
return nil, err
}
ss := make([]string, len(slice))
for i, iface := range slice {
val, err := toString(iface)
if err != nil {
return nil, err
}
ss[i] = val
}
return ss, nil
}
func (cmd *Cmd) Int64Slice() ([]int64, error) {
slice, err := cmd.Slice()
if err != nil {
return nil, err
}
nums := make([]int64, len(slice))
for i, iface := range slice {
val, err := toInt64(iface)
if err != nil {
return nil, err
}
nums[i] = val
}
return nums, nil
}
func (cmd *Cmd) Uint64Slice() ([]uint64, error) {
slice, err := cmd.Slice()
if err != nil {
return nil, err
}
nums := make([]uint64, len(slice))
for i, iface := range slice {
val, err := toUint64(iface)
if err != nil {
return nil, err
}
nums[i] = val
}
return nums, nil
}
func (cmd *Cmd) Float32Slice() ([]float32, error) {
slice, err := cmd.Slice()
if err != nil {
return nil, err
}
floats := make([]float32, len(slice))
for i, iface := range slice {
val, err := toFloat32(iface)
if err != nil {
return nil, err
}
floats[i] = val
}
return floats, nil
}
func (cmd *Cmd) Float64Slice() ([]float64, error) {
slice, err := cmd.Slice()
if err != nil {
return nil, err
}
floats := make([]float64, len(slice))
for i, iface := range slice {
val, err := toFloat64(iface)
if err != nil {
return nil, err
}
floats[i] = val
}
return floats, nil
}
func (cmd *Cmd) BoolSlice() ([]bool, error) {
slice, err := cmd.Slice()
if err != nil {
return nil, err
}
bools := make([]bool, len(slice))
for i, iface := range slice {
val, err := toBool(iface)
if err != nil {
return nil, err
}
bools[i] = val
}
return bools, nil
}
func (cmd *Cmd) readReply(rd *proto.Reader) (err error) {
cmd.val, err = rd.ReadReply()
return err
}
func (cmd *Cmd) Clone() Cmder {
return &Cmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val,
}
}
//------------------------------------------------------------------------------
type SliceCmd struct {
baseCmd
val []interface{}
}
var _ Cmder = (*SliceCmd)(nil)
func NewSliceCmd(ctx context.Context, args ...interface{}) *SliceCmd {
return &SliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeSlice,
},
}
}
func (cmd *SliceCmd) SetVal(val []interface{}) {
cmd.val = val
}
func (cmd *SliceCmd) Val() []interface{} {
return cmd.val
}
func (cmd *SliceCmd) Result() ([]interface{}, error) {
return cmd.val, cmd.err
}
func (cmd *SliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
// Scan scans the results from the map into a destination struct. The map keys
// are matched in the Redis struct fields by the `redis:"field"` tag.
func (cmd *SliceCmd) Scan(dst interface{}) error {
if cmd.err != nil {
return cmd.err
}
// Pass the list of keys and values.
// Skip the first two args for: HMGET key
var args []interface{}
if cmd.args[0] == "hmget" {
args = cmd.args[2:]
} else {
// Otherwise, it's: MGET field field ...
args = cmd.args[1:]
}
return hscan.Scan(dst, args, cmd.val)
}
func (cmd *SliceCmd) readReply(rd *proto.Reader) (err error) {
cmd.val, err = rd.ReadSlice()
return err
}
func (cmd *SliceCmd) Clone() Cmder {
var val []interface{}
if cmd.val != nil {
val = make([]interface{}, len(cmd.val))
copy(val, cmd.val)
}
return &SliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type StatusCmd struct {
baseCmd
val string
}
var _ Cmder = (*StatusCmd)(nil)
func NewStatusCmd(ctx context.Context, args ...interface{}) *StatusCmd {
return &StatusCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeStatus,
},
}
}
func (cmd *StatusCmd) SetVal(val string) {
cmd.val = val
}
func (cmd *StatusCmd) Val() string {
return cmd.val
}
func (cmd *StatusCmd) Result() (string, error) {
return cmd.val, cmd.err
}
func (cmd *StatusCmd) Bytes() ([]byte, error) {
return util.StringToBytes(cmd.val), cmd.err
}
func (cmd *StatusCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *StatusCmd) readReply(rd *proto.Reader) (err error) {
cmd.val, err = rd.ReadString()
return err
}
func (cmd *StatusCmd) Clone() Cmder {
return &StatusCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val,
}
}
//------------------------------------------------------------------------------
type IntCmd struct {
baseCmd
val int64
}
var _ Cmder = (*IntCmd)(nil)
func NewIntCmd(ctx context.Context, args ...interface{}) *IntCmd {
return &IntCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeInt,
},
}
}
func (cmd *IntCmd) SetVal(val int64) {
cmd.val = val
}
func (cmd *IntCmd) Val() int64 {
return cmd.val
}
func (cmd *IntCmd) Result() (int64, error) {
return cmd.val, cmd.err
}
func (cmd *IntCmd) Uint64() (uint64, error) {
return uint64(cmd.val), cmd.err
}
func (cmd *IntCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *IntCmd) readReply(rd *proto.Reader) (err error) {
cmd.val, err = rd.ReadInt()
return err
}
func (cmd *IntCmd) Clone() Cmder {
return &IntCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val,
}
}
//------------------------------------------------------------------------------
// DigestCmd is a command that returns a uint64 xxh3 hash digest.
//
// This command is specifically designed for the Redis DIGEST command,
// which returns the xxh3 hash of a key's value as a hex string.
// The hex string is automatically parsed to a uint64 value.
//
// The digest can be used for optimistic locking with SetIFDEQ, SetIFDNE,
// and DelExArgs commands.
//
// For examples of client-side digest generation and usage patterns, see:
// example/digest-optimistic-locking/
//
// Redis 8.4+. See https://redis.io/commands/digest/
type DigestCmd struct {
baseCmd
val uint64
}
var _ Cmder = (*DigestCmd)(nil)
func NewDigestCmd(ctx context.Context, args ...interface{}) *DigestCmd {
return &DigestCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
},
}
}
func (cmd *DigestCmd) SetVal(val uint64) {
cmd.val = val
}
func (cmd *DigestCmd) Val() uint64 {
return cmd.val
}
func (cmd *DigestCmd) Result() (uint64, error) {
return cmd.val, cmd.err
}
func (cmd *DigestCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *DigestCmd) Clone() Cmder {
return &DigestCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val,
}
}
func (cmd *DigestCmd) readReply(rd *proto.Reader) (err error) {
// Redis DIGEST command returns a hex string (e.g., "a1b2c3d4e5f67890")
// We parse it as a uint64 xxh3 hash value
var hexStr string
hexStr, err = rd.ReadString()
if err != nil {
return err
}
// Parse hex string to uint64
cmd.val, err = strconv.ParseUint(hexStr, 16, 64)
return err
}
//------------------------------------------------------------------------------
type IntSliceCmd struct {
baseCmd
val []int64
}
var _ Cmder = (*IntSliceCmd)(nil)
func NewIntSliceCmd(ctx context.Context, args ...interface{}) *IntSliceCmd {
return &IntSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeIntSlice,
},
}
}
func (cmd *IntSliceCmd) SetVal(val []int64) {
cmd.val = val
}
func (cmd *IntSliceCmd) Val() []int64 {
return cmd.val
}
func (cmd *IntSliceCmd) Result() ([]int64, error) {
return cmd.val, cmd.err
}
func (cmd *IntSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *IntSliceCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]int64, n)
for i := 0; i < len(cmd.val); i++ {
if cmd.val[i], err = rd.ReadInt(); err != nil {
return err
}
}
return nil
}
func (cmd *IntSliceCmd) Clone() Cmder {
var val []int64
if cmd.val != nil {
val = make([]int64, len(cmd.val))
copy(val, cmd.val)
}
return &IntSliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type DurationCmd struct {
baseCmd
val time.Duration
precision time.Duration
}
var _ Cmder = (*DurationCmd)(nil)
func NewDurationCmd(ctx context.Context, precision time.Duration, args ...interface{}) *DurationCmd {
return &DurationCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeDuration,
},
precision: precision,
}
}
func (cmd *DurationCmd) SetVal(val time.Duration) {
cmd.val = val
}
func (cmd *DurationCmd) Val() time.Duration {
return cmd.val
}
func (cmd *DurationCmd) Result() (time.Duration, error) {
return cmd.val, cmd.err
}
func (cmd *DurationCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *DurationCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadInt()
if err != nil {
return err
}
switch n {
// -2 if the key does not exist
// -1 if the key exists but has no associated expire
case -2, -1:
cmd.val = time.Duration(n)
default:
cmd.val = time.Duration(n) * cmd.precision
}
return nil
}
func (cmd *DurationCmd) Clone() Cmder {
return &DurationCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val,
precision: cmd.precision,
}
}
//------------------------------------------------------------------------------
type TimeCmd struct {
baseCmd
val time.Time
}
var _ Cmder = (*TimeCmd)(nil)
func NewTimeCmd(ctx context.Context, args ...interface{}) *TimeCmd {
return &TimeCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeTime,
},
}
}
func (cmd *TimeCmd) SetVal(val time.Time) {
cmd.val = val
}
func (cmd *TimeCmd) Val() time.Time {
return cmd.val
}
func (cmd *TimeCmd) Result() (time.Time, error) {
return cmd.val, cmd.err
}
func (cmd *TimeCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *TimeCmd) readReply(rd *proto.Reader) error {
if err := rd.ReadFixedArrayLen(2); err != nil {
return err
}
second, err := rd.ReadInt()
if err != nil {
return err
}
microsecond, err := rd.ReadInt()
if err != nil {
return err
}
cmd.val = time.Unix(second, microsecond*1000)
return nil
}
func (cmd *TimeCmd) Clone() Cmder {
return &TimeCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val,
}
}
//------------------------------------------------------------------------------
type BoolCmd struct {
baseCmd
val bool
}
var _ Cmder = (*BoolCmd)(nil)
func NewBoolCmd(ctx context.Context, args ...interface{}) *BoolCmd {
return &BoolCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeBool,
},
}
}
func (cmd *BoolCmd) SetVal(val bool) {
cmd.val = val
}
func (cmd *BoolCmd) Val() bool {
return cmd.val
}
func (cmd *BoolCmd) Result() (bool, error) {
return cmd.val, cmd.err
}
func (cmd *BoolCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *BoolCmd) readReply(rd *proto.Reader) (err error) {
cmd.val, err = rd.ReadBool()
// `SET key value NX` returns nil when key already exists. But
// `SETNX key value` returns bool (0/1). So convert nil to bool.
if err == Nil {
cmd.val = false
err = nil
}
return err
}
func (cmd *BoolCmd) Clone() Cmder {
return &BoolCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val,
}
}
//------------------------------------------------------------------------------
type StringCmd struct {
baseCmd
val string
}
var _ Cmder = (*StringCmd)(nil)
func NewStringCmd(ctx context.Context, args ...interface{}) *StringCmd {
return &StringCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeString,
},
}
}
func (cmd *StringCmd) SetVal(val string) {
cmd.val = val
}
func (cmd *StringCmd) Val() string {
return cmd.val
}
func (cmd *StringCmd) Result() (string, error) {
return cmd.val, cmd.err
}
func (cmd *StringCmd) Bytes() ([]byte, error) {
return util.StringToBytes(cmd.val), cmd.err
}
func (cmd *StringCmd) Bool() (bool, error) {
if cmd.err != nil {
return false, cmd.err
}
return strconv.ParseBool(cmd.val)
}
func (cmd *StringCmd) Int() (int, error) {
if cmd.err != nil {
return 0, cmd.err
}
return strconv.Atoi(cmd.val)
}
func (cmd *StringCmd) Int64() (int64, error) {
if cmd.err != nil {
return 0, cmd.err
}
return strconv.ParseInt(cmd.val, 10, 64)
}
func (cmd *StringCmd) Uint64() (uint64, error) {
if cmd.err != nil {
return 0, cmd.err
}
return strconv.ParseUint(cmd.val, 10, 64)
}
func (cmd *StringCmd) Float32() (float32, error) {
if cmd.err != nil {
return 0, cmd.err
}
f, err := strconv.ParseFloat(cmd.val, 32)
if err != nil {
return 0, err
}
return float32(f), nil
}
func (cmd *StringCmd) Float64() (float64, error) {
if cmd.err != nil {
return 0, cmd.err
}
return strconv.ParseFloat(cmd.val, 64)
}
func (cmd *StringCmd) Time() (time.Time, error) {
if cmd.err != nil {
return time.Time{}, cmd.err
}
return time.Parse(time.RFC3339Nano, cmd.val)
}
func (cmd *StringCmd) Scan(val interface{}) error {
if cmd.err != nil {
return cmd.err
}
return proto.Scan([]byte(cmd.val), val)
}
func (cmd *StringCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *StringCmd) readReply(rd *proto.Reader) (err error) {
cmd.val, err = rd.ReadString()
return err
}
func (cmd *StringCmd) Clone() Cmder {
return &StringCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val,
}
}
//------------------------------------------------------------------------------
type FloatCmd struct {
baseCmd
val float64
}
var _ Cmder = (*FloatCmd)(nil)
func NewFloatCmd(ctx context.Context, args ...interface{}) *FloatCmd {
return &FloatCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeFloat,
},
}
}
func (cmd *FloatCmd) SetVal(val float64) {
cmd.val = val
}
func (cmd *FloatCmd) Val() float64 {
return cmd.val
}
func (cmd *FloatCmd) Result() (float64, error) {
return cmd.val, cmd.err
}
func (cmd *FloatCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *FloatCmd) readReply(rd *proto.Reader) (err error) {
cmd.val, err = rd.ReadFloat()
return err
}
func (cmd *FloatCmd) Clone() Cmder {
return &FloatCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val,
}
}
//------------------------------------------------------------------------------
type FloatSliceCmd struct {
baseCmd
val []float64
}
var _ Cmder = (*FloatSliceCmd)(nil)
func NewFloatSliceCmd(ctx context.Context, args ...interface{}) *FloatSliceCmd {
return &FloatSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeFloatSlice,
},
}
}
func (cmd *FloatSliceCmd) SetVal(val []float64) {
cmd.val = val
}
func (cmd *FloatSliceCmd) Val() []float64 {
return cmd.val
}
func (cmd *FloatSliceCmd) Result() ([]float64, error) {
return cmd.val, cmd.err
}
func (cmd *FloatSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *FloatSliceCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]float64, n)
for i := 0; i < len(cmd.val); i++ {
switch num, err := rd.ReadFloat(); {
case err == Nil:
cmd.val[i] = 0
case err != nil:
return err
default:
cmd.val[i] = num
}
}
return nil
}
func (cmd *FloatSliceCmd) Clone() Cmder {
var val []float64
if cmd.val != nil {
val = make([]float64, len(cmd.val))
copy(val, cmd.val)
}
return &FloatSliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type StringSliceCmd struct {
baseCmd
val []string
}
var _ Cmder = (*StringSliceCmd)(nil)
func NewStringSliceCmd(ctx context.Context, args ...interface{}) *StringSliceCmd {
return &StringSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeStringSlice,
},
}
}
func (cmd *StringSliceCmd) SetVal(val []string) {
cmd.val = val
}
func (cmd *StringSliceCmd) Val() []string {
return cmd.val
}
func (cmd *StringSliceCmd) Result() ([]string, error) {
return cmd.val, cmd.err
}
func (cmd *StringSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *StringSliceCmd) ScanSlice(container interface{}) error {
return proto.ScanSlice(cmd.val, container)
}
func (cmd *StringSliceCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]string, n)
for i := 0; i < len(cmd.val); i++ {
switch s, err := rd.ReadString(); {
case err == Nil:
cmd.val[i] = ""
case err != nil:
return err
default:
cmd.val[i] = s
}
}
return nil
}
func (cmd *StringSliceCmd) Clone() Cmder {
var val []string
if cmd.val != nil {
val = make([]string, len(cmd.val))
copy(val, cmd.val)
}
return &StringSliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type KeyValue struct {
Key string
Value string
}
type KeyValueSliceCmd struct {
baseCmd
val []KeyValue
}
var _ Cmder = (*KeyValueSliceCmd)(nil)
func NewKeyValueSliceCmd(ctx context.Context, args ...interface{}) *KeyValueSliceCmd {
return &KeyValueSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeKeyValueSlice,
},
}
}
func (cmd *KeyValueSliceCmd) SetVal(val []KeyValue) {
cmd.val = val
}
func (cmd *KeyValueSliceCmd) Val() []KeyValue {
return cmd.val
}
func (cmd *KeyValueSliceCmd) Result() ([]KeyValue, error) {
return cmd.val, cmd.err
}
func (cmd *KeyValueSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
// Many commands will respond to two formats:
// 1. 1) "one"
// 2. (double) 1
// 2. 1) "two"
// 2. (double) 2
//
// OR:
// 1. "two"
// 2. (double) 2
// 3. "one"
// 4. (double) 1
func (cmd *KeyValueSliceCmd) readReply(rd *proto.Reader) error { // nolint:dupl
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
// If the n is 0, can't continue reading.
if n == 0 {
cmd.val = make([]KeyValue, 0)
return nil
}
typ, err := rd.PeekReplyType()
if err != nil {
return err
}
array := typ == proto.RespArray
if array {
cmd.val = make([]KeyValue, n)
} else {
cmd.val = make([]KeyValue, n/2)
}
for i := 0; i < len(cmd.val); i++ {
if array {
if err = rd.ReadFixedArrayLen(2); err != nil {
return err
}
}
if cmd.val[i].Key, err = rd.ReadString(); err != nil {
return err
}
if cmd.val[i].Value, err = rd.ReadString(); err != nil {
return err
}
}
return nil
}
func (cmd *KeyValueSliceCmd) Clone() Cmder {
var val []KeyValue
if cmd.val != nil {
val = make([]KeyValue, len(cmd.val))
copy(val, cmd.val)
}
return &KeyValueSliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type BoolSliceCmd struct {
baseCmd
val []bool
}
var _ Cmder = (*BoolSliceCmd)(nil)
func NewBoolSliceCmd(ctx context.Context, args ...interface{}) *BoolSliceCmd {
return &BoolSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeBoolSlice,
},
}
}
func (cmd *BoolSliceCmd) SetVal(val []bool) {
cmd.val = val
}
func (cmd *BoolSliceCmd) Val() []bool {
return cmd.val
}
func (cmd *BoolSliceCmd) Result() ([]bool, error) {
return cmd.val, cmd.err
}
func (cmd *BoolSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *BoolSliceCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]bool, n)
for i := 0; i < len(cmd.val); i++ {
if cmd.val[i], err = rd.ReadBool(); err != nil {
return err
}
}
return nil
}
func (cmd *BoolSliceCmd) Clone() Cmder {
var val []bool
if cmd.val != nil {
val = make([]bool, len(cmd.val))
copy(val, cmd.val)
}
return &BoolSliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type MapStringStringCmd struct {
baseCmd
val map[string]string
}
var _ Cmder = (*MapStringStringCmd)(nil)
func NewMapStringStringCmd(ctx context.Context, args ...interface{}) *MapStringStringCmd {
return &MapStringStringCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeMapStringString,
},
}
}
func (cmd *MapStringStringCmd) Val() map[string]string {
return cmd.val
}
func (cmd *MapStringStringCmd) SetVal(val map[string]string) {
cmd.val = val
}
func (cmd *MapStringStringCmd) Result() (map[string]string, error) {
return cmd.val, cmd.err
}
func (cmd *MapStringStringCmd) String() string {
return cmdString(cmd, cmd.val)
}
// Scan scans the results from the map into a destination struct. The map keys
// are matched in the Redis struct fields by the `redis:"field"` tag.
func (cmd *MapStringStringCmd) Scan(dest interface{}) error {
if cmd.err != nil {
return cmd.err
}
strct, err := hscan.Struct(dest)
if err != nil {
return err
}
for k, v := range cmd.val {
if err := strct.Scan(k, v); err != nil {
return err
}
}
return nil
}
func (cmd *MapStringStringCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
cmd.val = make(map[string]string, n)
for i := 0; i < n; i++ {
key, err := rd.ReadString()
if err != nil {
return err
}
value, err := rd.ReadString()
if err != nil {
return err
}
cmd.val[key] = value
}
return nil
}
func (cmd *MapStringStringCmd) Clone() Cmder {
var val map[string]string
if cmd.val != nil {
val = make(map[string]string, len(cmd.val))
for k, v := range cmd.val {
val[k] = v
}
}
return &MapStringStringCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type MapStringIntCmd struct {
baseCmd
val map[string]int64
}
var _ Cmder = (*MapStringIntCmd)(nil)
func NewMapStringIntCmd(ctx context.Context, args ...interface{}) *MapStringIntCmd {
return &MapStringIntCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeMapStringInt,
},
}
}
func (cmd *MapStringIntCmd) SetVal(val map[string]int64) {
cmd.val = val
}
func (cmd *MapStringIntCmd) Val() map[string]int64 {
return cmd.val
}
func (cmd *MapStringIntCmd) Result() (map[string]int64, error) {
return cmd.val, cmd.err
}
func (cmd *MapStringIntCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *MapStringIntCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
cmd.val = make(map[string]int64, n)
for i := 0; i < n; i++ {
key, err := rd.ReadString()
if err != nil {
return err
}
nn, err := rd.ReadInt()
if err != nil {
return err
}
cmd.val[key] = nn
}
return nil
}
func (cmd *MapStringIntCmd) Clone() Cmder {
var val map[string]int64
if cmd.val != nil {
val = make(map[string]int64, len(cmd.val))
for k, v := range cmd.val {
val[k] = v
}
}
return &MapStringIntCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
// ------------------------------------------------------------------------------
type MapStringSliceInterfaceCmd struct {
baseCmd
val map[string][]interface{}
}
func NewMapStringSliceInterfaceCmd(ctx context.Context, args ...interface{}) *MapStringSliceInterfaceCmd {
return &MapStringSliceInterfaceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeMapStringInterfaceSlice,
},
}
}
func (cmd *MapStringSliceInterfaceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *MapStringSliceInterfaceCmd) SetVal(val map[string][]interface{}) {
cmd.val = val
}
func (cmd *MapStringSliceInterfaceCmd) Result() (map[string][]interface{}, error) {
return cmd.val, cmd.err
}
func (cmd *MapStringSliceInterfaceCmd) Val() map[string][]interface{} {
return cmd.val
}
func (cmd *MapStringSliceInterfaceCmd) readReply(rd *proto.Reader) (err error) {
readType, err := rd.PeekReplyType()
if err != nil {
return err
}
cmd.val = make(map[string][]interface{})
switch readType {
case proto.RespMap:
n, err := rd.ReadMapLen()
if err != nil {
return err
}
for i := 0; i < n; i++ {
k, err := rd.ReadString()
if err != nil {
return err
}
nn, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val[k] = make([]interface{}, nn)
for j := 0; j < nn; j++ {
value, err := rd.ReadReply()
if err != nil {
return err
}
cmd.val[k][j] = value
}
}
case proto.RespArray:
// RESP2 response
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
for i := 0; i < n; i++ {
// Each entry in this array is itself an array with key details
itemLen, err := rd.ReadArrayLen()
if err != nil {
return err
}
key, err := rd.ReadString()
if err != nil {
return err
}
cmd.val[key] = make([]interface{}, 0, itemLen-1)
for j := 1; j < itemLen; j++ {
// Read the inner array for timestamp-value pairs
data, err := rd.ReadReply()
if err != nil {
return err
}
cmd.val[key] = append(cmd.val[key], data)
}
}
}
return nil
}
func (cmd *MapStringSliceInterfaceCmd) Clone() Cmder {
var val map[string][]interface{}
if cmd.val != nil {
val = make(map[string][]interface{}, len(cmd.val))
for k, v := range cmd.val {
if v != nil {
newSlice := make([]interface{}, len(v))
copy(newSlice, v)
val[k] = newSlice
}
}
}
return &MapStringSliceInterfaceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type StringStructMapCmd struct {
baseCmd
val map[string]struct{}
}
var _ Cmder = (*StringStructMapCmd)(nil)
func NewStringStructMapCmd(ctx context.Context, args ...interface{}) *StringStructMapCmd {
return &StringStructMapCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeStringStructMap,
},
}
}
func (cmd *StringStructMapCmd) SetVal(val map[string]struct{}) {
cmd.val = val
}
func (cmd *StringStructMapCmd) Val() map[string]struct{} {
return cmd.val
}
func (cmd *StringStructMapCmd) Result() (map[string]struct{}, error) {
return cmd.val, cmd.err
}
func (cmd *StringStructMapCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *StringStructMapCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make(map[string]struct{}, n)
for i := 0; i < n; i++ {
key, err := rd.ReadString()
if err != nil {
return err
}
cmd.val[key] = struct{}{}
}
return nil
}
func (cmd *StringStructMapCmd) Clone() Cmder {
var val map[string]struct{}
if cmd.val != nil {
val = maps.Clone(cmd.val)
}
return &StringStructMapCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type XMessage struct {
ID string
Values map[string]interface{}
// MillisElapsedFromDelivery is the number of milliseconds since the entry was last delivered.
// Only populated when using XREADGROUP with CLAIM argument for claimed entries.
MillisElapsedFromDelivery int64
// DeliveredCount is the number of times the entry was delivered.
// Only populated when using XREADGROUP with CLAIM argument for claimed entries.
DeliveredCount int64
}
type XMessageSliceCmd struct {
baseCmd
val []XMessage
}
var _ Cmder = (*XMessageSliceCmd)(nil)
func NewXMessageSliceCmd(ctx context.Context, args ...interface{}) *XMessageSliceCmd {
return &XMessageSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeXMessageSlice,
},
}
}
func (cmd *XMessageSliceCmd) SetVal(val []XMessage) {
cmd.val = val
}
func (cmd *XMessageSliceCmd) Val() []XMessage {
return cmd.val
}
func (cmd *XMessageSliceCmd) Result() ([]XMessage, error) {
return cmd.val, cmd.err
}
func (cmd *XMessageSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *XMessageSliceCmd) readReply(rd *proto.Reader) (err error) {
cmd.val, err = readXMessageSlice(rd)
return err
}
func (cmd *XMessageSliceCmd) Clone() Cmder {
var val []XMessage
if cmd.val != nil {
val = make([]XMessage, len(cmd.val))
for i, msg := range cmd.val {
val[i] = XMessage{
ID: msg.ID,
}
if msg.Values != nil {
val[i].Values = make(map[string]interface{}, len(msg.Values))
for k, v := range msg.Values {
val[i].Values[k] = v
}
}
}
}
return &XMessageSliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
func readXMessageSlice(rd *proto.Reader) ([]XMessage, error) {
n, err := rd.ReadArrayLen()
if err != nil {
return nil, err
}
msgs := make([]XMessage, n)
for i := 0; i < len(msgs); i++ {
if msgs[i], err = readXMessage(rd); err != nil {
return nil, err
}
}
return msgs, nil
}
func readXMessage(rd *proto.Reader) (XMessage, error) {
// Read array length can be 2 or 4 (with CLAIM metadata)
n, err := rd.ReadArrayLen()
if err != nil {
return XMessage{}, err
}
if n != 2 && n != 4 {
return XMessage{}, fmt.Errorf("redis: got %d elements in the XMessage array, expected 2 or 4", n)
}
id, err := rd.ReadString()
if err != nil {
return XMessage{}, err
}
v, err := stringInterfaceMapParser(rd)
if err != nil {
if err != proto.Nil {
return XMessage{}, err
}
}
msg := XMessage{
ID: id,
Values: v,
}
if n == 4 {
msg.MillisElapsedFromDelivery, err = rd.ReadInt()
if err != nil {
return XMessage{}, err
}
msg.DeliveredCount, err = rd.ReadInt()
if err != nil {
return XMessage{}, err
}
}
return msg, nil
}
func stringInterfaceMapParser(rd *proto.Reader) (map[string]interface{}, error) {
n, err := rd.ReadMapLen()
if err != nil {
return nil, err
}
m := make(map[string]interface{}, n)
for i := 0; i < n; i++ {
key, err := rd.ReadString()
if err != nil {
return nil, err
}
value, err := rd.ReadString()
if err != nil {
return nil, err
}
m[key] = value
}
return m, nil
}
//------------------------------------------------------------------------------
type XStream struct {
Stream string
Messages []XMessage
}
type XStreamSliceCmd struct {
baseCmd
val []XStream
}
var _ Cmder = (*XStreamSliceCmd)(nil)
func NewXStreamSliceCmd(ctx context.Context, args ...interface{}) *XStreamSliceCmd {
return &XStreamSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeXStreamSlice,
},
}
}
func (cmd *XStreamSliceCmd) SetVal(val []XStream) {
cmd.val = val
}
func (cmd *XStreamSliceCmd) Val() []XStream {
return cmd.val
}
func (cmd *XStreamSliceCmd) Result() ([]XStream, error) {
return cmd.val, cmd.err
}
func (cmd *XStreamSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *XStreamSliceCmd) readReply(rd *proto.Reader) error {
typ, err := rd.PeekReplyType()
if err != nil {
return err
}
var n int
if typ == proto.RespMap {
n, err = rd.ReadMapLen()
} else {
n, err = rd.ReadArrayLen()
}
if err != nil {
return err
}
cmd.val = make([]XStream, n)
for i := 0; i < len(cmd.val); i++ {
if typ != proto.RespMap {
if err = rd.ReadFixedArrayLen(2); err != nil {
return err
}
}
if cmd.val[i].Stream, err = rd.ReadString(); err != nil {
return err
}
if cmd.val[i].Messages, err = readXMessageSlice(rd); err != nil {
return err
}
}
return nil
}
func (cmd *XStreamSliceCmd) Clone() Cmder {
var val []XStream
if cmd.val != nil {
val = make([]XStream, len(cmd.val))
for i, stream := range cmd.val {
val[i] = XStream{
Stream: stream.Stream,
}
if stream.Messages != nil {
val[i].Messages = make([]XMessage, len(stream.Messages))
for j, msg := range stream.Messages {
val[i].Messages[j] = XMessage{
ID: msg.ID,
}
if msg.Values != nil {
val[i].Messages[j].Values = make(map[string]interface{}, len(msg.Values))
for k, v := range msg.Values {
val[i].Messages[j].Values[k] = v
}
}
}
}
}
}
return &XStreamSliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type XPending struct {
Count int64
Lower string
Higher string
Consumers map[string]int64
}
type XPendingCmd struct {
baseCmd
val *XPending
}
var _ Cmder = (*XPendingCmd)(nil)
func NewXPendingCmd(ctx context.Context, args ...interface{}) *XPendingCmd {
return &XPendingCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeXPending,
},
}
}
func (cmd *XPendingCmd) SetVal(val *XPending) {
cmd.val = val
}
func (cmd *XPendingCmd) Val() *XPending {
return cmd.val
}
func (cmd *XPendingCmd) Result() (*XPending, error) {
return cmd.val, cmd.err
}
func (cmd *XPendingCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *XPendingCmd) readReply(rd *proto.Reader) error {
var err error
if err = rd.ReadFixedArrayLen(4); err != nil {
return err
}
cmd.val = &XPending{}
if cmd.val.Count, err = rd.ReadInt(); err != nil {
return err
}
if cmd.val.Lower, err = rd.ReadString(); err != nil && err != Nil {
return err
}
if cmd.val.Higher, err = rd.ReadString(); err != nil && err != Nil {
return err
}
n, err := rd.ReadArrayLen()
if err != nil && err != Nil {
return err
}
cmd.val.Consumers = make(map[string]int64, n)
for i := 0; i < n; i++ {
if err = rd.ReadFixedArrayLen(2); err != nil {
return err
}
consumerName, err := rd.ReadString()
if err != nil {
return err
}
consumerPending, err := rd.ReadInt()
if err != nil {
return err
}
cmd.val.Consumers[consumerName] = consumerPending
}
return nil
}
func (cmd *XPendingCmd) Clone() Cmder {
var val *XPending
if cmd.val != nil {
val = &XPending{
Count: cmd.val.Count,
Lower: cmd.val.Lower,
Higher: cmd.val.Higher,
}
if cmd.val.Consumers != nil {
val.Consumers = make(map[string]int64, len(cmd.val.Consumers))
for k, v := range cmd.val.Consumers {
val.Consumers[k] = v
}
}
}
return &XPendingCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type XPendingExt struct {
ID string
Consumer string
Idle time.Duration
RetryCount int64
}
type XPendingExtCmd struct {
baseCmd
val []XPendingExt
}
var _ Cmder = (*XPendingExtCmd)(nil)
func NewXPendingExtCmd(ctx context.Context, args ...interface{}) *XPendingExtCmd {
return &XPendingExtCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeXPendingExt,
},
}
}
func (cmd *XPendingExtCmd) SetVal(val []XPendingExt) {
cmd.val = val
}
func (cmd *XPendingExtCmd) Val() []XPendingExt {
return cmd.val
}
func (cmd *XPendingExtCmd) Result() ([]XPendingExt, error) {
return cmd.val, cmd.err
}
func (cmd *XPendingExtCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *XPendingExtCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]XPendingExt, n)
for i := 0; i < len(cmd.val); i++ {
if err = rd.ReadFixedArrayLen(4); err != nil {
return err
}
if cmd.val[i].ID, err = rd.ReadString(); err != nil {
return err
}
if cmd.val[i].Consumer, err = rd.ReadString(); err != nil && err != Nil {
return err
}
idle, err := rd.ReadInt()
if err != nil && err != Nil {
return err
}
cmd.val[i].Idle = time.Duration(idle) * time.Millisecond
if cmd.val[i].RetryCount, err = rd.ReadInt(); err != nil && err != Nil {
return err
}
}
return nil
}
func (cmd *XPendingExtCmd) Clone() Cmder {
var val []XPendingExt
if cmd.val != nil {
val = make([]XPendingExt, len(cmd.val))
copy(val, cmd.val)
}
return &XPendingExtCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type XAutoClaimCmd struct {
baseCmd
start string
val []XMessage
}
var _ Cmder = (*XAutoClaimCmd)(nil)
func NewXAutoClaimCmd(ctx context.Context, args ...interface{}) *XAutoClaimCmd {
return &XAutoClaimCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeXAutoClaim,
},
}
}
func (cmd *XAutoClaimCmd) SetVal(val []XMessage, start string) {
cmd.val = val
cmd.start = start
}
func (cmd *XAutoClaimCmd) Val() (messages []XMessage, start string) {
return cmd.val, cmd.start
}
func (cmd *XAutoClaimCmd) Result() (messages []XMessage, start string, err error) {
return cmd.val, cmd.start, cmd.err
}
func (cmd *XAutoClaimCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *XAutoClaimCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
switch n {
case 2, // Redis 6
3: // Redis 7:
// ok
default:
return fmt.Errorf("redis: got %d elements in XAutoClaim reply, wanted 2/3", n)
}
cmd.start, err = rd.ReadString()
if err != nil {
return err
}
cmd.val, err = readXMessageSlice(rd)
if err != nil {
return err
}
if n >= 3 {
if err := rd.DiscardNext(); err != nil {
return err
}
}
return nil
}
func (cmd *XAutoClaimCmd) Clone() Cmder {
var val []XMessage
if cmd.val != nil {
val = make([]XMessage, len(cmd.val))
for i, msg := range cmd.val {
val[i] = XMessage{
ID: msg.ID,
}
if msg.Values != nil {
val[i].Values = make(map[string]interface{}, len(msg.Values))
for k, v := range msg.Values {
val[i].Values[k] = v
}
}
}
}
return &XAutoClaimCmd{
baseCmd: cmd.cloneBaseCmd(),
start: cmd.start,
val: val,
}
}
//------------------------------------------------------------------------------
type XAutoClaimJustIDCmd struct {
baseCmd
start string
val []string
}
var _ Cmder = (*XAutoClaimJustIDCmd)(nil)
func NewXAutoClaimJustIDCmd(ctx context.Context, args ...interface{}) *XAutoClaimJustIDCmd {
return &XAutoClaimJustIDCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeXAutoClaimJustID,
},
}
}
func (cmd *XAutoClaimJustIDCmd) SetVal(val []string, start string) {
cmd.val = val
cmd.start = start
}
func (cmd *XAutoClaimJustIDCmd) Val() (ids []string, start string) {
return cmd.val, cmd.start
}
func (cmd *XAutoClaimJustIDCmd) Result() (ids []string, start string, err error) {
return cmd.val, cmd.start, cmd.err
}
func (cmd *XAutoClaimJustIDCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *XAutoClaimJustIDCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
switch n {
case 2, // Redis 6
3: // Redis 7:
// ok
default:
return fmt.Errorf("redis: got %d elements in XAutoClaimJustID reply, wanted 2/3", n)
}
cmd.start, err = rd.ReadString()
if err != nil {
return err
}
nn, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]string, nn)
for i := 0; i < nn; i++ {
cmd.val[i], err = rd.ReadString()
if err != nil {
return err
}
}
if n >= 3 {
if err := rd.DiscardNext(); err != nil {
return err
}
}
return nil
}
func (cmd *XAutoClaimJustIDCmd) Clone() Cmder {
var val []string
if cmd.val != nil {
val = make([]string, len(cmd.val))
copy(val, cmd.val)
}
return &XAutoClaimJustIDCmd{
baseCmd: cmd.cloneBaseCmd(),
start: cmd.start,
val: val,
}
}
//------------------------------------------------------------------------------
type XInfoConsumersCmd struct {
baseCmd
val []XInfoConsumer
}
type XInfoConsumer struct {
Name string
Pending int64
Idle time.Duration
Inactive time.Duration
}
var _ Cmder = (*XInfoConsumersCmd)(nil)
func NewXInfoConsumersCmd(ctx context.Context, stream string, group string) *XInfoConsumersCmd {
return &XInfoConsumersCmd{
baseCmd: baseCmd{
ctx: ctx,
args: []interface{}{"xinfo", "consumers", stream, group},
cmdType: CmdTypeXInfoConsumers,
},
}
}
func (cmd *XInfoConsumersCmd) SetVal(val []XInfoConsumer) {
cmd.val = val
}
func (cmd *XInfoConsumersCmd) Val() []XInfoConsumer {
return cmd.val
}
func (cmd *XInfoConsumersCmd) Result() ([]XInfoConsumer, error) {
return cmd.val, cmd.err
}
func (cmd *XInfoConsumersCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *XInfoConsumersCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]XInfoConsumer, n)
for i := 0; i < len(cmd.val); i++ {
nn, err := rd.ReadMapLen()
if err != nil {
return err
}
var key string
for f := 0; f < nn; f++ {
key, err = rd.ReadString()
if err != nil {
return err
}
switch key {
case "name":
cmd.val[i].Name, err = rd.ReadString()
case "pending":
cmd.val[i].Pending, err = rd.ReadInt()
case "idle":
var idle int64
idle, err = rd.ReadInt()
cmd.val[i].Idle = time.Duration(idle) * time.Millisecond
case "inactive":
var inactive int64
inactive, err = rd.ReadInt()
cmd.val[i].Inactive = time.Duration(inactive) * time.Millisecond
default:
return fmt.Errorf("redis: unexpected content %s in XINFO CONSUMERS reply", key)
}
if err != nil {
return err
}
}
}
return nil
}
func (cmd *XInfoConsumersCmd) Clone() Cmder {
var val []XInfoConsumer
if cmd.val != nil {
val = make([]XInfoConsumer, len(cmd.val))
copy(val, cmd.val)
}
return &XInfoConsumersCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type XInfoGroupsCmd struct {
baseCmd
val []XInfoGroup
}
type XInfoGroup struct {
Name string
Consumers int64
Pending int64
LastDeliveredID string
EntriesRead int64
// Lag represents the number of pending messages in the stream not yet
// delivered to this consumer group. Returns -1 when the lag cannot be determined.
Lag int64
}
var _ Cmder = (*XInfoGroupsCmd)(nil)
func NewXInfoGroupsCmd(ctx context.Context, stream string) *XInfoGroupsCmd {
return &XInfoGroupsCmd{
baseCmd: baseCmd{
ctx: ctx,
args: []interface{}{"xinfo", "groups", stream},
cmdType: CmdTypeXInfoGroups,
},
}
}
func (cmd *XInfoGroupsCmd) SetVal(val []XInfoGroup) {
cmd.val = val
}
func (cmd *XInfoGroupsCmd) Val() []XInfoGroup {
return cmd.val
}
func (cmd *XInfoGroupsCmd) Result() ([]XInfoGroup, error) {
return cmd.val, cmd.err
}
func (cmd *XInfoGroupsCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *XInfoGroupsCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]XInfoGroup, n)
for i := 0; i < len(cmd.val); i++ {
group := &cmd.val[i]
nn, err := rd.ReadMapLen()
if err != nil {
return err
}
var key string
for j := 0; j < nn; j++ {
key, err = rd.ReadString()
if err != nil {
return err
}
switch key {
case "name":
group.Name, err = rd.ReadString()
if err != nil {
return err
}
case "consumers":
group.Consumers, err = rd.ReadInt()
if err != nil {
return err
}
case "pending":
group.Pending, err = rd.ReadInt()
if err != nil {
return err
}
case "last-delivered-id":
group.LastDeliveredID, err = rd.ReadString()
if err != nil {
return err
}
case "entries-read":
group.EntriesRead, err = rd.ReadInt()
if err != nil && err != Nil {
return err
}
case "lag":
group.Lag, err = rd.ReadInt()
// lag: the number of entries in the stream that are still waiting to be delivered
// to the group's consumers, or a NULL(Nil) when that number can't be determined.
// In that case, we return -1.
if err != nil && err != Nil {
return err
} else if err == Nil {
group.Lag = -1
}
default:
return fmt.Errorf("redis: unexpected key %q in XINFO GROUPS reply", key)
}
}
}
return nil
}
func (cmd *XInfoGroupsCmd) Clone() Cmder {
var val []XInfoGroup
if cmd.val != nil {
val = make([]XInfoGroup, len(cmd.val))
copy(val, cmd.val)
}
return &XInfoGroupsCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type XInfoStreamCmd struct {
baseCmd
val *XInfoStream
}
type XInfoStream struct {
Length int64
RadixTreeKeys int64
RadixTreeNodes int64
Groups int64
LastGeneratedID string
MaxDeletedEntryID string
EntriesAdded int64
FirstEntry XMessage
LastEntry XMessage
RecordedFirstEntryID string
IDMPDuration int64
IDMPMaxSize int64
PIDsTracked int64
IIDsTracked int64
IIDsAdded int64
IIDsDuplicates int64
}
var _ Cmder = (*XInfoStreamCmd)(nil)
func NewXInfoStreamCmd(ctx context.Context, stream string) *XInfoStreamCmd {
return &XInfoStreamCmd{
baseCmd: baseCmd{
ctx: ctx,
args: []interface{}{"xinfo", "stream", stream},
cmdType: CmdTypeXInfoStream,
},
}
}
func (cmd *XInfoStreamCmd) SetVal(val *XInfoStream) {
cmd.val = val
}
func (cmd *XInfoStreamCmd) Val() *XInfoStream {
return cmd.val
}
func (cmd *XInfoStreamCmd) Result() (*XInfoStream, error) {
return cmd.val, cmd.err
}
func (cmd *XInfoStreamCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *XInfoStreamCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
cmd.val = &XInfoStream{}
for i := 0; i < n; i++ {
key, err := rd.ReadString()
if err != nil {
return err
}
switch key {
case "length":
cmd.val.Length, err = rd.ReadInt()
if err != nil {
return err
}
case "radix-tree-keys":
cmd.val.RadixTreeKeys, err = rd.ReadInt()
if err != nil {
return err
}
case "radix-tree-nodes":
cmd.val.RadixTreeNodes, err = rd.ReadInt()
if err != nil {
return err
}
case "groups":
cmd.val.Groups, err = rd.ReadInt()
if err != nil {
return err
}
case "last-generated-id":
cmd.val.LastGeneratedID, err = rd.ReadString()
if err != nil {
return err
}
case "max-deleted-entry-id":
cmd.val.MaxDeletedEntryID, err = rd.ReadString()
if err != nil {
return err
}
case "entries-added":
cmd.val.EntriesAdded, err = rd.ReadInt()
if err != nil {
return err
}
case "first-entry":
cmd.val.FirstEntry, err = readXMessage(rd)
if err != nil && err != Nil {
return err
}
case "last-entry":
cmd.val.LastEntry, err = readXMessage(rd)
if err != nil && err != Nil {
return err
}
case "recorded-first-entry-id":
cmd.val.RecordedFirstEntryID, err = rd.ReadString()
if err != nil {
return err
}
case "idmp-duration":
cmd.val.IDMPDuration, err = rd.ReadInt()
if err != nil {
return err
}
case "idmp-maxsize":
cmd.val.IDMPMaxSize, err = rd.ReadInt()
if err != nil {
return err
}
case "pids-tracked":
cmd.val.PIDsTracked, err = rd.ReadInt()
if err != nil {
return err
}
case "iids-tracked":
cmd.val.IIDsTracked, err = rd.ReadInt()
if err != nil {
return err
}
case "iids-added":
cmd.val.IIDsAdded, err = rd.ReadInt()
if err != nil {
return err
}
case "iids-duplicates":
cmd.val.IIDsDuplicates, err = rd.ReadInt()
if err != nil {
return err
}
default:
return fmt.Errorf("redis: unexpected key %q in XINFO STREAM reply", key)
}
}
return nil
}
func (cmd *XInfoStreamCmd) Clone() Cmder {
var val *XInfoStream
if cmd.val != nil {
val = &XInfoStream{
Length: cmd.val.Length,
RadixTreeKeys: cmd.val.RadixTreeKeys,
RadixTreeNodes: cmd.val.RadixTreeNodes,
Groups: cmd.val.Groups,
LastGeneratedID: cmd.val.LastGeneratedID,
MaxDeletedEntryID: cmd.val.MaxDeletedEntryID,
EntriesAdded: cmd.val.EntriesAdded,
RecordedFirstEntryID: cmd.val.RecordedFirstEntryID,
}
// Clone XMessage fields
val.FirstEntry = XMessage{
ID: cmd.val.FirstEntry.ID,
}
if cmd.val.FirstEntry.Values != nil {
val.FirstEntry.Values = make(map[string]interface{}, len(cmd.val.FirstEntry.Values))
for k, v := range cmd.val.FirstEntry.Values {
val.FirstEntry.Values[k] = v
}
}
val.LastEntry = XMessage{
ID: cmd.val.LastEntry.ID,
}
if cmd.val.LastEntry.Values != nil {
val.LastEntry.Values = make(map[string]interface{}, len(cmd.val.LastEntry.Values))
for k, v := range cmd.val.LastEntry.Values {
val.LastEntry.Values[k] = v
}
}
}
return &XInfoStreamCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type XInfoStreamFullCmd struct {
baseCmd
val *XInfoStreamFull
}
type XInfoStreamFull struct {
Length int64
RadixTreeKeys int64
RadixTreeNodes int64
LastGeneratedID string
MaxDeletedEntryID string
EntriesAdded int64
Entries []XMessage
Groups []XInfoStreamGroup
RecordedFirstEntryID string
IDMPDuration int64
IDMPMaxSize int64
PIDsTracked int64
IIDsTracked int64
IIDsAdded int64
IIDsDuplicates int64
}
type XInfoStreamGroup struct {
Name string
LastDeliveredID string
EntriesRead int64
Lag int64
PelCount int64
Pending []XInfoStreamGroupPending
Consumers []XInfoStreamConsumer
}
type XInfoStreamGroupPending struct {
ID string
Consumer string
DeliveryTime time.Time
DeliveryCount int64
}
type XInfoStreamConsumer struct {
Name string
SeenTime time.Time
ActiveTime time.Time
PelCount int64
Pending []XInfoStreamConsumerPending
}
type XInfoStreamConsumerPending struct {
ID string
DeliveryTime time.Time
DeliveryCount int64
}
var _ Cmder = (*XInfoStreamFullCmd)(nil)
func NewXInfoStreamFullCmd(ctx context.Context, args ...interface{}) *XInfoStreamFullCmd {
return &XInfoStreamFullCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeXInfoStreamFull,
},
}
}
func (cmd *XInfoStreamFullCmd) SetVal(val *XInfoStreamFull) {
cmd.val = val
}
func (cmd *XInfoStreamFullCmd) Val() *XInfoStreamFull {
return cmd.val
}
func (cmd *XInfoStreamFullCmd) Result() (*XInfoStreamFull, error) {
return cmd.val, cmd.err
}
func (cmd *XInfoStreamFullCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *XInfoStreamFullCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
cmd.val = &XInfoStreamFull{}
for i := 0; i < n; i++ {
key, err := rd.ReadString()
if err != nil {
return err
}
switch key {
case "length":
cmd.val.Length, err = rd.ReadInt()
if err != nil {
return err
}
case "radix-tree-keys":
cmd.val.RadixTreeKeys, err = rd.ReadInt()
if err != nil {
return err
}
case "radix-tree-nodes":
cmd.val.RadixTreeNodes, err = rd.ReadInt()
if err != nil {
return err
}
case "last-generated-id":
cmd.val.LastGeneratedID, err = rd.ReadString()
if err != nil {
return err
}
case "entries-added":
cmd.val.EntriesAdded, err = rd.ReadInt()
if err != nil {
return err
}
case "entries":
cmd.val.Entries, err = readXMessageSlice(rd)
if err != nil {
return err
}
case "groups":
cmd.val.Groups, err = readStreamGroups(rd)
if err != nil {
return err
}
case "max-deleted-entry-id":
cmd.val.MaxDeletedEntryID, err = rd.ReadString()
if err != nil {
return err
}
case "recorded-first-entry-id":
cmd.val.RecordedFirstEntryID, err = rd.ReadString()
if err != nil {
return err
}
case "idmp-duration":
cmd.val.IDMPDuration, err = rd.ReadInt()
if err != nil {
return err
}
case "idmp-maxsize":
cmd.val.IDMPMaxSize, err = rd.ReadInt()
if err != nil {
return err
}
case "pids-tracked":
cmd.val.PIDsTracked, err = rd.ReadInt()
if err != nil {
return err
}
case "iids-tracked":
cmd.val.IIDsTracked, err = rd.ReadInt()
if err != nil {
return err
}
case "iids-added":
cmd.val.IIDsAdded, err = rd.ReadInt()
if err != nil {
return err
}
case "iids-duplicates":
cmd.val.IIDsDuplicates, err = rd.ReadInt()
if err != nil {
return err
}
default:
return fmt.Errorf("redis: unexpected key %q in XINFO STREAM FULL reply", key)
}
}
return nil
}
func readStreamGroups(rd *proto.Reader) ([]XInfoStreamGroup, error) {
n, err := rd.ReadArrayLen()
if err != nil {
return nil, err
}
groups := make([]XInfoStreamGroup, 0, n)
for i := 0; i < n; i++ {
nn, err := rd.ReadMapLen()
if err != nil {
return nil, err
}
group := XInfoStreamGroup{}
for j := 0; j < nn; j++ {
key, err := rd.ReadString()
if err != nil {
return nil, err
}
switch key {
case "name":
group.Name, err = rd.ReadString()
if err != nil {
return nil, err
}
case "last-delivered-id":
group.LastDeliveredID, err = rd.ReadString()
if err != nil {
return nil, err
}
case "entries-read":
group.EntriesRead, err = rd.ReadInt()
if err != nil && err != Nil {
return nil, err
}
case "lag":
// lag: the number of entries in the stream that are still waiting to be delivered
// to the group's consumers, or a NULL(Nil) when that number can't be determined.
group.Lag, err = rd.ReadInt()
if err != nil && err != Nil {
return nil, err
}
case "pel-count":
group.PelCount, err = rd.ReadInt()
if err != nil {
return nil, err
}
case "pending":
group.Pending, err = readXInfoStreamGroupPending(rd)
if err != nil {
return nil, err
}
case "consumers":
group.Consumers, err = readXInfoStreamConsumers(rd)
if err != nil {
return nil, err
}
default:
return nil, fmt.Errorf("redis: unexpected key %q in XINFO STREAM FULL reply", key)
}
}
groups = append(groups, group)
}
return groups, nil
}
func readXInfoStreamGroupPending(rd *proto.Reader) ([]XInfoStreamGroupPending, error) {
n, err := rd.ReadArrayLen()
if err != nil {
return nil, err
}
pending := make([]XInfoStreamGroupPending, 0, n)
for i := 0; i < n; i++ {
if err = rd.ReadFixedArrayLen(4); err != nil {
return nil, err
}
p := XInfoStreamGroupPending{}
p.ID, err = rd.ReadString()
if err != nil {
return nil, err
}
p.Consumer, err = rd.ReadString()
if err != nil {
return nil, err
}
delivery, err := rd.ReadInt()
if err != nil {
return nil, err
}
p.DeliveryTime = time.Unix(delivery/1000, delivery%1000*int64(time.Millisecond))
p.DeliveryCount, err = rd.ReadInt()
if err != nil {
return nil, err
}
pending = append(pending, p)
}
return pending, nil
}
func readXInfoStreamConsumers(rd *proto.Reader) ([]XInfoStreamConsumer, error) {
n, err := rd.ReadArrayLen()
if err != nil {
return nil, err
}
consumers := make([]XInfoStreamConsumer, 0, n)
for i := 0; i < n; i++ {
nn, err := rd.ReadMapLen()
if err != nil {
return nil, err
}
c := XInfoStreamConsumer{}
for f := 0; f < nn; f++ {
cKey, err := rd.ReadString()
if err != nil {
return nil, err
}
switch cKey {
case "name":
c.Name, err = rd.ReadString()
case "seen-time":
seen, err := rd.ReadInt()
if err != nil {
return nil, err
}
c.SeenTime = time.UnixMilli(seen)
case "active-time":
active, err := rd.ReadInt()
if err != nil {
return nil, err
}
c.ActiveTime = time.UnixMilli(active)
case "pel-count":
c.PelCount, err = rd.ReadInt()
case "pending":
pendingNumber, err := rd.ReadArrayLen()
if err != nil {
return nil, err
}
c.Pending = make([]XInfoStreamConsumerPending, 0, pendingNumber)
for pn := 0; pn < pendingNumber; pn++ {
if err = rd.ReadFixedArrayLen(3); err != nil {
return nil, err
}
p := XInfoStreamConsumerPending{}
p.ID, err = rd.ReadString()
if err != nil {
return nil, err
}
delivery, err := rd.ReadInt()
if err != nil {
return nil, err
}
p.DeliveryTime = time.Unix(delivery/1000, delivery%1000*int64(time.Millisecond))
p.DeliveryCount, err = rd.ReadInt()
if err != nil {
return nil, err
}
c.Pending = append(c.Pending, p)
}
default:
return nil, fmt.Errorf("redis: unexpected content %s "+
"in XINFO STREAM FULL reply", cKey)
}
if err != nil {
return nil, err
}
}
consumers = append(consumers, c)
}
return consumers, nil
}
func (cmd *XInfoStreamFullCmd) Clone() Cmder {
var val *XInfoStreamFull
if cmd.val != nil {
val = &XInfoStreamFull{
Length: cmd.val.Length,
RadixTreeKeys: cmd.val.RadixTreeKeys,
RadixTreeNodes: cmd.val.RadixTreeNodes,
LastGeneratedID: cmd.val.LastGeneratedID,
MaxDeletedEntryID: cmd.val.MaxDeletedEntryID,
EntriesAdded: cmd.val.EntriesAdded,
RecordedFirstEntryID: cmd.val.RecordedFirstEntryID,
}
// Clone Entries
if cmd.val.Entries != nil {
val.Entries = make([]XMessage, len(cmd.val.Entries))
for i, msg := range cmd.val.Entries {
val.Entries[i] = XMessage{
ID: msg.ID,
}
if msg.Values != nil {
val.Entries[i].Values = make(map[string]interface{}, len(msg.Values))
for k, v := range msg.Values {
val.Entries[i].Values[k] = v
}
}
}
}
// Clone Groups - simplified copy for now due to complexity
if cmd.val.Groups != nil {
val.Groups = make([]XInfoStreamGroup, len(cmd.val.Groups))
copy(val.Groups, cmd.val.Groups)
}
}
return &XInfoStreamFullCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type ZSliceCmd struct {
baseCmd
val []Z
}
var _ Cmder = (*ZSliceCmd)(nil)
func NewZSliceCmd(ctx context.Context, args ...interface{}) *ZSliceCmd {
return &ZSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeZSlice,
},
}
}
func (cmd *ZSliceCmd) SetVal(val []Z) {
cmd.val = val
}
func (cmd *ZSliceCmd) Val() []Z {
return cmd.val
}
func (cmd *ZSliceCmd) Result() ([]Z, error) {
return cmd.val, cmd.err
}
func (cmd *ZSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *ZSliceCmd) readReply(rd *proto.Reader) error { // nolint:dupl
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
// If the n is 0, can't continue reading.
if n == 0 {
cmd.val = make([]Z, 0)
return nil
}
typ, err := rd.PeekReplyType()
if err != nil {
return err
}
array := typ == proto.RespArray
if array {
cmd.val = make([]Z, n)
} else {
cmd.val = make([]Z, n/2)
}
for i := 0; i < len(cmd.val); i++ {
if array {
if err = rd.ReadFixedArrayLen(2); err != nil {
return err
}
}
if cmd.val[i].Member, err = rd.ReadString(); err != nil {
return err
}
if cmd.val[i].Score, err = rd.ReadFloat(); err != nil {
return err
}
}
return nil
}
func (cmd *ZSliceCmd) Clone() Cmder {
var val []Z
if cmd.val != nil {
val = make([]Z, len(cmd.val))
copy(val, cmd.val)
}
return &ZSliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type ZWithKeyCmd struct {
baseCmd
val *ZWithKey
}
var _ Cmder = (*ZWithKeyCmd)(nil)
func NewZWithKeyCmd(ctx context.Context, args ...interface{}) *ZWithKeyCmd {
return &ZWithKeyCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeZWithKey,
},
}
}
func (cmd *ZWithKeyCmd) SetVal(val *ZWithKey) {
cmd.val = val
}
func (cmd *ZWithKeyCmd) Val() *ZWithKey {
return cmd.val
}
func (cmd *ZWithKeyCmd) Result() (*ZWithKey, error) {
return cmd.val, cmd.err
}
func (cmd *ZWithKeyCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *ZWithKeyCmd) readReply(rd *proto.Reader) (err error) {
if err = rd.ReadFixedArrayLen(3); err != nil {
return err
}
cmd.val = &ZWithKey{}
if cmd.val.Key, err = rd.ReadString(); err != nil {
return err
}
if cmd.val.Member, err = rd.ReadString(); err != nil {
return err
}
if cmd.val.Score, err = rd.ReadFloat(); err != nil {
return err
}
return nil
}
func (cmd *ZWithKeyCmd) Clone() Cmder {
var val *ZWithKey
if cmd.val != nil {
val = &ZWithKey{
Z: Z{
Score: cmd.val.Score,
Member: cmd.val.Member,
},
Key: cmd.val.Key,
}
}
return &ZWithKeyCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type ScanCmd struct {
baseCmd
page []string
cursor uint64
process cmdable
}
var _ Cmder = (*ScanCmd)(nil)
func NewScanCmd(ctx context.Context, process cmdable, args ...interface{}) *ScanCmd {
return &ScanCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeScan,
},
process: process,
}
}
func (cmd *ScanCmd) SetVal(page []string, cursor uint64) {
cmd.page = page
cmd.cursor = cursor
}
func (cmd *ScanCmd) Val() (keys []string, cursor uint64) {
return cmd.page, cmd.cursor
}
func (cmd *ScanCmd) Result() (keys []string, cursor uint64, err error) {
return cmd.page, cmd.cursor, cmd.err
}
func (cmd *ScanCmd) String() string {
return cmdString(cmd, cmd.page)
}
func (cmd *ScanCmd) readReply(rd *proto.Reader) error {
if err := rd.ReadFixedArrayLen(2); err != nil {
return err
}
cursor, err := rd.ReadUint()
if err != nil {
return err
}
cmd.cursor = cursor
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.page = make([]string, n)
for i := 0; i < len(cmd.page); i++ {
if cmd.page[i], err = rd.ReadString(); err != nil {
return err
}
}
return nil
}
func (cmd *ScanCmd) Clone() Cmder {
var page []string
if cmd.page != nil {
page = make([]string, len(cmd.page))
copy(page, cmd.page)
}
return &ScanCmd{
baseCmd: cmd.cloneBaseCmd(),
page: page,
cursor: cmd.cursor,
process: cmd.process,
}
}
// Iterator creates a new ScanIterator.
func (cmd *ScanCmd) Iterator() *ScanIterator {
return &ScanIterator{
cmd: cmd,
}
}
//------------------------------------------------------------------------------
type ClusterNode struct {
ID string
Addr string
NetworkingMetadata map[string]string
}
type ClusterSlot struct {
Start int
End int
Nodes []ClusterNode
}
type ClusterSlotsCmd struct {
baseCmd
val []ClusterSlot
}
var _ Cmder = (*ClusterSlotsCmd)(nil)
func NewClusterSlotsCmd(ctx context.Context, args ...interface{}) *ClusterSlotsCmd {
return &ClusterSlotsCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeClusterSlots,
},
}
}
func (cmd *ClusterSlotsCmd) SetVal(val []ClusterSlot) {
cmd.val = val
}
func (cmd *ClusterSlotsCmd) Val() []ClusterSlot {
return cmd.val
}
func (cmd *ClusterSlotsCmd) Result() ([]ClusterSlot, error) {
return cmd.val, cmd.err
}
func (cmd *ClusterSlotsCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *ClusterSlotsCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]ClusterSlot, n)
for i := 0; i < len(cmd.val); i++ {
n, err = rd.ReadArrayLen()
if err != nil {
return err
}
if n < 2 {
return fmt.Errorf("redis: got %d elements in cluster info, expected at least 2", n)
}
start, err := rd.ReadInt()
if err != nil {
return err
}
end, err := rd.ReadInt()
if err != nil {
return err
}
// subtract start and end.
nodes := make([]ClusterNode, n-2)
for j := 0; j < len(nodes); j++ {
nn, err := rd.ReadArrayLen()
if err != nil {
return err
}
if nn < 2 || nn > 4 {
return fmt.Errorf("got %d elements in cluster info address, expected 2, 3, or 4", n)
}
ip, err := rd.ReadString()
if err != nil {
return err
}
port, err := rd.ReadString()
if err != nil {
return err
}
nodes[j].Addr = net.JoinHostPort(ip, port)
if nn >= 3 {
id, err := rd.ReadString()
if err != nil {
return err
}
nodes[j].ID = id
}
if nn >= 4 {
metadataLength, err := rd.ReadMapLen()
if err != nil {
return err
}
networkingMetadata := make(map[string]string, metadataLength)
for i := 0; i < metadataLength; i++ {
key, err := rd.ReadString()
if err != nil {
return err
}
value, err := rd.ReadString()
if err != nil {
return err
}
networkingMetadata[key] = value
}
nodes[j].NetworkingMetadata = networkingMetadata
}
}
cmd.val[i] = ClusterSlot{
Start: int(start),
End: int(end),
Nodes: nodes,
}
}
return nil
}
func (cmd *ClusterSlotsCmd) Clone() Cmder {
var val []ClusterSlot
if cmd.val != nil {
val = make([]ClusterSlot, len(cmd.val))
for i, slot := range cmd.val {
val[i] = ClusterSlot{
Start: slot.Start,
End: slot.End,
}
if slot.Nodes != nil {
val[i].Nodes = make([]ClusterNode, len(slot.Nodes))
for j, node := range slot.Nodes {
val[i].Nodes[j] = ClusterNode{
ID: node.ID,
Addr: node.Addr,
}
if node.NetworkingMetadata != nil {
val[i].Nodes[j].NetworkingMetadata = make(map[string]string, len(node.NetworkingMetadata))
for k, v := range node.NetworkingMetadata {
val[i].Nodes[j].NetworkingMetadata[k] = v
}
}
}
}
}
}
return &ClusterSlotsCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
// GeoLocation is used with GeoAdd to add geospatial location.
type GeoLocation struct {
Name string
Longitude, Latitude, Dist float64
GeoHash int64
}
// GeoRadiusQuery is used with GeoRadius to query geospatial index.
type GeoRadiusQuery struct {
Radius float64
// Can be m, km, ft, or mi. Default is km.
Unit string
WithCoord bool
WithDist bool
WithGeoHash bool
Count int
// Can be ASC or DESC. Default is no sort order.
Sort string
Store string
StoreDist string
// WithCoord+WithDist+WithGeoHash
withLen int
}
type GeoLocationCmd struct {
baseCmd
q *GeoRadiusQuery
locations []GeoLocation
}
var _ Cmder = (*GeoLocationCmd)(nil)
func NewGeoLocationCmd(ctx context.Context, q *GeoRadiusQuery, args ...interface{}) *GeoLocationCmd {
return &GeoLocationCmd{
baseCmd: baseCmd{
ctx: ctx,
args: geoLocationArgs(q, args...),
cmdType: CmdTypeGeoLocation,
},
q: q,
}
}
func geoLocationArgs(q *GeoRadiusQuery, args ...interface{}) []interface{} {
args = append(args, q.Radius)
if q.Unit != "" {
args = append(args, q.Unit)
} else {
args = append(args, "km")
}
if q.WithCoord {
args = append(args, "withcoord")
q.withLen++
}
if q.WithDist {
args = append(args, "withdist")
q.withLen++
}
if q.WithGeoHash {
args = append(args, "withhash")
q.withLen++
}
if q.Count > 0 {
args = append(args, "count", q.Count)
}
if q.Sort != "" {
args = append(args, q.Sort)
}
if q.Store != "" {
args = append(args, "store")
args = append(args, q.Store)
}
if q.StoreDist != "" {
args = append(args, "storedist")
args = append(args, q.StoreDist)
}
return args
}
func (cmd *GeoLocationCmd) SetVal(locations []GeoLocation) {
cmd.locations = locations
}
func (cmd *GeoLocationCmd) Val() []GeoLocation {
return cmd.locations
}
func (cmd *GeoLocationCmd) Result() ([]GeoLocation, error) {
return cmd.locations, cmd.err
}
func (cmd *GeoLocationCmd) String() string {
return cmdString(cmd, cmd.locations)
}
func (cmd *GeoLocationCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.locations = make([]GeoLocation, n)
for i := 0; i < len(cmd.locations); i++ {
// only name
if cmd.q.withLen == 0 {
if cmd.locations[i].Name, err = rd.ReadString(); err != nil {
return err
}
continue
}
// +name
if err = rd.ReadFixedArrayLen(cmd.q.withLen + 1); err != nil {
return err
}
if cmd.locations[i].Name, err = rd.ReadString(); err != nil {
return err
}
if cmd.q.WithDist {
if cmd.locations[i].Dist, err = rd.ReadFloat(); err != nil {
return err
}
}
if cmd.q.WithGeoHash {
if cmd.locations[i].GeoHash, err = rd.ReadInt(); err != nil {
return err
}
}
if cmd.q.WithCoord {
if err = rd.ReadFixedArrayLen(2); err != nil {
return err
}
if cmd.locations[i].Longitude, err = rd.ReadFloat(); err != nil {
return err
}
if cmd.locations[i].Latitude, err = rd.ReadFloat(); err != nil {
return err
}
}
}
return nil
}
func (cmd *GeoLocationCmd) Clone() Cmder {
var q *GeoRadiusQuery
if cmd.q != nil {
q = &GeoRadiusQuery{
Radius: cmd.q.Radius,
Unit: cmd.q.Unit,
WithCoord: cmd.q.WithCoord,
WithDist: cmd.q.WithDist,
WithGeoHash: cmd.q.WithGeoHash,
Count: cmd.q.Count,
Sort: cmd.q.Sort,
Store: cmd.q.Store,
StoreDist: cmd.q.StoreDist,
withLen: cmd.q.withLen,
}
}
var locations []GeoLocation
if cmd.locations != nil {
locations = make([]GeoLocation, len(cmd.locations))
copy(locations, cmd.locations)
}
return &GeoLocationCmd{
baseCmd: cmd.cloneBaseCmd(),
q: q,
locations: locations,
}
}
//------------------------------------------------------------------------------
// GeoSearchQuery is used for GEOSearch/GEOSearchStore command query.
type GeoSearchQuery struct {
Member string
// Latitude and Longitude when using FromLonLat option.
Longitude float64
Latitude float64
// Distance and unit when using ByRadius option.
// Can use m, km, ft, or mi. Default is km.
Radius float64
RadiusUnit string
// Height, width and unit when using ByBox option.
// Can be m, km, ft, or mi. Default is km.
BoxWidth float64
BoxHeight float64
BoxUnit string
// Can be ASC or DESC. Default is no sort order.
Sort string
Count int
CountAny bool
}
type GeoSearchLocationQuery struct {
GeoSearchQuery
WithCoord bool
WithDist bool
WithHash bool
}
type GeoSearchStoreQuery struct {
GeoSearchQuery
// When using the StoreDist option, the command stores the items in a
// sorted set populated with their distance from the center of the circle or box,
// as a floating-point number, in the same unit specified for that shape.
StoreDist bool
}
func geoSearchLocationArgs(q *GeoSearchLocationQuery, args []interface{}) []interface{} {
args = geoSearchArgs(&q.GeoSearchQuery, args)
if q.WithCoord {
args = append(args, "withcoord")
}
if q.WithDist {
args = append(args, "withdist")
}
if q.WithHash {
args = append(args, "withhash")
}
return args
}
func geoSearchArgs(q *GeoSearchQuery, args []interface{}) []interface{} {
if q.Member != "" {
args = append(args, "frommember", q.Member)
} else {
args = append(args, "fromlonlat", q.Longitude, q.Latitude)
}
if q.Radius > 0 {
if q.RadiusUnit == "" {
q.RadiusUnit = "km"
}
args = append(args, "byradius", q.Radius, q.RadiusUnit)
} else {
if q.BoxUnit == "" {
q.BoxUnit = "km"
}
args = append(args, "bybox", q.BoxWidth, q.BoxHeight, q.BoxUnit)
}
if q.Sort != "" {
args = append(args, q.Sort)
}
if q.Count > 0 {
args = append(args, "count", q.Count)
if q.CountAny {
args = append(args, "any")
}
}
return args
}
type GeoSearchLocationCmd struct {
baseCmd
opt *GeoSearchLocationQuery
val []GeoLocation
}
var _ Cmder = (*GeoSearchLocationCmd)(nil)
func NewGeoSearchLocationCmd(
ctx context.Context, opt *GeoSearchLocationQuery, args ...interface{},
) *GeoSearchLocationCmd {
return &GeoSearchLocationCmd{
baseCmd: baseCmd{
ctx: ctx,
args: geoSearchLocationArgs(opt, args),
cmdType: CmdTypeGeoSearchLocation,
},
opt: opt,
}
}
func (cmd *GeoSearchLocationCmd) SetVal(val []GeoLocation) {
cmd.val = val
}
func (cmd *GeoSearchLocationCmd) Val() []GeoLocation {
return cmd.val
}
func (cmd *GeoSearchLocationCmd) Result() ([]GeoLocation, error) {
return cmd.val, cmd.err
}
func (cmd *GeoSearchLocationCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *GeoSearchLocationCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]GeoLocation, n)
for i := 0; i < n; i++ {
_, err = rd.ReadArrayLen()
if err != nil {
return err
}
var loc GeoLocation
loc.Name, err = rd.ReadString()
if err != nil {
return err
}
if cmd.opt.WithDist {
loc.Dist, err = rd.ReadFloat()
if err != nil {
return err
}
}
if cmd.opt.WithHash {
loc.GeoHash, err = rd.ReadInt()
if err != nil {
return err
}
}
if cmd.opt.WithCoord {
if err = rd.ReadFixedArrayLen(2); err != nil {
return err
}
loc.Longitude, err = rd.ReadFloat()
if err != nil {
return err
}
loc.Latitude, err = rd.ReadFloat()
if err != nil {
return err
}
}
cmd.val[i] = loc
}
return nil
}
func (cmd *GeoSearchLocationCmd) Clone() Cmder {
var opt *GeoSearchLocationQuery
if cmd.opt != nil {
opt = &GeoSearchLocationQuery{
GeoSearchQuery: GeoSearchQuery{
Member: cmd.opt.Member,
Longitude: cmd.opt.Longitude,
Latitude: cmd.opt.Latitude,
Radius: cmd.opt.Radius,
RadiusUnit: cmd.opt.RadiusUnit,
BoxWidth: cmd.opt.BoxWidth,
BoxHeight: cmd.opt.BoxHeight,
BoxUnit: cmd.opt.BoxUnit,
Sort: cmd.opt.Sort,
Count: cmd.opt.Count,
CountAny: cmd.opt.CountAny,
},
WithCoord: cmd.opt.WithCoord,
WithDist: cmd.opt.WithDist,
WithHash: cmd.opt.WithHash,
}
}
var val []GeoLocation
if cmd.val != nil {
val = make([]GeoLocation, len(cmd.val))
copy(val, cmd.val)
}
return &GeoSearchLocationCmd{
baseCmd: cmd.cloneBaseCmd(),
opt: opt,
val: val,
}
}
//------------------------------------------------------------------------------
type GeoPos struct {
Longitude, Latitude float64
}
type GeoPosCmd struct {
baseCmd
val []*GeoPos
}
var _ Cmder = (*GeoPosCmd)(nil)
func NewGeoPosCmd(ctx context.Context, args ...interface{}) *GeoPosCmd {
return &GeoPosCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeGeoPos,
},
}
}
func (cmd *GeoPosCmd) SetVal(val []*GeoPos) {
cmd.val = val
}
func (cmd *GeoPosCmd) Val() []*GeoPos {
return cmd.val
}
func (cmd *GeoPosCmd) Result() ([]*GeoPos, error) {
return cmd.val, cmd.err
}
func (cmd *GeoPosCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *GeoPosCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]*GeoPos, n)
for i := 0; i < len(cmd.val); i++ {
err = rd.ReadFixedArrayLen(2)
if err != nil {
if err == Nil {
cmd.val[i] = nil
continue
}
return err
}
longitude, err := rd.ReadFloat()
if err != nil {
return err
}
latitude, err := rd.ReadFloat()
if err != nil {
return err
}
cmd.val[i] = &GeoPos{
Longitude: longitude,
Latitude: latitude,
}
}
return nil
}
func (cmd *GeoPosCmd) Clone() Cmder {
var val []*GeoPos
if cmd.val != nil {
val = make([]*GeoPos, len(cmd.val))
for i, pos := range cmd.val {
if pos != nil {
val[i] = &GeoPos{
Longitude: pos.Longitude,
Latitude: pos.Latitude,
}
}
}
}
return &GeoPosCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type CommandInfo struct {
Name string
Arity int8
Flags []string
ACLFlags []string
FirstKeyPos int8
LastKeyPos int8
StepCount int8
ReadOnly bool
CommandPolicy *routing.CommandPolicy
}
type CommandsInfoCmd struct {
baseCmd
val map[string]*CommandInfo
}
var _ Cmder = (*CommandsInfoCmd)(nil)
func NewCommandsInfoCmd(ctx context.Context, args ...interface{}) *CommandsInfoCmd {
return &CommandsInfoCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeCommandsInfo,
},
}
}
func (cmd *CommandsInfoCmd) SetVal(val map[string]*CommandInfo) {
cmd.val = val
}
func (cmd *CommandsInfoCmd) Val() map[string]*CommandInfo {
return cmd.val
}
func (cmd *CommandsInfoCmd) Result() (map[string]*CommandInfo, error) {
return cmd.val, cmd.err
}
func (cmd *CommandsInfoCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *CommandsInfoCmd) readReply(rd *proto.Reader) error {
const numArgRedis5 = 6
const numArgRedis6 = 7
const numArgRedis7 = 10 // Also matches redis 8
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make(map[string]*CommandInfo, n)
for i := 0; i < n; i++ {
nn, err := rd.ReadArrayLen()
if err != nil {
return err
}
switch nn {
case numArgRedis5, numArgRedis6, numArgRedis7:
// ok
default:
return fmt.Errorf("redis: got %d elements in COMMAND reply, wanted 6/7/10", nn)
}
cmdInfo := &CommandInfo{}
if cmdInfo.Name, err = rd.ReadString(); err != nil {
return err
}
arity, err := rd.ReadInt()
if err != nil {
return err
}
cmdInfo.Arity = int8(arity)
flagLen, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmdInfo.Flags = make([]string, flagLen)
for f := 0; f < len(cmdInfo.Flags); f++ {
switch s, err := rd.ReadString(); {
case err == Nil:
cmdInfo.Flags[f] = ""
case err != nil:
return err
default:
if !cmdInfo.ReadOnly && s == "readonly" {
cmdInfo.ReadOnly = true
}
cmdInfo.Flags[f] = s
}
}
firstKeyPos, err := rd.ReadInt()
if err != nil {
return err
}
cmdInfo.FirstKeyPos = int8(firstKeyPos)
lastKeyPos, err := rd.ReadInt()
if err != nil {
return err
}
cmdInfo.LastKeyPos = int8(lastKeyPos)
stepCount, err := rd.ReadInt()
if err != nil {
return err
}
cmdInfo.StepCount = int8(stepCount)
if nn >= numArgRedis6 {
aclFlagLen, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmdInfo.ACLFlags = make([]string, aclFlagLen)
for f := 0; f < len(cmdInfo.ACLFlags); f++ {
switch s, err := rd.ReadString(); {
case err == Nil:
cmdInfo.ACLFlags[f] = ""
case err != nil:
return err
default:
cmdInfo.ACLFlags[f] = s
}
}
}
if nn >= numArgRedis7 {
// The 8th argument is an array of tips.
tipsLen, err := rd.ReadArrayLen()
if err != nil {
return err
}
rawTips := make(map[string]string, tipsLen)
if cmdInfo.ReadOnly {
rawTips[routing.ReadOnlyCMD] = ""
}
for f := 0; f < tipsLen; f++ {
tip, err := rd.ReadString()
if err != nil {
return err
}
k, v, ok := strings.Cut(tip, ":")
if !ok {
// Handle tips that don't have a colon (like "nondeterministic_output")
rawTips[tip] = ""
} else {
// Handle normal key:value tips
rawTips[k] = v
}
}
cmdInfo.CommandPolicy = parseCommandPolicies(rawTips, cmdInfo.FirstKeyPos)
if err := rd.DiscardNext(); err != nil {
return err
}
if err := rd.DiscardNext(); err != nil {
return err
}
}
cmd.val[cmdInfo.Name] = cmdInfo
}
return nil
}
func (cmd *CommandsInfoCmd) Clone() Cmder {
var val map[string]*CommandInfo
if cmd.val != nil {
val = make(map[string]*CommandInfo, len(cmd.val))
for k, v := range cmd.val {
if v != nil {
newInfo := &CommandInfo{
Name: v.Name,
Arity: v.Arity,
FirstKeyPos: v.FirstKeyPos,
LastKeyPos: v.LastKeyPos,
StepCount: v.StepCount,
ReadOnly: v.ReadOnly,
CommandPolicy: v.CommandPolicy, // CommandPolicy can be shared as it's immutable
}
if v.Flags != nil {
newInfo.Flags = make([]string, len(v.Flags))
copy(newInfo.Flags, v.Flags)
}
if v.ACLFlags != nil {
newInfo.ACLFlags = make([]string, len(v.ACLFlags))
copy(newInfo.ACLFlags, v.ACLFlags)
}
val[k] = newInfo
}
}
}
return &CommandsInfoCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type cmdsInfoCache struct {
fn func(ctx context.Context) (map[string]*CommandInfo, error)
once internal.Once
refreshLock sync.Mutex
cmds map[string]*CommandInfo
}
func newCmdsInfoCache(fn func(ctx context.Context) (map[string]*CommandInfo, error)) *cmdsInfoCache {
return &cmdsInfoCache{
fn: fn,
}
}
func (c *cmdsInfoCache) Get(ctx context.Context) (map[string]*CommandInfo, error) {
c.refreshLock.Lock()
defer c.refreshLock.Unlock()
err := c.once.Do(func() error {
cmds, err := c.fn(ctx)
if err != nil {
return err
}
lowerCmds := make(map[string]*CommandInfo, len(cmds))
// Extensions have cmd names in upper case. Convert them to lower case.
for k, v := range cmds {
lowerCmds[internal.ToLower(k)] = v
}
c.cmds = lowerCmds
return nil
})
return c.cmds, err
}
func (c *cmdsInfoCache) Refresh() {
c.refreshLock.Lock()
defer c.refreshLock.Unlock()
c.once = internal.Once{}
}
// ------------------------------------------------------------------------------
const requestPolicy = "request_policy"
const responsePolicy = "response_policy"
func parseCommandPolicies(commandInfoTips map[string]string, firstKeyPos int8) *routing.CommandPolicy {
req := routing.ReqDefault
resp := routing.RespDefaultKeyless
if firstKeyPos > 0 {
resp = routing.RespDefaultHashSlot
}
tips := make(map[string]string, len(commandInfoTips))
for k, v := range commandInfoTips {
if k == requestPolicy {
if p, err := routing.ParseRequestPolicy(v); err == nil {
req = p
}
continue
}
if k == responsePolicy {
if p, err := routing.ParseResponsePolicy(v); err == nil {
resp = p
}
continue
}
tips[k] = v
}
return &routing.CommandPolicy{Request: req, Response: resp, Tips: tips}
}
//------------------------------------------------------------------------------
type SlowLog struct {
ID int64
Time time.Time
Duration time.Duration
Args []string
// These are also optional fields emitted only by Redis 4.0 or greater:
// https://redis.io/commands/slowlog#output-format
ClientAddr string
ClientName string
}
type SlowLogCmd struct {
baseCmd
val []SlowLog
}
var _ Cmder = (*SlowLogCmd)(nil)
func NewSlowLogCmd(ctx context.Context, args ...interface{}) *SlowLogCmd {
return &SlowLogCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeSlowLog,
},
}
}
func (cmd *SlowLogCmd) SetVal(val []SlowLog) {
cmd.val = val
}
func (cmd *SlowLogCmd) Val() []SlowLog {
return cmd.val
}
func (cmd *SlowLogCmd) Result() ([]SlowLog, error) {
return cmd.val, cmd.err
}
func (cmd *SlowLogCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *SlowLogCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]SlowLog, n)
for i := 0; i < len(cmd.val); i++ {
nn, err := rd.ReadArrayLen()
if err != nil {
return err
}
if nn < 4 {
return fmt.Errorf("redis: got %d elements in slowlog get, expected at least 4", nn)
}
if cmd.val[i].ID, err = rd.ReadInt(); err != nil {
return err
}
createdAt, err := rd.ReadInt()
if err != nil {
return err
}
cmd.val[i].Time = time.Unix(createdAt, 0)
costs, err := rd.ReadInt()
if err != nil {
return err
}
cmd.val[i].Duration = time.Duration(costs) * time.Microsecond
cmdLen, err := rd.ReadArrayLen()
if err != nil {
return err
}
if cmdLen < 1 {
return fmt.Errorf("redis: got %d elements commands reply in slowlog get, expected at least 1", cmdLen)
}
cmd.val[i].Args = make([]string, cmdLen)
for f := 0; f < len(cmd.val[i].Args); f++ {
cmd.val[i].Args[f], err = rd.ReadString()
if err != nil {
return err
}
}
if nn >= 5 {
if cmd.val[i].ClientAddr, err = rd.ReadString(); err != nil {
return err
}
}
if nn >= 6 {
if cmd.val[i].ClientName, err = rd.ReadString(); err != nil {
return err
}
}
}
return nil
}
func (cmd *SlowLogCmd) Clone() Cmder {
var val []SlowLog
if cmd.val != nil {
val = make([]SlowLog, len(cmd.val))
for i, log := range cmd.val {
val[i] = SlowLog{
ID: log.ID,
Time: log.Time,
Duration: log.Duration,
ClientAddr: log.ClientAddr,
ClientName: log.ClientName,
}
if log.Args != nil {
val[i].Args = make([]string, len(log.Args))
copy(val[i].Args, log.Args)
}
}
}
return &SlowLogCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//-----------------------------------------------------------------------
type Latency struct {
Name string
Time time.Time
Latest time.Duration
Max time.Duration
}
type LatencyCmd struct {
baseCmd
val []Latency
}
var _ Cmder = (*LatencyCmd)(nil)
func NewLatencyCmd(ctx context.Context, args ...interface{}) *LatencyCmd {
return &LatencyCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
},
}
}
func (cmd *LatencyCmd) SetVal(val []Latency) {
cmd.val = val
}
func (cmd *LatencyCmd) Val() []Latency {
return cmd.val
}
func (cmd *LatencyCmd) Result() ([]Latency, error) {
return cmd.val, cmd.err
}
func (cmd *LatencyCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *LatencyCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]Latency, n)
for i := 0; i < len(cmd.val); i++ {
nn, err := rd.ReadArrayLen()
if err != nil {
return err
}
if nn < 3 {
return fmt.Errorf("redis: got %d elements in latency get, expected at least 3", nn)
}
if cmd.val[i].Name, err = rd.ReadString(); err != nil {
return err
}
createdAt, err := rd.ReadInt()
if err != nil {
return err
}
cmd.val[i].Time = time.Unix(createdAt, 0)
latest, err := rd.ReadInt()
if err != nil {
return err
}
cmd.val[i].Latest = time.Duration(latest) * time.Millisecond
maximum, err := rd.ReadInt()
if err != nil {
return err
}
cmd.val[i].Max = time.Duration(maximum) * time.Millisecond
}
return nil
}
func (cmd *LatencyCmd) Clone() Cmder {
var val []Latency
if cmd.val != nil {
val = make([]Latency, len(cmd.val))
copy(val, cmd.val)
}
return &LatencyCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//-----------------------------------------------------------------------
// HotKeysSlotRange represents a slot or slot range in the response.
// Single element slice = individual slot, two element slice = slot range [start, end].
type HotKeysSlotRange []int64
// HotKeysKeyEntry represents a hot key entry with its metric value.
type HotKeysKeyEntry struct {
Key string
Value interface{} // Can be int64 or string
}
// HotKeysResult represents the response data from HOTKEYS GET command.
// Field names match the Redis response format.
type HotKeysResult struct {
TrackingActive bool
SampleRatio uint8
SelectedSlots []HotKeysSlotRange
SampledCommandsSelectedSlots time.Duration // Present when sample-ratio > 1 and selected-slots is not empty
AllCommandsSelectedSlots time.Duration // Present when selected-slots is not empty
AllCommandsAllSlots time.Duration
NetBytesSampledCommandsSelectedSlots int64 // Present when sample-ratio > 1 and selected-slots is not empty
NetBytesAllCommandsSelectedSlots int64 // Present when selected-slots is not empty
NetBytesAllCommandsAllSlots int64
CollectionStartTime time.Time
CollectionDuration time.Duration
UsedCPUSys time.Duration
UsedCPUUser time.Duration
TotalNetBytes int64
ByCPUTime []HotKeysKeyEntry
ByNetBytes []HotKeysKeyEntry
}
type HotKeysCmd struct {
baseCmd
val *HotKeysResult
}
var _ Cmder = (*HotKeysCmd)(nil)
func NewHotKeysCmd(ctx context.Context, args ...interface{}) *HotKeysCmd {
return &HotKeysCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeHotKeys,
},
}
}
func (cmd *HotKeysCmd) SetVal(val *HotKeysResult) {
cmd.val = val
}
func (cmd *HotKeysCmd) Val() *HotKeysResult {
return cmd.val
}
func (cmd *HotKeysCmd) Result() (*HotKeysResult, error) {
return cmd.val, cmd.err
}
func (cmd *HotKeysCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *HotKeysCmd) readReply(rd *proto.Reader) error {
// HOTKEYS GET response is wrapped in an array for aggregation support
arrayLen, err := rd.ReadArrayLen()
if err != nil {
return err
}
if arrayLen == 0 {
// Empty array means no tracking was started or after reset
cmd.val = nil
return nil
}
// Read the first (and typically only) element which is a map
n, err := rd.ReadMapLen()
if err != nil {
return err
}
result := &HotKeysResult{}
data := make(map[string]interface{}, n)
for i := 0; i < n; i++ {
k, err := rd.ReadString()
if err != nil {
return err
}
v, err := rd.ReadReply()
if err != nil {
if err == Nil {
data[k] = Nil
continue
}
if err, ok := err.(proto.RedisError); ok {
data[k] = err
continue
}
return err
}
data[k] = v
}
if v, ok := data["tracking-active"].(int64); ok {
result.TrackingActive = v == 1
}
if v, ok := data["sample-ratio"].(int64); ok {
result.SampleRatio = uint8(v)
}
if v, ok := data["selected-slots"].([]interface{}); ok {
result.SelectedSlots = make([]HotKeysSlotRange, 0, len(v))
for _, slot := range v {
switch s := slot.(type) {
case int64:
// Single slot
result.SelectedSlots = append(result.SelectedSlots, HotKeysSlotRange{s})
case []interface{}:
// Slot range
slotRange := make(HotKeysSlotRange, 0, len(s))
for _, sr := range s {
if val, ok := sr.(int64); ok {
slotRange = append(slotRange, val)
}
}
result.SelectedSlots = append(result.SelectedSlots, slotRange)
}
}
}
if v, ok := data["sampled-commands-selected-slots-us"].(int64); ok {
result.SampledCommandsSelectedSlots = time.Duration(v) * time.Microsecond
}
if v, ok := data["all-commands-selected-slots-us"].(int64); ok {
result.AllCommandsSelectedSlots = time.Duration(v) * time.Microsecond
}
if v, ok := data["all-commands-all-slots-us"].(int64); ok {
result.AllCommandsAllSlots = time.Duration(v) * time.Microsecond
}
if v, ok := data["net-bytes-sampled-commands-selected-slots"].(int64); ok {
result.NetBytesSampledCommandsSelectedSlots = v
}
if v, ok := data["net-bytes-all-commands-selected-slots"].(int64); ok {
result.NetBytesAllCommandsSelectedSlots = v
}
if v, ok := data["net-bytes-all-commands-all-slots"].(int64); ok {
result.NetBytesAllCommandsAllSlots = v
}
if v, ok := data["collection-start-time-unix-ms"].(int64); ok {
result.CollectionStartTime = time.UnixMilli(v)
}
if v, ok := data["collection-duration-ms"].(int64); ok {
result.CollectionDuration = time.Duration(v) * time.Millisecond
}
if v, ok := data["used-cpu-sys-ms"].(int64); ok {
result.UsedCPUSys = time.Duration(v) * time.Millisecond
}
if v, ok := data["used-cpu-user-ms"].(int64); ok {
result.UsedCPUUser = time.Duration(v) * time.Millisecond
}
if v, ok := data["total-net-bytes"].(int64); ok {
result.TotalNetBytes = v
}
if v, ok := data["by-cpu-time-us"].([]interface{}); ok {
result.ByCPUTime = parseHotKeysKeyEntries(v)
}
if v, ok := data["by-net-bytes"].([]interface{}); ok {
result.ByNetBytes = parseHotKeysKeyEntries(v)
}
cmd.val = result
return nil
}
// parseHotKeysKeyEntries parses the key-value pairs from HOTKEYS GET response.
func parseHotKeysKeyEntries(v []interface{}) []HotKeysKeyEntry {
entries := make([]HotKeysKeyEntry, 0, len(v)/2)
for i := 0; i < len(v); i += 2 {
if i+1 < len(v) {
key, keyOk := v[i].(string)
if keyOk {
entries = append(entries, HotKeysKeyEntry{
Key: key,
Value: v[i+1], // Can be int64 or string
})
}
}
}
return entries
}
func (cmd *HotKeysCmd) Clone() Cmder {
var val *HotKeysResult
if cmd.val != nil {
val = &HotKeysResult{
TrackingActive: cmd.val.TrackingActive,
SampleRatio: cmd.val.SampleRatio,
SampledCommandsSelectedSlots: cmd.val.SampledCommandsSelectedSlots,
AllCommandsSelectedSlots: cmd.val.AllCommandsSelectedSlots,
AllCommandsAllSlots: cmd.val.AllCommandsAllSlots,
NetBytesSampledCommandsSelectedSlots: cmd.val.NetBytesSampledCommandsSelectedSlots,
NetBytesAllCommandsSelectedSlots: cmd.val.NetBytesAllCommandsSelectedSlots,
NetBytesAllCommandsAllSlots: cmd.val.NetBytesAllCommandsAllSlots,
CollectionStartTime: cmd.val.CollectionStartTime,
CollectionDuration: cmd.val.CollectionDuration,
UsedCPUSys: cmd.val.UsedCPUSys,
UsedCPUUser: cmd.val.UsedCPUUser,
TotalNetBytes: cmd.val.TotalNetBytes,
}
if cmd.val.SelectedSlots != nil {
val.SelectedSlots = make([]HotKeysSlotRange, len(cmd.val.SelectedSlots))
for i, sr := range cmd.val.SelectedSlots {
val.SelectedSlots[i] = make(HotKeysSlotRange, len(sr))
copy(val.SelectedSlots[i], sr)
}
}
if cmd.val.ByCPUTime != nil {
val.ByCPUTime = make([]HotKeysKeyEntry, len(cmd.val.ByCPUTime))
copy(val.ByCPUTime, cmd.val.ByCPUTime)
}
if cmd.val.ByNetBytes != nil {
val.ByNetBytes = make([]HotKeysKeyEntry, len(cmd.val.ByNetBytes))
copy(val.ByNetBytes, cmd.val.ByNetBytes)
}
}
return &HotKeysCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//-----------------------------------------------------------------------
type MapStringInterfaceCmd struct {
baseCmd
val map[string]interface{}
}
var _ Cmder = (*MapStringInterfaceCmd)(nil)
func NewMapStringInterfaceCmd(ctx context.Context, args ...interface{}) *MapStringInterfaceCmd {
return &MapStringInterfaceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeMapStringInterface,
},
}
}
func (cmd *MapStringInterfaceCmd) SetVal(val map[string]interface{}) {
cmd.val = val
}
func (cmd *MapStringInterfaceCmd) Val() map[string]interface{} {
return cmd.val
}
func (cmd *MapStringInterfaceCmd) Result() (map[string]interface{}, error) {
return cmd.val, cmd.err
}
func (cmd *MapStringInterfaceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *MapStringInterfaceCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
cmd.val = make(map[string]interface{}, n)
for i := 0; i < n; i++ {
k, err := rd.ReadString()
if err != nil {
return err
}
v, err := rd.ReadReply()
if err != nil {
if err == Nil {
cmd.val[k] = Nil
continue
}
if err, ok := err.(proto.RedisError); ok {
cmd.val[k] = err
continue
}
return err
}
cmd.val[k] = v
}
return nil
}
func (cmd *MapStringInterfaceCmd) Clone() Cmder {
var val map[string]interface{}
if cmd.val != nil {
val = make(map[string]interface{}, len(cmd.val))
for k, v := range cmd.val {
val[k] = v
}
}
return &MapStringInterfaceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//-----------------------------------------------------------------------
type MapStringStringSliceCmd struct {
baseCmd
val []map[string]string
}
var _ Cmder = (*MapStringStringSliceCmd)(nil)
func NewMapStringStringSliceCmd(ctx context.Context, args ...interface{}) *MapStringStringSliceCmd {
return &MapStringStringSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeMapStringStringSlice,
},
}
}
func (cmd *MapStringStringSliceCmd) SetVal(val []map[string]string) {
cmd.val = val
}
func (cmd *MapStringStringSliceCmd) Val() []map[string]string {
return cmd.val
}
func (cmd *MapStringStringSliceCmd) Result() ([]map[string]string, error) {
return cmd.val, cmd.err
}
func (cmd *MapStringStringSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *MapStringStringSliceCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]map[string]string, n)
for i := 0; i < n; i++ {
nn, err := rd.ReadMapLen()
if err != nil {
return err
}
cmd.val[i] = make(map[string]string, nn)
for f := 0; f < nn; f++ {
k, err := rd.ReadString()
if err != nil {
return err
}
v, err := rd.ReadString()
if err != nil {
return err
}
cmd.val[i][k] = v
}
}
return nil
}
func (cmd *MapStringStringSliceCmd) Clone() Cmder {
var val []map[string]string
if cmd.val != nil {
val = make([]map[string]string, len(cmd.val))
for i, m := range cmd.val {
if m != nil {
val[i] = make(map[string]string, len(m))
for k, v := range m {
val[i][k] = v
}
}
}
}
return &MapStringStringSliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
// -----------------------------------------------------------------------
// MapMapStringInterfaceCmd represents a command that returns a map of strings to interface{}.
type MapMapStringInterfaceCmd struct {
baseCmd
val map[string]interface{}
}
func NewMapMapStringInterfaceCmd(ctx context.Context, args ...interface{}) *MapMapStringInterfaceCmd {
return &MapMapStringInterfaceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeMapMapStringInterface,
},
}
}
func (cmd *MapMapStringInterfaceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *MapMapStringInterfaceCmd) SetVal(val map[string]interface{}) {
cmd.val = val
}
func (cmd *MapMapStringInterfaceCmd) Result() (map[string]interface{}, error) {
return cmd.val, cmd.err
}
func (cmd *MapMapStringInterfaceCmd) Val() map[string]interface{} {
return cmd.val
}
// readReply will try to parse the reply from the proto.Reader for both resp2 and resp3
func (cmd *MapMapStringInterfaceCmd) readReply(rd *proto.Reader) (err error) {
data, err := rd.ReadReply()
if err != nil {
return err
}
resultMap := map[string]interface{}{}
switch midResponse := data.(type) {
case map[interface{}]interface{}: // resp3 will return map
for k, v := range midResponse {
stringKey, ok := k.(string)
if !ok {
return fmt.Errorf("redis: invalid map key %#v", k)
}
resultMap[stringKey] = v
}
case []interface{}: // resp2 will return array of arrays
n := len(midResponse)
for i := 0; i < n; i++ {
finalArr, ok := midResponse[i].([]interface{}) // final array that we need to transform to map
if !ok {
return fmt.Errorf("redis: unexpected response %#v", data)
}
m := len(finalArr)
if m%2 != 0 { // since this should be map, keys should be even number
return fmt.Errorf("redis: unexpected response %#v", data)
}
for j := 0; j < m; j += 2 {
stringKey, ok := finalArr[j].(string) // the first one
if !ok {
return fmt.Errorf("redis: invalid map key %#v", finalArr[i])
}
resultMap[stringKey] = finalArr[j+1] // second one is value
}
}
default:
return fmt.Errorf("redis: unexpected response %#v", data)
}
cmd.val = resultMap
return nil
}
func (cmd *MapMapStringInterfaceCmd) Clone() Cmder {
var val map[string]interface{}
if cmd.val != nil {
val = make(map[string]interface{}, len(cmd.val))
for k, v := range cmd.val {
val[k] = v
}
}
return &MapMapStringInterfaceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//-----------------------------------------------------------------------
type MapStringInterfaceSliceCmd struct {
baseCmd
val []map[string]interface{}
}
var _ Cmder = (*MapStringInterfaceSliceCmd)(nil)
func NewMapStringInterfaceSliceCmd(ctx context.Context, args ...interface{}) *MapStringInterfaceSliceCmd {
return &MapStringInterfaceSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeMapStringInterfaceSlice,
},
}
}
func (cmd *MapStringInterfaceSliceCmd) SetVal(val []map[string]interface{}) {
cmd.val = val
}
func (cmd *MapStringInterfaceSliceCmd) Val() []map[string]interface{} {
return cmd.val
}
func (cmd *MapStringInterfaceSliceCmd) Result() ([]map[string]interface{}, error) {
return cmd.val, cmd.err
}
func (cmd *MapStringInterfaceSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *MapStringInterfaceSliceCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]map[string]interface{}, n)
for i := 0; i < n; i++ {
nn, err := rd.ReadMapLen()
if err != nil {
return err
}
cmd.val[i] = make(map[string]interface{}, nn)
for f := 0; f < nn; f++ {
k, err := rd.ReadString()
if err != nil {
return err
}
v, err := rd.ReadReply()
if err != nil {
if err != Nil {
return err
}
}
cmd.val[i][k] = v
}
}
return nil
}
func (cmd *MapStringInterfaceSliceCmd) Clone() Cmder {
var val []map[string]interface{}
if cmd.val != nil {
val = make([]map[string]interface{}, len(cmd.val))
for i, m := range cmd.val {
if m != nil {
val[i] = make(map[string]interface{}, len(m))
for k, v := range m {
val[i][k] = v
}
}
}
}
return &MapStringInterfaceSliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
type KeyValuesCmd struct {
baseCmd
key string
val []string
}
var _ Cmder = (*KeyValuesCmd)(nil)
func NewKeyValuesCmd(ctx context.Context, args ...interface{}) *KeyValuesCmd {
return &KeyValuesCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeKeyValues,
},
}
}
func (cmd *KeyValuesCmd) SetVal(key string, val []string) {
cmd.key = key
cmd.val = val
}
func (cmd *KeyValuesCmd) Val() (string, []string) {
return cmd.key, cmd.val
}
func (cmd *KeyValuesCmd) Result() (string, []string, error) {
return cmd.key, cmd.val, cmd.err
}
func (cmd *KeyValuesCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *KeyValuesCmd) readReply(rd *proto.Reader) (err error) {
if err = rd.ReadFixedArrayLen(2); err != nil {
return err
}
cmd.key, err = rd.ReadString()
if err != nil {
return err
}
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]string, n)
for i := 0; i < n; i++ {
cmd.val[i], err = rd.ReadString()
if err != nil {
return err
}
}
return nil
}
func (cmd *KeyValuesCmd) Clone() Cmder {
var val []string
if cmd.val != nil {
val = make([]string, len(cmd.val))
copy(val, cmd.val)
}
return &KeyValuesCmd{
baseCmd: cmd.cloneBaseCmd(),
key: cmd.key,
val: val,
}
}
//------------------------------------------------------------------------------
type ZSliceWithKeyCmd struct {
baseCmd
key string
val []Z
}
var _ Cmder = (*ZSliceWithKeyCmd)(nil)
func NewZSliceWithKeyCmd(ctx context.Context, args ...interface{}) *ZSliceWithKeyCmd {
return &ZSliceWithKeyCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeZSliceWithKey,
},
}
}
func (cmd *ZSliceWithKeyCmd) SetVal(key string, val []Z) {
cmd.key = key
cmd.val = val
}
func (cmd *ZSliceWithKeyCmd) Val() (string, []Z) {
return cmd.key, cmd.val
}
func (cmd *ZSliceWithKeyCmd) Result() (string, []Z, error) {
return cmd.key, cmd.val, cmd.err
}
func (cmd *ZSliceWithKeyCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *ZSliceWithKeyCmd) readReply(rd *proto.Reader) (err error) {
if err = rd.ReadFixedArrayLen(2); err != nil {
return err
}
cmd.key, err = rd.ReadString()
if err != nil {
return err
}
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
typ, err := rd.PeekReplyType()
if err != nil {
return err
}
array := typ == proto.RespArray
if array {
cmd.val = make([]Z, n)
} else {
cmd.val = make([]Z, n/2)
}
for i := 0; i < len(cmd.val); i++ {
if array {
if err = rd.ReadFixedArrayLen(2); err != nil {
return err
}
}
if cmd.val[i].Member, err = rd.ReadString(); err != nil {
return err
}
if cmd.val[i].Score, err = rd.ReadFloat(); err != nil {
return err
}
}
return nil
}
func (cmd *ZSliceWithKeyCmd) Clone() Cmder {
var val []Z
if cmd.val != nil {
val = make([]Z, len(cmd.val))
copy(val, cmd.val)
}
return &ZSliceWithKeyCmd{
baseCmd: cmd.cloneBaseCmd(),
key: cmd.key,
val: val,
}
}
type Function struct {
Name string
Description string
Flags []string
}
type Library struct {
Name string
Engine string
Functions []Function
Code string
}
type FunctionListCmd struct {
baseCmd
val []Library
}
var _ Cmder = (*FunctionListCmd)(nil)
func NewFunctionListCmd(ctx context.Context, args ...interface{}) *FunctionListCmd {
return &FunctionListCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeFunctionList,
},
}
}
func (cmd *FunctionListCmd) SetVal(val []Library) {
cmd.val = val
}
func (cmd *FunctionListCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *FunctionListCmd) Val() []Library {
return cmd.val
}
func (cmd *FunctionListCmd) Result() ([]Library, error) {
return cmd.val, cmd.err
}
func (cmd *FunctionListCmd) First() (*Library, error) {
if cmd.err != nil {
return nil, cmd.err
}
if len(cmd.val) > 0 {
return &cmd.val[0], nil
}
return nil, Nil
}
func (cmd *FunctionListCmd) readReply(rd *proto.Reader) (err error) {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
libraries := make([]Library, n)
for i := 0; i < n; i++ {
nn, err := rd.ReadMapLen()
if err != nil {
return err
}
library := Library{}
for f := 0; f < nn; f++ {
key, err := rd.ReadString()
if err != nil {
return err
}
switch key {
case "library_name":
library.Name, err = rd.ReadString()
case "engine":
library.Engine, err = rd.ReadString()
case "functions":
library.Functions, err = cmd.readFunctions(rd)
case "library_code":
library.Code, err = rd.ReadString()
default:
return fmt.Errorf("redis: function list unexpected key %s", key)
}
if err != nil {
return err
}
}
libraries[i] = library
}
cmd.val = libraries
return nil
}
func (cmd *FunctionListCmd) readFunctions(rd *proto.Reader) ([]Function, error) {
n, err := rd.ReadArrayLen()
if err != nil {
return nil, err
}
functions := make([]Function, n)
for i := 0; i < n; i++ {
nn, err := rd.ReadMapLen()
if err != nil {
return nil, err
}
function := Function{}
for f := 0; f < nn; f++ {
key, err := rd.ReadString()
if err != nil {
return nil, err
}
switch key {
case "name":
if function.Name, err = rd.ReadString(); err != nil {
return nil, err
}
case "description":
if function.Description, err = rd.ReadString(); err != nil && err != Nil {
return nil, err
}
case "flags":
// resp set
nx, err := rd.ReadArrayLen()
if err != nil {
return nil, err
}
function.Flags = make([]string, nx)
for j := 0; j < nx; j++ {
if function.Flags[j], err = rd.ReadString(); err != nil {
return nil, err
}
}
default:
return nil, fmt.Errorf("redis: function list unexpected key %s", key)
}
}
functions[i] = function
}
return functions, nil
}
func (cmd *FunctionListCmd) Clone() Cmder {
var val []Library
if cmd.val != nil {
val = make([]Library, len(cmd.val))
for i, lib := range cmd.val {
val[i] = Library{
Name: lib.Name,
Engine: lib.Engine,
Code: lib.Code,
}
if lib.Functions != nil {
val[i].Functions = make([]Function, len(lib.Functions))
for j, fn := range lib.Functions {
val[i].Functions[j] = Function{
Name: fn.Name,
Description: fn.Description,
}
if fn.Flags != nil {
val[i].Functions[j].Flags = make([]string, len(fn.Flags))
copy(val[i].Functions[j].Flags, fn.Flags)
}
}
}
}
}
return &FunctionListCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
// FunctionStats contains information about the scripts currently executing on the server, and the available engines
// - Engines:
// Statistics about the engine like number of functions and number of libraries
// - RunningScript:
// The script currently running on the shard we're connecting to.
// For Redis Enterprise and Redis Cloud, this represents the
// function with the longest running time, across all the running functions, on all shards
// - RunningScripts
// All scripts currently running in a Redis Enterprise clustered database.
// Only available on Redis Enterprise
type FunctionStats struct {
Engines []Engine
isRunning bool
rs RunningScript
allrs []RunningScript
}
func (fs *FunctionStats) Running() bool {
return fs.isRunning
}
func (fs *FunctionStats) RunningScript() (RunningScript, bool) {
return fs.rs, fs.isRunning
}
// AllRunningScripts returns all scripts currently running in a Redis Enterprise clustered database.
// Only available on Redis Enterprise
func (fs *FunctionStats) AllRunningScripts() []RunningScript {
return fs.allrs
}
type RunningScript struct {
Name string
Command []string
Duration time.Duration
}
type Engine struct {
Language string
LibrariesCount int64
FunctionsCount int64
}
type FunctionStatsCmd struct {
baseCmd
val FunctionStats
}
var _ Cmder = (*FunctionStatsCmd)(nil)
func NewFunctionStatsCmd(ctx context.Context, args ...interface{}) *FunctionStatsCmd {
return &FunctionStatsCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeFunctionStats,
},
}
}
func (cmd *FunctionStatsCmd) SetVal(val FunctionStats) {
cmd.val = val
}
func (cmd *FunctionStatsCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *FunctionStatsCmd) Val() FunctionStats {
return cmd.val
}
func (cmd *FunctionStatsCmd) Result() (FunctionStats, error) {
return cmd.val, cmd.err
}
func (cmd *FunctionStatsCmd) readReply(rd *proto.Reader) (err error) {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
var key string
var result FunctionStats
for f := 0; f < n; f++ {
key, err = rd.ReadString()
if err != nil {
return err
}
switch key {
case "running_script":
result.rs, result.isRunning, err = cmd.readRunningScript(rd)
case "engines":
result.Engines, err = cmd.readEngines(rd)
case "all_running_scripts": // Redis Enterprise only
result.allrs, result.isRunning, err = cmd.readRunningScripts(rd)
default:
return fmt.Errorf("redis: function stats unexpected key %s", key)
}
if err != nil {
return err
}
}
cmd.val = result
return nil
}
func (cmd *FunctionStatsCmd) readRunningScript(rd *proto.Reader) (RunningScript, bool, error) {
err := rd.ReadFixedMapLen(3)
if err != nil {
if err == Nil {
return RunningScript{}, false, nil
}
return RunningScript{}, false, err
}
var runningScript RunningScript
for i := 0; i < 3; i++ {
key, err := rd.ReadString()
if err != nil {
return RunningScript{}, false, err
}
switch key {
case "name":
runningScript.Name, err = rd.ReadString()
case "duration_ms":
runningScript.Duration, err = cmd.readDuration(rd)
case "command":
runningScript.Command, err = cmd.readCommand(rd)
default:
return RunningScript{}, false, fmt.Errorf("redis: function stats unexpected running_script key %s", key)
}
if err != nil {
return RunningScript{}, false, err
}
}
return runningScript, true, nil
}
func (cmd *FunctionStatsCmd) readEngines(rd *proto.Reader) ([]Engine, error) {
n, err := rd.ReadMapLen()
if err != nil {
return nil, err
}
engines := make([]Engine, 0, n)
for i := 0; i < n; i++ {
engine := Engine{}
engine.Language, err = rd.ReadString()
if err != nil {
return nil, err
}
err = rd.ReadFixedMapLen(2)
if err != nil {
return nil, fmt.Errorf("redis: function stats unexpected %s engine map length", engine.Language)
}
for i := 0; i < 2; i++ {
key, err := rd.ReadString()
switch key {
case "libraries_count":
engine.LibrariesCount, err = rd.ReadInt()
case "functions_count":
engine.FunctionsCount, err = rd.ReadInt()
}
if err != nil {
return nil, err
}
}
engines = append(engines, engine)
}
return engines, nil
}
func (cmd *FunctionStatsCmd) readDuration(rd *proto.Reader) (time.Duration, error) {
t, err := rd.ReadInt()
if err != nil {
return time.Duration(0), err
}
return time.Duration(t) * time.Millisecond, nil
}
func (cmd *FunctionStatsCmd) readCommand(rd *proto.Reader) ([]string, error) {
n, err := rd.ReadArrayLen()
if err != nil {
return nil, err
}
command := make([]string, 0, n)
for i := 0; i < n; i++ {
x, err := rd.ReadString()
if err != nil {
return nil, err
}
command = append(command, x)
}
return command, nil
}
func (cmd *FunctionStatsCmd) readRunningScripts(rd *proto.Reader) ([]RunningScript, bool, error) {
n, err := rd.ReadArrayLen()
if err != nil {
return nil, false, err
}
runningScripts := make([]RunningScript, 0, n)
for i := 0; i < n; i++ {
rs, _, err := cmd.readRunningScript(rd)
if err != nil {
return nil, false, err
}
runningScripts = append(runningScripts, rs)
}
return runningScripts, len(runningScripts) > 0, nil
}
func (cmd *FunctionStatsCmd) Clone() Cmder {
val := FunctionStats{
isRunning: cmd.val.isRunning,
rs: cmd.val.rs, // RunningScript is a simple struct, can be copied directly
}
if cmd.val.Engines != nil {
val.Engines = make([]Engine, len(cmd.val.Engines))
copy(val.Engines, cmd.val.Engines)
}
if cmd.val.allrs != nil {
val.allrs = make([]RunningScript, len(cmd.val.allrs))
for i, rs := range cmd.val.allrs {
val.allrs[i] = RunningScript{
Name: rs.Name,
Duration: rs.Duration,
}
if rs.Command != nil {
val.allrs[i].Command = make([]string, len(rs.Command))
copy(val.allrs[i].Command, rs.Command)
}
}
}
return &FunctionStatsCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
// LCSQuery is a parameter used for the LCS command
type LCSQuery struct {
Key1 string
Key2 string
Len bool
Idx bool
MinMatchLen int
WithMatchLen bool
}
// LCSMatch is the result set of the LCS command.
type LCSMatch struct {
MatchString string
Matches []LCSMatchedPosition
Len int64
}
type LCSMatchedPosition struct {
Key1 LCSPosition
Key2 LCSPosition
// only for withMatchLen is true
MatchLen int64
}
type LCSPosition struct {
Start int64
End int64
}
type LCSCmd struct {
baseCmd
// 1: match string
// 2: match len
// 3: match idx LCSMatch
readType uint8
val *LCSMatch
}
func NewLCSCmd(ctx context.Context, q *LCSQuery) *LCSCmd {
args := make([]interface{}, 3, 7)
args[0] = "lcs"
args[1] = q.Key1
args[2] = q.Key2
cmd := &LCSCmd{readType: 1}
if q.Len {
cmd.readType = 2
args = append(args, "len")
} else if q.Idx {
cmd.readType = 3
args = append(args, "idx")
if q.MinMatchLen != 0 {
args = append(args, "minmatchlen", q.MinMatchLen)
}
if q.WithMatchLen {
args = append(args, "withmatchlen")
}
}
cmd.baseCmd = baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeLCS,
}
return cmd
}
func (cmd *LCSCmd) SetVal(val *LCSMatch) {
cmd.val = val
}
func (cmd *LCSCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *LCSCmd) Val() *LCSMatch {
return cmd.val
}
func (cmd *LCSCmd) Result() (*LCSMatch, error) {
return cmd.val, cmd.err
}
func (cmd *LCSCmd) readReply(rd *proto.Reader) (err error) {
lcs := &LCSMatch{}
switch cmd.readType {
case 1:
// match string
if lcs.MatchString, err = rd.ReadString(); err != nil {
return err
}
case 2:
// match len
if lcs.Len, err = rd.ReadInt(); err != nil {
return err
}
case 3:
// read LCSMatch
if err = rd.ReadFixedMapLen(2); err != nil {
return err
}
// read matches or len field
for i := 0; i < 2; i++ {
key, err := rd.ReadString()
if err != nil {
return err
}
switch key {
case "matches":
// read array of matched positions
if lcs.Matches, err = cmd.readMatchedPositions(rd); err != nil {
return err
}
case "len":
// read match length
if lcs.Len, err = rd.ReadInt(); err != nil {
return err
}
}
}
}
cmd.val = lcs
return nil
}
func (cmd *LCSCmd) readMatchedPositions(rd *proto.Reader) ([]LCSMatchedPosition, error) {
n, err := rd.ReadArrayLen()
if err != nil {
return nil, err
}
positions := make([]LCSMatchedPosition, n)
for i := 0; i < n; i++ {
pn, err := rd.ReadArrayLen()
if err != nil {
return nil, err
}
if positions[i].Key1, err = cmd.readPosition(rd); err != nil {
return nil, err
}
if positions[i].Key2, err = cmd.readPosition(rd); err != nil {
return nil, err
}
// read match length if WithMatchLen is true
if pn > 2 {
if positions[i].MatchLen, err = rd.ReadInt(); err != nil {
return nil, err
}
}
}
return positions, nil
}
func (cmd *LCSCmd) readPosition(rd *proto.Reader) (pos LCSPosition, err error) {
if err = rd.ReadFixedArrayLen(2); err != nil {
return pos, err
}
if pos.Start, err = rd.ReadInt(); err != nil {
return pos, err
}
if pos.End, err = rd.ReadInt(); err != nil {
return pos, err
}
return pos, nil
}
func (cmd *LCSCmd) Clone() Cmder {
var val *LCSMatch
if cmd.val != nil {
val = &LCSMatch{
MatchString: cmd.val.MatchString,
Len: cmd.val.Len,
}
if cmd.val.Matches != nil {
val.Matches = make([]LCSMatchedPosition, len(cmd.val.Matches))
copy(val.Matches, cmd.val.Matches)
}
}
return &LCSCmd{
baseCmd: cmd.cloneBaseCmd(),
readType: cmd.readType,
val: val,
}
}
// ------------------------------------------------------------------------
type KeyFlags struct {
Key string
Flags []string
}
type KeyFlagsCmd struct {
baseCmd
val []KeyFlags
}
var _ Cmder = (*KeyFlagsCmd)(nil)
func NewKeyFlagsCmd(ctx context.Context, args ...interface{}) *KeyFlagsCmd {
return &KeyFlagsCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeKeyFlags,
},
}
}
func (cmd *KeyFlagsCmd) SetVal(val []KeyFlags) {
cmd.val = val
}
func (cmd *KeyFlagsCmd) Val() []KeyFlags {
return cmd.val
}
func (cmd *KeyFlagsCmd) Result() ([]KeyFlags, error) {
return cmd.val, cmd.err
}
func (cmd *KeyFlagsCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *KeyFlagsCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
if n == 0 {
cmd.val = make([]KeyFlags, 0)
return nil
}
cmd.val = make([]KeyFlags, n)
for i := 0; i < len(cmd.val); i++ {
if err = rd.ReadFixedArrayLen(2); err != nil {
return err
}
if cmd.val[i].Key, err = rd.ReadString(); err != nil {
return err
}
flagsLen, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val[i].Flags = make([]string, flagsLen)
for j := 0; j < flagsLen; j++ {
if cmd.val[i].Flags[j], err = rd.ReadString(); err != nil {
return err
}
}
}
return nil
}
func (cmd *KeyFlagsCmd) Clone() Cmder {
var val []KeyFlags
if cmd.val != nil {
val = make([]KeyFlags, len(cmd.val))
for i, kf := range cmd.val {
val[i] = KeyFlags{
Key: kf.Key,
}
if kf.Flags != nil {
val[i].Flags = make([]string, len(kf.Flags))
copy(val[i].Flags, kf.Flags)
}
}
}
return &KeyFlagsCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
// ---------------------------------------------------------------------------------------------------
type ClusterLink struct {
Direction string
Node string
CreateTime int64
Events string
SendBufferAllocated int64
SendBufferUsed int64
}
type ClusterLinksCmd struct {
baseCmd
val []ClusterLink
}
var _ Cmder = (*ClusterLinksCmd)(nil)
func NewClusterLinksCmd(ctx context.Context, args ...interface{}) *ClusterLinksCmd {
return &ClusterLinksCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeClusterLinks,
},
}
}
func (cmd *ClusterLinksCmd) SetVal(val []ClusterLink) {
cmd.val = val
}
func (cmd *ClusterLinksCmd) Val() []ClusterLink {
return cmd.val
}
func (cmd *ClusterLinksCmd) Result() ([]ClusterLink, error) {
return cmd.val, cmd.err
}
func (cmd *ClusterLinksCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *ClusterLinksCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]ClusterLink, n)
for i := 0; i < len(cmd.val); i++ {
m, err := rd.ReadMapLen()
if err != nil {
return err
}
for j := 0; j < m; j++ {
key, err := rd.ReadString()
if err != nil {
return err
}
switch key {
case "direction":
cmd.val[i].Direction, err = rd.ReadString()
case "node":
cmd.val[i].Node, err = rd.ReadString()
case "create-time":
cmd.val[i].CreateTime, err = rd.ReadInt()
case "events":
cmd.val[i].Events, err = rd.ReadString()
case "send-buffer-allocated":
cmd.val[i].SendBufferAllocated, err = rd.ReadInt()
case "send-buffer-used":
cmd.val[i].SendBufferUsed, err = rd.ReadInt()
default:
return fmt.Errorf("redis: unexpected key %q in CLUSTER LINKS reply", key)
}
if err != nil {
return err
}
}
}
return nil
}
func (cmd *ClusterLinksCmd) Clone() Cmder {
var val []ClusterLink
if cmd.val != nil {
val = make([]ClusterLink, len(cmd.val))
copy(val, cmd.val)
}
return &ClusterLinksCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
// ------------------------------------------------------------------------------------------------------------------
type SlotRange struct {
Start int64
End int64
}
type Node struct {
ID string
Endpoint string
IP string
Hostname string
Port int64
TLSPort int64
Role string
ReplicationOffset int64
Health string
}
type ClusterShard struct {
Slots []SlotRange
Nodes []Node
}
type ClusterShardsCmd struct {
baseCmd
val []ClusterShard
}
var _ Cmder = (*ClusterShardsCmd)(nil)
func NewClusterShardsCmd(ctx context.Context, args ...interface{}) *ClusterShardsCmd {
return &ClusterShardsCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeClusterShards,
},
}
}
func (cmd *ClusterShardsCmd) SetVal(val []ClusterShard) {
cmd.val = val
}
func (cmd *ClusterShardsCmd) Val() []ClusterShard {
return cmd.val
}
func (cmd *ClusterShardsCmd) Result() ([]ClusterShard, error) {
return cmd.val, cmd.err
}
func (cmd *ClusterShardsCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *ClusterShardsCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]ClusterShard, n)
for i := 0; i < n; i++ {
m, err := rd.ReadMapLen()
if err != nil {
return err
}
for j := 0; j < m; j++ {
key, err := rd.ReadString()
if err != nil {
return err
}
switch key {
case "slots":
l, err := rd.ReadArrayLen()
if err != nil {
return err
}
for k := 0; k < l; k += 2 {
start, err := rd.ReadInt()
if err != nil {
return err
}
end, err := rd.ReadInt()
if err != nil {
return err
}
cmd.val[i].Slots = append(cmd.val[i].Slots, SlotRange{Start: start, End: end})
}
case "nodes":
nodesLen, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val[i].Nodes = make([]Node, nodesLen)
for k := 0; k < nodesLen; k++ {
nodeMapLen, err := rd.ReadMapLen()
if err != nil {
return err
}
for l := 0; l < nodeMapLen; l++ {
nodeKey, err := rd.ReadString()
if err != nil {
return err
}
switch nodeKey {
case "id":
cmd.val[i].Nodes[k].ID, err = rd.ReadString()
case "endpoint":
cmd.val[i].Nodes[k].Endpoint, err = rd.ReadString()
case "ip":
cmd.val[i].Nodes[k].IP, err = rd.ReadString()
case "hostname":
cmd.val[i].Nodes[k].Hostname, err = rd.ReadString()
case "port":
cmd.val[i].Nodes[k].Port, err = rd.ReadInt()
case "tls-port":
cmd.val[i].Nodes[k].TLSPort, err = rd.ReadInt()
case "role":
cmd.val[i].Nodes[k].Role, err = rd.ReadString()
case "replication-offset":
cmd.val[i].Nodes[k].ReplicationOffset, err = rd.ReadInt()
case "health":
cmd.val[i].Nodes[k].Health, err = rd.ReadString()
default:
return fmt.Errorf("redis: unexpected key %q in CLUSTER SHARDS node reply", nodeKey)
}
if err != nil {
return err
}
}
}
default:
return fmt.Errorf("redis: unexpected key %q in CLUSTER SHARDS reply", key)
}
}
}
return nil
}
func (cmd *ClusterShardsCmd) Clone() Cmder {
var val []ClusterShard
if cmd.val != nil {
val = make([]ClusterShard, len(cmd.val))
for i, shard := range cmd.val {
val[i] = ClusterShard{}
if shard.Slots != nil {
val[i].Slots = make([]SlotRange, len(shard.Slots))
copy(val[i].Slots, shard.Slots)
}
if shard.Nodes != nil {
val[i].Nodes = make([]Node, len(shard.Nodes))
copy(val[i].Nodes, shard.Nodes)
}
}
}
return &ClusterShardsCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
// -----------------------------------------
type RankScore struct {
Rank int64
Score float64
}
type RankWithScoreCmd struct {
baseCmd
val RankScore
}
var _ Cmder = (*RankWithScoreCmd)(nil)
func NewRankWithScoreCmd(ctx context.Context, args ...interface{}) *RankWithScoreCmd {
return &RankWithScoreCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeRankWithScore,
},
}
}
func (cmd *RankWithScoreCmd) SetVal(val RankScore) {
cmd.val = val
}
func (cmd *RankWithScoreCmd) Val() RankScore {
return cmd.val
}
func (cmd *RankWithScoreCmd) Result() (RankScore, error) {
return cmd.val, cmd.err
}
func (cmd *RankWithScoreCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *RankWithScoreCmd) readReply(rd *proto.Reader) error {
if err := rd.ReadFixedArrayLen(2); err != nil {
return err
}
rank, err := rd.ReadInt()
if err != nil {
return err
}
score, err := rd.ReadFloat()
if err != nil {
return err
}
cmd.val = RankScore{Rank: rank, Score: score}
return nil
}
func (cmd *RankWithScoreCmd) Clone() Cmder {
return &RankWithScoreCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val, // RankScore is a simple struct, can be copied directly
}
}
// --------------------------------------------------------------------------------------------------
// ClientFlags is redis-server client flags, copy from redis/src/server.h (redis 7.0)
type ClientFlags uint64
const (
ClientSlave ClientFlags = 1 << 0 /* This client is a replica */
ClientMaster ClientFlags = 1 << 1 /* This client is a master */
ClientMonitor ClientFlags = 1 << 2 /* This client is a slave monitor, see MONITOR */
ClientMulti ClientFlags = 1 << 3 /* This client is in a MULTI context */
ClientBlocked ClientFlags = 1 << 4 /* The client is waiting in a blocking operation */
ClientDirtyCAS ClientFlags = 1 << 5 /* Watched keys modified. EXEC will fail. */
ClientCloseAfterReply ClientFlags = 1 << 6 /* Close after writing entire reply. */
ClientUnBlocked ClientFlags = 1 << 7 /* This client was unblocked and is stored in server.unblocked_clients */
ClientScript ClientFlags = 1 << 8 /* This is a non-connected client used by Lua */
ClientAsking ClientFlags = 1 << 9 /* Client issued the ASKING command */
ClientCloseASAP ClientFlags = 1 << 10 /* Close this client ASAP */
ClientUnixSocket ClientFlags = 1 << 11 /* Client connected via Unix domain socket */
ClientDirtyExec ClientFlags = 1 << 12 /* EXEC will fail for errors while queueing */
ClientMasterForceReply ClientFlags = 1 << 13 /* Queue replies even if is master */
ClientForceAOF ClientFlags = 1 << 14 /* Force AOF propagation of current cmd. */
ClientForceRepl ClientFlags = 1 << 15 /* Force replication of current cmd. */
ClientPrePSync ClientFlags = 1 << 16 /* Instance don't understand PSYNC. */
ClientReadOnly ClientFlags = 1 << 17 /* Cluster client is in read-only state. */
ClientPubSub ClientFlags = 1 << 18 /* Client is in Pub/Sub mode. */
ClientPreventAOFProp ClientFlags = 1 << 19 /* Don't propagate to AOF. */
ClientPreventReplProp ClientFlags = 1 << 20 /* Don't propagate to slaves. */
ClientPreventProp ClientFlags = ClientPreventAOFProp | ClientPreventReplProp
ClientPendingWrite ClientFlags = 1 << 21 /* Client has output to send but a-write handler is yet not installed. */
ClientReplyOff ClientFlags = 1 << 22 /* Don't send replies to client. */
ClientReplySkipNext ClientFlags = 1 << 23 /* Set ClientREPLY_SKIP for next cmd */
ClientReplySkip ClientFlags = 1 << 24 /* Don't send just this reply. */
ClientLuaDebug ClientFlags = 1 << 25 /* Run EVAL in debug mode. */
ClientLuaDebugSync ClientFlags = 1 << 26 /* EVAL debugging without fork() */
ClientModule ClientFlags = 1 << 27 /* Non connected client used by some module. */
ClientProtected ClientFlags = 1 << 28 /* Client should not be freed for now. */
ClientExecutingCommand ClientFlags = 1 << 29 /* Indicates that the client is currently in the process of handling
a command. usually this will be marked only during call()
however, blocked clients might have this flag kept until they
will try to reprocess the command. */
ClientPendingCommand ClientFlags = 1 << 30 /* Indicates the client has a fully * parsed command ready for execution. */
ClientTracking ClientFlags = 1 << 31 /* Client enabled keys tracking in order to perform client side caching. */
ClientTrackingBrokenRedir ClientFlags = 1 << 32 /* Target client is invalid. */
ClientTrackingBCAST ClientFlags = 1 << 33 /* Tracking in BCAST mode. */
ClientTrackingOptIn ClientFlags = 1 << 34 /* Tracking in opt-in mode. */
ClientTrackingOptOut ClientFlags = 1 << 35 /* Tracking in opt-out mode. */
ClientTrackingCaching ClientFlags = 1 << 36 /* CACHING yes/no was given, depending on optin/optout mode. */
ClientTrackingNoLoop ClientFlags = 1 << 37 /* Don't send invalidation messages about writes performed by myself.*/
ClientInTimeoutTable ClientFlags = 1 << 38 /* This client is in the timeout table. */
ClientProtocolError ClientFlags = 1 << 39 /* Protocol error chatting with it. */
ClientCloseAfterCommand ClientFlags = 1 << 40 /* Close after executing commands * and writing entire reply. */
ClientDenyBlocking ClientFlags = 1 << 41 /* Indicate that the client should not be blocked. currently, turned on inside MULTI, Lua, RM_Call, and AOF client */
ClientReplRDBOnly ClientFlags = 1 << 42 /* This client is a replica that only wants RDB without replication buffer. */
ClientNoEvict ClientFlags = 1 << 43 /* This client is protected against client memory eviction. */
ClientAllowOOM ClientFlags = 1 << 44 /* Client used by RM_Call is allowed to fully execute scripts even when in OOM */
ClientNoTouch ClientFlags = 1 << 45 /* This client will not touch LFU/LRU stats. */
ClientPushing ClientFlags = 1 << 46 /* This client is pushing notifications. */
)
// ClientInfo is redis-server ClientInfo, not go-redis *Client
type ClientInfo struct {
ID int64 // redis version 2.8.12, a unique 64-bit client ID
Addr string // address/port of the client
LAddr string // address/port of local address client connected to (bind address)
FD int64 // file descriptor corresponding to the socket
Name string // the name set by the client with CLIENT SETNAME
Age time.Duration // total duration of the connection in seconds
Idle time.Duration // idle time of the connection in seconds
Flags ClientFlags // client flags (see below)
DB int // current database ID
Sub int // number of channel subscriptions
PSub int // number of pattern matching subscriptions
SSub int // redis version 7.0.3, number of shard channel subscriptions
Multi int // number of commands in a MULTI/EXEC context
Watch int // redis version 7.4 RC1, number of keys this client is currently watching.
QueryBuf int // qbuf, query buffer length (0 means no query pending)
QueryBufFree int // qbuf-free, free space of the query buffer (0 means the buffer is full)
ArgvMem int // incomplete arguments for the next command (already extracted from query buffer)
MultiMem int // redis version 7.0, memory is used up by buffered multi commands
BufferSize int // rbs, usable size of buffer
BufferPeak int // rbp, peak used size of buffer in last 5 sec interval
OutputBufferLength int // obl, output buffer length
OutputListLength int // oll, output list length (replies are queued in this list when the buffer is full)
OutputMemory int // omem, output buffer memory usage
TotalMemory int // tot-mem, total memory consumed by this client in its various buffers
TotalNetIn int // tot-net-in, total network input
TotalNetOut int // tot-net-out, total network output
TotalCmds int // tot-cmds, total number of commands processed
IoThread int // io-thread id
Events string // file descriptor events (see below)
LastCmd string // cmd, last command played
User string // the authenticated username of the client
Redir int64 // client id of current client tracking redirection
Resp int // redis version 7.0, client RESP protocol version
LibName string // redis version 7.2, client library name
LibVer string // redis version 7.2, client library version
}
type ClientInfoCmd struct {
baseCmd
val *ClientInfo
}
var _ Cmder = (*ClientInfoCmd)(nil)
func NewClientInfoCmd(ctx context.Context, args ...interface{}) *ClientInfoCmd {
return &ClientInfoCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeClientInfo,
},
}
}
func (cmd *ClientInfoCmd) SetVal(val *ClientInfo) {
cmd.val = val
}
func (cmd *ClientInfoCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *ClientInfoCmd) Val() *ClientInfo {
return cmd.val
}
func (cmd *ClientInfoCmd) Result() (*ClientInfo, error) {
return cmd.val, cmd.err
}
func (cmd *ClientInfoCmd) readReply(rd *proto.Reader) (err error) {
txt, err := rd.ReadString()
if err != nil {
return err
}
// sds o = catClientInfoString(sdsempty(), c);
// o = sdscatlen(o,"\n",1);
// addReplyVerbatim(c,o,sdslen(o),"txt");
// sdsfree(o);
cmd.val, err = parseClientInfo(strings.TrimSpace(txt))
return err
}
// fmt.Sscanf() cannot handle null values
func parseClientInfo(txt string) (info *ClientInfo, err error) {
info = &ClientInfo{}
for _, s := range strings.Split(txt, " ") {
kv := strings.Split(s, "=")
if len(kv) != 2 {
return nil, fmt.Errorf("redis: unexpected client info data (%s)", s)
}
key, val := kv[0], kv[1]
switch key {
case "id":
info.ID, err = strconv.ParseInt(val, 10, 64)
case "addr":
info.Addr = val
case "laddr":
info.LAddr = val
case "fd":
info.FD, err = strconv.ParseInt(val, 10, 64)
case "name":
info.Name = val
case "age":
var age int
if age, err = strconv.Atoi(val); err == nil {
info.Age = time.Duration(age) * time.Second
}
case "idle":
var idle int
if idle, err = strconv.Atoi(val); err == nil {
info.Idle = time.Duration(idle) * time.Second
}
case "flags":
if val == "N" {
break
}
for i := 0; i < len(val); i++ {
switch val[i] {
case 'S':
info.Flags |= ClientSlave
case 'O':
info.Flags |= ClientSlave | ClientMonitor
case 'M':
info.Flags |= ClientMaster
case 'P':
info.Flags |= ClientPubSub
case 'x':
info.Flags |= ClientMulti
case 'b':
info.Flags |= ClientBlocked
case 't':
info.Flags |= ClientTracking
case 'R':
info.Flags |= ClientTrackingBrokenRedir
case 'B':
info.Flags |= ClientTrackingBCAST
case 'd':
info.Flags |= ClientDirtyCAS
case 'c':
info.Flags |= ClientCloseAfterCommand
case 'u':
info.Flags |= ClientUnBlocked
case 'A':
info.Flags |= ClientCloseASAP
case 'U':
info.Flags |= ClientUnixSocket
case 'r':
info.Flags |= ClientReadOnly
case 'e':
info.Flags |= ClientNoEvict
case 'T':
info.Flags |= ClientNoTouch
default:
return nil, fmt.Errorf("redis: unexpected client info flags(%s)", string(val[i]))
}
}
case "db":
info.DB, err = strconv.Atoi(val)
case "sub":
info.Sub, err = strconv.Atoi(val)
case "psub":
info.PSub, err = strconv.Atoi(val)
case "ssub":
info.SSub, err = strconv.Atoi(val)
case "multi":
info.Multi, err = strconv.Atoi(val)
case "watch":
info.Watch, err = strconv.Atoi(val)
case "qbuf":
info.QueryBuf, err = strconv.Atoi(val)
case "qbuf-free":
info.QueryBufFree, err = strconv.Atoi(val)
case "argv-mem":
info.ArgvMem, err = strconv.Atoi(val)
case "multi-mem":
info.MultiMem, err = strconv.Atoi(val)
case "rbs":
info.BufferSize, err = strconv.Atoi(val)
case "rbp":
info.BufferPeak, err = strconv.Atoi(val)
case "obl":
info.OutputBufferLength, err = strconv.Atoi(val)
case "oll":
info.OutputListLength, err = strconv.Atoi(val)
case "omem":
info.OutputMemory, err = strconv.Atoi(val)
case "tot-mem":
info.TotalMemory, err = strconv.Atoi(val)
case "tot-net-in":
info.TotalNetIn, err = strconv.Atoi(val)
case "tot-net-out":
info.TotalNetOut, err = strconv.Atoi(val)
case "tot-cmds":
info.TotalCmds, err = strconv.Atoi(val)
case "events":
info.Events = val
case "cmd":
info.LastCmd = val
case "user":
info.User = val
case "redir":
info.Redir, err = strconv.ParseInt(val, 10, 64)
case "resp":
info.Resp, err = strconv.Atoi(val)
case "lib-name":
info.LibName = val
case "lib-ver":
info.LibVer = val
case "io-thread":
info.IoThread, err = strconv.Atoi(val)
default:
return nil, fmt.Errorf("redis: unexpected client info key(%s)", key)
}
if err != nil {
return nil, err
}
}
return info, nil
}
func (cmd *ClientInfoCmd) Clone() Cmder {
var val *ClientInfo
if cmd.val != nil {
val = &ClientInfo{
ID: cmd.val.ID,
Addr: cmd.val.Addr,
LAddr: cmd.val.LAddr,
FD: cmd.val.FD,
Name: cmd.val.Name,
Age: cmd.val.Age,
Idle: cmd.val.Idle,
Flags: cmd.val.Flags,
DB: cmd.val.DB,
Sub: cmd.val.Sub,
PSub: cmd.val.PSub,
SSub: cmd.val.SSub,
Multi: cmd.val.Multi,
Watch: cmd.val.Watch,
QueryBuf: cmd.val.QueryBuf,
QueryBufFree: cmd.val.QueryBufFree,
ArgvMem: cmd.val.ArgvMem,
MultiMem: cmd.val.MultiMem,
BufferSize: cmd.val.BufferSize,
BufferPeak: cmd.val.BufferPeak,
OutputBufferLength: cmd.val.OutputBufferLength,
OutputListLength: cmd.val.OutputListLength,
OutputMemory: cmd.val.OutputMemory,
TotalMemory: cmd.val.TotalMemory,
IoThread: cmd.val.IoThread,
Events: cmd.val.Events,
LastCmd: cmd.val.LastCmd,
User: cmd.val.User,
Redir: cmd.val.Redir,
Resp: cmd.val.Resp,
LibName: cmd.val.LibName,
LibVer: cmd.val.LibVer,
}
}
return &ClientInfoCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
// -------------------------------------------
type ACLLogEntry struct {
Count int64
Reason string
Context string
Object string
Username string
AgeSeconds float64
ClientInfo *ClientInfo
EntryID int64
TimestampCreated int64
TimestampLastUpdated int64
}
type ACLLogCmd struct {
baseCmd
val []*ACLLogEntry
}
var _ Cmder = (*ACLLogCmd)(nil)
func NewACLLogCmd(ctx context.Context, args ...interface{}) *ACLLogCmd {
return &ACLLogCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeACLLog,
},
}
}
func (cmd *ACLLogCmd) SetVal(val []*ACLLogEntry) {
cmd.val = val
}
func (cmd *ACLLogCmd) Val() []*ACLLogEntry {
return cmd.val
}
func (cmd *ACLLogCmd) Result() ([]*ACLLogEntry, error) {
return cmd.val, cmd.err
}
func (cmd *ACLLogCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *ACLLogCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]*ACLLogEntry, n)
for i := 0; i < n; i++ {
cmd.val[i] = &ACLLogEntry{}
entry := cmd.val[i]
respLen, err := rd.ReadMapLen()
if err != nil {
return err
}
for j := 0; j < respLen; j++ {
key, err := rd.ReadString()
if err != nil {
return err
}
switch key {
case "count":
entry.Count, err = rd.ReadInt()
case "reason":
entry.Reason, err = rd.ReadString()
case "context":
entry.Context, err = rd.ReadString()
case "object":
entry.Object, err = rd.ReadString()
case "username":
entry.Username, err = rd.ReadString()
case "age-seconds":
entry.AgeSeconds, err = rd.ReadFloat()
case "client-info":
txt, err := rd.ReadString()
if err != nil {
return err
}
entry.ClientInfo, err = parseClientInfo(strings.TrimSpace(txt))
if err != nil {
return err
}
case "entry-id":
entry.EntryID, err = rd.ReadInt()
case "timestamp-created":
entry.TimestampCreated, err = rd.ReadInt()
case "timestamp-last-updated":
entry.TimestampLastUpdated, err = rd.ReadInt()
default:
return fmt.Errorf("redis: unexpected key %q in ACL LOG reply", key)
}
if err != nil {
return err
}
}
}
return nil
}
func (cmd *ACLLogCmd) Clone() Cmder {
var val []*ACLLogEntry
if cmd.val != nil {
val = make([]*ACLLogEntry, len(cmd.val))
for i, entry := range cmd.val {
if entry != nil {
val[i] = &ACLLogEntry{
Count: entry.Count,
Reason: entry.Reason,
Context: entry.Context,
Object: entry.Object,
Username: entry.Username,
AgeSeconds: entry.AgeSeconds,
EntryID: entry.EntryID,
TimestampCreated: entry.TimestampCreated,
TimestampLastUpdated: entry.TimestampLastUpdated,
}
// Clone ClientInfo if present
if entry.ClientInfo != nil {
val[i].ClientInfo = &ClientInfo{
ID: entry.ClientInfo.ID,
Addr: entry.ClientInfo.Addr,
LAddr: entry.ClientInfo.LAddr,
FD: entry.ClientInfo.FD,
Name: entry.ClientInfo.Name,
Age: entry.ClientInfo.Age,
Idle: entry.ClientInfo.Idle,
Flags: entry.ClientInfo.Flags,
DB: entry.ClientInfo.DB,
Sub: entry.ClientInfo.Sub,
PSub: entry.ClientInfo.PSub,
SSub: entry.ClientInfo.SSub,
Multi: entry.ClientInfo.Multi,
Watch: entry.ClientInfo.Watch,
QueryBuf: entry.ClientInfo.QueryBuf,
QueryBufFree: entry.ClientInfo.QueryBufFree,
ArgvMem: entry.ClientInfo.ArgvMem,
MultiMem: entry.ClientInfo.MultiMem,
BufferSize: entry.ClientInfo.BufferSize,
BufferPeak: entry.ClientInfo.BufferPeak,
OutputBufferLength: entry.ClientInfo.OutputBufferLength,
OutputListLength: entry.ClientInfo.OutputListLength,
OutputMemory: entry.ClientInfo.OutputMemory,
TotalMemory: entry.ClientInfo.TotalMemory,
IoThread: entry.ClientInfo.IoThread,
Events: entry.ClientInfo.Events,
LastCmd: entry.ClientInfo.LastCmd,
User: entry.ClientInfo.User,
Redir: entry.ClientInfo.Redir,
Resp: entry.ClientInfo.Resp,
LibName: entry.ClientInfo.LibName,
LibVer: entry.ClientInfo.LibVer,
}
}
}
}
}
return &ACLLogCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
// LibraryInfo holds the library info.
type LibraryInfo struct {
LibName *string
LibVer *string
}
// WithLibraryName returns a valid LibraryInfo with library name only.
func WithLibraryName(libName string) LibraryInfo {
return LibraryInfo{LibName: &libName}
}
// WithLibraryVersion returns a valid LibraryInfo with library version only.
func WithLibraryVersion(libVer string) LibraryInfo {
return LibraryInfo{LibVer: &libVer}
}
// -------------------------------------------
type InfoCmd struct {
baseCmd
val map[string]map[string]string
}
var _ Cmder = (*InfoCmd)(nil)
func NewInfoCmd(ctx context.Context, args ...interface{}) *InfoCmd {
return &InfoCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeInfo,
},
}
}
func (cmd *InfoCmd) SetVal(val map[string]map[string]string) {
cmd.val = val
}
func (cmd *InfoCmd) Val() map[string]map[string]string {
return cmd.val
}
func (cmd *InfoCmd) Result() (map[string]map[string]string, error) {
return cmd.val, cmd.err
}
func (cmd *InfoCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *InfoCmd) readReply(rd *proto.Reader) error {
val, err := rd.ReadString()
if err != nil {
return err
}
section := ""
scanner := bufio.NewScanner(strings.NewReader(val))
for scanner.Scan() {
line := scanner.Text()
if strings.HasPrefix(line, "#") {
if cmd.val == nil {
cmd.val = make(map[string]map[string]string)
}
section = strings.TrimPrefix(line, "# ")
cmd.val[section] = make(map[string]string)
} else if line != "" {
if section == "Modules" {
moduleRe := regexp.MustCompile(`module:name=(.+?),(.+)$`)
kv := moduleRe.FindStringSubmatch(line)
if len(kv) == 3 {
cmd.val[section][kv[1]] = kv[2]
}
} else {
kv := strings.SplitN(line, ":", 2)
if len(kv) == 2 {
cmd.val[section][kv[0]] = kv[1]
}
}
}
}
return nil
}
func (cmd *InfoCmd) Item(section, key string) string {
if cmd.val == nil {
return ""
} else if cmd.val[section] == nil {
return ""
} else {
return cmd.val[section][key]
}
}
func (cmd *InfoCmd) Clone() Cmder {
var val map[string]map[string]string
if cmd.val != nil {
val = make(map[string]map[string]string, len(cmd.val))
for section, sectionMap := range cmd.val {
if sectionMap != nil {
val[section] = make(map[string]string, len(sectionMap))
for k, v := range sectionMap {
val[section][k] = v
}
}
}
}
return &InfoCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
type MonitorStatus int
const (
monitorStatusIdle MonitorStatus = iota
monitorStatusStart
monitorStatusStop
)
type MonitorCmd struct {
baseCmd
ch chan string
status MonitorStatus
mu sync.Mutex
}
func newMonitorCmd(ctx context.Context, ch chan string) *MonitorCmd {
return &MonitorCmd{
baseCmd: baseCmd{
ctx: ctx,
args: []interface{}{"monitor"},
cmdType: CmdTypeMonitor,
},
ch: ch,
status: monitorStatusIdle,
mu: sync.Mutex{},
}
}
func (cmd *MonitorCmd) String() string {
return cmdString(cmd, nil)
}
func (cmd *MonitorCmd) readReply(rd *proto.Reader) error {
ctx, cancel := context.WithCancel(cmd.ctx)
go func(ctx context.Context) {
for {
select {
case <-ctx.Done():
return
default:
err := cmd.readMonitor(rd, cancel)
if err != nil {
cmd.err = err
return
}
}
}
}(ctx)
return nil
}
func (cmd *MonitorCmd) readMonitor(rd *proto.Reader, cancel context.CancelFunc) error {
for {
cmd.mu.Lock()
st := cmd.status
pk, _ := rd.Peek(1)
cmd.mu.Unlock()
if len(pk) != 0 && st == monitorStatusStart {
cmd.mu.Lock()
line, err := rd.ReadString()
cmd.mu.Unlock()
if err != nil {
return err
}
cmd.ch <- line
}
if st == monitorStatusStop {
cancel()
break
}
}
return nil
}
func (cmd *MonitorCmd) Start() {
cmd.mu.Lock()
defer cmd.mu.Unlock()
cmd.status = monitorStatusStart
}
func (cmd *MonitorCmd) Stop() {
cmd.mu.Lock()
defer cmd.mu.Unlock()
cmd.status = monitorStatusStop
}
type VectorScoreSliceCmd struct {
baseCmd
val []VectorScore
}
var _ Cmder = (*VectorScoreSliceCmd)(nil)
func NewVectorInfoSliceCmd(ctx context.Context, args ...any) *VectorScoreSliceCmd {
return &VectorScoreSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
},
}
}
func (cmd *VectorScoreSliceCmd) SetVal(val []VectorScore) {
cmd.val = val
}
func (cmd *VectorScoreSliceCmd) Val() []VectorScore {
return cmd.val
}
func (cmd *VectorScoreSliceCmd) Result() ([]VectorScore, error) {
return cmd.val, cmd.err
}
func (cmd *VectorScoreSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *VectorScoreSliceCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
cmd.val = make([]VectorScore, n)
for i := 0; i < n; i++ {
name, err := rd.ReadString()
if err != nil {
return err
}
cmd.val[i].Name = name
score, err := rd.ReadFloat()
if err != nil {
return err
}
cmd.val[i].Score = score
}
return nil
}
func (cmd *VectorScoreSliceCmd) Clone() Cmder {
return &VectorScoreSliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val,
}
}
func (cmd *MonitorCmd) Clone() Cmder {
// MonitorCmd cannot be safely cloned due to channels and goroutines
// Return a new MonitorCmd with the same channel
return newMonitorCmd(cmd.ctx, cmd.ch)
}
// ExtractCommandValue extracts the value from a command result using the fast enum-based approach
func ExtractCommandValue(cmd interface{}) (interface{}, error) {
// First try to get the command type using the interface
if cmdTypeGetter, ok := cmd.(CmdTypeGetter); ok {
cmdType := cmdTypeGetter.GetCmdType()
// Use fast type-based extraction
switch cmdType {
case CmdTypeGeneric:
if genericCmd, ok := cmd.(interface {
Val() interface{}
Err() error
}); ok {
return genericCmd.Val(), genericCmd.Err()
}
case CmdTypeString:
if stringCmd, ok := cmd.(interface {
Val() string
Err() error
}); ok {
return stringCmd.Val(), stringCmd.Err()
}
case CmdTypeInt:
if intCmd, ok := cmd.(interface {
Val() int64
Err() error
}); ok {
return intCmd.Val(), intCmd.Err()
}
case CmdTypeBool:
if boolCmd, ok := cmd.(interface {
Val() bool
Err() error
}); ok {
return boolCmd.Val(), boolCmd.Err()
}
case CmdTypeFloat:
if floatCmd, ok := cmd.(interface {
Val() float64
Err() error
}); ok {
return floatCmd.Val(), floatCmd.Err()
}
case CmdTypeStatus:
if statusCmd, ok := cmd.(interface {
Val() string
Err() error
}); ok {
return statusCmd.Val(), statusCmd.Err()
}
case CmdTypeDuration:
if durationCmd, ok := cmd.(interface {
Val() time.Duration
Err() error
}); ok {
return durationCmd.Val(), durationCmd.Err()
}
case CmdTypeTime:
if timeCmd, ok := cmd.(interface {
Val() time.Time
Err() error
}); ok {
return timeCmd.Val(), timeCmd.Err()
}
case CmdTypeStringStructMap:
if structMapCmd, ok := cmd.(interface {
Val() map[string]struct{}
Err() error
}); ok {
return structMapCmd.Val(), structMapCmd.Err()
}
case CmdTypeXMessageSlice:
if xMessageSliceCmd, ok := cmd.(interface {
Val() []XMessage
Err() error
}); ok {
return xMessageSliceCmd.Val(), xMessageSliceCmd.Err()
}
case CmdTypeXStreamSlice:
if xStreamSliceCmd, ok := cmd.(interface {
Val() []XStream
Err() error
}); ok {
return xStreamSliceCmd.Val(), xStreamSliceCmd.Err()
}
case CmdTypeXPending:
if xPendingCmd, ok := cmd.(interface {
Val() *XPending
Err() error
}); ok {
return xPendingCmd.Val(), xPendingCmd.Err()
}
case CmdTypeXPendingExt:
if xPendingExtCmd, ok := cmd.(interface {
Val() []XPendingExt
Err() error
}); ok {
return xPendingExtCmd.Val(), xPendingExtCmd.Err()
}
case CmdTypeXAutoClaim:
if xAutoClaimCmd, ok := cmd.(interface {
Val() ([]XMessage, string)
Err() error
}); ok {
messages, start := xAutoClaimCmd.Val()
return CmdTypeXAutoClaimValue{messages: messages, start: start}, xAutoClaimCmd.Err()
}
case CmdTypeXAutoClaimJustID:
if xAutoClaimJustIDCmd, ok := cmd.(interface {
Val() ([]string, string)
Err() error
}); ok {
ids, start := xAutoClaimJustIDCmd.Val()
return CmdTypeXAutoClaimJustIDValue{ids: ids, start: start}, xAutoClaimJustIDCmd.Err()
}
case CmdTypeXInfoConsumers:
if xInfoConsumersCmd, ok := cmd.(interface {
Val() []XInfoConsumer
Err() error
}); ok {
return xInfoConsumersCmd.Val(), xInfoConsumersCmd.Err()
}
case CmdTypeXInfoGroups:
if xInfoGroupsCmd, ok := cmd.(interface {
Val() []XInfoGroup
Err() error
}); ok {
return xInfoGroupsCmd.Val(), xInfoGroupsCmd.Err()
}
case CmdTypeXInfoStream:
if xInfoStreamCmd, ok := cmd.(interface {
Val() *XInfoStream
Err() error
}); ok {
return xInfoStreamCmd.Val(), xInfoStreamCmd.Err()
}
case CmdTypeXInfoStreamFull:
if xInfoStreamFullCmd, ok := cmd.(interface {
Val() *XInfoStreamFull
Err() error
}); ok {
return xInfoStreamFullCmd.Val(), xInfoStreamFullCmd.Err()
}
case CmdTypeZSlice:
if zSliceCmd, ok := cmd.(interface {
Val() []Z
Err() error
}); ok {
return zSliceCmd.Val(), zSliceCmd.Err()
}
case CmdTypeZWithKey:
if zWithKeyCmd, ok := cmd.(interface {
Val() *ZWithKey
Err() error
}); ok {
return zWithKeyCmd.Val(), zWithKeyCmd.Err()
}
case CmdTypeScan:
if scanCmd, ok := cmd.(interface {
Val() ([]string, uint64)
Err() error
}); ok {
keys, cursor := scanCmd.Val()
return CmdTypeScanValue{keys: keys, cursor: cursor}, scanCmd.Err()
}
case CmdTypeClusterSlots:
if clusterSlotsCmd, ok := cmd.(interface {
Val() []ClusterSlot
Err() error
}); ok {
return clusterSlotsCmd.Val(), clusterSlotsCmd.Err()
}
case CmdTypeGeoLocation:
if geoLocationCmd, ok := cmd.(interface {
Val() []GeoLocation
Err() error
}); ok {
return geoLocationCmd.Val(), geoLocationCmd.Err()
}
case CmdTypeGeoSearchLocation:
if geoSearchLocationCmd, ok := cmd.(interface {
Val() []GeoLocation
Err() error
}); ok {
return geoSearchLocationCmd.Val(), geoSearchLocationCmd.Err()
}
case CmdTypeGeoPos:
if geoPosCmd, ok := cmd.(interface {
Val() []*GeoPos
Err() error
}); ok {
return geoPosCmd.Val(), geoPosCmd.Err()
}
case CmdTypeCommandsInfo:
if commandsInfoCmd, ok := cmd.(interface {
Val() map[string]*CommandInfo
Err() error
}); ok {
return commandsInfoCmd.Val(), commandsInfoCmd.Err()
}
case CmdTypeSlowLog:
if slowLogCmd, ok := cmd.(interface {
Val() []SlowLog
Err() error
}); ok {
return slowLogCmd.Val(), slowLogCmd.Err()
}
case CmdTypeHotKeys:
if hotKeysCmd, ok := cmd.(interface {
Val() *HotKeysResult
Err() error
}); ok {
return hotKeysCmd.Val(), hotKeysCmd.Err()
}
case CmdTypeKeyValues:
if keyValuesCmd, ok := cmd.(interface {
Val() (string, []string)
Err() error
}); ok {
key, values := keyValuesCmd.Val()
return CmdTypeKeyValuesValue{key: key, values: values}, keyValuesCmd.Err()
}
case CmdTypeZSliceWithKey:
if zSliceWithKeyCmd, ok := cmd.(interface {
Val() (string, []Z)
Err() error
}); ok {
key, zSlice := zSliceWithKeyCmd.Val()
return CmdTypeZSliceWithKeyValue{key: key, zSlice: zSlice}, zSliceWithKeyCmd.Err()
}
case CmdTypeFunctionList:
if functionListCmd, ok := cmd.(interface {
Val() []Library
Err() error
}); ok {
return functionListCmd.Val(), functionListCmd.Err()
}
case CmdTypeFunctionStats:
if functionStatsCmd, ok := cmd.(interface {
Val() FunctionStats
Err() error
}); ok {
return functionStatsCmd.Val(), functionStatsCmd.Err()
}
case CmdTypeLCS:
if lcsCmd, ok := cmd.(interface {
Val() *LCSMatch
Err() error
}); ok {
return lcsCmd.Val(), lcsCmd.Err()
}
case CmdTypeKeyFlags:
if keyFlagsCmd, ok := cmd.(interface {
Val() []KeyFlags
Err() error
}); ok {
return keyFlagsCmd.Val(), keyFlagsCmd.Err()
}
case CmdTypeClusterLinks:
if clusterLinksCmd, ok := cmd.(interface {
Val() []ClusterLink
Err() error
}); ok {
return clusterLinksCmd.Val(), clusterLinksCmd.Err()
}
case CmdTypeClusterShards:
if clusterShardsCmd, ok := cmd.(interface {
Val() []ClusterShard
Err() error
}); ok {
return clusterShardsCmd.Val(), clusterShardsCmd.Err()
}
case CmdTypeRankWithScore:
if rankWithScoreCmd, ok := cmd.(interface {
Val() RankScore
Err() error
}); ok {
return rankWithScoreCmd.Val(), rankWithScoreCmd.Err()
}
case CmdTypeClientInfo:
if clientInfoCmd, ok := cmd.(interface {
Val() *ClientInfo
Err() error
}); ok {
return clientInfoCmd.Val(), clientInfoCmd.Err()
}
case CmdTypeACLLog:
if aclLogCmd, ok := cmd.(interface {
Val() []*ACLLogEntry
Err() error
}); ok {
return aclLogCmd.Val(), aclLogCmd.Err()
}
case CmdTypeInfo:
if infoCmd, ok := cmd.(interface {
Val() string
Err() error
}); ok {
return infoCmd.Val(), infoCmd.Err()
}
case CmdTypeMonitor:
if monitorCmd, ok := cmd.(interface {
Val() string
Err() error
}); ok {
return monitorCmd.Val(), monitorCmd.Err()
}
case CmdTypeJSON:
if jsonCmd, ok := cmd.(interface {
Val() string
Err() error
}); ok {
return jsonCmd.Val(), jsonCmd.Err()
}
case CmdTypeJSONSlice:
if jsonSliceCmd, ok := cmd.(interface {
Val() []interface{}
Err() error
}); ok {
return jsonSliceCmd.Val(), jsonSliceCmd.Err()
}
case CmdTypeIntPointerSlice:
if intPointerSliceCmd, ok := cmd.(interface {
Val() []*int64
Err() error
}); ok {
return intPointerSliceCmd.Val(), intPointerSliceCmd.Err()
}
case CmdTypeScanDump:
if scanDumpCmd, ok := cmd.(interface {
Val() ScanDump
Err() error
}); ok {
return scanDumpCmd.Val(), scanDumpCmd.Err()
}
case CmdTypeBFInfo:
if bfInfoCmd, ok := cmd.(interface {
Val() BFInfo
Err() error
}); ok {
return bfInfoCmd.Val(), bfInfoCmd.Err()
}
case CmdTypeCFInfo:
if cfInfoCmd, ok := cmd.(interface {
Val() CFInfo
Err() error
}); ok {
return cfInfoCmd.Val(), cfInfoCmd.Err()
}
case CmdTypeCMSInfo:
if cmsInfoCmd, ok := cmd.(interface {
Val() CMSInfo
Err() error
}); ok {
return cmsInfoCmd.Val(), cmsInfoCmd.Err()
}
case CmdTypeTopKInfo:
if topKInfoCmd, ok := cmd.(interface {
Val() TopKInfo
Err() error
}); ok {
return topKInfoCmd.Val(), topKInfoCmd.Err()
}
case CmdTypeTDigestInfo:
if tDigestInfoCmd, ok := cmd.(interface {
Val() TDigestInfo
Err() error
}); ok {
return tDigestInfoCmd.Val(), tDigestInfoCmd.Err()
}
case CmdTypeFTSearch:
if ftSearchCmd, ok := cmd.(interface {
Val() FTSearchResult
Err() error
}); ok {
return ftSearchCmd.Val(), ftSearchCmd.Err()
}
case CmdTypeFTInfo:
if ftInfoCmd, ok := cmd.(interface {
Val() FTInfoResult
Err() error
}); ok {
return ftInfoCmd.Val(), ftInfoCmd.Err()
}
case CmdTypeFTSpellCheck:
if ftSpellCheckCmd, ok := cmd.(interface {
Val() []SpellCheckResult
Err() error
}); ok {
return ftSpellCheckCmd.Val(), ftSpellCheckCmd.Err()
}
case CmdTypeFTSynDump:
if ftSynDumpCmd, ok := cmd.(interface {
Val() []FTSynDumpResult
Err() error
}); ok {
return ftSynDumpCmd.Val(), ftSynDumpCmd.Err()
}
case CmdTypeAggregate:
if aggregateCmd, ok := cmd.(interface {
Val() *FTAggregateResult
Err() error
}); ok {
return aggregateCmd.Val(), aggregateCmd.Err()
}
case CmdTypeTSTimestampValue:
if tsTimestampValueCmd, ok := cmd.(interface {
Val() TSTimestampValue
Err() error
}); ok {
return tsTimestampValueCmd.Val(), tsTimestampValueCmd.Err()
}
case CmdTypeTSTimestampValueSlice:
if tsTimestampValueSliceCmd, ok := cmd.(interface {
Val() []TSTimestampValue
Err() error
}); ok {
return tsTimestampValueSliceCmd.Val(), tsTimestampValueSliceCmd.Err()
}
case CmdTypeStringSlice:
if stringSliceCmd, ok := cmd.(interface {
Val() []string
Err() error
}); ok {
return stringSliceCmd.Val(), stringSliceCmd.Err()
}
case CmdTypeIntSlice:
if intSliceCmd, ok := cmd.(interface {
Val() []int64
Err() error
}); ok {
return intSliceCmd.Val(), intSliceCmd.Err()
}
case CmdTypeBoolSlice:
if boolSliceCmd, ok := cmd.(interface {
Val() []bool
Err() error
}); ok {
return boolSliceCmd.Val(), boolSliceCmd.Err()
}
case CmdTypeFloatSlice:
if floatSliceCmd, ok := cmd.(interface {
Val() []float64
Err() error
}); ok {
return floatSliceCmd.Val(), floatSliceCmd.Err()
}
case CmdTypeSlice:
if sliceCmd, ok := cmd.(interface {
Val() []interface{}
Err() error
}); ok {
return sliceCmd.Val(), sliceCmd.Err()
}
case CmdTypeKeyValueSlice:
if keyValueSliceCmd, ok := cmd.(interface {
Val() []KeyValue
Err() error
}); ok {
return keyValueSliceCmd.Val(), keyValueSliceCmd.Err()
}
case CmdTypeMapStringString:
if mapCmd, ok := cmd.(interface {
Val() map[string]string
Err() error
}); ok {
return mapCmd.Val(), mapCmd.Err()
}
case CmdTypeMapStringInt:
if mapCmd, ok := cmd.(interface {
Val() map[string]int64
Err() error
}); ok {
return mapCmd.Val(), mapCmd.Err()
}
case CmdTypeMapStringInterfaceSlice:
if mapCmd, ok := cmd.(interface {
Val() []map[string]interface{}
Err() error
}); ok {
return mapCmd.Val(), mapCmd.Err()
}
case CmdTypeMapStringInterface:
if mapCmd, ok := cmd.(interface {
Val() map[string]interface{}
Err() error
}); ok {
return mapCmd.Val(), mapCmd.Err()
}
case CmdTypeMapStringStringSlice:
if mapCmd, ok := cmd.(interface {
Val() []map[string]string
Err() error
}); ok {
return mapCmd.Val(), mapCmd.Err()
}
case CmdTypeMapMapStringInterface:
if mapCmd, ok := cmd.(interface {
Val() map[string]interface{}
Err() error
}); ok {
return mapCmd.Val(), mapCmd.Err()
}
default:
// For unknown command types, return nil
return nil, nil
}
}
// If we can't get the command type, return nil
return nil, nil
}
package redis
import (
"context"
"strings"
"github.com/redis/go-redis/v9/internal/routing"
)
type (
module = string
commandName = string
)
var defaultPolicies = map[module]map[commandName]*routing.CommandPolicy{
"ft": {
"create": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
},
"search": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
Tips: map[string]string{
routing.ReadOnlyCMD: "",
},
},
"aggregate": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
Tips: map[string]string{
routing.ReadOnlyCMD: "",
},
},
"dictadd": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
},
"dictdump": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
Tips: map[string]string{
routing.ReadOnlyCMD: "",
},
},
"dictdel": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
},
"suglen": {
Request: routing.ReqDefault,
Response: routing.RespDefaultHashSlot,
Tips: map[string]string{
routing.ReadOnlyCMD: "",
},
},
"cursor": {
Request: routing.ReqSpecial,
Response: routing.RespDefaultKeyless,
Tips: map[string]string{
routing.ReadOnlyCMD: "",
},
},
"sugadd": {
Request: routing.ReqDefault,
Response: routing.RespDefaultHashSlot,
},
"sugget": {
Request: routing.ReqDefault,
Response: routing.RespDefaultHashSlot,
Tips: map[string]string{
routing.ReadOnlyCMD: "",
},
},
"sugdel": {
Request: routing.ReqDefault,
Response: routing.RespDefaultHashSlot,
},
"spellcheck": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
Tips: map[string]string{
routing.ReadOnlyCMD: "",
},
},
"explain": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
Tips: map[string]string{
routing.ReadOnlyCMD: "",
},
},
"explaincli": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
Tips: map[string]string{
routing.ReadOnlyCMD: "",
},
},
"aliasadd": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
},
"aliasupdate": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
},
"aliasdel": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
},
"info": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
Tips: map[string]string{
routing.ReadOnlyCMD: "",
},
},
"tagvals": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
Tips: map[string]string{
routing.ReadOnlyCMD: "",
},
},
"syndump": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
Tips: map[string]string{
routing.ReadOnlyCMD: "",
},
},
"synupdate": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
},
"profile": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
Tips: map[string]string{
routing.ReadOnlyCMD: "",
},
},
"alter": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
},
"dropindex": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
},
"drop": {
Request: routing.ReqDefault,
Response: routing.RespDefaultKeyless,
},
},
}
type CommandInfoResolveFunc func(ctx context.Context, cmd Cmder) *routing.CommandPolicy
type commandInfoResolver struct {
resolveFunc CommandInfoResolveFunc
fallBackResolver *commandInfoResolver
}
func NewCommandInfoResolver(resolveFunc CommandInfoResolveFunc) *commandInfoResolver {
return &commandInfoResolver{
resolveFunc: resolveFunc,
}
}
func NewDefaultCommandPolicyResolver() *commandInfoResolver {
return NewCommandInfoResolver(func(ctx context.Context, cmd Cmder) *routing.CommandPolicy {
module := "core"
command := cmd.Name()
cmdParts := strings.Split(command, ".")
if len(cmdParts) == 2 {
module = cmdParts[0]
command = cmdParts[1]
}
if policy, ok := defaultPolicies[module][command]; ok {
return policy
}
return nil
})
}
func (r *commandInfoResolver) GetCommandPolicy(ctx context.Context, cmd Cmder) *routing.CommandPolicy {
if r.resolveFunc == nil {
return nil
}
policy := r.resolveFunc(ctx, cmd)
if policy != nil {
return policy
}
if r.fallBackResolver != nil {
return r.fallBackResolver.GetCommandPolicy(ctx, cmd)
}
return nil
}
func (r *commandInfoResolver) SetFallbackResolver(fallbackResolver *commandInfoResolver) {
r.fallBackResolver = fallbackResolver
}
package redis
import (
"context"
"encoding"
"errors"
"fmt"
"io"
"net"
"reflect"
"runtime"
"strings"
"time"
"github.com/redis/go-redis/v9/internal"
)
// KeepTTL is a Redis KEEPTTL option to keep existing TTL, it requires your redis-server version >= 6.0,
// otherwise you will receive an error: (error) ERR syntax error.
// For example:
//
// rdb.Set(ctx, key, value, redis.KeepTTL)
const KeepTTL = -1
func usePrecise(dur time.Duration) bool {
return dur < time.Second || dur%time.Second != 0
}
func formatMs(ctx context.Context, dur time.Duration) int64 {
if dur > 0 && dur < time.Millisecond {
internal.Logger.Printf(
ctx,
"specified duration is %s, but minimal supported value is %s - truncating to 1ms",
dur, time.Millisecond,
)
return 1
}
return int64(dur / time.Millisecond)
}
func formatSec(ctx context.Context, dur time.Duration) int64 {
if dur > 0 && dur < time.Second {
internal.Logger.Printf(
ctx,
"specified duration is %s, but minimal supported value is %s - truncating to 1s",
dur, time.Second,
)
return 1
}
return int64(dur / time.Second)
}
func appendArgs(dst, src []interface{}) []interface{} {
if len(src) == 1 {
return appendArg(dst, src[0])
}
if cap(dst) < len(dst)+len(src) {
newDst := make([]interface{}, len(dst), len(dst)+len(src))
copy(newDst, dst)
dst = newDst
}
dst = append(dst, src...)
return dst
}
func appendArg(dst []interface{}, arg interface{}) []interface{} {
switch arg := arg.(type) {
case []string:
for _, s := range arg {
dst = append(dst, s)
}
return dst
case []interface{}:
dst = append(dst, arg...)
return dst
case map[string]interface{}:
for k, v := range arg {
dst = append(dst, k, v)
}
return dst
case map[string]string:
for k, v := range arg {
dst = append(dst, k, v)
}
return dst
case time.Time, time.Duration, encoding.BinaryMarshaler, net.IP:
return append(dst, arg)
case nil:
return dst
default:
// scan struct field
v := reflect.ValueOf(arg)
if v.Type().Kind() == reflect.Ptr {
if v.IsNil() {
// error: arg is not a valid object
return dst
}
v = v.Elem()
}
if v.Type().Kind() == reflect.Struct {
return appendStructField(dst, v)
}
return append(dst, arg)
}
}
// appendStructField appends the field and value held by the structure v to dst, and returns the appended dst.
func appendStructField(dst []interface{}, v reflect.Value) []interface{} {
typ := v.Type()
for i := 0; i < typ.NumField(); i++ {
tag := typ.Field(i).Tag.Get("redis")
if tag == "" || tag == "-" {
continue
}
name, opt, _ := strings.Cut(tag, ",")
if name == "" {
continue
}
field := v.Field(i)
// miss field
if omitEmpty(opt) && isEmptyValue(field) {
continue
}
if field.CanInterface() {
dst = append(dst, name, field.Interface())
}
}
return dst
}
func omitEmpty(opt string) bool {
for opt != "" {
var name string
name, opt, _ = strings.Cut(opt, ",")
if name == "omitempty" {
return true
}
}
return false
}
func isEmptyValue(v reflect.Value) bool {
switch v.Kind() {
case reflect.Array, reflect.Map, reflect.Slice, reflect.String:
return v.Len() == 0
case reflect.Bool:
return !v.Bool()
case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64:
return v.Int() == 0
case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr:
return v.Uint() == 0
case reflect.Float32, reflect.Float64:
return v.Float() == 0
case reflect.Interface, reflect.Pointer:
return v.IsNil()
case reflect.Struct:
if v.Type() == reflect.TypeOf(time.Time{}) {
return v.IsZero()
}
// Only supports the struct time.Time,
// subsequent iterations will follow the func Scan support decoder.
}
return false
}
type Cmdable interface {
Pipeline() Pipeliner
Pipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error)
TxPipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error)
TxPipeline() Pipeliner
Command(ctx context.Context) *CommandsInfoCmd
CommandList(ctx context.Context, filter *FilterBy) *StringSliceCmd
CommandGetKeys(ctx context.Context, commands ...interface{}) *StringSliceCmd
CommandGetKeysAndFlags(ctx context.Context, commands ...interface{}) *KeyFlagsCmd
ClientGetName(ctx context.Context) *StringCmd
Echo(ctx context.Context, message interface{}) *StringCmd
Ping(ctx context.Context) *StatusCmd
Quit(ctx context.Context) *StatusCmd
Unlink(ctx context.Context, keys ...string) *IntCmd
BgRewriteAOF(ctx context.Context) *StatusCmd
BgSave(ctx context.Context) *StatusCmd
ClientKill(ctx context.Context, ipPort string) *StatusCmd
ClientKillByFilter(ctx context.Context, keys ...string) *IntCmd
ClientList(ctx context.Context) *StringCmd
ClientInfo(ctx context.Context) *ClientInfoCmd
ClientPause(ctx context.Context, dur time.Duration) *BoolCmd
ClientUnpause(ctx context.Context) *BoolCmd
ClientID(ctx context.Context) *IntCmd
ClientUnblock(ctx context.Context, id int64) *IntCmd
ClientUnblockWithError(ctx context.Context, id int64) *IntCmd
ClientMaintNotifications(ctx context.Context, enabled bool, endpointType string) *StatusCmd
ConfigGet(ctx context.Context, parameter string) *MapStringStringCmd
ConfigResetStat(ctx context.Context) *StatusCmd
ConfigSet(ctx context.Context, parameter, value string) *StatusCmd
ConfigRewrite(ctx context.Context) *StatusCmd
DBSize(ctx context.Context) *IntCmd
FlushAll(ctx context.Context) *StatusCmd
FlushAllAsync(ctx context.Context) *StatusCmd
FlushDB(ctx context.Context) *StatusCmd
FlushDBAsync(ctx context.Context) *StatusCmd
Info(ctx context.Context, section ...string) *StringCmd
LastSave(ctx context.Context) *IntCmd
Save(ctx context.Context) *StatusCmd
Shutdown(ctx context.Context) *StatusCmd
ShutdownSave(ctx context.Context) *StatusCmd
ShutdownNoSave(ctx context.Context) *StatusCmd
SlaveOf(ctx context.Context, host, port string) *StatusCmd
SlowLogGet(ctx context.Context, num int64) *SlowLogCmd
SlowLogLen(ctx context.Context) *IntCmd
SlowLogReset(ctx context.Context) *StatusCmd
Time(ctx context.Context) *TimeCmd
DebugObject(ctx context.Context, key string) *StringCmd
MemoryUsage(ctx context.Context, key string, samples ...int) *IntCmd
Latency(ctx context.Context) *LatencyCmd
LatencyReset(ctx context.Context, events ...interface{}) *StatusCmd
ModuleLoadex(ctx context.Context, conf *ModuleLoadexConfig) *StringCmd
ACLCmdable
BitMapCmdable
ClusterCmdable
GenericCmdable
GeoCmdable
HashCmdable
HyperLogLogCmdable
ListCmdable
ProbabilisticCmdable
PubSubCmdable
ScriptingFunctionsCmdable
SearchCmdable
SetCmdable
SortedSetCmdable
StringCmdable
StreamCmdable
TimeseriesCmdable
JSONCmdable
VectorSetCmdable
}
type StatefulCmdable interface {
Cmdable
Auth(ctx context.Context, password string) *StatusCmd
AuthACL(ctx context.Context, username, password string) *StatusCmd
Select(ctx context.Context, index int) *StatusCmd
SwapDB(ctx context.Context, index1, index2 int) *StatusCmd
ClientSetName(ctx context.Context, name string) *BoolCmd
ClientSetInfo(ctx context.Context, info LibraryInfo) *StatusCmd
Hello(ctx context.Context, ver int, username, password, clientName string) *MapStringInterfaceCmd
}
var (
_ Cmdable = (*Client)(nil)
_ Cmdable = (*Tx)(nil)
_ Cmdable = (*Ring)(nil)
_ Cmdable = (*ClusterClient)(nil)
_ Cmdable = (*Pipeline)(nil)
)
type cmdable func(ctx context.Context, cmd Cmder) error
type statefulCmdable func(ctx context.Context, cmd Cmder) error
//------------------------------------------------------------------------------
func (c statefulCmdable) Auth(ctx context.Context, password string) *StatusCmd {
cmd := NewStatusCmd(ctx, "auth", password)
_ = c(ctx, cmd)
return cmd
}
// AuthACL Perform an AUTH command, using the given user and pass.
// Should be used to authenticate the current connection with one of the connections defined in the ACL list
// when connecting to a Redis 6.0 instance, or greater, that is using the Redis ACL system.
func (c statefulCmdable) AuthACL(ctx context.Context, username, password string) *StatusCmd {
cmd := NewStatusCmd(ctx, "auth", username, password)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Wait(ctx context.Context, numSlaves int, timeout time.Duration) *IntCmd {
cmd := NewIntCmd(ctx, "wait", numSlaves, int(timeout/time.Millisecond))
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) WaitAOF(ctx context.Context, numLocal, numSlaves int, timeout time.Duration) *IntCmd {
cmd := NewIntCmd(ctx, "waitAOF", numLocal, numSlaves, int(timeout/time.Millisecond))
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
func (c statefulCmdable) Select(ctx context.Context, index int) *StatusCmd {
cmd := NewStatusCmd(ctx, "select", index)
_ = c(ctx, cmd)
return cmd
}
func (c statefulCmdable) SwapDB(ctx context.Context, index1, index2 int) *StatusCmd {
cmd := NewStatusCmd(ctx, "swapdb", index1, index2)
_ = c(ctx, cmd)
return cmd
}
// ClientSetName assigns a name to the connection.
func (c statefulCmdable) ClientSetName(ctx context.Context, name string) *BoolCmd {
cmd := NewBoolCmd(ctx, "client", "setname", name)
_ = c(ctx, cmd)
return cmd
}
// ClientSetInfo sends a CLIENT SETINFO command with the provided info.
func (c statefulCmdable) ClientSetInfo(ctx context.Context, info LibraryInfo) *StatusCmd {
err := info.Validate()
if err != nil {
panic(err.Error())
}
var cmd *StatusCmd
if info.LibName != nil {
libName := fmt.Sprintf("go-redis(%s,%s)", *info.LibName, internal.ReplaceSpaces(runtime.Version()))
cmd = NewStatusCmd(ctx, "client", "setinfo", "LIB-NAME", libName)
} else {
cmd = NewStatusCmd(ctx, "client", "setinfo", "LIB-VER", *info.LibVer)
}
_ = c(ctx, cmd)
return cmd
}
// Validate checks if only one field in the struct is non-nil.
func (info LibraryInfo) Validate() error {
if info.LibName != nil && info.LibVer != nil {
return errors.New("both LibName and LibVer cannot be set at the same time")
}
if info.LibName == nil && info.LibVer == nil {
return errors.New("at least one of LibName and LibVer should be set")
}
return nil
}
// Hello sets the resp protocol used.
func (c statefulCmdable) Hello(ctx context.Context,
ver int, username, password, clientName string,
) *MapStringInterfaceCmd {
args := make([]interface{}, 0, 7)
args = append(args, "hello", ver)
if password != "" {
if username != "" {
args = append(args, "auth", username, password)
} else {
args = append(args, "auth", "default", password)
}
}
if clientName != "" {
args = append(args, "setname", clientName)
}
cmd := NewMapStringInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
//------------------------------------------------------------------------------
func (c cmdable) Command(ctx context.Context) *CommandsInfoCmd {
cmd := NewCommandsInfoCmd(ctx, "command")
_ = c(ctx, cmd)
return cmd
}
// FilterBy is used for the `CommandList` command parameter.
type FilterBy struct {
Module string
ACLCat string
Pattern string
}
func (c cmdable) CommandList(ctx context.Context, filter *FilterBy) *StringSliceCmd {
args := make([]interface{}, 0, 5)
args = append(args, "command", "list")
if filter != nil {
if filter.Module != "" {
args = append(args, "filterby", "module", filter.Module)
} else if filter.ACLCat != "" {
args = append(args, "filterby", "aclcat", filter.ACLCat)
} else if filter.Pattern != "" {
args = append(args, "filterby", "pattern", filter.Pattern)
}
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) CommandGetKeys(ctx context.Context, commands ...interface{}) *StringSliceCmd {
args := make([]interface{}, 2+len(commands))
args[0] = "command"
args[1] = "getkeys"
copy(args[2:], commands)
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) CommandGetKeysAndFlags(ctx context.Context, commands ...interface{}) *KeyFlagsCmd {
args := make([]interface{}, 2+len(commands))
args[0] = "command"
args[1] = "getkeysandflags"
copy(args[2:], commands)
cmd := NewKeyFlagsCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// ClientGetName returns the name of the connection.
func (c cmdable) ClientGetName(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "client", "getname")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Echo(ctx context.Context, message interface{}) *StringCmd {
cmd := NewStringCmd(ctx, "echo", message)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Ping(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "ping")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Do(ctx context.Context, args ...interface{}) *Cmd {
cmd := NewCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Quit closes the connection.
//
// Deprecated: Just close the connection instead as of Redis 7.2.0.
func (c cmdable) Quit(_ context.Context) *StatusCmd {
panic("not implemented")
}
//------------------------------------------------------------------------------
func (c cmdable) BgRewriteAOF(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "bgrewriteaof")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) BgSave(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "bgsave")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientKill(ctx context.Context, ipPort string) *StatusCmd {
cmd := NewStatusCmd(ctx, "client", "kill", ipPort)
_ = c(ctx, cmd)
return cmd
}
// ClientKillByFilter is new style syntax, while the ClientKill is old
//
// CLIENT KILL <option> [value] ... <option> [value]
func (c cmdable) ClientKillByFilter(ctx context.Context, keys ...string) *IntCmd {
args := make([]interface{}, 2+len(keys))
args[0] = "client"
args[1] = "kill"
for i, key := range keys {
args[2+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientList(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "client", "list")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientPause(ctx context.Context, dur time.Duration) *BoolCmd {
cmd := NewBoolCmd(ctx, "client", "pause", formatMs(ctx, dur))
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientUnpause(ctx context.Context) *BoolCmd {
cmd := NewBoolCmd(ctx, "client", "unpause")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientID(ctx context.Context) *IntCmd {
cmd := NewIntCmd(ctx, "client", "id")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientUnblock(ctx context.Context, id int64) *IntCmd {
cmd := NewIntCmd(ctx, "client", "unblock", id)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientUnblockWithError(ctx context.Context, id int64) *IntCmd {
cmd := NewIntCmd(ctx, "client", "unblock", id, "error")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ClientInfo(ctx context.Context) *ClientInfoCmd {
cmd := NewClientInfoCmd(ctx, "client", "info")
_ = c(ctx, cmd)
return cmd
}
// ClientMaintNotifications enables or disables maintenance notifications for maintenance upgrades.
// When enabled, the client will receive push notifications about Redis maintenance events.
func (c cmdable) ClientMaintNotifications(ctx context.Context, enabled bool, endpointType string) *StatusCmd {
args := []interface{}{"client", "maint_notifications"}
if enabled {
if endpointType == "" {
endpointType = "none"
}
args = append(args, "on", "moving-endpoint-type", endpointType)
} else {
args = append(args, "off")
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// ------------------------------------------------------------------------------------------------
func (c cmdable) ConfigGet(ctx context.Context, parameter string) *MapStringStringCmd {
cmd := NewMapStringStringCmd(ctx, "config", "get", parameter)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ConfigResetStat(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "config", "resetstat")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ConfigSet(ctx context.Context, parameter, value string) *StatusCmd {
cmd := NewStatusCmd(ctx, "config", "set", parameter, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ConfigRewrite(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "config", "rewrite")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) DBSize(ctx context.Context) *IntCmd {
cmd := NewIntCmd(ctx, "dbsize")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FlushAll(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "flushall")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FlushAllAsync(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "flushall", "async")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FlushDB(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "flushdb")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FlushDBAsync(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "flushdb", "async")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Info(ctx context.Context, sections ...string) *StringCmd {
args := make([]interface{}, 1+len(sections))
args[0] = "info"
for i, section := range sections {
args[i+1] = section
}
cmd := NewStringCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) InfoMap(ctx context.Context, sections ...string) *InfoCmd {
args := make([]interface{}, 1+len(sections))
args[0] = "info"
for i, section := range sections {
args[i+1] = section
}
cmd := NewInfoCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LastSave(ctx context.Context) *IntCmd {
cmd := NewIntCmd(ctx, "lastsave")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Save(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "save")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) shutdown(ctx context.Context, modifier string) *StatusCmd {
var args []interface{}
if modifier == "" {
args = []interface{}{"shutdown"}
} else {
args = []interface{}{"shutdown", modifier}
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
if err := cmd.Err(); err != nil {
if err == io.EOF {
// Server quit as expected.
cmd.err = nil
}
} else {
// Server did not quit. String reply contains the reason.
cmd.err = errors.New(cmd.val)
cmd.val = ""
}
return cmd
}
func (c cmdable) Shutdown(ctx context.Context) *StatusCmd {
return c.shutdown(ctx, "")
}
func (c cmdable) ShutdownSave(ctx context.Context) *StatusCmd {
return c.shutdown(ctx, "save")
}
func (c cmdable) ShutdownNoSave(ctx context.Context) *StatusCmd {
return c.shutdown(ctx, "nosave")
}
// SlaveOf sets a Redis server as a replica of another, or promotes it to being a master.
//
// Deprecated: Use ReplicaOf instead as of Redis 5.0.0.
func (c cmdable) SlaveOf(ctx context.Context, host, port string) *StatusCmd {
cmd := NewStatusCmd(ctx, "slaveof", host, port)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SlowLogGet(ctx context.Context, num int64) *SlowLogCmd {
cmd := NewSlowLogCmd(context.Background(), "slowlog", "get", num)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SlowLogLen(ctx context.Context) *IntCmd {
cmd := NewIntCmd(ctx, "slowlog", "len")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SlowLogReset(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "slowlog", "reset")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Latency(ctx context.Context) *LatencyCmd {
cmd := NewLatencyCmd(ctx, "latency", "latest")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LatencyReset(ctx context.Context, events ...interface{}) *StatusCmd {
args := make([]interface{}, 2+len(events))
args[0] = "latency"
args[1] = "reset"
copy(args[2:], events)
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Sync(_ context.Context) {
panic("not implemented")
}
func (c cmdable) Time(ctx context.Context) *TimeCmd {
cmd := NewTimeCmd(ctx, "time")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) DebugObject(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "debug", "object", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) MemoryUsage(ctx context.Context, key string, samples ...int) *IntCmd {
args := []interface{}{"memory", "usage", key}
if len(samples) > 0 {
if len(samples) != 1 {
cmd := NewIntCmd(ctx)
cmd.SetErr(errors.New("MemoryUsage expects single sample count"))
return cmd
}
args = append(args, "SAMPLES", samples[0])
}
cmd := NewIntCmd(ctx, args...)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
//------------------------------------------------------------------------------
// ModuleLoadexConfig struct is used to specify the arguments for the MODULE LOADEX command of redis.
// `MODULE LOADEX path [CONFIG name value [CONFIG name value ...]] [ARGS args [args ...]]`
type ModuleLoadexConfig struct {
Path string
Conf map[string]interface{}
Args []interface{}
}
func (c *ModuleLoadexConfig) toArgs() []interface{} {
args := make([]interface{}, 3, 3+len(c.Conf)*3+len(c.Args)*2)
args[0] = "MODULE"
args[1] = "LOADEX"
args[2] = c.Path
for k, v := range c.Conf {
args = append(args, "CONFIG", k, v)
}
for _, arg := range c.Args {
args = append(args, "ARGS", arg)
}
return args
}
// ModuleLoadex Redis `MODULE LOADEX path [CONFIG name value [CONFIG name value ...]] [ARGS args [args ...]]` command.
func (c cmdable) ModuleLoadex(ctx context.Context, conf *ModuleLoadexConfig) *StringCmd {
cmd := NewStringCmd(ctx, conf.toArgs()...)
_ = c(ctx, cmd)
return cmd
}
/*
Monitor - represents a Redis MONITOR command, allowing the user to capture
and process all commands sent to a Redis server. This mimics the behavior of
MONITOR in the redis-cli.
Notes:
- Using MONITOR blocks the connection to the server for itself. It needs a dedicated connection
- The user should create a channel of type string
- This runs concurrently in the background. Trigger via the Start and Stop functions
See further: Redis MONITOR command: https://redis.io/commands/monitor
*/
func (c cmdable) Monitor(ctx context.Context, ch chan string) *MonitorCmd {
cmd := newMonitorCmd(ctx, ch)
_ = c(ctx, cmd)
return cmd
}
package redis
import (
"context"
"errors"
"io"
"net"
"strings"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/internal/proto"
)
// ErrClosed performs any operation on the closed client will return this error.
var ErrClosed = pool.ErrClosed
// ErrPoolExhausted is returned from a pool connection method
// when the maximum number of database connections in the pool has been reached.
var ErrPoolExhausted = pool.ErrPoolExhausted
// ErrPoolTimeout timed out waiting to get a connection from the connection pool.
var ErrPoolTimeout = pool.ErrPoolTimeout
// ErrCrossSlot is returned when keys are used in the same Redis command and
// the keys are not in the same hash slot. This error is returned by Redis
// Cluster and will be returned by the client when TxPipeline or TxPipelined
// is used on a ClusterClient with keys in different slots.
var ErrCrossSlot = proto.RedisError("CROSSSLOT Keys in request don't hash to the same slot")
// HasErrorPrefix checks if the err is a Redis error and the message contains a prefix.
func HasErrorPrefix(err error, prefix string) bool {
var rErr Error
if !errors.As(err, &rErr) {
return false
}
msg := rErr.Error()
msg = strings.TrimPrefix(msg, "ERR ") // KVRocks adds such prefix
return strings.HasPrefix(msg, prefix)
}
type Error interface {
error
// RedisError is a no-op function but
// serves to distinguish types that are Redis
// errors from ordinary errors: a type is a
// Redis error if it has a RedisError method.
RedisError()
}
var _ Error = proto.RedisError("")
func isContextError(err error) bool {
// Check for wrapped context errors using errors.Is
return errors.Is(err, context.Canceled) || errors.Is(err, context.DeadlineExceeded)
}
// isTimeoutError checks if an error is a timeout error, even if wrapped.
// Returns (isTimeout, shouldRetryOnTimeout) where:
// - isTimeout: true if the error is any kind of timeout error
// - shouldRetryOnTimeout: true if Timeout() method returns true
func isTimeoutError(err error) (isTimeout bool, hasTimeoutFlag bool) {
// Check for timeoutError interface (works with wrapped errors)
var te timeoutError
if errors.As(err, &te) {
return true, te.Timeout()
}
// Check for net.Error specifically (common case for network timeouts)
var netErr net.Error
if errors.As(err, &netErr) {
return true, netErr.Timeout()
}
return false, false
}
func shouldRetry(err error, retryTimeout bool) bool {
if err == nil {
return false
}
// Check for EOF errors (works with wrapped errors)
if errors.Is(err, io.EOF) || errors.Is(err, io.ErrUnexpectedEOF) {
return true
}
// Check for context errors (works with wrapped errors)
if errors.Is(err, context.Canceled) || errors.Is(err, context.DeadlineExceeded) {
return false
}
// Check for pool timeout (works with wrapped errors)
if errors.Is(err, pool.ErrPoolTimeout) {
// connection pool timeout, increase retries. #3289
return true
}
// Check for timeout errors (works with wrapped errors)
if isTimeout, hasTimeoutFlag := isTimeoutError(err); isTimeout {
if hasTimeoutFlag {
return retryTimeout
}
return true
}
// Check for typed Redis errors using errors.As (works with wrapped errors)
if proto.IsMaxClientsError(err) {
return true
}
if proto.IsLoadingError(err) {
return true
}
if proto.IsReadOnlyError(err) {
return true
}
if proto.IsMasterDownError(err) {
return true
}
if proto.IsClusterDownError(err) {
return true
}
if proto.IsTryAgainError(err) {
return true
}
if proto.IsNoReplicasError(err) {
return true
}
// Fallback to string checking for backward compatibility with plain errors
s := err.Error()
if strings.HasPrefix(s, "ERR max number of clients reached") {
return true
}
if strings.HasPrefix(s, "LOADING ") {
return true
}
if strings.HasPrefix(s, "READONLY ") {
return true
}
if strings.HasPrefix(s, "CLUSTERDOWN ") {
return true
}
if strings.HasPrefix(s, "TRYAGAIN ") {
return true
}
if strings.HasPrefix(s, "MASTERDOWN ") {
return true
}
if strings.HasPrefix(s, "NOREPLICAS ") {
return true
}
return false
}
func isRedisError(err error) bool {
// Check if error implements the Error interface (works with wrapped errors)
var redisErr Error
if errors.As(err, &redisErr) {
return true
}
// Also check for proto.RedisError specifically
var protoRedisErr proto.RedisError
return errors.As(err, &protoRedisErr)
}
func isBadConn(err error, allowTimeout bool, addr string) bool {
if err == nil {
return false
}
// Check for context errors (works with wrapped errors)
if errors.Is(err, context.Canceled) || errors.Is(err, context.DeadlineExceeded) {
return true
}
// Check for pool timeout errors (works with wrapped errors)
if errors.Is(err, pool.ErrConnUnusableTimeout) {
return true
}
if isRedisError(err) {
switch {
case isReadOnlyError(err):
// Close connections in read only state in case domain addr is used
// and domain resolves to a different Redis Server. See #790.
return true
case isMovedSameConnAddr(err, addr):
// Close connections when we are asked to move to the same addr
// of the connection. Force a DNS resolution when all connections
// of the pool are recycled
return true
default:
return false
}
}
if allowTimeout {
// Check for network timeout errors (works with wrapped errors)
var netErr net.Error
if errors.As(err, &netErr) && netErr.Timeout() {
return false
}
}
return true
}
func isMovedError(err error) (moved bool, ask bool, addr string) {
// Check for typed MovedError
if movedErr, ok := proto.IsMovedError(err); ok {
addr = movedErr.Addr()
addr = internal.GetAddr(addr)
return true, false, addr
}
// Check for typed AskError
if askErr, ok := proto.IsAskError(err); ok {
addr = askErr.Addr()
addr = internal.GetAddr(addr)
return false, true, addr
}
// Fallback to string checking for backward compatibility
s := err.Error()
if strings.HasPrefix(s, "MOVED ") {
// Parse: MOVED 3999 127.0.0.1:6381
parts := strings.Split(s, " ")
if len(parts) == 3 {
addr = internal.GetAddr(parts[2])
return true, false, addr
}
}
if strings.HasPrefix(s, "ASK ") {
// Parse: ASK 3999 127.0.0.1:6381
parts := strings.Split(s, " ")
if len(parts) == 3 {
addr = internal.GetAddr(parts[2])
return false, true, addr
}
}
return false, false, ""
}
func isLoadingError(err error) bool {
return proto.IsLoadingError(err)
}
func isReadOnlyError(err error) bool {
return proto.IsReadOnlyError(err)
}
func isMovedSameConnAddr(err error, addr string) bool {
if movedErr, ok := proto.IsMovedError(err); ok {
return strings.HasSuffix(movedErr.Addr(), addr)
}
return false
}
//------------------------------------------------------------------------------
// Typed error checking functions for public use.
// These functions work correctly even when errors are wrapped in hooks.
// IsLoadingError checks if an error is a Redis LOADING error, even if wrapped.
// LOADING errors occur when Redis is loading the dataset in memory.
func IsLoadingError(err error) bool {
return proto.IsLoadingError(err)
}
// IsReadOnlyError checks if an error is a Redis READONLY error, even if wrapped.
// READONLY errors occur when trying to write to a read-only replica.
func IsReadOnlyError(err error) bool {
return proto.IsReadOnlyError(err)
}
// IsClusterDownError checks if an error is a Redis CLUSTERDOWN error, even if wrapped.
// CLUSTERDOWN errors occur when the cluster is down.
func IsClusterDownError(err error) bool {
return proto.IsClusterDownError(err)
}
// IsTryAgainError checks if an error is a Redis TRYAGAIN error, even if wrapped.
// TRYAGAIN errors occur when a command cannot be processed and should be retried.
func IsTryAgainError(err error) bool {
return proto.IsTryAgainError(err)
}
// IsMasterDownError checks if an error is a Redis MASTERDOWN error, even if wrapped.
// MASTERDOWN errors occur when the master is down.
func IsMasterDownError(err error) bool {
return proto.IsMasterDownError(err)
}
// IsMaxClientsError checks if an error is a Redis max clients error, even if wrapped.
// This error occurs when the maximum number of clients has been reached.
func IsMaxClientsError(err error) bool {
return proto.IsMaxClientsError(err)
}
// IsMovedError checks if an error is a Redis MOVED error, even if wrapped.
// MOVED errors occur in cluster mode when a key has been moved to a different node.
// Returns the address of the node where the key has been moved and a boolean indicating if it's a MOVED error.
func IsMovedError(err error) (addr string, ok bool) {
if movedErr, isMovedErr := proto.IsMovedError(err); isMovedErr {
return movedErr.Addr(), true
}
return "", false
}
// IsAskError checks if an error is a Redis ASK error, even if wrapped.
// ASK errors occur in cluster mode when a key is being migrated and the client should ask another node.
// Returns the address of the node to ask and a boolean indicating if it's an ASK error.
func IsAskError(err error) (addr string, ok bool) {
if askErr, isAskErr := proto.IsAskError(err); isAskErr {
return askErr.Addr(), true
}
return "", false
}
// IsAuthError checks if an error is a Redis authentication error, even if wrapped.
// Authentication errors occur when:
// - NOAUTH: Redis requires authentication but none was provided
// - WRONGPASS: Redis authentication failed due to incorrect password
// - unauthenticated: Error returned when password changed
func IsAuthError(err error) bool {
return proto.IsAuthError(err)
}
// IsPermissionError checks if an error is a Redis permission error, even if wrapped.
// Permission errors (NOPERM) occur when a user does not have permission to execute a command.
func IsPermissionError(err error) bool {
return proto.IsPermissionError(err)
}
// IsExecAbortError checks if an error is a Redis EXECABORT error, even if wrapped.
// EXECABORT errors occur when a transaction is aborted.
func IsExecAbortError(err error) bool {
return proto.IsExecAbortError(err)
}
// IsOOMError checks if an error is a Redis OOM (Out Of Memory) error, even if wrapped.
// OOM errors occur when Redis is out of memory.
func IsOOMError(err error) bool {
return proto.IsOOMError(err)
}
// IsNoReplicasError checks if an error is a Redis NOREPLICAS error, even if wrapped.
// NOREPLICAS errors occur when not enough replicas acknowledge a write operation.
// This typically happens with WAIT/WAITAOF commands or CLUSTER SETSLOT with synchronous
// replication when the required number of replicas cannot confirm the write within the timeout.
func IsNoReplicasError(err error) bool {
return proto.IsNoReplicasError(err)
}
//------------------------------------------------------------------------------
type timeoutError interface {
Timeout() bool
}
//go:build gofuzz
// +build gofuzz
package fuzz
import (
"context"
"time"
"github.com/redis/go-redis/v9"
)
const (
minDataLength = 4
redisAddr = ":6379"
dialTimeout = 10 * time.Second
readTimeout = 10 * time.Second
writeTimeout = 10 * time.Second
poolSize = 10
poolTimeout = 10 * time.Second
scanCount = 10
maxIterPercentage = 256 // Use first byte as percentage of data length
)
var (
ctx = context.Background()
rdb *redis.Client
)
type redisOperation func(key, value string)
func init() {
rdb = redis.NewClient(&redis.Options{
Addr: redisAddr,
DialTimeout: dialTimeout,
ReadTimeout: readTimeout,
WriteTimeout: writeTimeout,
PoolSize: poolSize,
PoolTimeout: poolTimeout,
})
}
func Fuzz(data []byte) int {
if len(data) < minDataLength {
return -1
}
maxIter := (int(data[0]) * len(data)) / maxIterPercentage
if maxIter == 0 {
maxIter = 1 // Ensure at least one iteration
}
operations := []redisOperation{
func(key, value string) { rdb.Set(ctx, key, value, 0).Err() },
func(key, value string) { rdb.Get(ctx, key).Result() },
func(key, value string) { rdb.Incr(ctx, key).Result() },
func(key, value string) {
var cursor uint64
rdb.Scan(ctx, cursor, key, scanCount).Result()
},
}
dataStr := string(data)
for i := 0; i < maxIter && i < len(data); i++ {
start := i % len(data)
end := (i + 1) % len(data)
if end <= start {
end = len(data)
}
key := dataStr[start:end]
opIndex := i % len(operations)
operations[opIndex](key, dataStr)
}
return 1
}
package redis
import (
"context"
"time"
"github.com/redis/go-redis/v9/internal/hashtag"
)
type GenericCmdable interface {
Del(ctx context.Context, keys ...string) *IntCmd
Dump(ctx context.Context, key string) *StringCmd
Exists(ctx context.Context, keys ...string) *IntCmd
Expire(ctx context.Context, key string, expiration time.Duration) *BoolCmd
ExpireAt(ctx context.Context, key string, tm time.Time) *BoolCmd
ExpireTime(ctx context.Context, key string) *DurationCmd
ExpireNX(ctx context.Context, key string, expiration time.Duration) *BoolCmd
ExpireXX(ctx context.Context, key string, expiration time.Duration) *BoolCmd
ExpireGT(ctx context.Context, key string, expiration time.Duration) *BoolCmd
ExpireLT(ctx context.Context, key string, expiration time.Duration) *BoolCmd
Keys(ctx context.Context, pattern string) *StringSliceCmd
Migrate(ctx context.Context, host, port, key string, db int, timeout time.Duration) *StatusCmd
Move(ctx context.Context, key string, db int) *BoolCmd
ObjectFreq(ctx context.Context, key string) *IntCmd
ObjectRefCount(ctx context.Context, key string) *IntCmd
ObjectEncoding(ctx context.Context, key string) *StringCmd
ObjectIdleTime(ctx context.Context, key string) *DurationCmd
Persist(ctx context.Context, key string) *BoolCmd
PExpire(ctx context.Context, key string, expiration time.Duration) *BoolCmd
PExpireAt(ctx context.Context, key string, tm time.Time) *BoolCmd
PExpireTime(ctx context.Context, key string) *DurationCmd
PTTL(ctx context.Context, key string) *DurationCmd
RandomKey(ctx context.Context) *StringCmd
Rename(ctx context.Context, key, newkey string) *StatusCmd
RenameNX(ctx context.Context, key, newkey string) *BoolCmd
Restore(ctx context.Context, key string, ttl time.Duration, value string) *StatusCmd
RestoreReplace(ctx context.Context, key string, ttl time.Duration, value string) *StatusCmd
Sort(ctx context.Context, key string, sort *Sort) *StringSliceCmd
SortRO(ctx context.Context, key string, sort *Sort) *StringSliceCmd
SortStore(ctx context.Context, key, store string, sort *Sort) *IntCmd
SortInterfaces(ctx context.Context, key string, sort *Sort) *SliceCmd
Touch(ctx context.Context, keys ...string) *IntCmd
TTL(ctx context.Context, key string) *DurationCmd
Type(ctx context.Context, key string) *StatusCmd
Copy(ctx context.Context, sourceKey string, destKey string, db int, replace bool) *IntCmd
Scan(ctx context.Context, cursor uint64, match string, count int64) *ScanCmd
ScanType(ctx context.Context, cursor uint64, match string, count int64, keyType string) *ScanCmd
}
func (c cmdable) Del(ctx context.Context, keys ...string) *IntCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "del"
for i, key := range keys {
args[1+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Unlink(ctx context.Context, keys ...string) *IntCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "unlink"
for i, key := range keys {
args[1+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Dump(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "dump", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Exists(ctx context.Context, keys ...string) *IntCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "exists"
for i, key := range keys {
args[1+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Expire(ctx context.Context, key string, expiration time.Duration) *BoolCmd {
return c.expire(ctx, key, expiration, "")
}
func (c cmdable) ExpireNX(ctx context.Context, key string, expiration time.Duration) *BoolCmd {
return c.expire(ctx, key, expiration, "NX")
}
func (c cmdable) ExpireXX(ctx context.Context, key string, expiration time.Duration) *BoolCmd {
return c.expire(ctx, key, expiration, "XX")
}
func (c cmdable) ExpireGT(ctx context.Context, key string, expiration time.Duration) *BoolCmd {
return c.expire(ctx, key, expiration, "GT")
}
func (c cmdable) ExpireLT(ctx context.Context, key string, expiration time.Duration) *BoolCmd {
return c.expire(ctx, key, expiration, "LT")
}
func (c cmdable) expire(
ctx context.Context, key string, expiration time.Duration, mode string,
) *BoolCmd {
args := make([]interface{}, 3, 4)
args[0] = "expire"
args[1] = key
args[2] = formatSec(ctx, expiration)
if mode != "" {
args = append(args, mode)
}
cmd := NewBoolCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ExpireAt(ctx context.Context, key string, tm time.Time) *BoolCmd {
cmd := NewBoolCmd(ctx, "expireat", key, tm.Unix())
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ExpireTime(ctx context.Context, key string) *DurationCmd {
cmd := NewDurationCmd(ctx, time.Second, "expiretime", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Keys(ctx context.Context, pattern string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "keys", pattern)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Migrate(ctx context.Context, host, port, key string, db int, timeout time.Duration) *StatusCmd {
cmd := NewStatusCmd(
ctx,
"migrate",
host,
port,
key,
db,
formatMs(ctx, timeout),
)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Move(ctx context.Context, key string, db int) *BoolCmd {
cmd := NewBoolCmd(ctx, "move", key, db)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ObjectFreq(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "object", "freq", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ObjectRefCount(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "object", "refcount", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ObjectEncoding(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "object", "encoding", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ObjectIdleTime(ctx context.Context, key string) *DurationCmd {
cmd := NewDurationCmd(ctx, time.Second, "object", "idletime", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Persist(ctx context.Context, key string) *BoolCmd {
cmd := NewBoolCmd(ctx, "persist", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PExpire(ctx context.Context, key string, expiration time.Duration) *BoolCmd {
cmd := NewBoolCmd(ctx, "pexpire", key, formatMs(ctx, expiration))
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PExpireAt(ctx context.Context, key string, tm time.Time) *BoolCmd {
cmd := NewBoolCmd(
ctx,
"pexpireat",
key,
tm.UnixNano()/int64(time.Millisecond),
)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PExpireTime(ctx context.Context, key string) *DurationCmd {
cmd := NewDurationCmd(ctx, time.Millisecond, "pexpiretime", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PTTL(ctx context.Context, key string) *DurationCmd {
cmd := NewDurationCmd(ctx, time.Millisecond, "pttl", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RandomKey(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "randomkey")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Rename(ctx context.Context, key, newkey string) *StatusCmd {
cmd := NewStatusCmd(ctx, "rename", key, newkey)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RenameNX(ctx context.Context, key, newkey string) *BoolCmd {
cmd := NewBoolCmd(ctx, "renamenx", key, newkey)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Restore(ctx context.Context, key string, ttl time.Duration, value string) *StatusCmd {
cmd := NewStatusCmd(
ctx,
"restore",
key,
formatMs(ctx, ttl),
value,
)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RestoreReplace(ctx context.Context, key string, ttl time.Duration, value string) *StatusCmd {
cmd := NewStatusCmd(
ctx,
"restore",
key,
formatMs(ctx, ttl),
value,
"replace",
)
_ = c(ctx, cmd)
return cmd
}
type Sort struct {
By string
Offset, Count int64
Get []string
Order string
Alpha bool
}
func (sort *Sort) args(command, key string) []interface{} {
args := []interface{}{command, key}
if sort.By != "" {
args = append(args, "by", sort.By)
}
if sort.Offset != 0 || sort.Count != 0 {
args = append(args, "limit", sort.Offset, sort.Count)
}
for _, get := range sort.Get {
args = append(args, "get", get)
}
if sort.Order != "" {
args = append(args, sort.Order)
}
if sort.Alpha {
args = append(args, "alpha")
}
return args
}
func (c cmdable) SortRO(ctx context.Context, key string, sort *Sort) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, sort.args("sort_ro", key)...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Sort(ctx context.Context, key string, sort *Sort) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, sort.args("sort", key)...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SortStore(ctx context.Context, key, store string, sort *Sort) *IntCmd {
args := sort.args("sort", key)
if store != "" {
args = append(args, "store", store)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SortInterfaces(ctx context.Context, key string, sort *Sort) *SliceCmd {
cmd := NewSliceCmd(ctx, sort.args("sort", key)...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Touch(ctx context.Context, keys ...string) *IntCmd {
args := make([]interface{}, len(keys)+1)
args[0] = "touch"
for i, key := range keys {
args[i+1] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) TTL(ctx context.Context, key string) *DurationCmd {
cmd := NewDurationCmd(ctx, time.Second, "ttl", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Type(ctx context.Context, key string) *StatusCmd {
cmd := NewStatusCmd(ctx, "type", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Copy(ctx context.Context, sourceKey, destKey string, db int, replace bool) *IntCmd {
args := []interface{}{"copy", sourceKey, destKey, "DB", db}
if replace {
args = append(args, "REPLACE")
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
//------------------------------------------------------------------------------
func (c cmdable) Scan(ctx context.Context, cursor uint64, match string, count int64) *ScanCmd {
args := []interface{}{"scan", cursor}
if match != "" {
args = append(args, "match", match)
}
if count > 0 {
args = append(args, "count", count)
}
cmd := NewScanCmd(ctx, c, args...)
if hashtag.Present(match) {
cmd.SetFirstKeyPos(3)
}
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ScanType(ctx context.Context, cursor uint64, match string, count int64, keyType string) *ScanCmd {
args := []interface{}{"scan", cursor}
if match != "" {
args = append(args, "match", match)
}
if count > 0 {
args = append(args, "count", count)
}
if keyType != "" {
args = append(args, "type", keyType)
}
cmd := NewScanCmd(ctx, c, args...)
if hashtag.Present(match) {
cmd.SetFirstKeyPos(3)
}
_ = c(ctx, cmd)
return cmd
}
package redis
import (
"context"
"errors"
)
type GeoCmdable interface {
GeoAdd(ctx context.Context, key string, geoLocation ...*GeoLocation) *IntCmd
GeoPos(ctx context.Context, key string, members ...string) *GeoPosCmd
GeoRadius(ctx context.Context, key string, longitude, latitude float64, query *GeoRadiusQuery) *GeoLocationCmd
GeoRadiusStore(ctx context.Context, key string, longitude, latitude float64, query *GeoRadiusQuery) *IntCmd
GeoRadiusByMember(ctx context.Context, key, member string, query *GeoRadiusQuery) *GeoLocationCmd
GeoRadiusByMemberStore(ctx context.Context, key, member string, query *GeoRadiusQuery) *IntCmd
GeoSearch(ctx context.Context, key string, q *GeoSearchQuery) *StringSliceCmd
GeoSearchLocation(ctx context.Context, key string, q *GeoSearchLocationQuery) *GeoSearchLocationCmd
GeoSearchStore(ctx context.Context, key, store string, q *GeoSearchStoreQuery) *IntCmd
GeoDist(ctx context.Context, key string, member1, member2, unit string) *FloatCmd
GeoHash(ctx context.Context, key string, members ...string) *StringSliceCmd
}
func (c cmdable) GeoAdd(ctx context.Context, key string, geoLocation ...*GeoLocation) *IntCmd {
args := make([]interface{}, 2+3*len(geoLocation))
args[0] = "geoadd"
args[1] = key
for i, eachLoc := range geoLocation {
args[2+3*i] = eachLoc.Longitude
args[2+3*i+1] = eachLoc.Latitude
args[2+3*i+2] = eachLoc.Name
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// GeoRadius queries a geospatial index for members within a distance from a coordinate.
// This is a read-only variant that does not support Store or StoreDist options.
//
// Deprecated: Use GeoSearch with BYRADIUS argument instead as of Redis 6.2.0.
func (c cmdable) GeoRadius(
ctx context.Context, key string, longitude, latitude float64, query *GeoRadiusQuery,
) *GeoLocationCmd {
cmd := NewGeoLocationCmd(ctx, query, "georadius_ro", key, longitude, latitude)
if query.Store != "" || query.StoreDist != "" {
cmd.SetErr(errors.New("GeoRadius does not support Store or StoreDist"))
return cmd
}
_ = c(ctx, cmd)
return cmd
}
// GeoRadiusStore is a writing GEORADIUS command.
func (c cmdable) GeoRadiusStore(
ctx context.Context, key string, longitude, latitude float64, query *GeoRadiusQuery,
) *IntCmd {
args := geoLocationArgs(query, "georadius", key, longitude, latitude)
cmd := NewIntCmd(ctx, args...)
if query.Store == "" && query.StoreDist == "" {
cmd.SetErr(errors.New("GeoRadiusStore requires Store or StoreDist"))
return cmd
}
_ = c(ctx, cmd)
return cmd
}
// GeoRadiusByMember queries a geospatial index for members within a distance from a member.
// This is a read-only variant that does not support Store or StoreDist options.
//
// Deprecated: Use GeoSearch with BYRADIUS and FROMMEMBER arguments instead as of Redis 6.2.0.
func (c cmdable) GeoRadiusByMember(
ctx context.Context, key, member string, query *GeoRadiusQuery,
) *GeoLocationCmd {
cmd := NewGeoLocationCmd(ctx, query, "georadiusbymember_ro", key, member)
if query.Store != "" || query.StoreDist != "" {
cmd.SetErr(errors.New("GeoRadiusByMember does not support Store or StoreDist"))
return cmd
}
_ = c(ctx, cmd)
return cmd
}
// GeoRadiusByMemberStore is a writing GEORADIUSBYMEMBER command.
func (c cmdable) GeoRadiusByMemberStore(
ctx context.Context, key, member string, query *GeoRadiusQuery,
) *IntCmd {
args := geoLocationArgs(query, "georadiusbymember", key, member)
cmd := NewIntCmd(ctx, args...)
if query.Store == "" && query.StoreDist == "" {
cmd.SetErr(errors.New("GeoRadiusByMemberStore requires Store or StoreDist"))
return cmd
}
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GeoSearch(ctx context.Context, key string, q *GeoSearchQuery) *StringSliceCmd {
args := make([]interface{}, 0, 13)
args = append(args, "geosearch", key)
args = geoSearchArgs(q, args)
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GeoSearchLocation(
ctx context.Context, key string, q *GeoSearchLocationQuery,
) *GeoSearchLocationCmd {
args := make([]interface{}, 0, 16)
args = append(args, "geosearch", key)
args = geoSearchLocationArgs(q, args)
cmd := NewGeoSearchLocationCmd(ctx, q, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GeoSearchStore(ctx context.Context, key, store string, q *GeoSearchStoreQuery) *IntCmd {
args := make([]interface{}, 0, 15)
args = append(args, "geosearchstore", store, key)
args = geoSearchArgs(&q.GeoSearchQuery, args)
if q.StoreDist {
args = append(args, "storedist")
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GeoDist(
ctx context.Context, key string, member1, member2, unit string,
) *FloatCmd {
if unit == "" {
unit = "km"
}
cmd := NewFloatCmd(ctx, "geodist", key, member1, member2, unit)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GeoHash(ctx context.Context, key string, members ...string) *StringSliceCmd {
args := make([]interface{}, 2+len(members))
args[0] = "geohash"
args[1] = key
for i, member := range members {
args[2+i] = member
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GeoPos(ctx context.Context, key string, members ...string) *GeoPosCmd {
args := make([]interface{}, 2+len(members))
args[0] = "geopos"
args[1] = key
for i, member := range members {
args[2+i] = member
}
cmd := NewGeoPosCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
package redis
import (
"context"
"time"
"github.com/redis/go-redis/v9/internal/hashtag"
)
type HashCmdable interface {
HDel(ctx context.Context, key string, fields ...string) *IntCmd
HExists(ctx context.Context, key, field string) *BoolCmd
HGet(ctx context.Context, key, field string) *StringCmd
HGetAll(ctx context.Context, key string) *MapStringStringCmd
HGetDel(ctx context.Context, key string, fields ...string) *StringSliceCmd
HGetEX(ctx context.Context, key string, fields ...string) *StringSliceCmd
HGetEXWithArgs(ctx context.Context, key string, options *HGetEXOptions, fields ...string) *StringSliceCmd
HIncrBy(ctx context.Context, key, field string, incr int64) *IntCmd
HIncrByFloat(ctx context.Context, key, field string, incr float64) *FloatCmd
HKeys(ctx context.Context, key string) *StringSliceCmd
HLen(ctx context.Context, key string) *IntCmd
HMGet(ctx context.Context, key string, fields ...string) *SliceCmd
HSet(ctx context.Context, key string, values ...interface{}) *IntCmd
HMSet(ctx context.Context, key string, values ...interface{}) *BoolCmd
HSetEX(ctx context.Context, key string, fieldsAndValues ...string) *IntCmd
HSetEXWithArgs(ctx context.Context, key string, options *HSetEXOptions, fieldsAndValues ...string) *IntCmd
HSetNX(ctx context.Context, key, field string, value interface{}) *BoolCmd
HScan(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd
HScanNoValues(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd
HVals(ctx context.Context, key string) *StringSliceCmd
HRandField(ctx context.Context, key string, count int) *StringSliceCmd
HRandFieldWithValues(ctx context.Context, key string, count int) *KeyValueSliceCmd
HStrLen(ctx context.Context, key, field string) *IntCmd
HExpire(ctx context.Context, key string, expiration time.Duration, fields ...string) *IntSliceCmd
HExpireWithArgs(ctx context.Context, key string, expiration time.Duration, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd
HPExpire(ctx context.Context, key string, expiration time.Duration, fields ...string) *IntSliceCmd
HPExpireWithArgs(ctx context.Context, key string, expiration time.Duration, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd
HExpireAt(ctx context.Context, key string, tm time.Time, fields ...string) *IntSliceCmd
HExpireAtWithArgs(ctx context.Context, key string, tm time.Time, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd
HPExpireAt(ctx context.Context, key string, tm time.Time, fields ...string) *IntSliceCmd
HPExpireAtWithArgs(ctx context.Context, key string, tm time.Time, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd
HPersist(ctx context.Context, key string, fields ...string) *IntSliceCmd
HExpireTime(ctx context.Context, key string, fields ...string) *IntSliceCmd
HPExpireTime(ctx context.Context, key string, fields ...string) *IntSliceCmd
HTTL(ctx context.Context, key string, fields ...string) *IntSliceCmd
HPTTL(ctx context.Context, key string, fields ...string) *IntSliceCmd
}
func (c cmdable) HDel(ctx context.Context, key string, fields ...string) *IntCmd {
args := make([]interface{}, 2+len(fields))
args[0] = "hdel"
args[1] = key
for i, field := range fields {
args[2+i] = field
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HExists(ctx context.Context, key, field string) *BoolCmd {
cmd := NewBoolCmd(ctx, "hexists", key, field)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HGet(ctx context.Context, key, field string) *StringCmd {
cmd := NewStringCmd(ctx, "hget", key, field)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HGetAll(ctx context.Context, key string) *MapStringStringCmd {
cmd := NewMapStringStringCmd(ctx, "hgetall", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HIncrBy(ctx context.Context, key, field string, incr int64) *IntCmd {
cmd := NewIntCmd(ctx, "hincrby", key, field, incr)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HIncrByFloat(ctx context.Context, key, field string, incr float64) *FloatCmd {
cmd := NewFloatCmd(ctx, "hincrbyfloat", key, field, incr)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HKeys(ctx context.Context, key string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "hkeys", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HLen(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "hlen", key)
_ = c(ctx, cmd)
return cmd
}
// HMGet returns the values for the specified fields in the hash stored at key.
// It returns an interface{} to distinguish between empty string and nil value.
func (c cmdable) HMGet(ctx context.Context, key string, fields ...string) *SliceCmd {
args := make([]interface{}, 2+len(fields))
args[0] = "hmget"
args[1] = key
for i, field := range fields {
args[2+i] = field
}
cmd := NewSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HSet accepts values in following formats:
//
// - HSet(ctx, "myhash", "key1", "value1", "key2", "value2")
//
// - HSet(ctx, "myhash", []string{"key1", "value1", "key2", "value2"})
//
// - HSet(ctx, "myhash", map[string]interface{}{"key1": "value1", "key2": "value2"})
//
// Playing struct With "redis" tag.
// type MyHash struct { Key1 string `redis:"key1"`; Key2 int `redis:"key2"` }
//
// - HSet(ctx, "myhash", MyHash{"value1", "value2"}) Warn: redis-server >= 4.0
//
// For struct, can be a structure pointer type, we only parse the field whose tag is redis.
// if you don't want the field to be read, you can use the `redis:"-"` flag to ignore it,
// or you don't need to set the redis tag.
// For the type of structure field, we only support simple data types:
// string, int/uint(8,16,32,64), float(32,64), time.Time(to RFC3339Nano), time.Duration(to Nanoseconds ),
// if you are other more complex or custom data types, please implement the encoding.BinaryMarshaler interface.
//
// Note that in older versions of Redis server(redis-server < 4.0), HSet only supports a single key-value pair.
// redis-docs: https://redis.io/commands/hset (Starting with Redis version 4.0.0: Accepts multiple field and value arguments.)
// If you are using a Struct type and the number of fields is greater than one,
// you will receive an error similar to "ERR wrong number of arguments", you can use HMSet as a substitute.
func (c cmdable) HSet(ctx context.Context, key string, values ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "hset"
args[1] = key
args = appendArgs(args, values)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HMSet is a deprecated version of HSet left for compatibility with Redis 3.
func (c cmdable) HMSet(ctx context.Context, key string, values ...interface{}) *BoolCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "hmset"
args[1] = key
args = appendArgs(args, values)
cmd := NewBoolCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HSetNX(ctx context.Context, key, field string, value interface{}) *BoolCmd {
cmd := NewBoolCmd(ctx, "hsetnx", key, field, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HVals(ctx context.Context, key string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "hvals", key)
_ = c(ctx, cmd)
return cmd
}
// HRandField redis-server version >= 6.2.0.
func (c cmdable) HRandField(ctx context.Context, key string, count int) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "hrandfield", key, count)
_ = c(ctx, cmd)
return cmd
}
// HRandFieldWithValues redis-server version >= 6.2.0.
func (c cmdable) HRandFieldWithValues(ctx context.Context, key string, count int) *KeyValueSliceCmd {
cmd := NewKeyValueSliceCmd(ctx, "hrandfield", key, count, "withvalues")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HScan(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd {
args := []interface{}{"hscan", key, cursor}
if match != "" {
args = append(args, "match", match)
}
if count > 0 {
args = append(args, "count", count)
}
cmd := NewScanCmd(ctx, c, args...)
if hashtag.Present(match) {
cmd.SetFirstKeyPos(4)
}
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HStrLen(ctx context.Context, key, field string) *IntCmd {
cmd := NewIntCmd(ctx, "hstrlen", key, field)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HScanNoValues(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd {
args := []interface{}{"hscan", key, cursor}
if match != "" {
args = append(args, "match", match)
}
if count > 0 {
args = append(args, "count", count)
}
args = append(args, "novalues")
cmd := NewScanCmd(ctx, c, args...)
if hashtag.Present(match) {
cmd.SetFirstKeyPos(4)
}
_ = c(ctx, cmd)
return cmd
}
type HExpireArgs struct {
NX bool
XX bool
GT bool
LT bool
}
// HExpire - Sets the expiration time for specified fields in a hash in seconds.
// The command constructs an argument list starting with "HEXPIRE", followed by the key, duration, any conditional flags, and the specified fields.
// Available since Redis 7.4 CE.
// For more information refer to [HEXPIRE Documentation].
//
// [HEXPIRE Documentation]: https://redis.io/commands/hexpire/
func (c cmdable) HExpire(ctx context.Context, key string, expiration time.Duration, fields ...string) *IntSliceCmd {
args := []interface{}{"HEXPIRE", key, formatSec(ctx, expiration), "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HExpireWithArgs - Sets the expiration time for specified fields in a hash in seconds.
// It requires a key, an expiration duration, a struct with boolean flags for conditional expiration settings (NX, XX, GT, LT), and a list of fields.
// The command constructs an argument list starting with "HEXPIRE", followed by the key, duration, any conditional flags, and the specified fields.
// Available since Redis 7.4 CE.
// For more information refer to [HEXPIRE Documentation].
//
// [HEXPIRE Documentation]: https://redis.io/commands/hexpire/
func (c cmdable) HExpireWithArgs(ctx context.Context, key string, expiration time.Duration, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd {
args := []interface{}{"HEXPIRE", key, formatSec(ctx, expiration)}
// only if one argument is true, we can add it to the args
// if more than one argument is true, it will cause an error
if expirationArgs.NX {
args = append(args, "NX")
} else if expirationArgs.XX {
args = append(args, "XX")
} else if expirationArgs.GT {
args = append(args, "GT")
} else if expirationArgs.LT {
args = append(args, "LT")
}
args = append(args, "FIELDS", len(fields))
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HPExpire - Sets the expiration time for specified fields in a hash in milliseconds.
// Similar to HExpire, it accepts a key, an expiration duration in milliseconds, a struct with expiration condition flags, and a list of fields.
// The command modifies the standard time.Duration to milliseconds for the Redis command.
// Available since Redis 7.4 CE.
// For more information refer to [HPEXPIRE Documentation].
//
// [HPEXPIRE Documentation]: https://redis.io/commands/hpexpire/
func (c cmdable) HPExpire(ctx context.Context, key string, expiration time.Duration, fields ...string) *IntSliceCmd {
args := []interface{}{"HPEXPIRE", key, formatMs(ctx, expiration), "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HPExpireWithArgs - Sets the expiration time for specified fields in a hash in milliseconds.
// It requires a key, an expiration duration, a struct with boolean flags for conditional expiration settings (NX, XX, GT, LT), and a list of fields.
// The command constructs an argument list starting with "HPEXPIRE", followed by the key, duration, any conditional flags, and the specified fields.
// Available since Redis 7.4 CE.
// For more information refer to [HPEXPIRE Documentation].
//
// [HPEXPIRE Documentation]: https://redis.io/commands/hpexpire/
func (c cmdable) HPExpireWithArgs(ctx context.Context, key string, expiration time.Duration, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd {
args := []interface{}{"HPEXPIRE", key, formatMs(ctx, expiration)}
// only if one argument is true, we can add it to the args
// if more than one argument is true, it will cause an error
if expirationArgs.NX {
args = append(args, "NX")
} else if expirationArgs.XX {
args = append(args, "XX")
} else if expirationArgs.GT {
args = append(args, "GT")
} else if expirationArgs.LT {
args = append(args, "LT")
}
args = append(args, "FIELDS", len(fields))
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HExpireAt - Sets the expiration time for specified fields in a hash to a UNIX timestamp in seconds.
// Takes a key, a UNIX timestamp, a struct of conditional flags, and a list of fields.
// The command sets absolute expiration times based on the UNIX timestamp provided.
// Available since Redis 7.4 CE.
// For more information refer to [HExpireAt Documentation].
//
// [HExpireAt Documentation]: https://redis.io/commands/hexpireat/
func (c cmdable) HExpireAt(ctx context.Context, key string, tm time.Time, fields ...string) *IntSliceCmd {
args := []interface{}{"HEXPIREAT", key, tm.Unix(), "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HExpireAtWithArgs(ctx context.Context, key string, tm time.Time, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd {
args := []interface{}{"HEXPIREAT", key, tm.Unix()}
// only if one argument is true, we can add it to the args
// if more than one argument is true, it will cause an error
if expirationArgs.NX {
args = append(args, "NX")
} else if expirationArgs.XX {
args = append(args, "XX")
} else if expirationArgs.GT {
args = append(args, "GT")
} else if expirationArgs.LT {
args = append(args, "LT")
}
args = append(args, "FIELDS", len(fields))
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HPExpireAt - Sets the expiration time for specified fields in a hash to a UNIX timestamp in milliseconds.
// Similar to HExpireAt but for timestamps in milliseconds. It accepts the same parameters and adjusts the UNIX time to milliseconds.
// Available since Redis 7.4 CE.
// For more information refer to [HExpireAt Documentation].
//
// [HExpireAt Documentation]: https://redis.io/commands/hexpireat/
func (c cmdable) HPExpireAt(ctx context.Context, key string, tm time.Time, fields ...string) *IntSliceCmd {
args := []interface{}{"HPEXPIREAT", key, tm.UnixNano() / int64(time.Millisecond), "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HPExpireAtWithArgs(ctx context.Context, key string, tm time.Time, expirationArgs HExpireArgs, fields ...string) *IntSliceCmd {
args := []interface{}{"HPEXPIREAT", key, tm.UnixNano() / int64(time.Millisecond)}
// only if one argument is true, we can add it to the args
// if more than one argument is true, it will cause an error
if expirationArgs.NX {
args = append(args, "NX")
} else if expirationArgs.XX {
args = append(args, "XX")
} else if expirationArgs.GT {
args = append(args, "GT")
} else if expirationArgs.LT {
args = append(args, "LT")
}
args = append(args, "FIELDS", len(fields))
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HPersist - Removes the expiration time from specified fields in a hash.
// Accepts a key and the fields themselves.
// This command ensures that each field specified will have its expiration removed if present.
// Available since Redis 7.4 CE.
// For more information refer to [HPersist Documentation].
//
// [HPersist Documentation]: https://redis.io/commands/hpersist/
func (c cmdable) HPersist(ctx context.Context, key string, fields ...string) *IntSliceCmd {
args := []interface{}{"HPERSIST", key, "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HExpireTime - Retrieves the expiration time for specified fields in a hash as a UNIX timestamp in seconds.
// Requires a key and the fields themselves to fetch their expiration timestamps.
// This command returns the expiration times for each field or error/status codes for each field as specified.
// Available since Redis 7.4 CE.
// For more information refer to [HExpireTime Documentation].
//
// [HExpireTime Documentation]: https://redis.io/commands/hexpiretime/
// For more information - https://redis.io/commands/hexpiretime/
func (c cmdable) HExpireTime(ctx context.Context, key string, fields ...string) *IntSliceCmd {
args := []interface{}{"HEXPIRETIME", key, "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HPExpireTime - Retrieves the expiration time for specified fields in a hash as a UNIX timestamp in milliseconds.
// Similar to HExpireTime, adjusted for timestamps in milliseconds. It requires the same parameters.
// Provides the expiration timestamp for each field in milliseconds.
// Available since Redis 7.4 CE.
// For more information refer to [HExpireTime Documentation].
//
// [HExpireTime Documentation]: https://redis.io/commands/hexpiretime/
// For more information - https://redis.io/commands/hexpiretime/
func (c cmdable) HPExpireTime(ctx context.Context, key string, fields ...string) *IntSliceCmd {
args := []interface{}{"HPEXPIRETIME", key, "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HTTL - Retrieves the remaining time to live for specified fields in a hash in seconds.
// Requires a key and the fields themselves. It returns the TTL for each specified field.
// This command fetches the TTL in seconds for each field or returns error/status codes as appropriate.
// Available since Redis 7.4 CE.
// For more information refer to [HTTL Documentation].
//
// [HTTL Documentation]: https://redis.io/commands/httl/
func (c cmdable) HTTL(ctx context.Context, key string, fields ...string) *IntSliceCmd {
args := []interface{}{"HTTL", key, "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HPTTL - Retrieves the remaining time to live for specified fields in a hash in milliseconds.
// Similar to HTTL, but returns the TTL in milliseconds. It requires a key and the specified fields.
// This command provides the TTL in milliseconds for each field or returns error/status codes as needed.
// Available since Redis 7.4 CE.
// For more information refer to [HPTTL Documentation].
//
// [HPTTL Documentation]: https://redis.io/commands/hpttl/
// For more information - https://redis.io/commands/hpttl/
func (c cmdable) HPTTL(ctx context.Context, key string, fields ...string) *IntSliceCmd {
args := []interface{}{"HPTTL", key, "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HGetDel(ctx context.Context, key string, fields ...string) *StringSliceCmd {
args := []interface{}{"HGETDEL", key, "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HGetEX(ctx context.Context, key string, fields ...string) *StringSliceCmd {
args := []interface{}{"HGETEX", key, "FIELDS", len(fields)}
for _, field := range fields {
args = append(args, field)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// HGetEXExpirationType represents an expiration option for the HGETEX command.
type HGetEXExpirationType string
const (
HGetEXExpirationEX HGetEXExpirationType = "EX"
HGetEXExpirationPX HGetEXExpirationType = "PX"
HGetEXExpirationEXAT HGetEXExpirationType = "EXAT"
HGetEXExpirationPXAT HGetEXExpirationType = "PXAT"
HGetEXExpirationPERSIST HGetEXExpirationType = "PERSIST"
)
type HGetEXOptions struct {
ExpirationType HGetEXExpirationType
ExpirationVal int64
}
func (c cmdable) HGetEXWithArgs(ctx context.Context, key string, options *HGetEXOptions, fields ...string) *StringSliceCmd {
args := []interface{}{"HGETEX", key}
if options.ExpirationType != "" {
args = append(args, string(options.ExpirationType))
if options.ExpirationType != HGetEXExpirationPERSIST {
args = append(args, options.ExpirationVal)
}
}
args = append(args, "FIELDS", len(fields))
for _, field := range fields {
args = append(args, field)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type HSetEXCondition string
const (
HSetEXFNX HSetEXCondition = "FNX" // Only set the fields if none of them already exist.
HSetEXFXX HSetEXCondition = "FXX" // Only set the fields if all already exist.
)
type HSetEXExpirationType string
const (
HSetEXExpirationEX HSetEXExpirationType = "EX"
HSetEXExpirationPX HSetEXExpirationType = "PX"
HSetEXExpirationEXAT HSetEXExpirationType = "EXAT"
HSetEXExpirationPXAT HSetEXExpirationType = "PXAT"
HSetEXExpirationKEEPTTL HSetEXExpirationType = "KEEPTTL"
)
type HSetEXOptions struct {
Condition HSetEXCondition
ExpirationType HSetEXExpirationType
ExpirationVal int64
}
func (c cmdable) HSetEX(ctx context.Context, key string, fieldsAndValues ...string) *IntCmd {
args := []interface{}{"HSETEX", key, "FIELDS", len(fieldsAndValues) / 2}
for _, field := range fieldsAndValues {
args = append(args, field)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) HSetEXWithArgs(ctx context.Context, key string, options *HSetEXOptions, fieldsAndValues ...string) *IntCmd {
args := []interface{}{"HSETEX", key}
if options.Condition != "" {
args = append(args, string(options.Condition))
}
if options.ExpirationType != "" {
args = append(args, string(options.ExpirationType))
if options.ExpirationType != HSetEXExpirationKEEPTTL {
args = append(args, options.ExpirationVal)
}
}
args = append(args, "FIELDS", len(fieldsAndValues)/2)
for _, field := range fieldsAndValues {
args = append(args, field)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
package redis
import (
"context"
"errors"
"strings"
)
// HOTKEYS commands are only available on standalone *Client instances.
// They are NOT available on ClusterClient, Ring, or UniversalClient because
// HOTKEYS is a stateful command requiring session affinity - all operations
// (START, GET, STOP, RESET) must be sent to the same Redis node.
//
// If you are using UniversalClient and need HOTKEYS functionality, you must
// type assert to *Client first:
//
// if client, ok := universalClient.(*redis.Client); ok {
// result, err := client.HotKeysStart(ctx, args)
// // ...
// }
// HotKeysMetric represents the metrics that can be tracked by the HOTKEYS command.
type HotKeysMetric string
const (
// HotKeysMetricCPU tracks CPU time spent on the key (in microseconds).
HotKeysMetricCPU HotKeysMetric = "CPU"
// HotKeysMetricNET tracks network bytes used by the key (ingress + egress + replication).
HotKeysMetricNET HotKeysMetric = "NET"
)
// HotKeysStartArgs contains the arguments for the HOTKEYS START command.
// This command is only available on standalone clients due to its stateful nature
// requiring session affinity. It must NOT be used on cluster or pooled clients.
type HotKeysStartArgs struct {
// Metrics to track. At least one must be specified.
Metrics []HotKeysMetric
// Count is the number of top keys to report.
// Default: 10, Min: 10, Max: 64
Count uint8
// Duration is the auto-stop tracking after this many seconds.
// Default: 0 (no auto-stop)
Duration int64
// Sample is the sample ratio - track keys with probability 1/sample.
// Default: 1 (track every key), Min: 1
Sample int64
// Slots specifies specific hash slots to track (0-16383).
// All specified slots must be hosted by the receiving node.
// If not specified, all slots are tracked.
Slots []uint16
}
// ErrHotKeysNoMetrics is returned when HotKeysStart is called without any metrics specified.
var ErrHotKeysNoMetrics = errors.New("redis: at least one metric must be specified for HOTKEYS START")
// HotKeysStart starts collecting hotkeys data.
// At least one metric must be specified in args.Metrics.
// This command is only available on standalone clients.
func (c *Client) HotKeysStart(ctx context.Context, args *HotKeysStartArgs) *StatusCmd {
cmdArgs := make([]interface{}, 0, 16)
cmdArgs = append(cmdArgs, "hotkeys", "start")
// Validate that at least one metric is specified
if len(args.Metrics) == 0 {
cmd := NewStatusCmd(ctx, cmdArgs...)
cmd.SetErr(ErrHotKeysNoMetrics)
return cmd
}
cmdArgs = append(cmdArgs, "metrics", len(args.Metrics))
for _, metric := range args.Metrics {
cmdArgs = append(cmdArgs, strings.ToLower(string(metric)))
}
if args.Count > 0 {
cmdArgs = append(cmdArgs, "count", args.Count)
}
if args.Duration > 0 {
cmdArgs = append(cmdArgs, "duration", args.Duration)
}
if args.Sample > 0 {
cmdArgs = append(cmdArgs, "sample", args.Sample)
}
if len(args.Slots) > 0 {
cmdArgs = append(cmdArgs, "slots", len(args.Slots))
for _, slot := range args.Slots {
cmdArgs = append(cmdArgs, slot)
}
}
cmd := NewStatusCmd(ctx, cmdArgs...)
_ = c.Process(ctx, cmd)
return cmd
}
// HotKeysStop stops the ongoing hotkeys collection session.
// This command is only available on standalone clients.
func (c *Client) HotKeysStop(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "hotkeys", "stop")
_ = c.Process(ctx, cmd)
return cmd
}
// HotKeysReset discards the last hotkeys collection session results.
// Returns an error if tracking is currently active.
// This command is only available on standalone clients.
func (c *Client) HotKeysReset(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "hotkeys", "reset")
_ = c.Process(ctx, cmd)
return cmd
}
// HotKeysGet retrieves the results of the ongoing or last hotkeys collection session.
// This command is only available on standalone clients.
func (c *Client) HotKeysGet(ctx context.Context) *HotKeysCmd {
cmd := NewHotKeysCmd(ctx, "hotkeys", "get")
_ = c.Process(ctx, cmd)
return cmd
}
package redis
import "context"
type HyperLogLogCmdable interface {
PFAdd(ctx context.Context, key string, els ...interface{}) *IntCmd
PFCount(ctx context.Context, keys ...string) *IntCmd
PFMerge(ctx context.Context, dest string, keys ...string) *StatusCmd
}
func (c cmdable) PFAdd(ctx context.Context, key string, els ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(els))
args[0] = "pfadd"
args[1] = key
args = appendArgs(args, els)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PFCount(ctx context.Context, keys ...string) *IntCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "pfcount"
for i, key := range keys {
args[1+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PFMerge(ctx context.Context, dest string, keys ...string) *StatusCmd {
args := make([]interface{}, 2+len(keys))
args[0] = "pfmerge"
args[1] = dest
for i, key := range keys {
args[2+i] = key
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
package internal
import (
"fmt"
"strconv"
"time"
"github.com/redis/go-redis/v9/internal/util"
)
func AppendArg(b []byte, v interface{}) []byte {
switch v := v.(type) {
case nil:
return append(b, "<nil>"...)
case string:
return appendUTF8String(b, util.StringToBytes(v))
case []byte:
return appendUTF8String(b, v)
case int:
return strconv.AppendInt(b, int64(v), 10)
case int8:
return strconv.AppendInt(b, int64(v), 10)
case int16:
return strconv.AppendInt(b, int64(v), 10)
case int32:
return strconv.AppendInt(b, int64(v), 10)
case int64:
return strconv.AppendInt(b, v, 10)
case uint:
return strconv.AppendUint(b, uint64(v), 10)
case uint8:
return strconv.AppendUint(b, uint64(v), 10)
case uint16:
return strconv.AppendUint(b, uint64(v), 10)
case uint32:
return strconv.AppendUint(b, uint64(v), 10)
case uint64:
return strconv.AppendUint(b, v, 10)
case float32:
return strconv.AppendFloat(b, float64(v), 'f', -1, 64)
case float64:
return strconv.AppendFloat(b, v, 'f', -1, 64)
case bool:
if v {
return append(b, "true"...)
}
return append(b, "false"...)
case time.Time:
return v.AppendFormat(b, time.RFC3339Nano)
default:
return append(b, fmt.Sprint(v)...)
}
}
func appendUTF8String(dst []byte, src []byte) []byte {
dst = append(dst, src...)
return dst
}
package streaming
import (
"github.com/redis/go-redis/v9/auth"
"github.com/redis/go-redis/v9/internal/pool"
)
// ConnReAuthCredentialsListener is a credentials listener for a specific connection
// that triggers re-authentication when credentials change.
//
// This listener implements the auth.CredentialsListener interface and is subscribed
// to a StreamingCredentialsProvider. When new credentials are received via OnNext,
// it marks the connection for re-authentication through the manager.
//
// The re-authentication is always performed asynchronously to avoid blocking the
// credentials provider and to prevent potential deadlocks with the pool semaphore.
// The actual re-auth happens when the connection is returned to the pool in an idle state.
//
// Lifecycle:
// - Created during connection initialization via Manager.Listener()
// - Subscribed to the StreamingCredentialsProvider
// - Receives credential updates via OnNext()
// - Cleaned up when connection is removed from pool via Manager.RemoveListener()
type ConnReAuthCredentialsListener struct {
// reAuth is the function to re-authenticate the connection with new credentials
reAuth func(conn *pool.Conn, credentials auth.Credentials) error
// onErr is the function to call when re-authentication or acquisition fails
onErr func(conn *pool.Conn, err error)
// conn is the connection this listener is associated with
conn *pool.Conn
// manager is the streaming credentials manager for coordinating re-auth
manager *Manager
}
// OnNext is called when new credentials are received from the StreamingCredentialsProvider.
//
// This method marks the connection for asynchronous re-authentication. The actual
// re-authentication happens in the background when the connection is returned to the
// pool and is in an idle state.
//
// Asynchronous re-auth is used to:
// - Avoid blocking the credentials provider's notification goroutine
// - Prevent deadlocks with the pool's semaphore (especially with small pool sizes)
// - Ensure re-auth happens when the connection is safe to use (not processing commands)
//
// The reAuthFn callback receives:
// - nil if the connection was successfully acquired for re-auth
// - error if acquisition timed out or failed
//
// Thread-safe: Called by the credentials provider's notification goroutine.
func (c *ConnReAuthCredentialsListener) OnNext(credentials auth.Credentials) {
if c.conn == nil || c.conn.IsClosed() || c.manager == nil || c.reAuth == nil {
return
}
// Always use async reauth to avoid complex pool semaphore issues
// The synchronous path can cause deadlocks in the pool's semaphore mechanism
// when called from the Subscribe goroutine, especially with small pool sizes.
// The connection pool hook will re-authenticate the connection when it is
// returned to the pool in a clean, idle state.
c.manager.MarkForReAuth(c.conn, func(err error) {
// err is from connection acquisition (timeout, etc.)
if err != nil {
// Log the error
c.OnError(err)
return
}
// err is from reauth command execution
err = c.reAuth(c.conn, credentials)
if err != nil {
// Log the error
c.OnError(err)
return
}
})
}
// OnError is called when an error occurs during credential streaming or re-authentication.
//
// This method can be called from:
// - The StreamingCredentialsProvider when there's an error in the credentials stream
// - The re-auth process when connection acquisition times out
// - The re-auth process when the AUTH command fails
//
// The error is delegated to the onErr callback provided during listener creation.
//
// Thread-safe: Can be called from multiple goroutines (provider, re-auth worker).
func (c *ConnReAuthCredentialsListener) OnError(err error) {
if c.onErr == nil {
return
}
c.onErr(c.conn, err)
}
// Ensure ConnReAuthCredentialsListener implements the CredentialsListener interface.
var _ auth.CredentialsListener = (*ConnReAuthCredentialsListener)(nil)
package streaming
import (
"sync"
"github.com/redis/go-redis/v9/auth"
)
// CredentialsListeners is a thread-safe collection of credentials listeners
// indexed by connection ID.
//
// This collection is used by the Manager to maintain a registry of listeners
// for each connection in the pool. Listeners are reused when connections are
// reinitialized (e.g., after a handoff) to avoid creating duplicate subscriptions
// to the StreamingCredentialsProvider.
//
// The collection supports concurrent access from multiple goroutines during
// connection initialization, credential updates, and connection removal.
type CredentialsListeners struct {
// listeners maps connection ID to credentials listener
listeners map[uint64]auth.CredentialsListener
// lock protects concurrent access to the listeners map
lock sync.RWMutex
}
// NewCredentialsListeners creates a new thread-safe credentials listeners collection.
func NewCredentialsListeners() *CredentialsListeners {
return &CredentialsListeners{
listeners: make(map[uint64]auth.CredentialsListener),
}
}
// Add adds or updates a credentials listener for a connection.
//
// If a listener already exists for the connection ID, it is replaced.
// This is safe because the old listener should have been unsubscribed
// before the connection was reinitialized.
//
// Thread-safe: Can be called concurrently from multiple goroutines.
func (c *CredentialsListeners) Add(connID uint64, listener auth.CredentialsListener) {
c.lock.Lock()
defer c.lock.Unlock()
if c.listeners == nil {
c.listeners = make(map[uint64]auth.CredentialsListener)
}
c.listeners[connID] = listener
}
// Get retrieves the credentials listener for a connection.
//
// Returns:
// - listener: The credentials listener for the connection, or nil if not found
// - ok: true if a listener exists for the connection ID, false otherwise
//
// Thread-safe: Can be called concurrently from multiple goroutines.
func (c *CredentialsListeners) Get(connID uint64) (auth.CredentialsListener, bool) {
c.lock.RLock()
defer c.lock.RUnlock()
if len(c.listeners) == 0 {
return nil, false
}
listener, ok := c.listeners[connID]
return listener, ok
}
// Remove removes the credentials listener for a connection.
//
// This is called when a connection is removed from the pool to prevent
// memory leaks. If no listener exists for the connection ID, this is a no-op.
//
// Thread-safe: Can be called concurrently from multiple goroutines.
func (c *CredentialsListeners) Remove(connID uint64) {
c.lock.Lock()
defer c.lock.Unlock()
delete(c.listeners, connID)
}
package streaming
import (
"errors"
"time"
"github.com/redis/go-redis/v9/auth"
"github.com/redis/go-redis/v9/internal/pool"
)
// Manager coordinates streaming credentials and re-authentication for a connection pool.
//
// The manager is responsible for:
// - Creating and managing per-connection credentials listeners
// - Providing the pool hook for re-authentication
// - Coordinating between credentials updates and pool operations
//
// When credentials change via a StreamingCredentialsProvider:
// 1. The credentials listener (ConnReAuthCredentialsListener) receives the update
// 2. It calls MarkForReAuth on the manager
// 3. The manager delegates to the pool hook
// 4. The pool hook schedules background re-authentication
//
// The manager maintains a registry of credentials listeners indexed by connection ID,
// allowing listener reuse when connections are reinitialized (e.g., after handoff).
type Manager struct {
// credentialsListeners maps connection ID to credentials listener
credentialsListeners *CredentialsListeners
// pool is the connection pool being managed
pool pool.Pooler
// poolHookRef is the re-authentication pool hook
poolHookRef *ReAuthPoolHook
}
// NewManager creates a new streaming credentials manager.
//
// Parameters:
// - pl: The connection pool to manage
// - reAuthTimeout: Maximum time to wait for acquiring a connection for re-authentication
//
// The manager creates a ReAuthPoolHook sized to match the pool size, ensuring that
// re-auth operations don't exhaust the connection pool.
func NewManager(pl pool.Pooler, reAuthTimeout time.Duration) *Manager {
m := &Manager{
pool: pl,
poolHookRef: NewReAuthPoolHook(pl.Size(), reAuthTimeout),
credentialsListeners: NewCredentialsListeners(),
}
m.poolHookRef.manager = m
return m
}
// PoolHook returns the pool hook for re-authentication.
//
// This hook should be registered with the connection pool to enable
// automatic re-authentication when credentials change.
func (m *Manager) PoolHook() pool.PoolHook {
return m.poolHookRef
}
// Listener returns or creates a credentials listener for a connection.
//
// This method is called during connection initialization to set up the
// credentials listener. If a listener already exists for the connection ID
// (e.g., after a handoff), it is reused.
//
// Parameters:
// - poolCn: The connection to create/get a listener for
// - reAuth: Function to re-authenticate the connection with new credentials
// - onErr: Function to call when re-authentication fails
//
// Returns:
// - auth.CredentialsListener: The listener to subscribe to the credentials provider
// - error: Non-nil if poolCn is nil
//
// Note: The reAuth and onErr callbacks are captured once when the listener is
// created and reused for the connection's lifetime. They should not change.
//
// Thread-safe: Can be called concurrently during connection initialization.
func (m *Manager) Listener(
poolCn *pool.Conn,
reAuth func(*pool.Conn, auth.Credentials) error,
onErr func(*pool.Conn, error),
) (auth.CredentialsListener, error) {
if poolCn == nil {
return nil, errors.New("poolCn cannot be nil")
}
connID := poolCn.GetID()
// if we reconnect the underlying network connection, the streaming credentials listener will continue to work
// so we can get the old listener from the cache and use it.
// subscribing the same (an already subscribed) listener for a StreamingCredentialsProvider SHOULD be a no-op
listener, ok := m.credentialsListeners.Get(connID)
if !ok || listener == nil {
// Create new listener for this connection
// Note: Callbacks (reAuth, onErr) are captured once and reused for the connection's lifetime
newCredListener := &ConnReAuthCredentialsListener{
conn: poolCn,
reAuth: reAuth,
onErr: onErr,
manager: m,
}
m.credentialsListeners.Add(connID, newCredListener)
listener = newCredListener
}
return listener, nil
}
// MarkForReAuth marks a connection for re-authentication.
//
// This method is called by the credentials listener when new credentials are
// received. It delegates to the pool hook to schedule background re-authentication.
//
// Parameters:
// - poolCn: The connection to re-authenticate
// - reAuthFn: Function to call for re-authentication, receives error if acquisition fails
//
// Thread-safe: Called by credentials listeners when credentials change.
func (m *Manager) MarkForReAuth(poolCn *pool.Conn, reAuthFn func(error)) {
connID := poolCn.GetID()
m.poolHookRef.MarkForReAuth(connID, reAuthFn)
}
// RemoveListener removes the credentials listener for a connection.
//
// This method is called by the pool hook's OnRemove to clean up listeners
// when connections are removed from the pool.
//
// Parameters:
// - connID: The connection ID whose listener should be removed
//
// Thread-safe: Called during connection removal.
func (m *Manager) RemoveListener(connID uint64) {
m.credentialsListeners.Remove(connID)
}
package streaming
import (
"context"
"sync"
"time"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/pool"
)
// ReAuthPoolHook is a pool hook that manages background re-authentication of connections
// when credentials change via a streaming credentials provider.
//
// The hook uses a semaphore-based worker pool to limit concurrent re-authentication
// operations and prevent pool exhaustion. When credentials change, connections are
// marked for re-authentication and processed asynchronously in the background.
//
// The re-authentication process:
// 1. OnPut: When a connection is returned to the pool, check if it needs re-auth
// 2. If yes, schedule it for background processing (move from shouldReAuth to scheduledReAuth)
// 3. A worker goroutine acquires the connection (waits until it's not in use)
// 4. Executes the re-auth function while holding the connection
// 5. Releases the connection back to the pool
//
// The hook ensures that:
// - Only one re-auth operation runs per connection at a time
// - Connections are not used for commands during re-authentication
// - Re-auth operations timeout if they can't acquire the connection
// - Resources are properly cleaned up on connection removal
type ReAuthPoolHook struct {
// shouldReAuth maps connection ID to re-auth function
// Connections in this map need re-authentication but haven't been scheduled yet
shouldReAuth map[uint64]func(error)
shouldReAuthLock sync.RWMutex
// workers is a semaphore limiting concurrent re-auth operations
// Initialized with poolSize tokens to prevent pool exhaustion
// Uses FastSemaphore for better performance with eventual fairness
workers *internal.FastSemaphore
// reAuthTimeout is the maximum time to wait for acquiring a connection for re-auth
reAuthTimeout time.Duration
// scheduledReAuth maps connection ID to scheduled status
// Connections in this map have a background worker attempting re-authentication
scheduledReAuth map[uint64]bool
scheduledLock sync.RWMutex
// manager is a back-reference for cleanup operations
manager *Manager
}
// NewReAuthPoolHook creates a new re-authentication pool hook.
//
// Parameters:
// - poolSize: Maximum number of concurrent re-auth operations (typically matches pool size)
// - reAuthTimeout: Maximum time to wait for acquiring a connection for re-authentication
//
// The poolSize parameter is used to initialize the worker semaphore, ensuring that
// re-auth operations don't exhaust the connection pool.
func NewReAuthPoolHook(poolSize int, reAuthTimeout time.Duration) *ReAuthPoolHook {
return &ReAuthPoolHook{
shouldReAuth: make(map[uint64]func(error)),
scheduledReAuth: make(map[uint64]bool),
workers: internal.NewFastSemaphore(int32(poolSize)),
reAuthTimeout: reAuthTimeout,
}
}
// MarkForReAuth marks a connection for re-authentication.
//
// This method is called when credentials change and a connection needs to be
// re-authenticated. The actual re-authentication happens asynchronously when
// the connection is returned to the pool (in OnPut).
//
// Parameters:
// - connID: The connection ID to mark for re-authentication
// - reAuthFn: Function to call for re-authentication, receives error if acquisition fails
//
// Thread-safe: Can be called concurrently from multiple goroutines.
func (r *ReAuthPoolHook) MarkForReAuth(connID uint64, reAuthFn func(error)) {
r.shouldReAuthLock.Lock()
defer r.shouldReAuthLock.Unlock()
r.shouldReAuth[connID] = reAuthFn
}
// OnGet is called when a connection is retrieved from the pool.
//
// This hook checks if the connection needs re-authentication or has a scheduled
// re-auth operation. If so, it rejects the connection (returns accept=false),
// causing the pool to try another connection.
//
// Returns:
// - accept: false if connection needs re-auth, true otherwise
// - err: always nil (errors are not used in this hook)
//
// Thread-safe: Called concurrently by multiple goroutines getting connections.
func (r *ReAuthPoolHook) OnGet(_ context.Context, conn *pool.Conn, _ bool) (accept bool, err error) {
connID := conn.GetID()
r.shouldReAuthLock.RLock()
_, shouldReAuth := r.shouldReAuth[connID]
r.shouldReAuthLock.RUnlock()
// This connection was marked for reauth while in the pool,
// reject the connection
if shouldReAuth {
// simply reject the connection, it will be re-authenticated in OnPut
return false, nil
}
r.scheduledLock.RLock()
_, hasScheduled := r.scheduledReAuth[connID]
r.scheduledLock.RUnlock()
// has scheduled reauth, reject the connection
if hasScheduled {
// simply reject the connection, it currently has a reauth scheduled
// and the worker is waiting for slot to execute the reauth
return false, nil
}
return true, nil
}
// OnPut is called when a connection is returned to the pool.
//
// This hook checks if the connection needs re-authentication. If so, it schedules
// a background goroutine to perform the re-auth asynchronously. The goroutine:
// 1. Waits for a worker slot (semaphore)
// 2. Acquires the connection (waits until not in use)
// 3. Executes the re-auth function
// 4. Releases the connection and worker slot
//
// The connection is always pooled (not removed) since re-auth happens in background.
//
// Returns:
// - shouldPool: always true (connection stays in pool during background re-auth)
// - shouldRemove: always false
// - err: always nil
//
// Thread-safe: Called concurrently by multiple goroutines returning connections.
func (r *ReAuthPoolHook) OnPut(_ context.Context, conn *pool.Conn) (bool, bool, error) {
if conn == nil {
// noop
return true, false, nil
}
connID := conn.GetID()
// Check if reauth is needed and get the function with proper locking
r.shouldReAuthLock.RLock()
reAuthFn, ok := r.shouldReAuth[connID]
r.shouldReAuthLock.RUnlock()
if ok {
// Acquire both locks to atomically move from shouldReAuth to scheduledReAuth
// This prevents race conditions where OnGet might miss the transition
r.shouldReAuthLock.Lock()
r.scheduledLock.Lock()
r.scheduledReAuth[connID] = true
delete(r.shouldReAuth, connID)
r.scheduledLock.Unlock()
r.shouldReAuthLock.Unlock()
go func() {
r.workers.AcquireBlocking()
// safety first
if conn == nil || (conn != nil && conn.IsClosed()) {
r.workers.Release()
return
}
defer func() {
if rec := recover(); rec != nil {
// once again - safety first
internal.Logger.Printf(context.Background(), "panic in reauth worker: %v", rec)
}
r.scheduledLock.Lock()
delete(r.scheduledReAuth, connID)
r.scheduledLock.Unlock()
r.workers.Release()
}()
// Create timeout context for connection acquisition
// This prevents indefinite waiting if the connection is stuck
ctx, cancel := context.WithTimeout(context.Background(), r.reAuthTimeout)
defer cancel()
// Try to acquire the connection for re-authentication
// We need to ensure the connection is IDLE (not IN_USE) before transitioning to UNUSABLE
// This prevents re-authentication from interfering with active commands
// Use AwaitAndTransition to wait for the connection to become IDLE
stateMachine := conn.GetStateMachine()
if stateMachine == nil {
// No state machine - should not happen, but handle gracefully
reAuthFn(pool.ErrConnUnusableTimeout)
return
}
// Use predefined slice to avoid allocation
_, err := stateMachine.AwaitAndTransition(ctx, pool.ValidFromIdle(), pool.StateUnusable)
if err != nil {
// Timeout or other error occurred, cannot acquire connection
reAuthFn(err)
return
}
// safety first
if !conn.IsClosed() {
// Successfully acquired the connection, perform reauth
reAuthFn(nil)
}
// Release the connection: transition from UNUSABLE back to IDLE
stateMachine.Transition(pool.StateIdle)
}()
}
// the reauth will happen in background, as far as the pool is concerned:
// pool the connection, don't remove it, no error
return true, false, nil
}
// OnRemove is called when a connection is removed from the pool.
//
// This hook cleans up all state associated with the connection:
// - Removes from shouldReAuth map (pending re-auth)
// - Removes from scheduledReAuth map (active re-auth)
// - Removes credentials listener from manager
//
// This prevents memory leaks and ensures that removed connections don't have
// lingering re-auth operations or listeners.
//
// Thread-safe: Called when connections are removed due to errors, timeouts, or pool closure.
func (r *ReAuthPoolHook) OnRemove(_ context.Context, conn *pool.Conn, _ error) {
connID := conn.GetID()
r.shouldReAuthLock.Lock()
r.scheduledLock.Lock()
delete(r.scheduledReAuth, connID)
delete(r.shouldReAuth, connID)
r.scheduledLock.Unlock()
r.shouldReAuthLock.Unlock()
if r.manager != nil {
r.manager.RemoveListener(connID)
}
}
var _ pool.PoolHook = (*ReAuthPoolHook)(nil)
package hashtag
import (
"strings"
"github.com/redis/go-redis/v9/internal/rand"
)
const slotNumber = 16384
// CRC16 implementation according to CCITT standards.
// Copyright 2001-2010 Georges Menie (www.menie.org)
// Copyright 2013 The Go Authors. All rights reserved.
// https://redis.io/docs/latest/operate/oss_and_stack/reference/cluster-spec#appendix-a-crc16-reference-implementation-in-ansi-c.
var crc16tab = [256]uint16{
0x0000, 0x1021, 0x2042, 0x3063, 0x4084, 0x50a5, 0x60c6, 0x70e7,
0x8108, 0x9129, 0xa14a, 0xb16b, 0xc18c, 0xd1ad, 0xe1ce, 0xf1ef,
0x1231, 0x0210, 0x3273, 0x2252, 0x52b5, 0x4294, 0x72f7, 0x62d6,
0x9339, 0x8318, 0xb37b, 0xa35a, 0xd3bd, 0xc39c, 0xf3ff, 0xe3de,
0x2462, 0x3443, 0x0420, 0x1401, 0x64e6, 0x74c7, 0x44a4, 0x5485,
0xa56a, 0xb54b, 0x8528, 0x9509, 0xe5ee, 0xf5cf, 0xc5ac, 0xd58d,
0x3653, 0x2672, 0x1611, 0x0630, 0x76d7, 0x66f6, 0x5695, 0x46b4,
0xb75b, 0xa77a, 0x9719, 0x8738, 0xf7df, 0xe7fe, 0xd79d, 0xc7bc,
0x48c4, 0x58e5, 0x6886, 0x78a7, 0x0840, 0x1861, 0x2802, 0x3823,
0xc9cc, 0xd9ed, 0xe98e, 0xf9af, 0x8948, 0x9969, 0xa90a, 0xb92b,
0x5af5, 0x4ad4, 0x7ab7, 0x6a96, 0x1a71, 0x0a50, 0x3a33, 0x2a12,
0xdbfd, 0xcbdc, 0xfbbf, 0xeb9e, 0x9b79, 0x8b58, 0xbb3b, 0xab1a,
0x6ca6, 0x7c87, 0x4ce4, 0x5cc5, 0x2c22, 0x3c03, 0x0c60, 0x1c41,
0xedae, 0xfd8f, 0xcdec, 0xddcd, 0xad2a, 0xbd0b, 0x8d68, 0x9d49,
0x7e97, 0x6eb6, 0x5ed5, 0x4ef4, 0x3e13, 0x2e32, 0x1e51, 0x0e70,
0xff9f, 0xefbe, 0xdfdd, 0xcffc, 0xbf1b, 0xaf3a, 0x9f59, 0x8f78,
0x9188, 0x81a9, 0xb1ca, 0xa1eb, 0xd10c, 0xc12d, 0xf14e, 0xe16f,
0x1080, 0x00a1, 0x30c2, 0x20e3, 0x5004, 0x4025, 0x7046, 0x6067,
0x83b9, 0x9398, 0xa3fb, 0xb3da, 0xc33d, 0xd31c, 0xe37f, 0xf35e,
0x02b1, 0x1290, 0x22f3, 0x32d2, 0x4235, 0x5214, 0x6277, 0x7256,
0xb5ea, 0xa5cb, 0x95a8, 0x8589, 0xf56e, 0xe54f, 0xd52c, 0xc50d,
0x34e2, 0x24c3, 0x14a0, 0x0481, 0x7466, 0x6447, 0x5424, 0x4405,
0xa7db, 0xb7fa, 0x8799, 0x97b8, 0xe75f, 0xf77e, 0xc71d, 0xd73c,
0x26d3, 0x36f2, 0x0691, 0x16b0, 0x6657, 0x7676, 0x4615, 0x5634,
0xd94c, 0xc96d, 0xf90e, 0xe92f, 0x99c8, 0x89e9, 0xb98a, 0xa9ab,
0x5844, 0x4865, 0x7806, 0x6827, 0x18c0, 0x08e1, 0x3882, 0x28a3,
0xcb7d, 0xdb5c, 0xeb3f, 0xfb1e, 0x8bf9, 0x9bd8, 0xabbb, 0xbb9a,
0x4a75, 0x5a54, 0x6a37, 0x7a16, 0x0af1, 0x1ad0, 0x2ab3, 0x3a92,
0xfd2e, 0xed0f, 0xdd6c, 0xcd4d, 0xbdaa, 0xad8b, 0x9de8, 0x8dc9,
0x7c26, 0x6c07, 0x5c64, 0x4c45, 0x3ca2, 0x2c83, 0x1ce0, 0x0cc1,
0xef1f, 0xff3e, 0xcf5d, 0xdf7c, 0xaf9b, 0xbfba, 0x8fd9, 0x9ff8,
0x6e17, 0x7e36, 0x4e55, 0x5e74, 0x2e93, 0x3eb2, 0x0ed1, 0x1ef0,
}
func Key(key string) string {
if s := strings.IndexByte(key, '{'); s > -1 {
if e := strings.IndexByte(key[s+1:], '}'); e > 0 {
return key[s+1 : s+e+1]
}
}
return key
}
func Present(key string) bool {
if key == "" {
return false
}
if s := strings.IndexByte(key, '{'); s > -1 {
if e := strings.IndexByte(key[s+1:], '}'); e > 0 {
return true
}
}
return false
}
func RandomSlot() int {
return rand.Intn(slotNumber)
}
// Slot returns a consistent slot number between 0 and 16383
// for any given string key.
func Slot(key string) int {
if key == "" {
return RandomSlot()
}
key = Key(key)
return int(crc16sum(key)) % slotNumber
}
func crc16sum(key string) (crc uint16) {
for i := 0; i < len(key); i++ {
crc = (crc << 8) ^ crc16tab[(byte(crc>>8)^key[i])&0x00ff]
}
return
}
package hscan
import (
"errors"
"fmt"
"reflect"
"strconv"
)
// decoderFunc represents decoding functions for default built-in types.
type decoderFunc func(reflect.Value, string) error
// Scanner is the interface implemented by themselves,
// which will override the decoding behavior of decoderFunc.
type Scanner interface {
ScanRedis(s string) error
}
var (
// List of built-in decoders indexed by their numeric constant values (eg: reflect.Bool = 1).
decoders = []decoderFunc{
reflect.Bool: decodeBool,
reflect.Int: decodeInt,
reflect.Int8: decodeInt8,
reflect.Int16: decodeInt16,
reflect.Int32: decodeInt32,
reflect.Int64: decodeInt64,
reflect.Uint: decodeUint,
reflect.Uint8: decodeUint8,
reflect.Uint16: decodeUint16,
reflect.Uint32: decodeUint32,
reflect.Uint64: decodeUint64,
reflect.Float32: decodeFloat32,
reflect.Float64: decodeFloat64,
reflect.Complex64: decodeUnsupported,
reflect.Complex128: decodeUnsupported,
reflect.Array: decodeUnsupported,
reflect.Chan: decodeUnsupported,
reflect.Func: decodeUnsupported,
reflect.Interface: decodeUnsupported,
reflect.Map: decodeUnsupported,
reflect.Ptr: decodeUnsupported,
reflect.Slice: decodeSlice,
reflect.String: decodeString,
reflect.Struct: decodeUnsupported,
reflect.UnsafePointer: decodeUnsupported,
}
// Global map of struct field specs that is populated once for every new
// struct type that is scanned. This caches the field types and the corresponding
// decoder functions to avoid iterating through struct fields on subsequent scans.
globalStructMap = newStructMap()
)
func Struct(dst interface{}) (StructValue, error) {
v := reflect.ValueOf(dst)
// The destination to scan into should be a struct pointer.
if v.Kind() != reflect.Ptr || v.IsNil() {
return StructValue{}, fmt.Errorf("redis.Scan(non-pointer %T)", dst)
}
v = v.Elem()
if v.Kind() != reflect.Struct {
return StructValue{}, fmt.Errorf("redis.Scan(non-struct %T)", dst)
}
return StructValue{
spec: globalStructMap.get(v.Type()),
value: v,
}, nil
}
// Scan scans the results from a key-value Redis map result set to a destination struct.
// The Redis keys are matched to the struct's field with the `redis` tag.
func Scan(dst interface{}, keys []interface{}, vals []interface{}) error {
if len(keys) != len(vals) {
return errors.New("args should have the same number of keys and vals")
}
strct, err := Struct(dst)
if err != nil {
return err
}
// Iterate through the (key, value) sequence.
for i := 0; i < len(vals); i++ {
key, ok := keys[i].(string)
if !ok {
continue
}
val, ok := vals[i].(string)
if !ok {
continue
}
if err := strct.Scan(key, val); err != nil {
return err
}
}
return nil
}
func decodeBool(f reflect.Value, s string) error {
b, err := strconv.ParseBool(s)
if err != nil {
return err
}
f.SetBool(b)
return nil
}
func decodeInt8(f reflect.Value, s string) error {
return decodeNumber(f, s, 8)
}
func decodeInt16(f reflect.Value, s string) error {
return decodeNumber(f, s, 16)
}
func decodeInt32(f reflect.Value, s string) error {
return decodeNumber(f, s, 32)
}
func decodeInt64(f reflect.Value, s string) error {
return decodeNumber(f, s, 64)
}
func decodeInt(f reflect.Value, s string) error {
return decodeNumber(f, s, 0)
}
func decodeNumber(f reflect.Value, s string, bitSize int) error {
v, err := strconv.ParseInt(s, 10, bitSize)
if err != nil {
return err
}
f.SetInt(v)
return nil
}
func decodeUint8(f reflect.Value, s string) error {
return decodeUnsignedNumber(f, s, 8)
}
func decodeUint16(f reflect.Value, s string) error {
return decodeUnsignedNumber(f, s, 16)
}
func decodeUint32(f reflect.Value, s string) error {
return decodeUnsignedNumber(f, s, 32)
}
func decodeUint64(f reflect.Value, s string) error {
return decodeUnsignedNumber(f, s, 64)
}
func decodeUint(f reflect.Value, s string) error {
return decodeUnsignedNumber(f, s, 0)
}
func decodeUnsignedNumber(f reflect.Value, s string, bitSize int) error {
v, err := strconv.ParseUint(s, 10, bitSize)
if err != nil {
return err
}
f.SetUint(v)
return nil
}
func decodeFloat32(f reflect.Value, s string) error {
v, err := strconv.ParseFloat(s, 32)
if err != nil {
return err
}
f.SetFloat(v)
return nil
}
// although the default is float64, but we better define it.
func decodeFloat64(f reflect.Value, s string) error {
v, err := strconv.ParseFloat(s, 64)
if err != nil {
return err
}
f.SetFloat(v)
return nil
}
func decodeString(f reflect.Value, s string) error {
f.SetString(s)
return nil
}
func decodeSlice(f reflect.Value, s string) error {
// []byte slice ([]uint8).
if f.Type().Elem().Kind() == reflect.Uint8 {
f.SetBytes([]byte(s))
}
return nil
}
func decodeUnsupported(v reflect.Value, s string) error {
return fmt.Errorf("redis.Scan(unsupported %s)", v.Type())
}
package hscan
import (
"encoding"
"fmt"
"reflect"
"strings"
"sync"
"github.com/redis/go-redis/v9/internal/util"
)
// structMap contains the map of struct fields for target structs
// indexed by the struct type.
type structMap struct {
m sync.Map
}
func newStructMap() *structMap {
return new(structMap)
}
func (s *structMap) get(t reflect.Type) *structSpec {
if v, ok := s.m.Load(t); ok {
return v.(*structSpec)
}
spec := newStructSpec(t, "redis")
s.m.Store(t, spec)
return spec
}
//------------------------------------------------------------------------------
// structSpec contains the list of all fields in a target struct.
type structSpec struct {
m map[string]*structField
}
func (s *structSpec) set(tag string, sf *structField) {
s.m[tag] = sf
}
func newStructSpec(t reflect.Type, fieldTag string) *structSpec {
numField := t.NumField()
out := &structSpec{
m: make(map[string]*structField, numField),
}
for i := 0; i < numField; i++ {
f := t.Field(i)
tag := f.Tag.Get(fieldTag)
if tag == "" || tag == "-" {
continue
}
tag = strings.Split(tag, ",")[0]
if tag == "" {
continue
}
// Use the built-in decoder.
kind := f.Type.Kind()
if kind == reflect.Pointer {
kind = f.Type.Elem().Kind()
}
out.set(tag, &structField{index: i, fn: decoders[kind]})
}
return out
}
//------------------------------------------------------------------------------
// structField represents a single field in a target struct.
type structField struct {
index int
fn decoderFunc
}
//------------------------------------------------------------------------------
type StructValue struct {
spec *structSpec
value reflect.Value
}
func (s StructValue) Scan(key string, value string) error {
field, ok := s.spec.m[key]
if !ok {
return nil
}
v := s.value.Field(field.index)
isPtr := v.Kind() == reflect.Ptr
if isPtr && v.IsNil() {
v.Set(reflect.New(v.Type().Elem()))
}
if !isPtr && v.Type().Name() != "" && v.CanAddr() {
v = v.Addr()
isPtr = true
}
if isPtr && v.Type().NumMethod() > 0 && v.CanInterface() {
switch scan := v.Interface().(type) {
case Scanner:
return scan.ScanRedis(value)
case encoding.TextUnmarshaler:
return scan.UnmarshalText(util.StringToBytes(value))
}
}
if isPtr {
v = v.Elem()
}
if err := field.fn(v, value); err != nil {
t := s.value.Type()
return fmt.Errorf("cannot scan redis.result %s into struct field %s.%s of type %s, error-%s",
value, t.Name(), t.Field(field.index).Name, t.Field(field.index).Type, err.Error())
}
return nil
}
package internal
import (
"time"
"github.com/redis/go-redis/v9/internal/rand"
)
func RetryBackoff(retry int, minBackoff, maxBackoff time.Duration) time.Duration {
if retry < 0 {
panic("not reached")
}
if minBackoff == 0 {
return 0
}
d := minBackoff << uint(retry)
if d < minBackoff {
return maxBackoff
}
d = minBackoff + time.Duration(rand.Int63n(int64(d)))
if d > maxBackoff || d < minBackoff {
d = maxBackoff
}
return d
}
package internal
import (
"context"
"fmt"
"log"
"os"
)
// TODO (ned): Revisit logging
// Add more standardized approach with log levels and configurability
type Logging interface {
Printf(ctx context.Context, format string, v ...interface{})
}
type DefaultLogger struct {
log *log.Logger
}
func (l *DefaultLogger) Printf(ctx context.Context, format string, v ...interface{}) {
_ = l.log.Output(2, fmt.Sprintf(format, v...))
}
func NewDefaultLogger() Logging {
return &DefaultLogger{
log: log.New(os.Stderr, "redis: ", log.LstdFlags|log.Lshortfile),
}
}
// Logger calls Output to print to the stderr.
// Arguments are handled in the manner of fmt.Print.
var Logger Logging = NewDefaultLogger()
var LogLevel LogLevelT = LogLevelError
// LogLevelT represents the logging level
type LogLevelT int
// Log level constants for the entire go-redis library
const (
LogLevelError LogLevelT = iota // 0 - errors only
LogLevelWarn // 1 - warnings and errors
LogLevelInfo // 2 - info, warnings, and errors
LogLevelDebug // 3 - debug, info, warnings, and errors
)
// String returns the string representation of the log level
func (l LogLevelT) String() string {
switch l {
case LogLevelError:
return "ERROR"
case LogLevelWarn:
return "WARN"
case LogLevelInfo:
return "INFO"
case LogLevelDebug:
return "DEBUG"
default:
return "UNKNOWN"
}
}
// IsValid returns true if the log level is valid
func (l LogLevelT) IsValid() bool {
return l >= LogLevelError && l <= LogLevelDebug
}
func (l LogLevelT) WarnOrAbove() bool {
return l >= LogLevelWarn
}
func (l LogLevelT) InfoOrAbove() bool {
return l >= LogLevelInfo
}
func (l LogLevelT) DebugOrAbove() bool {
return l >= LogLevelDebug
}
package logs
import (
"encoding/json"
"fmt"
"regexp"
"github.com/redis/go-redis/v9/internal"
)
// appendJSONIfDebug appends JSON data to a message only if the global log level is Debug
func appendJSONIfDebug(message string, data map[string]interface{}) string {
if internal.LogLevel.DebugOrAbove() {
jsonData, _ := json.Marshal(data)
return fmt.Sprintf("%s %s", message, string(jsonData))
}
return message
}
const (
// ========================================
// CIRCUIT_BREAKER.GO - Circuit breaker management
// ========================================
CircuitBreakerTransitioningToHalfOpenMessage = "circuit breaker transitioning to half-open"
CircuitBreakerOpenedMessage = "circuit breaker opened"
CircuitBreakerReopenedMessage = "circuit breaker reopened"
CircuitBreakerClosedMessage = "circuit breaker closed"
CircuitBreakerCleanupMessage = "circuit breaker cleanup"
CircuitBreakerOpenMessage = "circuit breaker is open, failing fast"
// ========================================
// CONFIG.GO - Configuration and debug
// ========================================
DebugLoggingEnabledMessage = "debug logging enabled"
ConfigDebugMessage = "config debug"
// ========================================
// ERRORS.GO - Error message constants
// ========================================
InvalidRelaxedTimeoutErrorMessage = "relaxed timeout must be greater than 0"
InvalidHandoffTimeoutErrorMessage = "handoff timeout must be greater than 0"
InvalidHandoffWorkersErrorMessage = "MaxWorkers must be greater than or equal to 0"
InvalidHandoffQueueSizeErrorMessage = "handoff queue size must be greater than 0"
InvalidPostHandoffRelaxedDurationErrorMessage = "post-handoff relaxed duration must be greater than or equal to 0"
InvalidEndpointTypeErrorMessage = "invalid endpoint type"
InvalidMaintNotificationsErrorMessage = "invalid maintenance notifications setting (must be 'disabled', 'enabled', or 'auto')"
InvalidHandoffRetriesErrorMessage = "MaxHandoffRetries must be between 1 and 10"
InvalidClientErrorMessage = "invalid client type"
InvalidNotificationErrorMessage = "invalid notification format"
MaxHandoffRetriesReachedErrorMessage = "max handoff retries reached"
HandoffQueueFullErrorMessage = "handoff queue is full, cannot queue new handoff requests - consider increasing HandoffQueueSize or MaxWorkers in configuration"
InvalidCircuitBreakerFailureThresholdErrorMessage = "circuit breaker failure threshold must be >= 1"
InvalidCircuitBreakerResetTimeoutErrorMessage = "circuit breaker reset timeout must be >= 0"
InvalidCircuitBreakerMaxRequestsErrorMessage = "circuit breaker max requests must be >= 1"
ConnectionMarkedForHandoffErrorMessage = "connection marked for handoff"
ConnectionInvalidHandoffStateErrorMessage = "connection is in invalid state for handoff"
ShutdownErrorMessage = "shutdown"
CircuitBreakerOpenErrorMessage = "circuit breaker is open, failing fast"
// ========================================
// EXAMPLE_HOOKS.GO - Example metrics hooks
// ========================================
MetricsHookProcessingNotificationMessage = "metrics hook processing"
MetricsHookRecordedErrorMessage = "metrics hook recorded error"
// ========================================
// HANDOFF_WORKER.GO - Connection handoff processing
// ========================================
HandoffStartedMessage = "handoff started"
HandoffFailedMessage = "handoff failed"
ConnectionNotMarkedForHandoffMessage = "is not marked for handoff and has no retries"
ConnectionNotMarkedForHandoffErrorMessage = "is not marked for handoff"
HandoffRetryAttemptMessage = "Performing handoff"
CannotQueueHandoffForRetryMessage = "can't queue handoff for retry"
HandoffQueueFullMessage = "handoff queue is full"
FailedToDialNewEndpointMessage = "failed to dial new endpoint"
ApplyingRelaxedTimeoutDueToPostHandoffMessage = "applying relaxed timeout due to post-handoff"
HandoffSuccessMessage = "handoff succeeded"
RemovingConnectionFromPoolMessage = "removing connection from pool"
NoPoolProvidedMessageCannotRemoveMessage = "no pool provided, cannot remove connection, closing it"
WorkerExitingDueToShutdownMessage = "worker exiting due to shutdown"
WorkerExitingDueToShutdownWhileProcessingMessage = "worker exiting due to shutdown while processing request"
WorkerPanicRecoveredMessage = "worker panic recovered"
WorkerExitingDueToInactivityTimeoutMessage = "worker exiting due to inactivity timeout"
ReachedMaxHandoffRetriesMessage = "reached max handoff retries"
// ========================================
// MANAGER.GO - Moving operation tracking and handler registration
// ========================================
DuplicateMovingOperationMessage = "duplicate MOVING operation ignored"
TrackingMovingOperationMessage = "tracking MOVING operation"
UntrackingMovingOperationMessage = "untracking MOVING operation"
OperationNotTrackedMessage = "operation not tracked"
FailedToRegisterHandlerMessage = "failed to register handler"
// ========================================
// HOOKS.GO - Notification processing hooks
// ========================================
ProcessingNotificationMessage = "processing notification started"
ProcessingNotificationFailedMessage = "proccessing notification failed"
ProcessingNotificationSucceededMessage = "processing notification succeeded"
// ========================================
// POOL_HOOK.GO - Pool connection management
// ========================================
FailedToQueueHandoffMessage = "failed to queue handoff"
MarkedForHandoffMessage = "connection marked for handoff"
// ========================================
// PUSH_NOTIFICATION_HANDLER.GO - Push notification validation and processing
// ========================================
InvalidNotificationFormatMessage = "invalid notification format"
InvalidNotificationTypeFormatMessage = "invalid notification type format"
InvalidSeqIDInMovingNotificationMessage = "invalid seqID in MOVING notification"
InvalidTimeSInMovingNotificationMessage = "invalid timeS in MOVING notification"
InvalidNewEndpointInMovingNotificationMessage = "invalid newEndpoint in MOVING notification"
NoConnectionInHandlerContextMessage = "no connection in handler context"
InvalidConnectionTypeInHandlerContextMessage = "invalid connection type in handler context"
SchedulingHandoffToCurrentEndpointMessage = "scheduling handoff to current endpoint"
RelaxedTimeoutDueToNotificationMessage = "applying relaxed timeout due to notification"
UnrelaxedTimeoutMessage = "clearing relaxed timeout"
ManagerNotInitializedMessage = "manager not initialized"
FailedToMarkForHandoffMessage = "failed to mark connection for handoff"
InvalidSeqIDInSMigratingNotificationMessage = "invalid SeqID in SMIGRATING notification"
InvalidSeqIDInSMigratedNotificationMessage = "invalid SeqID in SMIGRATED notification"
TriggeringClusterStateReloadMessage = "triggering cluster state reload"
// ========================================
// used in pool/conn
// ========================================
UnrelaxedTimeoutAfterDeadlineMessage = "clearing relaxed timeout after deadline"
)
func HandoffStarted(connID uint64, newEndpoint string) string {
message := fmt.Sprintf("conn[%d] %s to %s", connID, HandoffStartedMessage, newEndpoint)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"endpoint": newEndpoint,
})
}
func HandoffFailed(connID uint64, newEndpoint string, attempt int, maxAttempts int, err error) string {
message := fmt.Sprintf("conn[%d] %s to %s (attempt %d/%d): %v", connID, HandoffFailedMessage, newEndpoint, attempt, maxAttempts, err)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"endpoint": newEndpoint,
"attempt": attempt,
"maxAttempts": maxAttempts,
"error": err.Error(),
})
}
func HandoffSucceeded(connID uint64, newEndpoint string) string {
message := fmt.Sprintf("conn[%d] %s to %s", connID, HandoffSuccessMessage, newEndpoint)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"endpoint": newEndpoint,
})
}
// Timeout-related log functions
func RelaxedTimeoutDueToNotification(connID uint64, notificationType string, timeout interface{}) string {
message := fmt.Sprintf("conn[%d] %s %s (%v)", connID, RelaxedTimeoutDueToNotificationMessage, notificationType, timeout)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"notificationType": notificationType,
"timeout": fmt.Sprintf("%v", timeout),
})
}
func UnrelaxedTimeout(connID uint64) string {
message := fmt.Sprintf("conn[%d] %s", connID, UnrelaxedTimeoutMessage)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
})
}
func UnrelaxedTimeoutAfterDeadline(connID uint64) string {
message := fmt.Sprintf("conn[%d] %s", connID, UnrelaxedTimeoutAfterDeadlineMessage)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
})
}
// Handoff queue and marking functions
func HandoffQueueFull(queueLen, queueCap int) string {
message := fmt.Sprintf("%s (%d/%d), cannot queue new handoff requests - consider increasing HandoffQueueSize or MaxWorkers in configuration", HandoffQueueFullMessage, queueLen, queueCap)
return appendJSONIfDebug(message, map[string]interface{}{
"queueLen": queueLen,
"queueCap": queueCap,
})
}
func FailedToQueueHandoff(connID uint64, err error) string {
message := fmt.Sprintf("conn[%d] %s: %v", connID, FailedToQueueHandoffMessage, err)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"error": err.Error(),
})
}
func FailedToMarkForHandoff(connID uint64, err error) string {
message := fmt.Sprintf("conn[%d] %s: %v", connID, FailedToMarkForHandoffMessage, err)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"error": err.Error(),
})
}
func FailedToDialNewEndpoint(connID uint64, endpoint string, err error) string {
message := fmt.Sprintf("conn[%d] %s %s: %v", connID, FailedToDialNewEndpointMessage, endpoint, err)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"endpoint": endpoint,
"error": err.Error(),
})
}
func ReachedMaxHandoffRetries(connID uint64, endpoint string, maxRetries int) string {
message := fmt.Sprintf("conn[%d] %s to %s (max retries: %d)", connID, ReachedMaxHandoffRetriesMessage, endpoint, maxRetries)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"endpoint": endpoint,
"maxRetries": maxRetries,
})
}
// Notification processing functions
func ProcessingNotification(connID uint64, seqID int64, notificationType string, notification interface{}) string {
message := fmt.Sprintf("conn[%d] seqID[%d] %s %s: %v", connID, seqID, ProcessingNotificationMessage, notificationType, notification)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"seqID": seqID,
"notificationType": notificationType,
"notification": fmt.Sprintf("%v", notification),
})
}
func ProcessingNotificationFailed(connID uint64, notificationType string, err error, notification interface{}) string {
message := fmt.Sprintf("conn[%d] %s %s: %v - %v", connID, ProcessingNotificationFailedMessage, notificationType, err, notification)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"notificationType": notificationType,
"error": err.Error(),
"notification": fmt.Sprintf("%v", notification),
})
}
func ProcessingNotificationSucceeded(connID uint64, notificationType string) string {
message := fmt.Sprintf("conn[%d] %s %s", connID, ProcessingNotificationSucceededMessage, notificationType)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"notificationType": notificationType,
})
}
// Moving operation tracking functions
func DuplicateMovingOperation(connID uint64, endpoint string, seqID int64) string {
message := fmt.Sprintf("conn[%d] %s for %s seqID[%d]", connID, DuplicateMovingOperationMessage, endpoint, seqID)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"endpoint": endpoint,
"seqID": seqID,
})
}
func TrackingMovingOperation(connID uint64, endpoint string, seqID int64) string {
message := fmt.Sprintf("conn[%d] %s for %s seqID[%d]", connID, TrackingMovingOperationMessage, endpoint, seqID)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"endpoint": endpoint,
"seqID": seqID,
})
}
func UntrackingMovingOperation(connID uint64, seqID int64) string {
message := fmt.Sprintf("conn[%d] %s seqID[%d]", connID, UntrackingMovingOperationMessage, seqID)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"seqID": seqID,
})
}
func OperationNotTracked(connID uint64, seqID int64) string {
message := fmt.Sprintf("conn[%d] %s seqID[%d]", connID, OperationNotTrackedMessage, seqID)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"seqID": seqID,
})
}
// Connection pool functions
func RemovingConnectionFromPool(connID uint64, reason error) string {
metadata := map[string]interface{}{
"connID": connID,
"reason": "unknown", // this will be overwritten if reason is not nil
}
if reason != nil {
metadata["reason"] = reason.Error()
}
message := fmt.Sprintf("conn[%d] %s due to: %v", connID, RemovingConnectionFromPoolMessage, reason)
return appendJSONIfDebug(message, metadata)
}
func NoPoolProvidedCannotRemove(connID uint64, reason error) string {
metadata := map[string]interface{}{
"connID": connID,
"reason": "unknown", // this will be overwritten if reason is not nil
}
if reason != nil {
metadata["reason"] = reason.Error()
}
message := fmt.Sprintf("conn[%d] %s due to: %v", connID, NoPoolProvidedMessageCannotRemoveMessage, reason)
return appendJSONIfDebug(message, metadata)
}
// Circuit breaker functions
func CircuitBreakerOpen(connID uint64, endpoint string) string {
message := fmt.Sprintf("conn[%d] %s for %s", connID, CircuitBreakerOpenMessage, endpoint)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"endpoint": endpoint,
})
}
// Additional handoff functions for specific cases
func ConnectionNotMarkedForHandoff(connID uint64) string {
message := fmt.Sprintf("conn[%d] %s", connID, ConnectionNotMarkedForHandoffMessage)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
})
}
func ConnectionNotMarkedForHandoffError(connID uint64) string {
return fmt.Sprintf("conn[%d] %s", connID, ConnectionNotMarkedForHandoffErrorMessage)
}
func HandoffRetryAttempt(connID uint64, retries int, newEndpoint string, oldEndpoint string) string {
message := fmt.Sprintf("conn[%d] Retry %d: %s to %s(was %s)", connID, retries, HandoffRetryAttemptMessage, newEndpoint, oldEndpoint)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"retries": retries,
"newEndpoint": newEndpoint,
"oldEndpoint": oldEndpoint,
})
}
func CannotQueueHandoffForRetry(err error) string {
message := fmt.Sprintf("%s: %v", CannotQueueHandoffForRetryMessage, err)
return appendJSONIfDebug(message, map[string]interface{}{
"error": err.Error(),
})
}
// Validation and error functions
func InvalidNotificationFormat(notification interface{}) string {
message := fmt.Sprintf("%s: %v", InvalidNotificationFormatMessage, notification)
return appendJSONIfDebug(message, map[string]interface{}{
"notification": fmt.Sprintf("%v", notification),
})
}
func InvalidNotificationTypeFormat(notificationType interface{}) string {
message := fmt.Sprintf("%s: %v", InvalidNotificationTypeFormatMessage, notificationType)
return appendJSONIfDebug(message, map[string]interface{}{
"notificationType": fmt.Sprintf("%v", notificationType),
})
}
// InvalidNotification creates a log message for invalid notifications of any type
func InvalidNotification(notificationType string, notification interface{}) string {
message := fmt.Sprintf("invalid %s notification: %v", notificationType, notification)
return appendJSONIfDebug(message, map[string]interface{}{
"notificationType": notificationType,
"notification": fmt.Sprintf("%v", notification),
})
}
func InvalidSeqIDInMovingNotification(seqID interface{}) string {
message := fmt.Sprintf("%s: %v", InvalidSeqIDInMovingNotificationMessage, seqID)
return appendJSONIfDebug(message, map[string]interface{}{
"seqID": fmt.Sprintf("%v", seqID),
})
}
func InvalidTimeSInMovingNotification(timeS interface{}) string {
message := fmt.Sprintf("%s: %v", InvalidTimeSInMovingNotificationMessage, timeS)
return appendJSONIfDebug(message, map[string]interface{}{
"timeS": fmt.Sprintf("%v", timeS),
})
}
func InvalidNewEndpointInMovingNotification(newEndpoint interface{}) string {
message := fmt.Sprintf("%s: %v", InvalidNewEndpointInMovingNotificationMessage, newEndpoint)
return appendJSONIfDebug(message, map[string]interface{}{
"newEndpoint": fmt.Sprintf("%v", newEndpoint),
})
}
func NoConnectionInHandlerContext(notificationType string) string {
message := fmt.Sprintf("%s for %s notification", NoConnectionInHandlerContextMessage, notificationType)
return appendJSONIfDebug(message, map[string]interface{}{
"notificationType": notificationType,
})
}
func InvalidConnectionTypeInHandlerContext(notificationType string, conn interface{}, handlerCtx interface{}) string {
message := fmt.Sprintf("%s for %s notification - %T %#v", InvalidConnectionTypeInHandlerContextMessage, notificationType, conn, handlerCtx)
return appendJSONIfDebug(message, map[string]interface{}{
"notificationType": notificationType,
"connType": fmt.Sprintf("%T", conn),
})
}
func SchedulingHandoffToCurrentEndpoint(connID uint64, seconds float64) string {
message := fmt.Sprintf("conn[%d] %s in %v seconds", connID, SchedulingHandoffToCurrentEndpointMessage, seconds)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"seconds": seconds,
})
}
func ManagerNotInitialized() string {
return appendJSONIfDebug(ManagerNotInitializedMessage, map[string]interface{}{})
}
func FailedToRegisterHandler(notificationType string, err error) string {
message := fmt.Sprintf("%s for %s: %v", FailedToRegisterHandlerMessage, notificationType, err)
return appendJSONIfDebug(message, map[string]interface{}{
"notificationType": notificationType,
"error": err.Error(),
})
}
func ShutdownError() string {
return appendJSONIfDebug(ShutdownErrorMessage, map[string]interface{}{})
}
// Configuration validation error functions
func InvalidRelaxedTimeoutError() string {
return appendJSONIfDebug(InvalidRelaxedTimeoutErrorMessage, map[string]interface{}{})
}
func InvalidHandoffTimeoutError() string {
return appendJSONIfDebug(InvalidHandoffTimeoutErrorMessage, map[string]interface{}{})
}
func InvalidHandoffWorkersError() string {
return appendJSONIfDebug(InvalidHandoffWorkersErrorMessage, map[string]interface{}{})
}
func InvalidHandoffQueueSizeError() string {
return appendJSONIfDebug(InvalidHandoffQueueSizeErrorMessage, map[string]interface{}{})
}
func InvalidPostHandoffRelaxedDurationError() string {
return appendJSONIfDebug(InvalidPostHandoffRelaxedDurationErrorMessage, map[string]interface{}{})
}
func InvalidEndpointTypeError() string {
return appendJSONIfDebug(InvalidEndpointTypeErrorMessage, map[string]interface{}{})
}
func InvalidMaintNotificationsError() string {
return appendJSONIfDebug(InvalidMaintNotificationsErrorMessage, map[string]interface{}{})
}
func InvalidHandoffRetriesError() string {
return appendJSONIfDebug(InvalidHandoffRetriesErrorMessage, map[string]interface{}{})
}
func InvalidClientError() string {
return appendJSONIfDebug(InvalidClientErrorMessage, map[string]interface{}{})
}
func InvalidNotificationError() string {
return appendJSONIfDebug(InvalidNotificationErrorMessage, map[string]interface{}{})
}
func MaxHandoffRetriesReachedError() string {
return appendJSONIfDebug(MaxHandoffRetriesReachedErrorMessage, map[string]interface{}{})
}
func HandoffQueueFullError() string {
return appendJSONIfDebug(HandoffQueueFullErrorMessage, map[string]interface{}{})
}
func InvalidCircuitBreakerFailureThresholdError() string {
return appendJSONIfDebug(InvalidCircuitBreakerFailureThresholdErrorMessage, map[string]interface{}{})
}
func InvalidCircuitBreakerResetTimeoutError() string {
return appendJSONIfDebug(InvalidCircuitBreakerResetTimeoutErrorMessage, map[string]interface{}{})
}
func InvalidCircuitBreakerMaxRequestsError() string {
return appendJSONIfDebug(InvalidCircuitBreakerMaxRequestsErrorMessage, map[string]interface{}{})
}
// Configuration and debug functions
func DebugLoggingEnabled() string {
return appendJSONIfDebug(DebugLoggingEnabledMessage, map[string]interface{}{})
}
func ConfigDebug(config interface{}) string {
message := fmt.Sprintf("%s: %+v", ConfigDebugMessage, config)
return appendJSONIfDebug(message, map[string]interface{}{
"config": fmt.Sprintf("%+v", config),
})
}
// Handoff worker functions
func WorkerExitingDueToShutdown() string {
return appendJSONIfDebug(WorkerExitingDueToShutdownMessage, map[string]interface{}{})
}
func WorkerExitingDueToShutdownWhileProcessing() string {
return appendJSONIfDebug(WorkerExitingDueToShutdownWhileProcessingMessage, map[string]interface{}{})
}
func WorkerPanicRecovered(panicValue interface{}) string {
message := fmt.Sprintf("%s: %v", WorkerPanicRecoveredMessage, panicValue)
return appendJSONIfDebug(message, map[string]interface{}{
"panic": fmt.Sprintf("%v", panicValue),
})
}
func WorkerExitingDueToInactivityTimeout(timeout interface{}) string {
message := fmt.Sprintf("%s (%v)", WorkerExitingDueToInactivityTimeoutMessage, timeout)
return appendJSONIfDebug(message, map[string]interface{}{
"timeout": fmt.Sprintf("%v", timeout),
})
}
func ApplyingRelaxedTimeoutDueToPostHandoff(connID uint64, timeout interface{}, until string) string {
message := fmt.Sprintf("conn[%d] %s (%v) until %s", connID, ApplyingRelaxedTimeoutDueToPostHandoffMessage, timeout, until)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
"timeout": fmt.Sprintf("%v", timeout),
"until": until,
})
}
// Example hooks functions
func MetricsHookProcessingNotification(notificationType string, connID uint64) string {
message := fmt.Sprintf("%s %s notification on conn[%d]", MetricsHookProcessingNotificationMessage, notificationType, connID)
return appendJSONIfDebug(message, map[string]interface{}{
"notificationType": notificationType,
"connID": connID,
})
}
func MetricsHookRecordedError(notificationType string, connID uint64, err error) string {
message := fmt.Sprintf("%s for %s notification on conn[%d]: %v", MetricsHookRecordedErrorMessage, notificationType, connID, err)
return appendJSONIfDebug(message, map[string]interface{}{
"notificationType": notificationType,
"connID": connID,
"error": err.Error(),
})
}
// Pool hook functions
func MarkedForHandoff(connID uint64) string {
message := fmt.Sprintf("conn[%d] %s", connID, MarkedForHandoffMessage)
return appendJSONIfDebug(message, map[string]interface{}{
"connID": connID,
})
}
// Circuit breaker additional functions
func CircuitBreakerTransitioningToHalfOpen(endpoint string) string {
message := fmt.Sprintf("%s for %s", CircuitBreakerTransitioningToHalfOpenMessage, endpoint)
return appendJSONIfDebug(message, map[string]interface{}{
"endpoint": endpoint,
})
}
func CircuitBreakerOpened(endpoint string, failures int64) string {
message := fmt.Sprintf("%s for endpoint %s after %d failures", CircuitBreakerOpenedMessage, endpoint, failures)
return appendJSONIfDebug(message, map[string]interface{}{
"endpoint": endpoint,
"failures": failures,
})
}
func CircuitBreakerReopened(endpoint string) string {
message := fmt.Sprintf("%s for endpoint %s due to failure in half-open state", CircuitBreakerReopenedMessage, endpoint)
return appendJSONIfDebug(message, map[string]interface{}{
"endpoint": endpoint,
})
}
func CircuitBreakerClosed(endpoint string, successes int64) string {
message := fmt.Sprintf("%s for endpoint %s after %d successful requests", CircuitBreakerClosedMessage, endpoint, successes)
return appendJSONIfDebug(message, map[string]interface{}{
"endpoint": endpoint,
"successes": successes,
})
}
func CircuitBreakerCleanup(removed int, total int) string {
message := fmt.Sprintf("%s removed %d/%d entries", CircuitBreakerCleanupMessage, removed, total)
return appendJSONIfDebug(message, map[string]interface{}{
"removed": removed,
"total": total,
})
}
// ExtractDataFromLogMessage extracts structured data from maintnotifications log messages
// Returns a map containing the parsed key-value pairs from the structured data section
// Example: "conn[123] handoff started to localhost:6379 {"connID":123,"endpoint":"localhost:6379"}"
// Returns: map[string]interface{}{"connID": 123, "endpoint": "localhost:6379"}
func ExtractDataFromLogMessage(logMessage string) map[string]interface{} {
result := make(map[string]interface{})
// Find the JSON data section at the end of the message
re := regexp.MustCompile(`(\{.*\})$`)
matches := re.FindStringSubmatch(logMessage)
if len(matches) < 2 {
return result
}
jsonStr := matches[1]
if jsonStr == "" {
return result
}
// Parse the JSON directly
var jsonResult map[string]interface{}
if err := json.Unmarshal([]byte(jsonStr), &jsonResult); err == nil {
return jsonResult
}
// If JSON parsing fails, return empty map
return result
}
// Cluster notification functions
func InvalidSeqIDInSMigratingNotification(seqID interface{}) string {
message := fmt.Sprintf("%s: %v", InvalidSeqIDInSMigratingNotificationMessage, seqID)
return appendJSONIfDebug(message, map[string]interface{}{
"seqID": fmt.Sprintf("%v", seqID),
})
}
func InvalidSeqIDInSMigratedNotification(seqID interface{}) string {
message := fmt.Sprintf("%s: %v", InvalidSeqIDInSMigratedNotificationMessage, seqID)
return appendJSONIfDebug(message, map[string]interface{}{
"seqID": fmt.Sprintf("%v", seqID),
})
}
// TriggeringClusterStateReload logs when cluster state reload is triggered (deduplicated, once per seqID)
func TriggeringClusterStateReload(seqID int64, hostPort string, slotRanges []string) string {
message := fmt.Sprintf("%s seqID=%d host:port=%s slots=%v", TriggeringClusterStateReloadMessage, seqID, hostPort, slotRanges)
return appendJSONIfDebug(message, map[string]interface{}{
"seqID": seqID,
"hostPort": hostPort,
"slotRanges": slotRanges,
})
}
/*
Copyright 2014 The Camlistore Authors
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
*/
package internal
import (
"sync"
"sync/atomic"
)
// A Once will perform a successful action exactly once.
//
// Unlike a sync.Once, this Once's func returns an error
// and is re-armed on failure.
type Once struct {
m sync.Mutex
done uint32
}
// Do calls the function f if and only if Do has not been invoked
// without error for this instance of Once. In other words, given
//
// var once Once
//
// if once.Do(f) is called multiple times, only the first call will
// invoke f, even if f has a different value in each invocation unless
// f returns an error. A new instance of Once is required for each
// function to execute.
//
// Do is intended for initialization that must be run exactly once. Since f
// is niladic, it may be necessary to use a function literal to capture the
// arguments to a function to be invoked by Do:
//
// err := config.once.Do(func() error { return config.init(filename) })
func (o *Once) Do(f func() error) error {
if atomic.LoadUint32(&o.done) == 1 {
return nil
}
// Slow-path.
o.m.Lock()
defer o.m.Unlock()
var err error
if o.done == 0 {
err = f()
if err == nil {
atomic.StoreUint32(&o.done, 1)
}
}
return err
}
package otel
import (
"context"
"crypto/rand"
"encoding/hex"
"sync"
"time"
"github.com/redis/go-redis/v9/internal/pool"
)
// generateUniqueID generates a short unique identifier for pool names.
func generateUniqueID() string {
b := make([]byte, 4)
if _, err := rand.Read(b); err != nil {
return ""
}
return hex.EncodeToString(b)
}
// Cmder is a minimal interface for command information needed for metrics.
// This avoids circular dependencies with the main redis package.
type Cmder interface {
Name() string
FullName() string
Args() []interface{}
Err() error
}
// Recorder is the interface for recording metrics.
type Recorder interface {
// RecordOperationDuration records the total operation duration (including all retries)
// dbIndex is the Redis database index (0-15)
RecordOperationDuration(ctx context.Context, duration time.Duration, cmd Cmder, attempts int, err error, cn *pool.Conn, dbIndex int)
// RecordPipelineOperationDuration records the total pipeline/transaction duration.
// operationName should be "PIPELINE" for regular pipelines or "MULTI" for transactions.
// cmdCount is the number of commands in the pipeline.
// err is the error from the pipeline execution (can be nil).
// dbIndex is the Redis database index (0-15)
RecordPipelineOperationDuration(ctx context.Context, duration time.Duration, operationName string, cmdCount int, attempts int, err error, cn *pool.Conn, dbIndex int)
// RecordConnectionCreateTime records the time it took to create a new connection
RecordConnectionCreateTime(ctx context.Context, duration time.Duration, cn *pool.Conn)
// RecordConnectionRelaxedTimeout records when connection timeout is relaxed/unrelaxed
// delta: +1 for relaxed, -1 for unrelaxed
// poolName: name of the connection pool (e.g., "main", "pubsub")
// notificationType: the notification type that triggered the timeout relaxation (e.g., "MOVING")
RecordConnectionRelaxedTimeout(ctx context.Context, delta int, cn *pool.Conn, poolName, notificationType string)
// RecordConnectionHandoff records when a connection is handed off to another node
// poolName: name of the connection pool (e.g., "main", "pubsub")
RecordConnectionHandoff(ctx context.Context, cn *pool.Conn, poolName string)
// RecordError records client errors (ASK, MOVED, handshake failures, etc.)
// errorType: type of error (e.g., "ASK", "MOVED", "HANDSHAKE_FAILED")
// statusCode: Redis response status code if available (e.g., "MOVED", "ASK")
// isInternal: whether this is an internal error
// retryAttempts: number of retry attempts made
RecordError(ctx context.Context, errorType string, cn *pool.Conn, statusCode string, isInternal bool, retryAttempts int)
// RecordMaintenanceNotification records when a maintenance notification is received
// notificationType: the type of notification (e.g., "MOVING", "MIGRATING", etc.)
RecordMaintenanceNotification(ctx context.Context, cn *pool.Conn, notificationType string)
// RecordConnectionWaitTime records the time spent waiting for a connection from the pool
RecordConnectionWaitTime(ctx context.Context, duration time.Duration, cn *pool.Conn)
// RecordConnectionClosed records when a connection is closed
// reason: reason for closing (e.g., "idle", "max_lifetime", "error", "pool_closed")
// err: the error that caused the close (nil for non-error closures)
RecordConnectionClosed(ctx context.Context, cn *pool.Conn, reason string, err error)
// RecordPubSubMessage records a Pub/Sub message
// direction: "sent" or "received"
// channel: channel name (may be hidden for cardinality reduction)
// sharded: true for sharded pub/sub (SPUBLISH/SSUBSCRIBE)
RecordPubSubMessage(ctx context.Context, cn *pool.Conn, direction, channel string, sharded bool)
// RecordStreamLag records the lag for stream consumer group processing
// lag: time difference between message creation and consumption
// streamName: name of the stream (may be hidden for cardinality reduction)
// consumerGroup: name of the consumer group
// consumerName: name of the consumer
RecordStreamLag(ctx context.Context, lag time.Duration, cn *pool.Conn, streamName, consumerGroup, consumerName string)
}
type PubSubPooler interface {
Stats() *pool.PubSubStats
}
type PoolRegistrar interface {
// RegisterPool is called when a new client is created with its connection pools.
// poolName: identifier for the pool (e.g., "main_abc123")
// pool: the connection pool
RegisterPool(poolName string, pool pool.Pooler)
// UnregisterPool is called when a client is closed to remove its pool from the registry.
// pool: the connection pool to unregister
UnregisterPool(pool pool.Pooler)
// RegisterPubSubPool is called when a new client is created with a PubSub pool.
// poolName: identifier for the pool (e.g., "main_abc123_pubsub")
// pool: the PubSub connection pool
RegisterPubSubPool(poolName string, pool PubSubPooler)
// UnregisterPubSubPool is called when a PubSub client is closed to remove its pool.
// pool: the PubSub connection pool to unregister
UnregisterPubSubPool(pool PubSubPooler)
}
var (
// recorderMu protects globalRecorder and operation duration callbacks
recorderMu sync.RWMutex
// Global recorder instance (initialized by extra/redisotel-native)
globalRecorder Recorder = noopRecorder{}
// Callbacks for operation duration metrics
operationDurationCallback func(ctx context.Context, duration time.Duration, cmd Cmder, attempts int, err error, cn *pool.Conn, dbIndex int)
pipelineOperationDurationCallback func(ctx context.Context, duration time.Duration, operationName string, cmdCount int, attempts int, err error, cn *pool.Conn, dbIndex int)
)
// GetOperationDurationCallback returns the callback for operation duration.
func GetOperationDurationCallback() func(ctx context.Context, duration time.Duration, cmd Cmder, attempts int, err error, cn *pool.Conn, dbIndex int) {
recorderMu.RLock()
cb := operationDurationCallback
recorderMu.RUnlock()
return cb
}
// GetPipelineOperationDurationCallback returns the callback for pipeline operation duration.
func GetPipelineOperationDurationCallback() func(ctx context.Context, duration time.Duration, operationName string, cmdCount int, attempts int, err error, cn *pool.Conn, dbIndex int) {
recorderMu.RLock()
cb := pipelineOperationDurationCallback
recorderMu.RUnlock()
return cb
}
// getRecorder returns the current global recorder under a read lock.
func getRecorder() Recorder {
recorderMu.RLock()
r := globalRecorder
recorderMu.RUnlock()
return r
}
// SetGlobalRecorder sets the global recorder (called by Init() in extra/redisotel-native)
func SetGlobalRecorder(r Recorder) {
recorderMu.Lock()
if r == nil {
globalRecorder = noopRecorder{}
operationDurationCallback = nil
pipelineOperationDurationCallback = nil
recorderMu.Unlock()
// Unregister all pool metric callbacks atomically
pool.SetAllMetricCallbacks(nil)
return
}
globalRecorder = r
// Register operation duration callbacks
// These capture r directly since we want them to use the specific recorder
// that was set at this point in time
operationDurationCallback = func(ctx context.Context, duration time.Duration, cmd Cmder, attempts int, err error, cn *pool.Conn, dbIndex int) {
getRecorder().RecordOperationDuration(ctx, duration, cmd, attempts, err, cn, dbIndex)
}
pipelineOperationDurationCallback = func(ctx context.Context, duration time.Duration, operationName string, cmdCount int, attempts int, err error, cn *pool.Conn, dbIndex int) {
getRecorder().RecordPipelineOperationDuration(ctx, duration, operationName, cmdCount, attempts, err, cn, dbIndex)
}
recorderMu.Unlock()
// Register all pool metric callbacks atomically
// These use getRecorder() to safely access the current recorder
pool.SetAllMetricCallbacks(&pool.MetricCallbacks{
ConnectionCreateTime: func(ctx context.Context, duration time.Duration, cn *pool.Conn) {
getRecorder().RecordConnectionCreateTime(ctx, duration, cn)
},
ConnectionRelaxedTimeout: func(ctx context.Context, delta int, cn *pool.Conn, poolName, notificationType string) {
getRecorder().RecordConnectionRelaxedTimeout(ctx, delta, cn, poolName, notificationType)
},
ConnectionHandoff: func(ctx context.Context, cn *pool.Conn, poolName string) {
getRecorder().RecordConnectionHandoff(ctx, cn, poolName)
},
Error: func(ctx context.Context, errorType string, cn *pool.Conn, statusCode string, isInternal bool, retryAttempts int) {
getRecorder().RecordError(ctx, errorType, cn, statusCode, isInternal, retryAttempts)
},
MaintenanceNotification: func(ctx context.Context, cn *pool.Conn, notificationType string) {
getRecorder().RecordMaintenanceNotification(ctx, cn, notificationType)
},
ConnectionWaitTime: func(ctx context.Context, duration time.Duration, cn *pool.Conn) {
getRecorder().RecordConnectionWaitTime(ctx, duration, cn)
},
ConnectionClosed: func(ctx context.Context, cn *pool.Conn, reason string, err error) {
getRecorder().RecordConnectionClosed(ctx, cn, reason, err)
},
})
}
// RecordOperationDuration records the total operation duration.
// dbIndex is the Redis database index (0-15).
func RecordOperationDuration(ctx context.Context, duration time.Duration, cmd Cmder, attempts int, err error, cn *pool.Conn, dbIndex int) {
getRecorder().RecordOperationDuration(ctx, duration, cmd, attempts, err, cn, dbIndex)
}
// RecordPipelineOperationDuration records the total pipeline/transaction duration.
// This is called from redis.go after pipeline/transaction execution completes.
// operationName should be "PIPELINE" for regular pipelines or "MULTI" for transactions.
// err is the error from the pipeline execution (can be nil).
// dbIndex is the Redis database index (0-15).
func RecordPipelineOperationDuration(ctx context.Context, duration time.Duration, operationName string, cmdCount int, attempts int, err error, cn *pool.Conn, dbIndex int) {
getRecorder().RecordPipelineOperationDuration(ctx, duration, operationName, cmdCount, attempts, err, cn, dbIndex)
}
// RecordConnectionCreateTime records the time it took to create a new connection.
func RecordConnectionCreateTime(ctx context.Context, duration time.Duration, cn *pool.Conn) {
getRecorder().RecordConnectionCreateTime(ctx, duration, cn)
}
// RecordPubSubMessage records a Pub/Sub message sent or received.
func RecordPubSubMessage(ctx context.Context, cn *pool.Conn, direction, channel string, sharded bool) {
getRecorder().RecordPubSubMessage(ctx, cn, direction, channel, sharded)
}
// RecordStreamLag records the lag between message creation and consumption in a stream.
func RecordStreamLag(ctx context.Context, lag time.Duration, cn *pool.Conn, streamName, consumerGroup, consumerName string) {
getRecorder().RecordStreamLag(ctx, lag, cn, streamName, consumerGroup, consumerName)
}
type noopRecorder struct{}
func (noopRecorder) RecordOperationDuration(context.Context, time.Duration, Cmder, int, error, *pool.Conn, int) {
}
func (noopRecorder) RecordPipelineOperationDuration(context.Context, time.Duration, string, int, int, error, *pool.Conn, int) {
}
func (noopRecorder) RecordConnectionCreateTime(context.Context, time.Duration, *pool.Conn) {}
func (noopRecorder) RecordConnectionRelaxedTimeout(context.Context, int, *pool.Conn, string, string) {
}
func (noopRecorder) RecordConnectionHandoff(context.Context, *pool.Conn, string) {}
func (noopRecorder) RecordError(context.Context, string, *pool.Conn, string, bool, int) {}
func (noopRecorder) RecordMaintenanceNotification(context.Context, *pool.Conn, string) {}
func (noopRecorder) RecordConnectionWaitTime(context.Context, time.Duration, *pool.Conn) {}
func (noopRecorder) RecordConnectionClosed(context.Context, *pool.Conn, string, error) {}
func (noopRecorder) RecordPubSubMessage(context.Context, *pool.Conn, string, string, bool) {}
func (noopRecorder) RecordStreamLag(context.Context, time.Duration, *pool.Conn, string, string, string) {
}
// RegisterPools registers connection pools with the global recorder.
func RegisterPools(connPool pool.Pooler, pubSubPool PubSubPooler, addr string) {
// Check if the global recorder implements PoolRegistrar
if registrar, ok := globalRecorder.(PoolRegistrar); ok {
// Generate a unique ID for this client's pools
uniqueID := generateUniqueID()
if connPool != nil {
poolName := addr + "_" + uniqueID
registrar.RegisterPool(poolName, connPool)
}
if pubSubPool != nil {
poolName := addr + "_" + uniqueID + "_pubsub"
registrar.RegisterPubSubPool(poolName, pubSubPool)
}
}
}
// UnregisterPools removes connection pools from the global recorder
func UnregisterPools(connPool pool.Pooler, pubSubPool PubSubPooler) {
// Check if the global recorder implements PoolRegistrar
if registrar, ok := globalRecorder.(PoolRegistrar); ok {
if connPool != nil {
registrar.UnregisterPool(connPool)
}
if pubSubPool != nil {
registrar.UnregisterPubSubPool(pubSubPool)
}
}
}
// Package pool implements the pool management
package pool
import (
"bufio"
"context"
"errors"
"fmt"
"net"
"sync"
"sync/atomic"
"time"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/maintnotifications/logs"
"github.com/redis/go-redis/v9/internal/proto"
)
var noDeadline = time.Time{}
// Preallocated errors for hot paths to avoid allocations
var (
errAlreadyMarkedForHandoff = errors.New("connection is already marked for handoff")
errNotMarkedForHandoff = errors.New("connection was not marked for handoff")
errHandoffStateChanged = errors.New("handoff state changed during marking")
errConnectionNotAvailable = errors.New("redis: connection not available")
errConnNotAvailableForWrite = errors.New("redis: connection not available for write operation")
)
// getCachedTimeNs returns the current time in nanoseconds.
// This function previously used a global cache updated by a background goroutine,
// but that caused unnecessary CPU usage when the client was idle (ticker waking up
// the scheduler every 50ms). We now use time.Now() directly, which is fast enough
// on modern systems (vDSO on Linux) and only adds ~1-2% overhead in extreme
// high-concurrency benchmarks while eliminating idle CPU usage.
func getCachedTimeNs() int64 {
return time.Now().UnixNano()
}
// GetCachedTimeNs returns the current time in nanoseconds.
// Exported for use by other packages that need fast time access.
func GetCachedTimeNs() int64 {
return getCachedTimeNs()
}
// Global atomic counter for connection IDs
var connIDCounter uint64
// HandoffState represents the atomic state for connection handoffs
// This struct is stored atomically to prevent race conditions between
// checking handoff status and reading handoff parameters
type HandoffState struct {
ShouldHandoff bool // Whether connection should be handed off
Endpoint string // New endpoint for handoff
SeqID int64 // Sequence ID from MOVING notification
}
// atomicNetConn is a wrapper to ensure consistent typing in atomic.Value
type atomicNetConn struct {
conn net.Conn
}
// generateConnID generates a fast unique identifier for a connection with zero allocations
func generateConnID() uint64 {
return atomic.AddUint64(&connIDCounter, 1)
}
type Conn struct {
// Connection identifier for unique tracking
id uint64
usedAt atomic.Int64
lastPutAt atomic.Int64
dialStartNs atomic.Int64 // Time when dial started (for connection create time metric)
// Lock-free netConn access using atomic.Value
// Contains *atomicNetConn wrapper, accessed atomically for better performance
netConnAtomic atomic.Value // stores *atomicNetConn
rd *proto.Reader
bw *bufio.Writer
wr *proto.Writer
// Lightweight mutex to protect reader operations during handoff
// Only used for the brief period during SetNetConn and HasBufferedData/PeekReplyTypeSafe
readerMu sync.RWMutex
// State machine for connection state management
// Replaces: usable, Inited, used
// Provides thread-safe state transitions with FIFO waiting queue
// States: CREATED → INITIALIZING → IDLE ⇄ IN_USE
// ↓
// UNUSABLE (handoff/reauth)
// ↓
// IDLE/CLOSED
stateMachine *ConnStateMachine
// Handoff metadata - managed separately from state machine
// These are atomic for lock-free access during handoff operations
handoffStateAtomic atomic.Value // stores *HandoffState
handoffRetriesAtomic atomic.Uint32 // retry counter
pooled bool
pubsub bool
closed atomic.Bool
createdAt time.Time
expiresAt time.Time
poolName string // Name of the pool this connection belongs to (for metrics)
// maintenanceNotifications upgrade support: relaxed timeouts during migrations/failovers
// Using atomic operations for lock-free access to avoid mutex contention
relaxedReadTimeoutNs atomic.Int64 // time.Duration as nanoseconds
relaxedWriteTimeoutNs atomic.Int64 // time.Duration as nanoseconds
relaxedDeadlineNs atomic.Int64 // time.Time as nanoseconds since epoch
// Counter to track multiple relaxed timeout setters if we have nested calls
// will be decremented when ClearRelaxedTimeout is called or deadline is reached
// if counter reaches 0, we clear the relaxed timeouts
relaxedCounter atomic.Int32
// Connection initialization function for reconnections
initConnFunc func(context.Context, *Conn) error
onClose func() error
}
func NewConn(netConn net.Conn) *Conn {
return NewConnWithBufferSize(netConn, proto.DefaultBufferSize, proto.DefaultBufferSize)
}
func NewConnWithBufferSize(netConn net.Conn, readBufSize, writeBufSize int) *Conn {
now := time.Now()
cn := &Conn{
createdAt: now,
id: generateConnID(), // Generate unique ID for this connection
stateMachine: NewConnStateMachine(),
}
// Use specified buffer sizes, or fall back to 32KiB defaults if 0
if readBufSize > 0 {
cn.rd = proto.NewReaderSize(netConn, readBufSize)
} else {
cn.rd = proto.NewReader(netConn) // Uses 32KiB default
}
if writeBufSize > 0 {
cn.bw = bufio.NewWriterSize(netConn, writeBufSize)
} else {
cn.bw = bufio.NewWriterSize(netConn, proto.DefaultBufferSize)
}
// Store netConn atomically for lock-free access using wrapper
cn.netConnAtomic.Store(&atomicNetConn{conn: netConn})
cn.wr = proto.NewWriter(cn.bw)
cn.SetUsedAt(now)
// Initialize handoff state atomically
initialHandoffState := &HandoffState{
ShouldHandoff: false,
Endpoint: "",
SeqID: 0,
}
cn.handoffStateAtomic.Store(initialHandoffState)
return cn
}
func (cn *Conn) UsedAt() time.Time {
return time.Unix(0, cn.usedAt.Load())
}
func (cn *Conn) SetUsedAt(tm time.Time) {
cn.usedAt.Store(tm.UnixNano())
}
func (cn *Conn) UsedAtNs() int64 {
return cn.usedAt.Load()
}
func (cn *Conn) SetUsedAtNs(ns int64) {
cn.usedAt.Store(ns)
}
func (cn *Conn) LastPutAtNs() int64 {
return cn.lastPutAt.Load()
}
func (cn *Conn) SetLastPutAtNs(ns int64) {
cn.lastPutAt.Store(ns)
}
// GetDialStartNs returns the time when the dial started (in nanoseconds since epoch).
// This is used to calculate the full connection creation time (TCP + handshake).
func (cn *Conn) GetDialStartNs() int64 {
return cn.dialStartNs.Load()
}
// PoolName returns the name of the pool this connection belongs to.
// This is used for metrics to identify which pool a connection is from.
func (cn *Conn) PoolName() string {
return cn.poolName
}
// SetPoolName sets the name of the pool this connection belongs to.
// This should be called when the connection is added to a pool.
func (cn *Conn) SetPoolName(name string) {
cn.poolName = name
}
// Backward-compatible wrapper methods for state machine
// These maintain the existing API while using the new state machine internally
// CompareAndSwapUsable atomically compares and swaps the usable flag (lock-free).
//
// This is used by background operations (handoff, re-auth) to acquire exclusive
// access to a connection. The operation sets usable to false, preventing the pool
// from returning the connection to clients.
//
// Returns true if the swap was successful (old value matched), false otherwise.
//
// Implementation note: This is a compatibility wrapper around the state machine.
// It checks if the current state is "usable" (IDLE or IN_USE) and transitions accordingly.
// Deprecated: Use GetStateMachine().TryTransition() directly for better state management.
func (cn *Conn) CompareAndSwapUsable(old, new bool) bool {
currentState := cn.stateMachine.GetState()
// Check if current state matches the "old" usable value
currentUsable := (currentState == StateIdle || currentState == StateInUse)
if currentUsable != old {
return false
}
// If we're trying to set to the same value, succeed immediately
if old == new {
return true
}
// Transition based on new value
if new {
// Trying to make usable - transition from UNUSABLE to IDLE
// This should only work from UNUSABLE or INITIALIZING states
// Use predefined slice to avoid allocation
_, err := cn.stateMachine.TryTransition(
validFromInitializingOrUnusable,
StateIdle,
)
return err == nil
}
// Trying to make unusable - transition from IDLE to UNUSABLE
// This is typically for acquiring the connection for background operations
// Use predefined slice to avoid allocation
_, err := cn.stateMachine.TryTransition(
validFromIdle,
StateUnusable,
)
return err == nil
}
// IsUsable returns true if the connection is safe to use for new commands (lock-free).
//
// A connection is "usable" when it's in a stable state and can be returned to clients.
// It becomes unusable during:
// - Handoff operations (network connection replacement)
// - Re-authentication (credential updates)
// - Other background operations that need exclusive access
//
// Note: CREATED state is considered usable because new connections need to pass OnGet() hook
// before initialization. The initialization happens after OnGet() in the client code.
func (cn *Conn) IsUsable() bool {
state := cn.stateMachine.GetState()
// CREATED, IDLE, and IN_USE states are considered usable
// CREATED: new connection, not yet initialized (will be initialized by client)
// IDLE: initialized and ready to be acquired
// IN_USE: usable but currently acquired by someone
return state == StateCreated || state == StateIdle || state == StateInUse
}
// SetUsable sets the usable flag for the connection (lock-free).
//
// Deprecated: Use GetStateMachine().Transition() directly for better state management.
// This method is kept for backwards compatibility.
//
// This should be called to mark a connection as usable after initialization or
// to release it after a background operation completes.
//
// Prefer CompareAndSwapUsable() when acquiring exclusive access to avoid race conditions.
// Deprecated: Use GetStateMachine().Transition() directly for better state management.
func (cn *Conn) SetUsable(usable bool) {
if usable {
// Transition to IDLE state (ready to be acquired)
cn.stateMachine.Transition(StateIdle)
} else {
// Transition to UNUSABLE state (for background operations)
cn.stateMachine.Transition(StateUnusable)
}
}
// IsInited returns true if the connection has been initialized.
// This is a backward-compatible wrapper around the state machine.
func (cn *Conn) IsInited() bool {
state := cn.stateMachine.GetState()
// Connection is initialized if it's in IDLE or any post-initialization state
return state != StateCreated && state != StateInitializing && state != StateClosed
}
// Used - State machine based implementation
// CompareAndSwapUsed atomically compares and swaps the used flag (lock-free).
// This method is kept for backwards compatibility.
//
// This is the preferred method for acquiring a connection from the pool, as it
// ensures that only one goroutine marks the connection as used.
//
// Implementation: Uses state machine transitions IDLE ⇄ IN_USE
//
// Returns true if the swap was successful (old value matched), false otherwise.
// Deprecated: Use GetStateMachine().TryTransition() directly for better state management.
func (cn *Conn) CompareAndSwapUsed(old, new bool) bool {
if old == new {
// No change needed
currentState := cn.stateMachine.GetState()
currentUsed := (currentState == StateInUse)
return currentUsed == old
}
if !old && new {
// Acquiring: IDLE → IN_USE
// Use predefined slice to avoid allocation
_, err := cn.stateMachine.TryTransition(validFromCreatedOrIdle, StateInUse)
return err == nil
} else {
// Releasing: IN_USE → IDLE
// Use predefined slice to avoid allocation
_, err := cn.stateMachine.TryTransition(validFromInUse, StateIdle)
return err == nil
}
}
// IsUsed returns true if the connection is currently in use (lock-free).
//
// Deprecated: Use GetStateMachine().GetState() == StateInUse directly for better clarity.
// This method is kept for backwards compatibility.
//
// A connection is "used" when it has been retrieved from the pool and is
// actively processing a command. Background operations (like re-auth) should
// wait until the connection is not used before executing commands.
func (cn *Conn) IsUsed() bool {
return cn.stateMachine.GetState() == StateInUse
}
// SetUsed sets the used flag for the connection (lock-free).
//
// This should be called when returning a connection to the pool (set to false)
// or when a single-connection pool retrieves its connection (set to true).
//
// Prefer CompareAndSwapUsed() when acquiring from a multi-connection pool to
// avoid race conditions.
// Deprecated: Use GetStateMachine().Transition() directly for better state management.
func (cn *Conn) SetUsed(val bool) {
if val {
cn.stateMachine.Transition(StateInUse)
} else {
cn.stateMachine.Transition(StateIdle)
}
}
// getNetConn returns the current network connection using atomic load (lock-free).
// This is the fast path for accessing netConn without mutex overhead.
func (cn *Conn) getNetConn() net.Conn {
if v := cn.netConnAtomic.Load(); v != nil {
if wrapper, ok := v.(*atomicNetConn); ok {
return wrapper.conn
}
}
return nil
}
// setNetConn stores the network connection atomically (lock-free).
// This is used for the fast path of connection replacement.
func (cn *Conn) setNetConn(netConn net.Conn) {
cn.netConnAtomic.Store(&atomicNetConn{conn: netConn})
}
// Handoff state management - atomic access to handoff metadata
// ShouldHandoff returns true if connection needs handoff (lock-free).
func (cn *Conn) ShouldHandoff() bool {
if v := cn.handoffStateAtomic.Load(); v != nil {
return v.(*HandoffState).ShouldHandoff
}
return false
}
// GetHandoffEndpoint returns the new endpoint for handoff (lock-free).
func (cn *Conn) GetHandoffEndpoint() string {
if v := cn.handoffStateAtomic.Load(); v != nil {
return v.(*HandoffState).Endpoint
}
return ""
}
// GetMovingSeqID returns the sequence ID from the MOVING notification (lock-free).
func (cn *Conn) GetMovingSeqID() int64 {
if v := cn.handoffStateAtomic.Load(); v != nil {
return v.(*HandoffState).SeqID
}
return 0
}
// GetHandoffInfo returns all handoff information atomically (lock-free).
// This method prevents race conditions by returning all handoff state in a single atomic operation.
// Returns (shouldHandoff, endpoint, seqID).
func (cn *Conn) GetHandoffInfo() (bool, string, int64) {
if v := cn.handoffStateAtomic.Load(); v != nil {
state := v.(*HandoffState)
return state.ShouldHandoff, state.Endpoint, state.SeqID
}
return false, "", 0
}
// HandoffRetries returns the current handoff retry count (lock-free).
func (cn *Conn) HandoffRetries() int {
return int(cn.handoffRetriesAtomic.Load())
}
// IncrementAndGetHandoffRetries atomically increments and returns handoff retries (lock-free).
func (cn *Conn) IncrementAndGetHandoffRetries(n int) int {
return int(cn.handoffRetriesAtomic.Add(uint32(n)))
}
// IsPooled returns true if the connection is managed by a pool and will be pooled on Put.
func (cn *Conn) IsPooled() bool {
return cn.pooled
}
// IsPubSub returns true if the connection is used for PubSub.
func (cn *Conn) IsPubSub() bool {
return cn.pubsub
}
// SetRelaxedTimeout sets relaxed timeouts for this connection during maintenanceNotifications upgrades.
// These timeouts will be used for all subsequent commands until the deadline expires.
// Uses atomic operations for lock-free access.
// Note: Metrics should be recorded by the caller (notification handler) which has context about
// the notification type and pool name.
func (cn *Conn) SetRelaxedTimeout(readTimeout, writeTimeout time.Duration) {
cn.relaxedCounter.Add(1)
cn.relaxedReadTimeoutNs.Store(int64(readTimeout))
cn.relaxedWriteTimeoutNs.Store(int64(writeTimeout))
}
// SetRelaxedTimeoutWithDeadline sets relaxed timeouts with an expiration deadline.
// After the deadline, timeouts automatically revert to normal values.
// Uses atomic operations for lock-free access.
func (cn *Conn) SetRelaxedTimeoutWithDeadline(readTimeout, writeTimeout time.Duration, deadline time.Time) {
cn.SetRelaxedTimeout(readTimeout, writeTimeout)
cn.relaxedDeadlineNs.Store(deadline.UnixNano())
}
// ClearRelaxedTimeout removes relaxed timeouts, returning to normal timeout behavior.
// Uses atomic operations for lock-free access.
func (cn *Conn) ClearRelaxedTimeout() {
// Atomically decrement counter and check if we should clear
newCount := cn.relaxedCounter.Add(-1)
deadlineNs := cn.relaxedDeadlineNs.Load()
if newCount <= 0 && (deadlineNs == 0 || time.Now().UnixNano() >= deadlineNs) {
// Use atomic load to get current value for CAS to avoid stale value race
current := cn.relaxedCounter.Load()
if current <= 0 && cn.relaxedCounter.CompareAndSwap(current, 0) {
cn.clearRelaxedTimeout()
}
}
}
func (cn *Conn) clearRelaxedTimeout() {
cn.relaxedReadTimeoutNs.Store(0)
cn.relaxedWriteTimeoutNs.Store(0)
cn.relaxedDeadlineNs.Store(0)
cn.relaxedCounter.Store(0)
// Note: Metrics for timeout unrelaxing are not recorded here because we don't have
// context about which notification type or pool triggered the relaxation.
// In practice, relaxed timeouts expire automatically via deadline, so explicit
// unrelaxing metrics are less critical than the initial relaxation metrics.
}
// HasRelaxedTimeout returns true if relaxed timeouts are currently active on this connection.
// This checks both the timeout values and the deadline (if set).
// Uses atomic operations for lock-free access.
func (cn *Conn) HasRelaxedTimeout() bool {
// Fast path: no relaxed timeouts are set
if cn.relaxedCounter.Load() <= 0 {
return false
}
readTimeoutNs := cn.relaxedReadTimeoutNs.Load()
writeTimeoutNs := cn.relaxedWriteTimeoutNs.Load()
// If no relaxed timeouts are set, return false
if readTimeoutNs <= 0 && writeTimeoutNs <= 0 {
return false
}
deadlineNs := cn.relaxedDeadlineNs.Load()
// If no deadline is set, relaxed timeouts are active
if deadlineNs == 0 {
return true
}
// If deadline is set, check if it's still in the future
return time.Now().UnixNano() < deadlineNs
}
// getEffectiveReadTimeout returns the timeout to use for read operations.
// If relaxed timeout is set and not expired, it takes precedence over the provided timeout.
// This method automatically clears expired relaxed timeouts using atomic operations.
func (cn *Conn) getEffectiveReadTimeout(normalTimeout time.Duration) time.Duration {
readTimeoutNs := cn.relaxedReadTimeoutNs.Load()
// Fast path: no relaxed timeout set
if readTimeoutNs <= 0 {
return normalTimeout
}
deadlineNs := cn.relaxedDeadlineNs.Load()
// If no deadline is set, use relaxed timeout
if deadlineNs == 0 {
return time.Duration(readTimeoutNs)
}
// Use cached time to avoid expensive syscall (max 50ms staleness is acceptable for timeout checks)
nowNs := getCachedTimeNs()
// Check if deadline has passed
if nowNs < deadlineNs {
// Deadline is in the future, use relaxed timeout
return time.Duration(readTimeoutNs)
} else {
// Deadline has passed, clear relaxed timeouts atomically and use normal timeout
newCount := cn.relaxedCounter.Add(-1)
if newCount <= 0 {
internal.Logger.Printf(context.Background(), logs.UnrelaxedTimeoutAfterDeadline(cn.GetID()))
cn.clearRelaxedTimeout()
}
return normalTimeout
}
}
// getEffectiveWriteTimeout returns the timeout to use for write operations.
// If relaxed timeout is set and not expired, it takes precedence over the provided timeout.
// This method automatically clears expired relaxed timeouts using atomic operations.
func (cn *Conn) getEffectiveWriteTimeout(normalTimeout time.Duration) time.Duration {
writeTimeoutNs := cn.relaxedWriteTimeoutNs.Load()
// Fast path: no relaxed timeout set
if writeTimeoutNs <= 0 {
return normalTimeout
}
deadlineNs := cn.relaxedDeadlineNs.Load()
// If no deadline is set, use relaxed timeout
if deadlineNs == 0 {
return time.Duration(writeTimeoutNs)
}
// Use cached time to avoid expensive syscall (max 50ms staleness is acceptable for timeout checks)
nowNs := getCachedTimeNs()
// Check if deadline has passed
if nowNs < deadlineNs {
// Deadline is in the future, use relaxed timeout
return time.Duration(writeTimeoutNs)
} else {
// Deadline has passed, clear relaxed timeouts atomically and use normal timeout
newCount := cn.relaxedCounter.Add(-1)
if newCount <= 0 {
internal.Logger.Printf(context.Background(), logs.UnrelaxedTimeoutAfterDeadline(cn.GetID()))
cn.clearRelaxedTimeout()
}
return normalTimeout
}
}
func (cn *Conn) SetOnClose(fn func() error) {
cn.onClose = fn
}
// SetInitConnFunc sets the connection initialization function to be called on reconnections.
func (cn *Conn) SetInitConnFunc(fn func(context.Context, *Conn) error) {
cn.initConnFunc = fn
}
// ExecuteInitConn runs the stored connection initialization function if available.
func (cn *Conn) ExecuteInitConn(ctx context.Context) error {
if cn.initConnFunc != nil {
return cn.initConnFunc(ctx, cn)
}
return fmt.Errorf("redis: no initConnFunc set for conn[%d]", cn.GetID())
}
func (cn *Conn) SetNetConn(netConn net.Conn) {
// Store the new connection atomically first (lock-free)
cn.setNetConn(netConn)
// Protect reader reset operations to avoid data races
// Use write lock since we're modifying the reader state
cn.readerMu.Lock()
cn.rd.Reset(netConn)
cn.readerMu.Unlock()
cn.bw.Reset(netConn)
}
// GetNetConn safely returns the current network connection using atomic load (lock-free).
// This method is used by the pool for health checks and provides better performance.
func (cn *Conn) GetNetConn() net.Conn {
return cn.getNetConn()
}
// SetNetConnAndInitConn replaces the underlying connection and executes the initialization.
// This method ensures only one initialization can happen at a time by using atomic state transitions.
// If another goroutine is currently initializing, this will wait for it to complete.
func (cn *Conn) SetNetConnAndInitConn(ctx context.Context, netConn net.Conn) error {
// Wait for and transition to INITIALIZING state - this prevents concurrent initializations
// Valid from states: CREATED (first init), IDLE (reconnect), UNUSABLE (handoff/reauth)
// If another goroutine is initializing, we'll wait for it to finish
// if the context has a deadline, use that, otherwise use the connection read (relaxed) timeout
// which should be set during handoff. If it is not set, use a 5 second default
deadline, ok := ctx.Deadline()
if !ok {
deadline = time.Now().Add(cn.getEffectiveReadTimeout(5 * time.Second))
}
waitCtx, cancel := context.WithDeadline(ctx, deadline)
defer cancel()
// Use predefined slice to avoid allocation
finalState, err := cn.stateMachine.AwaitAndTransition(
waitCtx,
validFromCreatedIdleOrUnusable,
StateInitializing,
)
if err != nil {
return fmt.Errorf("cannot initialize connection from state %s: %w", finalState, err)
}
// Replace the underlying connection
cn.SetNetConn(netConn)
// Execute initialization
// NOTE: ExecuteInitConn (via baseClient.initConn) will transition to IDLE on success
// or CLOSED on failure. We don't need to do it here.
// NOTE: Initconn returns conn in IDLE state
initErr := cn.ExecuteInitConn(ctx)
if initErr != nil {
// ExecuteInitConn already transitioned to CLOSED, just return the error
return initErr
}
// ExecuteInitConn already transitioned to IDLE
return nil
}
// MarkForHandoff marks the connection for handoff due to MOVING notification.
// Returns an error if the connection is already marked for handoff.
// Note: This only sets metadata - the connection state is not changed until OnPut.
// This allows the current user to finish using the connection before handoff.
func (cn *Conn) MarkForHandoff(newEndpoint string, seqID int64) error {
// Check if already marked for handoff
if cn.ShouldHandoff() {
return errAlreadyMarkedForHandoff
}
// Set handoff metadata atomically
cn.handoffStateAtomic.Store(&HandoffState{
ShouldHandoff: true,
Endpoint: newEndpoint,
SeqID: seqID,
})
return nil
}
// MarkQueuedForHandoff marks the connection as queued for handoff processing.
// This makes the connection unusable until handoff completes.
// This is called from OnPut hook, where the connection is typically in IN_USE state.
// The pool will preserve the UNUSABLE state and not overwrite it with IDLE.
func (cn *Conn) MarkQueuedForHandoff() error {
// Get current handoff state
currentState := cn.handoffStateAtomic.Load()
if currentState == nil {
return errNotMarkedForHandoff
}
state := currentState.(*HandoffState)
if !state.ShouldHandoff {
return errNotMarkedForHandoff
}
// Create new state with ShouldHandoff=false but preserve endpoint and seqID
// This prevents the connection from being queued multiple times while still
// allowing the worker to access the handoff metadata
newState := &HandoffState{
ShouldHandoff: false,
Endpoint: state.Endpoint, // Preserve endpoint for handoff processing
SeqID: state.SeqID, // Preserve seqID for handoff processing
}
// Atomic compare-and-swap to update state
if !cn.handoffStateAtomic.CompareAndSwap(currentState, newState) {
// State changed between load and CAS - retry or return error
return errHandoffStateChanged
}
// Transition to UNUSABLE from IN_USE (normal flow), IDLE (edge cases), or CREATED (tests/uninitialized)
// The connection is typically in IN_USE state when OnPut is called (normal Put flow)
// But in some edge cases or tests, it might be in IDLE or CREATED state
// The pool will detect this state change and preserve it (not overwrite with IDLE)
// Use predefined slice to avoid allocation
finalState, err := cn.stateMachine.TryTransition(validFromCreatedInUseOrIdle, StateUnusable)
if err != nil {
// Check if already in UNUSABLE state (race condition or retry)
// ShouldHandoff should be false now, but check just in case
if finalState == StateUnusable && !cn.ShouldHandoff() {
// Already unusable - this is fine, keep the new handoff state
return nil
}
// Restore the original state if transition fails for other reasons
cn.handoffStateAtomic.Store(currentState)
return fmt.Errorf("failed to mark connection as unusable: %w", err)
}
return nil
}
// GetID returns the unique identifier for this connection.
func (cn *Conn) GetID() uint64 {
return cn.id
}
// GetStateMachine returns the connection's state machine for advanced state management.
// This is primarily used by internal packages like maintnotifications for handoff processing.
func (cn *Conn) GetStateMachine() *ConnStateMachine {
return cn.stateMachine
}
// TryAcquire attempts to acquire the connection for use.
// This is an optimized inline method for the hot path (Get operation).
//
// It tries to transition from IDLE -> IN_USE or CREATED -> CREATED.
// Returns true if the connection was successfully acquired, false otherwise.
// The CREATED->CREATED is done so we can keep the state correct for later
// initialization of the connection in initConn.
//
// Performance: This is faster than calling GetStateMachine() + TryTransitionFast()
//
// NOTE: We directly access cn.stateMachine.state here instead of using the state machine's
// methods. This breaks encapsulation but is necessary for performance.
// The IDLE->IN_USE and CREATED->CREATED transitions don't need
// waiter notification, and benchmarks show 1-3% improvement. If the state machine ever
// needs to notify waiters on these transitions, update this to use TryTransitionFast().
func (cn *Conn) TryAcquire() bool {
// The || operator short-circuits, so only 1 CAS in the common case
return cn.stateMachine.state.CompareAndSwap(uint32(StateIdle), uint32(StateInUse)) ||
cn.stateMachine.state.CompareAndSwap(uint32(StateCreated), uint32(StateCreated))
}
// Release releases the connection back to the pool.
// This is an optimized inline method for the hot path (Put operation).
//
// It tries to transition from IN_USE -> IDLE.
// Returns true if the connection was successfully released, false otherwise.
//
// Performance: This is faster than calling GetStateMachine() + TryTransitionFast().
//
// NOTE: We directly access cn.stateMachine.state here instead of using the state machine's
// methods. This breaks encapsulation but is necessary for performance.
// If the state machine ever needs to notify waiters
// on this transition, update this to use TryTransitionFast().
func (cn *Conn) Release() bool {
// Inline the hot path - single CAS operation
return cn.stateMachine.state.CompareAndSwap(uint32(StateInUse), uint32(StateIdle))
}
// ClearHandoffState clears the handoff state after successful handoff.
// Makes the connection usable again.
func (cn *Conn) ClearHandoffState() {
// Clear handoff metadata
cn.handoffStateAtomic.Store(&HandoffState{
ShouldHandoff: false,
Endpoint: "",
SeqID: 0,
})
// Reset retry counter
cn.handoffRetriesAtomic.Store(0)
// Mark connection as usable again
// Use state machine directly instead of deprecated SetUsable
// probably done by initConn
cn.stateMachine.Transition(StateIdle)
}
// HasBufferedData safely checks if the connection has buffered data.
// This method is used to avoid data races when checking for push notifications.
func (cn *Conn) HasBufferedData() bool {
// Use read lock for concurrent access to reader state
cn.readerMu.RLock()
defer cn.readerMu.RUnlock()
return cn.rd.Buffered() > 0
}
// PeekReplyTypeSafe safely peeks at the reply type.
// This method is used to avoid data races when checking for push notifications.
func (cn *Conn) PeekReplyTypeSafe() (byte, error) {
// Use read lock for concurrent access to reader state
cn.readerMu.RLock()
defer cn.readerMu.RUnlock()
if cn.rd.Buffered() <= 0 {
return 0, fmt.Errorf("redis: can't peek reply type, no data available")
}
return cn.rd.PeekReplyType()
}
func (cn *Conn) Write(b []byte) (int, error) {
// Lock-free netConn access for better performance
if netConn := cn.getNetConn(); netConn != nil {
return netConn.Write(b)
}
return 0, net.ErrClosed
}
func (cn *Conn) RemoteAddr() net.Addr {
// Lock-free netConn access for better performance
if netConn := cn.getNetConn(); netConn != nil {
return netConn.RemoteAddr()
}
return nil
}
func (cn *Conn) WithReader(
ctx context.Context, timeout time.Duration, fn func(rd *proto.Reader) error,
) error {
if timeout >= 0 {
// Use relaxed timeout if set, otherwise use provided timeout
effectiveTimeout := cn.getEffectiveReadTimeout(timeout)
// Get the connection directly from atomic storage
netConn := cn.getNetConn()
if netConn == nil {
return errConnectionNotAvailable
}
if err := netConn.SetReadDeadline(cn.deadline(ctx, effectiveTimeout)); err != nil {
return err
}
}
return fn(cn.rd)
}
func (cn *Conn) WithWriter(
ctx context.Context, timeout time.Duration, fn func(wr *proto.Writer) error,
) error {
if timeout >= 0 {
// Use relaxed timeout if set, otherwise use provided timeout
effectiveTimeout := cn.getEffectiveWriteTimeout(timeout)
// Set write deadline on the connection
if netConn := cn.getNetConn(); netConn != nil {
if err := netConn.SetWriteDeadline(cn.deadline(ctx, effectiveTimeout)); err != nil {
return err
}
} else {
// Connection is not available - return preallocated error
return errConnNotAvailableForWrite
}
}
// Reset the buffered writer if needed, should not happen
if cn.bw.Buffered() > 0 {
if netConn := cn.getNetConn(); netConn != nil {
cn.bw.Reset(netConn)
}
}
if err := fn(cn.wr); err != nil {
return err
}
return cn.bw.Flush()
}
func (cn *Conn) IsClosed() bool {
return cn.closed.Load() || cn.stateMachine.GetState() == StateClosed
}
func (cn *Conn) Close() error {
cn.closed.Store(true)
// Transition to CLOSED state
cn.stateMachine.Transition(StateClosed)
if cn.onClose != nil {
// ignore error
_ = cn.onClose()
}
// Lock-free netConn access for better performance
if netConn := cn.getNetConn(); netConn != nil {
return netConn.Close()
}
return nil
}
// MaybeHasData tries to peek at the next byte in the socket without consuming it
// This is used to check if there are push notifications available
// Important: This will work on Linux, but not on Windows
func (cn *Conn) MaybeHasData() bool {
// Lock-free netConn access for better performance
if netConn := cn.getNetConn(); netConn != nil {
return maybeHasData(netConn)
}
return false
}
// deadline computes the effective deadline time based on context and timeout.
// It updates the usedAt timestamp to now.
// Uses cached time to avoid expensive syscall (max 50ms staleness is acceptable for deadline calculation).
func (cn *Conn) deadline(ctx context.Context, timeout time.Duration) time.Time {
// Use cached time for deadline calculation (called 2x per command: read + write)
nowNs := getCachedTimeNs()
cn.SetUsedAtNs(nowNs)
tm := time.Unix(0, nowNs)
if timeout > 0 {
tm = tm.Add(timeout)
}
if ctx != nil {
deadline, ok := ctx.Deadline()
if ok {
if timeout == 0 {
return deadline
}
if deadline.Before(tm) {
return deadline
}
return tm
}
}
if timeout > 0 {
return tm
}
return noDeadline
}
//go:build linux || darwin || dragonfly || freebsd || netbsd || openbsd || solaris || illumos
package pool
import (
"errors"
"io"
"net"
"syscall"
"time"
)
var errUnexpectedRead = errors.New("unexpected read from socket")
// connCheck checks if the connection is still alive and if there is data in the socket
// it will try to peek at the next byte without consuming it since we may want to work with it
// later on (e.g. push notifications)
func connCheck(conn net.Conn) error {
// Reset previous timeout.
_ = conn.SetDeadline(time.Time{})
sysConn, ok := conn.(syscall.Conn)
if !ok {
return nil
}
rawConn, err := sysConn.SyscallConn()
if err != nil {
return err
}
var sysErr error
if err := rawConn.Read(func(fd uintptr) bool {
var buf [1]byte
// Use MSG_PEEK to peek at data without consuming it
n, _, err := syscall.Recvfrom(int(fd), buf[:], syscall.MSG_PEEK|syscall.MSG_DONTWAIT)
switch {
case n == 0 && err == nil:
sysErr = io.EOF
case n > 0:
sysErr = errUnexpectedRead
case err == syscall.EAGAIN || err == syscall.EWOULDBLOCK:
sysErr = nil
default:
sysErr = err
}
return true
}); err != nil {
return err
}
return sysErr
}
// maybeHasData checks if there is data in the socket without consuming it
func maybeHasData(conn net.Conn) bool {
return connCheck(conn) == errUnexpectedRead
}
package pool
import (
"container/list"
"context"
"errors"
"fmt"
"sync"
"sync/atomic"
)
// ConnState represents the connection state in the state machine.
// States are designed to be lightweight and fast to check.
//
// State Transitions:
//
// CREATED → INITIALIZING → IDLE ⇄ IN_USE
// ↓
// UNUSABLE (handoff/reauth)
// ↓
// IDLE/CLOSED
type ConnState uint32
const (
// StateCreated - Connection just created, not yet initialized
StateCreated ConnState = iota
// StateInitializing - Connection initialization in progress
StateInitializing
// StateIdle - Connection initialized and idle in pool, ready to be acquired
StateIdle
// StateInUse - Connection actively processing a command (retrieved from pool)
StateInUse
// StateUnusable - Connection temporarily unusable due to background operation
// (handoff, reauth, etc.). Cannot be acquired from pool.
StateUnusable
// StateClosed - Connection closed
StateClosed
)
// Predefined state slices to avoid allocations in hot paths
var (
validFromInUse = []ConnState{StateInUse}
validFromCreatedOrIdle = []ConnState{StateCreated, StateIdle}
validFromCreatedInUseOrIdle = []ConnState{StateCreated, StateInUse, StateIdle}
// For AwaitAndTransition calls
validFromCreatedIdleOrUnusable = []ConnState{StateCreated, StateIdle, StateUnusable}
validFromIdle = []ConnState{StateIdle}
// For CompareAndSwapUsable
validFromInitializingOrUnusable = []ConnState{StateInitializing, StateUnusable}
)
// Accessor functions for predefined slices to avoid allocations in external packages
// These return the same slice instance, so they're zero-allocation
// ValidFromIdle returns a predefined slice containing only StateIdle.
// Use this to avoid allocations when calling AwaitAndTransition or TryTransition.
func ValidFromIdle() []ConnState {
return validFromIdle
}
// ValidFromCreatedIdleOrUnusable returns a predefined slice for initialization transitions.
// Use this to avoid allocations when calling AwaitAndTransition or TryTransition.
func ValidFromCreatedIdleOrUnusable() []ConnState {
return validFromCreatedIdleOrUnusable
}
// String returns a human-readable string representation of the state.
func (s ConnState) String() string {
switch s {
case StateCreated:
return "CREATED"
case StateInitializing:
return "INITIALIZING"
case StateIdle:
return "IDLE"
case StateInUse:
return "IN_USE"
case StateUnusable:
return "UNUSABLE"
case StateClosed:
return "CLOSED"
default:
return fmt.Sprintf("UNKNOWN(%d)", s)
}
}
var (
// ErrInvalidStateTransition is returned when a state transition is not allowed
ErrInvalidStateTransition = errors.New("invalid state transition")
// ErrStateMachineClosed is returned when operating on a closed state machine
ErrStateMachineClosed = errors.New("state machine is closed")
// ErrTimeout is returned when a state transition times out
ErrTimeout = errors.New("state transition timeout")
)
// waiter represents a goroutine waiting for a state transition.
// Designed for minimal allocations and fast processing.
type waiter struct {
validStates map[ConnState]struct{} // States we're waiting for
targetState ConnState // State to transition to
done chan error // Signaled when transition completes or times out
}
// ConnStateMachine manages connection state transitions with FIFO waiting queue.
// Optimized for:
// - Lock-free reads (hot path)
// - Minimal allocations
// - Fast state transitions
// - FIFO fairness for waiters
// Note: Handoff metadata (endpoint, seqID, retries) is managed separately in the Conn struct.
type ConnStateMachine struct {
// Current state - atomic for lock-free reads
state atomic.Uint32
// FIFO queue for waiters - only locked during waiter add/remove/notify
mu sync.Mutex
waiters *list.List // List of *waiter
waiterCount atomic.Int32 // Fast lock-free check for waiters (avoids mutex in hot path)
}
// NewConnStateMachine creates a new connection state machine.
// Initial state is StateCreated.
func NewConnStateMachine() *ConnStateMachine {
sm := &ConnStateMachine{
waiters: list.New(),
}
sm.state.Store(uint32(StateCreated))
return sm
}
// GetState returns the current state (lock-free read).
// This is the hot path - optimized for zero allocations and minimal overhead.
// Note: Zero allocations applies to state reads; converting the returned state to a string
// (via String()) may allocate if the state is unknown.
func (sm *ConnStateMachine) GetState() ConnState {
return ConnState(sm.state.Load())
}
// TryTransitionFast is an optimized version for the hot path (Get/Put operations).
// It only handles simple state transitions without waiter notification.
// This is safe because:
// 1. Get/Put don't need to wait for state changes
// 2. Background operations (handoff/reauth) use UNUSABLE state, which this won't match
// 3. If a background operation is in progress (state is UNUSABLE), this fails fast
//
// Returns true if transition succeeded, false otherwise.
// Use this for performance-critical paths where you don't need error details.
//
// Performance: Single CAS operation - as fast as the old atomic bool!
// For multiple from states, use: sm.TryTransitionFast(State1, Target) || sm.TryTransitionFast(State2, Target)
// The || operator short-circuits, so only 1 CAS is executed in the common case.
func (sm *ConnStateMachine) TryTransitionFast(fromState, targetState ConnState) bool {
return sm.state.CompareAndSwap(uint32(fromState), uint32(targetState))
}
// TryTransition attempts an immediate state transition without waiting.
// Returns the current state after the transition attempt and an error if the transition failed.
// The returned state is the CURRENT state (after the attempt), not the previous state.
// This is faster than AwaitAndTransition when you don't need to wait.
// Uses compare-and-swap to atomically transition, preventing concurrent transitions.
// This method does NOT wait - it fails immediately if the transition cannot be performed.
//
// Performance: Zero allocations on success path (hot path).
func (sm *ConnStateMachine) TryTransition(validFromStates []ConnState, targetState ConnState) (ConnState, error) {
// Try each valid from state with CAS
// This ensures only ONE goroutine can successfully transition at a time
for _, fromState := range validFromStates {
// Try to atomically swap from fromState to targetState
// If successful, we won the race and can proceed
if sm.state.CompareAndSwap(uint32(fromState), uint32(targetState)) {
// Success! We transitioned atomically
// Hot path optimization: only check for waiters if transition succeeded
// This avoids atomic load on every Get/Put when no waiters exist
if sm.waiterCount.Load() > 0 {
sm.notifyWaiters()
}
return targetState, nil
}
}
// All CAS attempts failed - state is not valid for this transition
// Return the current state so caller can decide what to do
// Note: This error path allocates, but it's the exceptional case
currentState := sm.GetState()
return currentState, fmt.Errorf("%w: cannot transition from %s to %s (valid from: %v)",
ErrInvalidStateTransition, currentState, targetState, validFromStates)
}
// Transition unconditionally transitions to the target state.
// Use with caution - prefer AwaitAndTransition or TryTransition for safety.
// This is useful for error paths or when you know the transition is valid.
func (sm *ConnStateMachine) Transition(targetState ConnState) {
sm.state.Store(uint32(targetState))
sm.notifyWaiters()
}
// AwaitAndTransition waits for the connection to reach one of the valid states,
// then atomically transitions to the target state.
// Returns the current state after the transition attempt and an error if the operation failed.
// The returned state is the CURRENT state (after the attempt), not the previous state.
// Returns error if timeout expires or context is cancelled.
//
// This method implements FIFO fairness - the first caller to wait gets priority
// when the state becomes available.
//
// Performance notes:
// - If already in a valid state, this is very fast (no allocation, no waiting)
// - If waiting is required, allocates one waiter struct and one channel
func (sm *ConnStateMachine) AwaitAndTransition(
ctx context.Context,
validFromStates []ConnState,
targetState ConnState,
) (ConnState, error) {
// Fast path: try immediate transition with CAS to prevent race conditions
// BUT: only if there are no waiters in the queue (to maintain FIFO ordering)
if sm.waiterCount.Load() == 0 {
for _, fromState := range validFromStates {
// Check if we're already in target state
if fromState == targetState && sm.GetState() == targetState {
return targetState, nil
}
// Try to atomically swap from fromState to targetState
if sm.state.CompareAndSwap(uint32(fromState), uint32(targetState)) {
// Success! We transitioned atomically
sm.notifyWaiters()
return targetState, nil
}
}
}
// Fast path failed - check if we should wait or fail
currentState := sm.GetState()
// Check if closed
if currentState == StateClosed {
return currentState, ErrStateMachineClosed
}
// Slow path: need to wait for state change
// Create waiter with valid states map for fast lookup
validStatesMap := make(map[ConnState]struct{}, len(validFromStates))
for _, s := range validFromStates {
validStatesMap[s] = struct{}{}
}
w := &waiter{
validStates: validStatesMap,
targetState: targetState,
done: make(chan error, 1), // Buffered to avoid goroutine leak
}
// Add to FIFO queue
sm.mu.Lock()
elem := sm.waiters.PushBack(w)
sm.waiterCount.Add(1)
sm.mu.Unlock()
// Wait for state change or timeout
select {
case <-ctx.Done():
// Timeout or cancellation - remove from queue
sm.mu.Lock()
sm.waiters.Remove(elem)
sm.waiterCount.Add(-1)
sm.mu.Unlock()
return sm.GetState(), ctx.Err()
case err := <-w.done:
// Transition completed (or failed)
// Note: waiterCount is decremented either in notifyWaiters (when the waiter is notified and removed)
// or here (on timeout/cancellation).
return sm.GetState(), err
}
}
// notifyWaiters checks if any waiters can proceed and notifies them in FIFO order.
// This is called after every state transition.
func (sm *ConnStateMachine) notifyWaiters() {
// Fast path: check atomic counter without acquiring lock
// This eliminates mutex overhead in the common case (no waiters)
if sm.waiterCount.Load() == 0 {
return
}
sm.mu.Lock()
defer sm.mu.Unlock()
// Double-check after acquiring lock (waiters might have been processed)
if sm.waiters.Len() == 0 {
return
}
// Process waiters in FIFO order until no more can be processed
// We loop instead of recursing to avoid stack overflow and mutex issues
for {
processed := false
// Find the first waiter that can proceed
for elem := sm.waiters.Front(); elem != nil; elem = elem.Next() {
w := elem.Value.(*waiter)
// Read current state inside the loop to get the latest value
currentState := sm.GetState()
// Check if current state is valid for this waiter
if _, valid := w.validStates[currentState]; valid {
// Remove from queue first
sm.waiters.Remove(elem)
sm.waiterCount.Add(-1)
// Use CAS to ensure state hasn't changed since we checked
// This prevents race condition where another thread changes state
// between our check and our transition
if sm.state.CompareAndSwap(uint32(currentState), uint32(w.targetState)) {
// Successfully transitioned - notify waiter
w.done <- nil
processed = true
break
} else {
// State changed - re-add waiter to front of queue to maintain FIFO ordering
// This waiter was first in line and should retain priority
sm.waiters.PushFront(w)
sm.waiterCount.Add(1)
// Continue to next iteration to re-read state
processed = true
break
}
}
}
// If we didn't process any waiter, we're done
if !processed {
break
}
}
}
package pool
import (
"context"
"sync"
)
// PoolHook defines the interface for connection lifecycle hooks.
type PoolHook interface {
// OnGet is called when a connection is retrieved from the pool.
// It can modify the connection or return an error to prevent its use.
// The accept flag can be used to prevent the connection from being used.
// On Accept = false the connection is rejected and returned to the pool.
// The error can be used to prevent the connection from being used and returned to the pool.
// On Errors, the connection is removed from the pool.
// It has isNewConn flag to indicate if this is a new connection (rather than idle from the pool)
// The flag can be used for gathering metrics on pool hit/miss ratio.
OnGet(ctx context.Context, conn *Conn, isNewConn bool) (accept bool, err error)
// OnPut is called when a connection is returned to the pool.
// It returns whether the connection should be pooled and whether it should be removed.
OnPut(ctx context.Context, conn *Conn) (shouldPool bool, shouldRemove bool, err error)
// OnRemove is called when a connection is removed from the pool.
// This happens when:
// - Connection fails health check
// - Connection exceeds max lifetime
// - Pool is being closed
// - Connection encounters an error
// Implementations should clean up any per-connection state.
// The reason parameter indicates why the connection was removed.
OnRemove(ctx context.Context, conn *Conn, reason error)
}
// PoolHookManager manages multiple pool hooks.
type PoolHookManager struct {
hooks []PoolHook
hooksMu sync.RWMutex
}
// NewPoolHookManager creates a new pool hook manager.
func NewPoolHookManager() *PoolHookManager {
return &PoolHookManager{
hooks: make([]PoolHook, 0),
}
}
// AddHook adds a pool hook to the manager.
// Hooks are called in the order they were added.
func (phm *PoolHookManager) AddHook(hook PoolHook) {
phm.hooksMu.Lock()
defer phm.hooksMu.Unlock()
phm.hooks = append(phm.hooks, hook)
}
// RemoveHook removes a pool hook from the manager.
func (phm *PoolHookManager) RemoveHook(hook PoolHook) {
phm.hooksMu.Lock()
defer phm.hooksMu.Unlock()
for i, h := range phm.hooks {
if h == hook {
// Remove hook by swapping with last element and truncating
phm.hooks[i] = phm.hooks[len(phm.hooks)-1]
phm.hooks = phm.hooks[:len(phm.hooks)-1]
break
}
}
}
// ProcessOnGet calls all OnGet hooks in order.
// If any hook returns an error, processing stops and the error is returned.
func (phm *PoolHookManager) ProcessOnGet(ctx context.Context, conn *Conn, isNewConn bool) (acceptConn bool, err error) {
// Copy slice reference while holding lock (fast)
phm.hooksMu.RLock()
hooks := phm.hooks
phm.hooksMu.RUnlock()
// Call hooks without holding lock (slow operations)
for _, hook := range hooks {
acceptConn, err := hook.OnGet(ctx, conn, isNewConn)
if err != nil {
return false, err
}
if !acceptConn {
return false, nil
}
}
return true, nil
}
// ProcessOnPut calls all OnPut hooks in order.
// The first hook that returns shouldRemove=true or shouldPool=false will stop processing.
func (phm *PoolHookManager) ProcessOnPut(ctx context.Context, conn *Conn) (shouldPool bool, shouldRemove bool, err error) {
// Copy slice reference while holding lock (fast)
phm.hooksMu.RLock()
hooks := phm.hooks
phm.hooksMu.RUnlock()
shouldPool = true // Default to pooling the connection
// Call hooks without holding lock (slow operations)
for _, hook := range hooks {
hookShouldPool, hookShouldRemove, hookErr := hook.OnPut(ctx, conn)
if hookErr != nil {
return false, true, hookErr
}
// If any hook says to remove or not pool, respect that decision
if hookShouldRemove {
return false, true, nil
}
if !hookShouldPool {
shouldPool = false
}
}
return shouldPool, false, nil
}
// ProcessOnRemove calls all OnRemove hooks in order.
func (phm *PoolHookManager) ProcessOnRemove(ctx context.Context, conn *Conn, reason error) {
// Copy slice reference while holding lock (fast)
phm.hooksMu.RLock()
hooks := phm.hooks
phm.hooksMu.RUnlock()
// Call hooks without holding lock (slow operations)
for _, hook := range hooks {
hook.OnRemove(ctx, conn, reason)
}
}
// GetHookCount returns the number of registered hooks (for testing).
func (phm *PoolHookManager) GetHookCount() int {
phm.hooksMu.RLock()
defer phm.hooksMu.RUnlock()
return len(phm.hooks)
}
// GetHooks returns a copy of all registered hooks.
func (phm *PoolHookManager) GetHooks() []PoolHook {
phm.hooksMu.RLock()
defer phm.hooksMu.RUnlock()
hooks := make([]PoolHook, len(phm.hooks))
copy(hooks, phm.hooks)
return hooks
}
// Clone creates a copy of the hook manager with the same hooks.
// This is used for lock-free atomic updates of the hook manager.
func (phm *PoolHookManager) Clone() *PoolHookManager {
phm.hooksMu.RLock()
defer phm.hooksMu.RUnlock()
newManager := &PoolHookManager{
hooks: make([]PoolHook, len(phm.hooks)),
}
copy(newManager.hooks, phm.hooks)
return newManager
}
package pool
import (
"context"
"errors"
"net"
"sync"
"sync/atomic"
"time"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/proto"
"github.com/redis/go-redis/v9/internal/rand"
)
var (
// ErrClosed performs any operation on the closed client will return this error.
ErrClosed = errors.New("redis: client is closed")
// ErrPoolExhausted is returned from a pool connection method
// when the maximum number of database connections in the pool has been reached.
ErrPoolExhausted = errors.New("redis: connection pool exhausted")
// ErrPoolTimeout timed out waiting to get a connection from the connection pool.
ErrPoolTimeout = errors.New("redis: connection pool timeout")
// ErrConnUnusableTimeout is returned when a connection is not usable and we timed out trying to mark it as unusable.
ErrConnUnusableTimeout = errors.New("redis: timed out trying to mark connection as unusable")
// errHookRequestedRemoval is returned when a hook requests connection removal.
errHookRequestedRemoval = errors.New("hook requested removal")
// errConnNotPooled is returned when trying to return a non-pooled connection to the pool.
errConnNotPooled = errors.New("connection not pooled")
// metricCallbackMu protects all global metric callback functions for thread-safe access.
metricCallbackMu sync.RWMutex
// Global metric callbacks for connection state changes
metricConnectionStateChangeCallback func(ctx context.Context, cn *Conn, fromState, toState string)
// Global metric callback for connection creation time
metricConnectionCreateTimeCallback func(ctx context.Context, duration time.Duration, cn *Conn)
// Global metric callback for connection relaxed timeout changes
// Parameters: ctx, delta (+1/-1), cn, poolName, notificationType
metricConnectionRelaxedTimeoutCallback func(ctx context.Context, delta int, cn *Conn, poolName, notificationType string)
// Global metric callback for connection handoff
// Parameters: ctx, cn, poolName
metricConnectionHandoffCallback func(ctx context.Context, cn *Conn, poolName string)
// Global metric callback for error tracking
// Parameters: ctx, errorType, cn, statusCode, isInternal, retryAttempts
metricErrorCallback func(ctx context.Context, errorType string, cn *Conn, statusCode string, isInternal bool, retryAttempts int)
// Global metric callback for maintenance notifications
// Parameters: ctx, cn, notificationType
metricMaintenanceNotificationCallback func(ctx context.Context, cn *Conn, notificationType string)
// Global metric callback for connection wait time
// Parameters: ctx, duration, cn
metricConnectionWaitTimeCallback func(ctx context.Context, duration time.Duration, cn *Conn)
// Global metric callback for connection timeouts
// Parameters: ctx, cn, timeoutType
metricConnectionTimeoutCallback func(ctx context.Context, cn *Conn, timeoutType string)
// Global metric callback for connection closed
// Parameters: ctx, cn, reason, err
metricConnectionClosedCallback func(ctx context.Context, cn *Conn, reason string, err error)
// errPanicInDial is returned when a panic occurs in the dial function.
errPanicInQueuedNewConn = errors.New("panic in queuedNewConn")
// popAttempts is the maximum number of attempts to find a usable connection
// when popping from the idle connection pool. This handles cases where connections
// are temporarily marked as unusable (e.g., during maintenanceNotifications upgrades or network issues).
// Value of 50 provides sufficient resilience without excessive overhead.
// This is capped by the idle connection count, so we won't loop excessively.
popAttempts = 50
// getAttempts is the maximum number of attempts to get a connection that passes
// hook validation (e.g., maintenanceNotifications upgrade hooks). This protects against race conditions
// where hooks might temporarily reject connections during cluster transitions.
// Value of 3 balances resilience with performance - most hook rejections resolve quickly.
getAttempts = 3
minTime = time.Unix(-2208988800, 0) // Jan 1, 1900
maxTime = minTime.Add(1<<63 - 1)
noExpiration = maxTime
)
// MetricCallbacks holds all metric callback functions.
// Use SetAllMetricCallbacks to register all callbacks atomically.
type MetricCallbacks struct {
// ConnectionCreateTime is called when a new connection is created
ConnectionCreateTime func(ctx context.Context, duration time.Duration, cn *Conn)
// ConnectionRelaxedTimeout is called when connection timeout is relaxed/unrelaxed
// delta: +1 for relaxed, -1 for unrelaxed
ConnectionRelaxedTimeout func(ctx context.Context, delta int, cn *Conn, poolName, notificationType string)
// ConnectionHandoff is called when a connection is handed off to another node
ConnectionHandoff func(ctx context.Context, cn *Conn, poolName string)
// Error is called when an error occurs
Error func(ctx context.Context, errorType string, cn *Conn, statusCode string, isInternal bool, retryAttempts int)
// MaintenanceNotification is called when a maintenance notification is received
MaintenanceNotification func(ctx context.Context, cn *Conn, notificationType string)
// ConnectionWaitTime is called to record time spent waiting for a connection
ConnectionWaitTime func(ctx context.Context, duration time.Duration, cn *Conn)
// ConnectionClosed is called when a connection is closed
ConnectionClosed func(ctx context.Context, cn *Conn, reason string, err error)
}
// SetAllMetricCallbacks sets all metric callbacks atomically.
// Pass nil to clear all callbacks (disable metrics).
// This ensures all callbacks are set together under a single lock,
// preventing inconsistent state during registration.
//
// Note on thread safety: After returning, there is a small window where
// concurrent getMetric* calls may return the old callback value. This is
// acceptable for metrics - at most one event may go to the old recorder
// or be missed during the transition. The callbacks themselves are immutable
// function pointers, so calling an "old" callback is safe.
func SetAllMetricCallbacks(callbacks *MetricCallbacks) {
metricCallbackMu.Lock()
defer metricCallbackMu.Unlock()
if callbacks == nil {
metricConnectionCreateTimeCallback = nil
metricConnectionRelaxedTimeoutCallback = nil
metricConnectionHandoffCallback = nil
metricErrorCallback = nil
metricMaintenanceNotificationCallback = nil
metricConnectionWaitTimeCallback = nil
metricConnectionClosedCallback = nil
return
}
metricConnectionCreateTimeCallback = callbacks.ConnectionCreateTime
metricConnectionRelaxedTimeoutCallback = callbacks.ConnectionRelaxedTimeout
metricConnectionHandoffCallback = callbacks.ConnectionHandoff
metricErrorCallback = callbacks.Error
metricMaintenanceNotificationCallback = callbacks.MaintenanceNotification
metricConnectionWaitTimeCallback = callbacks.ConnectionWaitTime
metricConnectionClosedCallback = callbacks.ConnectionClosed
}
// getMetricConnectionStateChangeCallback returns the metric callback for connection state changes.
func getMetricConnectionStateChangeCallback() func(ctx context.Context, cn *Conn, fromState, toState string) {
metricCallbackMu.RLock()
cb := metricConnectionStateChangeCallback
metricCallbackMu.RUnlock()
return cb
}
// GetMetricConnectionCreateTimeCallback returns the metric callback for connection creation time.
func GetMetricConnectionCreateTimeCallback() func(ctx context.Context, duration time.Duration, cn *Conn) {
metricCallbackMu.RLock()
cb := metricConnectionCreateTimeCallback
metricCallbackMu.RUnlock()
return cb
}
// GetMetricConnectionRelaxedTimeoutCallback returns the metric callback for connection relaxed timeout changes.
// This is used by maintnotifications to record relaxed timeout metrics.
func GetMetricConnectionRelaxedTimeoutCallback() func(ctx context.Context, delta int, cn *Conn, poolName, notificationType string) {
metricCallbackMu.RLock()
cb := metricConnectionRelaxedTimeoutCallback
metricCallbackMu.RUnlock()
return cb
}
// GetMetricConnectionHandoffCallback returns the metric callback for connection handoffs.
// This is used by maintnotifications to record handoff metrics.
func GetMetricConnectionHandoffCallback() func(ctx context.Context, cn *Conn, poolName string) {
metricCallbackMu.RLock()
cb := metricConnectionHandoffCallback
metricCallbackMu.RUnlock()
return cb
}
// GetMetricErrorCallback returns the metric callback for error tracking.
// This is used by cluster and client code to record error metrics.
func GetMetricErrorCallback() func(ctx context.Context, errorType string, cn *Conn, statusCode string, isInternal bool, retryAttempts int) {
metricCallbackMu.RLock()
cb := metricErrorCallback
metricCallbackMu.RUnlock()
return cb
}
// GetMetricMaintenanceNotificationCallback returns the metric callback for maintenance notifications.
// This is used by maintnotifications to record notification metrics.
func GetMetricMaintenanceNotificationCallback() func(ctx context.Context, cn *Conn, notificationType string) {
metricCallbackMu.RLock()
cb := metricMaintenanceNotificationCallback
metricCallbackMu.RUnlock()
return cb
}
func getMetricConnectionWaitTimeCallback() func(ctx context.Context, duration time.Duration, cn *Conn) {
metricCallbackMu.RLock()
cb := metricConnectionWaitTimeCallback
metricCallbackMu.RUnlock()
return cb
}
func getMetricConnectionTimeoutCallback() func(ctx context.Context, cn *Conn, timeoutType string) {
metricCallbackMu.RLock()
cb := metricConnectionTimeoutCallback
metricCallbackMu.RUnlock()
return cb
}
func getMetricConnectionClosedCallback() func(ctx context.Context, cn *Conn, reason string, err error) {
metricCallbackMu.RLock()
cb := metricConnectionClosedCallback
metricCallbackMu.RUnlock()
return cb
}
// Stats contains pool state information and accumulated stats.
type Stats struct {
Hits uint32 // number of times free connection was found in the pool
Misses uint32 // number of times free connection was NOT found in the pool
Timeouts uint32 // number of times a wait timeout occurred
WaitCount uint32 // number of times a connection was waited
Unusable uint32 // number of times a connection was found to be unusable
WaitDurationNs int64 // total time spent for waiting a connection in nanoseconds
TotalConns uint32 // number of total connections in the pool
IdleConns uint32 // number of idle connections in the pool
StaleConns uint32 // number of stale connections removed from the pool
PendingRequests uint32 // number of pending requests waiting for a connection
PubSubStats PubSubStats
}
type Pooler interface {
NewConn(context.Context) (*Conn, error)
CloseConn(*Conn) error
Get(context.Context) (*Conn, error)
Put(context.Context, *Conn)
Remove(context.Context, *Conn, error)
Len() int
IdleLen() int
Stats() *Stats
// Size returns the maximum pool size (capacity).
// This is used by the streaming credentials manager to size the re-auth worker pool.
Size() int
AddPoolHook(hook PoolHook)
RemovePoolHook(hook PoolHook)
// RemoveWithoutTurn removes a connection from the pool without freeing a turn.
// This should be used when removing a connection from a context that didn't acquire
// a turn via Get() (e.g., background workers, cleanup tasks).
// For normal removal after Get(), use Remove() instead.
RemoveWithoutTurn(context.Context, *Conn, error)
Close() error
}
type Options struct {
Dialer func(context.Context) (net.Conn, error)
ReadBufferSize int
WriteBufferSize int
PoolFIFO bool
PoolSize int32
MaxConcurrentDials int
DialTimeout time.Duration
PoolTimeout time.Duration
MinIdleConns int32
MaxIdleConns int32
MaxActiveConns int32
ConnMaxIdleTime time.Duration
ConnMaxLifetime time.Duration
ConnMaxLifetimeJitter time.Duration
PushNotificationsEnabled bool
// DialerRetries is the maximum number of retry attempts when dialing fails.
// Default: 5
DialerRetries int
// DialerRetryTimeout is the backoff duration between retry attempts.
// Default: 100ms
DialerRetryTimeout time.Duration
// Name is a unique identifier for this pool, used in metrics.
// Format: addr_uniqueID (e.g., "localhost:6379_a1b2c3d4")
Name string
}
type lastDialErrorWrap struct {
err error
}
type ConnPool struct {
cfg *Options
dialErrorsNum uint32 // atomic
lastDialError atomic.Value
queue chan struct{}
dialsInProgress chan struct{}
dialsQueue *wantConnQueue
// Fast semaphore for connection limiting with eventual fairness
// Uses fast path optimization to avoid timer allocation when tokens are available
semaphore *internal.FastSemaphore
connsMu sync.Mutex
conns map[uint64]*Conn
idleConns []*Conn
poolSize atomic.Int32
idleConnsLen atomic.Int32
idleCheckInProgress atomic.Bool
idleCheckNeeded atomic.Bool
stats Stats
waitDurationNs atomic.Int64
_closed uint32 // atomic
// Pool hooks manager for flexible connection processing
// Using atomic.Pointer for lock-free reads in hot paths (Get/Put)
hookManager atomic.Pointer[PoolHookManager]
}
var _ Pooler = (*ConnPool)(nil)
func NewConnPool(opt *Options) *ConnPool {
p := &ConnPool{
cfg: opt,
semaphore: internal.NewFastSemaphore(opt.PoolSize),
queue: make(chan struct{}, opt.PoolSize),
conns: make(map[uint64]*Conn),
dialsInProgress: make(chan struct{}, opt.MaxConcurrentDials),
dialsQueue: newWantConnQueue(),
idleConns: make([]*Conn, 0, opt.PoolSize),
}
// Only create MinIdleConns if explicitly requested (> 0)
// This avoids creating connections during pool initialization for tests
if opt.MinIdleConns > 0 {
p.connsMu.Lock()
p.checkMinIdleConns()
p.connsMu.Unlock()
}
return p
}
// initializeHooks sets up the pool hooks system.
func (p *ConnPool) initializeHooks() {
manager := NewPoolHookManager()
p.hookManager.Store(manager)
}
// AddPoolHook adds a pool hook to the pool.
func (p *ConnPool) AddPoolHook(hook PoolHook) {
// Lock-free read of current manager
manager := p.hookManager.Load()
if manager == nil {
p.initializeHooks()
manager = p.hookManager.Load()
}
// Create new manager with added hook
newManager := manager.Clone()
newManager.AddHook(hook)
// Atomically swap to new manager
p.hookManager.Store(newManager)
}
// RemovePoolHook removes a pool hook from the pool.
func (p *ConnPool) RemovePoolHook(hook PoolHook) {
manager := p.hookManager.Load()
if manager != nil {
// Create new manager with removed hook
newManager := manager.Clone()
newManager.RemoveHook(hook)
// Atomically swap to new manager
p.hookManager.Store(newManager)
}
}
func (p *ConnPool) checkMinIdleConns() {
// If a check is already in progress, mark that we need another check and return
if !p.idleCheckInProgress.CompareAndSwap(false, true) {
p.idleCheckNeeded.Store(true)
return
}
if p.cfg.MinIdleConns == 0 {
p.idleCheckInProgress.Store(false)
return
}
// Keep checking until no more checks are needed
// This handles the case where multiple Remove() calls happen concurrently
for {
// Clear the "check needed" flag before we start
p.idleCheckNeeded.Store(false)
// Only create idle connections if we haven't reached the total pool size limit
// MinIdleConns should be a subset of PoolSize, not additional connections
for p.poolSize.Load() < p.cfg.PoolSize && p.idleConnsLen.Load() < p.cfg.MinIdleConns {
// Try to acquire a semaphore token
if !p.semaphore.TryAcquire() {
// Semaphore is full, can't create more connections right now
// Break out of inner loop to check if we need to retry
break
}
p.poolSize.Add(1)
p.idleConnsLen.Add(1)
go func() {
defer func() {
if err := recover(); err != nil {
p.poolSize.Add(-1)
p.idleConnsLen.Add(-1)
p.freeTurn()
internal.Logger.Printf(context.Background(), "addIdleConn panic: %+v", err)
}
}()
err := p.addIdleConn()
if err != nil && err != ErrClosed {
p.poolSize.Add(-1)
p.idleConnsLen.Add(-1)
}
p.freeTurn()
}()
}
// If no one requested another check while we were working, we're done
if !p.idleCheckNeeded.Load() {
p.idleCheckInProgress.Store(false)
return
}
// Otherwise, loop again to handle the new requests
}
}
func (p *ConnPool) addIdleConn() error {
// Do not apply DialTimeout via context here; dialConn applies DialTimeout per attempt.
cn, err := p.dialConn(context.Background(), true)
if err != nil {
return err
}
// NOTE: Connection is in CREATED state and will be initialized by redis.go:initConn()
// when first acquired from the pool. Do NOT transition to IDLE here - that happens
// after initialization completes.
p.connsMu.Lock()
defer p.connsMu.Unlock()
// It is not allowed to add new connections to the closed connection pool.
if p.closed() {
_ = cn.Close()
return ErrClosed
}
p.conns[cn.GetID()] = cn
p.idleConns = append(p.idleConns, cn)
return nil
}
// NewConn creates a new connection and returns it to the user.
// This will still obey MaxActiveConns but will not include it in the pool and won't increase the pool size.
//
// NOTE: If you directly get a connection from the pool, it won't be pooled and won't support maintnotifications upgrades.
func (p *ConnPool) NewConn(ctx context.Context) (*Conn, error) {
return p.newConn(ctx, false)
}
func (p *ConnPool) newConn(ctx context.Context, pooled bool) (*Conn, error) {
if p.closed() {
return nil, ErrClosed
}
if p.cfg.MaxActiveConns > 0 && p.poolSize.Load() >= p.cfg.MaxActiveConns {
return nil, ErrPoolExhausted
}
// Protect against nil context due to race condition in queuedNewConn
// where the context can be set to nil after timeout/cancellation
if ctx == nil {
ctx = context.Background()
}
// Do not apply DialTimeout via context here; dialConn applies DialTimeout per attempt.
// We still propagate ctx so callers can cancel explicitly.
cn, err := p.dialConn(ctx, pooled)
if err != nil {
return nil, err
}
// NOTE: Connection is in CREATED state and will be initialized by redis.go:initConn()
// when first used. Do NOT transition to IDLE here - that happens after initialization completes.
// The state machine flow is: CREATED → INITIALIZING (in initConn) → IDLE (after init success)
if p.cfg.MaxActiveConns > 0 && p.poolSize.Load() > p.cfg.MaxActiveConns {
_ = cn.Close()
return nil, ErrPoolExhausted
}
p.connsMu.Lock()
defer p.connsMu.Unlock()
if p.closed() {
_ = cn.Close()
return nil, ErrClosed
}
// Check if pool was closed while we were waiting for the lock
if p.conns == nil {
p.conns = make(map[uint64]*Conn)
}
p.conns[cn.GetID()] = cn
if pooled {
// If pool is full remove the cn on next Put.
currentPoolSize := p.poolSize.Load()
if currentPoolSize >= p.cfg.PoolSize {
cn.pooled = false
} else {
p.poolSize.Add(1)
}
}
// Notify metrics: new connection created and idle
if cb := getMetricConnectionStateChangeCallback(); cb != nil {
cb(ctx, cn, "", "idle")
}
return cn, nil
}
func (p *ConnPool) dialConn(ctx context.Context, pooled bool) (*Conn, error) {
if p.closed() {
return nil, ErrClosed
}
if atomic.LoadUint32(&p.dialErrorsNum) >= uint32(p.cfg.PoolSize) {
return nil, p.getLastDialError()
}
// Record dial start time for connection creation metric
// This will be used after handshake completes in redis.go _getConn()
// Only call time.Now() if callback is registered to avoid overhead
var dialStartNs int64
if GetMetricConnectionCreateTimeCallback() != nil {
dialStartNs = time.Now().UnixNano()
}
// Retry dialing with backoff
// Dial timeout is applied per attempt (so retries/backoff don't eat into the next
// attempt's dial budget), while still honoring caller cancellation via ctx.
maxRetries := p.cfg.DialerRetries
if maxRetries <= 0 {
maxRetries = 5 // Default value
}
backoffDuration := p.cfg.DialerRetryTimeout
if backoffDuration <= 0 {
backoffDuration = 100 * time.Millisecond // Default value
}
var lastErr error
shouldLoop := true
// when the timeout is reached, we should stop retrying
// but keep the lastErr to return to the caller
// instead of a generic context deadline exceeded error
attempt := 0
for attempt = 0; (attempt < maxRetries) && shouldLoop; attempt++ {
attemptCtx := ctx
var cancel context.CancelFunc
if p.cfg.DialTimeout > 0 {
// Apply DialTimeout per attempt, but never extend an existing earlier deadline.
if deadline, ok := ctx.Deadline(); !ok || time.Until(deadline) > p.cfg.DialTimeout {
attemptCtx, cancel = context.WithTimeout(ctx, p.cfg.DialTimeout)
}
}
netConn, err := p.cfg.Dialer(attemptCtx)
if cancel != nil {
cancel()
}
if err != nil {
lastErr = err
// Add backoff delay for retry attempts
// (not for the first attempt, do at least one)
// Do not sleep after the last attempt.
if attempt+1 < maxRetries {
select {
case <-ctx.Done():
shouldLoop = false
case <-time.After(backoffDuration):
// Continue with retry
}
}
continue
}
cn := NewConnWithBufferSize(netConn, p.cfg.ReadBufferSize, p.cfg.WriteBufferSize)
cn.pooled = pooled
// Store dial start time only if we recorded it
if dialStartNs > 0 {
cn.dialStartNs.Store(dialStartNs)
}
cn.expiresAt = p.calcConnExpiresAt()
// Set pool name for metrics
cn.SetPoolName(p.cfg.Name)
return cn, nil
}
internal.Logger.Printf(ctx, "redis: connection pool: failed to dial after %d attempts: %v", attempt, lastErr)
// All retries failed - handle error tracking
p.setLastDialError(lastErr)
if atomic.AddUint32(&p.dialErrorsNum, 1) == uint32(p.cfg.PoolSize) {
go p.tryDial()
}
return nil, lastErr
}
// calcConnExpiresAt calculates the expiration time for a connection.
// It applies random jitter to prevent all connections from expiring simultaneously,
// avoiding the "thundering herd" problem where all connections expire at once.
// Returns noExpiration if ConnMaxLifetime is not set.
func (p *ConnPool) calcConnExpiresAt() time.Time {
if p.cfg.ConnMaxLifetime <= 0 {
return noExpiration
}
if p.cfg.ConnMaxLifetimeJitter <= 0 {
return time.Now().Add(p.cfg.ConnMaxLifetime)
}
jitter := p.cfg.ConnMaxLifetimeJitter
jitterRange := jitter.Nanoseconds() * 2
jitterNs := rand.Int63n(jitterRange) - jitter.Nanoseconds()
return time.Now().Add(p.cfg.ConnMaxLifetime + time.Duration(jitterNs))
}
func (p *ConnPool) tryDial() {
for {
if p.closed() {
return
}
// Probe dialing even when dialErrorsNum is saturated. Apply DialTimeout per probe
// attempt so custom dialers can't hang indefinitely.
ctx := context.Background()
var cancel context.CancelFunc
if p.cfg.DialTimeout > 0 {
ctx, cancel = context.WithTimeout(ctx, p.cfg.DialTimeout)
}
conn, err := p.cfg.Dialer(ctx)
if cancel != nil {
cancel()
}
if err != nil {
p.setLastDialError(err)
time.Sleep(time.Second)
continue
}
atomic.StoreUint32(&p.dialErrorsNum, 0)
_ = conn.Close()
return
}
}
func (p *ConnPool) setLastDialError(err error) {
p.lastDialError.Store(&lastDialErrorWrap{err: err})
}
func (p *ConnPool) getLastDialError() error {
err, _ := p.lastDialError.Load().(*lastDialErrorWrap)
if err != nil {
return err.err
}
return nil
}
// Get returns existed connection from the pool or creates a new one.
func (p *ConnPool) Get(ctx context.Context) (*Conn, error) {
return p.getConn(ctx)
}
// getConn returns a connection from the pool.
func (p *ConnPool) getConn(ctx context.Context) (cn *Conn, err error) {
if p.closed() {
return nil, ErrClosed
}
// Track pending requests in pool stats
// NOTE: We only track in stats, not via callback. The AsyncGauge reads stats directly.
atomic.AddUint32(&p.stats.PendingRequests, 1)
defer func() {
if err != nil {
// Failed to get connection, decrement pending requests
atomic.AddUint32(&p.stats.PendingRequests, ^uint32(0)) // -1
}
}()
// Track wait time - only call time.Now() if callback is registered
var waitStart time.Time
waitTimeCallback := getMetricConnectionWaitTimeCallback()
if waitTimeCallback != nil {
waitStart = time.Now()
}
if err = p.waitTurn(ctx); err != nil {
// Record timeout if applicable
if err == ErrPoolTimeout {
if cb := getMetricConnectionTimeoutCallback(); cb != nil {
cb(ctx, nil, "pool")
}
// Record general error metric for pool timeout
if cb := GetMetricErrorCallback(); cb != nil {
cb(ctx, "POOL_TIMEOUT", nil, "POOL_TIMEOUT", true, 0)
}
}
return nil, err
}
var waitDuration time.Duration
if waitTimeCallback != nil {
waitDuration = time.Since(waitStart)
}
// Use cached time for health checks (max 50ms staleness is acceptable)
nowNs := getCachedTimeNs()
// Lock-free atomic read - no mutex overhead!
hookManager := p.hookManager.Load()
for attempts := 0; attempts < getAttempts; attempts++ {
p.connsMu.Lock()
cn, err = p.popIdle()
p.connsMu.Unlock()
if err != nil {
p.freeTurn()
return nil, err
}
if cn == nil {
break
}
if !p.isHealthyConn(cn, nowNs) {
_ = p.CloseConn(cn)
continue
}
// Process connection using the hooks system
// Combine error and rejection checks to reduce branches
if hookManager != nil {
acceptConn, hookErr := hookManager.ProcessOnGet(ctx, cn, false)
if hookErr != nil || !acceptConn {
if hookErr != nil {
internal.Logger.Printf(ctx, "redis: connection pool: failed to process idle connection by hook: %v", hookErr)
_ = p.CloseConn(cn)
} else {
internal.Logger.Printf(ctx, "redis: connection pool: conn[%d] rejected by hook, returning to pool", cn.GetID())
// Return connection to pool without freeing the turn that this Get() call holds.
// We use putConnWithoutTurn() to run all the Put hooks and logic without freeing a turn.
p.putConnWithoutTurn(ctx, cn)
cn = nil
}
continue
}
}
atomic.AddUint32(&p.stats.Hits, 1)
// Notify metrics: connection moved from idle to used
if cb := getMetricConnectionStateChangeCallback(); cb != nil {
cb(ctx, cn, "idle", "used")
}
// Record wait time (use cached callback from above)
if waitTimeCallback != nil {
waitTimeCallback(ctx, waitDuration, cn)
}
// Decrement pending requests (connection acquired successfully)
// NOTE: We only track in stats, not via callback. The AsyncGauge reads stats directly.
atomic.AddUint32(&p.stats.PendingRequests, ^uint32(0)) // -1
return cn, nil
}
atomic.AddUint32(&p.stats.Misses, 1)
var newcn *Conn
newcn, err = p.queuedNewConn(ctx)
if err != nil {
return nil, err
}
// Process connection using the hooks system
// This includes the handshake (HELLO/AUTH) via initConn hook
if hookManager != nil {
var acceptConn bool
acceptConn, err = hookManager.ProcessOnGet(ctx, newcn, true)
// both errors and accept=false mean a hook rejected the connection
// this should not happen with a new connection, but we handle it gracefully
if err != nil || !acceptConn {
// Failed to process connection, discard it
internal.Logger.Printf(ctx, "redis: connection pool: failed to process new connection conn[%d] by hook: accept=%v, err=%v", newcn.GetID(), acceptConn, err)
_ = p.CloseConn(newcn)
return nil, err
}
}
// Notify metrics: new connection is created and used
if cb := getMetricConnectionStateChangeCallback(); cb != nil {
cb(ctx, newcn, "", "used")
}
// Record wait time (use cached callback from above)
if waitTimeCallback != nil {
waitTimeCallback(ctx, waitDuration, newcn)
}
// Decrement pending requests (connection acquired successfully)
// NOTE: We only track in stats, not via callback. The AsyncGauge reads stats directly.
atomic.AddUint32(&p.stats.PendingRequests, ^uint32(0)) // -1
return newcn, nil
}
func (p *ConnPool) queuedNewConn(ctx context.Context) (*Conn, error) {
select {
case p.dialsInProgress <- struct{}{}:
// Got permission, proceed to create connection
case <-ctx.Done():
p.freeTurn()
return nil, ctx.Err()
}
// Don't apply DialTimeout via context here; dialConn applies DialTimeout per attempt.
dialCtx, cancel := context.WithCancel(context.Background())
w := &wantConn{
ctx: dialCtx,
cancelCtx: cancel,
result: make(chan wantConnResult, 1),
}
var err error
defer func() {
if err != nil {
if cn := w.cancel(); cn != nil && p.putIdleConn(ctx, cn) {
p.freeTurn()
}
}
}()
p.dialsQueue.discardDoneAtFront()
p.dialsQueue.enqueue(w)
go func(w *wantConn) {
var freeTurnCalled bool
defer func() {
if err := recover(); err != nil {
w.tryDeliver(nil, errPanicInQueuedNewConn)
p.dialsQueue.discardDoneAtFront()
if !freeTurnCalled {
p.freeTurn()
}
internal.Logger.Printf(context.Background(), "queuedNewConn panic: %+v", err)
}
}()
defer w.cancelCtx()
defer func() { <-p.dialsInProgress }() // Release connection creation permission
dialCtx := w.getCtxForDial()
cn, cnErr := p.newConn(dialCtx, true)
if cnErr != nil {
w.tryDeliver(nil, cnErr) // deliver error to caller, notify connection creation failed
p.dialsQueue.discardDoneAtFront()
p.freeTurn()
freeTurnCalled = true
return
}
delivered := w.tryDeliver(cn, cnErr)
p.dialsQueue.discardDoneAtFront()
if !delivered && p.putIdleConn(dialCtx, cn) {
p.freeTurn()
freeTurnCalled = true
}
}(w)
select {
case <-ctx.Done():
err = ctx.Err()
return nil, err
case result := <-w.result:
err = result.err
return result.cn, err
}
}
// putIdleConn puts a connection back to the pool or passes it to the next waiting request.
//
// It returns true if the connection was put back to the pool,
// which means the turn needs to be freed directly by the caller,
// or false if the connection was passed to the next waiting request,
// which means the turn will be freed by the waiting goroutine after it returns.
func (p *ConnPool) putIdleConn(ctx context.Context, cn *Conn) bool {
for {
w, ok := p.dialsQueue.dequeue()
if !ok {
break
}
if w.tryDeliver(cn, nil) {
return false
}
}
p.connsMu.Lock()
defer p.connsMu.Unlock()
if p.closed() {
_ = cn.Close()
return true
}
// poolSize is increased in newConn
p.idleConns = append(p.idleConns, cn)
p.idleConnsLen.Add(1)
return true
}
func (p *ConnPool) waitTurn(ctx context.Context) error {
// Fast path: check context first
select {
case <-ctx.Done():
return ctx.Err()
default:
}
// Fast path: try to acquire without blocking
if p.semaphore.TryAcquire() {
return nil
}
// Slow path: need to wait
start := time.Now()
err := p.semaphore.Acquire(ctx, p.cfg.PoolTimeout, ErrPoolTimeout)
switch err {
case nil:
// Successfully acquired after waiting
p.waitDurationNs.Add(time.Now().UnixNano() - start.UnixNano())
atomic.AddUint32(&p.stats.WaitCount, 1)
case ErrPoolTimeout:
atomic.AddUint32(&p.stats.Timeouts, 1)
}
return err
}
func (p *ConnPool) freeTurn() {
p.semaphore.Release()
}
func (p *ConnPool) popIdle() (*Conn, error) {
if p.closed() {
return nil, ErrClosed
}
defer p.checkMinIdleConns()
n := len(p.idleConns)
if n == 0 {
return nil, nil
}
var cn *Conn
attempts := 0
maxAttempts := min(popAttempts, n)
for attempts < maxAttempts {
if len(p.idleConns) == 0 {
return nil, nil
}
if p.cfg.PoolFIFO {
cn = p.idleConns[0]
copy(p.idleConns, p.idleConns[1:])
p.idleConns = p.idleConns[:len(p.idleConns)-1]
} else {
idx := len(p.idleConns) - 1
cn = p.idleConns[idx]
p.idleConns = p.idleConns[:idx]
}
attempts++
// Hot path optimization: try IDLE → IN_USE or CREATED → IN_USE transition
// Using inline TryAcquire() method for better performance (avoids pointer dereference)
if cn.TryAcquire() {
// Successfully acquired the connection
p.idleConnsLen.Add(-1)
break
}
// Connection is in UNUSABLE, INITIALIZING, or other state - skip it
// Connection is not in a valid state (might be UNUSABLE for handoff/re-auth, INITIALIZING, etc.)
// Put it back in the pool and try the next one
if p.cfg.PoolFIFO {
// FIFO: put at end (will be picked up last since we pop from front)
p.idleConns = append(p.idleConns, cn)
} else {
// LIFO: put at beginning (will be picked up last since we pop from end)
p.idleConns = append([]*Conn{cn}, p.idleConns...)
}
cn = nil
}
// If we exhausted all attempts without finding a usable connection, return nil
if attempts > 1 && attempts >= maxAttempts && int32(attempts) >= p.poolSize.Load() {
internal.Logger.Printf(context.Background(), "redis: connection pool: failed to get a usable connection after %d attempts", attempts)
return nil, nil
}
return cn, nil
}
func (p *ConnPool) Put(ctx context.Context, cn *Conn) {
p.putConn(ctx, cn, true)
}
// putConnWithoutTurn is an internal method that puts a connection back to the pool
// without freeing a turn. This is used when returning a rejected connection from
// within Get(), where the turn is still held by the Get() call.
func (p *ConnPool) putConnWithoutTurn(ctx context.Context, cn *Conn) {
p.putConn(ctx, cn, false)
}
// putConn is the internal implementation of Put that optionally frees a turn.
func (p *ConnPool) putConn(ctx context.Context, cn *Conn, freeTurn bool) {
// Guard against nil connection
if cn == nil {
internal.Logger.Printf(ctx, "putConn called with nil connection")
if freeTurn {
p.freeTurn()
}
return
}
// Process connection using the hooks system
shouldPool := true
shouldRemove := false
var err error
if cn.HasBufferedData() {
// Peek at the reply type to check if it's a push notification
if replyType, err := cn.PeekReplyTypeSafe(); err != nil || replyType != proto.RespPush {
// Not a push notification or error peeking, remove connection
internal.Logger.Printf(ctx, "Conn has unread data (not push notification), removing it")
p.removeConnInternal(ctx, cn, err, freeTurn)
return
}
// It's a push notification, allow pooling (client will handle it)
}
// Lock-free atomic read - no mutex overhead!
hookManager := p.hookManager.Load()
if hookManager != nil {
shouldPool, shouldRemove, err = hookManager.ProcessOnPut(ctx, cn)
if err != nil {
internal.Logger.Printf(ctx, "Connection hook error: %v", err)
p.removeConnInternal(ctx, cn, err, freeTurn)
return
}
}
// Combine all removal checks into one - reduces branches
if shouldRemove || !shouldPool {
p.removeConnInternal(ctx, cn, errHookRequestedRemoval, freeTurn)
return
}
if !cn.pooled {
p.removeConnInternal(ctx, cn, errConnNotPooled, freeTurn)
return
}
var shouldCloseConn bool
if p.cfg.MaxIdleConns == 0 || p.idleConnsLen.Load() < p.cfg.MaxIdleConns {
// Hot path optimization: try fast IN_USE → IDLE transition
// Using inline Release() method for better performance (avoids pointer dereference)
transitionedToIdle := cn.Release()
// Handle unexpected state changes
if !transitionedToIdle {
// Fast path failed - hook might have changed state (e.g., to UNUSABLE for handoff)
// Keep the state set by the hook and pool the connection anyway
sm := cn.GetStateMachine()
if sm == nil {
// State machine is nil - connection is in an invalid state, remove it
internal.Logger.Printf(ctx, "conn[%d] has nil state machine, removing it", cn.GetID())
p.removeConnInternal(ctx, cn, errConnNotPooled, freeTurn)
return
}
currentState := sm.GetState()
switch currentState {
case StateUnusable:
// expected state, don't log it
case StateClosed:
internal.Logger.Printf(ctx, "Unexpected conn[%d] state changed by hook to %v, closing it", cn.GetID(), currentState)
shouldCloseConn = true
p.removeConnWithLock(cn)
default:
// Pool as-is
internal.Logger.Printf(ctx, "Unexpected conn[%d] state changed by hook to %v, pooling as-is", cn.GetID(), currentState)
}
}
// unusable conns are expected to become usable at some point (background process is reconnecting them)
// put them at the opposite end of the queue
// Optimization: if we just transitioned to IDLE, we know it's usable - skip the check
if !transitionedToIdle && !cn.IsUsable() {
if p.cfg.PoolFIFO {
p.connsMu.Lock()
p.idleConns = append(p.idleConns, cn)
p.connsMu.Unlock()
} else {
p.connsMu.Lock()
p.idleConns = append([]*Conn{cn}, p.idleConns...)
p.connsMu.Unlock()
}
p.idleConnsLen.Add(1)
} else if !shouldCloseConn {
p.connsMu.Lock()
p.idleConns = append(p.idleConns, cn)
p.connsMu.Unlock()
p.idleConnsLen.Add(1)
}
// Notify metrics: connection moved from used to idle
if cb := getMetricConnectionStateChangeCallback(); cb != nil {
cb(ctx, cn, "used", "idle")
}
} else {
shouldCloseConn = true
p.removeConnWithLock(cn)
// Notify metrics: connection removed (used -> nothing)
if cb := getMetricConnectionStateChangeCallback(); cb != nil {
cb(ctx, cn, "used", "")
}
}
if freeTurn {
p.freeTurn()
}
if shouldCloseConn {
_ = p.closeConn(cn)
}
cn.SetLastPutAtNs(getCachedTimeNs())
}
func (p *ConnPool) Remove(ctx context.Context, cn *Conn, reason error) {
p.removeConnInternal(ctx, cn, reason, true)
}
// RemoveWithoutTurn removes a connection from the pool without freeing a turn.
// This should be used when removing a connection from a context that didn't acquire
// a turn via Get() (e.g., background workers, cleanup tasks).
// For normal removal after Get(), use Remove() instead.
func (p *ConnPool) RemoveWithoutTurn(ctx context.Context, cn *Conn, reason error) {
p.removeConnInternal(ctx, cn, reason, false)
}
// removeConnInternal is the internal implementation of Remove that optionally frees a turn.
func (p *ConnPool) removeConnInternal(ctx context.Context, cn *Conn, reason error, freeTurn bool) {
// Lock-free atomic read - no mutex overhead!
hookManager := p.hookManager.Load()
if hookManager != nil {
hookManager.ProcessOnRemove(ctx, cn, reason)
}
p.removeConnWithLock(cn)
if freeTurn {
p.freeTurn()
}
// Notify metrics: connection removed (assume from used state)
if cb := getMetricConnectionStateChangeCallback(); cb != nil {
cb(ctx, cn, "used", "")
}
// Record connection closed
if cb := getMetricConnectionClosedCallback(); cb != nil {
reasonStr := "unknown"
if reason != nil {
reasonStr = reason.Error()
}
cb(ctx, cn, reasonStr, reason)
}
_ = p.closeConn(cn)
// Check if we need to create new idle connections to maintain MinIdleConns
p.checkMinIdleConns()
}
func (p *ConnPool) CloseConn(cn *Conn) error {
p.removeConnWithLock(cn)
return p.closeConn(cn)
}
func (p *ConnPool) removeConnWithLock(cn *Conn) {
p.connsMu.Lock()
defer p.connsMu.Unlock()
p.removeConn(cn)
}
func (p *ConnPool) removeConn(cn *Conn) {
cid := cn.GetID()
delete(p.conns, cid)
atomic.AddUint32(&p.stats.StaleConns, 1)
// Decrement pool size counter when removing a connection
if cn.pooled {
p.poolSize.Add(-1)
// this can be idle conn
for idx, ic := range p.idleConns {
if ic == cn {
p.idleConns = append(p.idleConns[:idx], p.idleConns[idx+1:]...)
p.idleConnsLen.Add(-1)
break
}
}
}
}
func (p *ConnPool) closeConn(cn *Conn) error {
return cn.Close()
}
// Len returns total number of connections.
func (p *ConnPool) Len() int {
p.connsMu.Lock()
n := len(p.conns)
p.connsMu.Unlock()
return n
}
// IdleLen returns number of idle connections.
func (p *ConnPool) IdleLen() int {
p.connsMu.Lock()
n := p.idleConnsLen.Load()
p.connsMu.Unlock()
return int(n)
}
// Size returns the maximum pool size (capacity).
//
// This is used by the streaming credentials manager to size the re-auth worker pool,
// ensuring that re-auth operations don't exhaust the connection pool.
func (p *ConnPool) Size() int {
return int(p.cfg.PoolSize)
}
func (p *ConnPool) Stats() *Stats {
return &Stats{
Hits: atomic.LoadUint32(&p.stats.Hits),
Misses: atomic.LoadUint32(&p.stats.Misses),
Timeouts: atomic.LoadUint32(&p.stats.Timeouts),
WaitCount: atomic.LoadUint32(&p.stats.WaitCount),
Unusable: atomic.LoadUint32(&p.stats.Unusable),
WaitDurationNs: p.waitDurationNs.Load(),
PendingRequests: atomic.LoadUint32(&p.stats.PendingRequests),
TotalConns: uint32(p.Len()),
IdleConns: uint32(p.IdleLen()),
StaleConns: atomic.LoadUint32(&p.stats.StaleConns),
}
}
func (p *ConnPool) closed() bool {
return atomic.LoadUint32(&p._closed) == 1
}
func (p *ConnPool) Filter(fn func(*Conn) bool) error {
p.connsMu.Lock()
defer p.connsMu.Unlock()
var firstErr error
for _, cn := range p.conns {
if fn(cn) {
if err := p.closeConn(cn); err != nil && firstErr == nil {
firstErr = err
}
}
}
return firstErr
}
func (p *ConnPool) Close() error {
if !atomic.CompareAndSwapUint32(&p._closed, 0, 1) {
return ErrClosed
}
var firstErr error
p.connsMu.Lock()
for _, cn := range p.conns {
if err := p.closeConn(cn); err != nil && firstErr == nil {
firstErr = err
}
}
p.conns = nil
p.poolSize.Store(0)
p.idleConns = nil
p.idleConnsLen.Store(0)
p.connsMu.Unlock()
return firstErr
}
func (p *ConnPool) isHealthyConn(cn *Conn, nowNs int64) bool {
// Performance optimization: check conditions from cheapest to most expensive,
// and from most likely to fail to least likely to fail.
// Only fails if ConnMaxLifetime is set AND connection is old.
// Most pools don't set ConnMaxLifetime, so this rarely fails.
if p.cfg.ConnMaxLifetime > 0 {
if cn.expiresAt.UnixNano() < nowNs {
return false // Connection has exceeded max lifetime
}
}
// Most pools set ConnMaxIdleTime, and idle connections are common.
// Checking this first allows us to fail fast without expensive syscalls.
if p.cfg.ConnMaxIdleTime > 0 {
if nowNs-cn.UsedAtNs() >= int64(p.cfg.ConnMaxIdleTime) {
return false // Connection has been idle too long
}
}
// Only run this if the cheap checks passed.
if err := connCheck(cn.getNetConn()); err != nil {
// If there's unexpected data, it might be push notifications (RESP3)
if p.cfg.PushNotificationsEnabled && err == errUnexpectedRead {
// Peek at the reply type to check if it's a push notification
if replyType, err := cn.rd.PeekReplyType(); err == nil && replyType == proto.RespPush {
// For RESP3 connections with push notifications, we allow some buffered data
// The client will process these notifications before using the connection
internal.Logger.Printf(
context.Background(),
"push: conn[%d] has buffered data, likely push notifications - will be processed by client",
cn.GetID(),
)
// Update timestamp for healthy connection
cn.SetUsedAtNs(nowNs)
// Connection is healthy, client will handle notifications
return true
}
// Not a push notification - treat as unhealthy
return false
}
// Connection failed health check
return false
}
// Only update UsedAt if connection is healthy (avoids unnecessary atomic store)
cn.SetUsedAtNs(nowNs)
return true
}
package pool
import (
"context"
"time"
)
// SingleConnPool is a pool that always returns the same connection.
// Note: This pool is not thread-safe.
// It is intended to be used by clients that need a single connection.
type SingleConnPool struct {
pool Pooler
cn *Conn
stickyErr error
}
var _ Pooler = (*SingleConnPool)(nil)
// NewSingleConnPool creates a new single connection pool.
// The pool will always return the same connection.
// The pool will not:
// - Close the connection
// - Reconnect the connection
// - Track the connection in any way
func NewSingleConnPool(pool Pooler, cn *Conn) *SingleConnPool {
return &SingleConnPool{
pool: pool,
cn: cn,
}
}
func (p *SingleConnPool) NewConn(ctx context.Context) (*Conn, error) {
return p.pool.NewConn(ctx)
}
func (p *SingleConnPool) CloseConn(cn *Conn) error {
return p.pool.CloseConn(cn)
}
func (p *SingleConnPool) Get(_ context.Context) (*Conn, error) {
if p.stickyErr != nil {
return nil, p.stickyErr
}
if p.cn == nil {
return nil, ErrClosed
}
// NOTE: SingleConnPool is NOT thread-safe by design and is used in special scenarios:
// - During initialization (connection is in INITIALIZING state)
// - During re-authentication (connection is in UNUSABLE state)
// - For transactions (connection might be in various states)
// We use SetUsed() which forces the transition, rather than TryTransition() which
// would fail if the connection is not in IDLE/CREATED state.
p.cn.SetUsed(true)
p.cn.SetUsedAt(time.Now())
return p.cn, nil
}
func (p *SingleConnPool) Put(_ context.Context, cn *Conn) {
if p.cn == nil {
return
}
if p.cn != cn {
return
}
p.cn.SetUsed(false)
}
func (p *SingleConnPool) Remove(_ context.Context, cn *Conn, reason error) {
cn.SetUsed(false)
p.cn = nil
p.stickyErr = reason
}
// RemoveWithoutTurn has the same behavior as Remove for SingleConnPool
// since SingleConnPool doesn't use a turn-based queue system.
func (p *SingleConnPool) RemoveWithoutTurn(ctx context.Context, cn *Conn, reason error) {
p.Remove(ctx, cn, reason)
}
func (p *SingleConnPool) Close() error {
p.cn = nil
p.stickyErr = ErrClosed
return nil
}
func (p *SingleConnPool) Len() int {
return 0
}
func (p *SingleConnPool) IdleLen() int {
return 0
}
// Size returns the maximum pool size, which is always 1 for SingleConnPool.
func (p *SingleConnPool) Size() int { return 1 }
func (p *SingleConnPool) Stats() *Stats {
return &Stats{}
}
func (p *SingleConnPool) AddPoolHook(_ PoolHook) {}
func (p *SingleConnPool) RemovePoolHook(_ PoolHook) {}
package pool
import (
"context"
"errors"
"fmt"
"sync/atomic"
)
const (
stateDefault = 0
stateInited = 1
stateClosed = 2
)
type BadConnError struct {
wrapped error
}
var _ error = (*BadConnError)(nil)
func (e BadConnError) Error() string {
s := "redis: Conn is in a bad state"
if e.wrapped != nil {
s += ": " + e.wrapped.Error()
}
return s
}
func (e BadConnError) Unwrap() error {
return e.wrapped
}
//------------------------------------------------------------------------------
type StickyConnPool struct {
pool Pooler
shared int32 // atomic
state uint32 // atomic
ch chan *Conn
_badConnError atomic.Value
}
var _ Pooler = (*StickyConnPool)(nil)
func NewStickyConnPool(pool Pooler) *StickyConnPool {
p, ok := pool.(*StickyConnPool)
if !ok {
p = &StickyConnPool{
pool: pool,
ch: make(chan *Conn, 1),
}
}
atomic.AddInt32(&p.shared, 1)
return p
}
func (p *StickyConnPool) NewConn(ctx context.Context) (*Conn, error) {
return p.pool.NewConn(ctx)
}
func (p *StickyConnPool) CloseConn(cn *Conn) error {
return p.pool.CloseConn(cn)
}
func (p *StickyConnPool) Get(ctx context.Context) (*Conn, error) {
// In worst case this races with Close which is not a very common operation.
for i := 0; i < 1000; i++ {
switch atomic.LoadUint32(&p.state) {
case stateDefault:
cn, err := p.pool.Get(ctx)
if err != nil {
return nil, err
}
if atomic.CompareAndSwapUint32(&p.state, stateDefault, stateInited) {
return cn, nil
}
p.pool.Remove(ctx, cn, ErrClosed)
case stateInited:
if err := p.badConnError(); err != nil {
return nil, err
}
cn, ok := <-p.ch
if !ok {
return nil, ErrClosed
}
return cn, nil
case stateClosed:
return nil, ErrClosed
default:
panic("not reached")
}
}
return nil, fmt.Errorf("redis: StickyConnPool.Get: infinite loop")
}
func (p *StickyConnPool) Put(ctx context.Context, cn *Conn) {
defer func() {
if recover() != nil {
p.freeConn(ctx, cn)
}
}()
p.ch <- cn
}
func (p *StickyConnPool) freeConn(ctx context.Context, cn *Conn) {
if err := p.badConnError(); err != nil {
p.pool.Remove(ctx, cn, err)
} else {
p.pool.Put(ctx, cn)
}
}
func (p *StickyConnPool) Remove(ctx context.Context, cn *Conn, reason error) {
defer func() {
if recover() != nil {
p.pool.Remove(ctx, cn, ErrClosed)
}
}()
p._badConnError.Store(BadConnError{wrapped: reason})
p.ch <- cn
}
// RemoveWithoutTurn has the same behavior as Remove for StickyConnPool
// since StickyConnPool doesn't use a turn-based queue system.
func (p *StickyConnPool) RemoveWithoutTurn(ctx context.Context, cn *Conn, reason error) {
p.Remove(ctx, cn, reason)
}
func (p *StickyConnPool) Close() error {
if shared := atomic.AddInt32(&p.shared, -1); shared > 0 {
return nil
}
for i := 0; i < 1000; i++ {
state := atomic.LoadUint32(&p.state)
if state == stateClosed {
return ErrClosed
}
if atomic.CompareAndSwapUint32(&p.state, state, stateClosed) {
close(p.ch)
cn, ok := <-p.ch
if ok {
p.freeConn(context.TODO(), cn)
}
return nil
}
}
return errors.New("redis: StickyConnPool.Close: infinite loop")
}
func (p *StickyConnPool) Reset(ctx context.Context) error {
if p.badConnError() == nil {
return nil
}
select {
case cn, ok := <-p.ch:
if !ok {
return ErrClosed
}
p.pool.Remove(ctx, cn, ErrClosed)
p._badConnError.Store(BadConnError{wrapped: nil})
default:
return errors.New("redis: StickyConnPool does not have a Conn")
}
if !atomic.CompareAndSwapUint32(&p.state, stateInited, stateDefault) {
state := atomic.LoadUint32(&p.state)
return fmt.Errorf("redis: invalid StickyConnPool state: %d", state)
}
return nil
}
func (p *StickyConnPool) badConnError() error {
if v := p._badConnError.Load(); v != nil {
if err := v.(BadConnError); err.wrapped != nil {
return err
}
}
return nil
}
func (p *StickyConnPool) Len() int {
switch atomic.LoadUint32(&p.state) {
case stateDefault:
return 0
case stateInited:
return 1
case stateClosed:
return 0
default:
panic("not reached")
}
}
func (p *StickyConnPool) IdleLen() int {
return len(p.ch)
}
// Size returns the maximum pool size, which is always 1 for StickyConnPool.
func (p *StickyConnPool) Size() int { return 1 }
func (p *StickyConnPool) Stats() *Stats {
return &Stats{}
}
func (p *StickyConnPool) AddPoolHook(hook PoolHook) {}
func (p *StickyConnPool) RemovePoolHook(hook PoolHook) {}
package pool
import (
"context"
"net"
"sync"
"sync/atomic"
)
type PubSubStats struct {
Created uint32
Untracked uint32
Active uint32
}
// PubSubPool manages a pool of PubSub connections.
type PubSubPool struct {
opt *Options
netDialer func(ctx context.Context, network, addr string) (net.Conn, error)
// Map to track active PubSub connections
activeConns sync.Map // map[uint64]*Conn (connID -> conn)
closed atomic.Bool
stats PubSubStats
}
// NewPubSubPool implements a pool for PubSub connections.
// It intentionally does not implement the Pooler interface
func NewPubSubPool(opt *Options, netDialer func(ctx context.Context, network, addr string) (net.Conn, error)) *PubSubPool {
return &PubSubPool{
opt: opt,
netDialer: netDialer,
}
}
func (p *PubSubPool) NewConn(ctx context.Context, network string, addr string, channels []string) (*Conn, error) {
if p.closed.Load() {
return nil, ErrClosed
}
netConn, err := p.netDialer(ctx, network, addr)
if err != nil {
return nil, err
}
cn := NewConnWithBufferSize(netConn, p.opt.ReadBufferSize, p.opt.WriteBufferSize)
cn.pubsub = true
// Set pool name for metrics
cn.SetPoolName(p.opt.Name)
atomic.AddUint32(&p.stats.Created, 1)
return cn, nil
}
func (p *PubSubPool) TrackConn(cn *Conn) {
atomic.AddUint32(&p.stats.Active, 1)
p.activeConns.Store(cn.GetID(), cn)
}
func (p *PubSubPool) UntrackConn(cn *Conn) {
atomic.AddUint32(&p.stats.Active, ^uint32(0))
atomic.AddUint32(&p.stats.Untracked, 1)
p.activeConns.Delete(cn.GetID())
}
func (p *PubSubPool) Close() error {
p.closed.Store(true)
p.activeConns.Range(func(key, value interface{}) bool {
cn := value.(*Conn)
_ = cn.Close()
return true
})
return nil
}
func (p *PubSubPool) Stats() *PubSubStats {
// load stats atomically
return &PubSubStats{
Created: atomic.LoadUint32(&p.stats.Created),
Untracked: atomic.LoadUint32(&p.stats.Untracked),
Active: atomic.LoadUint32(&p.stats.Active),
}
}
package pool
import (
"context"
"sync"
)
type wantConn struct {
mu sync.RWMutex // protects ctx, done and sending of the result
ctx context.Context // context for dial, cleared after delivered or canceled
cancelCtx context.CancelFunc
done bool // true after delivered or canceled
result chan wantConnResult // channel to deliver connection or error
}
// getCtxForDial returns context for dial or nil if connection was delivered or canceled.
func (w *wantConn) getCtxForDial() context.Context {
w.mu.RLock()
defer w.mu.RUnlock()
return w.ctx
}
func (w *wantConn) tryDeliver(cn *Conn, err error) bool {
w.mu.Lock()
defer w.mu.Unlock()
if w.done {
return false
}
w.done = true
w.ctx = nil
w.result <- wantConnResult{cn: cn, err: err}
close(w.result)
return true
}
func (w *wantConn) cancel() *Conn {
w.mu.Lock()
var cn *Conn
if w.done {
select {
case result := <-w.result:
cn = result.cn
default:
}
} else {
close(w.result)
}
w.done = true
w.ctx = nil
w.mu.Unlock()
return cn
}
func (w *wantConn) isOngoing() bool {
w.mu.RLock()
defer w.mu.RUnlock()
return !w.done
}
type wantConnResult struct {
cn *Conn
err error
}
type wantConnQueue struct {
mu sync.RWMutex
items []*wantConn
}
func newWantConnQueue() *wantConnQueue {
return &wantConnQueue{
items: make([]*wantConn, 0),
}
}
func (q *wantConnQueue) enqueue(w *wantConn) {
q.mu.Lock()
defer q.mu.Unlock()
q.items = append(q.items, w)
}
func (q *wantConnQueue) dequeue() (*wantConn, bool) {
q.mu.Lock()
defer q.mu.Unlock()
if len(q.items) == 0 {
return nil, false
}
item := q.items[0]
q.items = q.items[1:]
return item, true
}
func (q *wantConnQueue) discardDoneAtFront() int {
q.mu.Lock()
defer q.mu.Unlock()
count := 0
for len(q.items) > 0 {
if q.items[0].isOngoing() {
break
}
q.items = q.items[1:]
count++
}
return count
}
package proto
import (
"bufio"
"errors"
"fmt"
"io"
"math"
"math/big"
"strconv"
"github.com/redis/go-redis/v9/internal/util"
)
// DefaultBufferSize is the default size for read/write buffers (32 KiB).
const DefaultBufferSize = 32 * 1024
// redis resp protocol data type.
const (
RespStatus = '+' // +<string>\r\n
RespError = '-' // -<string>\r\n
RespString = '$' // $<length>\r\n<bytes>\r\n
RespInt = ':' // :<number>\r\n
RespNil = '_' // _\r\n
RespFloat = ',' // ,<floating-point-number>\r\n (golang float)
RespBool = '#' // true: #t\r\n false: #f\r\n
RespBlobError = '!' // !<length>\r\n<bytes>\r\n
RespVerbatim = '=' // =<length>\r\nFORMAT:<bytes>\r\n
RespBigInt = '(' // (<big number>\r\n
RespArray = '*' // *<len>\r\n... (same as resp2)
RespMap = '%' // %<len>\r\n(key)\r\n(value)\r\n... (golang map)
RespSet = '~' // ~<len>\r\n... (same as Array)
RespAttr = '|' // |<len>\r\n(key)\r\n(value)\r\n... + command reply
RespPush = '>' // ><len>\r\n... (same as Array)
)
// Not used temporarily.
// Redis has not used these two data types for the time being, and will implement them later.
// Streamed = "EOF:"
// StreamedAggregated = '?'
//------------------------------------------------------------------------------
const Nil = RedisError("redis: nil") // nolint:errname
type RedisError string
func (e RedisError) Error() string { return string(e) }
func (RedisError) RedisError() {}
func ParseErrorReply(line []byte) error {
msg := string(line[1:])
return parseTypedRedisError(msg)
}
//------------------------------------------------------------------------------
type Reader struct {
rd *bufio.Reader
}
func NewReader(rd io.Reader) *Reader {
return &Reader{
rd: bufio.NewReaderSize(rd, DefaultBufferSize),
}
}
func NewReaderSize(rd io.Reader, size int) *Reader {
return &Reader{
rd: bufio.NewReaderSize(rd, size),
}
}
func (r *Reader) Buffered() int {
return r.rd.Buffered()
}
func (r *Reader) Peek(n int) ([]byte, error) {
return r.rd.Peek(n)
}
func (r *Reader) Reset(rd io.Reader) {
r.rd.Reset(rd)
}
// PeekReplyType returns the data type of the next response without advancing the Reader,
// and discard the attribute type.
func (r *Reader) PeekReplyType() (byte, error) {
b, err := r.rd.Peek(1)
if err != nil {
return 0, err
}
if b[0] == RespAttr {
if err = r.DiscardNext(); err != nil {
return 0, err
}
return r.PeekReplyType()
}
return b[0], nil
}
func (r *Reader) PeekPushNotificationName() (string, error) {
// "prime" the buffer by peeking at the next byte
c, err := r.Peek(1)
if err != nil {
return "", err
}
if c[0] != RespPush {
return "", fmt.Errorf("redis: can't peek push notification name, next reply is not a push notification")
}
// peek 36 bytes at most, should be enough to read the push notification name
toPeek := 36
buffered := r.Buffered()
if buffered == 0 {
return "", fmt.Errorf("redis: can't peek push notification name, no data available")
}
if buffered < toPeek {
toPeek = buffered
}
buf, err := r.rd.Peek(toPeek)
if err != nil {
return "", err
}
if buf[0] != RespPush {
return "", fmt.Errorf("redis: can't parse push notification: %q", buf)
}
if len(buf) < 3 {
return "", fmt.Errorf("redis: can't parse push notification: %q", buf)
}
// remove push notification type
buf = buf[1:]
// remove first line - e.g. >2\r\n
for i := 0; i < len(buf)-1; i++ {
if buf[i] == '\r' && buf[i+1] == '\n' {
buf = buf[i+2:]
break
} else {
if buf[i] < '0' || buf[i] > '9' {
return "", fmt.Errorf("redis: can't parse push notification: %q", buf)
}
}
}
if len(buf) < 2 {
return "", fmt.Errorf("redis: can't parse push notification: %q", buf)
}
// next line should be $<length><string>\r\n or +<length><string>\r\n
// should have the type of the push notification name and it's length
if buf[0] != RespString && buf[0] != RespStatus {
return "", fmt.Errorf("redis: can't parse push notification name: %q", buf)
}
typeOfName := buf[0]
// remove the type of the push notification name
buf = buf[1:]
if typeOfName == RespString {
// remove the length of the string
if len(buf) < 2 {
return "", fmt.Errorf("redis: can't parse push notification name: %q", buf)
}
for i := 0; i < len(buf)-1; i++ {
if buf[i] == '\r' && buf[i+1] == '\n' {
buf = buf[i+2:]
break
} else {
if buf[i] < '0' || buf[i] > '9' {
return "", fmt.Errorf("redis: can't parse push notification name: %q", buf)
}
}
}
}
if len(buf) < 2 {
return "", fmt.Errorf("redis: can't parse push notification name: %q", buf)
}
// keep only the notification name
for i := 0; i < len(buf)-1; i++ {
if buf[i] == '\r' && buf[i+1] == '\n' {
buf = buf[:i]
break
}
}
return util.BytesToString(buf), nil
}
// ReadLine Return a valid reply, it will check the protocol or redis error,
// and discard the attribute type.
func (r *Reader) ReadLine() ([]byte, error) {
line, err := r.readLine()
if err != nil {
return nil, err
}
switch line[0] {
case RespError:
return nil, ParseErrorReply(line)
case RespNil:
return nil, Nil
case RespBlobError:
var blobErr string
blobErr, err = r.readStringReply(line)
if err == nil {
err = parseTypedRedisError(blobErr)
}
return nil, err
case RespAttr:
if err = r.Discard(line); err != nil {
return nil, err
}
return r.ReadLine()
}
// Compatible with RESP2
if IsNilReply(line) {
return nil, Nil
}
return line, nil
}
// readLine returns an error if:
// - there is a pending read error;
// - or line does not end with \r\n.
func (r *Reader) readLine() ([]byte, error) {
b, err := r.rd.ReadSlice('\n')
if err != nil {
if err != bufio.ErrBufferFull {
return nil, err
}
full := make([]byte, len(b))
copy(full, b)
b, err = r.rd.ReadBytes('\n')
if err != nil {
return nil, err
}
full = append(full, b...) //nolint:makezero
b = full
}
if len(b) <= 2 || b[len(b)-1] != '\n' || b[len(b)-2] != '\r' {
return nil, fmt.Errorf("redis: invalid reply: %q", b)
}
return b[:len(b)-2], nil
}
func (r *Reader) ReadReply() (interface{}, error) {
line, err := r.ReadLine()
if err != nil {
return nil, err
}
switch line[0] {
case RespStatus:
return string(line[1:]), nil
case RespInt:
return util.ParseInt(line[1:], 10, 64)
case RespFloat:
return r.readFloat(line)
case RespBool:
return r.readBool(line)
case RespBigInt:
return r.readBigInt(line)
case RespString:
return r.readStringReply(line)
case RespVerbatim:
return r.readVerb(line)
case RespArray, RespSet, RespPush:
return r.readSlice(line)
case RespMap:
return r.readMap(line)
}
return nil, fmt.Errorf("redis: can't parse %.100q", line)
}
func (r *Reader) readFloat(line []byte) (float64, error) {
v := string(line[1:])
switch string(line[1:]) {
case "inf":
return math.Inf(1), nil
case "-inf":
return math.Inf(-1), nil
case "nan", "-nan":
return math.NaN(), nil
}
return strconv.ParseFloat(v, 64)
}
func (r *Reader) readBool(line []byte) (bool, error) {
switch string(line[1:]) {
case "t":
return true, nil
case "f":
return false, nil
}
return false, fmt.Errorf("redis: can't parse bool reply: %q", line)
}
func (r *Reader) readBigInt(line []byte) (*big.Int, error) {
i := new(big.Int)
if i, ok := i.SetString(string(line[1:]), 10); ok {
return i, nil
}
return nil, fmt.Errorf("redis: can't parse bigInt reply: %q", line)
}
func (r *Reader) readStringReply(line []byte) (string, error) {
n, err := replyLen(line)
if err != nil {
return "", err
}
b := make([]byte, n+2)
_, err = io.ReadFull(r.rd, b)
if err != nil {
return "", err
}
return util.BytesToString(b[:n]), nil
}
func (r *Reader) readVerb(line []byte) (string, error) {
s, err := r.readStringReply(line)
if err != nil {
return "", err
}
if len(s) < 4 || s[3] != ':' {
return "", fmt.Errorf("redis: can't parse verbatim string reply: %q", line)
}
return s[4:], nil
}
func (r *Reader) readSlice(line []byte) ([]interface{}, error) {
n, err := replyLen(line)
if err != nil {
return nil, err
}
val := make([]interface{}, n)
for i := 0; i < len(val); i++ {
v, err := r.ReadReply()
if err != nil {
if err == Nil {
val[i] = nil
continue
}
if err, ok := err.(RedisError); ok {
val[i] = err
continue
}
return nil, err
}
val[i] = v
}
return val, nil
}
func (r *Reader) readMap(line []byte) (map[interface{}]interface{}, error) {
n, err := replyLen(line)
if err != nil {
return nil, err
}
m := make(map[interface{}]interface{}, n)
for i := 0; i < n; i++ {
k, err := r.ReadReply()
if err != nil {
return nil, err
}
v, err := r.ReadReply()
if err != nil {
if err == Nil {
m[k] = nil
continue
}
if err, ok := err.(RedisError); ok {
m[k] = err
continue
}
return nil, err
}
m[k] = v
}
return m, nil
}
// -------------------------------
func (r *Reader) ReadInt() (int64, error) {
line, err := r.ReadLine()
if err != nil {
return 0, err
}
switch line[0] {
case RespInt, RespStatus:
return util.ParseInt(line[1:], 10, 64)
case RespString:
s, err := r.readStringReply(line)
if err != nil {
return 0, err
}
return util.ParseInt([]byte(s), 10, 64)
case RespBigInt:
b, err := r.readBigInt(line)
if err != nil {
return 0, err
}
if !b.IsInt64() {
return 0, fmt.Errorf("bigInt(%s) value out of range", b.String())
}
return b.Int64(), nil
}
return 0, fmt.Errorf("redis: can't parse int reply: %.100q", line)
}
func (r *Reader) ReadUint() (uint64, error) {
line, err := r.ReadLine()
if err != nil {
return 0, err
}
switch line[0] {
case RespInt, RespStatus:
return util.ParseUint(line[1:], 10, 64)
case RespString:
s, err := r.readStringReply(line)
if err != nil {
return 0, err
}
return util.ParseUint([]byte(s), 10, 64)
case RespBigInt:
b, err := r.readBigInt(line)
if err != nil {
return 0, err
}
if !b.IsUint64() {
return 0, fmt.Errorf("bigInt(%s) value out of range", b.String())
}
return b.Uint64(), nil
}
return 0, fmt.Errorf("redis: can't parse uint reply: %.100q", line)
}
func (r *Reader) ReadFloat() (float64, error) {
line, err := r.ReadLine()
if err != nil {
return 0, err
}
switch line[0] {
case RespFloat:
return r.readFloat(line)
case RespStatus:
return strconv.ParseFloat(string(line[1:]), 64)
case RespString:
s, err := r.readStringReply(line)
if err != nil {
return 0, err
}
return strconv.ParseFloat(s, 64)
}
return 0, fmt.Errorf("redis: can't parse float reply: %.100q", line)
}
func (r *Reader) ReadString() (string, error) {
line, err := r.ReadLine()
if err != nil {
return "", err
}
switch line[0] {
case RespStatus, RespInt, RespFloat:
return string(line[1:]), nil
case RespString:
return r.readStringReply(line)
case RespBool:
b, err := r.readBool(line)
return strconv.FormatBool(b), err
case RespVerbatim:
return r.readVerb(line)
case RespBigInt:
b, err := r.readBigInt(line)
if err != nil {
return "", err
}
return b.String(), nil
}
return "", fmt.Errorf("redis: can't parse reply=%.100q reading string", line)
}
func (r *Reader) ReadBool() (bool, error) {
s, err := r.ReadString()
if err != nil {
return false, err
}
return s == "OK" || s == "1" || s == "true", nil
}
func (r *Reader) ReadSlice() ([]interface{}, error) {
line, err := r.ReadLine()
if err != nil {
return nil, err
}
return r.readSlice(line)
}
// ReadFixedArrayLen read fixed array length.
func (r *Reader) ReadFixedArrayLen(fixedLen int) error {
n, err := r.ReadArrayLen()
if err != nil {
return err
}
if n != fixedLen {
return fmt.Errorf("redis: got %d elements in the array, wanted %d", n, fixedLen)
}
return nil
}
// ReadArrayLen Read and return the length of the array.
func (r *Reader) ReadArrayLen() (int, error) {
line, err := r.ReadLine()
if err != nil {
return 0, err
}
switch line[0] {
case RespArray, RespSet, RespPush:
return replyLen(line)
default:
return 0, fmt.Errorf("redis: can't parse array/set/push reply: %.100q", line)
}
}
// ReadFixedMapLen reads fixed map length.
func (r *Reader) ReadFixedMapLen(fixedLen int) error {
n, err := r.ReadMapLen()
if err != nil {
return err
}
if n != fixedLen {
return fmt.Errorf("redis: got %d elements in the map, wanted %d", n, fixedLen)
}
return nil
}
// ReadMapLen reads the length of the map type.
// If responding to the array type (RespArray/RespSet/RespPush),
// it must be a multiple of 2 and return n/2.
// Other types will return an error.
func (r *Reader) ReadMapLen() (int, error) {
line, err := r.ReadLine()
if err != nil {
return 0, err
}
switch line[0] {
case RespMap:
return replyLen(line)
case RespArray, RespSet, RespPush:
// Some commands and RESP2 protocol may respond to array types.
n, err := replyLen(line)
if err != nil {
return 0, err
}
if n%2 != 0 {
return 0, fmt.Errorf("redis: the length of the array must be a multiple of 2, got: %d", n)
}
return n / 2, nil
default:
return 0, fmt.Errorf("redis: can't parse map reply: %.100q", line)
}
}
// DiscardNext read and discard the data represented by the next line.
func (r *Reader) DiscardNext() error {
line, err := r.readLine()
if err != nil {
return err
}
return r.Discard(line)
}
// Discard the data represented by line.
func (r *Reader) Discard(line []byte) (err error) {
if len(line) == 0 {
return errors.New("redis: invalid line")
}
switch line[0] {
case RespStatus, RespError, RespInt, RespNil, RespFloat, RespBool, RespBigInt:
return nil
}
n, err := replyLen(line)
if err != nil && err != Nil {
return err
}
switch line[0] {
case RespBlobError, RespString, RespVerbatim:
// +\r\n
_, err = r.rd.Discard(n + 2)
return err
case RespArray, RespSet, RespPush:
for i := 0; i < n; i++ {
if err = r.DiscardNext(); err != nil {
return err
}
}
return nil
case RespMap, RespAttr:
// Read key & value.
for i := 0; i < n*2; i++ {
if err = r.DiscardNext(); err != nil {
return err
}
}
return nil
}
return fmt.Errorf("redis: can't parse %.100q", line)
}
func replyLen(line []byte) (n int, err error) {
n, err = util.Atoi(line[1:])
if err != nil {
return 0, err
}
if n < -1 {
return 0, fmt.Errorf("redis: invalid reply: %q", line)
}
switch line[0] {
case RespString, RespVerbatim, RespBlobError,
RespArray, RespSet, RespPush, RespMap, RespAttr:
if n == -1 {
return 0, Nil
}
}
return n, nil
}
// IsNilReply detects redis.Nil of RESP2.
func IsNilReply(line []byte) bool {
return len(line) == 3 &&
(line[0] == RespString || line[0] == RespArray) &&
line[1] == '-' && line[2] == '1'
}
package proto
import (
"errors"
"strings"
)
// Typed Redis errors for better error handling with wrapping support.
// These errors maintain backward compatibility by keeping the same error messages.
// LoadingError is returned when Redis is loading the dataset in memory.
type LoadingError struct {
msg string
}
func (e *LoadingError) Error() string {
return e.msg
}
func (e *LoadingError) RedisError() {}
// NewLoadingError creates a new LoadingError with the given message.
func NewLoadingError(msg string) *LoadingError {
return &LoadingError{msg: msg}
}
// ReadOnlyError is returned when trying to write to a read-only replica.
type ReadOnlyError struct {
msg string
}
func (e *ReadOnlyError) Error() string {
return e.msg
}
func (e *ReadOnlyError) RedisError() {}
// NewReadOnlyError creates a new ReadOnlyError with the given message.
func NewReadOnlyError(msg string) *ReadOnlyError {
return &ReadOnlyError{msg: msg}
}
// MovedError is returned when a key has been moved to a different node in a cluster.
type MovedError struct {
msg string
addr string
}
func (e *MovedError) Error() string {
return e.msg
}
func (e *MovedError) RedisError() {}
// Addr returns the address of the node where the key has been moved.
func (e *MovedError) Addr() string {
return e.addr
}
// NewMovedError creates a new MovedError with the given message and address.
func NewMovedError(msg string, addr string) *MovedError {
return &MovedError{msg: msg, addr: addr}
}
// AskError is returned when a key is being migrated and the client should ask another node.
type AskError struct {
msg string
addr string
}
func (e *AskError) Error() string {
return e.msg
}
func (e *AskError) RedisError() {}
// Addr returns the address of the node to ask.
func (e *AskError) Addr() string {
return e.addr
}
// NewAskError creates a new AskError with the given message and address.
func NewAskError(msg string, addr string) *AskError {
return &AskError{msg: msg, addr: addr}
}
// ClusterDownError is returned when the cluster is down.
type ClusterDownError struct {
msg string
}
func (e *ClusterDownError) Error() string {
return e.msg
}
func (e *ClusterDownError) RedisError() {}
// NewClusterDownError creates a new ClusterDownError with the given message.
func NewClusterDownError(msg string) *ClusterDownError {
return &ClusterDownError{msg: msg}
}
// TryAgainError is returned when a command cannot be processed and should be retried.
type TryAgainError struct {
msg string
}
func (e *TryAgainError) Error() string {
return e.msg
}
func (e *TryAgainError) RedisError() {}
// NewTryAgainError creates a new TryAgainError with the given message.
func NewTryAgainError(msg string) *TryAgainError {
return &TryAgainError{msg: msg}
}
// MasterDownError is returned when the master is down.
type MasterDownError struct {
msg string
}
func (e *MasterDownError) Error() string {
return e.msg
}
func (e *MasterDownError) RedisError() {}
// NewMasterDownError creates a new MasterDownError with the given message.
func NewMasterDownError(msg string) *MasterDownError {
return &MasterDownError{msg: msg}
}
// MaxClientsError is returned when the maximum number of clients has been reached.
type MaxClientsError struct {
msg string
}
func (e *MaxClientsError) Error() string {
return e.msg
}
func (e *MaxClientsError) RedisError() {}
// NewMaxClientsError creates a new MaxClientsError with the given message.
func NewMaxClientsError(msg string) *MaxClientsError {
return &MaxClientsError{msg: msg}
}
// AuthError is returned when authentication fails.
type AuthError struct {
msg string
}
func (e *AuthError) Error() string {
return e.msg
}
func (e *AuthError) RedisError() {}
// NewAuthError creates a new AuthError with the given message.
func NewAuthError(msg string) *AuthError {
return &AuthError{msg: msg}
}
// PermissionError is returned when a user lacks required permissions.
type PermissionError struct {
msg string
}
func (e *PermissionError) Error() string {
return e.msg
}
func (e *PermissionError) RedisError() {}
// NewPermissionError creates a new PermissionError with the given message.
func NewPermissionError(msg string) *PermissionError {
return &PermissionError{msg: msg}
}
// ExecAbortError is returned when a transaction is aborted.
type ExecAbortError struct {
msg string
}
func (e *ExecAbortError) Error() string {
return e.msg
}
func (e *ExecAbortError) RedisError() {}
// NewExecAbortError creates a new ExecAbortError with the given message.
func NewExecAbortError(msg string) *ExecAbortError {
return &ExecAbortError{msg: msg}
}
// OOMError is returned when Redis is out of memory.
type OOMError struct {
msg string
}
func (e *OOMError) Error() string {
return e.msg
}
func (e *OOMError) RedisError() {}
// NewOOMError creates a new OOMError with the given message.
func NewOOMError(msg string) *OOMError {
return &OOMError{msg: msg}
}
// NoReplicasError is returned when not enough replicas acknowledge a write.
// This error occurs when using WAIT/WAITAOF commands or CLUSTER SETSLOT with
// synchronous replication, and the required number of replicas cannot confirm
// the write within the timeout period.
type NoReplicasError struct {
msg string
}
func (e *NoReplicasError) Error() string {
return e.msg
}
func (e *NoReplicasError) RedisError() {}
// NewNoReplicasError creates a new NoReplicasError with the given message.
func NewNoReplicasError(msg string) *NoReplicasError {
return &NoReplicasError{msg: msg}
}
// parseTypedRedisError parses a Redis error message and returns a typed error if applicable.
// This function maintains backward compatibility by keeping the same error messages.
func parseTypedRedisError(msg string) error {
// Check for specific error patterns and return typed errors
switch {
case strings.HasPrefix(msg, "LOADING "):
return NewLoadingError(msg)
case strings.HasPrefix(msg, "READONLY "):
return NewReadOnlyError(msg)
case strings.HasPrefix(msg, "MOVED "):
// Extract address from "MOVED <slot> <addr>"
addr := extractAddr(msg)
return NewMovedError(msg, addr)
case strings.HasPrefix(msg, "ASK "):
// Extract address from "ASK <slot> <addr>"
addr := extractAddr(msg)
return NewAskError(msg, addr)
case strings.HasPrefix(msg, "CLUSTERDOWN "):
return NewClusterDownError(msg)
case strings.HasPrefix(msg, "TRYAGAIN "):
return NewTryAgainError(msg)
case strings.HasPrefix(msg, "MASTERDOWN "):
return NewMasterDownError(msg)
case strings.HasPrefix(msg, "NOREPLICAS "):
return NewNoReplicasError(msg)
case msg == "ERR max number of clients reached":
return NewMaxClientsError(msg)
case strings.HasPrefix(msg, "NOAUTH "), strings.HasPrefix(msg, "WRONGPASS "), strings.Contains(msg, "unauthenticated"):
return NewAuthError(msg)
case strings.HasPrefix(msg, "NOPERM "):
return NewPermissionError(msg)
case strings.HasPrefix(msg, "EXECABORT "):
return NewExecAbortError(msg)
case strings.HasPrefix(msg, "OOM "):
return NewOOMError(msg)
default:
// Return generic RedisError for unknown error types
return RedisError(msg)
}
}
// extractAddr extracts the address from MOVED/ASK error messages.
// Format: "MOVED <slot> <addr>" or "ASK <slot> <addr>"
func extractAddr(msg string) string {
ind := strings.LastIndex(msg, " ")
if ind == -1 {
return ""
}
return msg[ind+1:]
}
// IsLoadingError checks if an error is a LoadingError, even if wrapped.
func IsLoadingError(err error) bool {
if err == nil {
return false
}
var loadingErr *LoadingError
if errors.As(err, &loadingErr) {
return true
}
// Check if wrapped error is a RedisError with LOADING prefix
var redisErr RedisError
if errors.As(err, &redisErr) && strings.HasPrefix(redisErr.Error(), "LOADING ") {
return true
}
// Fallback to string checking for backward compatibility
return strings.HasPrefix(err.Error(), "LOADING ")
}
// IsReadOnlyError checks if an error is a ReadOnlyError, even if wrapped.
func IsReadOnlyError(err error) bool {
if err == nil {
return false
}
var readOnlyErr *ReadOnlyError
if errors.As(err, &readOnlyErr) {
return true
}
// Check if wrapped error is a RedisError with READONLY prefix
var redisErr RedisError
if errors.As(err, &redisErr) && strings.HasPrefix(redisErr.Error(), "READONLY ") {
return true
}
// Fallback to string checking for backward compatibility
return strings.HasPrefix(err.Error(), "READONLY ")
}
// IsMovedError checks if an error is a MovedError, even if wrapped.
// Returns the error and a boolean indicating if it's a MovedError.
func IsMovedError(err error) (*MovedError, bool) {
if err == nil {
return nil, false
}
var movedErr *MovedError
if errors.As(err, &movedErr) {
return movedErr, true
}
// Fallback to string checking for backward compatibility
s := err.Error()
if strings.HasPrefix(s, "MOVED ") {
// Parse: MOVED 3999 127.0.0.1:6381
parts := strings.Split(s, " ")
if len(parts) == 3 {
return &MovedError{msg: s, addr: parts[2]}, true
}
}
return nil, false
}
// IsAskError checks if an error is an AskError, even if wrapped.
// Returns the error and a boolean indicating if it's an AskError.
func IsAskError(err error) (*AskError, bool) {
if err == nil {
return nil, false
}
var askErr *AskError
if errors.As(err, &askErr) {
return askErr, true
}
// Fallback to string checking for backward compatibility
s := err.Error()
if strings.HasPrefix(s, "ASK ") {
// Parse: ASK 3999 127.0.0.1:6381
parts := strings.Split(s, " ")
if len(parts) == 3 {
return &AskError{msg: s, addr: parts[2]}, true
}
}
return nil, false
}
// IsClusterDownError checks if an error is a ClusterDownError, even if wrapped.
func IsClusterDownError(err error) bool {
if err == nil {
return false
}
var clusterDownErr *ClusterDownError
if errors.As(err, &clusterDownErr) {
return true
}
// Check if wrapped error is a RedisError with CLUSTERDOWN prefix
var redisErr RedisError
if errors.As(err, &redisErr) && strings.HasPrefix(redisErr.Error(), "CLUSTERDOWN ") {
return true
}
// Fallback to string checking for backward compatibility
return strings.HasPrefix(err.Error(), "CLUSTERDOWN ")
}
// IsTryAgainError checks if an error is a TryAgainError, even if wrapped.
func IsTryAgainError(err error) bool {
if err == nil {
return false
}
var tryAgainErr *TryAgainError
if errors.As(err, &tryAgainErr) {
return true
}
// Check if wrapped error is a RedisError with TRYAGAIN prefix
var redisErr RedisError
if errors.As(err, &redisErr) && strings.HasPrefix(redisErr.Error(), "TRYAGAIN ") {
return true
}
// Fallback to string checking for backward compatibility
return strings.HasPrefix(err.Error(), "TRYAGAIN ")
}
// IsMasterDownError checks if an error is a MasterDownError, even if wrapped.
func IsMasterDownError(err error) bool {
if err == nil {
return false
}
var masterDownErr *MasterDownError
if errors.As(err, &masterDownErr) {
return true
}
// Check if wrapped error is a RedisError with MASTERDOWN prefix
var redisErr RedisError
if errors.As(err, &redisErr) && strings.HasPrefix(redisErr.Error(), "MASTERDOWN ") {
return true
}
// Fallback to string checking for backward compatibility
return strings.HasPrefix(err.Error(), "MASTERDOWN ")
}
// IsMaxClientsError checks if an error is a MaxClientsError, even if wrapped.
func IsMaxClientsError(err error) bool {
if err == nil {
return false
}
var maxClientsErr *MaxClientsError
if errors.As(err, &maxClientsErr) {
return true
}
// Check if wrapped error is a RedisError with max clients prefix
var redisErr RedisError
if errors.As(err, &redisErr) && strings.HasPrefix(redisErr.Error(), "ERR max number of clients reached") {
return true
}
// Fallback to string checking for backward compatibility
return strings.HasPrefix(err.Error(), "ERR max number of clients reached")
}
// IsAuthError checks if an error is an AuthError, even if wrapped.
func IsAuthError(err error) bool {
if err == nil {
return false
}
var authErr *AuthError
if errors.As(err, &authErr) {
return true
}
// Check if wrapped error is a RedisError with auth error prefix
var redisErr RedisError
if errors.As(err, &redisErr) {
s := redisErr.Error()
return strings.HasPrefix(s, "NOAUTH ") || strings.HasPrefix(s, "WRONGPASS ") || strings.Contains(s, "unauthenticated")
}
// Fallback to string checking for backward compatibility
s := err.Error()
return strings.HasPrefix(s, "NOAUTH ") || strings.HasPrefix(s, "WRONGPASS ") || strings.Contains(s, "unauthenticated")
}
// IsPermissionError checks if an error is a PermissionError, even if wrapped.
func IsPermissionError(err error) bool {
if err == nil {
return false
}
var permErr *PermissionError
if errors.As(err, &permErr) {
return true
}
// Check if wrapped error is a RedisError with NOPERM prefix
var redisErr RedisError
if errors.As(err, &redisErr) && strings.HasPrefix(redisErr.Error(), "NOPERM ") {
return true
}
// Fallback to string checking for backward compatibility
return strings.HasPrefix(err.Error(), "NOPERM ")
}
// IsExecAbortError checks if an error is an ExecAbortError, even if wrapped.
func IsExecAbortError(err error) bool {
if err == nil {
return false
}
var execAbortErr *ExecAbortError
if errors.As(err, &execAbortErr) {
return true
}
// Check if wrapped error is a RedisError with EXECABORT prefix
var redisErr RedisError
if errors.As(err, &redisErr) && strings.HasPrefix(redisErr.Error(), "EXECABORT ") {
return true
}
// Fallback to string checking for backward compatibility
return strings.HasPrefix(err.Error(), "EXECABORT ")
}
// IsOOMError checks if an error is an OOMError, even if wrapped.
func IsOOMError(err error) bool {
if err == nil {
return false
}
var oomErr *OOMError
if errors.As(err, &oomErr) {
return true
}
// Check if wrapped error is a RedisError with OOM prefix
var redisErr RedisError
if errors.As(err, &redisErr) && strings.HasPrefix(redisErr.Error(), "OOM ") {
return true
}
// Fallback to string checking for backward compatibility
return strings.HasPrefix(err.Error(), "OOM ")
}
// IsNoReplicasError checks if an error is a NoReplicasError, even if wrapped.
func IsNoReplicasError(err error) bool {
if err == nil {
return false
}
var noReplicasErr *NoReplicasError
if errors.As(err, &noReplicasErr) {
return true
}
// Check if wrapped error is a RedisError with NOREPLICAS prefix
var redisErr RedisError
if errors.As(err, &redisErr) && strings.HasPrefix(redisErr.Error(), "NOREPLICAS ") {
return true
}
// Fallback to string checking for backward compatibility
return strings.HasPrefix(err.Error(), "NOREPLICAS ")
}
package proto
import (
"encoding"
"fmt"
"net"
"reflect"
"time"
"github.com/redis/go-redis/v9/internal/util"
)
// Scan parses bytes `b` to `v` with appropriate type.
//
//nolint:gocyclo
func Scan(b []byte, v interface{}) error {
switch v := v.(type) {
case nil:
return fmt.Errorf("redis: Scan(nil)")
case *string:
*v = util.BytesToString(b)
return nil
case *[]byte:
*v = b
return nil
case *int:
var err error
*v, err = util.Atoi(b)
return err
case *int8:
n, err := util.ParseInt(b, 10, 8)
if err != nil {
return err
}
*v = int8(n)
return nil
case *int16:
n, err := util.ParseInt(b, 10, 16)
if err != nil {
return err
}
*v = int16(n)
return nil
case *int32:
n, err := util.ParseInt(b, 10, 32)
if err != nil {
return err
}
*v = int32(n)
return nil
case *int64:
n, err := util.ParseInt(b, 10, 64)
if err != nil {
return err
}
*v = n
return nil
case *uint:
n, err := util.ParseUint(b, 10, 64)
if err != nil {
return err
}
*v = uint(n)
return nil
case *uint8:
n, err := util.ParseUint(b, 10, 8)
if err != nil {
return err
}
*v = uint8(n)
return nil
case *uint16:
n, err := util.ParseUint(b, 10, 16)
if err != nil {
return err
}
*v = uint16(n)
return nil
case *uint32:
n, err := util.ParseUint(b, 10, 32)
if err != nil {
return err
}
*v = uint32(n)
return nil
case *uint64:
n, err := util.ParseUint(b, 10, 64)
if err != nil {
return err
}
*v = n
return nil
case *float32:
n, err := util.ParseFloat(b, 32)
if err != nil {
return err
}
*v = float32(n)
return err
case *float64:
var err error
*v, err = util.ParseFloat(b, 64)
return err
case *bool:
*v = len(b) == 1 && b[0] == '1'
return nil
case *time.Time:
var err error
*v, err = time.Parse(time.RFC3339Nano, util.BytesToString(b))
return err
case *time.Duration:
n, err := util.ParseInt(b, 10, 64)
if err != nil {
return err
}
*v = time.Duration(n)
return nil
case encoding.BinaryUnmarshaler:
return v.UnmarshalBinary(b)
case *net.IP:
*v = b
return nil
default:
return fmt.Errorf(
"redis: can't unmarshal %T (consider implementing BinaryUnmarshaler)", v)
}
}
func ScanSlice(data []string, slice interface{}) error {
v := reflect.ValueOf(slice)
if !v.IsValid() {
return fmt.Errorf("redis: ScanSlice(nil)")
}
if v.Kind() != reflect.Ptr {
return fmt.Errorf("redis: ScanSlice(non-pointer %T)", slice)
}
v = v.Elem()
if v.Kind() != reflect.Slice {
return fmt.Errorf("redis: ScanSlice(non-slice %T)", slice)
}
next := makeSliceNextElemFunc(v)
for i, s := range data {
elem := next()
if err := Scan([]byte(s), elem.Addr().Interface()); err != nil {
err = fmt.Errorf("redis: ScanSlice index=%d value=%q failed: %w", i, s, err)
return err
}
}
return nil
}
func makeSliceNextElemFunc(v reflect.Value) func() reflect.Value {
elemType := v.Type().Elem()
if elemType.Kind() == reflect.Ptr {
elemType = elemType.Elem()
return func() reflect.Value {
if v.Len() < v.Cap() {
v.Set(v.Slice(0, v.Len()+1))
elem := v.Index(v.Len() - 1)
if elem.IsNil() {
elem.Set(reflect.New(elemType))
}
return elem.Elem()
}
elem := reflect.New(elemType)
v.Set(reflect.Append(v, elem))
return elem.Elem()
}
}
zero := reflect.Zero(elemType)
return func() reflect.Value {
if v.Len() < v.Cap() {
v.Set(v.Slice(0, v.Len()+1))
return v.Index(v.Len() - 1)
}
v.Set(reflect.Append(v, zero))
return v.Index(v.Len() - 1)
}
}
package proto
import (
"encoding"
"fmt"
"io"
"net"
"strconv"
"time"
"github.com/redis/go-redis/v9/internal/util"
)
type writer interface {
io.Writer
io.ByteWriter
// WriteString implement io.StringWriter.
WriteString(s string) (n int, err error)
}
type Writer struct {
writer
lenBuf []byte
numBuf []byte
}
func NewWriter(wr writer) *Writer {
return &Writer{
writer: wr,
lenBuf: make([]byte, 64),
numBuf: make([]byte, 64),
}
}
func (w *Writer) WriteArgs(args []interface{}) error {
if err := w.WriteByte(RespArray); err != nil {
return err
}
if err := w.writeLen(len(args)); err != nil {
return err
}
for _, arg := range args {
if err := w.WriteArg(arg); err != nil {
return err
}
}
return nil
}
func (w *Writer) writeLen(n int) error {
w.lenBuf = strconv.AppendUint(w.lenBuf[:0], uint64(n), 10)
w.lenBuf = append(w.lenBuf, '\r', '\n')
_, err := w.Write(w.lenBuf)
return err
}
func (w *Writer) WriteArg(v interface{}) error {
switch v := v.(type) {
case nil:
return w.string("")
case string:
return w.string(v)
case *string:
if v == nil {
return w.string("")
}
return w.string(*v)
case []byte:
return w.bytes(v)
case int:
return w.int(int64(v))
case *int:
if v == nil {
return w.int(0)
}
return w.int(int64(*v))
case int8:
return w.int(int64(v))
case *int8:
if v == nil {
return w.int(0)
}
return w.int(int64(*v))
case int16:
return w.int(int64(v))
case *int16:
if v == nil {
return w.int(0)
}
return w.int(int64(*v))
case int32:
return w.int(int64(v))
case *int32:
if v == nil {
return w.int(0)
}
return w.int(int64(*v))
case int64:
return w.int(v)
case *int64:
if v == nil {
return w.int(0)
}
return w.int(*v)
case uint:
return w.uint(uint64(v))
case *uint:
if v == nil {
return w.uint(0)
}
return w.uint(uint64(*v))
case uint8:
return w.uint(uint64(v))
case *uint8:
if v == nil {
return w.string("")
}
return w.uint(uint64(*v))
case uint16:
return w.uint(uint64(v))
case *uint16:
if v == nil {
return w.uint(0)
}
return w.uint(uint64(*v))
case uint32:
return w.uint(uint64(v))
case *uint32:
if v == nil {
return w.uint(0)
}
return w.uint(uint64(*v))
case uint64:
return w.uint(v)
case *uint64:
if v == nil {
return w.uint(0)
}
return w.uint(*v)
case float32:
return w.float(float64(v))
case *float32:
if v == nil {
return w.float(0)
}
return w.float(float64(*v))
case float64:
return w.float(v)
case *float64:
if v == nil {
return w.float(0)
}
return w.float(*v)
case bool:
if v {
return w.int(1)
}
return w.int(0)
case *bool:
if v == nil {
return w.int(0)
}
if *v {
return w.int(1)
}
return w.int(0)
case time.Time:
w.numBuf = v.AppendFormat(w.numBuf[:0], time.RFC3339Nano)
return w.bytes(w.numBuf)
case *time.Time:
if v == nil {
v = &time.Time{}
}
w.numBuf = v.AppendFormat(w.numBuf[:0], time.RFC3339Nano)
return w.bytes(w.numBuf)
case time.Duration:
return w.int(v.Nanoseconds())
case *time.Duration:
if v == nil {
return w.int(0)
}
return w.int(v.Nanoseconds())
case encoding.BinaryMarshaler:
b, err := v.MarshalBinary()
if err != nil {
return err
}
return w.bytes(b)
case net.IP:
return w.bytes(v)
default:
return fmt.Errorf(
"redis: can't marshal %T (implement encoding.BinaryMarshaler)", v)
}
}
func (w *Writer) bytes(b []byte) error {
if err := w.WriteByte(RespString); err != nil {
return err
}
if err := w.writeLen(len(b)); err != nil {
return err
}
if _, err := w.Write(b); err != nil {
return err
}
return w.crlf()
}
func (w *Writer) string(s string) error {
return w.bytes(util.StringToBytes(s))
}
func (w *Writer) uint(n uint64) error {
w.numBuf = strconv.AppendUint(w.numBuf[:0], n, 10)
return w.bytes(w.numBuf)
}
func (w *Writer) int(n int64) error {
w.numBuf = strconv.AppendInt(w.numBuf[:0], n, 10)
return w.bytes(w.numBuf)
}
func (w *Writer) float(f float64) error {
w.numBuf = strconv.AppendFloat(w.numBuf[:0], f, 'f', -1, 64)
return w.bytes(w.numBuf)
}
func (w *Writer) crlf() error {
if err := w.WriteByte('\r'); err != nil {
return err
}
return w.WriteByte('\n')
}
package rand
import (
"math/rand"
"sync"
)
// Int returns a non-negative pseudo-random int.
func Int() int { return pseudo.Int() }
// Intn returns, as an int, a non-negative pseudo-random number in [0,n).
// It panics if n <= 0.
func Intn(n int) int { return pseudo.Intn(n) }
// Int63n returns, as an int64, a non-negative pseudo-random number in [0,n).
// It panics if n <= 0.
func Int63n(n int64) int64 { return pseudo.Int63n(n) }
// Perm returns, as a slice of n ints, a pseudo-random permutation of the integers [0,n).
func Perm(n int) []int { return pseudo.Perm(n) }
// Seed uses the provided seed value to initialize the default Source to a
// deterministic state. If Seed is not called, the generator behaves as if
// seeded by Seed(1).
func Seed(n int64) { pseudo.Seed(n) }
var pseudo = rand.New(&source{src: rand.NewSource(1)})
type source struct {
src rand.Source
mu sync.Mutex
}
func (s *source) Int63() int64 {
s.mu.Lock()
n := s.src.Int63()
s.mu.Unlock()
return n
}
func (s *source) Seed(seed int64) {
s.mu.Lock()
s.src.Seed(seed)
s.mu.Unlock()
}
// Shuffle pseudo-randomizes the order of elements.
// n is the number of elements.
// swap swaps the elements with indexes i and j.
func Shuffle(n int, swap func(i, j int)) { pseudo.Shuffle(n, swap) }
package routing
import (
"errors"
"fmt"
"math"
"sync"
"sync/atomic"
"github.com/redis/go-redis/v9/internal/util"
uberAtomic "go.uber.org/atomic"
)
var (
ErrMaxAggregation = errors.New("redis: no valid results to aggregate for max operation")
ErrMinAggregation = errors.New("redis: no valid results to aggregate for min operation")
ErrAndAggregation = errors.New("redis: no valid results to aggregate for logical AND operation")
ErrOrAggregation = errors.New("redis: no valid results to aggregate for logical OR operation")
)
// ResponseAggregator defines the interface for aggregating responses from multiple shards.
type ResponseAggregator interface {
// Add processes a single shard response.
Add(result interface{}, err error) error
// AddWithKey processes a single shard response for a specific key (used by keyed aggregators).
AddWithKey(key string, result interface{}, err error) error
BatchAdd(map[string]AggregatorResErr) error
BatchSlice([]AggregatorResErr) error
// Result returns the final aggregated result and any error.
Result() (interface{}, error)
}
type AggregatorResErr struct {
Result interface{}
Err error
}
// NewResponseAggregator creates an aggregator based on the response policy.
func NewResponseAggregator(policy ResponsePolicy, cmdName string) ResponseAggregator {
switch policy {
case RespDefaultKeyless:
return &DefaultKeylessAggregator{results: make([]interface{}, 0)}
case RespDefaultHashSlot:
return &DefaultKeyedAggregator{results: make(map[string]interface{})}
case RespAllSucceeded:
return &AllSucceededAggregator{}
case RespOneSucceeded:
return &OneSucceededAggregator{}
case RespAggSum:
return &AggSumAggregator{
// res:
}
case RespAggMin:
return &AggMinAggregator{
res: util.NewAtomicMin(),
}
case RespAggMax:
return &AggMaxAggregator{
res: util.NewAtomicMax(),
}
case RespAggLogicalAnd:
andAgg := &AggLogicalAndAggregator{}
andAgg.res.Store(true)
return andAgg
case RespAggLogicalOr:
return &AggLogicalOrAggregator{}
case RespSpecial:
return NewSpecialAggregator(cmdName)
default:
return &AllSucceededAggregator{}
}
}
func NewDefaultAggregator(isKeyed bool) ResponseAggregator {
if isKeyed {
return &DefaultKeyedAggregator{
results: make(map[string]interface{}),
}
}
return &DefaultKeylessAggregator{}
}
// AllSucceededAggregator returns one non-error reply if every shard succeeded,
// propagates the first error otherwise.
type AllSucceededAggregator struct {
err atomic.Value
res atomic.Value
}
func (a *AllSucceededAggregator) Add(result interface{}, err error) error {
if err != nil {
a.err.CompareAndSwap(nil, err)
return nil
}
if result != nil {
a.res.CompareAndSwap(nil, result)
}
return nil
}
func (a *AllSucceededAggregator) BatchAdd(results map[string]AggregatorResErr) error {
for _, res := range results {
err := a.Add(res.Result, res.Err)
if err != nil {
return err
}
if res.Err != nil {
return nil
}
}
return nil
}
func (a *AllSucceededAggregator) BatchSlice(results []AggregatorResErr) error {
for _, res := range results {
err := a.Add(res.Result, res.Err)
if err != nil {
return err
}
if res.Err != nil {
return nil
}
}
return nil
}
func (a *AllSucceededAggregator) Result() (interface{}, error) {
var err error
res, e := a.res.Load(), a.err.Load()
if e != nil {
err = e.(error)
}
return res, err
}
func (a *AllSucceededAggregator) AddWithKey(key string, result interface{}, err error) error {
return a.Add(result, err)
}
// OneSucceededAggregator returns the first non-error reply,
// if all shards errored, returns any one of those errors.
type OneSucceededAggregator struct {
err atomic.Value
res atomic.Value
}
func (a *OneSucceededAggregator) Add(result interface{}, err error) error {
if err != nil {
a.err.CompareAndSwap(nil, err)
return nil
}
if result != nil {
a.res.CompareAndSwap(nil, result)
}
return nil
}
func (a *OneSucceededAggregator) BatchAdd(results map[string]AggregatorResErr) error {
for _, res := range results {
err := a.Add(res.Result, res.Err)
if err != nil {
return err
}
if res.Err == nil {
return nil
}
}
return nil
}
func (a *OneSucceededAggregator) AddWithKey(key string, result interface{}, err error) error {
return a.Add(result, err)
}
func (a *OneSucceededAggregator) BatchSlice(results []AggregatorResErr) error {
for _, res := range results {
err := a.Add(res.Result, res.Err)
if err != nil {
return err
}
if res.Err == nil {
return nil
}
}
return nil
}
func (a *OneSucceededAggregator) Result() (interface{}, error) {
res, e := a.res.Load(), a.err.Load()
if res == nil {
return nil, e.(error)
}
return res, nil
}
// AggSumAggregator sums numeric replies from all shards.
type AggSumAggregator struct {
err atomic.Value
res uberAtomic.Float64
}
func (a *AggSumAggregator) Add(result interface{}, err error) error {
if err != nil {
a.err.CompareAndSwap(nil, err)
}
if result != nil {
val, err := toFloat64(result)
if err != nil {
a.err.CompareAndSwap(nil, err)
return err
}
a.res.Add(val)
}
return nil
}
func (a *AggSumAggregator) BatchAdd(results map[string]AggregatorResErr) error {
var sum int64
for _, res := range results {
if res.Err != nil {
return a.Add(res.Result, res.Err)
}
intRes, err := toInt64(res.Result)
if err != nil {
return a.Add(nil, err)
}
sum += intRes
}
return a.Add(sum, nil)
}
func (a *AggSumAggregator) AddWithKey(key string, result interface{}, err error) error {
return a.Add(result, err)
}
func (a *AggSumAggregator) BatchSlice(results []AggregatorResErr) error {
var sum int64
for _, res := range results {
if res.Err != nil {
return a.Add(res.Result, res.Err)
}
intRes, err := toInt64(res.Result)
if err != nil {
return a.Add(nil, err)
}
sum += intRes
}
return a.Add(sum, nil)
}
func (a *AggSumAggregator) Result() (interface{}, error) {
res, err := a.res.Load(), a.err.Load()
if err != nil {
return nil, err.(error)
}
return res, nil
}
// AggMinAggregator returns the minimum numeric value from all shards.
type AggMinAggregator struct {
err atomic.Value
res *util.AtomicMin
}
func (a *AggMinAggregator) Add(result interface{}, err error) error {
if err != nil {
a.err.CompareAndSwap(nil, err)
return nil
}
floatVal, e := toFloat64(result)
if e != nil {
a.err.CompareAndSwap(nil, err)
return nil
}
a.res.Value(floatVal)
return nil
}
func (a *AggMinAggregator) BatchAdd(results map[string]AggregatorResErr) error {
min := int64(math.MaxInt64)
for _, res := range results {
if res.Err != nil {
_ = a.Add(nil, res.Err)
return nil
}
resInt, err := toInt64(res.Result)
if err != nil {
_ = a.Add(nil, res.Err)
return nil
}
if resInt < min {
min = resInt
}
}
return a.Add(min, nil)
}
func (a *AggMinAggregator) AddWithKey(key string, result interface{}, err error) error {
return a.Add(result, err)
}
func (a *AggMinAggregator) BatchSlice(results []AggregatorResErr) error {
min := float64(math.MaxFloat64)
for _, res := range results {
if res.Err != nil {
_ = a.Add(nil, res.Err)
return nil
}
floatVal, err := toFloat64(res.Result)
if err != nil {
_ = a.Add(nil, res.Err)
return nil
}
if floatVal < min {
min = floatVal
}
}
return a.Add(min, nil)
}
func (a *AggMinAggregator) Result() (interface{}, error) {
err := a.err.Load()
if err != nil {
return nil, err.(error)
}
val, hasVal := a.res.Min()
if !hasVal {
return nil, ErrMinAggregation
}
return val, nil
}
// AggMaxAggregator returns the maximum numeric value from all shards.
type AggMaxAggregator struct {
err atomic.Value
res *util.AtomicMax
}
func (a *AggMaxAggregator) Add(result interface{}, err error) error {
if err != nil {
a.err.CompareAndSwap(nil, err)
return nil
}
floatVal, e := toFloat64(result)
if e != nil {
a.err.CompareAndSwap(nil, err)
return nil
}
a.res.Value(floatVal)
return nil
}
func (a *AggMaxAggregator) BatchAdd(results map[string]AggregatorResErr) error {
max := int64(math.MinInt64)
for _, res := range results {
if res.Err != nil {
_ = a.Add(nil, res.Err)
return nil
}
resInt, err := toInt64(res.Result)
if err != nil {
_ = a.Add(nil, res.Err)
return nil
}
if resInt > max {
max = resInt
}
}
return a.Add(max, nil)
}
func (a *AggMaxAggregator) AddWithKey(key string, result interface{}, err error) error {
return a.Add(result, err)
}
func (a *AggMaxAggregator) BatchSlice(results []AggregatorResErr) error {
max := int64(math.MinInt64)
for _, res := range results {
if res.Err != nil {
_ = a.Add(nil, res.Err)
return nil
}
resInt, err := toInt64(res.Result)
if err != nil {
_ = a.Add(nil, res.Err)
return nil
}
if resInt > max {
max = resInt
}
}
return a.Add(max, nil)
}
func (a *AggMaxAggregator) Result() (interface{}, error) {
err := a.err.Load()
if err != nil {
return nil, err.(error)
}
val, hasVal := a.res.Max()
if !hasVal {
return nil, ErrMaxAggregation
}
return val, nil
}
// AggLogicalAndAggregator performs logical AND on boolean values.
type AggLogicalAndAggregator struct {
err atomic.Value
res atomic.Bool
hasResult atomic.Bool
}
func (a *AggLogicalAndAggregator) Add(result interface{}, err error) error {
if err != nil {
a.err.CompareAndSwap(nil, err)
return nil
}
val, e := toBool(result)
if e != nil {
a.err.CompareAndSwap(nil, e)
return e
}
// Atomic AND operation: if val is false, result is always false
if !val {
a.res.Store(false)
}
a.hasResult.Store(true)
return nil
}
func (a *AggLogicalAndAggregator) BatchAdd(results map[string]AggregatorResErr) error {
result := true
for _, res := range results {
if res.Err != nil {
return a.Add(nil, res.Err)
}
boolRes, err := toBool(res.Result)
if err != nil {
return a.Add(nil, err)
}
result = result && boolRes
}
return a.Add(result, nil)
}
func (a *AggLogicalAndAggregator) AddWithKey(key string, result interface{}, err error) error {
return a.Add(result, err)
}
func (a *AggLogicalAndAggregator) BatchSlice(results []AggregatorResErr) error {
result := true
for _, res := range results {
if res.Err != nil {
return a.Add(nil, res.Err)
}
boolRes, err := toBool(res.Result)
if err != nil {
return a.Add(nil, err)
}
result = result && boolRes
}
return a.Add(result, nil)
}
func (a *AggLogicalAndAggregator) Result() (interface{}, error) {
err := a.err.Load()
if err != nil {
return nil, err.(error)
}
if !a.hasResult.Load() {
return nil, ErrAndAggregation
}
return a.res.Load(), nil
}
// AggLogicalOrAggregator performs logical OR on boolean values.
type AggLogicalOrAggregator struct {
err atomic.Value
res atomic.Bool
hasResult atomic.Bool
}
func (a *AggLogicalOrAggregator) Add(result interface{}, err error) error {
if err != nil {
a.err.CompareAndSwap(nil, err)
return nil
}
val, e := toBool(result)
if e != nil {
a.err.CompareAndSwap(nil, e)
return e
}
// Atomic OR operation: if val is true, result is always true
if val {
a.res.Store(true)
}
a.hasResult.Store(true)
return nil
}
func (a *AggLogicalOrAggregator) BatchAdd(results map[string]AggregatorResErr) error {
result := false
for _, res := range results {
if res.Err != nil {
return a.Add(nil, res.Err)
}
boolRes, err := toBool(res.Result)
if err != nil {
return a.Add(nil, err)
}
result = result || boolRes
}
return a.Add(result, nil)
}
func (a *AggLogicalOrAggregator) AddWithKey(key string, result interface{}, err error) error {
return a.Add(result, err)
}
func (a *AggLogicalOrAggregator) BatchSlice(results []AggregatorResErr) error {
result := false
for _, res := range results {
if res.Err != nil {
return a.Add(nil, res.Err)
}
boolRes, err := toBool(res.Result)
if err != nil {
return a.Add(nil, err)
}
result = result || boolRes
}
return a.Add(result, nil)
}
func (a *AggLogicalOrAggregator) Result() (interface{}, error) {
err := a.err.Load()
if err != nil {
return nil, err.(error)
}
if !a.hasResult.Load() {
return nil, ErrOrAggregation
}
return a.res.Load(), nil
}
func toInt64(val interface{}) (int64, error) {
if val == nil {
return 0, nil
}
switch v := val.(type) {
case int64:
return v, nil
case int:
return int64(v), nil
case int32:
return int64(v), nil
case float64:
if v != math.Trunc(v) {
return 0, fmt.Errorf("cannot convert float %f to int64", v)
}
return int64(v), nil
default:
return 0, fmt.Errorf("cannot convert %T to int64", val)
}
}
func toFloat64(val interface{}) (float64, error) {
if val == nil {
return 0, nil
}
switch v := val.(type) {
case float64:
return v, nil
case int:
return float64(v), nil
case int32:
return float64(v), nil
case int64:
return float64(v), nil
case float32:
return float64(v), nil
default:
return 0, fmt.Errorf("cannot convert %T to float64", val)
}
}
func toBool(val interface{}) (bool, error) {
if val == nil {
return false, nil
}
switch v := val.(type) {
case bool:
return v, nil
case int64:
return v != 0, nil
case int:
return v != 0, nil
default:
return false, fmt.Errorf("cannot convert %T to bool", val)
}
}
// DefaultKeylessAggregator collects all results in an array, order doesn't matter.
type DefaultKeylessAggregator struct {
mu sync.Mutex
results []interface{}
firstErr error
}
func (a *DefaultKeylessAggregator) add(result interface{}, err error) error {
if err != nil && a.firstErr == nil {
a.firstErr = err
return nil
}
if err == nil {
a.results = append(a.results, result)
}
return nil
}
func (a *DefaultKeylessAggregator) Add(result interface{}, err error) error {
a.mu.Lock()
defer a.mu.Unlock()
return a.add(result, err)
}
func (a *DefaultKeylessAggregator) BatchAdd(results map[string]AggregatorResErr) error {
a.mu.Lock()
defer a.mu.Unlock()
for _, res := range results {
err := a.add(res.Result, res.Err)
if err != nil {
return err
}
if res.Err != nil {
return nil
}
}
return nil
}
func (a *DefaultKeylessAggregator) AddWithKey(key string, result interface{}, err error) error {
return a.Add(result, err)
}
func (a *DefaultKeylessAggregator) BatchSlice(results []AggregatorResErr) error {
a.mu.Lock()
defer a.mu.Unlock()
for _, res := range results {
err := a.add(res.Result, res.Err)
if err != nil {
return err
}
if res.Err != nil {
return nil
}
}
return nil
}
func (a *DefaultKeylessAggregator) Result() (interface{}, error) {
a.mu.Lock()
defer a.mu.Unlock()
if a.firstErr != nil {
return nil, a.firstErr
}
return a.results, nil
}
// DefaultKeyedAggregator reassembles replies in the exact key order of the original request.
type DefaultKeyedAggregator struct {
mu sync.Mutex
results map[string]interface{}
keyOrder []string
firstErr error
}
func NewDefaultKeyedAggregator(keyOrder []string) *DefaultKeyedAggregator {
return &DefaultKeyedAggregator{
results: make(map[string]interface{}),
keyOrder: keyOrder,
}
}
func (a *DefaultKeyedAggregator) add(result interface{}, err error) error {
if err != nil && a.firstErr == nil {
a.firstErr = err
return nil
}
// For non-keyed Add, just collect the result without ordering
if err == nil {
a.results["__default__"] = result
}
return nil
}
func (a *DefaultKeyedAggregator) Add(result interface{}, err error) error {
a.mu.Lock()
defer a.mu.Unlock()
return a.add(result, err)
}
func (a *DefaultKeyedAggregator) BatchAdd(results map[string]AggregatorResErr) error {
a.mu.Lock()
defer a.mu.Unlock()
for _, res := range results {
err := a.add(res.Result, res.Err)
if err != nil {
return err
}
if res.Err != nil {
return nil
}
}
return nil
}
func (a *DefaultKeyedAggregator) addWithKey(key string, result interface{}, err error) error {
if err != nil && a.firstErr == nil {
a.firstErr = err
return nil
}
if err == nil {
a.results[key] = result
}
return nil
}
func (a *DefaultKeyedAggregator) AddWithKey(key string, result interface{}, err error) error {
a.mu.Lock()
defer a.mu.Unlock()
return a.addWithKey(key, result, err)
}
func (a *DefaultKeyedAggregator) BatchAddWithKeyOrder(results map[string]AggregatorResErr, keyOrder []string) error {
a.mu.Lock()
defer a.mu.Unlock()
a.keyOrder = keyOrder
for key, res := range results {
err := a.addWithKey(key, res.Result, res.Err)
if err != nil {
return nil
}
if res.Err != nil {
return nil
}
}
return nil
}
func (a *DefaultKeyedAggregator) SetKeyOrder(keyOrder []string) {
a.mu.Lock()
defer a.mu.Unlock()
a.keyOrder = keyOrder
}
func (a *DefaultKeyedAggregator) BatchSlice(results []AggregatorResErr) error {
a.mu.Lock()
defer a.mu.Unlock()
for _, res := range results {
err := a.add(res.Result, res.Err)
if err != nil {
return err
}
if res.Err != nil {
return nil
}
}
return nil
}
func (a *DefaultKeyedAggregator) Result() (interface{}, error) {
a.mu.Lock()
defer a.mu.Unlock()
if a.firstErr != nil {
return nil, a.firstErr
}
// If no explicit key order is set, return results in any order
if len(a.keyOrder) == 0 {
orderedResults := make([]interface{}, 0, len(a.results))
for _, result := range a.results {
orderedResults = append(orderedResults, result)
}
return orderedResults, nil
}
// Return results in the exact key order
orderedResults := make([]interface{}, len(a.keyOrder))
for i, key := range a.keyOrder {
if result, exists := a.results[key]; exists {
orderedResults[i] = result
}
}
return orderedResults, nil
}
// SpecialAggregator provides a registry for command-specific aggregation logic.
type SpecialAggregator struct {
mu sync.Mutex
aggregatorFunc func([]interface{}, []error) (interface{}, error)
results []interface{}
errors []error
}
func (a *SpecialAggregator) add(result interface{}, err error) error {
a.results = append(a.results, result)
a.errors = append(a.errors, err)
return nil
}
func (a *SpecialAggregator) Add(result interface{}, err error) error {
a.mu.Lock()
defer a.mu.Unlock()
return a.add(result, err)
}
func (a *SpecialAggregator) BatchAdd(results map[string]AggregatorResErr) error {
a.mu.Lock()
defer a.mu.Unlock()
for _, res := range results {
err := a.add(res.Result, res.Err)
if err != nil {
return err
}
if res.Err != nil {
return nil
}
}
return nil
}
func (a *SpecialAggregator) AddWithKey(key string, result interface{}, err error) error {
return a.Add(result, err)
}
func (a *SpecialAggregator) BatchSlice(results []AggregatorResErr) error {
a.mu.Lock()
defer a.mu.Unlock()
for _, res := range results {
err := a.add(res.Result, res.Err)
if err != nil {
return err
}
if res.Err != nil {
return nil
}
}
return nil
}
func (a *SpecialAggregator) Result() (interface{}, error) {
a.mu.Lock()
defer a.mu.Unlock()
if a.aggregatorFunc != nil {
return a.aggregatorFunc(a.results, a.errors)
}
// Default behavior: return first non-error result or first error
for i, err := range a.errors {
if err == nil {
return a.results[i], nil
}
}
if len(a.errors) > 0 {
return nil, a.errors[0]
}
return nil, nil
}
// SpecialAggregatorRegistry holds custom aggregation functions for specific commands.
var SpecialAggregatorRegistry = make(map[string]func([]interface{}, []error) (interface{}, error))
// RegisterSpecialAggregator registers a custom aggregation function for a command.
func RegisterSpecialAggregator(cmdName string, fn func([]interface{}, []error) (interface{}, error)) {
SpecialAggregatorRegistry[cmdName] = fn
}
// NewSpecialAggregator creates a special aggregator with command-specific logic if available.
func NewSpecialAggregator(cmdName string) *SpecialAggregator {
agg := &SpecialAggregator{}
if fn, exists := SpecialAggregatorRegistry[cmdName]; exists {
agg.aggregatorFunc = fn
}
return agg
}
package routing
import (
"fmt"
"strings"
)
type RequestPolicy uint8
const (
ReqDefault RequestPolicy = iota
ReqAllNodes
ReqAllShards
ReqMultiShard
ReqSpecial
)
const (
ReadOnlyCMD string = "readonly"
)
func (p RequestPolicy) String() string {
switch p {
case ReqDefault:
return "default"
case ReqAllNodes:
return "all_nodes"
case ReqAllShards:
return "all_shards"
case ReqMultiShard:
return "multi_shard"
case ReqSpecial:
return "special"
default:
return fmt.Sprintf("unknown_request_policy(%d)", p)
}
}
func ParseRequestPolicy(raw string) (RequestPolicy, error) {
switch strings.ToLower(raw) {
case "", "default", "none":
return ReqDefault, nil
case "all_nodes":
return ReqAllNodes, nil
case "all_shards":
return ReqAllShards, nil
case "multi_shard":
return ReqMultiShard, nil
case "special":
return ReqSpecial, nil
default:
return ReqDefault, fmt.Errorf("routing: unknown request_policy %q", raw)
}
}
type ResponsePolicy uint8
const (
RespDefaultKeyless ResponsePolicy = iota
RespDefaultHashSlot
RespAllSucceeded
RespOneSucceeded
RespAggSum
RespAggMin
RespAggMax
RespAggLogicalAnd
RespAggLogicalOr
RespSpecial
)
func (p ResponsePolicy) String() string {
switch p {
case RespDefaultKeyless:
return "default(keyless)"
case RespDefaultHashSlot:
return "default(hashslot)"
case RespAllSucceeded:
return "all_succeeded"
case RespOneSucceeded:
return "one_succeeded"
case RespAggSum:
return "agg_sum"
case RespAggMin:
return "agg_min"
case RespAggMax:
return "agg_max"
case RespAggLogicalAnd:
return "agg_logical_and"
case RespAggLogicalOr:
return "agg_logical_or"
case RespSpecial:
return "special"
default:
return "all_succeeded"
}
}
func ParseResponsePolicy(raw string) (ResponsePolicy, error) {
switch strings.ToLower(raw) {
case "default(keyless)":
return RespDefaultKeyless, nil
case "default(hashslot)":
return RespDefaultHashSlot, nil
case "all_succeeded":
return RespAllSucceeded, nil
case "one_succeeded":
return RespOneSucceeded, nil
case "agg_sum":
return RespAggSum, nil
case "agg_min":
return RespAggMin, nil
case "agg_max":
return RespAggMax, nil
case "agg_logical_and":
return RespAggLogicalAnd, nil
case "agg_logical_or":
return RespAggLogicalOr, nil
case "special":
return RespSpecial, nil
default:
return RespDefaultKeyless, fmt.Errorf("routing: unknown response_policy %q", raw)
}
}
type CommandPolicy struct {
Request RequestPolicy
Response ResponsePolicy
// Tips that are not request_policy or response_policy
// e.g nondeterministic_output, nondeterministic_output_order.
Tips map[string]string
}
func (p *CommandPolicy) CanBeUsedInPipeline() bool {
return p.Request != ReqAllNodes && p.Request != ReqAllShards && p.Request != ReqMultiShard
}
func (p *CommandPolicy) IsReadOnly() bool {
_, readOnly := p.Tips[ReadOnlyCMD]
return readOnly
}
package routing
import (
"math/rand"
"sync/atomic"
)
// ShardPicker chooses “one arbitrary shard” when the request_policy is
// ReqDefault and the command has no keys.
type ShardPicker interface {
Next(total int) int // returns an index in [0,total)
}
// StaticShardPicker always returns the same shard index.
type StaticShardPicker struct {
index int
}
func NewStaticShardPicker(index int) *StaticShardPicker {
return &StaticShardPicker{index: index}
}
func (p *StaticShardPicker) Next(total int) int {
if total == 0 || p.index >= total {
return 0
}
return p.index
}
/*───────────────────────────────
Round-robin (default)
────────────────────────────────*/
type RoundRobinPicker struct {
cnt atomic.Uint32
}
func (p *RoundRobinPicker) Next(total int) int {
if total == 0 {
return 0
}
i := p.cnt.Add(1)
return int(i-1) % total
}
/*───────────────────────────────
Random
────────────────────────────────*/
type RandomPicker struct{}
func (RandomPicker) Next(total int) int {
if total == 0 {
return 0
}
return rand.Intn(total)
}
package internal
import (
"context"
"sync"
"time"
)
var semTimers = sync.Pool{
New: func() interface{} {
t := time.NewTimer(time.Hour)
t.Stop()
return t
},
}
// FastSemaphore is a channel-based semaphore optimized for performance.
// It uses a fast path that avoids timer allocation when tokens are available.
// The channel is pre-filled with tokens: Acquire = receive, Release = send.
// Closing the semaphore unblocks all waiting goroutines.
//
// Performance: ~30 ns/op with zero allocations on fast path.
// Fairness: Eventual fairness (no starvation) but not strict FIFO.
type FastSemaphore struct {
tokens chan struct{}
max int32
}
// NewFastSemaphore creates a new fast semaphore with the given capacity.
func NewFastSemaphore(capacity int32) *FastSemaphore {
ch := make(chan struct{}, capacity)
// Pre-fill with tokens
for i := int32(0); i < capacity; i++ {
ch <- struct{}{}
}
return &FastSemaphore{
tokens: ch,
max: capacity,
}
}
// TryAcquire attempts to acquire a token without blocking.
// Returns true if successful, false if no tokens available.
func (s *FastSemaphore) TryAcquire() bool {
select {
case <-s.tokens:
return true
default:
return false
}
}
// Acquire acquires a token, blocking if necessary until one is available.
// Returns an error if the context is cancelled or the timeout expires.
// Uses a fast path to avoid timer allocation when tokens are immediately available.
func (s *FastSemaphore) Acquire(ctx context.Context, timeout time.Duration, timeoutErr error) error {
// Check context first
select {
case <-ctx.Done():
return ctx.Err()
default:
}
// Try fast path first (no timer needed)
select {
case <-s.tokens:
return nil
default:
}
// Slow path: need to wait with timeout
timer := semTimers.Get().(*time.Timer)
defer semTimers.Put(timer)
timer.Reset(timeout)
select {
case <-s.tokens:
if !timer.Stop() {
<-timer.C
}
return nil
case <-ctx.Done():
if !timer.Stop() {
<-timer.C
}
return ctx.Err()
case <-timer.C:
return timeoutErr
}
}
// AcquireBlocking acquires a token, blocking indefinitely until one is available.
func (s *FastSemaphore) AcquireBlocking() {
<-s.tokens
}
// Release releases a token back to the semaphore.
func (s *FastSemaphore) Release() {
s.tokens <- struct{}{}
}
// Close closes the semaphore, unblocking all waiting goroutines.
// After close, all Acquire calls will receive a closed channel signal.
func (s *FastSemaphore) Close() {
close(s.tokens)
}
// Len returns the current number of acquired tokens.
func (s *FastSemaphore) Len() int32 {
return s.max - int32(len(s.tokens))
}
// FIFOSemaphore is a channel-based semaphore with strict FIFO ordering.
// Unlike FastSemaphore, this guarantees that threads are served in the exact order they call Acquire().
// The channel is pre-filled with tokens: Acquire = receive, Release = send.
// Closing the semaphore unblocks all waiting goroutines.
//
// Performance: ~115 ns/op with zero allocations (slower than FastSemaphore due to timer allocation).
// Fairness: Strict FIFO ordering guaranteed by Go runtime.
type FIFOSemaphore struct {
tokens chan struct{}
max int32
}
// NewFIFOSemaphore creates a new FIFO semaphore with the given capacity.
func NewFIFOSemaphore(capacity int32) *FIFOSemaphore {
ch := make(chan struct{}, capacity)
// Pre-fill with tokens
for i := int32(0); i < capacity; i++ {
ch <- struct{}{}
}
return &FIFOSemaphore{
tokens: ch,
max: capacity,
}
}
// TryAcquire attempts to acquire a token without blocking.
// Returns true if successful, false if no tokens available.
func (s *FIFOSemaphore) TryAcquire() bool {
select {
case <-s.tokens:
return true
default:
return false
}
}
// Acquire acquires a token, blocking if necessary until one is available.
// Returns an error if the context is cancelled or the timeout expires.
// Always uses timer to guarantee FIFO ordering (no fast path).
func (s *FIFOSemaphore) Acquire(ctx context.Context, timeout time.Duration, timeoutErr error) error {
// No fast path - always use timer to guarantee FIFO
timer := semTimers.Get().(*time.Timer)
defer semTimers.Put(timer)
timer.Reset(timeout)
select {
case <-s.tokens:
if !timer.Stop() {
<-timer.C
}
return nil
case <-ctx.Done():
if !timer.Stop() {
<-timer.C
}
return ctx.Err()
case <-timer.C:
return timeoutErr
}
}
// AcquireBlocking acquires a token, blocking indefinitely until one is available.
func (s *FIFOSemaphore) AcquireBlocking() {
<-s.tokens
}
// Release releases a token back to the semaphore.
func (s *FIFOSemaphore) Release() {
s.tokens <- struct{}{}
}
// Close closes the semaphore, unblocking all waiting goroutines.
// After close, all Acquire calls will receive a closed channel signal.
func (s *FIFOSemaphore) Close() {
close(s.tokens)
}
// Len returns the current number of acquired tokens.
func (s *FIFOSemaphore) Len() int32 {
return s.max - int32(len(s.tokens))
}
package internal
import (
"context"
"net"
"strconv"
"strings"
"time"
"github.com/redis/go-redis/v9/internal/util"
)
func Sleep(ctx context.Context, dur time.Duration) error {
t := time.NewTimer(dur)
defer t.Stop()
select {
case <-t.C:
return nil
case <-ctx.Done():
return ctx.Err()
}
}
func ToLower(s string) string {
if isLower(s) {
return s
}
b := make([]byte, len(s))
for i := range b {
c := s[i]
if c >= 'A' && c <= 'Z' {
c += 'a' - 'A'
}
b[i] = c
}
return util.BytesToString(b)
}
func isLower(s string) bool {
for i := 0; i < len(s); i++ {
c := s[i]
if c >= 'A' && c <= 'Z' {
return false
}
}
return true
}
func ReplaceSpaces(s string) string {
return strings.ReplaceAll(s, " ", "-")
}
func GetAddr(addr string) string {
ind := strings.LastIndexByte(addr, ':')
if ind == -1 {
return ""
}
if strings.IndexByte(addr, '.') != -1 {
return addr
}
if addr[0] == '[' {
return addr
}
return net.JoinHostPort(addr[:ind], addr[ind+1:])
}
func ToInteger(val interface{}) int {
switch v := val.(type) {
case int:
return v
case int64:
return int(v)
case string:
i, _ := strconv.Atoi(v)
return i
default:
return 0
}
}
func ToFloat(val interface{}) float64 {
switch v := val.(type) {
case float64:
return v
case string:
f, _ := strconv.ParseFloat(v, 64)
return f
default:
return 0.0
}
}
func ToString(val interface{}) string {
if str, ok := val.(string); ok {
return str
}
return ""
}
func ToStringSlice(val interface{}) []string {
if arr, ok := val.([]interface{}); ok {
result := make([]string, len(arr))
for i, v := range arr {
result[i] = ToString(v)
}
return result
}
return nil
}
/*
© 2023–present Harald Rudell <harald.rudell@gmail.com> (https://haraldrudell.github.io/haraldrudell/)
ISC License
Modified by htemelski-redis
Removed the treshold, adapted it to work with float64
*/
package util
import (
"math"
"go.uber.org/atomic"
)
// AtomicMax is a thread-safe max container
// - hasValue indicator true if a value was equal to or greater than threshold
// - optional threshold for minimum accepted max value
// - if threshold is not used, initialization-free
// - —
// - wait-free CompareAndSwap mechanic
type AtomicMax struct {
// value is current max
value atomic.Float64
// whether [AtomicMax.Value] has been invoked
// with value equal or greater to threshold
hasValue atomic.Bool
}
// NewAtomicMax returns a thread-safe max container
// - if threshold is not used, AtomicMax is initialization-free
func NewAtomicMax() (atomicMax *AtomicMax) {
m := AtomicMax{}
m.value.Store((-math.MaxFloat64))
return &m
}
// Value updates the container with a possible max value
// - isNewMax is true if:
// - — value is equal to or greater than any threshold and
// - — invocation recorded the first 0 or
// - — a new max
// - upon return, Max and Max1 are guaranteed to reflect the invocation
// - the return order of concurrent Value invocations is not guaranteed
// - Thread-safe
func (m *AtomicMax) Value(value float64) (isNewMax bool) {
// -math.MaxFloat64 as max case
var hasValue0 = m.hasValue.Load()
if value == (-math.MaxFloat64) {
if !hasValue0 {
isNewMax = m.hasValue.CompareAndSwap(false, true)
}
return // -math.MaxFloat64 as max: isNewMax true for first 0 writer
}
// check against present value
var current = m.value.Load()
if isNewMax = value > current; !isNewMax {
return // not a new max return: isNewMax false
}
// store the new max
for {
// try to write value to *max
if isNewMax = m.value.CompareAndSwap(current, value); isNewMax {
if !hasValue0 {
// may be rarely written multiple times
// still faster than CompareAndSwap
m.hasValue.Store(true)
}
return // new max written return: isNewMax true
}
if current = m.value.Load(); current >= value {
return // no longer a need to write return: isNewMax false
}
}
}
// Max returns current max and value-present flag
// - hasValue true indicates that value reflects a Value invocation
// - hasValue false: value is zero-value
// - Thread-safe
func (m *AtomicMax) Max() (value float64, hasValue bool) {
if hasValue = m.hasValue.Load(); !hasValue {
return
}
value = m.value.Load()
return
}
// Max1 returns current maximum whether zero-value or set by Value
// - threshold is ignored
// - Thread-safe
func (m *AtomicMax) Max1() (value float64) { return m.value.Load() }
package util
/*
© 2023–present Harald Rudell <harald.rudell@gmail.com> (https://haraldrudell.github.io/haraldrudell/)
ISC License
Modified by htemelski-redis
Adapted from the modified atomic_max, but with inverted logic
*/
import (
"math"
"go.uber.org/atomic"
)
// AtomicMin is a thread-safe Min container
// - hasValue indicator true if a value was equal to or greater than threshold
// - optional threshold for minimum accepted Min value
// - —
// - wait-free CompareAndSwap mechanic
type AtomicMin struct {
// value is current Min
value atomic.Float64
// whether [AtomicMin.Value] has been invoked
// with value equal or greater to threshold
hasValue atomic.Bool
}
// NewAtomicMin returns a thread-safe Min container
// - if threshold is not used, AtomicMin is initialization-free
func NewAtomicMin() (atomicMin *AtomicMin) {
m := AtomicMin{}
m.value.Store(math.MaxFloat64)
return &m
}
// Value updates the container with a possible Min value
// - isNewMin is true if:
// - — value is equal to or greater than any threshold and
// - — invocation recorded the first 0 or
// - — a new Min
// - upon return, Min and Min1 are guaranteed to reflect the invocation
// - the return order of concurrent Value invocations is not guaranteed
// - Thread-safe
func (m *AtomicMin) Value(value float64) (isNewMin bool) {
// math.MaxFloat64 as Min case
var hasValue0 = m.hasValue.Load()
if value == math.MaxFloat64 {
if !hasValue0 {
isNewMin = m.hasValue.CompareAndSwap(false, true)
}
return // math.MaxFloat64 as Min: isNewMin true for first 0 writer
}
// check against present value
var current = m.value.Load()
if isNewMin = value < current; !isNewMin {
return // not a new Min return: isNewMin false
}
// store the new Min
for {
// try to write value to *Min
if isNewMin = m.value.CompareAndSwap(current, value); isNewMin {
if !hasValue0 {
// may be rarely written multiple times
// still faster than CompareAndSwap
m.hasValue.Store(true)
}
return // new Min written return: isNewMin true
}
if current = m.value.Load(); current <= value {
return // no longer a need to write return: isNewMin false
}
}
}
// Min returns current min and value-present flag
// - hasValue true indicates that value reflects a Value invocation
// - hasValue false: value is zero-value
// - Thread-safe
func (m *AtomicMin) Min() (value float64, hasValue bool) {
if hasValue = m.hasValue.Load(); !hasValue {
return
}
value = m.value.Load()
return
}
// Min1 returns current Minimum whether zero-value or set by Value
// - threshold is ignored
// - Thread-safe
func (m *AtomicMin) Min1() (value float64) { return m.value.Load() }
package util
import (
"fmt"
"math"
"strconv"
)
// ParseFloat parses a Redis RESP3 float reply into a Go float64,
// handling "inf", "-inf", "nan" per Redis conventions.
func ParseStringToFloat(s string) (float64, error) {
switch s {
case "inf":
return math.Inf(1), nil
case "-inf":
return math.Inf(-1), nil
case "nan", "-nan":
return math.NaN(), nil
}
return strconv.ParseFloat(s, 64)
}
// MustParseFloat is like ParseFloat but panics on parse errors.
func MustParseFloat(s string) float64 {
f, err := ParseStringToFloat(s)
if err != nil {
panic(fmt.Sprintf("redis: failed to parse float %q: %v", s, err))
}
return f
}
// SafeIntToInt32 safely converts an int to int32, returning an error if overflow would occur.
func SafeIntToInt32(value int, fieldName string) (int32, error) {
if value > math.MaxInt32 {
return 0, fmt.Errorf("redis: %s value %d exceeds maximum allowed value %d", fieldName, value, math.MaxInt32)
}
if value < math.MinInt32 {
return 0, fmt.Errorf("redis: %s value %d is below minimum allowed value %d", fieldName, value, math.MinInt32)
}
return int32(value), nil
}
package util
import "strconv"
func Atoi(b []byte) (int, error) {
return strconv.Atoi(BytesToString(b))
}
func ParseInt(b []byte, base int, bitSize int) (int64, error) {
return strconv.ParseInt(BytesToString(b), base, bitSize)
}
func ParseUint(b []byte, base int, bitSize int) (uint64, error) {
return strconv.ParseUint(BytesToString(b), base, bitSize)
}
func ParseFloat(b []byte, bitSize int) (float64, error) {
return strconv.ParseFloat(BytesToString(b), bitSize)
}
package util
func ToPtr[T any](v T) *T {
return &v
}
//go:build !appengine
package util
import (
"unsafe"
)
// BytesToString converts byte slice to string.
func BytesToString(b []byte) string {
return unsafe.String(unsafe.SliceData(b), len(b))
}
// StringToBytes converts string to byte slice.
func StringToBytes(s string) []byte {
return unsafe.Slice(unsafe.StringData(s), len(s))
}
package redis
import (
"context"
)
// ScanIterator is used to incrementally iterate over a collection of elements.
type ScanIterator struct {
cmd *ScanCmd
pos int
}
// Err returns the last iterator error, if any.
func (it *ScanIterator) Err() error {
return it.cmd.Err()
}
// Next advances the cursor and returns true if more values can be read.
func (it *ScanIterator) Next(ctx context.Context) bool {
// Instantly return on errors.
if it.cmd.Err() != nil {
return false
}
// Advance cursor, check if we are still within range.
if it.pos < len(it.cmd.page) {
it.pos++
return true
}
for {
// Return if there is no more data to fetch.
if it.cmd.cursor == 0 {
return false
}
// Fetch next page.
switch it.cmd.args[0] {
case "scan", "qscan":
it.cmd.args[1] = it.cmd.cursor
default:
it.cmd.args[2] = it.cmd.cursor
}
err := it.cmd.process(ctx, it.cmd)
if err != nil {
return false
}
it.pos = 1
// Redis can occasionally return empty page.
if len(it.cmd.page) > 0 {
return true
}
}
}
// Val returns the key/field at the current cursor position.
func (it *ScanIterator) Val() string {
var v string
if it.cmd.Err() == nil && it.pos > 0 && it.pos <= len(it.cmd.page) {
v = it.cmd.page[it.pos-1]
}
return v
}
package redis
import (
"context"
"encoding/json"
"strings"
"github.com/redis/go-redis/v9/internal/proto"
"github.com/redis/go-redis/v9/internal/util"
)
// -------------------------------------------
type JSONCmdable interface {
JSONArrAppend(ctx context.Context, key, path string, values ...interface{}) *IntSliceCmd
JSONArrIndex(ctx context.Context, key, path string, value ...interface{}) *IntSliceCmd
JSONArrIndexWithArgs(ctx context.Context, key, path string, options *JSONArrIndexArgs, value ...interface{}) *IntSliceCmd
JSONArrInsert(ctx context.Context, key, path string, index int64, values ...interface{}) *IntSliceCmd
JSONArrLen(ctx context.Context, key, path string) *IntSliceCmd
JSONArrPop(ctx context.Context, key, path string, index int) *StringSliceCmd
JSONArrTrim(ctx context.Context, key, path string) *IntSliceCmd
JSONArrTrimWithArgs(ctx context.Context, key, path string, options *JSONArrTrimArgs) *IntSliceCmd
JSONClear(ctx context.Context, key, path string) *IntCmd
JSONDebugMemory(ctx context.Context, key, path string) *IntCmd
JSONDel(ctx context.Context, key, path string) *IntCmd
JSONForget(ctx context.Context, key, path string) *IntCmd
JSONGet(ctx context.Context, key string, paths ...string) *JSONCmd
JSONGetWithArgs(ctx context.Context, key string, options *JSONGetArgs, paths ...string) *JSONCmd
JSONMerge(ctx context.Context, key, path string, value string) *StatusCmd
JSONMSetArgs(ctx context.Context, docs []JSONSetArgs) *StatusCmd
JSONMSet(ctx context.Context, params ...interface{}) *StatusCmd
JSONMGet(ctx context.Context, path string, keys ...string) *JSONSliceCmd
JSONNumIncrBy(ctx context.Context, key, path string, value float64) *JSONCmd
JSONObjKeys(ctx context.Context, key, path string) *SliceCmd
JSONObjLen(ctx context.Context, key, path string) *IntPointerSliceCmd
JSONSet(ctx context.Context, key, path string, value interface{}) *StatusCmd
JSONSetMode(ctx context.Context, key, path string, value interface{}, mode string) *StatusCmd
JSONStrAppend(ctx context.Context, key, path, value string) *IntPointerSliceCmd
JSONStrLen(ctx context.Context, key, path string) *IntPointerSliceCmd
JSONToggle(ctx context.Context, key, path string) *IntPointerSliceCmd
JSONType(ctx context.Context, key, path string) *JSONSliceCmd
}
type JSONSetArgs struct {
Key string
Path string
Value interface{}
}
type JSONArrIndexArgs struct {
Start int
Stop *int
}
type JSONArrTrimArgs struct {
Start int
Stop *int
}
type JSONCmd struct {
baseCmd
val string
expanded interface{}
}
var _ Cmder = (*JSONCmd)(nil)
func newJSONCmd(ctx context.Context, args ...interface{}) *JSONCmd {
return &JSONCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeJSON,
},
}
}
func (cmd *JSONCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *JSONCmd) SetVal(val string) {
cmd.val = val
}
// Val returns the result of the JSON.GET command as a string.
func (cmd *JSONCmd) Val() string {
if len(cmd.val) == 0 && cmd.expanded != nil {
val, err := json.Marshal(cmd.expanded)
if err != nil {
cmd.SetErr(err)
return ""
}
return string(val)
} else {
return cmd.val
}
}
func (cmd *JSONCmd) Result() (string, error) {
return cmd.Val(), cmd.Err()
}
// Expanded returns the result of the JSON.GET command as unmarshalled JSON.
func (cmd *JSONCmd) Expanded() (interface{}, error) {
if len(cmd.val) != 0 && cmd.expanded == nil {
err := json.Unmarshal([]byte(cmd.val), &cmd.expanded)
if err != nil {
return nil, err
}
}
return cmd.expanded, nil
}
func (cmd *JSONCmd) readReply(rd *proto.Reader) error {
// nil response from JSON.(M)GET (cmd.baseCmd.err will be "redis: nil")
// This happens when the key doesn't exist
if cmd.baseCmd.Err() == Nil {
cmd.val = ""
return Nil
}
// Handle other base command errors
if cmd.baseCmd.Err() != nil {
return cmd.baseCmd.Err()
}
if readType, err := rd.PeekReplyType(); err != nil {
return err
} else if readType == proto.RespArray {
size, err := rd.ReadArrayLen()
if err != nil {
return err
}
// Empty array means no results found for JSON path, but key exists
// This should return "[]", not an error
if size == 0 {
cmd.val = "[]"
return nil
}
expanded := make([]interface{}, size)
for i := 0; i < size; i++ {
if expanded[i], err = rd.ReadReply(); err != nil {
return err
}
}
cmd.expanded = expanded
} else {
if str, err := rd.ReadString(); err != nil && err != Nil {
return err
} else if str == "" || err == Nil {
cmd.val = ""
return Nil
} else {
cmd.val = str
}
}
return nil
}
func (cmd *JSONCmd) Clone() Cmder {
return &JSONCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val,
expanded: cmd.expanded, // interface{} can be shared as it should be immutable after parsing
}
}
// -------------------------------------------
type JSONSliceCmd struct {
baseCmd
val []interface{}
}
func NewJSONSliceCmd(ctx context.Context, args ...interface{}) *JSONSliceCmd {
return &JSONSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeJSONSlice,
},
}
}
func (cmd *JSONSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *JSONSliceCmd) SetVal(val []interface{}) {
cmd.val = val
}
func (cmd *JSONSliceCmd) Val() []interface{} {
return cmd.val
}
func (cmd *JSONSliceCmd) Result() ([]interface{}, error) {
return cmd.val, cmd.err
}
func (cmd *JSONSliceCmd) readReply(rd *proto.Reader) error {
if cmd.baseCmd.Err() == Nil {
cmd.val = nil
return Nil
}
if readType, err := rd.PeekReplyType(); err != nil {
return err
} else if readType == proto.RespArray {
response, err := rd.ReadReply()
if err != nil {
return nil
} else {
cmd.val = response.([]interface{})
}
} else {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]interface{}, n)
for i := 0; i < len(cmd.val); i++ {
switch s, err := rd.ReadString(); {
case err == Nil:
cmd.val[i] = ""
case err != nil:
return err
default:
cmd.val[i] = s
}
}
}
return nil
}
func (cmd *JSONSliceCmd) Clone() Cmder {
var val []interface{}
if cmd.val != nil {
val = make([]interface{}, len(cmd.val))
copy(val, cmd.val)
}
return &JSONSliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
/*******************************************************************************
*
* IntPointerSliceCmd
* used to represent a RedisJSON response where the result is either an integer or nil
*
*******************************************************************************/
type IntPointerSliceCmd struct {
baseCmd
val []*int64
}
// NewIntPointerSliceCmd initialises an IntPointerSliceCmd
func NewIntPointerSliceCmd(ctx context.Context, args ...interface{}) *IntPointerSliceCmd {
return &IntPointerSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeIntPointerSlice,
},
}
}
func (cmd *IntPointerSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *IntPointerSliceCmd) SetVal(val []*int64) {
cmd.val = val
}
func (cmd *IntPointerSliceCmd) Val() []*int64 {
return cmd.val
}
func (cmd *IntPointerSliceCmd) Result() ([]*int64, error) {
return cmd.val, cmd.err
}
func (cmd *IntPointerSliceCmd) readReply(rd *proto.Reader) error {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]*int64, n)
for i := 0; i < len(cmd.val); i++ {
val, err := rd.ReadInt()
if err != nil && err != Nil {
return err
} else if err != Nil {
cmd.val[i] = &val
}
}
return nil
}
func (cmd *IntPointerSliceCmd) Clone() Cmder {
var val []*int64
if cmd.val != nil {
val = make([]*int64, len(cmd.val))
copy(val, cmd.val)
}
return &IntPointerSliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
//------------------------------------------------------------------------------
// JSONArrAppend adds the provided JSON values to the end of the array at the given path.
// For more information, see https://redis.io/commands/json.arrappend
func (c cmdable) JSONArrAppend(ctx context.Context, key, path string, values ...interface{}) *IntSliceCmd {
args := []interface{}{"JSON.ARRAPPEND", key, path}
args = append(args, values...)
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONArrIndex searches for the first occurrence of the provided JSON value in the array at the given path.
// For more information, see https://redis.io/commands/json.arrindex
func (c cmdable) JSONArrIndex(ctx context.Context, key, path string, value ...interface{}) *IntSliceCmd {
args := []interface{}{"JSON.ARRINDEX", key, path}
args = append(args, value...)
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONArrIndexWithArgs searches for the first occurrence of a JSON value in an array while allowing the start and
// stop options to be provided.
// For more information, see https://redis.io/commands/json.arrindex
func (c cmdable) JSONArrIndexWithArgs(ctx context.Context, key, path string, options *JSONArrIndexArgs, value ...interface{}) *IntSliceCmd {
args := []interface{}{"JSON.ARRINDEX", key, path}
args = append(args, value...)
if options != nil {
args = append(args, options.Start)
if options.Stop != nil {
args = append(args, *options.Stop)
}
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONArrInsert inserts the JSON values into the array at the specified path before the index (shifts to the right).
// For more information, see https://redis.io/commands/json.arrinsert
func (c cmdable) JSONArrInsert(ctx context.Context, key, path string, index int64, values ...interface{}) *IntSliceCmd {
args := []interface{}{"JSON.ARRINSERT", key, path, index}
args = append(args, values...)
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONArrLen reports the length of the JSON array at the specified path in the given key.
// For more information, see https://redis.io/commands/json.arrlen
func (c cmdable) JSONArrLen(ctx context.Context, key, path string) *IntSliceCmd {
args := []interface{}{"JSON.ARRLEN", key, path}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONArrPop removes and returns an element from the specified index in the array.
// For more information, see https://redis.io/commands/json.arrpop
func (c cmdable) JSONArrPop(ctx context.Context, key, path string, index int) *StringSliceCmd {
args := []interface{}{"JSON.ARRPOP", key, path, index}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONArrTrim trims an array to contain only the specified inclusive range of elements.
// For more information, see https://redis.io/commands/json.arrtrim
func (c cmdable) JSONArrTrim(ctx context.Context, key, path string) *IntSliceCmd {
args := []interface{}{"JSON.ARRTRIM", key, path}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONArrTrimWithArgs trims an array to contain only the specified inclusive range of elements.
// For more information, see https://redis.io/commands/json.arrtrim
func (c cmdable) JSONArrTrimWithArgs(ctx context.Context, key, path string, options *JSONArrTrimArgs) *IntSliceCmd {
args := []interface{}{"JSON.ARRTRIM", key, path}
if options != nil {
args = append(args, options.Start)
if options.Stop != nil {
args = append(args, *options.Stop)
}
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONClear clears container values (arrays/objects) and sets numeric values to 0.
// For more information, see https://redis.io/commands/json.clear
func (c cmdable) JSONClear(ctx context.Context, key, path string) *IntCmd {
args := []interface{}{"JSON.CLEAR", key, path}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONDebugMemory reports a value's memory usage in bytes (unimplemented)
// For more information, see https://redis.io/commands/json.debug-memory
func (c cmdable) JSONDebugMemory(ctx context.Context, key, path string) *IntCmd {
panic("not implemented")
}
// JSONDel deletes a value.
// For more information, see https://redis.io/commands/json.del
func (c cmdable) JSONDel(ctx context.Context, key, path string) *IntCmd {
args := []interface{}{"JSON.DEL", key, path}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONForget deletes a value.
// For more information, see https://redis.io/commands/json.forget
func (c cmdable) JSONForget(ctx context.Context, key, path string) *IntCmd {
args := []interface{}{"JSON.FORGET", key, path}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONGet returns the value at path in JSON serialized form. JSON.GET returns an
// array of strings. This function parses out the wrapping array but leaves the
// internal strings unprocessed by default (see Val())
// For more information - https://redis.io/commands/json.get/
func (c cmdable) JSONGet(ctx context.Context, key string, paths ...string) *JSONCmd {
args := make([]interface{}, len(paths)+2)
args[0] = "JSON.GET"
args[1] = key
for n, path := range paths {
args[n+2] = path
}
cmd := newJSONCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type JSONGetArgs struct {
Indent string
Newline string
Space string
}
// JSONGetWithArgs - Retrieves the value of a key from a JSON document.
// This function also allows for specifying additional options such as:
// Indention, NewLine and Space
// For more information - https://redis.io/commands/json.get/
func (c cmdable) JSONGetWithArgs(ctx context.Context, key string, options *JSONGetArgs, paths ...string) *JSONCmd {
args := []interface{}{"JSON.GET", key}
if options != nil {
if options.Indent != "" {
args = append(args, "INDENT", options.Indent)
}
if options.Newline != "" {
args = append(args, "NEWLINE", options.Newline)
}
if options.Space != "" {
args = append(args, "SPACE", options.Space)
}
for _, path := range paths {
args = append(args, path)
}
}
cmd := newJSONCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONMerge merges a given JSON value into matching paths.
// For more information, see https://redis.io/commands/json.merge
func (c cmdable) JSONMerge(ctx context.Context, key, path string, value string) *StatusCmd {
args := []interface{}{"JSON.MERGE", key, path, value}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONMGet returns the values at the specified path from multiple key arguments.
// Note - the arguments are reversed when compared with `JSON.MGET` as we want
// to follow the pattern of having the last argument be variable.
// For more information, see https://redis.io/commands/json.mget
func (c cmdable) JSONMGet(ctx context.Context, path string, keys ...string) *JSONSliceCmd {
args := make([]interface{}, len(keys)+1)
args[0] = "JSON.MGET"
for n, key := range keys {
args[n+1] = key
}
args = append(args, path)
cmd := NewJSONSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONMSetArgs sets or updates one or more JSON values according to the specified key-path-value triplets.
// For more information, see https://redis.io/commands/json.mset
func (c cmdable) JSONMSetArgs(ctx context.Context, docs []JSONSetArgs) *StatusCmd {
args := []interface{}{"JSON.MSET"}
for _, doc := range docs {
args = append(args, doc.Key, doc.Path, doc.Value)
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) JSONMSet(ctx context.Context, params ...interface{}) *StatusCmd {
args := []interface{}{"JSON.MSET"}
args = append(args, params...)
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONNumIncrBy increments the number value stored at the specified path by the provided number.
// For more information, see https://redis.io/docs/latest/commands/json.numincrby/
func (c cmdable) JSONNumIncrBy(ctx context.Context, key, path string, value float64) *JSONCmd {
args := []interface{}{"JSON.NUMINCRBY", key, path, value}
cmd := newJSONCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONObjKeys returns the keys in the object that's referenced by the specified path.
// For more information, see https://redis.io/commands/json.objkeys
func (c cmdable) JSONObjKeys(ctx context.Context, key, path string) *SliceCmd {
args := []interface{}{"JSON.OBJKEYS", key, path}
cmd := NewSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONObjLen reports the number of keys in the JSON object at the specified path in the given key.
// For more information, see https://redis.io/commands/json.objlen
func (c cmdable) JSONObjLen(ctx context.Context, key, path string) *IntPointerSliceCmd {
args := []interface{}{"JSON.OBJLEN", key, path}
cmd := NewIntPointerSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONSet sets the JSON value at the given path in the given key. The value must be something that
// can be marshaled to JSON (using encoding/JSON) unless the argument is a string or a []byte when we assume that
// it can be passed directly as JSON.
// For more information, see https://redis.io/commands/json.set
func (c cmdable) JSONSet(ctx context.Context, key, path string, value interface{}) *StatusCmd {
return c.JSONSetMode(ctx, key, path, value, "")
}
// JSONSetMode sets the JSON value at the given path in the given key and allows the mode to be set
// (the mode value must be "XX" or "NX"). The value must be something that can be marshaled to JSON (using encoding/JSON) unless
// the argument is a string or []byte when we assume that it can be passed directly as JSON.
// For more information, see https://redis.io/commands/json.set
func (c cmdable) JSONSetMode(ctx context.Context, key, path string, value interface{}, mode string) *StatusCmd {
var bytes []byte
var err error
switch v := value.(type) {
case string:
bytes = []byte(v)
case []byte:
bytes = v
default:
bytes, err = json.Marshal(v)
}
args := []interface{}{"JSON.SET", key, path, util.BytesToString(bytes)}
if mode != "" {
switch strings.ToUpper(mode) {
case "XX", "NX":
args = append(args, strings.ToUpper(mode))
default:
panic("redis: JSON.SET mode must be NX or XX")
}
}
cmd := NewStatusCmd(ctx, args...)
if err != nil {
cmd.SetErr(err)
} else {
_ = c(ctx, cmd)
}
return cmd
}
// JSONStrAppend appends the JSON-string values to the string at the specified path.
// For more information, see https://redis.io/commands/json.strappend
func (c cmdable) JSONStrAppend(ctx context.Context, key, path, value string) *IntPointerSliceCmd {
args := []interface{}{"JSON.STRAPPEND", key, path, value}
cmd := NewIntPointerSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONStrLen reports the length of the JSON String at the specified path in the given key.
// For more information, see https://redis.io/commands/json.strlen
func (c cmdable) JSONStrLen(ctx context.Context, key, path string) *IntPointerSliceCmd {
args := []interface{}{"JSON.STRLEN", key, path}
cmd := NewIntPointerSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONToggle toggles a Boolean value stored at the specified path.
// For more information, see https://redis.io/commands/json.toggle
func (c cmdable) JSONToggle(ctx context.Context, key, path string) *IntPointerSliceCmd {
args := []interface{}{"JSON.TOGGLE", key, path}
cmd := NewIntPointerSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// JSONType reports the type of JSON value at the specified path.
// For more information, see https://redis.io/commands/json.type
func (c cmdable) JSONType(ctx context.Context, key, path string) *JSONSliceCmd {
args := []interface{}{"JSON.TYPE", key, path}
cmd := NewJSONSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
package redis
import (
"context"
"strings"
"time"
)
type ListCmdable interface {
BLPop(ctx context.Context, timeout time.Duration, keys ...string) *StringSliceCmd
BLMPop(ctx context.Context, timeout time.Duration, direction string, count int64, keys ...string) *KeyValuesCmd
BRPop(ctx context.Context, timeout time.Duration, keys ...string) *StringSliceCmd
BRPopLPush(ctx context.Context, source, destination string, timeout time.Duration) *StringCmd
LIndex(ctx context.Context, key string, index int64) *StringCmd
LInsert(ctx context.Context, key, op string, pivot, value interface{}) *IntCmd
LInsertBefore(ctx context.Context, key string, pivot, value interface{}) *IntCmd
LInsertAfter(ctx context.Context, key string, pivot, value interface{}) *IntCmd
LLen(ctx context.Context, key string) *IntCmd
LMPop(ctx context.Context, direction string, count int64, keys ...string) *KeyValuesCmd
LPop(ctx context.Context, key string) *StringCmd
LPopCount(ctx context.Context, key string, count int) *StringSliceCmd
LPos(ctx context.Context, key string, value string, args LPosArgs) *IntCmd
LPosCount(ctx context.Context, key string, value string, count int64, args LPosArgs) *IntSliceCmd
LPush(ctx context.Context, key string, values ...interface{}) *IntCmd
LPushX(ctx context.Context, key string, values ...interface{}) *IntCmd
LRange(ctx context.Context, key string, start, stop int64) *StringSliceCmd
LRem(ctx context.Context, key string, count int64, value interface{}) *IntCmd
LSet(ctx context.Context, key string, index int64, value interface{}) *StatusCmd
LTrim(ctx context.Context, key string, start, stop int64) *StatusCmd
RPop(ctx context.Context, key string) *StringCmd
RPopCount(ctx context.Context, key string, count int) *StringSliceCmd
RPopLPush(ctx context.Context, source, destination string) *StringCmd
RPush(ctx context.Context, key string, values ...interface{}) *IntCmd
RPushX(ctx context.Context, key string, values ...interface{}) *IntCmd
LMove(ctx context.Context, source, destination, srcpos, destpos string) *StringCmd
BLMove(ctx context.Context, source, destination, srcpos, destpos string, timeout time.Duration) *StringCmd
}
func (c cmdable) BLPop(ctx context.Context, timeout time.Duration, keys ...string) *StringSliceCmd {
args := make([]interface{}, 1+len(keys)+1)
args[0] = "blpop"
for i, key := range keys {
args[1+i] = key
}
args[len(args)-1] = formatSec(ctx, timeout)
cmd := NewStringSliceCmd(ctx, args...)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) BLMPop(ctx context.Context, timeout time.Duration, direction string, count int64, keys ...string) *KeyValuesCmd {
args := make([]interface{}, 3+len(keys), 6+len(keys))
args[0] = "blmpop"
args[1] = formatSec(ctx, timeout)
args[2] = len(keys)
for i, key := range keys {
args[3+i] = key
}
args = append(args, strings.ToLower(direction), "count", count)
cmd := NewKeyValuesCmd(ctx, args...)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) BRPop(ctx context.Context, timeout time.Duration, keys ...string) *StringSliceCmd {
args := make([]interface{}, 1+len(keys)+1)
args[0] = "brpop"
for i, key := range keys {
args[1+i] = key
}
args[len(keys)+1] = formatSec(ctx, timeout)
cmd := NewStringSliceCmd(ctx, args...)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
// BRPopLPush pops an element from a list, pushes it to another list and returns it.
// Blocks until an element is available or timeout is reached.
//
// Deprecated: Use BLMove with RIGHT and LEFT arguments instead as of Redis 6.2.0.
func (c cmdable) BRPopLPush(ctx context.Context, source, destination string, timeout time.Duration) *StringCmd {
cmd := NewStringCmd(
ctx,
"brpoplpush",
source,
destination,
formatSec(ctx, timeout),
)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LIndex(ctx context.Context, key string, index int64) *StringCmd {
cmd := NewStringCmd(ctx, "lindex", key, index)
_ = c(ctx, cmd)
return cmd
}
// LMPop Pops one or more elements from the first non-empty list key from the list of provided key names.
// direction: left or right, count: > 0
// example: client.LMPop(ctx, "left", 3, "key1", "key2")
func (c cmdable) LMPop(ctx context.Context, direction string, count int64, keys ...string) *KeyValuesCmd {
args := make([]interface{}, 2+len(keys), 5+len(keys))
args[0] = "lmpop"
args[1] = len(keys)
for i, key := range keys {
args[2+i] = key
}
args = append(args, strings.ToLower(direction), "count", count)
cmd := NewKeyValuesCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LInsert(ctx context.Context, key, op string, pivot, value interface{}) *IntCmd {
cmd := NewIntCmd(ctx, "linsert", key, op, pivot, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LInsertBefore(ctx context.Context, key string, pivot, value interface{}) *IntCmd {
cmd := NewIntCmd(ctx, "linsert", key, "before", pivot, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LInsertAfter(ctx context.Context, key string, pivot, value interface{}) *IntCmd {
cmd := NewIntCmd(ctx, "linsert", key, "after", pivot, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LLen(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "llen", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LPop(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "lpop", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LPopCount(ctx context.Context, key string, count int) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "lpop", key, count)
_ = c(ctx, cmd)
return cmd
}
type LPosArgs struct {
Rank, MaxLen int64
}
func (c cmdable) LPos(ctx context.Context, key string, value string, a LPosArgs) *IntCmd {
args := []interface{}{"lpos", key, value}
if a.Rank != 0 {
args = append(args, "rank", a.Rank)
}
if a.MaxLen != 0 {
args = append(args, "maxlen", a.MaxLen)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LPosCount(ctx context.Context, key string, value string, count int64, a LPosArgs) *IntSliceCmd {
args := []interface{}{"lpos", key, value, "count", count}
if a.Rank != 0 {
args = append(args, "rank", a.Rank)
}
if a.MaxLen != 0 {
args = append(args, "maxlen", a.MaxLen)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LPush(ctx context.Context, key string, values ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "lpush"
args[1] = key
args = appendArgs(args, values)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LPushX(ctx context.Context, key string, values ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "lpushx"
args[1] = key
args = appendArgs(args, values)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LRange(ctx context.Context, key string, start, stop int64) *StringSliceCmd {
cmd := NewStringSliceCmd(
ctx,
"lrange",
key,
start,
stop,
)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LRem(ctx context.Context, key string, count int64, value interface{}) *IntCmd {
cmd := NewIntCmd(ctx, "lrem", key, count, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LSet(ctx context.Context, key string, index int64, value interface{}) *StatusCmd {
cmd := NewStatusCmd(ctx, "lset", key, index, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LTrim(ctx context.Context, key string, start, stop int64) *StatusCmd {
cmd := NewStatusCmd(
ctx,
"ltrim",
key,
start,
stop,
)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RPop(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "rpop", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RPopCount(ctx context.Context, key string, count int) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "rpop", key, count)
_ = c(ctx, cmd)
return cmd
}
// RPopLPush atomically returns and removes the last element of the source list,
// and pushes the element as the first element of the destination list.
//
// Deprecated: Use LMove with RIGHT and LEFT arguments instead as of Redis 6.2.0.
func (c cmdable) RPopLPush(ctx context.Context, source, destination string) *StringCmd {
cmd := NewStringCmd(ctx, "rpoplpush", source, destination)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RPush(ctx context.Context, key string, values ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "rpush"
args[1] = key
args = appendArgs(args, values)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) RPushX(ctx context.Context, key string, values ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(values))
args[0] = "rpushx"
args[1] = key
args = appendArgs(args, values)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) LMove(ctx context.Context, source, destination, srcpos, destpos string) *StringCmd {
cmd := NewStringCmd(ctx, "lmove", source, destination, srcpos, destpos)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) BLMove(
ctx context.Context, source, destination, srcpos, destpos string, timeout time.Duration,
) *StringCmd {
cmd := NewStringCmd(ctx, "blmove", source, destination, srcpos, destpos, formatSec(ctx, timeout))
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
package maintnotifications
import (
"context"
"sync"
"sync/atomic"
"time"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/maintnotifications/logs"
)
// CircuitBreakerState represents the state of a circuit breaker
type CircuitBreakerState int32
const (
// CircuitBreakerClosed - normal operation, requests allowed
CircuitBreakerClosed CircuitBreakerState = iota
// CircuitBreakerOpen - failing fast, requests rejected
CircuitBreakerOpen
// CircuitBreakerHalfOpen - testing if service recovered
CircuitBreakerHalfOpen
)
func (s CircuitBreakerState) String() string {
switch s {
case CircuitBreakerClosed:
return "closed"
case CircuitBreakerOpen:
return "open"
case CircuitBreakerHalfOpen:
return "half-open"
default:
return "unknown"
}
}
// CircuitBreaker implements the circuit breaker pattern for endpoint-specific failure handling
type CircuitBreaker struct {
// Configuration
failureThreshold int // Number of failures before opening
resetTimeout time.Duration // How long to stay open before testing
maxRequests int // Max requests allowed in half-open state
// State tracking (atomic for lock-free access)
state atomic.Int32 // CircuitBreakerState
failures atomic.Int64 // Current failure count
successes atomic.Int64 // Success count in half-open state
requests atomic.Int64 // Request count in half-open state
lastFailureTime atomic.Int64 // Unix timestamp of last failure
lastSuccessTime atomic.Int64 // Unix timestamp of last success
// Endpoint identification
endpoint string
config *Config
}
// newCircuitBreaker creates a new circuit breaker for an endpoint
func newCircuitBreaker(endpoint string, config *Config) *CircuitBreaker {
// Use configuration values with sensible defaults
failureThreshold := 5
resetTimeout := 60 * time.Second
maxRequests := 3
if config != nil {
failureThreshold = config.CircuitBreakerFailureThreshold
resetTimeout = config.CircuitBreakerResetTimeout
maxRequests = config.CircuitBreakerMaxRequests
}
return &CircuitBreaker{
failureThreshold: failureThreshold,
resetTimeout: resetTimeout,
maxRequests: maxRequests,
endpoint: endpoint,
config: config,
state: atomic.Int32{}, // Defaults to CircuitBreakerClosed (0)
}
}
// IsOpen returns true if the circuit breaker is open (rejecting requests)
func (cb *CircuitBreaker) IsOpen() bool {
state := CircuitBreakerState(cb.state.Load())
return state == CircuitBreakerOpen
}
// shouldAttemptReset checks if enough time has passed to attempt reset
func (cb *CircuitBreaker) shouldAttemptReset() bool {
lastFailure := time.Unix(cb.lastFailureTime.Load(), 0)
return time.Since(lastFailure) >= cb.resetTimeout
}
// Execute runs the given function with circuit breaker protection
func (cb *CircuitBreaker) Execute(fn func() error) error {
// Single atomic state load for consistency
state := CircuitBreakerState(cb.state.Load())
switch state {
case CircuitBreakerOpen:
if cb.shouldAttemptReset() {
// Attempt transition to half-open
if cb.state.CompareAndSwap(int32(CircuitBreakerOpen), int32(CircuitBreakerHalfOpen)) {
cb.requests.Store(0)
cb.successes.Store(0)
if internal.LogLevel.InfoOrAbove() {
internal.Logger.Printf(context.Background(), logs.CircuitBreakerTransitioningToHalfOpen(cb.endpoint))
}
// Fall through to half-open logic
} else {
return ErrCircuitBreakerOpen
}
} else {
return ErrCircuitBreakerOpen
}
fallthrough
case CircuitBreakerHalfOpen:
requests := cb.requests.Add(1)
if requests > int64(cb.maxRequests) {
cb.requests.Add(-1) // Revert the increment
return ErrCircuitBreakerOpen
}
}
// Execute the function with consistent state
err := fn()
if err != nil {
cb.recordFailure()
return err
}
cb.recordSuccess()
return nil
}
// recordFailure records a failure and potentially opens the circuit
func (cb *CircuitBreaker) recordFailure() {
cb.lastFailureTime.Store(time.Now().Unix())
failures := cb.failures.Add(1)
state := CircuitBreakerState(cb.state.Load())
switch state {
case CircuitBreakerClosed:
if failures >= int64(cb.failureThreshold) {
if cb.state.CompareAndSwap(int32(CircuitBreakerClosed), int32(CircuitBreakerOpen)) {
if internal.LogLevel.WarnOrAbove() {
internal.Logger.Printf(context.Background(), logs.CircuitBreakerOpened(cb.endpoint, failures))
}
}
}
case CircuitBreakerHalfOpen:
// Any failure in half-open state immediately opens the circuit
if cb.state.CompareAndSwap(int32(CircuitBreakerHalfOpen), int32(CircuitBreakerOpen)) {
if internal.LogLevel.WarnOrAbove() {
internal.Logger.Printf(context.Background(), logs.CircuitBreakerReopened(cb.endpoint))
}
}
}
}
// recordSuccess records a success and potentially closes the circuit
func (cb *CircuitBreaker) recordSuccess() {
cb.lastSuccessTime.Store(time.Now().Unix())
state := CircuitBreakerState(cb.state.Load())
switch state {
case CircuitBreakerClosed:
// Reset failure count on success in closed state
cb.failures.Store(0)
case CircuitBreakerHalfOpen:
successes := cb.successes.Add(1)
// If we've had enough successful requests, close the circuit
if successes >= int64(cb.maxRequests) {
if cb.state.CompareAndSwap(int32(CircuitBreakerHalfOpen), int32(CircuitBreakerClosed)) {
cb.failures.Store(0)
if internal.LogLevel.InfoOrAbove() {
internal.Logger.Printf(context.Background(), logs.CircuitBreakerClosed(cb.endpoint, successes))
}
}
}
}
}
// GetState returns the current state of the circuit breaker
func (cb *CircuitBreaker) GetState() CircuitBreakerState {
return CircuitBreakerState(cb.state.Load())
}
// GetStats returns current statistics for monitoring
func (cb *CircuitBreaker) GetStats() CircuitBreakerStats {
return CircuitBreakerStats{
Endpoint: cb.endpoint,
State: cb.GetState(),
Failures: cb.failures.Load(),
Successes: cb.successes.Load(),
Requests: cb.requests.Load(),
LastFailureTime: time.Unix(cb.lastFailureTime.Load(), 0),
LastSuccessTime: time.Unix(cb.lastSuccessTime.Load(), 0),
}
}
// CircuitBreakerStats provides statistics about a circuit breaker
type CircuitBreakerStats struct {
Endpoint string
State CircuitBreakerState
Failures int64
Successes int64
Requests int64
LastFailureTime time.Time
LastSuccessTime time.Time
}
// CircuitBreakerEntry wraps a circuit breaker with access tracking
type CircuitBreakerEntry struct {
breaker *CircuitBreaker
lastAccess atomic.Int64 // Unix timestamp
created time.Time
}
// CircuitBreakerManager manages circuit breakers for multiple endpoints
type CircuitBreakerManager struct {
breakers sync.Map // map[string]*CircuitBreakerEntry
config *Config
cleanupStop chan struct{}
cleanupMu sync.Mutex
lastCleanup atomic.Int64 // Unix timestamp
}
// newCircuitBreakerManager creates a new circuit breaker manager
func newCircuitBreakerManager(config *Config) *CircuitBreakerManager {
cbm := &CircuitBreakerManager{
config: config,
cleanupStop: make(chan struct{}),
}
cbm.lastCleanup.Store(time.Now().Unix())
// Start background cleanup goroutine
go cbm.cleanupLoop()
return cbm
}
// GetCircuitBreaker returns the circuit breaker for an endpoint, creating it if necessary
func (cbm *CircuitBreakerManager) GetCircuitBreaker(endpoint string) *CircuitBreaker {
now := time.Now().Unix()
if entry, ok := cbm.breakers.Load(endpoint); ok {
cbEntry := entry.(*CircuitBreakerEntry)
cbEntry.lastAccess.Store(now)
return cbEntry.breaker
}
// Create new circuit breaker with metadata
newBreaker := newCircuitBreaker(endpoint, cbm.config)
newEntry := &CircuitBreakerEntry{
breaker: newBreaker,
created: time.Now(),
}
newEntry.lastAccess.Store(now)
actual, _ := cbm.breakers.LoadOrStore(endpoint, newEntry)
return actual.(*CircuitBreakerEntry).breaker
}
// GetAllStats returns statistics for all circuit breakers
func (cbm *CircuitBreakerManager) GetAllStats() []CircuitBreakerStats {
var stats []CircuitBreakerStats
cbm.breakers.Range(func(key, value interface{}) bool {
entry := value.(*CircuitBreakerEntry)
stats = append(stats, entry.breaker.GetStats())
return true
})
return stats
}
// cleanupLoop runs background cleanup of unused circuit breakers
func (cbm *CircuitBreakerManager) cleanupLoop() {
ticker := time.NewTicker(5 * time.Minute) // Cleanup every 5 minutes
defer ticker.Stop()
for {
select {
case <-ticker.C:
cbm.cleanup()
case <-cbm.cleanupStop:
return
}
}
}
// cleanup removes circuit breakers that haven't been accessed recently
func (cbm *CircuitBreakerManager) cleanup() {
// Prevent concurrent cleanups
if !cbm.cleanupMu.TryLock() {
return
}
defer cbm.cleanupMu.Unlock()
now := time.Now()
cutoff := now.Add(-30 * time.Minute).Unix() // 30 minute TTL
var toDelete []string
count := 0
cbm.breakers.Range(func(key, value interface{}) bool {
endpoint := key.(string)
entry := value.(*CircuitBreakerEntry)
count++
// Remove if not accessed recently
if entry.lastAccess.Load() < cutoff {
toDelete = append(toDelete, endpoint)
}
return true
})
// Delete expired entries
for _, endpoint := range toDelete {
cbm.breakers.Delete(endpoint)
}
// Log cleanup results
if len(toDelete) > 0 && internal.LogLevel.InfoOrAbove() {
internal.Logger.Printf(context.Background(), logs.CircuitBreakerCleanup(len(toDelete), count))
}
cbm.lastCleanup.Store(now.Unix())
}
// Shutdown stops the cleanup goroutine
func (cbm *CircuitBreakerManager) Shutdown() {
close(cbm.cleanupStop)
}
// Reset resets all circuit breakers (useful for testing)
func (cbm *CircuitBreakerManager) Reset() {
cbm.breakers.Range(func(key, value interface{}) bool {
entry := value.(*CircuitBreakerEntry)
breaker := entry.breaker
breaker.state.Store(int32(CircuitBreakerClosed))
breaker.failures.Store(0)
breaker.successes.Store(0)
breaker.requests.Store(0)
breaker.lastFailureTime.Store(0)
breaker.lastSuccessTime.Store(0)
return true
})
}
package maintnotifications
import (
"context"
"net"
"runtime"
"strings"
"time"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/maintnotifications/logs"
)
// Mode represents the maintenance notifications mode
type Mode string
// Constants for maintenance push notifications modes
const (
ModeDisabled Mode = "disabled" // Client doesn't send CLIENT MAINT_NOTIFICATIONS ON command
ModeEnabled Mode = "enabled" // Client forcefully sends command, interrupts connection on error
ModeAuto Mode = "auto" // Client tries to send command, disables feature on error
)
// IsValid returns true if the maintenance notifications mode is valid
func (m Mode) IsValid() bool {
switch m {
case ModeDisabled, ModeEnabled, ModeAuto:
return true
default:
return false
}
}
// String returns the string representation of the mode
func (m Mode) String() string {
return string(m)
}
// EndpointType represents the type of endpoint to request in MOVING notifications
type EndpointType string
// Constants for endpoint types
const (
EndpointTypeAuto EndpointType = "auto" // Auto-detect based on connection
EndpointTypeInternalIP EndpointType = "internal-ip" // Internal IP address
EndpointTypeInternalFQDN EndpointType = "internal-fqdn" // Internal FQDN
EndpointTypeExternalIP EndpointType = "external-ip" // External IP address
EndpointTypeExternalFQDN EndpointType = "external-fqdn" // External FQDN
EndpointTypeNone EndpointType = "none" // No endpoint (reconnect with current config)
)
// IsValid returns true if the endpoint type is valid
func (e EndpointType) IsValid() bool {
switch e {
case EndpointTypeAuto, EndpointTypeInternalIP, EndpointTypeInternalFQDN,
EndpointTypeExternalIP, EndpointTypeExternalFQDN, EndpointTypeNone:
return true
default:
return false
}
}
// String returns the string representation of the endpoint type
func (e EndpointType) String() string {
return string(e)
}
// Config provides configuration options for maintenance notifications
type Config struct {
// Mode controls how client maintenance notifications are handled.
// Valid values: ModeDisabled, ModeEnabled, ModeAuto
// Default: ModeAuto
Mode Mode
// EndpointType specifies the type of endpoint to request in MOVING notifications.
// Valid values: EndpointTypeAuto, EndpointTypeInternalIP, EndpointTypeInternalFQDN,
// EndpointTypeExternalIP, EndpointTypeExternalFQDN, EndpointTypeNone
// Default: EndpointTypeAuto
EndpointType EndpointType
// RelaxedTimeout is the concrete timeout value to use during
// MIGRATING/FAILING_OVER states to accommodate increased latency.
// This applies to both read and write timeouts.
// Default: 10 seconds
RelaxedTimeout time.Duration
// HandoffTimeout is the maximum time to wait for connection handoff to complete.
// If handoff takes longer than this, the old connection will be forcibly closed.
// Default: 15 seconds (matches server-side eviction timeout)
HandoffTimeout time.Duration
// MaxWorkers is the maximum number of worker goroutines for processing handoff requests.
// Workers are created on-demand and automatically cleaned up when idle.
// If zero, defaults to min(10, PoolSize/2) to handle bursts effectively.
// If explicitly set, enforces minimum of PoolSize/2
//
// Default: min(PoolSize/2, max(10, PoolSize/3)), Minimum when set: PoolSize/2
MaxWorkers int
// HandoffQueueSize is the size of the buffered channel used to queue handoff requests.
// If the queue is full, new handoff requests will be rejected.
// Scales with both worker count and pool size for better burst handling.
//
// Default: max(20×MaxWorkers, PoolSize), capped by MaxActiveConns+1 (if set) or 5×PoolSize
// When set: minimum 200, capped by MaxActiveConns+1 (if set) or 5×PoolSize
HandoffQueueSize int
// PostHandoffRelaxedDuration is how long to keep relaxed timeouts on the new connection
// after a handoff completes. This provides additional resilience during cluster transitions.
// Default: 2 * RelaxedTimeout
PostHandoffRelaxedDuration time.Duration
// Circuit breaker configuration for endpoint failure handling
// CircuitBreakerFailureThreshold is the number of failures before opening the circuit.
// Default: 5
CircuitBreakerFailureThreshold int
// CircuitBreakerResetTimeout is how long to wait before testing if the endpoint recovered.
// Default: 60 seconds
CircuitBreakerResetTimeout time.Duration
// CircuitBreakerMaxRequests is the maximum number of requests allowed in half-open state.
// Default: 3
CircuitBreakerMaxRequests int
// MaxHandoffRetries is the maximum number of times to retry a failed handoff.
// After this many retries, the connection will be removed from the pool.
// Default: 3
MaxHandoffRetries int
}
func (c *Config) IsEnabled() bool {
return c != nil && c.Mode != ModeDisabled
}
// DefaultConfig returns a Config with sensible defaults.
func DefaultConfig() *Config {
return &Config{
Mode: ModeAuto, // Enable by default for Redis Cloud
EndpointType: EndpointTypeAuto, // Auto-detect based on connection
RelaxedTimeout: 10 * time.Second,
HandoffTimeout: 15 * time.Second,
MaxWorkers: 0, // Auto-calculated based on pool size
HandoffQueueSize: 0, // Auto-calculated based on max workers
PostHandoffRelaxedDuration: 0, // Auto-calculated based on relaxed timeout
// Circuit breaker configuration
CircuitBreakerFailureThreshold: 5,
CircuitBreakerResetTimeout: 60 * time.Second,
CircuitBreakerMaxRequests: 3,
// Connection Handoff Configuration
MaxHandoffRetries: 3,
}
}
// Validate checks if the configuration is valid.
func (c *Config) Validate() error {
if c.RelaxedTimeout <= 0 {
return ErrInvalidRelaxedTimeout
}
if c.HandoffTimeout <= 0 {
return ErrInvalidHandoffTimeout
}
// Validate worker configuration
// Allow 0 for auto-calculation, but negative values are invalid
if c.MaxWorkers < 0 {
return ErrInvalidHandoffWorkers
}
// HandoffQueueSize validation - allow 0 for auto-calculation
if c.HandoffQueueSize < 0 {
return ErrInvalidHandoffQueueSize
}
if c.PostHandoffRelaxedDuration < 0 {
return ErrInvalidPostHandoffRelaxedDuration
}
// Circuit breaker validation
if c.CircuitBreakerFailureThreshold < 1 {
return ErrInvalidCircuitBreakerFailureThreshold
}
if c.CircuitBreakerResetTimeout < 0 {
return ErrInvalidCircuitBreakerResetTimeout
}
if c.CircuitBreakerMaxRequests < 1 {
return ErrInvalidCircuitBreakerMaxRequests
}
// Validate Mode (maintenance notifications mode)
if !c.Mode.IsValid() {
return ErrInvalidMaintNotifications
}
// Validate EndpointType
if !c.EndpointType.IsValid() {
return ErrInvalidEndpointType
}
// Validate configuration fields
if c.MaxHandoffRetries < 1 || c.MaxHandoffRetries > 10 {
return ErrInvalidHandoffRetries
}
return nil
}
// ApplyDefaults applies default values to any zero-value fields in the configuration.
// This ensures that partially configured structs get sensible defaults for missing fields.
func (c *Config) ApplyDefaults() *Config {
return c.ApplyDefaultsWithPoolSize(0)
}
// ApplyDefaultsWithPoolSize applies default values to any zero-value fields in the configuration,
// using the provided pool size to calculate worker defaults.
// This ensures that partially configured structs get sensible defaults for missing fields.
func (c *Config) ApplyDefaultsWithPoolSize(poolSize int) *Config {
return c.ApplyDefaultsWithPoolConfig(poolSize, 0)
}
// ApplyDefaultsWithPoolConfig applies default values to any zero-value fields in the configuration,
// using the provided pool size and max active connections to calculate worker and queue defaults.
// This ensures that partially configured structs get sensible defaults for missing fields.
func (c *Config) ApplyDefaultsWithPoolConfig(poolSize int, maxActiveConns int) *Config {
if c == nil {
return DefaultConfig().ApplyDefaultsWithPoolSize(poolSize)
}
defaults := DefaultConfig()
result := &Config{}
// Apply defaults for enum fields (empty/zero means not set)
result.Mode = defaults.Mode
if c.Mode != "" {
result.Mode = c.Mode
}
result.EndpointType = defaults.EndpointType
if c.EndpointType != "" {
result.EndpointType = c.EndpointType
}
// Apply defaults for duration fields (zero means not set)
result.RelaxedTimeout = defaults.RelaxedTimeout
if c.RelaxedTimeout > 0 {
result.RelaxedTimeout = c.RelaxedTimeout
}
result.HandoffTimeout = defaults.HandoffTimeout
if c.HandoffTimeout > 0 {
result.HandoffTimeout = c.HandoffTimeout
}
// Copy worker configuration
result.MaxWorkers = c.MaxWorkers
// Apply worker defaults based on pool size
result.applyWorkerDefaults(poolSize)
// Apply queue size defaults with new scaling approach
// Default: max(20x workers, PoolSize), capped by maxActiveConns or 5x pool size
workerBasedSize := result.MaxWorkers * 20
poolBasedSize := poolSize
result.HandoffQueueSize = max(workerBasedSize, poolBasedSize)
if c.HandoffQueueSize > 0 {
// When explicitly set: enforce minimum of 200
result.HandoffQueueSize = max(200, c.HandoffQueueSize)
}
// Cap queue size: use maxActiveConns+1 if set, otherwise 5x pool size
var queueCap int
if maxActiveConns > 0 {
queueCap = maxActiveConns + 1
// Ensure queue cap is at least 2 for very small maxActiveConns
if queueCap < 2 {
queueCap = 2
}
} else {
queueCap = poolSize * 5
}
result.HandoffQueueSize = min(result.HandoffQueueSize, queueCap)
// Ensure minimum queue size of 2 (fallback for very small pools)
if result.HandoffQueueSize < 2 {
result.HandoffQueueSize = 2
}
result.PostHandoffRelaxedDuration = result.RelaxedTimeout * 2
if c.PostHandoffRelaxedDuration > 0 {
result.PostHandoffRelaxedDuration = c.PostHandoffRelaxedDuration
}
// Apply defaults for configuration fields
result.MaxHandoffRetries = defaults.MaxHandoffRetries
if c.MaxHandoffRetries > 0 {
result.MaxHandoffRetries = c.MaxHandoffRetries
}
// Circuit breaker configuration
result.CircuitBreakerFailureThreshold = defaults.CircuitBreakerFailureThreshold
if c.CircuitBreakerFailureThreshold > 0 {
result.CircuitBreakerFailureThreshold = c.CircuitBreakerFailureThreshold
}
result.CircuitBreakerResetTimeout = defaults.CircuitBreakerResetTimeout
if c.CircuitBreakerResetTimeout > 0 {
result.CircuitBreakerResetTimeout = c.CircuitBreakerResetTimeout
}
result.CircuitBreakerMaxRequests = defaults.CircuitBreakerMaxRequests
if c.CircuitBreakerMaxRequests > 0 {
result.CircuitBreakerMaxRequests = c.CircuitBreakerMaxRequests
}
if internal.LogLevel.DebugOrAbove() {
internal.Logger.Printf(context.Background(), logs.DebugLoggingEnabled())
internal.Logger.Printf(context.Background(), logs.ConfigDebug(result))
}
return result
}
// Clone creates a deep copy of the configuration.
func (c *Config) Clone() *Config {
if c == nil {
return DefaultConfig()
}
return &Config{
Mode: c.Mode,
EndpointType: c.EndpointType,
RelaxedTimeout: c.RelaxedTimeout,
HandoffTimeout: c.HandoffTimeout,
MaxWorkers: c.MaxWorkers,
HandoffQueueSize: c.HandoffQueueSize,
PostHandoffRelaxedDuration: c.PostHandoffRelaxedDuration,
// Circuit breaker configuration
CircuitBreakerFailureThreshold: c.CircuitBreakerFailureThreshold,
CircuitBreakerResetTimeout: c.CircuitBreakerResetTimeout,
CircuitBreakerMaxRequests: c.CircuitBreakerMaxRequests,
// Configuration fields
MaxHandoffRetries: c.MaxHandoffRetries,
}
}
// applyWorkerDefaults calculates and applies worker defaults based on pool size
func (c *Config) applyWorkerDefaults(poolSize int) {
// Calculate defaults based on pool size
if poolSize <= 0 {
poolSize = 10 * runtime.GOMAXPROCS(0)
}
// When not set: min(poolSize/2, max(10, poolSize/3)) - balanced scaling approach
originalMaxWorkers := c.MaxWorkers
c.MaxWorkers = min(poolSize/2, max(10, poolSize/3))
if originalMaxWorkers != 0 {
// When explicitly set: max(poolSize/2, set_value) - ensure at least poolSize/2 workers
c.MaxWorkers = max(poolSize/2, originalMaxWorkers)
}
// Ensure minimum of 1 worker (fallback for very small pools)
if c.MaxWorkers < 1 {
c.MaxWorkers = 1
}
}
// DetectEndpointType automatically detects the appropriate endpoint type
// based on the connection address and TLS configuration.
//
// For IP addresses:
// - If TLS is enabled: requests FQDN for proper certificate validation
// - If TLS is disabled: requests IP for better performance
//
// For hostnames:
// - If TLS is enabled: always requests FQDN for proper certificate validation
// - If TLS is disabled: requests IP for better performance
//
// Internal vs External detection:
// - For IPs: uses private IP range detection
// - For hostnames: uses heuristics based on common internal naming patterns
func DetectEndpointType(addr string, tlsEnabled bool) EndpointType {
// Extract host from "host:port" format
host, _, err := net.SplitHostPort(addr)
if err != nil {
host = addr // Assume no port
}
// Check if the host is an IP address or hostname
ip := net.ParseIP(host)
isIPAddress := ip != nil
var endpointType EndpointType
if isIPAddress {
// Address is an IP - determine if it's private or public
isPrivate := ip.IsPrivate() || ip.IsLoopback() || ip.IsLinkLocalUnicast()
if tlsEnabled {
// TLS with IP addresses - still prefer FQDN for certificate validation
if isPrivate {
endpointType = EndpointTypeInternalFQDN
} else {
endpointType = EndpointTypeExternalFQDN
}
} else {
// No TLS - can use IP addresses directly
if isPrivate {
endpointType = EndpointTypeInternalIP
} else {
endpointType = EndpointTypeExternalIP
}
}
} else {
// Address is a hostname
isInternalHostname := isInternalHostname(host)
if isInternalHostname {
endpointType = EndpointTypeInternalFQDN
} else {
endpointType = EndpointTypeExternalFQDN
}
}
return endpointType
}
// isInternalHostname determines if a hostname appears to be internal/private.
// This is a heuristic based on common naming patterns.
func isInternalHostname(hostname string) bool {
// Convert to lowercase for comparison
hostname = strings.ToLower(hostname)
// Common internal hostname patterns
internalPatterns := []string{
"localhost",
".local",
".internal",
".corp",
".lan",
".intranet",
".private",
}
// Check for exact match or suffix match
for _, pattern := range internalPatterns {
if hostname == pattern || strings.HasSuffix(hostname, pattern) {
return true
}
}
// Check for RFC 1918 style hostnames (e.g., redis-1, db-server, etc.)
// If hostname doesn't contain dots, it's likely internal
if !strings.Contains(hostname, ".") {
return true
}
// Default to external for fully qualified domain names
return false
}
package maintnotifications
import (
"context"
"fmt"
"time"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/maintnotifications/logs"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/push"
)
// contextKey is a custom type for context keys to avoid collisions
type contextKey string
const (
startTimeKey contextKey = "maint_notif_start_time"
)
// MetricsHook collects metrics about notification processing.
type MetricsHook struct {
NotificationCounts map[string]int64
ProcessingTimes map[string]time.Duration
ErrorCounts map[string]int64
HandoffCounts int64 // Total handoffs initiated
HandoffSuccesses int64 // Successful handoffs
HandoffFailures int64 // Failed handoffs
}
// NewMetricsHook creates a new metrics collection hook.
func NewMetricsHook() *MetricsHook {
return &MetricsHook{
NotificationCounts: make(map[string]int64),
ProcessingTimes: make(map[string]time.Duration),
ErrorCounts: make(map[string]int64),
}
}
// PreHook records the start time for processing metrics.
func (mh *MetricsHook) PreHook(ctx context.Context, notificationCtx push.NotificationHandlerContext, notificationType string, notification []interface{}) ([]interface{}, bool) {
mh.NotificationCounts[notificationType]++
// Log connection information if available
if conn, ok := notificationCtx.Conn.(*pool.Conn); ok {
internal.Logger.Printf(ctx, logs.MetricsHookProcessingNotification(notificationType, conn.GetID()))
}
// Store start time in context for duration calculation
startTime := time.Now()
_ = context.WithValue(ctx, startTimeKey, startTime) // Context not used further
return notification, true
}
// PostHook records processing completion and any errors.
func (mh *MetricsHook) PostHook(ctx context.Context, notificationCtx push.NotificationHandlerContext, notificationType string, notification []interface{}, result error) {
// Calculate processing duration
if startTime, ok := ctx.Value(startTimeKey).(time.Time); ok {
duration := time.Since(startTime)
mh.ProcessingTimes[notificationType] = duration
}
// Record errors
if result != nil {
mh.ErrorCounts[notificationType]++
// Log error details with connection information
if conn, ok := notificationCtx.Conn.(*pool.Conn); ok {
internal.Logger.Printf(ctx, logs.MetricsHookRecordedError(notificationType, conn.GetID(), result))
}
}
}
// GetMetrics returns a summary of collected metrics.
func (mh *MetricsHook) GetMetrics() map[string]interface{} {
return map[string]interface{}{
"notification_counts": mh.NotificationCounts,
"processing_times": mh.ProcessingTimes,
"error_counts": mh.ErrorCounts,
}
}
// ExampleCircuitBreakerMonitor demonstrates how to monitor circuit breaker status
func ExampleCircuitBreakerMonitor(poolHook *PoolHook) {
// Get circuit breaker statistics
stats := poolHook.GetCircuitBreakerStats()
for _, stat := range stats {
fmt.Printf("Circuit Breaker for %s:\n", stat.Endpoint)
fmt.Printf(" State: %s\n", stat.State)
fmt.Printf(" Failures: %d\n", stat.Failures)
fmt.Printf(" Last Failure: %v\n", stat.LastFailureTime)
fmt.Printf(" Last Success: %v\n", stat.LastSuccessTime)
// Alert if circuit breaker is open
if stat.State.String() == "open" {
fmt.Printf(" ⚠️ ALERT: Circuit breaker is OPEN for %s\n", stat.Endpoint)
}
}
}
package maintnotifications
import (
"context"
"errors"
"net"
"sync"
"sync/atomic"
"time"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/maintnotifications/logs"
"github.com/redis/go-redis/v9/internal/pool"
)
// PoolNameMain is the name used for the main connection pool in metrics.
const PoolNameMain = "main"
// handoffWorkerManager manages background workers and queue for connection handoffs
type handoffWorkerManager struct {
// Event-driven handoff support
handoffQueue chan HandoffRequest // Queue for handoff requests
shutdown chan struct{} // Shutdown signal
shutdownOnce sync.Once // Ensure clean shutdown
workerWg sync.WaitGroup // Track worker goroutines
// On-demand worker management
maxWorkers int
activeWorkers atomic.Int32
workerTimeout time.Duration // How long workers wait for work before exiting
workersScaling atomic.Bool
// Simple state tracking
pending sync.Map // map[uint64]int64 (connID -> seqID)
// Configuration for the maintenance notifications
config *Config
// Pool hook reference for handoff processing
poolHook *PoolHook
// Circuit breaker manager for endpoint failure handling
circuitBreakerManager *CircuitBreakerManager
}
// newHandoffWorkerManager creates a new handoff worker manager
func newHandoffWorkerManager(config *Config, poolHook *PoolHook) *handoffWorkerManager {
return &handoffWorkerManager{
handoffQueue: make(chan HandoffRequest, config.HandoffQueueSize),
shutdown: make(chan struct{}),
maxWorkers: config.MaxWorkers,
activeWorkers: atomic.Int32{}, // Start with no workers - create on demand
workerTimeout: 15 * time.Second, // Workers exit after 15s of inactivity
config: config,
poolHook: poolHook,
circuitBreakerManager: newCircuitBreakerManager(config),
}
}
// getCurrentWorkers returns the current number of active workers (for testing)
func (hwm *handoffWorkerManager) getCurrentWorkers() int {
return int(hwm.activeWorkers.Load())
}
// getPendingMap returns the pending map for testing purposes
func (hwm *handoffWorkerManager) getPendingMap() *sync.Map {
return &hwm.pending
}
// getMaxWorkers returns the max workers for testing purposes
func (hwm *handoffWorkerManager) getMaxWorkers() int {
return hwm.maxWorkers
}
// getHandoffQueue returns the handoff queue for testing purposes
func (hwm *handoffWorkerManager) getHandoffQueue() chan HandoffRequest {
return hwm.handoffQueue
}
// getCircuitBreakerStats returns circuit breaker statistics for monitoring
func (hwm *handoffWorkerManager) getCircuitBreakerStats() []CircuitBreakerStats {
return hwm.circuitBreakerManager.GetAllStats()
}
// resetCircuitBreakers resets all circuit breakers (useful for testing)
func (hwm *handoffWorkerManager) resetCircuitBreakers() {
hwm.circuitBreakerManager.Reset()
}
// isHandoffPending returns true if the given connection has a pending handoff
func (hwm *handoffWorkerManager) isHandoffPending(conn *pool.Conn) bool {
_, pending := hwm.pending.Load(conn.GetID())
return pending
}
// ensureWorkerAvailable ensures at least one worker is available to process requests
// Creates a new worker if needed and under the max limit
func (hwm *handoffWorkerManager) ensureWorkerAvailable() {
select {
case <-hwm.shutdown:
return
default:
if hwm.workersScaling.CompareAndSwap(false, true) {
defer hwm.workersScaling.Store(false)
// Check if we need a new worker
currentWorkers := hwm.activeWorkers.Load()
workersWas := currentWorkers
for currentWorkers < int32(hwm.maxWorkers) {
hwm.workerWg.Add(1)
go hwm.onDemandWorker()
currentWorkers++
}
// workersWas is always <= currentWorkers
// currentWorkers will be maxWorkers, but if we have a worker that was closed
// while we were creating new workers, just add the difference between
// the currentWorkers and the number of workers we observed initially (i.e. the number of workers we created)
hwm.activeWorkers.Add(currentWorkers - workersWas)
}
}
}
// onDemandWorker processes handoff requests and exits when idle
func (hwm *handoffWorkerManager) onDemandWorker() {
defer func() {
// Handle panics to ensure proper cleanup
if r := recover(); r != nil {
internal.Logger.Printf(context.Background(), logs.WorkerPanicRecovered(r))
}
// Decrement active worker count when exiting
hwm.activeWorkers.Add(-1)
hwm.workerWg.Done()
}()
// Create reusable timer to prevent timer leaks
timer := time.NewTimer(hwm.workerTimeout)
defer timer.Stop()
for {
// Reset timer for next iteration
if !timer.Stop() {
select {
case <-timer.C:
default:
}
}
timer.Reset(hwm.workerTimeout)
select {
case <-hwm.shutdown:
if internal.LogLevel.InfoOrAbove() {
internal.Logger.Printf(context.Background(), logs.WorkerExitingDueToShutdown())
}
return
case <-timer.C:
// Worker has been idle for too long, exit to save resources
if internal.LogLevel.InfoOrAbove() {
internal.Logger.Printf(context.Background(), logs.WorkerExitingDueToInactivityTimeout(hwm.workerTimeout))
}
return
case request := <-hwm.handoffQueue:
// Check for shutdown before processing
select {
case <-hwm.shutdown:
if internal.LogLevel.InfoOrAbove() {
internal.Logger.Printf(context.Background(), logs.WorkerExitingDueToShutdownWhileProcessing())
}
// Clean up the request before exiting
hwm.pending.Delete(request.ConnID)
return
default:
// Process the request
hwm.processHandoffRequest(request)
}
}
}
}
// processHandoffRequest processes a single handoff request
func (hwm *handoffWorkerManager) processHandoffRequest(request HandoffRequest) {
if internal.LogLevel.InfoOrAbove() {
internal.Logger.Printf(context.Background(), logs.HandoffStarted(request.Conn.GetID(), request.Endpoint))
}
// Create a context with handoff timeout from config
handoffTimeout := 15 * time.Second // Default timeout
if hwm.config != nil && hwm.config.HandoffTimeout > 0 {
handoffTimeout = hwm.config.HandoffTimeout
}
ctx, cancel := context.WithTimeout(context.Background(), handoffTimeout)
defer cancel()
// Create a context that also respects the shutdown signal
shutdownCtx, shutdownCancel := context.WithCancel(ctx)
defer shutdownCancel()
// Monitor shutdown signal in a separate goroutine
go func() {
select {
case <-hwm.shutdown:
shutdownCancel()
case <-shutdownCtx.Done():
}
}()
// Perform the handoff with cancellable context
shouldRetry, err := hwm.performConnectionHandoff(shutdownCtx, request.Conn)
minRetryBackoff := 500 * time.Millisecond
if err != nil {
if shouldRetry {
now := time.Now()
deadline, ok := shutdownCtx.Deadline()
thirdOfTimeout := handoffTimeout / 3
if !ok || deadline.Before(now) {
// wait half the timeout before retrying if no deadline or deadline has passed
deadline = now.Add(thirdOfTimeout)
}
afterTime := deadline.Sub(now)
if afterTime < minRetryBackoff {
afterTime = minRetryBackoff
}
if internal.LogLevel.InfoOrAbove() {
// Get current retry count for better logging
currentRetries := request.Conn.HandoffRetries()
maxRetries := 3 // Default fallback
if hwm.config != nil {
maxRetries = hwm.config.MaxHandoffRetries
}
internal.Logger.Printf(context.Background(), logs.HandoffFailed(request.ConnID, request.Endpoint, currentRetries, maxRetries, err))
}
// Schedule retry - keep connection in pending map until retry is queued
time.AfterFunc(afterTime, func() {
if err := hwm.queueHandoff(request.Conn); err != nil {
if internal.LogLevel.WarnOrAbove() {
internal.Logger.Printf(context.Background(), logs.CannotQueueHandoffForRetry(err))
}
// Failed to queue retry - remove from pending and close connection
hwm.pending.Delete(request.Conn.GetID())
hwm.closeConnFromRequest(context.Background(), request, err)
} else {
// Successfully queued retry - remove from pending (will be re-added by queueHandoff)
hwm.pending.Delete(request.Conn.GetID())
}
})
return
} else {
// Won't retry - remove from pending and close connection
hwm.pending.Delete(request.Conn.GetID())
go hwm.closeConnFromRequest(ctx, request, err)
}
// Clear handoff state if not returned for retry
seqID := request.Conn.GetMovingSeqID()
connID := request.Conn.GetID()
if hwm.poolHook.operationsManager != nil {
hwm.poolHook.operationsManager.UntrackOperationWithConnID(seqID, connID)
}
} else {
// Success - remove from pending map
hwm.pending.Delete(request.Conn.GetID())
}
}
// queueHandoff queues a handoff request for processing
// if err is returned, connection will be removed from pool
func (hwm *handoffWorkerManager) queueHandoff(conn *pool.Conn) error {
// Get handoff info atomically to prevent race conditions
shouldHandoff, endpoint, seqID := conn.GetHandoffInfo()
// on retries the connection will not be marked for handoff, but it will have retries > 0
// if shouldHandoff is false and retries is 0, then we are not retrying and not do a handoff
if !shouldHandoff && conn.HandoffRetries() == 0 {
if internal.LogLevel.InfoOrAbove() {
internal.Logger.Printf(context.Background(), logs.ConnectionNotMarkedForHandoff(conn.GetID()))
}
return errors.New(logs.ConnectionNotMarkedForHandoffError(conn.GetID()))
}
// Create handoff request with atomically retrieved data
request := HandoffRequest{
Conn: conn,
ConnID: conn.GetID(),
Endpoint: endpoint,
SeqID: seqID,
Pool: hwm.poolHook.pool, // Include pool for connection removal on failure
}
select {
// priority to shutdown
case <-hwm.shutdown:
return ErrShutdown
default:
select {
case <-hwm.shutdown:
return ErrShutdown
case hwm.handoffQueue <- request:
// Store in pending map
hwm.pending.Store(request.ConnID, request.SeqID)
// Ensure we have a worker to process this request
hwm.ensureWorkerAvailable()
return nil
default:
select {
case <-hwm.shutdown:
return ErrShutdown
case hwm.handoffQueue <- request:
// Store in pending map
hwm.pending.Store(request.ConnID, request.SeqID)
// Ensure we have a worker to process this request
hwm.ensureWorkerAvailable()
return nil
case <-time.After(100 * time.Millisecond): // give workers a chance to process
// Queue is full - log and attempt scaling
queueLen := len(hwm.handoffQueue)
queueCap := cap(hwm.handoffQueue)
if internal.LogLevel.WarnOrAbove() {
internal.Logger.Printf(context.Background(), logs.HandoffQueueFull(queueLen, queueCap))
}
}
}
}
// Ensure we have workers available to handle the load
hwm.ensureWorkerAvailable()
return ErrHandoffQueueFull
}
// shutdownWorkers gracefully shuts down the worker manager, waiting for workers to complete
func (hwm *handoffWorkerManager) shutdownWorkers(ctx context.Context) error {
hwm.shutdownOnce.Do(func() {
close(hwm.shutdown)
// workers will exit when they finish their current request
// Shutdown circuit breaker manager cleanup goroutine
if hwm.circuitBreakerManager != nil {
hwm.circuitBreakerManager.Shutdown()
}
})
// Wait for workers to complete
done := make(chan struct{})
go func() {
hwm.workerWg.Wait()
close(done)
}()
select {
case <-done:
return nil
case <-ctx.Done():
return ctx.Err()
}
}
// performConnectionHandoff performs the actual connection handoff
// When error is returned, the connection handoff should be retried if err is not ErrMaxHandoffRetriesReached
func (hwm *handoffWorkerManager) performConnectionHandoff(ctx context.Context, conn *pool.Conn) (shouldRetry bool, err error) {
// Clear handoff state after successful handoff
connID := conn.GetID()
newEndpoint := conn.GetHandoffEndpoint()
if newEndpoint == "" {
return false, ErrConnectionInvalidHandoffState
}
// Use circuit breaker to protect against failing endpoints
circuitBreaker := hwm.circuitBreakerManager.GetCircuitBreaker(newEndpoint)
// Check if circuit breaker is open before attempting handoff
if circuitBreaker.IsOpen() {
internal.Logger.Printf(ctx, logs.CircuitBreakerOpen(connID, newEndpoint))
return false, ErrCircuitBreakerOpen // Don't retry when circuit breaker is open
}
// Perform the handoff
shouldRetry, err = hwm.performHandoffInternal(ctx, conn, newEndpoint, connID)
// Update circuit breaker based on result
if err != nil {
// Only track dial/network errors in circuit breaker, not initialization errors
if shouldRetry {
circuitBreaker.recordFailure()
}
return shouldRetry, err
}
// Success - record in circuit breaker
circuitBreaker.recordSuccess()
return false, nil
}
// performHandoffInternal performs the actual handoff logic (extracted for circuit breaker integration)
func (hwm *handoffWorkerManager) performHandoffInternal(
ctx context.Context,
conn *pool.Conn,
newEndpoint string,
connID uint64,
) (shouldRetry bool, err error) {
retries := conn.IncrementAndGetHandoffRetries(1)
internal.Logger.Printf(ctx, logs.HandoffRetryAttempt(connID, retries, newEndpoint, conn.RemoteAddr().String()))
maxRetries := 3 // Default fallback
if hwm.config != nil {
maxRetries = hwm.config.MaxHandoffRetries
}
if retries > maxRetries {
if internal.LogLevel.WarnOrAbove() {
internal.Logger.Printf(ctx, logs.ReachedMaxHandoffRetries(connID, newEndpoint, maxRetries))
}
// won't retry on ErrMaxHandoffRetriesReached
return false, ErrMaxHandoffRetriesReached
}
// Create endpoint-specific dialer
endpointDialer := hwm.createEndpointDialer(newEndpoint)
// Create new connection to the new endpoint
newNetConn, err := endpointDialer(ctx)
if err != nil {
internal.Logger.Printf(ctx, logs.FailedToDialNewEndpoint(connID, newEndpoint, err))
// will retry
// Maybe a network error - retry after a delay
return true, err
}
// Get the old connection
oldConn := conn.GetNetConn()
// Apply relaxed timeout to the new connection for the configured post-handoff duration
// This gives the new connection more time to handle operations during cluster transition
// Setting this here (before initing the connection) ensures that the connection is going
// to use the relaxed timeout for the first operation (auth/ACL select)
if hwm.config != nil && hwm.config.PostHandoffRelaxedDuration > 0 {
relaxedTimeout := hwm.config.RelaxedTimeout
// Set relaxed timeout with deadline - no background goroutine needed
deadline := time.Now().Add(hwm.config.PostHandoffRelaxedDuration)
conn.SetRelaxedTimeoutWithDeadline(relaxedTimeout, relaxedTimeout, deadline)
// Record relaxed timeout metric (post-handoff)
if relaxedTimeoutCallback := pool.GetMetricConnectionRelaxedTimeoutCallback(); relaxedTimeoutCallback != nil {
relaxedTimeoutCallback(ctx, 1, conn, PoolNameMain, "HANDOFF")
}
if internal.LogLevel.InfoOrAbove() {
internal.Logger.Printf(context.Background(), logs.ApplyingRelaxedTimeoutDueToPostHandoff(connID, relaxedTimeout, deadline.Format("15:04:05.000")))
}
}
// Replace the connection and execute initialization
err = conn.SetNetConnAndInitConn(ctx, newNetConn)
if err != nil {
// won't retry
// Initialization failed - remove the connection
return false, err
}
defer func() {
if oldConn != nil {
oldConn.Close()
}
}()
// Clear handoff state will:
// - set the connection as usable again
// - clear the handoff state (shouldHandoff, endpoint, seqID)
// - reset the handoff retries to 0
// Note: Theoretically there may be a short window where the connection is in the pool
// and IDLE (initConn completed) but still has handoff state set.
conn.ClearHandoffState()
internal.Logger.Printf(ctx, logs.HandoffSucceeded(connID, newEndpoint))
// successfully completed the handoff, no retry needed and no error
// Notify metrics: connection handoff succeeded
if handoffCallback := pool.GetMetricConnectionHandoffCallback(); handoffCallback != nil {
handoffCallback(ctx, conn, PoolNameMain)
}
return false, nil
}
// createEndpointDialer creates a dialer function that connects to a specific endpoint
func (hwm *handoffWorkerManager) createEndpointDialer(endpoint string) func(context.Context) (net.Conn, error) {
return func(ctx context.Context) (net.Conn, error) {
// Parse endpoint to extract host and port
host, port, err := net.SplitHostPort(endpoint)
if err != nil {
// If no port specified, assume default Redis port
host = endpoint
if port == "" {
port = "6379"
}
}
// Use the base dialer to connect to the new endpoint
return hwm.poolHook.baseDialer(ctx, hwm.poolHook.network, net.JoinHostPort(host, port))
}
}
// closeConnFromRequest closes the connection and logs the reason
func (hwm *handoffWorkerManager) closeConnFromRequest(ctx context.Context, request HandoffRequest, err error) {
pooler := request.Pool
conn := request.Conn
// Clear handoff state before closing
conn.ClearHandoffState()
if pooler != nil {
// Use RemoveWithoutTurn instead of Remove to avoid freeing a turn that we don't have.
// The handoff worker doesn't call Get(), so it doesn't have a turn to free.
// Remove() is meant to be called after Get() and frees a turn.
// RemoveWithoutTurn() removes and closes the connection without affecting the queue.
pooler.RemoveWithoutTurn(ctx, conn, err)
if internal.LogLevel.WarnOrAbove() {
internal.Logger.Printf(ctx, logs.RemovingConnectionFromPool(conn.GetID(), err))
}
} else {
errClose := conn.Close() // Close the connection if no pool provided
if errClose != nil {
internal.Logger.Printf(ctx, "redis: failed to close connection: %v", errClose)
}
if internal.LogLevel.WarnOrAbove() {
internal.Logger.Printf(ctx, logs.NoPoolProvidedCannotRemove(conn.GetID(), err))
}
}
}
package maintnotifications
import (
"context"
"slices"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/maintnotifications/logs"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/push"
)
// LoggingHook is an example hook implementation that logs all notifications.
type LoggingHook struct {
LogLevel int // 0=Error, 1=Warn, 2=Info, 3=Debug
}
// PreHook logs the notification before processing and allows modification.
func (lh *LoggingHook) PreHook(ctx context.Context, notificationCtx push.NotificationHandlerContext, notificationType string, notification []interface{}) ([]interface{}, bool) {
if lh.LogLevel >= 2 { // Info level
// Log the notification type and content
connID := uint64(0)
if conn, ok := notificationCtx.Conn.(*pool.Conn); ok {
connID = conn.GetID()
}
seqID := int64(0)
if slices.Contains(maintenanceNotificationTypes, notificationType) {
// seqID is the second element in the notification array
if len(notification) > 1 {
if parsedSeqID, ok := notification[1].(int64); !ok {
seqID = 0
} else {
seqID = parsedSeqID
}
}
}
internal.Logger.Printf(ctx, logs.ProcessingNotification(connID, seqID, notificationType, notification))
}
return notification, true // Continue processing with unmodified notification
}
// PostHook logs the result after processing.
func (lh *LoggingHook) PostHook(ctx context.Context, notificationCtx push.NotificationHandlerContext, notificationType string, notification []interface{}, result error) {
connID := uint64(0)
if conn, ok := notificationCtx.Conn.(*pool.Conn); ok {
connID = conn.GetID()
}
if result != nil && lh.LogLevel >= 1 { // Warning level
internal.Logger.Printf(ctx, logs.ProcessingNotificationFailed(connID, notificationType, result, notification))
} else if lh.LogLevel >= 3 { // Debug level
internal.Logger.Printf(ctx, logs.ProcessingNotificationSucceeded(connID, notificationType))
}
}
// NewLoggingHook creates a new logging hook with the specified log level.
// Log levels: 0=Error, 1=Warn, 2=Info, 3=Debug
func NewLoggingHook(logLevel int) *LoggingHook {
return &LoggingHook{LogLevel: logLevel}
}
package maintnotifications
import (
"context"
"errors"
"fmt"
"net"
"sync"
"sync/atomic"
"time"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/interfaces"
"github.com/redis/go-redis/v9/internal/maintnotifications/logs"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/push"
)
// Push notification type constants for maintenance
const (
NotificationMoving = "MOVING" // Per-connection handoff notification
NotificationMigrating = "MIGRATING" // Per-connection migration start notification - relaxes timeouts
NotificationMigrated = "MIGRATED" // Per-connection migration complete notification - clears relaxed timeouts
NotificationFailingOver = "FAILING_OVER" // Per-connection failover start notification - relaxes timeouts
NotificationFailedOver = "FAILED_OVER" // Per-connection failover complete notification - clears relaxed timeouts
NotificationSMigrating = "SMIGRATING" // Cluster slot migrating notification - relaxes timeouts
NotificationSMigrated = "SMIGRATED" // Cluster slot migrated notification - unrelaxes timeouts and triggers cluster state reload
)
// maintenanceNotificationTypes contains all notification types that maintenance handles
var maintenanceNotificationTypes = []string{
NotificationMoving,
NotificationMigrating,
NotificationMigrated,
NotificationFailingOver,
NotificationFailedOver,
NotificationSMigrating,
NotificationSMigrated,
}
// NotificationHook is called before and after notification processing
// PreHook can modify the notification and return false to skip processing
// PostHook is called after successful processing
type NotificationHook interface {
PreHook(ctx context.Context, notificationCtx push.NotificationHandlerContext, notificationType string, notification []interface{}) ([]interface{}, bool)
PostHook(ctx context.Context, notificationCtx push.NotificationHandlerContext, notificationType string, notification []interface{}, result error)
}
// MovingOperationKey provides a unique key for tracking MOVING operations
// that combines sequence ID with connection identifier to handle duplicate
// sequence IDs across multiple connections to the same node.
type MovingOperationKey struct {
SeqID int64 // Sequence ID from MOVING notification
ConnID uint64 // Unique connection identifier
}
// String returns a string representation of the key for debugging
func (k MovingOperationKey) String() string {
return fmt.Sprintf("seq:%d-conn:%d", k.SeqID, k.ConnID)
}
// Manager provides a simplified upgrade functionality with hooks and atomic state.
type Manager struct {
client interfaces.ClientInterface
config *Config
options interfaces.OptionsInterface
pool pool.Pooler
// MOVING operation tracking - using sync.Map for better concurrent performance
activeMovingOps sync.Map // map[MovingOperationKey]*MovingOperation
// SMIGRATED notification deduplication - tracks processed SeqIDs
// Multiple connections may receive the same SMIGRATED notification
processedSMigratedSeqIDs sync.Map // map[int64]bool
// Atomic state tracking - no locks needed for state queries
activeOperationCount atomic.Int64 // Number of active operations
closed atomic.Bool // Manager closed state
// Notification hooks for extensibility
hooks []NotificationHook
hooksMu sync.RWMutex // Protects hooks slice
poolHooksRef *PoolHook
// Cluster state reload callback for SMIGRATED notifications
clusterStateReloadCallback ClusterStateReloadCallback
}
// MovingOperation tracks an active MOVING operation.
type MovingOperation struct {
SeqID int64
NewEndpoint string
StartTime time.Time
Deadline time.Time
}
// ClusterStateReloadCallback is a callback function that triggers cluster state reload.
// This is used by node clients to notify their parent ClusterClient about SMIGRATED notifications.
// The hostPort parameter indicates the destination node (e.g., "127.0.0.1:6379").
// The slotRanges parameter contains the migrated slots (e.g., ["1234", "5000-6000"]).
// Currently, implementations typically reload the entire cluster state, but in the future
// this could be optimized to reload only the specific slots.
type ClusterStateReloadCallback func(ctx context.Context, hostPort string, slotRanges []string)
// NewManager creates a new simplified manager.
func NewManager(client interfaces.ClientInterface, pool pool.Pooler, config *Config) (*Manager, error) {
if client == nil {
return nil, ErrInvalidClient
}
hm := &Manager{
client: client,
pool: pool,
options: client.GetOptions(),
config: config.Clone(),
hooks: make([]NotificationHook, 0),
}
// Set up push notification handling
if err := hm.setupPushNotifications(); err != nil {
return nil, err
}
return hm, nil
}
// GetPoolHook creates a pool hook with a custom dialer.
func (hm *Manager) InitPoolHook(baseDialer func(context.Context, string, string) (net.Conn, error)) {
poolHook := hm.createPoolHook(baseDialer)
hm.pool.AddPoolHook(poolHook)
}
// setupPushNotifications sets up push notification handling by registering with the client's processor.
func (hm *Manager) setupPushNotifications() error {
processor := hm.client.GetPushProcessor()
if processor == nil {
return ErrInvalidClient // Client doesn't support push notifications
}
// Create our notification handler
handler := &NotificationHandler{manager: hm, operationsManager: hm}
// Register handlers for all upgrade notifications with the client's processor
for _, notificationType := range maintenanceNotificationTypes {
if err := processor.RegisterHandler(notificationType, handler, true); err != nil {
return errors.New(logs.FailedToRegisterHandler(notificationType, err))
}
}
return nil
}
// TrackMovingOperationWithConnID starts a new MOVING operation with a specific connection ID.
func (hm *Manager) TrackMovingOperationWithConnID(ctx context.Context, newEndpoint string, deadline time.Time, seqID int64, connID uint64) error {
// Create composite key
key := MovingOperationKey{
SeqID: seqID,
ConnID: connID,
}
// Create MOVING operation record
movingOp := &MovingOperation{
SeqID: seqID,
NewEndpoint: newEndpoint,
StartTime: time.Now(),
Deadline: deadline,
}
// Use LoadOrStore for atomic check-and-set operation
if _, loaded := hm.activeMovingOps.LoadOrStore(key, movingOp); loaded {
// Duplicate MOVING notification, ignore
if internal.LogLevel.DebugOrAbove() { // Debug level
internal.Logger.Printf(context.Background(), logs.DuplicateMovingOperation(connID, newEndpoint, seqID))
}
return nil
}
if internal.LogLevel.DebugOrAbove() { // Debug level
internal.Logger.Printf(context.Background(), logs.TrackingMovingOperation(connID, newEndpoint, seqID))
}
// Increment active operation count atomically
hm.activeOperationCount.Add(1)
return nil
}
// UntrackOperationWithConnID completes a MOVING operation with a specific connection ID.
func (hm *Manager) UntrackOperationWithConnID(seqID int64, connID uint64) {
// Create composite key
key := MovingOperationKey{
SeqID: seqID,
ConnID: connID,
}
// Remove from active operations atomically
if _, loaded := hm.activeMovingOps.LoadAndDelete(key); loaded {
if internal.LogLevel.DebugOrAbove() { // Debug level
internal.Logger.Printf(context.Background(), logs.UntrackingMovingOperation(connID, seqID))
}
// Decrement active operation count only if operation existed
hm.activeOperationCount.Add(-1)
} else {
if internal.LogLevel.DebugOrAbove() { // Debug level
internal.Logger.Printf(context.Background(), logs.OperationNotTracked(connID, seqID))
}
}
}
// GetActiveMovingOperations returns active operations with composite keys.
// WARNING: This method creates a new map and copies all operations on every call.
// Use sparingly, especially in hot paths or high-frequency logging.
func (hm *Manager) GetActiveMovingOperations() map[MovingOperationKey]*MovingOperation {
result := make(map[MovingOperationKey]*MovingOperation)
// Iterate over sync.Map to build result
hm.activeMovingOps.Range(func(key, value interface{}) bool {
k := key.(MovingOperationKey)
op := value.(*MovingOperation)
// Create a copy to avoid sharing references
result[k] = &MovingOperation{
SeqID: op.SeqID,
NewEndpoint: op.NewEndpoint,
StartTime: op.StartTime,
Deadline: op.Deadline,
}
return true // Continue iteration
})
return result
}
// IsHandoffInProgress returns true if any handoff is in progress.
// Uses atomic counter for lock-free operation.
func (hm *Manager) IsHandoffInProgress() bool {
return hm.activeOperationCount.Load() > 0
}
// GetActiveOperationCount returns the number of active operations.
// Uses atomic counter for lock-free operation.
func (hm *Manager) GetActiveOperationCount() int64 {
return hm.activeOperationCount.Load()
}
// MarkSMigratedSeqIDProcessed attempts to mark a SMIGRATED SeqID as processed.
// Returns true if this is the first time processing this SeqID (should process),
// false if it was already processed (should skip).
// This prevents duplicate processing when multiple connections receive the same notification.
func (hm *Manager) MarkSMigratedSeqIDProcessed(seqID int64) bool {
_, alreadyProcessed := hm.processedSMigratedSeqIDs.LoadOrStore(seqID, true)
return !alreadyProcessed // Return true if NOT already processed
}
// Close closes the manager.
func (hm *Manager) Close() error {
// Use atomic operation for thread-safe close check
if !hm.closed.CompareAndSwap(false, true) {
return nil // Already closed
}
// Shutdown the pool hook if it exists
if hm.poolHooksRef != nil {
// Use a timeout to prevent hanging indefinitely
shutdownCtx, cancel := context.WithTimeout(context.Background(), 10*time.Second)
defer cancel()
err := hm.poolHooksRef.Shutdown(shutdownCtx)
if err != nil {
// was not able to close pool hook, keep closed state false
hm.closed.Store(false)
return err
}
// Remove the pool hook from the pool
if hm.pool != nil {
hm.pool.RemovePoolHook(hm.poolHooksRef)
}
}
// Clear all active operations
hm.activeMovingOps.Range(func(key, value interface{}) bool {
hm.activeMovingOps.Delete(key)
return true
})
// Reset counter
hm.activeOperationCount.Store(0)
return nil
}
// GetState returns current state using atomic counter for lock-free operation.
func (hm *Manager) GetState() State {
if hm.activeOperationCount.Load() > 0 {
return StateMoving
}
return StateIdle
}
// processPreHooks calls all pre-hooks and returns the modified notification and whether to continue processing.
func (hm *Manager) processPreHooks(ctx context.Context, notificationCtx push.NotificationHandlerContext, notificationType string, notification []interface{}) ([]interface{}, bool) {
hm.hooksMu.RLock()
defer hm.hooksMu.RUnlock()
currentNotification := notification
for _, hook := range hm.hooks {
modifiedNotification, shouldContinue := hook.PreHook(ctx, notificationCtx, notificationType, currentNotification)
if !shouldContinue {
return modifiedNotification, false
}
currentNotification = modifiedNotification
}
return currentNotification, true
}
// processPostHooks calls all post-hooks with the processing result.
func (hm *Manager) processPostHooks(ctx context.Context, notificationCtx push.NotificationHandlerContext, notificationType string, notification []interface{}, result error) {
hm.hooksMu.RLock()
defer hm.hooksMu.RUnlock()
for _, hook := range hm.hooks {
hook.PostHook(ctx, notificationCtx, notificationType, notification, result)
}
}
// createPoolHook creates a pool hook with this manager already set.
func (hm *Manager) createPoolHook(baseDialer func(context.Context, string, string) (net.Conn, error)) *PoolHook {
if hm.poolHooksRef != nil {
return hm.poolHooksRef
}
// Get pool size from client options for better worker defaults
poolSize := 0
if hm.options != nil {
poolSize = hm.options.GetPoolSize()
}
hm.poolHooksRef = NewPoolHookWithPoolSize(baseDialer, hm.options.GetNetwork(), hm.config, hm, poolSize)
hm.poolHooksRef.SetPool(hm.pool)
return hm.poolHooksRef
}
func (hm *Manager) AddNotificationHook(notificationHook NotificationHook) {
hm.hooksMu.Lock()
defer hm.hooksMu.Unlock()
hm.hooks = append(hm.hooks, notificationHook)
}
// SetClusterStateReloadCallback sets the callback function that will be called when a SMIGRATED notification is received.
// This allows node clients to notify their parent ClusterClient to reload cluster state.
func (hm *Manager) SetClusterStateReloadCallback(callback ClusterStateReloadCallback) {
hm.clusterStateReloadCallback = callback
}
// TriggerClusterStateReload calls the cluster state reload callback if it's set.
// This is called when a SMIGRATED notification is received.
func (hm *Manager) TriggerClusterStateReload(ctx context.Context, hostPort string, slotRanges []string) {
if hm.clusterStateReloadCallback != nil {
hm.clusterStateReloadCallback(ctx, hostPort, slotRanges)
}
}
package maintnotifications
import (
"context"
"net"
"sync"
"time"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/maintnotifications/logs"
"github.com/redis/go-redis/v9/internal/pool"
)
// OperationsManagerInterface defines the interface for completing handoff operations
type OperationsManagerInterface interface {
TrackMovingOperationWithConnID(ctx context.Context, newEndpoint string, deadline time.Time, seqID int64, connID uint64) error
UntrackOperationWithConnID(seqID int64, connID uint64)
}
// HandoffRequest represents a request to handoff a connection to a new endpoint
type HandoffRequest struct {
Conn *pool.Conn
ConnID uint64 // Unique connection identifier
Endpoint string
SeqID int64
Pool pool.Pooler // Pool to remove connection from on failure
}
// PoolHook implements pool.PoolHook for Redis-specific connection handling
// with maintenance notifications support.
type PoolHook struct {
// Base dialer for creating connections to new endpoints during handoffs
// args are network and address
baseDialer func(context.Context, string, string) (net.Conn, error)
// Network type (e.g., "tcp", "unix")
network string
// Worker manager for background handoff processing
workerManager *handoffWorkerManager
// Configuration for the maintenance notifications
config *Config
// Operations manager interface for operation completion tracking
operationsManager OperationsManagerInterface
// Pool interface for removing connections on handoff failure
pool pool.Pooler
}
// NewPoolHook creates a new pool hook
func NewPoolHook(baseDialer func(context.Context, string, string) (net.Conn, error), network string, config *Config, operationsManager OperationsManagerInterface) *PoolHook {
return NewPoolHookWithPoolSize(baseDialer, network, config, operationsManager, 0)
}
// NewPoolHookWithPoolSize creates a new pool hook with pool size for better worker defaults
func NewPoolHookWithPoolSize(baseDialer func(context.Context, string, string) (net.Conn, error), network string, config *Config, operationsManager OperationsManagerInterface, poolSize int) *PoolHook {
// Apply defaults if config is nil or has zero values
if config == nil {
config = config.ApplyDefaultsWithPoolSize(poolSize)
}
ph := &PoolHook{
// baseDialer is used to create connections to new endpoints during handoffs
baseDialer: baseDialer,
network: network,
config: config,
operationsManager: operationsManager,
}
// Create worker manager
ph.workerManager = newHandoffWorkerManager(config, ph)
return ph
}
// SetPool sets the pool interface for removing connections on handoff failure
func (ph *PoolHook) SetPool(pooler pool.Pooler) {
ph.pool = pooler
}
// GetCurrentWorkers returns the current number of active workers (for testing)
func (ph *PoolHook) GetCurrentWorkers() int {
return ph.workerManager.getCurrentWorkers()
}
// IsHandoffPending returns true if the given connection has a pending handoff
func (ph *PoolHook) IsHandoffPending(conn *pool.Conn) bool {
return ph.workerManager.isHandoffPending(conn)
}
// GetPendingMap returns the pending map for testing purposes
func (ph *PoolHook) GetPendingMap() *sync.Map {
return ph.workerManager.getPendingMap()
}
// GetMaxWorkers returns the max workers for testing purposes
func (ph *PoolHook) GetMaxWorkers() int {
return ph.workerManager.getMaxWorkers()
}
// GetHandoffQueue returns the handoff queue for testing purposes
func (ph *PoolHook) GetHandoffQueue() chan HandoffRequest {
return ph.workerManager.getHandoffQueue()
}
// GetCircuitBreakerStats returns circuit breaker statistics for monitoring
func (ph *PoolHook) GetCircuitBreakerStats() []CircuitBreakerStats {
return ph.workerManager.getCircuitBreakerStats()
}
// ResetCircuitBreakers resets all circuit breakers (useful for testing)
func (ph *PoolHook) ResetCircuitBreakers() {
ph.workerManager.resetCircuitBreakers()
}
// OnGet is called when a connection is retrieved from the pool
func (ph *PoolHook) OnGet(_ context.Context, conn *pool.Conn, _ bool) (accept bool, err error) {
// Check if connection is marked for handoff
// This prevents using connections that have received MOVING notifications
if conn.ShouldHandoff() {
return false, ErrConnectionMarkedForHandoffWithState
}
// Check if connection is usable (not in UNUSABLE or CLOSED state)
// This ensures we don't return connections that are currently being handed off or re-authenticated.
if !conn.IsUsable() {
return false, ErrConnectionMarkedForHandoff
}
return true, nil
}
// OnPut is called when a connection is returned to the pool
func (ph *PoolHook) OnPut(ctx context.Context, conn *pool.Conn) (shouldPool bool, shouldRemove bool, err error) {
// first check if we should handoff for faster rejection
if !conn.ShouldHandoff() {
// Default behavior (no handoff): pool the connection
return true, false, nil
}
// check pending handoff to not queue the same connection twice
if ph.workerManager.isHandoffPending(conn) {
// Default behavior (pending handoff): pool the connection
return true, false, nil
}
if err := ph.workerManager.queueHandoff(conn); err != nil {
// Failed to queue handoff, remove the connection
internal.Logger.Printf(ctx, logs.FailedToQueueHandoff(conn.GetID(), err))
// Don't pool, remove connection, no error to caller
return false, true, nil
}
// Check if handoff was already processed by a worker before we can mark it as queued
if !conn.ShouldHandoff() {
// Handoff was already processed - this is normal and the connection should be pooled
return true, false, nil
}
if err := conn.MarkQueuedForHandoff(); err != nil {
// If marking fails, check if handoff was processed in the meantime
if !conn.ShouldHandoff() {
// Handoff was processed - this is normal, pool the connection
return true, false, nil
}
// Other error - remove the connection
return false, true, nil
}
internal.Logger.Printf(ctx, logs.MarkedForHandoff(conn.GetID()))
return true, false, nil
}
func (ph *PoolHook) OnRemove(_ context.Context, _ *pool.Conn, _ error) {
// Not used
}
// Shutdown gracefully shuts down the processor, waiting for workers to complete
func (ph *PoolHook) Shutdown(ctx context.Context) error {
return ph.workerManager.shutdownWorkers(ctx)
}
package maintnotifications
import (
"context"
"errors"
"fmt"
"strings"
"time"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/maintnotifications/logs"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/push"
)
// NotificationHandler handles push notifications for the simplified manager.
type NotificationHandler struct {
manager *Manager
operationsManager OperationsManagerInterface
}
// HandlePushNotification processes push notifications with hook support.
func (snh *NotificationHandler) HandlePushNotification(ctx context.Context, handlerCtx push.NotificationHandlerContext, notification []interface{}) error {
if len(notification) == 0 {
internal.Logger.Printf(ctx, logs.InvalidNotificationFormat(notification))
return ErrInvalidNotification
}
notificationType, ok := notification[0].(string)
if !ok {
internal.Logger.Printf(ctx, logs.InvalidNotificationTypeFormat(notification[0]))
return ErrInvalidNotification
}
// Process pre-hooks - they can modify the notification or skip processing
modifiedNotification, shouldContinue := snh.manager.processPreHooks(ctx, handlerCtx, notificationType, notification)
if !shouldContinue {
return nil // Hooks decided to skip processing
}
var err error
switch notificationType {
case NotificationMoving:
err = snh.handleMoving(ctx, handlerCtx, modifiedNotification)
case NotificationMigrating:
err = snh.handleMigrating(ctx, handlerCtx, modifiedNotification)
case NotificationMigrated:
err = snh.handleMigrated(ctx, handlerCtx, modifiedNotification)
case NotificationFailingOver:
err = snh.handleFailingOver(ctx, handlerCtx, modifiedNotification)
case NotificationFailedOver:
err = snh.handleFailedOver(ctx, handlerCtx, modifiedNotification)
case NotificationSMigrating:
err = snh.handleSMigrating(ctx, handlerCtx, modifiedNotification)
case NotificationSMigrated:
err = snh.handleSMigrated(ctx, handlerCtx, modifiedNotification)
default:
// Ignore other notification types (e.g., pub/sub messages)
err = nil
}
// Record maintenance notification metric
if maintenanceCallback := pool.GetMetricMaintenanceNotificationCallback(); maintenanceCallback != nil {
if conn, ok := handlerCtx.Conn.(*pool.Conn); ok {
maintenanceCallback(ctx, conn, notificationType)
}
}
// Process post-hooks with the result
snh.manager.processPostHooks(ctx, handlerCtx, notificationType, modifiedNotification, err)
return err
}
// handleMoving processes MOVING notifications.
// MOVING indicates that a connection should be handed off to a new endpoint.
// This is a per-connection notification that triggers connection handoff.
// Expected format: ["MOVING", seqNum, timeS, endpoint]
func (snh *NotificationHandler) handleMoving(ctx context.Context, handlerCtx push.NotificationHandlerContext, notification []interface{}) error {
if len(notification) < 3 {
internal.Logger.Printf(ctx, logs.InvalidNotification("MOVING", notification))
return ErrInvalidNotification
}
seqID, ok := notification[1].(int64)
if !ok {
internal.Logger.Printf(ctx, logs.InvalidSeqIDInMovingNotification(notification[1]))
return ErrInvalidNotification
}
// Extract timeS
timeS, ok := notification[2].(int64)
if !ok {
internal.Logger.Printf(ctx, logs.InvalidTimeSInMovingNotification(notification[2]))
return ErrInvalidNotification
}
newEndpoint := ""
if len(notification) > 3 {
// Extract new endpoint
newEndpoint, ok = notification[3].(string)
if !ok {
stringified := fmt.Sprintf("%v", notification[3])
// this could be <nil> which is valid
if notification[3] == nil || stringified == internal.RedisNull {
newEndpoint = ""
} else {
internal.Logger.Printf(ctx, logs.InvalidNewEndpointInMovingNotification(notification[3]))
return ErrInvalidNotification
}
}
}
// Get the connection that received this notification
conn := handlerCtx.Conn
if conn == nil {
internal.Logger.Printf(ctx, logs.NoConnectionInHandlerContext("MOVING"))
return ErrInvalidNotification
}
// Type assert to get the underlying pool connection
var poolConn *pool.Conn
if pc, ok := conn.(*pool.Conn); ok {
poolConn = pc
} else {
internal.Logger.Printf(ctx, logs.InvalidConnectionTypeInHandlerContext("MOVING", conn, handlerCtx))
return ErrInvalidNotification
}
// If the connection is closed or not pooled, we can ignore the notification
// this connection won't be remembered by the pool and will be garbage collected
// Keep pubsub connections around since they are not pooled but are long-lived
// and should be allowed to handoff (the pubsub instance will reconnect and change
// the underlying *pool.Conn)
if (poolConn.IsClosed() || !poolConn.IsPooled()) && !poolConn.IsPubSub() {
return nil
}
deadline := time.Now().Add(time.Duration(timeS) * time.Second)
// If newEndpoint is empty, we should schedule a handoff to the current endpoint in timeS/2 seconds
if newEndpoint == "" || newEndpoint == internal.RedisNull {
if internal.LogLevel.DebugOrAbove() {
internal.Logger.Printf(ctx, logs.SchedulingHandoffToCurrentEndpoint(poolConn.GetID(), float64(timeS)/2))
}
// same as current endpoint
newEndpoint = snh.manager.options.GetAddr()
// delay the handoff for timeS/2 seconds to the same endpoint
// do this in a goroutine to avoid blocking the notification handler
// NOTE: This timer is started while parsing the notification, so the connection is not marked for handoff
// and there should be no possibility of a race condition or double handoff.
time.AfterFunc(time.Duration(timeS/2)*time.Second, func() {
if poolConn == nil || poolConn.IsClosed() {
return
}
if err := snh.markConnForHandoff(poolConn, newEndpoint, seqID, deadline); err != nil {
// Log error but don't fail the goroutine - use background context since original may be cancelled
internal.Logger.Printf(context.Background(), logs.FailedToMarkForHandoff(poolConn.GetID(), err))
return
}
// Queue the handoff immediately if the connection is idle in the pool.
// If the connection is in use (StateInUse), it will be queued when returned to the pool via OnPut.
// This handles the case where the connection is idle and might never be retrieved again.
if poolConn.GetStateMachine().GetState() == pool.StateIdle {
if snh.manager.poolHooksRef != nil && snh.manager.poolHooksRef.workerManager != nil {
if err := snh.manager.poolHooksRef.workerManager.queueHandoff(poolConn); err != nil {
internal.Logger.Printf(context.Background(), logs.FailedToQueueHandoff(poolConn.GetID(), err))
} else {
// Mark the connection as queued for handoff to prevent it from being retrieved
// This transitions the connection to StateUnusable
if err := poolConn.MarkQueuedForHandoff(); err != nil {
internal.Logger.Printf(context.Background(), logs.FailedToMarkForHandoff(poolConn.GetID(), err))
} else {
internal.Logger.Printf(context.Background(), logs.MarkedForHandoff(poolConn.GetID()))
}
}
}
}
// If connection is StateInUse, the handoff will be queued when it's returned to the pool
})
return nil
}
return snh.markConnForHandoff(poolConn, newEndpoint, seqID, deadline)
}
func (snh *NotificationHandler) markConnForHandoff(conn *pool.Conn, newEndpoint string, seqID int64, deadline time.Time) error {
if err := conn.MarkForHandoff(newEndpoint, seqID); err != nil {
internal.Logger.Printf(context.Background(), logs.FailedToMarkForHandoff(conn.GetID(), err))
// Connection is already marked for handoff, which is acceptable
// This can happen if multiple MOVING notifications are received for the same connection
return nil
}
// Optionally track in m
if snh.operationsManager != nil {
connID := conn.GetID()
// Track the operation (ignore errors since this is optional)
_ = snh.operationsManager.TrackMovingOperationWithConnID(context.Background(), newEndpoint, deadline, seqID, connID)
} else {
return errors.New(logs.ManagerNotInitialized())
}
return nil
}
// handleMigrating processes MIGRATING notifications.
// MIGRATING indicates that a connection migration is starting.
// This is a per-connection notification that applies relaxed timeouts.
// Expected format: ["MIGRATING", ...]
func (snh *NotificationHandler) handleMigrating(ctx context.Context, handlerCtx push.NotificationHandlerContext, notification []interface{}) error {
if len(notification) < 2 {
internal.Logger.Printf(ctx, logs.InvalidNotification("MIGRATING", notification))
return ErrInvalidNotification
}
if handlerCtx.Conn == nil {
internal.Logger.Printf(ctx, logs.NoConnectionInHandlerContext("MIGRATING"))
return ErrInvalidNotification
}
conn, ok := handlerCtx.Conn.(*pool.Conn)
if !ok {
internal.Logger.Printf(ctx, logs.InvalidConnectionTypeInHandlerContext("MIGRATING", handlerCtx.Conn, handlerCtx))
return ErrInvalidNotification
}
// Apply relaxed timeout to this specific connection
if internal.LogLevel.InfoOrAbove() {
internal.Logger.Printf(ctx, logs.RelaxedTimeoutDueToNotification(conn.GetID(), "MIGRATING", snh.manager.config.RelaxedTimeout))
}
conn.SetRelaxedTimeout(snh.manager.config.RelaxedTimeout, snh.manager.config.RelaxedTimeout)
// Record relaxed timeout metric
if relaxedTimeoutCallback := pool.GetMetricConnectionRelaxedTimeoutCallback(); relaxedTimeoutCallback != nil {
relaxedTimeoutCallback(ctx, 1, conn, PoolNameMain, "MIGRATING")
}
return nil
}
// handleMigrated processes MIGRATED notifications.
// MIGRATED indicates that a connection migration has completed.
// This is a per-connection notification that clears relaxed timeouts.
// Expected format: ["MIGRATED", ...]
func (snh *NotificationHandler) handleMigrated(ctx context.Context, handlerCtx push.NotificationHandlerContext, notification []interface{}) error {
if len(notification) < 2 {
internal.Logger.Printf(ctx, logs.InvalidNotification("MIGRATED", notification))
return ErrInvalidNotification
}
if handlerCtx.Conn == nil {
internal.Logger.Printf(ctx, logs.NoConnectionInHandlerContext("MIGRATED"))
return ErrInvalidNotification
}
conn, ok := handlerCtx.Conn.(*pool.Conn)
if !ok {
internal.Logger.Printf(ctx, logs.InvalidConnectionTypeInHandlerContext("MIGRATED", handlerCtx.Conn, handlerCtx))
return ErrInvalidNotification
}
// Clear relaxed timeout for this specific connection
if internal.LogLevel.InfoOrAbove() {
connID := conn.GetID()
internal.Logger.Printf(ctx, logs.UnrelaxedTimeout(connID))
}
conn.ClearRelaxedTimeout()
return nil
}
// handleFailingOver processes FAILING_OVER notifications.
// FAILING_OVER indicates that a failover is starting.
// This is a per-connection notification that applies relaxed timeouts.
// Expected format: ["FAILING_OVER", ...]
func (snh *NotificationHandler) handleFailingOver(ctx context.Context, handlerCtx push.NotificationHandlerContext, notification []interface{}) error {
if len(notification) < 2 {
internal.Logger.Printf(ctx, logs.InvalidNotification("FAILING_OVER", notification))
return ErrInvalidNotification
}
if handlerCtx.Conn == nil {
internal.Logger.Printf(ctx, logs.NoConnectionInHandlerContext("FAILING_OVER"))
return ErrInvalidNotification
}
conn, ok := handlerCtx.Conn.(*pool.Conn)
if !ok {
internal.Logger.Printf(ctx, logs.InvalidConnectionTypeInHandlerContext("FAILING_OVER", handlerCtx.Conn, handlerCtx))
return ErrInvalidNotification
}
// Apply relaxed timeout to this specific connection
if internal.LogLevel.InfoOrAbove() {
connID := conn.GetID()
internal.Logger.Printf(ctx, logs.RelaxedTimeoutDueToNotification(connID, "FAILING_OVER", snh.manager.config.RelaxedTimeout))
}
conn.SetRelaxedTimeout(snh.manager.config.RelaxedTimeout, snh.manager.config.RelaxedTimeout)
// Record relaxed timeout metric
if relaxedTimeoutCallback := pool.GetMetricConnectionRelaxedTimeoutCallback(); relaxedTimeoutCallback != nil {
relaxedTimeoutCallback(ctx, 1, conn, PoolNameMain, "FAILING_OVER")
}
return nil
}
// handleFailedOver processes FAILED_OVER notifications.
// FAILED_OVER indicates that a failover has completed.
// This is a per-connection notification that clears relaxed timeouts.
// Expected format: ["FAILED_OVER", ...]
func (snh *NotificationHandler) handleFailedOver(ctx context.Context, handlerCtx push.NotificationHandlerContext, notification []interface{}) error {
if len(notification) < 2 {
internal.Logger.Printf(ctx, logs.InvalidNotification("FAILED_OVER", notification))
return ErrInvalidNotification
}
if handlerCtx.Conn == nil {
internal.Logger.Printf(ctx, logs.NoConnectionInHandlerContext("FAILED_OVER"))
return ErrInvalidNotification
}
conn, ok := handlerCtx.Conn.(*pool.Conn)
if !ok {
internal.Logger.Printf(ctx, logs.InvalidConnectionTypeInHandlerContext("FAILED_OVER", handlerCtx.Conn, handlerCtx))
return ErrInvalidNotification
}
// Clear relaxed timeout for this specific connection
if internal.LogLevel.InfoOrAbove() {
connID := conn.GetID()
internal.Logger.Printf(ctx, logs.UnrelaxedTimeout(connID))
}
conn.ClearRelaxedTimeout()
return nil
}
// handleSMigrating processes SMIGRATING notifications.
// SMIGRATING indicates that a cluster slot is in the process of migrating to a different node.
// This is a per-connection notification that applies relaxed timeouts during slot migration.
// Expected format: ["SMIGRATING", SeqID, slot/range1-range2, ...]
func (snh *NotificationHandler) handleSMigrating(ctx context.Context, handlerCtx push.NotificationHandlerContext, notification []interface{}) error {
if len(notification) < 3 {
internal.Logger.Printf(ctx, logs.InvalidNotification("SMIGRATING", notification))
return ErrInvalidNotification
}
// Validate SeqID (position 1)
if _, ok := notification[1].(int64); !ok {
internal.Logger.Printf(ctx, logs.InvalidSeqIDInSMigratingNotification(notification[1]))
return ErrInvalidNotification
}
if handlerCtx.Conn == nil {
internal.Logger.Printf(ctx, logs.NoConnectionInHandlerContext("SMIGRATING"))
return ErrInvalidNotification
}
conn, ok := handlerCtx.Conn.(*pool.Conn)
if !ok {
internal.Logger.Printf(ctx, logs.InvalidConnectionTypeInHandlerContext("SMIGRATING", handlerCtx.Conn, handlerCtx))
return ErrInvalidNotification
}
// Apply relaxed timeout to this specific connection
if internal.LogLevel.InfoOrAbove() {
internal.Logger.Printf(ctx, logs.RelaxedTimeoutDueToNotification(conn.GetID(), "SMIGRATING", snh.manager.config.RelaxedTimeout))
}
conn.SetRelaxedTimeout(snh.manager.config.RelaxedTimeout, snh.manager.config.RelaxedTimeout)
return nil
}
// handleSMigrated processes SMIGRATED notifications.
// SMIGRATED indicates that a cluster slot has finished migrating to a different node.
// This is a cluster-level notification that triggers cluster state reload.
//
// Expected RESP3 format:
//
// >3
// +SMIGRATED
// :SeqID
// *<num_entries> <- array of triplet arrays
// *3 <- each triplet is a 3-element array
// +<source> <- node from which slots are migrating FROM
// +<destination> <- node to which slots are migrating TO
// +<slots> <- comma-separated slots and/or ranges (e.g., "123,789-1000")
//
// A source and target endpoint may appear in multiple triplets.
// The notification is only processed if the connection's NodeAddress matches one of the source endpoints.
//
// Note: Multiple connections may receive the same notification, so we deduplicate by SeqID before triggering reload.
// but we still process the notification on each connection to clear the relaxed timeout.
// In the case when the connection is from MOVED/ASK, the connection's original endpoint is not set,
// so we will not be able to match the source endpoint. In such case, we will trigger the reload callback with the first target endpoint.
func (snh *NotificationHandler) handleSMigrated(ctx context.Context, handlerCtx push.NotificationHandlerContext, notification []interface{}) error {
// Expected: ["SMIGRATED", SeqID, [[source, target, slots], ...]]
// Minimum 3 elements: SMIGRATED, SeqID, and the array of triplets
if len(notification) < 3 {
internal.Logger.Printf(ctx, logs.InvalidNotification("SMIGRATED", notification))
return ErrInvalidNotification
}
// Extract SeqID (position 1)
seqID, ok := notification[1].(int64)
if !ok {
internal.Logger.Printf(ctx, logs.InvalidSeqIDInSMigratedNotification(notification[1]))
return ErrInvalidNotification
}
// Extract the array of triplets (position 2)
triplets, ok := notification[2].([]interface{})
if !ok {
internal.Logger.Printf(ctx, logs.InvalidNotification("SMIGRATED (triplets array)", notification[2]))
return ErrInvalidNotification
}
if len(triplets) == 0 {
internal.Logger.Printf(ctx, logs.InvalidNotification("SMIGRATED (empty triplets)", notification))
return ErrInvalidNotification
}
// Get the connection's endpoints to check if this notification is relevant
// We check against both nodeAddress (from CLUSTER SLOTS) and addr (after resolution)
// since we cannot be certain which format the notification source will use
var connectionNodeAddress string
var connectionAddr string
if snh.manager.options != nil {
connectionNodeAddress = snh.manager.options.GetNodeAddress()
connectionAddr = snh.manager.options.GetAddr()
}
// Helper function to check if source matches either of our endpoints
// notification source can be either the node address or the addr after resolution
sourceMatchesConnection := func(source string) bool {
if source == connectionNodeAddress {
return true
}
if source == connectionAddr {
return true
}
return false
}
// Parse triplets and check if any source matches our connection's endpoints
var matchingTriplets []struct {
source string
target string
slots string
}
var allSlotRanges []string
for _, tripletInterface := range triplets {
// Each triplet should be a 3-element array: [source, target, slots]
triplet, ok := tripletInterface.([]interface{})
if !ok || len(triplet) != 3 {
internal.Logger.Printf(ctx, logs.InvalidNotification("SMIGRATED (triplet format)", tripletInterface))
continue
}
// Extract source endpoint
source, ok := triplet[0].(string)
if !ok {
internal.Logger.Printf(ctx, logs.InvalidNotification("SMIGRATED (source)", triplet[0]))
continue
}
// Extract target endpoint
target, ok := triplet[1].(string)
if !ok {
internal.Logger.Printf(ctx, logs.InvalidNotification("SMIGRATED (target)", triplet[1]))
continue
}
// Extract slots
slots, ok := triplet[2].(string)
if !ok {
internal.Logger.Printf(ctx, logs.InvalidNotification("SMIGRATED (slots)", triplet[2]))
continue
}
// Check if this triplet's source matches our connection's endpoints
if sourceMatchesConnection(source) {
matchingTriplets = append(matchingTriplets, struct {
source string
target string
slots string
}{source, target, slots})
slotRanges := strings.Split(slots, ",")
allSlotRanges = append(allSlotRanges, slotRanges...)
}
}
var connID uint64
// Reset relaxed timeout for this specific connection
if handlerCtx.Conn != nil {
conn, ok := handlerCtx.Conn.(*pool.Conn)
if ok {
if internal.LogLevel.InfoOrAbove() {
connID = conn.GetID()
internal.Logger.Printf(ctx, logs.UnrelaxedTimeout(connID))
}
conn.ClearRelaxedTimeout()
}
}
// If no matching triplets, this notification is not relevant to this connection
if len(matchingTriplets) == 0 {
return nil
}
// Deduplicate by SeqID - multiple connections may receive the same notification
// Only trigger cluster state reload once per seqID
if snh.manager.MarkSMigratedSeqIDProcessed(seqID) {
// Use the first matching triplet
target := matchingTriplets[0].target
slotsForLog := allSlotRanges
if internal.LogLevel.InfoOrAbove() {
internal.Logger.Printf(ctx, logs.TriggeringClusterStateReload(seqID, target, slotsForLog))
}
// Trigger cluster state reload via callback
snh.manager.TriggerClusterStateReload(ctx, target, slotsForLog)
}
return nil
}
package maintnotifications
// State represents the current state of a maintenance operation
type State int
const (
// StateIdle indicates no upgrade is in progress
StateIdle State = iota
// StateHandoff indicates a connection handoff is in progress
StateMoving
)
// String returns a string representation of the state.
func (s State) String() string {
switch s {
case StateIdle:
return "idle"
case StateMoving:
return "moving"
default:
return "unknown"
}
}
package redis
import (
"context"
"crypto/tls"
"errors"
"fmt"
"net"
"net/url"
"runtime"
"sort"
"strconv"
"strings"
"sync/atomic"
"time"
"github.com/redis/go-redis/v9/auth"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/internal/proto"
"github.com/redis/go-redis/v9/internal/util"
"github.com/redis/go-redis/v9/maintnotifications"
"github.com/redis/go-redis/v9/push"
)
// poolIDCounter is a global auto-increment counter for generating unique pool IDs.
var poolIDCounter atomic.Uint64
// generateUniqueID generates a short unique identifier for pool names using auto-increment.
// This makes it easier to identify and track pools in order of creation.
func generateUniqueID() string {
id := poolIDCounter.Add(1)
return strconv.FormatUint(id, 10)
}
// Limiter is the interface of a rate limiter or a circuit breaker.
type Limiter interface {
// Allow returns nil if operation is allowed or an error otherwise.
// If operation is allowed client must ReportResult of the operation
// whether it is a success or a failure.
Allow() error
// ReportResult reports the result of the previously allowed operation.
// nil indicates a success, non-nil error usually indicates a failure.
ReportResult(result error)
}
// Options keeps the settings to set up redis connection.
type Options struct {
// Network type, either tcp or unix.
//
// default: is tcp.
Network string
// Addr is the address formated as host:port
Addr string
// NodeAddress is the address of the Redis node as reported by the server.
// For cluster clients, this is the exact endpoint string returned by CLUSTER SLOTS
// before any resolution or transformation (e.g., loopback replacement).
// For standalone clients, this defaults to Addr.
//
// This is used to match the source endpoint in maintenance notifications
// (e.g. SMIGRATED).
//
// Use Client.NodeAddress() to access this value.
NodeAddress string
// ClientName will execute the `CLIENT SETNAME ClientName` command for each conn.
ClientName string
// Dialer creates new network connection and has priority over
// Network and Addr options.
Dialer func(ctx context.Context, network, addr string) (net.Conn, error)
// Hook that is called when new connection is established.
OnConnect func(ctx context.Context, cn *Conn) error
// Protocol 2 or 3. Use the version to negotiate RESP version with redis-server.
//
// default: 3.
Protocol int
// Username is used to authenticate the current connection
// with one of the connections defined in the ACL list when connecting
// to a Redis 6.0 instance, or greater, that is using the Redis ACL system.
Username string
// Password is an optional password. Must match the password specified in the
// `requirepass` server configuration option (if connecting to a Redis 5.0 instance, or lower),
// or the User Password when connecting to a Redis 6.0 instance, or greater,
// that is using the Redis ACL system.
Password string
// CredentialsProvider allows the username and password to be updated
// before reconnecting. It should return the current username and password.
CredentialsProvider func() (username string, password string)
// CredentialsProviderContext is an enhanced parameter of CredentialsProvider,
// done to maintain API compatibility. In the future,
// there might be a merge between CredentialsProviderContext and CredentialsProvider.
// There will be a conflict between them; if CredentialsProviderContext exists, we will ignore CredentialsProvider.
CredentialsProviderContext func(ctx context.Context) (username string, password string, err error)
// StreamingCredentialsProvider is used to retrieve the credentials
// for the connection from an external source. Those credentials may change
// during the connection lifetime. This is useful for managed identity
// scenarios where the credentials are retrieved from an external source.
//
// Currently, this is a placeholder for the future implementation.
StreamingCredentialsProvider auth.StreamingCredentialsProvider
// DB is the database to be selected after connecting to the server.
DB int
// MaxRetries is the maximum number of retries before giving up.
// -1 (not 0) disables retries.
//
// default: 3 retries
MaxRetries int
// MinRetryBackoff is the minimum backoff between each retry.
// -1 disables backoff.
//
// default: 8 milliseconds
MinRetryBackoff time.Duration
// MaxRetryBackoff is the maximum backoff between each retry.
// -1 disables backoff.
// default: 512 milliseconds;
MaxRetryBackoff time.Duration
// DialTimeout for establishing new connections.
//
// default: 5 seconds
DialTimeout time.Duration
// DialerRetries is the maximum number of retry attempts when dialing fails.
//
// default: 5
DialerRetries int
// DialerRetryTimeout is the backoff duration between retry attempts.
//
// default: 100 milliseconds
DialerRetryTimeout time.Duration
// ReadTimeout for socket reads. If reached, commands will fail
// with a timeout instead of blocking. Supported values:
//
// - `-1` - no timeout (block indefinitely).
// - `-2` - disables SetReadDeadline calls completely.
//
// default: 3 seconds
ReadTimeout time.Duration
// WriteTimeout for socket writes. If reached, commands will fail
// with a timeout instead of blocking. Supported values:
//
// - `-1` - no timeout (block indefinitely).
// - `-2` - disables SetWriteDeadline calls completely.
//
// default: 3 seconds
WriteTimeout time.Duration
// ContextTimeoutEnabled controls whether the client respects context timeouts and deadlines.
// See https://redis.uptrace.dev/guide/go-redis-debugging.html#timeouts
ContextTimeoutEnabled bool
// ReadBufferSize is the size of the bufio.Reader buffer for each connection.
// Larger buffers can improve performance for commands that return large responses.
// Smaller buffers can improve memory usage for larger pools.
//
// default: 32KiB (32768 bytes)
ReadBufferSize int
// WriteBufferSize is the size of the bufio.Writer buffer for each connection.
// Larger buffers can improve performance for large pipelines and commands with many arguments.
// Smaller buffers can improve memory usage for larger pools.
//
// default: 32KiB (32768 bytes)
WriteBufferSize int
// PoolFIFO type of connection pool.
//
// - true for FIFO pool
// - false for LIFO pool.
//
// Note that FIFO has slightly higher overhead compared to LIFO,
// but it helps closing idle connections faster reducing the pool size.
// default: false
PoolFIFO bool
// PoolSize is the base number of socket connections.
// Default is 10 connections per every available CPU as reported by runtime.GOMAXPROCS.
// If there is not enough connections in the pool, new connections will be allocated in excess of PoolSize,
// you can limit it through MaxActiveConns
//
// default: 10 * runtime.GOMAXPROCS(0)
PoolSize int
// MaxConcurrentDials is the maximum number of concurrent connection creation goroutines.
// If <= 0, defaults to PoolSize. If > PoolSize, it will be capped at PoolSize.
MaxConcurrentDials int
// PoolTimeout is the amount of time client waits for connection if all connections
// are busy before returning an error.
//
// default: ReadTimeout + 1 second
PoolTimeout time.Duration
// MinIdleConns is the minimum number of idle connections which is useful when establishing
// new connection is slow. The idle connections are not closed by default.
//
// default: 0
MinIdleConns int
// MaxIdleConns is the maximum number of idle connections.
// The idle connections are not closed by default.
//
// default: 0
MaxIdleConns int
// MaxActiveConns is the maximum number of connections allocated by the pool at a given time.
// When zero, there is no limit on the number of connections in the pool.
// If the pool is full, the next call to Get() will block until a connection is released.
//
// default: 0
MaxActiveConns int
// ConnMaxIdleTime is the maximum amount of time a connection may be idle.
// Should be less than server's timeout.
//
// Expired connections may be closed lazily before reuse.
// If d <= 0, connections are not closed due to a connection's idle time.
// -1 disables idle timeout check.
//
// default: 30 minutes
ConnMaxIdleTime time.Duration
// ConnMaxLifetime is the maximum amount of time a connection may be reused.
//
// Expired connections may be closed lazily before reuse.
// If <= 0, connections are not closed due to a connection's age.
//
// default: 0
ConnMaxLifetime time.Duration
// ConnMaxLifetimeJitter is the absolute jitter duration applied to ConnMaxLifetime
// to prevent all connections from expiring simultaneously.
//
// The jitter is applied as a random offset in the range [-jitter, +jitter].
// For example, if ConnMaxLifetime is 1 hour and ConnMaxLifetimeJitter is 6 minutes,
// connections will expire between 54 minutes and 66 minutes.
//
// If <= 0, no jitter is applied.
// If > ConnMaxLifetime, it will be capped at ConnMaxLifetime.
//
// default: 0
ConnMaxLifetimeJitter time.Duration
// TLSConfig to use. When set, TLS will be negotiated.
TLSConfig *tls.Config
// Limiter interface used to implement circuit breaker or rate limiter.
Limiter Limiter
// readOnly enables read only queries on slave/follower nodes.
readOnly bool
// DisableIndentity - Disable set-lib on connect.
//
// default: false
//
// Deprecated: Use DisableIdentity instead.
DisableIndentity bool
// DisableIdentity is used to disable CLIENT SETINFO command on connect.
//
// default: false
DisableIdentity bool
// Add suffix to client name. Default is empty.
// IdentitySuffix - add suffix to client name.
IdentitySuffix string
// UnstableResp3 enables Unstable mode for Redis Search module with RESP3.
// When unstable mode is enabled, the client will use RESP3 protocol and only be able to use RawResult
UnstableResp3 bool
// Push notifications are always enabled for RESP3 connections (Protocol: 3)
// and are not available for RESP2 connections. No configuration option is needed.
// PushNotificationProcessor is the processor for handling push notifications.
// If nil, a default processor will be created for RESP3 connections.
PushNotificationProcessor push.NotificationProcessor
// FailingTimeoutSeconds is the timeout in seconds for marking a cluster node as failing.
// When a node is marked as failing, it will be avoided for this duration.
// Default is 15 seconds.
FailingTimeoutSeconds int
// MaintNotificationsConfig provides custom configuration for maintnotifications.
// When MaintNotificationsConfig.Mode is not "disabled", the client will handle
// cluster upgrade notifications gracefully and manage connection/pool state
// transitions seamlessly. Requires Protocol: 3 (RESP3) for push notifications.
// If nil, maintnotifications are in "auto" mode and will be enabled if the server supports it.
MaintNotificationsConfig *maintnotifications.Config
}
func (opt *Options) init() {
if opt.Addr == "" {
opt.Addr = "localhost:6379"
}
if opt.Network == "" {
if strings.HasPrefix(opt.Addr, "/") {
opt.Network = "unix"
} else {
opt.Network = "tcp"
}
}
// For standalone clients, default NodeAddress to Addr if not set.
// This ensures maintenance notifications (SMIGRATED, etc.) can match
// the connection's endpoint even for non-cluster clients.
if opt.NodeAddress == "" {
opt.NodeAddress = opt.Addr
}
if opt.Protocol < 2 {
opt.Protocol = 3
}
if opt.DialTimeout == 0 {
opt.DialTimeout = 5 * time.Second
}
if opt.DialerRetries == 0 {
opt.DialerRetries = 5
}
if opt.DialerRetryTimeout == 0 {
opt.DialerRetryTimeout = 100 * time.Millisecond
}
if opt.Dialer == nil {
opt.Dialer = NewDialer(opt)
}
if opt.PoolSize == 0 {
opt.PoolSize = 10 * runtime.GOMAXPROCS(0)
}
if opt.MaxConcurrentDials <= 0 {
opt.MaxConcurrentDials = opt.PoolSize
} else if opt.MaxConcurrentDials > opt.PoolSize {
opt.MaxConcurrentDials = opt.PoolSize
}
if opt.ReadBufferSize == 0 {
opt.ReadBufferSize = proto.DefaultBufferSize
}
if opt.WriteBufferSize == 0 {
opt.WriteBufferSize = proto.DefaultBufferSize
}
switch opt.ReadTimeout {
case -2:
opt.ReadTimeout = -1
case -1:
opt.ReadTimeout = 0
case 0:
opt.ReadTimeout = 3 * time.Second
}
switch opt.WriteTimeout {
case -2:
opt.WriteTimeout = -1
case -1:
opt.WriteTimeout = 0
case 0:
opt.WriteTimeout = opt.ReadTimeout
}
if opt.PoolTimeout == 0 {
if opt.ReadTimeout > 0 {
opt.PoolTimeout = opt.ReadTimeout + time.Second
} else {
opt.PoolTimeout = 30 * time.Second
}
}
if opt.ConnMaxIdleTime == 0 {
opt.ConnMaxIdleTime = 30 * time.Minute
}
opt.ConnMaxLifetimeJitter = min(opt.ConnMaxLifetimeJitter, opt.ConnMaxLifetime)
switch opt.MaxRetries {
case -1:
opt.MaxRetries = 0
case 0:
opt.MaxRetries = 3
}
switch opt.MinRetryBackoff {
case -1:
opt.MinRetryBackoff = 0
case 0:
opt.MinRetryBackoff = 8 * time.Millisecond
}
switch opt.MaxRetryBackoff {
case -1:
opt.MaxRetryBackoff = 0
case 0:
opt.MaxRetryBackoff = 512 * time.Millisecond
}
if opt.FailingTimeoutSeconds == 0 {
opt.FailingTimeoutSeconds = 15
}
opt.MaintNotificationsConfig = opt.MaintNotificationsConfig.ApplyDefaultsWithPoolConfig(opt.PoolSize, opt.MaxActiveConns)
// auto-detect endpoint type if not specified
endpointType := opt.MaintNotificationsConfig.EndpointType
if endpointType == "" || endpointType == maintnotifications.EndpointTypeAuto {
// Auto-detect endpoint type if not specified
endpointType = maintnotifications.DetectEndpointType(opt.Addr, opt.TLSConfig != nil)
}
opt.MaintNotificationsConfig.EndpointType = endpointType
}
func (opt *Options) clone() *Options {
clone := *opt
// Deep clone MaintNotificationsConfig to avoid sharing between clients
if opt.MaintNotificationsConfig != nil {
configClone := *opt.MaintNotificationsConfig
clone.MaintNotificationsConfig = &configClone
}
return &clone
}
// NewDialer returns a function that will be used as the default dialer
// when none is specified in Options.Dialer.
func (opt *Options) NewDialer() func(context.Context, string, string) (net.Conn, error) {
return NewDialer(opt)
}
// NewDialer returns a function that will be used as the default dialer
// when none is specified in Options.Dialer.
func NewDialer(opt *Options) func(context.Context, string, string) (net.Conn, error) {
return func(ctx context.Context, network, addr string) (net.Conn, error) {
netDialer := &net.Dialer{
Timeout: opt.DialTimeout,
KeepAlive: 5 * time.Minute,
}
if opt.TLSConfig == nil {
return netDialer.DialContext(ctx, network, addr)
}
return tls.DialWithDialer(netDialer, network, addr, opt.TLSConfig)
}
}
// ParseURL parses a URL into Options that can be used to connect to Redis.
// Scheme is required.
// There are two connection types: by tcp socket and by unix socket.
// Tcp connection:
//
// redis://<user>:<password>@<host>:<port>/<db_number>
//
// Unix connection:
//
// unix://<user>:<password>@</path/to/redis.sock>?db=<db_number>
//
// Most Option fields can be set using query parameters, with the following restrictions:
// - field names are mapped using snake-case conversion: to set MaxRetries, use max_retries
// - only scalar type fields are supported (bool, int, time.Duration)
// - for time.Duration fields, values must be a valid input for time.ParseDuration();
// additionally a plain integer as value (i.e. without unit) is interpreted as seconds
// - to disable a duration field, use value less than or equal to 0; to use the default
// value, leave the value blank or remove the parameter
// - only the last value is interpreted if a parameter is given multiple times
// - fields "network", "addr", "username" and "password" can only be set using other
// URL attributes (scheme, host, userinfo, resp.), query parameters using these
// names will be treated as unknown parameters
// - unknown parameter names will result in an error
// - use "skip_verify=true" to ignore TLS certificate validation
//
// Examples:
//
// redis://user:password@localhost:6789/3?dial_timeout=3&db=1&read_timeout=6s&max_retries=2
// is equivalent to:
// &Options{
// Network: "tcp",
// Addr: "localhost:6789",
// DB: 1, // path "/3" was overridden by "&db=1"
// DialTimeout: 3 * time.Second, // no time unit = seconds
// ReadTimeout: 6 * time.Second,
// MaxRetries: 2,
// }
func ParseURL(redisURL string) (*Options, error) {
u, err := url.Parse(redisURL)
if err != nil {
return nil, err
}
switch u.Scheme {
case "redis", "rediss":
return setupTCPConn(u)
case "unix":
return setupUnixConn(u)
default:
return nil, fmt.Errorf("redis: invalid URL scheme: %s", u.Scheme)
}
}
func setupTCPConn(u *url.URL) (*Options, error) {
o := &Options{Network: "tcp"}
o.Username, o.Password = getUserPassword(u)
h, p := getHostPortWithDefaults(u)
o.Addr = net.JoinHostPort(h, p)
f := strings.FieldsFunc(u.Path, func(r rune) bool {
return r == '/'
})
switch len(f) {
case 0:
o.DB = 0
case 1:
var err error
if o.DB, err = strconv.Atoi(f[0]); err != nil {
return nil, fmt.Errorf("redis: invalid database number: %q", f[0])
}
default:
return nil, fmt.Errorf("redis: invalid URL path: %s", u.Path)
}
if u.Scheme == "rediss" {
o.TLSConfig = &tls.Config{
ServerName: h,
MinVersion: tls.VersionTLS12,
}
}
return setupConnParams(u, o)
}
// getHostPortWithDefaults is a helper function that splits the url into
// a host and a port. If the host is missing, it defaults to localhost
// and if the port is missing, it defaults to 6379.
func getHostPortWithDefaults(u *url.URL) (string, string) {
host, port, err := net.SplitHostPort(u.Host)
if err != nil {
host = u.Host
}
if host == "" {
host = "localhost"
}
if port == "" {
port = "6379"
}
return host, port
}
func setupUnixConn(u *url.URL) (*Options, error) {
o := &Options{
Network: "unix",
}
if strings.TrimSpace(u.Path) == "" { // path is required with unix connection
return nil, errors.New("redis: empty unix socket path")
}
o.Addr = u.Path
o.Username, o.Password = getUserPassword(u)
return setupConnParams(u, o)
}
type queryOptions struct {
q url.Values
err error
}
func (o *queryOptions) has(name string) bool {
return len(o.q[name]) > 0
}
func (o *queryOptions) string(name string) string {
vs := o.q[name]
if len(vs) == 0 {
return ""
}
delete(o.q, name) // enable detection of unknown parameters
return vs[len(vs)-1]
}
func (o *queryOptions) strings(name string) []string {
vs := o.q[name]
delete(o.q, name)
return vs
}
func (o *queryOptions) int(name string) int {
s := o.string(name)
if s == "" {
return 0
}
i, err := strconv.Atoi(s)
if err == nil {
return i
}
if o.err == nil {
o.err = fmt.Errorf("redis: invalid %s number: %s", name, err)
}
return 0
}
func (o *queryOptions) duration(name string) time.Duration {
s := o.string(name)
if s == "" {
return 0
}
// try plain number first
if i, err := strconv.Atoi(s); err == nil {
if i <= 0 {
// disable timeouts
return -1
}
return time.Duration(i) * time.Second
}
dur, err := time.ParseDuration(s)
if err == nil {
return dur
}
if o.err == nil {
o.err = fmt.Errorf("redis: invalid %s duration: %w", name, err)
}
return 0
}
func (o *queryOptions) bool(name string) bool {
switch s := o.string(name); s {
case "true", "1":
return true
case "false", "0", "":
return false
default:
if o.err == nil {
o.err = fmt.Errorf("redis: invalid %s boolean: expected true/false/1/0 or an empty string, got %q", name, s)
}
return false
}
}
func (o *queryOptions) remaining() []string {
if len(o.q) == 0 {
return nil
}
keys := make([]string, 0, len(o.q))
for k := range o.q {
keys = append(keys, k)
}
sort.Strings(keys)
return keys
}
// setupConnParams converts query parameters in u to option value in o.
func setupConnParams(u *url.URL, o *Options) (*Options, error) {
q := queryOptions{q: u.Query()}
// compat: a future major release may use q.int("db")
if tmp := q.string("db"); tmp != "" {
db, err := strconv.Atoi(tmp)
if err != nil {
return nil, fmt.Errorf("redis: invalid database number: %w", err)
}
o.DB = db
}
o.Protocol = q.int("protocol")
o.ClientName = q.string("client_name")
o.MaxRetries = q.int("max_retries")
o.MinRetryBackoff = q.duration("min_retry_backoff")
o.MaxRetryBackoff = q.duration("max_retry_backoff")
o.DialTimeout = q.duration("dial_timeout")
o.ReadTimeout = q.duration("read_timeout")
o.WriteTimeout = q.duration("write_timeout")
o.PoolFIFO = q.bool("pool_fifo")
o.PoolSize = q.int("pool_size")
o.PoolTimeout = q.duration("pool_timeout")
o.MinIdleConns = q.int("min_idle_conns")
o.MaxIdleConns = q.int("max_idle_conns")
o.MaxActiveConns = q.int("max_active_conns")
o.MaxConcurrentDials = q.int("max_concurrent_dials")
if q.has("conn_max_idle_time") {
o.ConnMaxIdleTime = q.duration("conn_max_idle_time")
} else {
o.ConnMaxIdleTime = q.duration("idle_timeout")
}
if q.has("conn_max_lifetime") {
o.ConnMaxLifetime = q.duration("conn_max_lifetime")
} else {
o.ConnMaxLifetime = q.duration("max_conn_age")
}
if q.has("conn_max_lifetime_jitter") {
o.ConnMaxLifetimeJitter = min(q.duration("conn_max_lifetime_jitter"), o.ConnMaxLifetime)
}
if q.err != nil {
return nil, q.err
}
if o.TLSConfig != nil && q.has("skip_verify") {
o.TLSConfig.InsecureSkipVerify = q.bool("skip_verify")
}
// any parameters left?
if r := q.remaining(); len(r) > 0 {
return nil, fmt.Errorf("redis: unexpected option: %s", strings.Join(r, ", "))
}
return o, nil
}
func getUserPassword(u *url.URL) (string, string) {
var user, password string
if u.User != nil {
user = u.User.Username()
if p, ok := u.User.Password(); ok {
password = p
}
}
return user, password
}
func newConnPool(
opt *Options,
dialer func(ctx context.Context, network, addr string) (net.Conn, error),
poolName string,
) (*pool.ConnPool, error) {
poolSize, err := util.SafeIntToInt32(opt.PoolSize, "PoolSize")
if err != nil {
return nil, err
}
minIdleConns, err := util.SafeIntToInt32(opt.MinIdleConns, "MinIdleConns")
if err != nil {
return nil, err
}
maxIdleConns, err := util.SafeIntToInt32(opt.MaxIdleConns, "MaxIdleConns")
if err != nil {
return nil, err
}
maxActiveConns, err := util.SafeIntToInt32(opt.MaxActiveConns, "MaxActiveConns")
if err != nil {
return nil, err
}
return pool.NewConnPool(&pool.Options{
Dialer: func(ctx context.Context) (net.Conn, error) {
return dialer(ctx, opt.Network, opt.Addr)
},
PoolFIFO: opt.PoolFIFO,
PoolSize: poolSize,
MaxConcurrentDials: opt.MaxConcurrentDials,
PoolTimeout: opt.PoolTimeout,
DialTimeout: opt.DialTimeout,
DialerRetries: opt.DialerRetries,
DialerRetryTimeout: opt.DialerRetryTimeout,
MinIdleConns: minIdleConns,
MaxIdleConns: maxIdleConns,
MaxActiveConns: maxActiveConns,
ConnMaxIdleTime: opt.ConnMaxIdleTime,
ConnMaxLifetime: opt.ConnMaxLifetime,
ConnMaxLifetimeJitter: opt.ConnMaxLifetimeJitter,
ReadBufferSize: opt.ReadBufferSize,
WriteBufferSize: opt.WriteBufferSize,
PushNotificationsEnabled: opt.Protocol == 3,
Name: poolName,
}), nil
}
func newPubSubPool(
opt *Options,
dialer func(ctx context.Context, network, addr string) (net.Conn, error),
poolName string,
) (*pool.PubSubPool, error) {
poolSize, err := util.SafeIntToInt32(opt.PoolSize, "PoolSize")
if err != nil {
return nil, err
}
minIdleConns, err := util.SafeIntToInt32(opt.MinIdleConns, "MinIdleConns")
if err != nil {
return nil, err
}
maxIdleConns, err := util.SafeIntToInt32(opt.MaxIdleConns, "MaxIdleConns")
if err != nil {
return nil, err
}
maxActiveConns, err := util.SafeIntToInt32(opt.MaxActiveConns, "MaxActiveConns")
if err != nil {
return nil, err
}
return pool.NewPubSubPool(&pool.Options{
PoolFIFO: opt.PoolFIFO,
PoolSize: poolSize,
MaxConcurrentDials: opt.MaxConcurrentDials,
PoolTimeout: opt.PoolTimeout,
DialTimeout: opt.DialTimeout,
DialerRetries: opt.DialerRetries,
DialerRetryTimeout: opt.DialerRetryTimeout,
MinIdleConns: minIdleConns,
MaxIdleConns: maxIdleConns,
MaxActiveConns: maxActiveConns,
ConnMaxIdleTime: opt.ConnMaxIdleTime,
ConnMaxLifetime: opt.ConnMaxLifetime,
ConnMaxLifetimeJitter: opt.ConnMaxLifetimeJitter,
ReadBufferSize: 32 * 1024,
WriteBufferSize: 32 * 1024,
PushNotificationsEnabled: opt.Protocol == 3,
Name: poolName,
}, dialer), nil
}
package redis
import (
"context"
"crypto/tls"
"errors"
"fmt"
"math"
"net"
"net/url"
"runtime"
"sort"
"strings"
"sync"
"sync/atomic"
"time"
"github.com/redis/go-redis/v9/auth"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/hashtag"
"github.com/redis/go-redis/v9/internal/otel"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/internal/proto"
"github.com/redis/go-redis/v9/internal/rand"
"github.com/redis/go-redis/v9/internal/routing"
"github.com/redis/go-redis/v9/maintnotifications"
"github.com/redis/go-redis/v9/push"
)
const (
minLatencyMeasurementInterval = 10 * time.Second
)
var (
errClusterNoNodes = errors.New("redis: cluster has no nodes")
errNoWatchKeys = errors.New("redis: Watch requires at least one key")
errWatchCrosslot = errors.New("redis: Watch requires all keys to be in the same slot")
)
// ClusterOptions are used to configure a cluster client and should be
// passed to NewClusterClient.
type ClusterOptions struct {
// A seed list of host:port addresses of cluster nodes.
Addrs []string
// ClientName will execute the `CLIENT SETNAME ClientName` command for each conn.
ClientName string
// NewClient creates a cluster node client with provided name and options.
// If NewClient is set by the user, the user is responsible for handling maintnotifications upgrades and push notifications.
NewClient func(opt *Options) *Client
// The maximum number of retries before giving up. Command is retried
// on network errors and MOVED/ASK redirects.
// Default is 3 retries.
MaxRedirects int
// Enables read-only commands on slave nodes.
ReadOnly bool
// Allows routing read-only commands to the closest master or slave node.
// It automatically enables ReadOnly.
RouteByLatency bool
// Allows routing read-only commands to the random master or slave node.
// It automatically enables ReadOnly.
RouteRandomly bool
// Optional function that returns cluster slots information.
// It is useful to manually create cluster of standalone Redis servers
// and load-balance read/write operations between master and slaves.
// It can use service like ZooKeeper to maintain configuration information
// and Cluster.ReloadState to manually trigger state reloading.
ClusterSlots func(context.Context) ([]ClusterSlot, error)
// Following options are copied from Options struct.
Dialer func(ctx context.Context, network, addr string) (net.Conn, error)
OnConnect func(ctx context.Context, cn *Conn) error
Protocol int
Username string
Password string
CredentialsProvider func() (username string, password string)
CredentialsProviderContext func(ctx context.Context) (username string, password string, err error)
StreamingCredentialsProvider auth.StreamingCredentialsProvider
// MaxRetries is the maximum number of retries before giving up.
// For ClusterClient, retries are disabled by default (set to -1),
// because the cluster client handles all kinds of retries internally.
// This is intentional and differs from the standalone Options default.
MaxRetries int
MinRetryBackoff time.Duration
MaxRetryBackoff time.Duration
DialTimeout time.Duration
// DialerRetries is the maximum number of retry attempts when dialing fails.
//
// default: 5
DialerRetries int
// DialerRetryTimeout is the backoff duration between retry attempts.
//
// default: 100 milliseconds
DialerRetryTimeout time.Duration
ReadTimeout time.Duration
WriteTimeout time.Duration
ContextTimeoutEnabled bool
// MaxConcurrentDials is the maximum number of concurrent connection creation goroutines.
// If <= 0, defaults to PoolSize. If > PoolSize, it will be capped at PoolSize.
MaxConcurrentDials int
PoolFIFO bool
PoolSize int // applies per cluster node and not for the whole cluster
PoolTimeout time.Duration
MinIdleConns int
MaxIdleConns int
MaxActiveConns int // applies per cluster node and not for the whole cluster
ConnMaxIdleTime time.Duration
ConnMaxLifetime time.Duration
ConnMaxLifetimeJitter time.Duration
// ReadBufferSize is the size of the bufio.Reader buffer for each connection.
// Larger buffers can improve performance for commands that return large responses.
// Smaller buffers can improve memory usage for larger pools.
//
// default: 32KiB (32768 bytes)
ReadBufferSize int
// WriteBufferSize is the size of the bufio.Writer buffer for each connection.
// Larger buffers can improve performance for large pipelines and commands with many arguments.
// Smaller buffers can improve memory usage for larger pools.
//
// default: 32KiB (32768 bytes)
WriteBufferSize int
TLSConfig *tls.Config
// DisableRoutingPolicies disables the request/response policy routing system.
// When disabled, all commands use the legacy routing behavior.
// Experimental. Will be removed when shard picker is fully implemented.
DisableRoutingPolicies bool
// DisableIndentity - Disable set-lib on connect.
//
// default: false
//
// Deprecated: Use DisableIdentity instead.
DisableIndentity bool
// DisableIdentity is used to disable CLIENT SETINFO command on connect.
//
// default: false
DisableIdentity bool
IdentitySuffix string // Add suffix to client name. Default is empty.
// UnstableResp3 enables Unstable mode for Redis Search module with RESP3.
UnstableResp3 bool
// PushNotificationProcessor is the processor for handling push notifications.
// If nil, a default processor will be created for RESP3 connections.
PushNotificationProcessor push.NotificationProcessor
// FailingTimeoutSeconds is the timeout in seconds for marking a cluster node as failing.
// When a node is marked as failing, it will be avoided for this duration.
// Default is 15 seconds.
FailingTimeoutSeconds int
// MaintNotificationsConfig provides custom configuration for maintnotifications upgrades.
// When MaintNotificationsConfig.Mode is not "disabled", the client will handle
// cluster upgrade notifications gracefully and manage connection/pool state
// transitions seamlessly. Requires Protocol: 3 (RESP3) for push notifications.
// If nil, maintnotifications upgrades are in "auto" mode and will be enabled if the server supports it.
// The ClusterClient supports SMIGRATING and SMIGRATED notifications for cluster state management.
// Individual node clients handle other maintenance notifications (MOVING, MIGRATING, etc.).
MaintNotificationsConfig *maintnotifications.Config
// ShardPicker is used to pick a shard when the request_policy is
// ReqDefault and the command has no keys.
ShardPicker routing.ShardPicker
// ClusterStateReloadInterval is the interval for reloading the cluster state.
// Default is 10 seconds.
ClusterStateReloadInterval time.Duration
}
func (opt *ClusterOptions) init() {
switch opt.MaxRedirects {
case -1:
opt.MaxRedirects = 0
case 0:
opt.MaxRedirects = 3
}
if opt.RouteByLatency || opt.RouteRandomly {
opt.ReadOnly = true
}
if opt.DialTimeout == 0 {
opt.DialTimeout = 5 * time.Second
}
if opt.DialerRetries == 0 {
opt.DialerRetries = 5
}
if opt.DialerRetryTimeout == 0 {
opt.DialerRetryTimeout = 100 * time.Millisecond
}
if opt.PoolSize == 0 {
opt.PoolSize = 5 * runtime.GOMAXPROCS(0)
}
if opt.MaxConcurrentDials <= 0 {
opt.MaxConcurrentDials = opt.PoolSize
} else if opt.MaxConcurrentDials > opt.PoolSize {
opt.MaxConcurrentDials = opt.PoolSize
}
if opt.ReadBufferSize == 0 {
opt.ReadBufferSize = proto.DefaultBufferSize
}
if opt.WriteBufferSize == 0 {
opt.WriteBufferSize = proto.DefaultBufferSize
}
switch opt.ReadTimeout {
case -1:
opt.ReadTimeout = 0
case 0:
opt.ReadTimeout = 3 * time.Second
}
switch opt.WriteTimeout {
case -1:
opt.WriteTimeout = 0
case 0:
opt.WriteTimeout = opt.ReadTimeout
}
if opt.MaxRetries == 0 {
opt.MaxRetries = -1
}
switch opt.MinRetryBackoff {
case -1:
opt.MinRetryBackoff = 0
case 0:
opt.MinRetryBackoff = 8 * time.Millisecond
}
switch opt.MaxRetryBackoff {
case -1:
opt.MaxRetryBackoff = 0
case 0:
opt.MaxRetryBackoff = 512 * time.Millisecond
}
if opt.NewClient == nil {
opt.NewClient = NewClient
}
if opt.FailingTimeoutSeconds == 0 {
opt.FailingTimeoutSeconds = 15
}
if opt.ShardPicker == nil {
opt.ShardPicker = &routing.RoundRobinPicker{}
}
if opt.ClusterStateReloadInterval == 0 {
opt.ClusterStateReloadInterval = 10 * time.Second
}
}
// ParseClusterURL parses a URL into ClusterOptions that can be used to connect to Redis.
// The URL must be in the form:
//
// redis://<user>:<password>@<host>:<port>
// or
// rediss://<user>:<password>@<host>:<port>
//
// To add additional addresses, specify the query parameter, "addr" one or more times. e.g:
//
// redis://<user>:<password>@<host>:<port>?addr=<host2>:<port2>&addr=<host3>:<port3>
// or
// rediss://<user>:<password>@<host>:<port>?addr=<host2>:<port2>&addr=<host3>:<port3>
//
// Most Option fields can be set using query parameters, with the following restrictions:
// - field names are mapped using snake-case conversion: to set MaxRetries, use max_retries
// - only scalar type fields are supported (bool, int, time.Duration)
// - for time.Duration fields, values must be a valid input for time.ParseDuration();
// additionally a plain integer as value (i.e. without unit) is interpreted as seconds
// - to disable a duration field, use value less than or equal to 0; to use the default
// value, leave the value blank or remove the parameter
// - only the last value is interpreted if a parameter is given multiple times
// - fields "network", "addr", "username" and "password" can only be set using other
// URL attributes (scheme, host, userinfo, resp.), query parameters using these
// names will be treated as unknown parameters
// - unknown parameter names will result in an error
//
// Example:
//
// redis://user:password@localhost:6789?dial_timeout=3&read_timeout=6s&addr=localhost:6790&addr=localhost:6791
// is equivalent to:
// &ClusterOptions{
// Addr: ["localhost:6789", "localhost:6790", "localhost:6791"]
// DialTimeout: 3 * time.Second, // no time unit = seconds
// ReadTimeout: 6 * time.Second,
// }
func ParseClusterURL(redisURL string) (*ClusterOptions, error) {
o := &ClusterOptions{}
u, err := url.Parse(redisURL)
if err != nil {
return nil, err
}
// add base URL to the array of addresses
// more addresses may be added through the URL params
h, p := getHostPortWithDefaults(u)
o.Addrs = append(o.Addrs, net.JoinHostPort(h, p))
// setup username, password, and other configurations
o, err = setupClusterConn(u, h, o)
if err != nil {
return nil, err
}
return o, nil
}
// setupClusterConn gets the username and password from the URL and the query parameters.
func setupClusterConn(u *url.URL, host string, o *ClusterOptions) (*ClusterOptions, error) {
switch u.Scheme {
case "rediss":
o.TLSConfig = &tls.Config{ServerName: host}
fallthrough
case "redis":
o.Username, o.Password = getUserPassword(u)
default:
return nil, fmt.Errorf("redis: invalid URL scheme: %s", u.Scheme)
}
// retrieve the configuration from the query parameters
o, err := setupClusterQueryParams(u, o)
if err != nil {
return nil, err
}
return o, nil
}
// setupClusterQueryParams converts query parameters in u to option value in o.
func setupClusterQueryParams(u *url.URL, o *ClusterOptions) (*ClusterOptions, error) {
q := queryOptions{q: u.Query()}
o.Protocol = q.int("protocol")
o.ClientName = q.string("client_name")
o.MaxRedirects = q.int("max_redirects")
o.ReadOnly = q.bool("read_only")
o.RouteByLatency = q.bool("route_by_latency")
o.RouteRandomly = q.bool("route_randomly")
o.MaxRetries = q.int("max_retries")
o.MinRetryBackoff = q.duration("min_retry_backoff")
o.MaxRetryBackoff = q.duration("max_retry_backoff")
o.DialTimeout = q.duration("dial_timeout")
o.DialerRetries = q.int("dialer_retries")
o.DialerRetryTimeout = q.duration("dialer_retry_timeout")
o.ReadTimeout = q.duration("read_timeout")
o.WriteTimeout = q.duration("write_timeout")
o.PoolFIFO = q.bool("pool_fifo")
o.PoolSize = q.int("pool_size")
o.MaxConcurrentDials = q.int("max_concurrent_dials")
o.MinIdleConns = q.int("min_idle_conns")
o.MaxIdleConns = q.int("max_idle_conns")
o.MaxActiveConns = q.int("max_active_conns")
o.PoolTimeout = q.duration("pool_timeout")
o.ConnMaxLifetime = q.duration("conn_max_lifetime")
if q.has("conn_max_lifetime_jitter") {
o.ConnMaxLifetimeJitter = min(q.duration("conn_max_lifetime_jitter"), o.ConnMaxLifetime)
}
o.ConnMaxIdleTime = q.duration("conn_max_idle_time")
o.FailingTimeoutSeconds = q.int("failing_timeout_seconds")
if q.err != nil {
return nil, q.err
}
// addr can be specified as many times as needed
addrs := q.strings("addr")
for _, addr := range addrs {
h, p, err := net.SplitHostPort(addr)
if err != nil || h == "" || p == "" {
return nil, fmt.Errorf("redis: unable to parse addr param: %s", addr)
}
o.Addrs = append(o.Addrs, net.JoinHostPort(h, p))
}
// any parameters left?
if r := q.remaining(); len(r) > 0 {
return nil, fmt.Errorf("redis: unexpected option: %s", strings.Join(r, ", "))
}
return o, nil
}
func (opt *ClusterOptions) clientOptions() *Options {
// Clone MaintNotificationsConfig to avoid sharing between cluster node clients
var maintNotificationsConfig *maintnotifications.Config
if opt.MaintNotificationsConfig != nil {
configClone := *opt.MaintNotificationsConfig
maintNotificationsConfig = &configClone
}
return &Options{
ClientName: opt.ClientName,
Dialer: opt.Dialer,
OnConnect: opt.OnConnect,
Protocol: opt.Protocol,
Username: opt.Username,
Password: opt.Password,
CredentialsProvider: opt.CredentialsProvider,
CredentialsProviderContext: opt.CredentialsProviderContext,
StreamingCredentialsProvider: opt.StreamingCredentialsProvider,
MaxRetries: opt.MaxRetries,
MinRetryBackoff: opt.MinRetryBackoff,
MaxRetryBackoff: opt.MaxRetryBackoff,
DialTimeout: opt.DialTimeout,
DialerRetries: opt.DialerRetries,
DialerRetryTimeout: opt.DialerRetryTimeout,
ReadTimeout: opt.ReadTimeout,
WriteTimeout: opt.WriteTimeout,
ContextTimeoutEnabled: opt.ContextTimeoutEnabled,
PoolFIFO: opt.PoolFIFO,
PoolSize: opt.PoolSize,
MaxConcurrentDials: opt.MaxConcurrentDials,
PoolTimeout: opt.PoolTimeout,
MinIdleConns: opt.MinIdleConns,
MaxIdleConns: opt.MaxIdleConns,
MaxActiveConns: opt.MaxActiveConns,
ConnMaxIdleTime: opt.ConnMaxIdleTime,
ConnMaxLifetime: opt.ConnMaxLifetime,
ConnMaxLifetimeJitter: opt.ConnMaxLifetimeJitter,
ReadBufferSize: opt.ReadBufferSize,
WriteBufferSize: opt.WriteBufferSize,
DisableIdentity: opt.DisableIdentity,
DisableIndentity: opt.DisableIdentity,
IdentitySuffix: opt.IdentitySuffix,
FailingTimeoutSeconds: opt.FailingTimeoutSeconds,
TLSConfig: opt.TLSConfig,
// If ClusterSlots is populated, then we probably have an artificial
// cluster whose nodes are not in clustering mode (otherwise there isn't
// much use for ClusterSlots config). This means we cannot execute the
// READONLY command against that node -- setting readOnly to false in such
// situations in the options below will prevent that from happening.
readOnly: opt.ReadOnly && opt.ClusterSlots == nil,
UnstableResp3: opt.UnstableResp3,
MaintNotificationsConfig: maintNotificationsConfig,
PushNotificationProcessor: opt.PushNotificationProcessor,
}
}
//------------------------------------------------------------------------------
type clusterNode struct {
Client *Client
latency uint32 // atomic
generation uint32 // atomic
failing uint32 // atomic
loaded uint32 // atomic
// last time the latency measurement was performed for the node, stored in nanoseconds from epoch
lastLatencyMeasurement int64 // atomic
}
func newClusterNodeWithNodeAddress(clOpt *ClusterOptions, addr, nodeAddress string) *clusterNode {
opt := clOpt.clientOptions()
opt.Addr = addr
opt.NodeAddress = nodeAddress
node := clusterNode{
Client: clOpt.NewClient(opt),
}
node.latency = math.MaxUint32
if clOpt.RouteByLatency {
go node.updateLatency()
}
return &node
}
func (n *clusterNode) String() string {
return n.Client.String()
}
func (n *clusterNode) Close() error {
return n.Client.Close()
}
const maximumNodeLatency = 1 * time.Minute
func (n *clusterNode) updateLatency() {
const numProbe = 10
var dur uint64
successes := 0
for i := 0; i < numProbe; i++ {
time.Sleep(time.Duration(10+rand.Intn(10)) * time.Millisecond)
start := time.Now()
err := n.Client.Ping(context.TODO()).Err()
if err == nil {
dur += uint64(time.Since(start) / time.Microsecond)
successes++
}
}
var latency float64
if successes == 0 {
// If none of the pings worked, set latency to some arbitrarily high value so this node gets
// least priority.
latency = float64((maximumNodeLatency) / time.Microsecond)
} else {
latency = float64(dur) / float64(successes)
}
atomic.StoreUint32(&n.latency, uint32(latency+0.5))
n.SetLastLatencyMeasurement(time.Now())
}
func (n *clusterNode) Latency() time.Duration {
latency := atomic.LoadUint32(&n.latency)
return time.Duration(latency) * time.Microsecond
}
func (n *clusterNode) MarkAsFailing() {
atomic.StoreUint32(&n.failing, uint32(time.Now().Unix()))
atomic.StoreUint32(&n.loaded, 0)
}
func (n *clusterNode) Failing() bool {
timeout := int64(n.Client.opt.FailingTimeoutSeconds)
failing := atomic.LoadUint32(&n.failing)
if failing == 0 {
return false
}
if time.Now().Unix()-int64(failing) < timeout {
return true
}
atomic.StoreUint32(&n.failing, 0)
return false
}
func (n *clusterNode) Generation() uint32 {
return atomic.LoadUint32(&n.generation)
}
func (n *clusterNode) LastLatencyMeasurement() int64 {
return atomic.LoadInt64(&n.lastLatencyMeasurement)
}
func (n *clusterNode) SetGeneration(gen uint32) {
for {
v := atomic.LoadUint32(&n.generation)
if gen < v || atomic.CompareAndSwapUint32(&n.generation, v, gen) {
break
}
}
}
func (n *clusterNode) SetLastLatencyMeasurement(t time.Time) {
for {
v := atomic.LoadInt64(&n.lastLatencyMeasurement)
if t.UnixNano() < v || atomic.CompareAndSwapInt64(&n.lastLatencyMeasurement, v, t.UnixNano()) {
break
}
}
}
func (n *clusterNode) Loading() bool {
loaded := atomic.LoadUint32(&n.loaded)
if loaded == 1 {
return false
}
// check if the node is loading
ctx, cancel := context.WithTimeout(context.Background(), 100*time.Millisecond)
defer cancel()
err := n.Client.Ping(ctx).Err()
loading := err != nil && isLoadingError(err)
if !loading {
atomic.StoreUint32(&n.loaded, 1)
}
return loading
}
//------------------------------------------------------------------------------
type clusterNodes struct {
opt *ClusterOptions
mu sync.RWMutex
addrs []string
nodes map[string]*clusterNode
activeAddrs []string
closed bool
onNewNode []func(rdb *Client)
generation uint32 // atomic
}
func newClusterNodes(opt *ClusterOptions) *clusterNodes {
return &clusterNodes{
opt: opt,
addrs: opt.Addrs,
nodes: make(map[string]*clusterNode),
}
}
func (c *clusterNodes) Close() error {
c.mu.Lock()
defer c.mu.Unlock()
if c.closed {
return nil
}
c.closed = true
var firstErr error
for _, node := range c.nodes {
if err := node.Client.Close(); err != nil && firstErr == nil {
firstErr = err
}
}
c.nodes = nil
c.activeAddrs = nil
return firstErr
}
func (c *clusterNodes) OnNewNode(fn func(rdb *Client)) {
c.mu.Lock()
c.onNewNode = append(c.onNewNode, fn)
c.mu.Unlock()
}
func (c *clusterNodes) Addrs() ([]string, error) {
var addrs []string
c.mu.RLock()
closed := c.closed //nolint:ifshort
if !closed {
if len(c.activeAddrs) > 0 {
addrs = make([]string, len(c.activeAddrs))
copy(addrs, c.activeAddrs)
} else {
addrs = make([]string, len(c.addrs))
copy(addrs, c.addrs)
}
}
c.mu.RUnlock()
if closed {
return nil, pool.ErrClosed
}
if len(addrs) == 0 {
return nil, errClusterNoNodes
}
return addrs, nil
}
func (c *clusterNodes) NextGeneration() uint32 {
return atomic.AddUint32(&c.generation, 1)
}
// GC removes unused nodes.
func (c *clusterNodes) GC(generation uint32) {
var collected []*clusterNode
c.mu.Lock()
c.activeAddrs = c.activeAddrs[:0]
now := time.Now()
for addr, node := range c.nodes {
if node.Generation() >= generation {
c.activeAddrs = append(c.activeAddrs, addr)
if c.opt.RouteByLatency && node.LastLatencyMeasurement() < now.Add(-minLatencyMeasurementInterval).UnixNano() {
go node.updateLatency()
}
continue
}
delete(c.nodes, addr)
collected = append(collected, node)
}
c.mu.Unlock()
for _, node := range collected {
_ = node.Client.Close()
}
}
func (c *clusterNodes) GetOrCreate(addr string) (*clusterNode, error) {
return c.GetOrCreateWithNodeAddress(addr, "")
}
func (c *clusterNodes) GetOrCreateWithNodeAddress(addr, nodeAddress string) (*clusterNode, error) {
node, err := c.get(addr)
if err != nil {
return nil, err
}
if node != nil {
return node, nil
}
c.mu.Lock()
defer c.mu.Unlock()
if c.closed {
return nil, pool.ErrClosed
}
node, ok := c.nodes[addr]
if ok {
return node, nil
}
node = newClusterNodeWithNodeAddress(c.opt, addr, nodeAddress)
for _, fn := range c.onNewNode {
fn(node.Client)
}
c.addrs = appendIfNotExist(c.addrs, addr)
c.nodes[addr] = node
return node, nil
}
func (c *clusterNodes) get(addr string) (*clusterNode, error) {
c.mu.RLock()
defer c.mu.RUnlock()
if c.closed {
return nil, pool.ErrClosed
}
return c.nodes[addr], nil
}
func (c *clusterNodes) All() ([]*clusterNode, error) {
c.mu.RLock()
defer c.mu.RUnlock()
if c.closed {
return nil, pool.ErrClosed
}
cp := make([]*clusterNode, 0, len(c.nodes))
for _, node := range c.nodes {
cp = append(cp, node)
}
return cp, nil
}
func (c *clusterNodes) Random() (*clusterNode, error) {
addrs, err := c.Addrs()
if err != nil {
return nil, err
}
n := rand.Intn(len(addrs))
return c.GetOrCreate(addrs[n])
}
//------------------------------------------------------------------------------
type clusterSlot struct {
start int
end int
nodes []*clusterNode
}
type clusterSlotSlice []*clusterSlot
func (p clusterSlotSlice) Len() int {
return len(p)
}
func (p clusterSlotSlice) Less(i, j int) bool {
return p[i].start < p[j].start
}
func (p clusterSlotSlice) Swap(i, j int) {
p[i], p[j] = p[j], p[i]
}
type clusterState struct {
nodes *clusterNodes
Masters []*clusterNode
Slaves []*clusterNode
slots []*clusterSlot
generation uint32
createdAt time.Time
}
func newClusterState(
nodes *clusterNodes, slots []ClusterSlot, origin string,
) (*clusterState, error) {
c := clusterState{
nodes: nodes,
slots: make([]*clusterSlot, 0, len(slots)),
generation: nodes.NextGeneration(),
createdAt: time.Now(),
}
originHost, _, _ := net.SplitHostPort(origin)
isLoopbackOrigin := isLoopback(originHost)
for _, slot := range slots {
var nodes []*clusterNode
for i, slotNode := range slot.Nodes {
// slotNode.Addr is the node address from CLUSTER SLOTS
nodeAddress := slotNode.Addr
addr := nodeAddress
if !isLoopbackOrigin {
addr = replaceLoopbackHost(addr, originHost)
}
node, err := c.nodes.GetOrCreateWithNodeAddress(addr, nodeAddress)
if err != nil {
return nil, err
}
node.SetGeneration(c.generation)
nodes = append(nodes, node)
if i == 0 {
c.Masters = appendIfNotExist(c.Masters, node)
} else {
c.Slaves = appendIfNotExist(c.Slaves, node)
}
}
c.slots = append(c.slots, &clusterSlot{
start: slot.Start,
end: slot.End,
nodes: nodes,
})
}
sort.Sort(clusterSlotSlice(c.slots))
time.AfterFunc(time.Minute, func() {
nodes.GC(c.generation)
})
return &c, nil
}
func replaceLoopbackHost(nodeAddr, originHost string) string {
nodeHost, nodePort, err := net.SplitHostPort(nodeAddr)
if err != nil {
return nodeAddr
}
nodeIP := net.ParseIP(nodeHost)
if nodeIP == nil {
return nodeAddr
}
if !nodeIP.IsLoopback() {
return nodeAddr
}
// Use origin host which is not loopback and node port.
return net.JoinHostPort(originHost, nodePort)
}
// isLoopback returns true if the host is a loopback address.
// For IP addresses, it uses net.IP.IsLoopback().
// For hostnames, it recognizes well-known loopback hostnames like "localhost"
// and Docker-specific loopback patterns like "*.docker.internal".
func isLoopback(host string) bool {
ip := net.ParseIP(host)
if ip != nil {
return ip.IsLoopback()
}
if strings.ToLower(host) == "localhost" {
return true
}
if strings.HasSuffix(strings.ToLower(host), ".docker.internal") {
return true
}
return false
}
func (c *clusterState) slotMasterNode(slot int) (*clusterNode, error) {
nodes := c.slotNodes(slot)
if len(nodes) > 0 {
return nodes[0], nil
}
return c.nodes.Random()
}
func (c *clusterState) slotSlaveNode(slot int) (*clusterNode, error) {
nodes := c.slotNodes(slot)
switch len(nodes) {
case 0:
return c.nodes.Random()
case 1:
return nodes[0], nil
case 2:
slave := nodes[1]
if !slave.Failing() && !slave.Loading() {
return slave, nil
}
return nodes[0], nil
default:
var slave *clusterNode
for i := 0; i < 10; i++ {
n := rand.Intn(len(nodes)-1) + 1
slave = nodes[n]
if !slave.Failing() && !slave.Loading() {
return slave, nil
}
}
// All slaves are loading - use master.
return nodes[0], nil
}
}
func (c *clusterState) slotClosestNode(slot int) (*clusterNode, error) {
nodes := c.slotNodes(slot)
if len(nodes) == 0 {
return c.nodes.Random()
}
var allNodesFailing = true
var (
closestNonFailingNode *clusterNode
closestNode *clusterNode
minLatency time.Duration
)
// setting the max possible duration as zerovalue for minlatency
minLatency = time.Duration(math.MaxInt64)
for _, n := range nodes {
if closestNode == nil || n.Latency() < minLatency {
closestNode = n
minLatency = n.Latency()
if !n.Failing() {
closestNonFailingNode = n
allNodesFailing = false
}
}
}
// pick the healthly node with the lowest latency
if !allNodesFailing && closestNonFailingNode != nil {
return closestNonFailingNode, nil
}
// if all nodes are failing, we will pick the temporarily failing node with lowest latency
if minLatency < maximumNodeLatency && closestNode != nil {
internal.Logger.Printf(context.TODO(), "redis: all nodes are marked as failed, picking the temporarily failing node with lowest latency")
return closestNode, nil
}
// If all nodes are having the maximum latency(all pings are failing) - return a random node across the cluster
internal.Logger.Printf(context.TODO(), "redis: pings to all nodes are failing, picking a random node across the cluster")
return c.nodes.Random()
}
func (c *clusterState) slotRandomNode(slot int) (*clusterNode, error) {
nodes := c.slotNodes(slot)
if len(nodes) == 0 {
return c.nodes.Random()
}
if len(nodes) == 1 {
return nodes[0], nil
}
randomNodes := rand.Perm(len(nodes))
for _, idx := range randomNodes {
if node := nodes[idx]; !node.Failing() {
return node, nil
}
}
return nodes[randomNodes[0]], nil
}
func (c *clusterState) slotShardPickerSlaveNode(slot int, shardPicker routing.ShardPicker) (*clusterNode, error) {
nodes := c.slotNodes(slot)
if len(nodes) == 0 {
return c.nodes.Random()
}
// nodes[0] is master, nodes[1:] are slaves
// First, try all slave nodes for this slot using ShardPicker order
slaves := nodes[1:]
if len(slaves) > 0 {
for i := 0; i < len(slaves); i++ {
idx := shardPicker.Next(len(slaves))
slave := slaves[idx]
if !slave.Failing() && !slave.Loading() {
return slave, nil
}
}
}
// All slaves are failing or loading - return master
return nodes[0], nil
}
func (c *clusterState) slotNodes(slot int) []*clusterNode {
i := sort.Search(len(c.slots), func(i int) bool {
return c.slots[i].end >= slot
})
if i >= len(c.slots) {
return nil
}
x := c.slots[i]
if slot >= x.start && slot <= x.end {
return x.nodes
}
return nil
}
//------------------------------------------------------------------------------
type clusterStateHolder struct {
load func(ctx context.Context) (*clusterState, error)
reloadInterval time.Duration
state atomic.Value
reloading uint32 // atomic
reloadPending uint32 // atomic - set to 1 when reload is requested during active reload
}
func newClusterStateHolder(load func(ctx context.Context) (*clusterState, error), reloadInterval time.Duration) *clusterStateHolder {
return &clusterStateHolder{
load: load,
reloadInterval: reloadInterval,
}
}
func (c *clusterStateHolder) Reload(ctx context.Context) (*clusterState, error) {
state, err := c.load(ctx)
if err != nil {
return nil, err
}
c.state.Store(state)
return state, nil
}
func (c *clusterStateHolder) LazyReload() {
// If already reloading, mark that another reload is pending
if !atomic.CompareAndSwapUint32(&c.reloading, 0, 1) {
atomic.StoreUint32(&c.reloadPending, 1)
return
}
go func() {
for {
_, err := c.Reload(context.Background())
if err != nil {
atomic.StoreUint32(&c.reloadPending, 0)
atomic.StoreUint32(&c.reloading, 0)
return
}
// Clear pending flag after reload completes, before cooldown
// This captures notifications that arrived during the reload
atomic.StoreUint32(&c.reloadPending, 0)
// Wait cooldown period
time.Sleep(200 * time.Millisecond)
// Check if another reload was requested during cooldown
if atomic.LoadUint32(&c.reloadPending) == 0 {
// No pending reload, we're done
atomic.StoreUint32(&c.reloading, 0)
return
}
// Pending reload requested, loop to reload again
}
}()
}
func (c *clusterStateHolder) Get(ctx context.Context) (*clusterState, error) {
v := c.state.Load()
if v == nil {
return c.Reload(ctx)
}
state := v.(*clusterState)
if time.Since(state.createdAt) > c.reloadInterval {
c.LazyReload()
}
return state, nil
}
func (c *clusterStateHolder) ReloadOrGet(ctx context.Context) (*clusterState, error) {
state, err := c.Reload(ctx)
if err == nil {
return state, nil
}
return c.Get(ctx)
}
//------------------------------------------------------------------------------
// ClusterClient is a Redis Cluster client representing a pool of zero
// or more underlying connections. It's safe for concurrent use by
// multiple goroutines.
type ClusterClient struct {
opt *ClusterOptions
nodes *clusterNodes
state *clusterStateHolder
cmdsInfoCache *cmdsInfoCache
cmdInfoResolver *commandInfoResolver
cmdable
hooksMixin
}
// NewClusterClient returns a Redis Cluster client as described in
// https://redis.io/docs/latest/operate/oss_and_stack/reference/cluster-spec.
func NewClusterClient(opt *ClusterOptions) *ClusterClient {
opt.init()
c := &ClusterClient{
opt: opt,
nodes: newClusterNodes(opt),
}
c.cmdsInfoCache = newCmdsInfoCache(c.cmdsInfo)
c.state = newClusterStateHolder(c.loadState, opt.ClusterStateReloadInterval)
c.SetCommandInfoResolver(NewDefaultCommandPolicyResolver())
c.cmdable = c.Process
c.initHooks(hooks{
dial: nil,
process: c.process,
pipeline: c.processPipeline,
txPipeline: c.processTxPipeline,
})
// Set up SMIGRATED notification handling for cluster state reload
// When a node client receives a SMIGRATED notification, it should trigger
// cluster state reload on the parent ClusterClient
if opt.MaintNotificationsConfig != nil {
c.nodes.OnNewNode(func(nodeClient *Client) {
manager := nodeClient.GetMaintNotificationsManager()
if manager != nil {
manager.SetClusterStateReloadCallback(func(ctx context.Context, hostPort string, slotRanges []string) {
// Log the migration details for now
if internal.LogLevel.InfoOrAbove() {
internal.Logger.Printf(ctx, "cluster: slots %v migrated to %s, reloading cluster state", slotRanges, hostPort)
}
// Currently we reload the entire cluster state
// In the future, this could be optimized to reload only the specific slots
c.state.LazyReload()
})
}
})
}
return c
}
// Options returns read-only Options that were used to create the client.
func (c *ClusterClient) Options() *ClusterOptions {
return c.opt
}
// ReloadState reloads cluster state. If available it calls ClusterSlots func
// to get cluster slots information.
func (c *ClusterClient) ReloadState(ctx context.Context) {
c.state.LazyReload()
}
// Close closes the cluster client, releasing any open resources.
//
// It is rare to Close a ClusterClient, as the ClusterClient is meant
// to be long-lived and shared between many goroutines.
func (c *ClusterClient) Close() error {
return c.nodes.Close()
}
func (c *ClusterClient) Process(ctx context.Context, cmd Cmder) error {
err := c.processHook(ctx, cmd)
cmd.SetErr(err)
return err
}
func (c *ClusterClient) process(ctx context.Context, cmd Cmder) error {
slot := c.cmdSlot(cmd, -1)
var node *clusterNode
var moved bool
var ask bool
var lastErr error
for attempt := 0; attempt <= c.opt.MaxRedirects; attempt++ {
// MOVED and ASK responses are not transient errors that require retry delay; they
// should be attempted immediately.
if attempt > 0 && !moved && !ask {
if err := internal.Sleep(ctx, c.retryBackoff(attempt)); err != nil {
return err
}
}
if node == nil {
var err error
if !c.opt.DisableRoutingPolicies && c.opt.ShardPicker != nil {
node, err = c.cmdNodeWithShardPicker(ctx, cmd.Name(), slot, c.opt.ShardPicker)
} else {
node, err = c.cmdNode(ctx, cmd.Name(), slot)
}
if err != nil {
return err
}
}
if ask {
ask = false
pipe := node.Client.Pipeline()
_ = pipe.Process(ctx, NewCmd(ctx, "asking"))
_ = pipe.Process(ctx, cmd)
_, lastErr = pipe.Exec(ctx)
} else {
if !c.opt.DisableRoutingPolicies {
lastErr = c.routeAndRun(ctx, cmd, node)
} else {
lastErr = node.Client.Process(ctx, cmd)
}
}
// If there is no error - we are done.
if lastErr == nil {
return nil
}
if isReadOnly := isReadOnlyError(lastErr); isReadOnly || lastErr == pool.ErrClosed {
if isReadOnly {
c.state.LazyReload()
}
node = nil
continue
}
// If slave is loading - pick another node.
if c.opt.ReadOnly && isLoadingError(lastErr) {
node.MarkAsFailing()
node = nil
continue
}
var addr string
moved, ask, addr = isMovedError(lastErr)
if moved || ask {
c.state.LazyReload()
// Record error metrics
if errorCallback := pool.GetMetricErrorCallback(); errorCallback != nil {
errorType := "MOVED"
statusCode := "MOVED"
if ask {
errorType = "ASK"
statusCode = "ASK"
}
// MOVED/ASK are not internal errors, and this is the first attempt (retry count = 0)
errorCallback(ctx, errorType, nil, statusCode, false, 0)
}
var err error
node, err = c.nodes.GetOrCreate(addr)
if err != nil {
return err
}
continue
}
if shouldRetry(lastErr, cmd.readTimeout() == nil) {
// First retry the same node.
if attempt == 0 {
continue
}
// Second try another node.
node.MarkAsFailing()
node = nil
continue
}
return lastErr
}
return lastErr
}
func (c *ClusterClient) OnNewNode(fn func(rdb *Client)) {
c.nodes.OnNewNode(fn)
}
// ForEachMaster concurrently calls the fn on each master node in the cluster.
// It returns the first error if any.
func (c *ClusterClient) ForEachMaster(
ctx context.Context,
fn func(ctx context.Context, client *Client) error,
) error {
state, err := c.state.ReloadOrGet(ctx)
if err != nil {
return err
}
var wg sync.WaitGroup
errCh := make(chan error, 1)
for _, master := range state.Masters {
wg.Add(1)
go func(node *clusterNode) {
defer wg.Done()
err := fn(ctx, node.Client)
if err != nil {
select {
case errCh <- err:
default:
}
}
}(master)
}
wg.Wait()
select {
case err := <-errCh:
return err
default:
return nil
}
}
// ForEachSlave concurrently calls the fn on each slave node in the cluster.
// It returns the first error if any.
func (c *ClusterClient) ForEachSlave(
ctx context.Context,
fn func(ctx context.Context, client *Client) error,
) error {
state, err := c.state.ReloadOrGet(ctx)
if err != nil {
return err
}
var wg sync.WaitGroup
errCh := make(chan error, 1)
for _, slave := range state.Slaves {
wg.Add(1)
go func(node *clusterNode) {
defer wg.Done()
err := fn(ctx, node.Client)
if err != nil {
select {
case errCh <- err:
default:
}
}
}(slave)
}
wg.Wait()
select {
case err := <-errCh:
return err
default:
return nil
}
}
// ForEachShard concurrently calls the fn on each known node in the cluster.
// It returns the first error if any.
func (c *ClusterClient) ForEachShard(
ctx context.Context,
fn func(ctx context.Context, client *Client) error,
) error {
state, err := c.state.ReloadOrGet(ctx)
if err != nil {
return err
}
var wg sync.WaitGroup
errCh := make(chan error, 1)
worker := func(node *clusterNode) {
defer wg.Done()
err := fn(ctx, node.Client)
if err != nil {
select {
case errCh <- err:
default:
}
}
}
for _, node := range state.Masters {
wg.Add(1)
go worker(node)
}
for _, node := range state.Slaves {
wg.Add(1)
go worker(node)
}
wg.Wait()
select {
case err := <-errCh:
return err
default:
return nil
}
}
// PoolStats returns accumulated connection pool stats.
func (c *ClusterClient) PoolStats() *PoolStats {
var acc PoolStats
state, _ := c.state.Get(context.TODO())
if state == nil {
return &acc
}
for _, node := range state.Masters {
s := node.Client.connPool.Stats()
acc.Hits += s.Hits
acc.Misses += s.Misses
acc.Timeouts += s.Timeouts
acc.TotalConns += s.TotalConns
acc.IdleConns += s.IdleConns
acc.StaleConns += s.StaleConns
}
for _, node := range state.Slaves {
s := node.Client.connPool.Stats()
acc.Hits += s.Hits
acc.Misses += s.Misses
acc.Timeouts += s.Timeouts
acc.TotalConns += s.TotalConns
acc.IdleConns += s.IdleConns
acc.StaleConns += s.StaleConns
}
return &acc
}
func (c *ClusterClient) loadState(ctx context.Context) (*clusterState, error) {
if c.opt.ClusterSlots != nil {
slots, err := c.opt.ClusterSlots(ctx)
if err != nil {
return nil, err
}
return newClusterState(c.nodes, slots, "")
}
addrs, err := c.nodes.Addrs()
if err != nil {
return nil, err
}
var firstErr error
for _, idx := range rand.Perm(len(addrs)) {
addr := addrs[idx]
node, err := c.nodes.GetOrCreate(addr)
if err != nil {
if firstErr == nil {
firstErr = err
}
continue
}
slots, err := node.Client.ClusterSlots(ctx).Result()
if err != nil {
if firstErr == nil {
firstErr = err
}
continue
}
return newClusterState(c.nodes, slots, addr)
}
/*
* No node is connectable. It's possible that all nodes' IP has changed.
* Clear activeAddrs to let client be able to re-connect using the initial
* setting of the addresses (e.g. [redis-cluster-0:6379, redis-cluster-1:6379]),
* which might have chance to resolve domain name and get updated IP address.
*/
c.nodes.mu.Lock()
c.nodes.activeAddrs = nil
c.nodes.mu.Unlock()
return nil, firstErr
}
func (c *ClusterClient) Pipeline() Pipeliner {
pipe := Pipeline{
exec: pipelineExecer(c.processPipelineHook),
}
pipe.init()
return &pipe
}
func (c *ClusterClient) Pipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.Pipeline().Pipelined(ctx, fn)
}
func (c *ClusterClient) processPipeline(ctx context.Context, cmds []Cmder) error {
// Only call time.Now() if pipeline operation duration callback is set to avoid overhead
var operationStart time.Time
pipelineOpDurationCallback := otel.GetPipelineOperationDurationCallback()
if pipelineOpDurationCallback != nil {
operationStart = time.Now()
}
totalAttempts := 0
cmdsMap := newCmdsMap()
if err := c.mapCmdsByNode(ctx, cmdsMap, cmds); err != nil {
setCmdsErr(cmds, err)
if pipelineOpDurationCallback != nil {
operationDuration := time.Since(operationStart)
pipelineOpDurationCallback(ctx, operationDuration, "PIPELINE", len(cmds), 1, err, nil, 0)
}
return err
}
var lastErr error
for attempt := 0; attempt <= c.opt.MaxRedirects; attempt++ {
totalAttempts++
if attempt > 0 {
if err := internal.Sleep(ctx, c.retryBackoff(attempt)); err != nil {
setCmdsErr(cmds, err)
if pipelineOpDurationCallback != nil {
operationDuration := time.Since(operationStart)
pipelineOpDurationCallback(ctx, operationDuration, "PIPELINE", len(cmds), totalAttempts, err, nil, 0)
}
return err
}
}
failedCmds := newCmdsMap()
var wg sync.WaitGroup
for node, cmds := range cmdsMap.m {
wg.Add(1)
go func(node *clusterNode, cmds []Cmder) {
defer wg.Done()
c.processPipelineNode(ctx, node, cmds, failedCmds)
}(node, cmds)
}
wg.Wait()
if len(failedCmds.m) == 0 {
break
}
cmdsMap = failedCmds
lastErr = cmdsFirstErr(cmds)
}
// Record pipeline operation duration
if pipelineOpDurationCallback != nil {
operationDuration := time.Since(operationStart)
finalErr := cmdsFirstErr(cmds)
if finalErr == nil {
finalErr = lastErr
}
pipelineOpDurationCallback(ctx, operationDuration, "PIPELINE", len(cmds), totalAttempts, finalErr, nil, 0)
}
return cmdsFirstErr(cmds)
}
func (c *ClusterClient) mapCmdsByNode(ctx context.Context, cmdsMap *cmdsMap, cmds []Cmder) error {
state, err := c.state.Get(ctx)
if err != nil {
return err
}
if c.opt.ReadOnly && c.cmdsAreReadOnly(ctx, cmds) {
for _, cmd := range cmds {
var policy *routing.CommandPolicy
if c.cmdInfoResolver != nil {
policy = c.cmdInfoResolver.GetCommandPolicy(ctx, cmd)
}
if policy != nil && !policy.CanBeUsedInPipeline() {
return fmt.Errorf(
"redis: cannot pipeline command %q with request policy ReqAllNodes/ReqAllShards/ReqMultiShard; Note: This behavior is subject to change in the future", cmd.Name(),
)
}
slot := c.cmdSlot(cmd, -1)
var node *clusterNode
// For keyless commands (slot == -1), use ShardPicker if routing policies are enabled
if slot == -1 && !c.opt.DisableRoutingPolicies && c.opt.ShardPicker != nil {
if len(state.Masters) == 0 {
return errClusterNoNodes
}
// For read-only keyless commands, pick from all nodes (masters + slaves)
allNodes := append(state.Masters, state.Slaves...)
idx := c.opt.ShardPicker.Next(len(allNodes))
node = allNodes[idx]
} else {
node, err = c.slotReadOnlyNode(state, slot)
if err != nil {
return err
}
}
cmdsMap.Add(node, cmd)
}
return nil
}
for _, cmd := range cmds {
var policy *routing.CommandPolicy
if c.cmdInfoResolver != nil {
policy = c.cmdInfoResolver.GetCommandPolicy(ctx, cmd)
}
if policy != nil && !policy.CanBeUsedInPipeline() {
return fmt.Errorf(
"redis: cannot pipeline command %q with request policy ReqAllNodes/ReqAllShards/ReqMultiShard; Note: This behavior is subject to change in the future", cmd.Name(),
)
}
slot := c.cmdSlot(cmd, -1)
var node *clusterNode
// For keyless commands (slot == -1), use ShardPicker if routing policies are enabled
if slot == -1 && !c.opt.DisableRoutingPolicies && c.opt.ShardPicker != nil {
if len(state.Masters) == 0 {
return errClusterNoNodes
}
idx := c.opt.ShardPicker.Next(len(state.Masters))
node = state.Masters[idx]
} else {
node, err = state.slotMasterNode(slot)
if err != nil {
return err
}
}
cmdsMap.Add(node, cmd)
}
return nil
}
func (c *ClusterClient) cmdsAreReadOnly(ctx context.Context, cmds []Cmder) bool {
for _, cmd := range cmds {
cmdInfo := c.cmdInfo(ctx, cmd.Name())
if cmdInfo == nil || !cmdInfo.ReadOnly {
return false
}
}
return true
}
func (c *ClusterClient) processPipelineNode(
ctx context.Context, node *clusterNode, cmds []Cmder, failedCmds *cmdsMap,
) {
_ = node.Client.withProcessPipelineHook(ctx, cmds, func(ctx context.Context, cmds []Cmder) error {
cn, err := node.Client.getConn(ctx)
if err != nil {
if !isContextError(err) {
node.MarkAsFailing()
}
_ = c.mapCmdsByNode(ctx, failedCmds, cmds)
setCmdsErr(cmds, err)
return err
}
var processErr error
defer func() {
node.Client.releaseConn(ctx, cn, processErr)
}()
processErr = c.processPipelineNodeConn(ctx, node, cn, cmds, failedCmds)
return processErr
})
}
func (c *ClusterClient) processPipelineNodeConn(
ctx context.Context, node *clusterNode, cn *pool.Conn, cmds []Cmder, failedCmds *cmdsMap,
) error {
if err := cn.WithWriter(c.context(ctx), c.opt.WriteTimeout, func(wr *proto.Writer) error {
return writeCmds(wr, cmds)
}); err != nil {
if isBadConn(err, false, node.Client.getAddr()) {
node.MarkAsFailing()
}
if shouldRetry(err, true) {
_ = c.mapCmdsByNode(ctx, failedCmds, cmds)
}
setCmdsErr(cmds, err)
return err
}
return cn.WithReader(c.context(ctx), c.opt.ReadTimeout, func(rd *proto.Reader) error {
return c.pipelineReadCmds(ctx, node, rd, cmds, failedCmds)
})
}
func (c *ClusterClient) pipelineReadCmds(
ctx context.Context,
node *clusterNode,
rd *proto.Reader,
cmds []Cmder,
failedCmds *cmdsMap,
) error {
for i, cmd := range cmds {
err := cmd.readReply(rd)
cmd.SetErr(err)
if err == nil {
continue
}
if c.checkMovedErr(ctx, cmd, err, failedCmds) {
continue
}
if c.opt.ReadOnly && isBadConn(err, false, node.Client.getAddr()) {
node.MarkAsFailing()
}
if !isRedisError(err) {
if shouldRetry(err, true) {
_ = c.mapCmdsByNode(ctx, failedCmds, cmds)
}
setCmdsErr(cmds[i+1:], err)
return err
}
}
if err := cmds[0].Err(); err != nil && shouldRetry(err, true) {
_ = c.mapCmdsByNode(ctx, failedCmds, cmds)
return err
}
return nil
}
func (c *ClusterClient) checkMovedErr(
ctx context.Context, cmd Cmder, err error, failedCmds *cmdsMap,
) bool {
moved, ask, addr := isMovedError(err)
if !moved && !ask {
return false
}
node, err := c.nodes.GetOrCreate(addr)
if err != nil {
return false
}
if moved {
c.state.LazyReload()
failedCmds.Add(node, cmd)
return true
}
if ask {
failedCmds.Add(node, NewCmd(ctx, "asking"), cmd)
return true
}
panic("not reached")
}
// TxPipeline acts like Pipeline, but wraps queued commands with MULTI/EXEC.
func (c *ClusterClient) TxPipeline() Pipeliner {
pipe := Pipeline{
exec: func(ctx context.Context, cmds []Cmder) error {
cmds = wrapMultiExec(ctx, cmds)
return c.processTxPipelineHook(ctx, cmds)
},
}
pipe.init()
return &pipe
}
func (c *ClusterClient) TxPipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.TxPipeline().Pipelined(ctx, fn)
}
func (c *ClusterClient) processTxPipeline(ctx context.Context, cmds []Cmder) error {
// Only call time.Now() if pipeline operation duration callback is set to avoid overhead
var operationStart time.Time
pipelineOpDurationCallback := otel.GetPipelineOperationDurationCallback()
if pipelineOpDurationCallback != nil {
operationStart = time.Now()
}
totalAttempts := 0
// Trim multi .. exec.
cmds = cmds[1 : len(cmds)-1]
if len(cmds) == 0 {
return nil
}
state, err := c.state.Get(ctx)
if err != nil {
setCmdsErr(cmds, err)
if pipelineOpDurationCallback != nil {
operationDuration := time.Since(operationStart)
pipelineOpDurationCallback(ctx, operationDuration, "MULTI", len(cmds), 1, err, nil, 0)
}
return err
}
keyedCmdsBySlot := c.slottedKeyedCommands(ctx, cmds)
slot := -1
switch len(keyedCmdsBySlot) {
case 0:
slot = hashtag.RandomSlot()
case 1:
for sl := range keyedCmdsBySlot {
slot = sl
break
}
default:
// TxPipeline does not support cross slot transaction.
setCmdsErr(cmds, ErrCrossSlot)
if pipelineOpDurationCallback != nil {
operationDuration := time.Since(operationStart)
pipelineOpDurationCallback(ctx, operationDuration, "MULTI", len(cmds), 1, ErrCrossSlot, nil, 0)
}
return ErrCrossSlot
}
node, err := state.slotMasterNode(slot)
if err != nil {
setCmdsErr(cmds, err)
if pipelineOpDurationCallback != nil {
operationDuration := time.Since(operationStart)
pipelineOpDurationCallback(ctx, operationDuration, "MULTI", len(cmds), 1, err, nil, 0)
}
return err
}
var lastErr error
cmdsMap := map[*clusterNode][]Cmder{node: cmds}
for attempt := 0; attempt <= c.opt.MaxRedirects; attempt++ {
totalAttempts++
if attempt > 0 {
if err := internal.Sleep(ctx, c.retryBackoff(attempt)); err != nil {
setCmdsErr(cmds, err)
if pipelineOpDurationCallback != nil {
operationDuration := time.Since(operationStart)
pipelineOpDurationCallback(ctx, operationDuration, "MULTI", len(cmds), totalAttempts, err, nil, 0)
}
return err
}
}
failedCmds := newCmdsMap()
var wg sync.WaitGroup
for node, cmds := range cmdsMap {
wg.Add(1)
go func(node *clusterNode, cmds []Cmder) {
defer wg.Done()
c.processTxPipelineNode(ctx, node, cmds, failedCmds)
}(node, cmds)
}
wg.Wait()
if len(failedCmds.m) == 0 {
break
}
cmdsMap = failedCmds.m
lastErr = cmdsFirstErr(cmds)
}
if pipelineOpDurationCallback != nil {
operationDuration := time.Since(operationStart)
finalErr := cmdsFirstErr(cmds)
if finalErr == nil {
finalErr = lastErr
}
pipelineOpDurationCallback(ctx, operationDuration, "MULTI", len(cmds), totalAttempts, finalErr, nil, 0)
}
return cmdsFirstErr(cmds)
}
// slottedKeyedCommands returns a map of slot to commands taking into account
// only commands that have keys.
func (c *ClusterClient) slottedKeyedCommands(ctx context.Context, cmds []Cmder) map[int][]Cmder {
cmdsSlots := map[int][]Cmder{}
prefferedRandomSlot := -1
for _, cmd := range cmds {
if cmdFirstKeyPos(cmd) == 0 {
continue
}
slot := c.cmdSlot(cmd, prefferedRandomSlot)
if prefferedRandomSlot == -1 {
prefferedRandomSlot = slot
}
cmdsSlots[slot] = append(cmdsSlots[slot], cmd)
}
return cmdsSlots
}
func (c *ClusterClient) processTxPipelineNode(
ctx context.Context, node *clusterNode, cmds []Cmder, failedCmds *cmdsMap,
) {
cmds = wrapMultiExec(ctx, cmds)
_ = node.Client.withProcessPipelineHook(ctx, cmds, func(ctx context.Context, cmds []Cmder) error {
cn, err := node.Client.getConn(ctx)
if err != nil {
_ = c.mapCmdsByNode(ctx, failedCmds, cmds)
setCmdsErr(cmds, err)
return err
}
var processErr error
defer func() {
node.Client.releaseConn(ctx, cn, processErr)
}()
processErr = c.processTxPipelineNodeConn(ctx, node, cn, cmds, failedCmds)
return processErr
})
}
func (c *ClusterClient) processTxPipelineNodeConn(
ctx context.Context, node *clusterNode, cn *pool.Conn, cmds []Cmder, failedCmds *cmdsMap,
) error {
if err := cn.WithWriter(c.context(ctx), c.opt.WriteTimeout, func(wr *proto.Writer) error {
return writeCmds(wr, cmds)
}); err != nil {
if shouldRetry(err, true) {
_ = c.mapCmdsByNode(ctx, failedCmds, cmds)
}
setCmdsErr(cmds, err)
return err
}
return cn.WithReader(c.context(ctx), c.opt.ReadTimeout, func(rd *proto.Reader) error {
statusCmd := cmds[0].(*StatusCmd)
// Trim multi and exec.
trimmedCmds := cmds[1 : len(cmds)-1]
if err := c.txPipelineReadQueued(
ctx, node, cn, rd, statusCmd, trimmedCmds, failedCmds,
); err != nil {
setCmdsErr(cmds, err)
moved, ask, addr := isMovedError(err)
if moved || ask {
return c.cmdsMoved(ctx, trimmedCmds, moved, ask, addr, failedCmds)
}
return err
}
return node.Client.pipelineReadCmds(ctx, cn, rd, trimmedCmds)
})
}
func (c *ClusterClient) txPipelineReadQueued(
ctx context.Context,
node *clusterNode,
cn *pool.Conn,
rd *proto.Reader,
statusCmd *StatusCmd,
cmds []Cmder,
failedCmds *cmdsMap,
) error {
// Parse queued replies.
// To be sure there are no buffered push notifications, we process them before reading the reply
if err := node.Client.processPendingPushNotificationWithReader(ctx, cn, rd); err != nil {
// Log the error but don't fail the command execution
// Push notification processing errors shouldn't break normal Redis operations
internal.Logger.Printf(ctx, "push: error processing pending notifications before reading reply: %v", err)
}
if err := statusCmd.readReply(rd); err != nil {
return err
}
for _, cmd := range cmds {
// To be sure there are no buffered push notifications, we process them before reading the reply
if err := node.Client.processPendingPushNotificationWithReader(ctx, cn, rd); err != nil {
// Log the error but don't fail the command execution
// Push notification processing errors shouldn't break normal Redis operations
internal.Logger.Printf(ctx, "push: error processing pending notifications before reading reply: %v", err)
}
err := statusCmd.readReply(rd)
if err != nil {
if c.checkMovedErr(ctx, cmd, err, failedCmds) {
// will be processed later
continue
}
cmd.SetErr(err)
if !isRedisError(err) {
return err
}
}
}
// To be sure there are no buffered push notifications, we process them before reading the reply
if err := node.Client.processPendingPushNotificationWithReader(ctx, cn, rd); err != nil {
// Log the error but don't fail the command execution
// Push notification processing errors shouldn't break normal Redis operations
internal.Logger.Printf(ctx, "push: error processing pending notifications before reading reply: %v", err)
}
// Parse number of replies.
line, err := rd.ReadLine()
if err != nil {
if err == Nil {
err = TxFailedErr
}
return err
}
if line[0] != proto.RespArray {
return fmt.Errorf("redis: expected '*', but got line %q", line)
}
return nil
}
func (c *ClusterClient) cmdsMoved(
ctx context.Context, cmds []Cmder,
moved, ask bool,
addr string,
failedCmds *cmdsMap,
) error {
node, err := c.nodes.GetOrCreate(addr)
if err != nil {
return err
}
if moved {
c.state.LazyReload()
for _, cmd := range cmds {
failedCmds.Add(node, cmd)
}
return nil
}
if ask {
for _, cmd := range cmds {
failedCmds.Add(node, NewCmd(ctx, "asking"), cmd)
}
return nil
}
return nil
}
func (c *ClusterClient) Watch(ctx context.Context, fn func(*Tx) error, keys ...string) error {
if len(keys) == 0 {
return errNoWatchKeys
}
slot := hashtag.Slot(keys[0])
for _, key := range keys[1:] {
if hashtag.Slot(key) != slot {
return errWatchCrosslot
}
}
node, err := c.slotMasterNode(ctx, slot)
if err != nil {
return err
}
for attempt := 0; attempt <= c.opt.MaxRedirects; attempt++ {
if attempt > 0 {
if err := internal.Sleep(ctx, c.retryBackoff(attempt)); err != nil {
return err
}
}
err = node.Client.Watch(ctx, fn, keys...)
if err == nil {
break
}
moved, ask, addr := isMovedError(err)
if moved || ask {
node, err = c.nodes.GetOrCreate(addr)
if err != nil {
return err
}
continue
}
if isReadOnly := isReadOnlyError(err); isReadOnly || err == pool.ErrClosed {
if isReadOnly {
c.state.LazyReload()
}
node, err = c.slotMasterNode(ctx, slot)
if err != nil {
return err
}
continue
}
if shouldRetry(err, true) {
continue
}
return err
}
return err
}
// maintenance notifications won't work here for now
func (c *ClusterClient) pubSub() *PubSub {
var node *clusterNode
pubsub := &PubSub{
opt: c.opt.clientOptions(),
newConn: func(ctx context.Context, addr string, channels []string) (*pool.Conn, error) {
if node != nil {
panic("node != nil")
}
var err error
if len(channels) > 0 {
slot := hashtag.Slot(channels[0])
// newConn in PubSub is only used for subscription connections, so it is safe to
// assume that a slave node can always be used when client options specify ReadOnly.
if c.opt.ReadOnly {
state, err := c.state.Get(ctx)
if err != nil {
return nil, err
}
node, err = c.slotReadOnlyNode(state, slot)
if err != nil {
return nil, err
}
} else {
node, err = c.slotMasterNode(ctx, slot)
if err != nil {
return nil, err
}
}
} else {
node, err = c.nodes.Random()
if err != nil {
return nil, err
}
}
cn, err := node.Client.pubSubPool.NewConn(ctx, node.Client.opt.Network, node.Client.opt.Addr, channels)
if err != nil {
node = nil
return nil, err
}
// will return nil if already initialized
err = node.Client.initConn(ctx, cn)
if err != nil {
_ = cn.Close()
node = nil
return nil, err
}
node.Client.pubSubPool.TrackConn(cn)
return cn, nil
},
closeConn: func(cn *pool.Conn) error {
// Untrack connection from PubSubPool
node.Client.pubSubPool.UntrackConn(cn)
err := cn.Close()
node = nil
return err
},
}
pubsub.init()
return pubsub
}
// Subscribe subscribes the client to the specified channels.
// Channels can be omitted to create empty subscription.
func (c *ClusterClient) Subscribe(ctx context.Context, channels ...string) *PubSub {
pubsub := c.pubSub()
if len(channels) > 0 {
_ = pubsub.Subscribe(ctx, channels...)
}
return pubsub
}
// PSubscribe subscribes the client to the given patterns.
// Patterns can be omitted to create empty subscription.
func (c *ClusterClient) PSubscribe(ctx context.Context, channels ...string) *PubSub {
pubsub := c.pubSub()
if len(channels) > 0 {
_ = pubsub.PSubscribe(ctx, channels...)
}
return pubsub
}
// SSubscribe Subscribes the client to the specified shard channels.
func (c *ClusterClient) SSubscribe(ctx context.Context, channels ...string) *PubSub {
pubsub := c.pubSub()
if len(channels) > 0 {
_ = pubsub.SSubscribe(ctx, channels...)
}
return pubsub
}
func (c *ClusterClient) retryBackoff(attempt int) time.Duration {
return internal.RetryBackoff(attempt, c.opt.MinRetryBackoff, c.opt.MaxRetryBackoff)
}
func (c *ClusterClient) cmdsInfo(ctx context.Context) (map[string]*CommandInfo, error) {
// Try 3 random nodes.
const nodeLimit = 3
addrs, err := c.nodes.Addrs()
if err != nil {
return nil, err
}
var firstErr error
perm := rand.Perm(len(addrs))
if len(perm) > nodeLimit {
perm = perm[:nodeLimit]
}
for _, idx := range perm {
addr := addrs[idx]
node, err := c.nodes.GetOrCreate(addr)
if err != nil {
if firstErr == nil {
firstErr = err
}
continue
}
info, err := node.Client.Command(ctx).Result()
if err == nil {
return info, nil
}
if firstErr == nil {
firstErr = err
}
}
if firstErr == nil {
panic("not reached")
}
return nil, firstErr
}
// cmdInfo will fetch and cache the command policies after the first execution
func (c *ClusterClient) cmdInfo(ctx context.Context, name string) *CommandInfo {
// Use a separate context that won't be canceled to ensure command info lookup
// doesn't fail due to original context cancellation
cmdInfoCtx := c.context(ctx)
if c.opt.ContextTimeoutEnabled && ctx != nil {
// If context timeout is enabled, still use a reasonable timeout
var cancel context.CancelFunc
cmdInfoCtx, cancel = context.WithTimeout(context.Background(), 5*time.Second)
defer cancel()
}
cmdsInfo, err := c.cmdsInfoCache.Get(cmdInfoCtx)
if err != nil {
internal.Logger.Printf(cmdInfoCtx, "getting command info: %s", err)
return nil
}
info := cmdsInfo[name]
if info == nil {
internal.Logger.Printf(cmdInfoCtx, "info for cmd=%s not found", name)
}
return info
}
func (c *ClusterClient) cmdSlot(cmd Cmder, prefferedSlot int) int {
args := cmd.Args()
if args[0] == "cluster" && (args[1] == "getkeysinslot" || args[1] == "countkeysinslot") {
return args[2].(int)
}
return cmdSlot(cmd, cmdFirstKeyPos(cmd), prefferedSlot)
}
func cmdSlot(cmd Cmder, pos int, prefferedRandomSlot int) int {
if pos == 0 {
if prefferedRandomSlot != -1 {
return prefferedRandomSlot
}
// Return -1 for keyless commands to signal that ShardPicker should be used
return -1
}
firstKey := cmd.stringArg(pos)
return hashtag.Slot(firstKey)
}
func (c *ClusterClient) cmdNode(
ctx context.Context,
cmdName string,
slot int,
) (*clusterNode, error) {
state, err := c.state.Get(ctx)
if err != nil {
return nil, err
}
if c.opt.ReadOnly {
cmdInfo := c.cmdInfo(ctx, cmdName)
if cmdInfo != nil && cmdInfo.ReadOnly {
return c.slotReadOnlyNode(state, slot)
}
}
return state.slotMasterNode(slot)
}
func (c *ClusterClient) cmdNodeWithShardPicker(
ctx context.Context,
cmdName string,
slot int,
shardPicker routing.ShardPicker,
) (*clusterNode, error) {
state, err := c.state.Get(ctx)
if err != nil {
return nil, err
}
// For keyless commands (slot == -1), use ShardPicker to select a shard
// This respects the user's configured ShardPicker policy
if slot == -1 {
if len(state.Masters) == 0 {
return nil, errClusterNoNodes
}
idx := shardPicker.Next(len(state.Masters))
return state.Masters[idx], nil
}
if c.opt.ReadOnly {
cmdInfo := c.cmdInfo(ctx, cmdName)
if cmdInfo != nil && cmdInfo.ReadOnly {
return c.slotReadOnlyNode(state, slot)
}
}
return state.slotMasterNode(slot)
}
func (c *ClusterClient) slotReadOnlyNode(state *clusterState, slot int) (*clusterNode, error) {
if c.opt.RouteByLatency {
return state.slotClosestNode(slot)
}
if c.opt.RouteRandomly {
return state.slotRandomNode(slot)
}
if c.opt.ShardPicker != nil {
return state.slotShardPickerSlaveNode(slot, c.opt.ShardPicker)
}
return state.slotSlaveNode(slot)
}
func (c *ClusterClient) slotMasterNode(ctx context.Context, slot int) (*clusterNode, error) {
state, err := c.state.Get(ctx)
if err != nil {
return nil, err
}
return state.slotMasterNode(slot)
}
// SlaveForKey gets a client for a replica node to run any command on it.
// This is especially useful if we want to run a particular lua script which has
// only read only commands on the replica.
// This is because other redis commands generally have a flag that points that
// they are read only and automatically run on the replica nodes
// if ClusterOptions.ReadOnly flag is set to true.
func (c *ClusterClient) SlaveForKey(ctx context.Context, key string) (*Client, error) {
state, err := c.state.Get(ctx)
if err != nil {
return nil, err
}
slot := hashtag.Slot(key)
node, err := c.slotReadOnlyNode(state, slot)
if err != nil {
return nil, err
}
return node.Client, err
}
// MasterForKey return a client to the master node for a particular key.
func (c *ClusterClient) MasterForKey(ctx context.Context, key string) (*Client, error) {
slot := hashtag.Slot(key)
node, err := c.slotMasterNode(ctx, slot)
if err != nil {
return nil, err
}
return node.Client, nil
}
func (c *ClusterClient) context(ctx context.Context) context.Context {
if c.opt.ContextTimeoutEnabled {
return ctx
}
return context.Background()
}
func (c *ClusterClient) GetResolver() *commandInfoResolver {
return c.cmdInfoResolver
}
func (c *ClusterClient) SetCommandInfoResolver(cmdInfoResolver *commandInfoResolver) {
c.cmdInfoResolver = cmdInfoResolver
}
// extractCommandInfo retrieves the routing policy for a command
func (c *ClusterClient) extractCommandInfo(ctx context.Context, cmd Cmder) *routing.CommandPolicy {
if cmdInfo := c.cmdInfo(ctx, cmd.Name()); cmdInfo != nil && cmdInfo.CommandPolicy != nil {
return cmdInfo.CommandPolicy
}
return nil
}
// NewDynamicResolver returns a CommandInfoResolver
// that uses the underlying cmdInfo cache to resolve the policies
func (c *ClusterClient) NewDynamicResolver() *commandInfoResolver {
return &commandInfoResolver{
resolveFunc: c.extractCommandInfo,
}
}
func appendIfNotExist[T comparable](vals []T, newVal T) []T {
for _, v := range vals {
if v == newVal {
return vals
}
}
return append(vals, newVal)
}
//------------------------------------------------------------------------------
type cmdsMap struct {
mu sync.Mutex
m map[*clusterNode][]Cmder
}
func newCmdsMap() *cmdsMap {
return &cmdsMap{
m: make(map[*clusterNode][]Cmder),
}
}
func (m *cmdsMap) Add(node *clusterNode, cmds ...Cmder) {
m.mu.Lock()
m.m[node] = append(m.m[node], cmds...)
m.mu.Unlock()
}
package redis
import (
"context"
"sync"
"sync/atomic"
)
func (c *ClusterClient) DBSize(ctx context.Context) *IntCmd {
cmd := NewIntCmd(ctx, "dbsize")
_ = c.withProcessHook(ctx, cmd, func(ctx context.Context, _ Cmder) error {
var size int64
err := c.ForEachMaster(ctx, func(ctx context.Context, master *Client) error {
n, err := master.DBSize(ctx).Result()
if err != nil {
return err
}
atomic.AddInt64(&size, n)
return nil
})
if err != nil {
cmd.SetErr(err)
} else {
cmd.val = size
}
return nil
})
return cmd
}
func (c *ClusterClient) ScriptLoad(ctx context.Context, script string) *StringCmd {
cmd := NewStringCmd(ctx, "script", "load", script)
_ = c.withProcessHook(ctx, cmd, func(ctx context.Context, _ Cmder) error {
var mu sync.Mutex
err := c.ForEachShard(ctx, func(ctx context.Context, shard *Client) error {
val, err := shard.ScriptLoad(ctx, script).Result()
if err != nil {
return err
}
mu.Lock()
if cmd.Val() == "" {
cmd.val = val
}
mu.Unlock()
return nil
})
if err != nil {
cmd.SetErr(err)
}
return nil
})
return cmd
}
func (c *ClusterClient) ScriptFlush(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "script", "flush")
_ = c.withProcessHook(ctx, cmd, func(ctx context.Context, _ Cmder) error {
err := c.ForEachShard(ctx, func(ctx context.Context, shard *Client) error {
return shard.ScriptFlush(ctx).Err()
})
if err != nil {
cmd.SetErr(err)
}
return nil
})
return cmd
}
func (c *ClusterClient) ScriptExists(ctx context.Context, hashes ...string) *BoolSliceCmd {
args := make([]interface{}, 2+len(hashes))
args[0] = "script"
args[1] = "exists"
for i, hash := range hashes {
args[2+i] = hash
}
cmd := NewBoolSliceCmd(ctx, args...)
result := make([]bool, len(hashes))
for i := range result {
result[i] = true
}
_ = c.withProcessHook(ctx, cmd, func(ctx context.Context, _ Cmder) error {
var mu sync.Mutex
err := c.ForEachShard(ctx, func(ctx context.Context, shard *Client) error {
val, err := shard.ScriptExists(ctx, hashes...).Result()
if err != nil {
return err
}
mu.Lock()
for i, v := range val {
result[i] = result[i] && v
}
mu.Unlock()
return nil
})
if err != nil {
cmd.SetErr(err)
} else {
cmd.val = result
}
return nil
})
return cmd
}
package redis
import (
"context"
"errors"
"fmt"
"reflect"
"sync"
"time"
"github.com/redis/go-redis/v9/internal/hashtag"
"github.com/redis/go-redis/v9/internal/routing"
)
var (
errInvalidCmdPointer = errors.New("redis: invalid command pointer")
errNoCmdsToAggregate = errors.New("redis: no commands to aggregate")
errNoResToAggregate = errors.New("redis: no results to aggregate")
errInvalidCursorCmdArgsCount = errors.New("redis: FT.CURSOR command requires at least 3 arguments")
errInvalidCursorIdType = errors.New("redis: invalid cursor ID type")
)
// slotResult represents the result of executing a command on a specific slot
type slotResult struct {
cmd Cmder
keys []string
err error
}
// routeAndRun routes a command to the appropriate cluster nodes and executes it
func (c *ClusterClient) routeAndRun(ctx context.Context, cmd Cmder, node *clusterNode) error {
var policy *routing.CommandPolicy
if c.cmdInfoResolver != nil {
policy = c.cmdInfoResolver.GetCommandPolicy(ctx, cmd)
}
// Set stepCount from cmdInfo if not already set
if cmd.stepCount() == 0 {
if cmdInfo := c.cmdInfo(ctx, cmd.Name()); cmdInfo != nil && cmdInfo.StepCount > 0 {
cmd.SetStepCount(cmdInfo.StepCount)
}
}
if policy == nil {
return c.executeDefault(ctx, cmd, policy, node)
}
switch policy.Request {
case routing.ReqAllNodes:
return c.executeOnAllNodes(ctx, cmd, policy)
case routing.ReqAllShards:
return c.executeOnAllShards(ctx, cmd, policy)
case routing.ReqMultiShard:
return c.executeMultiShard(ctx, cmd, policy)
case routing.ReqSpecial:
return c.executeSpecialCommand(ctx, cmd, policy, node)
default:
return c.executeDefault(ctx, cmd, policy, node)
}
}
// executeDefault handles standard command routing based on keys
func (c *ClusterClient) executeDefault(ctx context.Context, cmd Cmder, policy *routing.CommandPolicy, node *clusterNode) error {
if policy != nil && !c.hasKeys(cmd) {
if c.readOnlyEnabled() && policy.IsReadOnly() {
return c.executeOnArbitraryNode(ctx, cmd)
}
}
return node.Client.Process(ctx, cmd)
}
// executeOnArbitraryNode routes command to an arbitrary node
func (c *ClusterClient) executeOnArbitraryNode(ctx context.Context, cmd Cmder) error {
node := c.pickArbitraryNode(ctx)
if node == nil {
return errClusterNoNodes
}
return node.Client.Process(ctx, cmd)
}
// executeOnAllNodes executes command on all nodes (masters and replicas)
func (c *ClusterClient) executeOnAllNodes(ctx context.Context, cmd Cmder, policy *routing.CommandPolicy) error {
state, err := c.state.Get(ctx)
if err != nil {
return err
}
nodes := append(state.Masters, state.Slaves...)
if len(nodes) == 0 {
return errClusterNoNodes
}
return c.executeParallel(ctx, cmd, nodes, policy)
}
// executeOnAllShards executes command on all master shards
func (c *ClusterClient) executeOnAllShards(ctx context.Context, cmd Cmder, policy *routing.CommandPolicy) error {
state, err := c.state.Get(ctx)
if err != nil {
return err
}
if len(state.Masters) == 0 {
return errClusterNoNodes
}
return c.executeParallel(ctx, cmd, state.Masters, policy)
}
// executeMultiShard handles commands that operate on multiple keys across shards
func (c *ClusterClient) executeMultiShard(ctx context.Context, cmd Cmder, policy *routing.CommandPolicy) error {
args := cmd.Args()
firstKeyPos := int(cmdFirstKeyPos(cmd))
stepCount := int(cmd.stepCount())
if stepCount == 0 {
stepCount = 1 // Default to 1 if not set
}
if firstKeyPos == 0 || firstKeyPos >= len(args) {
return fmt.Errorf("redis: multi-shard command %s has no key arguments", cmd.Name())
}
// Group keys by slot
slotMap := make(map[int][]string)
keyOrder := make([]string, 0)
for i := firstKeyPos; i < len(args); i += stepCount {
key, ok := args[i].(string)
if !ok {
return fmt.Errorf("redis: non-string key at position %d: %v", i, args[i])
}
slot := hashtag.Slot(key)
slotMap[slot] = append(slotMap[slot], key)
for j := 1; j < stepCount; j++ {
if i+j >= len(args) {
break
}
slotMap[slot] = append(slotMap[slot], args[i+j].(string))
}
keyOrder = append(keyOrder, key)
}
return c.executeMultiSlot(ctx, cmd, slotMap, keyOrder, policy)
}
// executeMultiSlot executes commands across multiple slots concurrently
func (c *ClusterClient) executeMultiSlot(ctx context.Context, cmd Cmder, slotMap map[int][]string, keyOrder []string, policy *routing.CommandPolicy) error {
results := make(chan slotResult, len(slotMap))
var wg sync.WaitGroup
// Execute on each slot concurrently
for slot, keys := range slotMap {
wg.Add(1)
go func(slot int, keys []string) {
defer wg.Done()
node, err := c.cmdNodeWithShardPicker(ctx, cmd.Name(), slot, c.opt.ShardPicker)
if err != nil {
results <- slotResult{nil, keys, err}
return
}
// Create a command for this specific slot's keys
subCmd := c.createSlotSpecificCommand(ctx, cmd, keys)
err = node.Client.Process(ctx, subCmd)
results <- slotResult{subCmd, keys, err}
}(slot, keys)
}
go func() {
wg.Wait()
close(results)
}()
return c.aggregateMultiSlotResults(ctx, cmd, results, keyOrder, policy)
}
// createSlotSpecificCommand creates a new command for a specific slot's keys
func (c *ClusterClient) createSlotSpecificCommand(ctx context.Context, originalCmd Cmder, keys []string) Cmder {
originalArgs := originalCmd.Args()
firstKeyPos := int(cmdFirstKeyPos(originalCmd))
// Build new args with only the specified keys
newArgs := make([]interface{}, 0, firstKeyPos+len(keys))
// Copy command name and arguments before the keys
newArgs = append(newArgs, originalArgs[:firstKeyPos]...)
// Add the slot-specific keys
for _, key := range keys {
newArgs = append(newArgs, key)
}
// Create a new command of the same type using the helper function
return createCommandByType(ctx, originalCmd.GetCmdType(), newArgs...)
}
// createCommandByType creates a new command of the specified type with the given arguments
func createCommandByType(ctx context.Context, cmdType CmdType, args ...interface{}) Cmder {
switch cmdType {
case CmdTypeString:
return NewStringCmd(ctx, args...)
case CmdTypeInt:
return NewIntCmd(ctx, args...)
case CmdTypeBool:
return NewBoolCmd(ctx, args...)
case CmdTypeFloat:
return NewFloatCmd(ctx, args...)
case CmdTypeStringSlice:
return NewStringSliceCmd(ctx, args...)
case CmdTypeIntSlice:
return NewIntSliceCmd(ctx, args...)
case CmdTypeFloatSlice:
return NewFloatSliceCmd(ctx, args...)
case CmdTypeBoolSlice:
return NewBoolSliceCmd(ctx, args...)
case CmdTypeStatus:
return NewStatusCmd(ctx, args...)
case CmdTypeTime:
return NewTimeCmd(ctx, args...)
case CmdTypeMapStringString:
return NewMapStringStringCmd(ctx, args...)
case CmdTypeMapStringInt:
return NewMapStringIntCmd(ctx, args...)
case CmdTypeMapStringInterface:
return NewMapStringInterfaceCmd(ctx, args...)
case CmdTypeMapStringInterfaceSlice:
return NewMapStringInterfaceSliceCmd(ctx, args...)
case CmdTypeSlice:
return NewSliceCmd(ctx, args...)
case CmdTypeStringStructMap:
return NewStringStructMapCmd(ctx, args...)
case CmdTypeXMessageSlice:
return NewXMessageSliceCmd(ctx, args...)
case CmdTypeXStreamSlice:
return NewXStreamSliceCmd(ctx, args...)
case CmdTypeXPending:
return NewXPendingCmd(ctx, args...)
case CmdTypeXPendingExt:
return NewXPendingExtCmd(ctx, args...)
case CmdTypeXAutoClaim:
return NewXAutoClaimCmd(ctx, args...)
case CmdTypeXAutoClaimJustID:
return NewXAutoClaimJustIDCmd(ctx, args...)
case CmdTypeXInfoStreamFull:
return NewXInfoStreamFullCmd(ctx, args...)
case CmdTypeZSlice:
return NewZSliceCmd(ctx, args...)
case CmdTypeZWithKey:
return NewZWithKeyCmd(ctx, args...)
case CmdTypeClusterSlots:
return NewClusterSlotsCmd(ctx, args...)
case CmdTypeGeoPos:
return NewGeoPosCmd(ctx, args...)
case CmdTypeCommandsInfo:
return NewCommandsInfoCmd(ctx, args...)
case CmdTypeSlowLog:
return NewSlowLogCmd(ctx, args...)
case CmdTypeKeyValues:
return NewKeyValuesCmd(ctx, args...)
case CmdTypeZSliceWithKey:
return NewZSliceWithKeyCmd(ctx, args...)
case CmdTypeFunctionList:
return NewFunctionListCmd(ctx, args...)
case CmdTypeFunctionStats:
return NewFunctionStatsCmd(ctx, args...)
case CmdTypeKeyFlags:
return NewKeyFlagsCmd(ctx, args...)
case CmdTypeDuration:
return NewDurationCmd(ctx, time.Millisecond, args...)
}
return NewCmd(ctx, args...)
}
// executeSpecialCommand handles commands with special routing requirements
func (c *ClusterClient) executeSpecialCommand(ctx context.Context, cmd Cmder, policy *routing.CommandPolicy, node *clusterNode) error {
switch cmd.Name() {
case "ft.cursor":
return c.executeCursorCommand(ctx, cmd)
default:
return c.executeDefault(ctx, cmd, policy, node)
}
}
// executeCursorCommand handles FT.CURSOR commands with sticky routing
func (c *ClusterClient) executeCursorCommand(ctx context.Context, cmd Cmder) error {
args := cmd.Args()
if len(args) < 4 {
return errInvalidCursorCmdArgsCount
}
cursorID, ok := args[3].(string)
if !ok {
return errInvalidCursorIdType
}
// Route based on cursor ID to maintain stickiness
slot := hashtag.Slot(cursorID)
node, err := c.cmdNodeWithShardPicker(ctx, cmd.Name(), slot, c.opt.ShardPicker)
if err != nil {
return err
}
return node.Client.Process(ctx, cmd)
}
// executeParallel executes a command on multiple nodes concurrently
func (c *ClusterClient) executeParallel(ctx context.Context, cmd Cmder, nodes []*clusterNode, policy *routing.CommandPolicy) error {
if len(nodes) == 0 {
return errClusterNoNodes
}
if len(nodes) == 1 {
return nodes[0].Client.Process(ctx, cmd)
}
type nodeResult struct {
cmd Cmder
err error
}
results := make(chan nodeResult, len(nodes))
var wg sync.WaitGroup
for _, node := range nodes {
wg.Add(1)
go func(n *clusterNode) {
defer wg.Done()
cmdCopy := cmd.Clone()
err := n.Client.Process(ctx, cmdCopy)
results <- nodeResult{cmdCopy, err}
}(node)
}
go func() {
wg.Wait()
close(results)
}()
// Collect results and check for errors
cmds := make([]Cmder, 0, len(nodes))
var firstErr error
for result := range results {
if result.err != nil && firstErr == nil {
firstErr = result.err
}
cmds = append(cmds, result.cmd)
}
// If there was an error and no policy specified, fail fast
if firstErr != nil && (policy == nil || policy.Response == routing.RespDefaultKeyless) {
cmd.SetErr(firstErr)
return firstErr
}
return c.aggregateResponses(cmd, cmds, policy)
}
// aggregateMultiSlotResults aggregates results from multi-slot execution
func (c *ClusterClient) aggregateMultiSlotResults(ctx context.Context, cmd Cmder, results <-chan slotResult, keyOrder []string, policy *routing.CommandPolicy) error {
keyedResults := make(map[string]routing.AggregatorResErr)
var firstErr error
for result := range results {
if result.err != nil && firstErr == nil {
firstErr = result.err
}
if result.cmd != nil && result.err == nil {
value, err := ExtractCommandValue(result.cmd)
// Check if the result is a slice (e.g., from MGET)
if sliceValue, ok := value.([]interface{}); ok {
// Map each element to its corresponding key
for i, key := range result.keys {
if i < len(sliceValue) {
keyedResults[key] = routing.AggregatorResErr{Result: sliceValue[i], Err: err}
} else {
keyedResults[key] = routing.AggregatorResErr{Result: nil, Err: err}
}
}
} else {
// For non-slice results, map the entire result to each key
for _, key := range result.keys {
keyedResults[key] = routing.AggregatorResErr{Result: value, Err: err}
}
}
}
// TODO: return multiple errors by order when we will implement multiple errors returning
if result.err != nil {
firstErr = result.err
}
}
return c.aggregateKeyedValues(cmd, keyedResults, keyOrder, policy)
}
// aggregateKeyedValues aggregates individual key-value pairs while preserving key order
func (c *ClusterClient) aggregateKeyedValues(cmd Cmder, keyedResults map[string]routing.AggregatorResErr, keyOrder []string, policy *routing.CommandPolicy) error {
if len(keyedResults) == 0 {
return errNoResToAggregate
}
aggregator := c.createAggregator(policy, cmd, true)
// Set key order for keyed aggregators
var keyedAgg *routing.DefaultKeyedAggregator
var isKeyedAgg bool
var err error
if keyedAgg, isKeyedAgg = aggregator.(*routing.DefaultKeyedAggregator); isKeyedAgg {
err = keyedAgg.BatchAddWithKeyOrder(keyedResults, keyOrder)
} else {
err = aggregator.BatchAdd(keyedResults)
}
if err != nil {
return err
}
return c.finishAggregation(cmd, aggregator)
}
// aggregateResponses aggregates multiple shard responses
func (c *ClusterClient) aggregateResponses(cmd Cmder, cmds []Cmder, policy *routing.CommandPolicy) error {
if len(cmds) == 0 {
return errNoCmdsToAggregate
}
if len(cmds) == 1 {
shardCmd := cmds[0]
if err := shardCmd.Err(); err != nil {
cmd.SetErr(err)
return err
}
value, _ := ExtractCommandValue(shardCmd)
return c.setCommandValue(cmd, value)
}
aggregator := c.createAggregator(policy, cmd, false)
batchWithErrs := []routing.AggregatorResErr{}
// Add all results to aggregator
for _, shardCmd := range cmds {
value, err := ExtractCommandValue(shardCmd)
batchWithErrs = append(batchWithErrs, routing.AggregatorResErr{
Result: value,
Err: err,
})
}
err := aggregator.BatchSlice(batchWithErrs)
if err != nil {
return err
}
return c.finishAggregation(cmd, aggregator)
}
// createAggregator creates the appropriate response aggregator
func (c *ClusterClient) createAggregator(policy *routing.CommandPolicy, cmd Cmder, isKeyed bool) routing.ResponseAggregator {
if policy != nil {
return routing.NewResponseAggregator(policy.Response, cmd.Name())
}
if !isKeyed {
firstKeyPos := cmdFirstKeyPos(cmd)
isKeyed = firstKeyPos > 0
}
return routing.NewDefaultAggregator(isKeyed)
}
// finishAggregation completes the aggregation process and sets the result
func (c *ClusterClient) finishAggregation(cmd Cmder, aggregator routing.ResponseAggregator) error {
finalValue, finalErr := aggregator.Result()
if finalErr != nil {
cmd.SetErr(finalErr)
return finalErr
}
return c.setCommandValue(cmd, finalValue)
}
// pickArbitraryNode selects a master or slave shard using the configured ShardPicker
func (c *ClusterClient) pickArbitraryNode(ctx context.Context) *clusterNode {
state, err := c.state.Get(ctx)
if err != nil || len(state.Masters) == 0 {
return nil
}
allNodes := append(state.Masters, state.Slaves...)
idx := c.opt.ShardPicker.Next(len(allNodes))
return allNodes[idx]
}
// hasKeys checks if a command operates on keys
func (c *ClusterClient) hasKeys(cmd Cmder) bool {
firstKeyPos := cmdFirstKeyPos(cmd)
return firstKeyPos > 0
}
func (c *ClusterClient) readOnlyEnabled() bool {
return c.opt.ReadOnly
}
// setCommandValue sets the aggregated value on a command using the enum-based approach
func (c *ClusterClient) setCommandValue(cmd Cmder, value interface{}) error {
// If value is nil, it might mean ExtractCommandValue couldn't extract the value
// but the command might have executed successfully. In this case, don't set an error.
if value == nil {
// ExtractCommandValue returned nil - this means the command type is not supported
// in the aggregation flow. This is a programming error, not a runtime error.
if cmd.Err() != nil {
// Command already has an error, preserve it
return cmd.Err()
}
// Command executed successfully but we can't extract/set the aggregated value
// This indicates the command type needs to be added to ExtractCommandValue
return fmt.Errorf("redis: cannot aggregate command %s: unsupported command type %d",
cmd.Name(), cmd.GetCmdType())
}
switch cmd.GetCmdType() {
case CmdTypeGeneric:
if c, ok := cmd.(*Cmd); ok {
c.SetVal(value)
}
case CmdTypeString:
if c, ok := cmd.(*StringCmd); ok {
if v, ok := value.(string); ok {
c.SetVal(v)
}
}
case CmdTypeInt:
if c, ok := cmd.(*IntCmd); ok {
if v, ok := value.(int64); ok {
c.SetVal(v)
} else if v, ok := value.(float64); ok {
c.SetVal(int64(v))
}
}
case CmdTypeBool:
if c, ok := cmd.(*BoolCmd); ok {
if v, ok := value.(bool); ok {
c.SetVal(v)
}
}
case CmdTypeFloat:
if c, ok := cmd.(*FloatCmd); ok {
if v, ok := value.(float64); ok {
c.SetVal(v)
}
}
case CmdTypeStringSlice:
if c, ok := cmd.(*StringSliceCmd); ok {
if v, ok := value.([]string); ok {
c.SetVal(v)
}
}
case CmdTypeIntSlice:
if c, ok := cmd.(*IntSliceCmd); ok {
if v, ok := value.([]int64); ok {
c.SetVal(v)
} else if v, ok := value.([]float64); ok {
els := len(v)
intSlc := make([]int, els)
for i := range v {
intSlc[i] = int(v[i])
}
}
}
case CmdTypeFloatSlice:
if c, ok := cmd.(*FloatSliceCmd); ok {
if v, ok := value.([]float64); ok {
c.SetVal(v)
}
}
case CmdTypeBoolSlice:
if c, ok := cmd.(*BoolSliceCmd); ok {
if v, ok := value.([]bool); ok {
c.SetVal(v)
}
}
case CmdTypeMapStringString:
if c, ok := cmd.(*MapStringStringCmd); ok {
if v, ok := value.(map[string]string); ok {
c.SetVal(v)
}
}
case CmdTypeMapStringInt:
if c, ok := cmd.(*MapStringIntCmd); ok {
if v, ok := value.(map[string]int64); ok {
c.SetVal(v)
}
}
case CmdTypeMapStringInterface:
if c, ok := cmd.(*MapStringInterfaceCmd); ok {
if v, ok := value.(map[string]interface{}); ok {
c.SetVal(v)
}
}
case CmdTypeSlice:
if c, ok := cmd.(*SliceCmd); ok {
if v, ok := value.([]interface{}); ok {
c.SetVal(v)
}
}
case CmdTypeStatus:
if c, ok := cmd.(*StatusCmd); ok {
if v, ok := value.(string); ok {
c.SetVal(v)
}
}
case CmdTypeDuration:
if c, ok := cmd.(*DurationCmd); ok {
if v, ok := value.(time.Duration); ok {
c.SetVal(v)
}
}
case CmdTypeTime:
if c, ok := cmd.(*TimeCmd); ok {
if v, ok := value.(time.Time); ok {
c.SetVal(v)
}
}
case CmdTypeKeyValueSlice:
if c, ok := cmd.(*KeyValueSliceCmd); ok {
if v, ok := value.([]KeyValue); ok {
c.SetVal(v)
}
}
case CmdTypeStringStructMap:
if c, ok := cmd.(*StringStructMapCmd); ok {
if v, ok := value.(map[string]struct{}); ok {
c.SetVal(v)
}
}
case CmdTypeXMessageSlice:
if c, ok := cmd.(*XMessageSliceCmd); ok {
if v, ok := value.([]XMessage); ok {
c.SetVal(v)
}
}
case CmdTypeXStreamSlice:
if c, ok := cmd.(*XStreamSliceCmd); ok {
if v, ok := value.([]XStream); ok {
c.SetVal(v)
}
}
case CmdTypeXPending:
if c, ok := cmd.(*XPendingCmd); ok {
if v, ok := value.(*XPending); ok {
c.SetVal(v)
}
}
case CmdTypeXPendingExt:
if c, ok := cmd.(*XPendingExtCmd); ok {
if v, ok := value.([]XPendingExt); ok {
c.SetVal(v)
}
}
case CmdTypeXAutoClaim:
if c, ok := cmd.(*XAutoClaimCmd); ok {
if v, ok := value.(CmdTypeXAutoClaimValue); ok {
c.SetVal(v.messages, v.start)
}
}
case CmdTypeXAutoClaimJustID:
if c, ok := cmd.(*XAutoClaimJustIDCmd); ok {
if v, ok := value.(CmdTypeXAutoClaimJustIDValue); ok {
c.SetVal(v.ids, v.start)
}
}
case CmdTypeXInfoConsumers:
if c, ok := cmd.(*XInfoConsumersCmd); ok {
if v, ok := value.([]XInfoConsumer); ok {
c.SetVal(v)
}
}
case CmdTypeXInfoGroups:
if c, ok := cmd.(*XInfoGroupsCmd); ok {
if v, ok := value.([]XInfoGroup); ok {
c.SetVal(v)
}
}
case CmdTypeXInfoStream:
if c, ok := cmd.(*XInfoStreamCmd); ok {
if v, ok := value.(*XInfoStream); ok {
c.SetVal(v)
}
}
case CmdTypeXInfoStreamFull:
if c, ok := cmd.(*XInfoStreamFullCmd); ok {
if v, ok := value.(*XInfoStreamFull); ok {
c.SetVal(v)
}
}
case CmdTypeZSlice:
if c, ok := cmd.(*ZSliceCmd); ok {
if v, ok := value.([]Z); ok {
c.SetVal(v)
}
}
case CmdTypeZWithKey:
if c, ok := cmd.(*ZWithKeyCmd); ok {
if v, ok := value.(*ZWithKey); ok {
c.SetVal(v)
}
}
case CmdTypeScan:
if c, ok := cmd.(*ScanCmd); ok {
if v, ok := value.(CmdTypeScanValue); ok {
c.SetVal(v.keys, v.cursor)
}
}
case CmdTypeClusterSlots:
if c, ok := cmd.(*ClusterSlotsCmd); ok {
if v, ok := value.([]ClusterSlot); ok {
c.SetVal(v)
}
}
case CmdTypeGeoLocation:
if c, ok := cmd.(*GeoLocationCmd); ok {
if v, ok := value.([]GeoLocation); ok {
c.SetVal(v)
}
}
case CmdTypeGeoSearchLocation:
if c, ok := cmd.(*GeoSearchLocationCmd); ok {
if v, ok := value.([]GeoLocation); ok {
c.SetVal(v)
}
}
case CmdTypeGeoPos:
if c, ok := cmd.(*GeoPosCmd); ok {
if v, ok := value.([]*GeoPos); ok {
c.SetVal(v)
}
}
case CmdTypeCommandsInfo:
if c, ok := cmd.(*CommandsInfoCmd); ok {
if v, ok := value.(map[string]*CommandInfo); ok {
c.SetVal(v)
}
}
case CmdTypeSlowLog:
if c, ok := cmd.(*SlowLogCmd); ok {
if v, ok := value.([]SlowLog); ok {
c.SetVal(v)
}
}
case CmdTypeMapStringStringSlice:
if c, ok := cmd.(*MapStringStringSliceCmd); ok {
if v, ok := value.([]map[string]string); ok {
c.SetVal(v)
}
}
case CmdTypeMapMapStringInterface:
if c, ok := cmd.(*MapMapStringInterfaceCmd); ok {
if v, ok := value.(map[string]interface{}); ok {
c.SetVal(v)
}
}
case CmdTypeMapStringInterfaceSlice:
if c, ok := cmd.(*MapStringInterfaceSliceCmd); ok {
if v, ok := value.([]map[string]interface{}); ok {
c.SetVal(v)
}
}
case CmdTypeKeyValues:
if c, ok := cmd.(*KeyValuesCmd); ok {
// KeyValuesCmd needs a key string and values slice
if v, ok := value.(CmdTypeKeyValuesValue); ok {
c.SetVal(v.key, v.values)
}
}
case CmdTypeZSliceWithKey:
if c, ok := cmd.(*ZSliceWithKeyCmd); ok {
// ZSliceWithKeyCmd needs a key string and Z slice
if v, ok := value.(CmdTypeZSliceWithKeyValue); ok {
c.SetVal(v.key, v.zSlice)
}
}
case CmdTypeFunctionList:
if c, ok := cmd.(*FunctionListCmd); ok {
if v, ok := value.([]Library); ok {
c.SetVal(v)
}
}
case CmdTypeFunctionStats:
if c, ok := cmd.(*FunctionStatsCmd); ok {
if v, ok := value.(FunctionStats); ok {
c.SetVal(v)
}
}
case CmdTypeLCS:
if c, ok := cmd.(*LCSCmd); ok {
if v, ok := value.(*LCSMatch); ok {
c.SetVal(v)
}
}
case CmdTypeKeyFlags:
if c, ok := cmd.(*KeyFlagsCmd); ok {
if v, ok := value.([]KeyFlags); ok {
c.SetVal(v)
}
}
case CmdTypeClusterLinks:
if c, ok := cmd.(*ClusterLinksCmd); ok {
if v, ok := value.([]ClusterLink); ok {
c.SetVal(v)
}
}
case CmdTypeClusterShards:
if c, ok := cmd.(*ClusterShardsCmd); ok {
if v, ok := value.([]ClusterShard); ok {
c.SetVal(v)
}
}
case CmdTypeRankWithScore:
if c, ok := cmd.(*RankWithScoreCmd); ok {
if v, ok := value.(RankScore); ok {
c.SetVal(v)
}
}
case CmdTypeClientInfo:
if c, ok := cmd.(*ClientInfoCmd); ok {
if v, ok := value.(*ClientInfo); ok {
c.SetVal(v)
}
}
case CmdTypeACLLog:
if c, ok := cmd.(*ACLLogCmd); ok {
if v, ok := value.([]*ACLLogEntry); ok {
c.SetVal(v)
}
}
case CmdTypeInfo:
if c, ok := cmd.(*InfoCmd); ok {
if v, ok := value.(map[string]map[string]string); ok {
c.SetVal(v)
}
}
case CmdTypeMonitor:
// MonitorCmd doesn't have SetVal method
// Skip setting value for MonitorCmd
case CmdTypeJSON:
if c, ok := cmd.(*JSONCmd); ok {
if v, ok := value.(string); ok {
c.SetVal(v)
}
}
case CmdTypeJSONSlice:
if c, ok := cmd.(*JSONSliceCmd); ok {
if v, ok := value.([]interface{}); ok {
c.SetVal(v)
}
}
case CmdTypeIntPointerSlice:
if c, ok := cmd.(*IntPointerSliceCmd); ok {
if v, ok := value.([]*int64); ok {
c.SetVal(v)
}
}
case CmdTypeScanDump:
if c, ok := cmd.(*ScanDumpCmd); ok {
if v, ok := value.(ScanDump); ok {
c.SetVal(v)
}
}
case CmdTypeBFInfo:
if c, ok := cmd.(*BFInfoCmd); ok {
if v, ok := value.(BFInfo); ok {
c.SetVal(v)
}
}
case CmdTypeCFInfo:
if c, ok := cmd.(*CFInfoCmd); ok {
if v, ok := value.(CFInfo); ok {
c.SetVal(v)
}
}
case CmdTypeCMSInfo:
if c, ok := cmd.(*CMSInfoCmd); ok {
if v, ok := value.(CMSInfo); ok {
c.SetVal(v)
}
}
case CmdTypeTopKInfo:
if c, ok := cmd.(*TopKInfoCmd); ok {
if v, ok := value.(TopKInfo); ok {
c.SetVal(v)
}
}
case CmdTypeTDigestInfo:
if c, ok := cmd.(*TDigestInfoCmd); ok {
if v, ok := value.(TDigestInfo); ok {
c.SetVal(v)
}
}
case CmdTypeFTSynDump:
if c, ok := cmd.(*FTSynDumpCmd); ok {
if v, ok := value.([]FTSynDumpResult); ok {
c.SetVal(v)
}
}
case CmdTypeAggregate:
if c, ok := cmd.(*AggregateCmd); ok {
if v, ok := value.(*FTAggregateResult); ok {
c.SetVal(v)
}
}
case CmdTypeFTInfo:
if c, ok := cmd.(*FTInfoCmd); ok {
if v, ok := value.(FTInfoResult); ok {
c.SetVal(v)
}
}
case CmdTypeFTSpellCheck:
if c, ok := cmd.(*FTSpellCheckCmd); ok {
if v, ok := value.([]SpellCheckResult); ok {
c.SetVal(v)
}
}
case CmdTypeFTSearch:
if c, ok := cmd.(*FTSearchCmd); ok {
if v, ok := value.(FTSearchResult); ok {
c.SetVal(v)
}
}
case CmdTypeTSTimestampValue:
if c, ok := cmd.(*TSTimestampValueCmd); ok {
if v, ok := value.(TSTimestampValue); ok {
c.SetVal(v)
}
}
case CmdTypeTSTimestampValueSlice:
if c, ok := cmd.(*TSTimestampValueSliceCmd); ok {
if v, ok := value.([]TSTimestampValue); ok {
c.SetVal(v)
}
}
default:
// Fallback to reflection for unknown types
return c.setCommandValueReflection(cmd, value)
}
return nil
}
// setCommandValueReflection is a fallback function that uses reflection
func (c *ClusterClient) setCommandValueReflection(cmd Cmder, value interface{}) error {
cmdValue := reflect.ValueOf(cmd)
if cmdValue.Kind() != reflect.Ptr || cmdValue.IsNil() {
return errInvalidCmdPointer
}
setValMethod := cmdValue.MethodByName("SetVal")
if !setValMethod.IsValid() {
return fmt.Errorf("redis: command %T does not have SetVal method", cmd)
}
args := []reflect.Value{reflect.ValueOf(value)}
switch cmd.(type) {
case *XAutoClaimCmd, *XAutoClaimJustIDCmd:
args = append(args, reflect.ValueOf(""))
case *ScanCmd:
args = append(args, reflect.ValueOf(uint64(0)))
case *KeyValuesCmd, *ZSliceWithKeyCmd:
if key, ok := value.(string); ok {
args = []reflect.Value{reflect.ValueOf(key)}
if _, ok := cmd.(*ZSliceWithKeyCmd); ok {
args = append(args, reflect.ValueOf([]Z{}))
} else {
args = append(args, reflect.ValueOf([]string{}))
}
}
}
defer func() {
if r := recover(); r != nil {
cmd.SetErr(fmt.Errorf("redis: failed to set command value: %v", r))
}
}()
setValMethod.Call(args)
return nil
}
package redis
import (
"context"
"net"
"time"
"github.com/redis/go-redis/v9/internal/otel"
"github.com/redis/go-redis/v9/internal/pool"
)
// ConnInfo provides information about a Redis connection for metrics.
type ConnInfo interface {
RemoteAddr() net.Addr
PoolName() string
}
type Pooler interface {
PoolStats() *pool.Stats
}
type PubSubPooler interface {
Stats() *pool.PubSubStats
}
// OTelRecorder is the interface for recording OpenTelemetry metrics.
type OTelRecorder interface {
// RecordOperationDuration records the total operation duration (including all retries)
RecordOperationDuration(ctx context.Context, duration time.Duration, cmd Cmder, attempts int, err error, cn ConnInfo, dbIndex int)
// RecordPipelineOperationDuration records the total pipeline/transaction duration.
// operationName should be "PIPELINE" for regular pipelines or "MULTI" for transactions.
RecordPipelineOperationDuration(ctx context.Context, duration time.Duration, operationName string, cmdCount int, attempts int, err error, cn ConnInfo, dbIndex int)
// RecordConnectionCreateTime records the time it took to create a new connection
RecordConnectionCreateTime(ctx context.Context, duration time.Duration, cn ConnInfo)
// RecordConnectionRelaxedTimeout records when connection timeout is relaxed/unrelaxed
// delta: +1 for relaxed, -1 for unrelaxed
// poolName: name of the connection pool (e.g., "main", "pubsub")
// notificationType: the notification type that triggered the timeout relaxation (e.g., "MOVING", "HANDOFF")
RecordConnectionRelaxedTimeout(ctx context.Context, delta int, cn ConnInfo, poolName, notificationType string)
// RecordConnectionHandoff records when a connection is handed off to another node
// poolName: name of the connection pool (e.g., "main", "pubsub")
RecordConnectionHandoff(ctx context.Context, cn ConnInfo, poolName string)
// RecordError records client errors (ASK, MOVED, handshake failures, etc.)
// errorType: type of error (e.g., "ASK", "MOVED", "HANDSHAKE_FAILED")
// statusCode: Redis response status code if available (e.g., "MOVED", "ASK")
// isInternal: whether this is an internal error
// retryAttempts: number of retry attempts made
RecordError(ctx context.Context, errorType string, cn ConnInfo, statusCode string, isInternal bool, retryAttempts int)
// RecordMaintenanceNotification records when a maintenance notification is received
// notificationType: the type of notification (e.g., "MOVING", "MIGRATING", etc.)
RecordMaintenanceNotification(ctx context.Context, cn ConnInfo, notificationType string)
// RecordConnectionWaitTime records the time spent waiting for a connection from the pool
RecordConnectionWaitTime(ctx context.Context, duration time.Duration, cn ConnInfo)
// RecordConnectionClosed records when a connection is closed
// reason: reason for closing (e.g., "idle", "max_lifetime", "error", "pool_closed")
// err: the error that caused the close (nil for non-error closures)
RecordConnectionClosed(ctx context.Context, cn ConnInfo, reason string, err error)
// RecordPubSubMessage records a Pub/Sub message
// direction: "sent" or "received"
// channel: channel name (may be hidden for cardinality reduction)
// sharded: true for sharded pub/sub (SPUBLISH/SSUBSCRIBE)
RecordPubSubMessage(ctx context.Context, cn ConnInfo, direction, channel string, sharded bool)
// RecordStreamLag records the lag for stream consumer group processing
// lag: time difference between message creation and consumption
// streamName: name of the stream (may be hidden for cardinality reduction)
// consumerGroup: name of the consumer group
// consumerName: name of the consumer
RecordStreamLag(ctx context.Context, lag time.Duration, cn ConnInfo, streamName, consumerGroup, consumerName string)
}
// This is used for async gauge metrics that need to pull stats from pools periodically.
type OTelPoolRegistrar interface {
// RegisterPool is called when a new client is created with its main connection pool.
// poolName: unique identifier for the pool (e.g., "main_abc123")
RegisterPool(poolName string, pool Pooler)
// UnregisterPool is called when a client is closed to remove its pool from the registry.
UnregisterPool(pool Pooler)
// RegisterPubSubPool is called when a new client is created with a PubSub pool.
// poolName: unique identifier for the pool (e.g., "main_abc123_pubsub")
RegisterPubSubPool(poolName string, pool PubSubPooler)
// UnregisterPubSubPool is called when a PubSub client is closed to remove its pool.
UnregisterPubSubPool(pool PubSubPooler)
}
// SetOTelRecorder sets the global OpenTelemetry recorder.
func SetOTelRecorder(r OTelRecorder) {
if r == nil {
otel.SetGlobalRecorder(nil)
return
}
otel.SetGlobalRecorder(&otelRecorderAdapter{r})
}
type otelRecorderAdapter struct {
recorder OTelRecorder
}
// toConnInfo converts *pool.Conn to ConnInfo interface properly.
// This ensures that a nil *pool.Conn becomes a true nil interface,
// not a non-nil interface containing a nil pointer.
func toConnInfo(cn *pool.Conn) ConnInfo {
if cn == nil {
return nil
}
return cn
}
func (a *otelRecorderAdapter) RecordOperationDuration(ctx context.Context, duration time.Duration, cmd otel.Cmder, attempts int, err error, cn *pool.Conn, dbIndex int) {
// Convert internal Cmder to public Cmder
if publicCmd, ok := cmd.(Cmder); ok {
a.recorder.RecordOperationDuration(ctx, duration, publicCmd, attempts, err, toConnInfo(cn), dbIndex)
}
}
func (a *otelRecorderAdapter) RecordPipelineOperationDuration(ctx context.Context, duration time.Duration, operationName string, cmdCount int, attempts int, err error, cn *pool.Conn, dbIndex int) {
a.recorder.RecordPipelineOperationDuration(ctx, duration, operationName, cmdCount, attempts, err, toConnInfo(cn), dbIndex)
}
func (a *otelRecorderAdapter) RecordConnectionCreateTime(ctx context.Context, duration time.Duration, cn *pool.Conn) {
a.recorder.RecordConnectionCreateTime(ctx, duration, toConnInfo(cn))
}
func (a *otelRecorderAdapter) RecordConnectionRelaxedTimeout(ctx context.Context, delta int, cn *pool.Conn, poolName, notificationType string) {
a.recorder.RecordConnectionRelaxedTimeout(ctx, delta, toConnInfo(cn), poolName, notificationType)
}
func (a *otelRecorderAdapter) RecordConnectionHandoff(ctx context.Context, cn *pool.Conn, poolName string) {
a.recorder.RecordConnectionHandoff(ctx, toConnInfo(cn), poolName)
}
func (a *otelRecorderAdapter) RecordError(ctx context.Context, errorType string, cn *pool.Conn, statusCode string, isInternal bool, retryAttempts int) {
a.recorder.RecordError(ctx, errorType, toConnInfo(cn), statusCode, isInternal, retryAttempts)
}
func (a *otelRecorderAdapter) RecordMaintenanceNotification(ctx context.Context, cn *pool.Conn, notificationType string) {
a.recorder.RecordMaintenanceNotification(ctx, toConnInfo(cn), notificationType)
}
func (a *otelRecorderAdapter) RecordConnectionWaitTime(ctx context.Context, duration time.Duration, cn *pool.Conn) {
a.recorder.RecordConnectionWaitTime(ctx, duration, toConnInfo(cn))
}
func (a *otelRecorderAdapter) RecordConnectionClosed(ctx context.Context, cn *pool.Conn, reason string, err error) {
a.recorder.RecordConnectionClosed(ctx, toConnInfo(cn), reason, err)
}
func (a *otelRecorderAdapter) RecordPubSubMessage(ctx context.Context, cn *pool.Conn, direction, channel string, sharded bool) {
a.recorder.RecordPubSubMessage(ctx, toConnInfo(cn), direction, channel, sharded)
}
func (a *otelRecorderAdapter) RecordStreamLag(ctx context.Context, lag time.Duration, cn *pool.Conn, streamName, consumerGroup, consumerName string) {
a.recorder.RecordStreamLag(ctx, lag, toConnInfo(cn), streamName, consumerGroup, consumerName)
}
func (a *otelRecorderAdapter) RegisterPool(poolName string, p pool.Pooler) {
if registrar, ok := a.recorder.(OTelPoolRegistrar); ok {
registrar.RegisterPool(poolName, &poolerAdapter{p})
}
}
func (a *otelRecorderAdapter) UnregisterPool(p pool.Pooler) {
if registrar, ok := a.recorder.(OTelPoolRegistrar); ok {
registrar.UnregisterPool(&poolerAdapter{p})
}
}
func (a *otelRecorderAdapter) RegisterPubSubPool(poolName string, p otel.PubSubPooler) {
if registrar, ok := a.recorder.(OTelPoolRegistrar); ok {
registrar.RegisterPubSubPool(poolName, &pubSubPoolerAdapter{p})
}
}
func (a *otelRecorderAdapter) UnregisterPubSubPool(p otel.PubSubPooler) {
if registrar, ok := a.recorder.(OTelPoolRegistrar); ok {
registrar.UnregisterPubSubPool(&pubSubPoolerAdapter{p})
}
}
type poolerAdapter struct {
p pool.Pooler
}
func (a *poolerAdapter) PoolStats() *pool.Stats {
return a.p.Stats()
}
type pubSubPoolerAdapter struct {
p otel.PubSubPooler
}
func (a *pubSubPoolerAdapter) Stats() *pool.PubSubStats {
return a.p.Stats()
}
package redis
import (
"context"
"errors"
)
type pipelineExecer func(context.Context, []Cmder) error
// Pipeliner is a mechanism to realise Redis Pipeline technique.
//
// Pipelining is a technique to extremely speed up processing by packing
// operations to batches, send them at once to Redis and read a replies in a
// single step.
// See https://redis.io/topics/pipelining
//
// Pay attention, that Pipeline is not a transaction, so you can get unexpected
// results in case of big pipelines and small read/write timeouts.
// Redis client has retransmission logic in case of timeouts, pipeline
// can be retransmitted and commands can be executed more then once.
// To avoid this: it is good idea to use reasonable bigger read/write timeouts
// depends of your batch size and/or use TxPipeline.
type Pipeliner interface {
StatefulCmdable
// Len obtains the number of commands in the pipeline that have not yet been executed.
Len() int
// Do is an API for executing any command.
// If a certain Redis command is not yet supported, you can use Do to execute it.
Do(ctx context.Context, args ...interface{}) *Cmd
// Process queues the cmd for later execution.
Process(ctx context.Context, cmd Cmder) error
// BatchProcess adds multiple commands to be executed into the pipeline buffer.
BatchProcess(ctx context.Context, cmd ...Cmder) error
// Discard discards all commands in the pipeline buffer that have not yet been executed.
Discard()
// Exec sends all the commands buffered in the pipeline to the redis server.
Exec(ctx context.Context) ([]Cmder, error)
// Cmds returns the list of queued commands.
Cmds() []Cmder
}
var _ Pipeliner = (*Pipeline)(nil)
// Pipeline implements pipelining as described in
// https://redis.io/docs/latest/develop/using-commands/pipelining.
// Please note: it is not safe for concurrent use by multiple goroutines.
type Pipeline struct {
cmdable
statefulCmdable
exec pipelineExecer
cmds []Cmder
}
func (c *Pipeline) init() {
c.cmdable = c.Process
c.statefulCmdable = c.Process
}
// Len returns the number of queued commands.
func (c *Pipeline) Len() int {
return len(c.cmds)
}
// Do queues the custom command for later execution.
func (c *Pipeline) Do(ctx context.Context, args ...interface{}) *Cmd {
cmd := NewCmd(ctx, args...)
if len(args) == 0 {
cmd.SetErr(errors.New("redis: please enter the command to be executed"))
return cmd
}
_ = c.Process(ctx, cmd)
return cmd
}
// Process queues the cmd for later execution.
func (c *Pipeline) Process(ctx context.Context, cmd Cmder) error {
return c.BatchProcess(ctx, cmd)
}
// BatchProcess queues multiple cmds for later execution.
func (c *Pipeline) BatchProcess(ctx context.Context, cmd ...Cmder) error {
c.cmds = append(c.cmds, cmd...)
return nil
}
// Discard resets the pipeline and discards queued commands.
func (c *Pipeline) Discard() {
c.cmds = c.cmds[:0]
}
// Exec executes all previously queued commands using one
// client-server roundtrip.
//
// Exec always returns list of commands and error of the first failed
// command if any.
func (c *Pipeline) Exec(ctx context.Context) ([]Cmder, error) {
if len(c.cmds) == 0 {
return nil, nil
}
cmds := c.cmds
c.cmds = nil
return cmds, c.exec(ctx, cmds)
}
func (c *Pipeline) Pipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
if err := fn(c); err != nil {
return nil, err
}
return c.Exec(ctx)
}
func (c *Pipeline) Pipeline() Pipeliner {
return c
}
func (c *Pipeline) TxPipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.Pipelined(ctx, fn)
}
func (c *Pipeline) TxPipeline() Pipeliner {
return c
}
func (c *Pipeline) Cmds() []Cmder {
return c.cmds
}
package redis
import (
"context"
"fmt"
"github.com/redis/go-redis/v9/internal/proto"
)
type ProbabilisticCmdable interface {
BFAdd(ctx context.Context, key string, element interface{}) *BoolCmd
BFCard(ctx context.Context, key string) *IntCmd
BFExists(ctx context.Context, key string, element interface{}) *BoolCmd
BFInfo(ctx context.Context, key string) *BFInfoCmd
BFInfoArg(ctx context.Context, key, option string) *BFInfoCmd
BFInfoCapacity(ctx context.Context, key string) *BFInfoCmd
BFInfoSize(ctx context.Context, key string) *BFInfoCmd
BFInfoFilters(ctx context.Context, key string) *BFInfoCmd
BFInfoItems(ctx context.Context, key string) *BFInfoCmd
BFInfoExpansion(ctx context.Context, key string) *BFInfoCmd
BFInsert(ctx context.Context, key string, options *BFInsertOptions, elements ...interface{}) *BoolSliceCmd
BFMAdd(ctx context.Context, key string, elements ...interface{}) *BoolSliceCmd
BFMExists(ctx context.Context, key string, elements ...interface{}) *BoolSliceCmd
BFReserve(ctx context.Context, key string, errorRate float64, capacity int64) *StatusCmd
BFReserveExpansion(ctx context.Context, key string, errorRate float64, capacity, expansion int64) *StatusCmd
BFReserveNonScaling(ctx context.Context, key string, errorRate float64, capacity int64) *StatusCmd
BFReserveWithArgs(ctx context.Context, key string, options *BFReserveOptions) *StatusCmd
BFScanDump(ctx context.Context, key string, iterator int64) *ScanDumpCmd
BFLoadChunk(ctx context.Context, key string, iterator int64, data interface{}) *StatusCmd
CFAdd(ctx context.Context, key string, element interface{}) *BoolCmd
CFAddNX(ctx context.Context, key string, element interface{}) *BoolCmd
CFCount(ctx context.Context, key string, element interface{}) *IntCmd
CFDel(ctx context.Context, key string, element interface{}) *BoolCmd
CFExists(ctx context.Context, key string, element interface{}) *BoolCmd
CFInfo(ctx context.Context, key string) *CFInfoCmd
CFInsert(ctx context.Context, key string, options *CFInsertOptions, elements ...interface{}) *BoolSliceCmd
CFInsertNX(ctx context.Context, key string, options *CFInsertOptions, elements ...interface{}) *IntSliceCmd
CFMExists(ctx context.Context, key string, elements ...interface{}) *BoolSliceCmd
CFReserve(ctx context.Context, key string, capacity int64) *StatusCmd
CFReserveWithArgs(ctx context.Context, key string, options *CFReserveOptions) *StatusCmd
CFReserveExpansion(ctx context.Context, key string, capacity int64, expansion int64) *StatusCmd
CFReserveBucketSize(ctx context.Context, key string, capacity int64, bucketsize int64) *StatusCmd
CFReserveMaxIterations(ctx context.Context, key string, capacity int64, maxiterations int64) *StatusCmd
CFScanDump(ctx context.Context, key string, iterator int64) *ScanDumpCmd
CFLoadChunk(ctx context.Context, key string, iterator int64, data interface{}) *StatusCmd
CMSIncrBy(ctx context.Context, key string, elements ...interface{}) *IntSliceCmd
CMSInfo(ctx context.Context, key string) *CMSInfoCmd
CMSInitByDim(ctx context.Context, key string, width, height int64) *StatusCmd
CMSInitByProb(ctx context.Context, key string, errorRate, probability float64) *StatusCmd
CMSMerge(ctx context.Context, destKey string, sourceKeys ...string) *StatusCmd
CMSMergeWithWeight(ctx context.Context, destKey string, sourceKeys map[string]int64) *StatusCmd
CMSQuery(ctx context.Context, key string, elements ...interface{}) *IntSliceCmd
TopKAdd(ctx context.Context, key string, elements ...interface{}) *StringSliceCmd
TopKCount(ctx context.Context, key string, elements ...interface{}) *IntSliceCmd
TopKIncrBy(ctx context.Context, key string, elements ...interface{}) *StringSliceCmd
TopKInfo(ctx context.Context, key string) *TopKInfoCmd
TopKList(ctx context.Context, key string) *StringSliceCmd
TopKListWithCount(ctx context.Context, key string) *MapStringIntCmd
TopKQuery(ctx context.Context, key string, elements ...interface{}) *BoolSliceCmd
TopKReserve(ctx context.Context, key string, k int64) *StatusCmd
TopKReserveWithOptions(ctx context.Context, key string, k int64, width, depth int64, decay float64) *StatusCmd
TDigestAdd(ctx context.Context, key string, elements ...float64) *StatusCmd
TDigestByRank(ctx context.Context, key string, rank ...uint64) *FloatSliceCmd
TDigestByRevRank(ctx context.Context, key string, rank ...uint64) *FloatSliceCmd
TDigestCDF(ctx context.Context, key string, elements ...float64) *FloatSliceCmd
TDigestCreate(ctx context.Context, key string) *StatusCmd
TDigestCreateWithCompression(ctx context.Context, key string, compression int64) *StatusCmd
TDigestInfo(ctx context.Context, key string) *TDigestInfoCmd
TDigestMax(ctx context.Context, key string) *FloatCmd
TDigestMin(ctx context.Context, key string) *FloatCmd
TDigestMerge(ctx context.Context, destKey string, options *TDigestMergeOptions, sourceKeys ...string) *StatusCmd
TDigestQuantile(ctx context.Context, key string, elements ...float64) *FloatSliceCmd
TDigestRank(ctx context.Context, key string, values ...float64) *IntSliceCmd
TDigestReset(ctx context.Context, key string) *StatusCmd
TDigestRevRank(ctx context.Context, key string, values ...float64) *IntSliceCmd
TDigestTrimmedMean(ctx context.Context, key string, lowCutQuantile, highCutQuantile float64) *FloatCmd
}
type BFInsertOptions struct {
Capacity int64
Error float64
Expansion int64
NonScaling bool
NoCreate bool
}
type BFReserveOptions struct {
Capacity int64
Error float64
Expansion int64
NonScaling bool
}
type CFReserveOptions struct {
Capacity int64
BucketSize int64
MaxIterations int64
Expansion int64
}
type CFInsertOptions struct {
Capacity int64
NoCreate bool
}
// -------------------------------------------
// Bloom filter commands
//-------------------------------------------
// BFReserve creates an empty Bloom filter with a single sub-filter
// for the initial specified capacity and with an upper bound error_rate.
// For more information - https://redis.io/commands/bf.reserve/
func (c cmdable) BFReserve(ctx context.Context, key string, errorRate float64, capacity int64) *StatusCmd {
args := []interface{}{"BF.RESERVE", key, errorRate, capacity}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BFReserveExpansion creates an empty Bloom filter with a single sub-filter
// for the initial specified capacity and with an upper bound error_rate.
// This function also allows for specifying an expansion rate for the filter.
// For more information - https://redis.io/commands/bf.reserve/
func (c cmdable) BFReserveExpansion(ctx context.Context, key string, errorRate float64, capacity, expansion int64) *StatusCmd {
args := []interface{}{"BF.RESERVE", key, errorRate, capacity, "EXPANSION", expansion}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BFReserveNonScaling creates an empty Bloom filter with a single sub-filter
// for the initial specified capacity and with an upper bound error_rate.
// This function also allows for specifying that the filter should not scale.
// For more information - https://redis.io/commands/bf.reserve/
func (c cmdable) BFReserveNonScaling(ctx context.Context, key string, errorRate float64, capacity int64) *StatusCmd {
args := []interface{}{"BF.RESERVE", key, errorRate, capacity, "NONSCALING"}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BFReserveWithArgs creates an empty Bloom filter with a single sub-filter
// for the initial specified capacity and with an upper bound error_rate.
// This function also allows for specifying additional options such as expansion rate and non-scaling behavior.
// For more information - https://redis.io/commands/bf.reserve/
func (c cmdable) BFReserveWithArgs(ctx context.Context, key string, options *BFReserveOptions) *StatusCmd {
args := []interface{}{"BF.RESERVE", key}
if options != nil {
args = append(args, options.Error, options.Capacity)
if options.Expansion != 0 {
args = append(args, "EXPANSION", options.Expansion)
}
if options.NonScaling {
args = append(args, "NONSCALING")
}
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BFAdd adds an item to a Bloom filter.
// For more information - https://redis.io/commands/bf.add/
func (c cmdable) BFAdd(ctx context.Context, key string, element interface{}) *BoolCmd {
args := []interface{}{"BF.ADD", key, element}
cmd := NewBoolCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BFCard returns the cardinality of a Bloom filter -
// number of items that were added to a Bloom filter and detected as unique
// (items that caused at least one bit to be set in at least one sub-filter).
// For more information - https://redis.io/commands/bf.card/
func (c cmdable) BFCard(ctx context.Context, key string) *IntCmd {
args := []interface{}{"BF.CARD", key}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BFExists determines whether a given item was added to a Bloom filter.
// For more information - https://redis.io/commands/bf.exists/
func (c cmdable) BFExists(ctx context.Context, key string, element interface{}) *BoolCmd {
args := []interface{}{"BF.EXISTS", key, element}
cmd := NewBoolCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BFLoadChunk restores a Bloom filter previously saved using BF.SCANDUMP.
// For more information - https://redis.io/commands/bf.loadchunk/
func (c cmdable) BFLoadChunk(ctx context.Context, key string, iterator int64, data interface{}) *StatusCmd {
args := []interface{}{"BF.LOADCHUNK", key, iterator, data}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Begins an incremental save of the Bloom filter.
// This command is useful for large Bloom filters that cannot fit into the DUMP and RESTORE model.
// For more information - https://redis.io/commands/bf.scandump/
func (c cmdable) BFScanDump(ctx context.Context, key string, iterator int64) *ScanDumpCmd {
args := []interface{}{"BF.SCANDUMP", key, iterator}
cmd := newScanDumpCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type ScanDump struct {
Iter int64
Data string
}
type ScanDumpCmd struct {
baseCmd
val ScanDump
}
func newScanDumpCmd(ctx context.Context, args ...interface{}) *ScanDumpCmd {
return &ScanDumpCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeScanDump,
},
}
}
func (cmd *ScanDumpCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *ScanDumpCmd) SetVal(val ScanDump) {
cmd.val = val
}
func (cmd *ScanDumpCmd) Result() (ScanDump, error) {
return cmd.val, cmd.err
}
func (cmd *ScanDumpCmd) Val() ScanDump {
return cmd.val
}
func (cmd *ScanDumpCmd) readReply(rd *proto.Reader) (err error) {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
cmd.val = ScanDump{}
for i := 0; i < n; i++ {
iter, err := rd.ReadInt()
if err != nil {
return err
}
data, err := rd.ReadString()
if err != nil {
return err
}
cmd.val.Data = data
cmd.val.Iter = iter
}
return nil
}
func (cmd *ScanDumpCmd) Clone() Cmder {
return &ScanDumpCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val, // ScanDump is a simple struct, can be copied directly
}
}
// Returns information about a Bloom filter.
// For more information - https://redis.io/commands/bf.info/
func (c cmdable) BFInfo(ctx context.Context, key string) *BFInfoCmd {
args := []interface{}{"BF.INFO", key}
cmd := NewBFInfoCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type BFInfo struct {
Capacity int64
Size int64
Filters int64
ItemsInserted int64
ExpansionRate int64
}
type BFInfoCmd struct {
baseCmd
val BFInfo
}
func NewBFInfoCmd(ctx context.Context, args ...interface{}) *BFInfoCmd {
return &BFInfoCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeBFInfo,
},
}
}
func (cmd *BFInfoCmd) SetVal(val BFInfo) {
cmd.val = val
}
func (cmd *BFInfoCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *BFInfoCmd) Val() BFInfo {
return cmd.val
}
func (cmd *BFInfoCmd) Result() (BFInfo, error) {
return cmd.val, cmd.err
}
func (cmd *BFInfoCmd) readReply(rd *proto.Reader) (err error) {
result := BFInfo{}
// Create a mapping from key names to pointers of struct fields
respMapping := map[string]*int64{
"Capacity": &result.Capacity,
"CAPACITY": &result.Capacity,
"Size": &result.Size,
"SIZE": &result.Size,
"Number of filters": &result.Filters,
"FILTERS": &result.Filters,
"Number of items inserted": &result.ItemsInserted,
"ITEMS": &result.ItemsInserted,
"Expansion rate": &result.ExpansionRate,
"EXPANSION": &result.ExpansionRate,
}
// Helper function to read and assign a value based on the key
readAndAssignValue := func(key string) error {
fieldPtr, exists := respMapping[key]
if !exists {
return fmt.Errorf("redis: BLOOM.INFO unexpected key %s", key)
}
// Read the integer and assign to the field via pointer dereferencing
val, err := rd.ReadInt()
if err != nil {
return err
}
*fieldPtr = val
return nil
}
readType, err := rd.PeekReplyType()
if err != nil {
return err
}
if len(cmd.args) > 2 && readType == proto.RespArray {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
if key, ok := cmd.args[2].(string); ok && n == 1 {
if err := readAndAssignValue(key); err != nil {
return err
}
} else {
return fmt.Errorf("redis: BLOOM.INFO invalid argument key type")
}
} else {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
for i := 0; i < n; i++ {
key, err := rd.ReadString()
if err != nil {
return err
}
if err := readAndAssignValue(key); err != nil {
return err
}
}
}
cmd.val = result
return nil
}
func (cmd *BFInfoCmd) Clone() Cmder {
return &BFInfoCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val, // BFInfo is a simple struct, can be copied directly
}
}
// BFInfoCapacity returns information about the capacity of a Bloom filter.
// For more information - https://redis.io/commands/bf.info/
func (c cmdable) BFInfoCapacity(ctx context.Context, key string) *BFInfoCmd {
return c.BFInfoArg(ctx, key, "CAPACITY")
}
// BFInfoSize returns information about the size of a Bloom filter.
// For more information - https://redis.io/commands/bf.info/
func (c cmdable) BFInfoSize(ctx context.Context, key string) *BFInfoCmd {
return c.BFInfoArg(ctx, key, "SIZE")
}
// BFInfoFilters returns information about the filters of a Bloom filter.
// For more information - https://redis.io/commands/bf.info/
func (c cmdable) BFInfoFilters(ctx context.Context, key string) *BFInfoCmd {
return c.BFInfoArg(ctx, key, "FILTERS")
}
// BFInfoItems returns information about the items of a Bloom filter.
// For more information - https://redis.io/commands/bf.info/
func (c cmdable) BFInfoItems(ctx context.Context, key string) *BFInfoCmd {
return c.BFInfoArg(ctx, key, "ITEMS")
}
// BFInfoExpansion returns information about the expansion rate of a Bloom filter.
// For more information - https://redis.io/commands/bf.info/
func (c cmdable) BFInfoExpansion(ctx context.Context, key string) *BFInfoCmd {
return c.BFInfoArg(ctx, key, "EXPANSION")
}
// BFInfoArg returns information about a specific option of a Bloom filter.
// For more information - https://redis.io/commands/bf.info/
func (c cmdable) BFInfoArg(ctx context.Context, key, option string) *BFInfoCmd {
args := []interface{}{"BF.INFO", key, option}
cmd := NewBFInfoCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BFInsert inserts elements into a Bloom filter.
// This function also allows for specifying additional options such as:
// capacity, error rate, expansion rate, and non-scaling behavior.
// For more information - https://redis.io/commands/bf.insert/
func (c cmdable) BFInsert(ctx context.Context, key string, options *BFInsertOptions, elements ...interface{}) *BoolSliceCmd {
args := []interface{}{"BF.INSERT", key}
if options != nil {
if options.Capacity != 0 {
args = append(args, "CAPACITY", options.Capacity)
}
if options.Error != 0 {
args = append(args, "ERROR", options.Error)
}
if options.Expansion != 0 {
args = append(args, "EXPANSION", options.Expansion)
}
if options.NoCreate {
args = append(args, "NOCREATE")
}
if options.NonScaling {
args = append(args, "NONSCALING")
}
}
args = append(args, "ITEMS")
args = append(args, elements...)
cmd := NewBoolSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BFMAdd adds multiple elements to a Bloom filter.
// Returns an array of booleans indicating whether each element was added to the filter or not.
// For more information - https://redis.io/commands/bf.madd/
func (c cmdable) BFMAdd(ctx context.Context, key string, elements ...interface{}) *BoolSliceCmd {
args := []interface{}{"BF.MADD", key}
args = append(args, elements...)
cmd := NewBoolSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// BFMExists check if multiple elements exist in a Bloom filter.
// Returns an array of booleans indicating whether each element exists in the filter or not.
// For more information - https://redis.io/commands/bf.mexists/
func (c cmdable) BFMExists(ctx context.Context, key string, elements ...interface{}) *BoolSliceCmd {
args := []interface{}{"BF.MEXISTS", key}
args = append(args, elements...)
cmd := NewBoolSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// -------------------------------------------
// Cuckoo filter commands
//-------------------------------------------
// CFReserve creates an empty Cuckoo filter with the specified capacity.
// For more information - https://redis.io/commands/cf.reserve/
func (c cmdable) CFReserve(ctx context.Context, key string, capacity int64) *StatusCmd {
args := []interface{}{"CF.RESERVE", key, capacity}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CFReserveExpansion creates an empty Cuckoo filter with the specified capacity and expansion rate.
// For more information - https://redis.io/commands/cf.reserve/
func (c cmdable) CFReserveExpansion(ctx context.Context, key string, capacity int64, expansion int64) *StatusCmd {
args := []interface{}{"CF.RESERVE", key, capacity, "EXPANSION", expansion}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CFReserveBucketSize creates an empty Cuckoo filter with the specified capacity and bucket size.
// For more information - https://redis.io/commands/cf.reserve/
func (c cmdable) CFReserveBucketSize(ctx context.Context, key string, capacity int64, bucketsize int64) *StatusCmd {
args := []interface{}{"CF.RESERVE", key, capacity, "BUCKETSIZE", bucketsize}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CFReserveMaxIterations creates an empty Cuckoo filter with the specified capacity and maximum number of iterations.
// For more information - https://redis.io/commands/cf.reserve/
func (c cmdable) CFReserveMaxIterations(ctx context.Context, key string, capacity int64, maxiterations int64) *StatusCmd {
args := []interface{}{"CF.RESERVE", key, capacity, "MAXITERATIONS", maxiterations}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CFReserveWithArgs creates an empty Cuckoo filter with the specified options.
// This function allows for specifying additional options such as bucket size and maximum number of iterations.
// For more information - https://redis.io/commands/cf.reserve/
func (c cmdable) CFReserveWithArgs(ctx context.Context, key string, options *CFReserveOptions) *StatusCmd {
args := []interface{}{"CF.RESERVE", key, options.Capacity}
if options.BucketSize != 0 {
args = append(args, "BUCKETSIZE", options.BucketSize)
}
if options.MaxIterations != 0 {
args = append(args, "MAXITERATIONS", options.MaxIterations)
}
if options.Expansion != 0 {
args = append(args, "EXPANSION", options.Expansion)
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CFAdd adds an element to a Cuckoo filter.
// Returns true if the element was added to the filter or false if it already exists in the filter.
// For more information - https://redis.io/commands/cf.add/
func (c cmdable) CFAdd(ctx context.Context, key string, element interface{}) *BoolCmd {
args := []interface{}{"CF.ADD", key, element}
cmd := NewBoolCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CFAddNX adds an element to a Cuckoo filter only if it does not already exist in the filter.
// Returns true if the element was added to the filter or false if it already exists in the filter.
// For more information - https://redis.io/commands/cf.addnx/
func (c cmdable) CFAddNX(ctx context.Context, key string, element interface{}) *BoolCmd {
args := []interface{}{"CF.ADDNX", key, element}
cmd := NewBoolCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CFCount returns an estimate of the number of times an element may be in a Cuckoo Filter.
// For more information - https://redis.io/commands/cf.count/
func (c cmdable) CFCount(ctx context.Context, key string, element interface{}) *IntCmd {
args := []interface{}{"CF.COUNT", key, element}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CFDel deletes an item once from the cuckoo filter.
// For more information - https://redis.io/commands/cf.del/
func (c cmdable) CFDel(ctx context.Context, key string, element interface{}) *BoolCmd {
args := []interface{}{"CF.DEL", key, element}
cmd := NewBoolCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CFExists determines whether an item may exist in the Cuckoo Filter or not.
// For more information - https://redis.io/commands/cf.exists/
func (c cmdable) CFExists(ctx context.Context, key string, element interface{}) *BoolCmd {
args := []interface{}{"CF.EXISTS", key, element}
cmd := NewBoolCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CFLoadChunk restores a filter previously saved using SCANDUMP.
// For more information - https://redis.io/commands/cf.loadchunk/
func (c cmdable) CFLoadChunk(ctx context.Context, key string, iterator int64, data interface{}) *StatusCmd {
args := []interface{}{"CF.LOADCHUNK", key, iterator, data}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CFScanDump begins an incremental save of the cuckoo filter.
// For more information - https://redis.io/commands/cf.scandump/
func (c cmdable) CFScanDump(ctx context.Context, key string, iterator int64) *ScanDumpCmd {
args := []interface{}{"CF.SCANDUMP", key, iterator}
cmd := newScanDumpCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type CFInfo struct {
Size int64
NumBuckets int64
NumFilters int64
NumItemsInserted int64
NumItemsDeleted int64
BucketSize int64
ExpansionRate int64
MaxIteration int64
}
type CFInfoCmd struct {
baseCmd
val CFInfo
}
func NewCFInfoCmd(ctx context.Context, args ...interface{}) *CFInfoCmd {
return &CFInfoCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeCFInfo,
},
}
}
func (cmd *CFInfoCmd) SetVal(val CFInfo) {
cmd.val = val
}
func (cmd *CFInfoCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *CFInfoCmd) Val() CFInfo {
return cmd.val
}
func (cmd *CFInfoCmd) Result() (CFInfo, error) {
return cmd.val, cmd.err
}
func (cmd *CFInfoCmd) readReply(rd *proto.Reader) (err error) {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
var key string
var result CFInfo
for f := 0; f < n; f++ {
key, err = rd.ReadString()
if err != nil {
return err
}
switch key {
case "Size":
result.Size, err = rd.ReadInt()
case "Number of buckets":
result.NumBuckets, err = rd.ReadInt()
case "Number of filters":
result.NumFilters, err = rd.ReadInt()
case "Number of items inserted":
result.NumItemsInserted, err = rd.ReadInt()
case "Number of items deleted":
result.NumItemsDeleted, err = rd.ReadInt()
case "Bucket size":
result.BucketSize, err = rd.ReadInt()
case "Expansion rate":
result.ExpansionRate, err = rd.ReadInt()
case "Max iterations":
result.MaxIteration, err = rd.ReadInt()
default:
return fmt.Errorf("redis: CF.INFO unexpected key %s", key)
}
if err != nil {
return err
}
}
cmd.val = result
return nil
}
func (cmd *CFInfoCmd) Clone() Cmder {
return &CFInfoCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val, // CFInfo is a simple struct, can be copied directly
}
}
// CFInfo returns information about a Cuckoo filter.
// For more information - https://redis.io/commands/cf.info/
func (c cmdable) CFInfo(ctx context.Context, key string) *CFInfoCmd {
args := []interface{}{"CF.INFO", key}
cmd := NewCFInfoCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CFInsert inserts elements into a Cuckoo filter.
// This function also allows for specifying additional options such as capacity, error rate, expansion rate, and non-scaling behavior.
// Returns an array of booleans indicating whether each element was added to the filter or not.
// For more information - https://redis.io/commands/cf.insert/
func (c cmdable) CFInsert(ctx context.Context, key string, options *CFInsertOptions, elements ...interface{}) *BoolSliceCmd {
args := []interface{}{"CF.INSERT", key}
args = c.getCfInsertWithArgs(args, options, elements...)
cmd := NewBoolSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CFInsertNX inserts elements into a Cuckoo filter only if they do not already exist in the filter.
// This function also allows for specifying additional options such as:
// capacity, error rate, expansion rate, and non-scaling behavior.
// Returns an array of integers indicating whether each element was added to the filter or not.
// For more information - https://redis.io/commands/cf.insertnx/
func (c cmdable) CFInsertNX(ctx context.Context, key string, options *CFInsertOptions, elements ...interface{}) *IntSliceCmd {
args := []interface{}{"CF.INSERTNX", key}
args = c.getCfInsertWithArgs(args, options, elements...)
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) getCfInsertWithArgs(args []interface{}, options *CFInsertOptions, elements ...interface{}) []interface{} {
if options != nil {
if options.Capacity != 0 {
args = append(args, "CAPACITY", options.Capacity)
}
if options.NoCreate {
args = append(args, "NOCREATE")
}
}
args = append(args, "ITEMS")
args = append(args, elements...)
return args
}
// CFMExists check if multiple elements exist in a Cuckoo filter.
// Returns an array of booleans indicating whether each element exists in the filter or not.
// For more information - https://redis.io/commands/cf.mexists/
func (c cmdable) CFMExists(ctx context.Context, key string, elements ...interface{}) *BoolSliceCmd {
args := []interface{}{"CF.MEXISTS", key}
args = append(args, elements...)
cmd := NewBoolSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// -------------------------------------------
// CMS commands
//-------------------------------------------
// CMSIncrBy increments the count of one or more items in a Count-Min Sketch filter.
// Returns an array of integers representing the updated count of each item.
// For more information - https://redis.io/commands/cms.incrby/
func (c cmdable) CMSIncrBy(ctx context.Context, key string, elements ...interface{}) *IntSliceCmd {
args := make([]interface{}, 2, 2+len(elements))
args[0] = "CMS.INCRBY"
args[1] = key
args = appendArgs(args, elements)
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type CMSInfo struct {
Width int64
Depth int64
Count int64
}
type CMSInfoCmd struct {
baseCmd
val CMSInfo
}
func NewCMSInfoCmd(ctx context.Context, args ...interface{}) *CMSInfoCmd {
return &CMSInfoCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeCMSInfo,
},
}
}
func (cmd *CMSInfoCmd) SetVal(val CMSInfo) {
cmd.val = val
}
func (cmd *CMSInfoCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *CMSInfoCmd) Val() CMSInfo {
return cmd.val
}
func (cmd *CMSInfoCmd) Result() (CMSInfo, error) {
return cmd.val, cmd.err
}
func (cmd *CMSInfoCmd) readReply(rd *proto.Reader) (err error) {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
var key string
var result CMSInfo
for f := 0; f < n; f++ {
key, err = rd.ReadString()
if err != nil {
return err
}
switch key {
case "width":
result.Width, err = rd.ReadInt()
case "depth":
result.Depth, err = rd.ReadInt()
case "count":
result.Count, err = rd.ReadInt()
default:
return fmt.Errorf("redis: CMS.INFO unexpected key %s", key)
}
if err != nil {
return err
}
}
cmd.val = result
return nil
}
func (cmd *CMSInfoCmd) Clone() Cmder {
return &CMSInfoCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val, // CMSInfo is a simple struct, can be copied directly
}
}
// CMSInfo returns information about a Count-Min Sketch filter.
// For more information - https://redis.io/commands/cms.info/
func (c cmdable) CMSInfo(ctx context.Context, key string) *CMSInfoCmd {
args := []interface{}{"CMS.INFO", key}
cmd := NewCMSInfoCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CMSInitByDim creates an empty Count-Min Sketch filter with the specified dimensions.
// For more information - https://redis.io/commands/cms.initbydim/
func (c cmdable) CMSInitByDim(ctx context.Context, key string, width, depth int64) *StatusCmd {
args := []interface{}{"CMS.INITBYDIM", key, width, depth}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CMSInitByProb creates an empty Count-Min Sketch filter with the specified error rate and probability.
// For more information - https://redis.io/commands/cms.initbyprob/
func (c cmdable) CMSInitByProb(ctx context.Context, key string, errorRate, probability float64) *StatusCmd {
args := []interface{}{"CMS.INITBYPROB", key, errorRate, probability}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CMSMerge merges multiple Count-Min Sketch filters into a single filter.
// The destination filter must not exist and will be created with the dimensions of the first source filter.
// The number of items in each source filter must be equal.
// Returns OK on success or an error if the filters could not be merged.
// For more information - https://redis.io/commands/cms.merge/
func (c cmdable) CMSMerge(ctx context.Context, destKey string, sourceKeys ...string) *StatusCmd {
args := []interface{}{"CMS.MERGE", destKey, len(sourceKeys)}
for _, s := range sourceKeys {
args = append(args, s)
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CMSMergeWithWeight merges multiple Count-Min Sketch filters into a single filter with weights for each source filter.
// The destination filter must not exist and will be created with the dimensions of the first source filter.
// The number of items in each source filter must be equal.
// Returns OK on success or an error if the filters could not be merged.
// For more information - https://redis.io/commands/cms.merge/
func (c cmdable) CMSMergeWithWeight(ctx context.Context, destKey string, sourceKeys map[string]int64) *StatusCmd {
args := make([]interface{}, 0, 4+(len(sourceKeys)*2+1))
args = append(args, "CMS.MERGE", destKey, len(sourceKeys))
if len(sourceKeys) > 0 {
sk := make([]interface{}, len(sourceKeys))
sw := make([]interface{}, len(sourceKeys))
i := 0
for k, w := range sourceKeys {
sk[i] = k
sw[i] = w
i++
}
args = append(args, sk...)
args = append(args, "WEIGHTS")
args = append(args, sw...)
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// CMSQuery returns count for item(s).
// For more information - https://redis.io/commands/cms.query/
func (c cmdable) CMSQuery(ctx context.Context, key string, elements ...interface{}) *IntSliceCmd {
args := []interface{}{"CMS.QUERY", key}
args = append(args, elements...)
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// -------------------------------------------
// TopK commands
//--------------------------------------------
// TopKAdd adds one or more elements to a Top-K filter.
// Returns an array of strings representing the items that were removed from the filter, if any.
// For more information - https://redis.io/commands/topk.add/
func (c cmdable) TopKAdd(ctx context.Context, key string, elements ...interface{}) *StringSliceCmd {
args := make([]interface{}, 2, 2+len(elements))
args[0] = "TOPK.ADD"
args[1] = key
args = appendArgs(args, elements)
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TopKReserve creates an empty Top-K filter with the specified number of top items to keep.
// For more information - https://redis.io/commands/topk.reserve/
func (c cmdable) TopKReserve(ctx context.Context, key string, k int64) *StatusCmd {
args := []interface{}{"TOPK.RESERVE", key, k}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TopKReserveWithOptions creates an empty Top-K filter with the specified number of top items to keep and additional options.
// This function allows for specifying additional options such as width, depth and decay.
// For more information - https://redis.io/commands/topk.reserve/
func (c cmdable) TopKReserveWithOptions(ctx context.Context, key string, k int64, width, depth int64, decay float64) *StatusCmd {
args := []interface{}{"TOPK.RESERVE", key, k, width, depth, decay}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type TopKInfo struct {
K int64
Width int64
Depth int64
Decay float64
}
type TopKInfoCmd struct {
baseCmd
val TopKInfo
}
func NewTopKInfoCmd(ctx context.Context, args ...interface{}) *TopKInfoCmd {
return &TopKInfoCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeTopKInfo,
},
}
}
func (cmd *TopKInfoCmd) SetVal(val TopKInfo) {
cmd.val = val
}
func (cmd *TopKInfoCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *TopKInfoCmd) Val() TopKInfo {
return cmd.val
}
func (cmd *TopKInfoCmd) Result() (TopKInfo, error) {
return cmd.val, cmd.err
}
func (cmd *TopKInfoCmd) readReply(rd *proto.Reader) (err error) {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
var key string
var result TopKInfo
for f := 0; f < n; f++ {
key, err = rd.ReadString()
if err != nil {
return err
}
switch key {
case "k":
result.K, err = rd.ReadInt()
case "width":
result.Width, err = rd.ReadInt()
case "depth":
result.Depth, err = rd.ReadInt()
case "decay":
result.Decay, err = rd.ReadFloat()
default:
return fmt.Errorf("redis: topk.info unexpected key %s", key)
}
if err != nil {
return err
}
}
cmd.val = result
return nil
}
func (cmd *TopKInfoCmd) Clone() Cmder {
return &TopKInfoCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val, // TopKInfo is a simple struct, can be copied directly
}
}
// TopKInfo returns information about a Top-K filter.
// For more information - https://redis.io/commands/topk.info/
func (c cmdable) TopKInfo(ctx context.Context, key string) *TopKInfoCmd {
args := []interface{}{"TOPK.INFO", key}
cmd := NewTopKInfoCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TopKQuery check if multiple elements exist in a Top-K filter.
// Returns an array of booleans indicating whether each element exists in the filter or not.
// For more information - https://redis.io/commands/topk.query/
func (c cmdable) TopKQuery(ctx context.Context, key string, elements ...interface{}) *BoolSliceCmd {
args := make([]interface{}, 2, 2+len(elements))
args[0] = "TOPK.QUERY"
args[1] = key
args = appendArgs(args, elements)
cmd := NewBoolSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TopKCount returns an estimate of the number of times an item may be in a Top-K filter.
// For more information - https://redis.io/commands/topk.count/
func (c cmdable) TopKCount(ctx context.Context, key string, elements ...interface{}) *IntSliceCmd {
args := make([]interface{}, 2, 2+len(elements))
args[0] = "TOPK.COUNT"
args[1] = key
args = appendArgs(args, elements)
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TopKIncrBy increases the count of one or more items in a Top-K filter.
// For more information - https://redis.io/commands/topk.incrby/
func (c cmdable) TopKIncrBy(ctx context.Context, key string, elements ...interface{}) *StringSliceCmd {
args := make([]interface{}, 2, 2+len(elements))
args[0] = "TOPK.INCRBY"
args[1] = key
args = appendArgs(args, elements)
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TopKList returns all items in Top-K list.
// For more information - https://redis.io/commands/topk.list/
func (c cmdable) TopKList(ctx context.Context, key string) *StringSliceCmd {
args := []interface{}{"TOPK.LIST", key}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TopKListWithCount returns all items in Top-K list with their respective count.
// For more information - https://redis.io/commands/topk.list/
func (c cmdable) TopKListWithCount(ctx context.Context, key string) *MapStringIntCmd {
args := []interface{}{"TOPK.LIST", key, "WITHCOUNT"}
cmd := NewMapStringIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// -------------------------------------------
// t-digest commands
// --------------------------------------------
// TDigestAdd adds one or more elements to a t-Digest data structure.
// Returns OK on success or an error if the operation could not be completed.
// For more information - https://redis.io/commands/tdigest.add/
func (c cmdable) TDigestAdd(ctx context.Context, key string, elements ...float64) *StatusCmd {
args := make([]interface{}, 2+len(elements))
args[0] = "TDIGEST.ADD"
args[1] = key
for i, v := range elements {
args[2+i] = v
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TDigestByRank returns an array of values from a t-Digest data structure based on their rank.
// The rank of an element is its position in the sorted list of all elements in the t-Digest.
// Returns an array of floats representing the values at the specified ranks or an error if the operation could not be completed.
// For more information - https://redis.io/commands/tdigest.byrank/
func (c cmdable) TDigestByRank(ctx context.Context, key string, rank ...uint64) *FloatSliceCmd {
args := make([]interface{}, 2+len(rank))
args[0] = "TDIGEST.BYRANK"
args[1] = key
for i, r := range rank {
args[2+i] = r
}
cmd := NewFloatSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TDigestByRevRank returns an array of values from a t-Digest data structure based on their reverse rank.
// The reverse rank of an element is its position in the sorted list of all elements in the t-Digest when sorted in descending order.
// Returns an array of floats representing the values at the specified ranks or an error if the operation could not be completed.
// For more information - https://redis.io/commands/tdigest.byrevrank/
func (c cmdable) TDigestByRevRank(ctx context.Context, key string, rank ...uint64) *FloatSliceCmd {
args := make([]interface{}, 2+len(rank))
args[0] = "TDIGEST.BYREVRANK"
args[1] = key
for i, r := range rank {
args[2+i] = r
}
cmd := NewFloatSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TDigestCDF returns an array of cumulative distribution function (CDF) values for one or more elements in a t-Digest data structure.
// The CDF value for an element is the fraction of all elements in the t-Digest that are less than or equal to it.
// Returns an array of floats representing the CDF values for each element or an error if the operation could not be completed.
// For more information - https://redis.io/commands/tdigest.cdf/
func (c cmdable) TDigestCDF(ctx context.Context, key string, elements ...float64) *FloatSliceCmd {
args := make([]interface{}, 2+len(elements))
args[0] = "TDIGEST.CDF"
args[1] = key
for i, v := range elements {
args[2+i] = v
}
cmd := NewFloatSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TDigestCreate creates an empty t-Digest data structure with default parameters.
// Returns OK on success or an error if the operation could not be completed.
// For more information - https://redis.io/commands/tdigest.create/
func (c cmdable) TDigestCreate(ctx context.Context, key string) *StatusCmd {
args := []interface{}{"TDIGEST.CREATE", key}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TDigestCreateWithCompression creates an empty t-Digest data structure with a specified compression parameter.
// The compression parameter controls the accuracy and memory usage of the t-Digest.
// Returns OK on success or an error if the operation could not be completed.
// For more information - https://redis.io/commands/tdigest.create/
func (c cmdable) TDigestCreateWithCompression(ctx context.Context, key string, compression int64) *StatusCmd {
args := []interface{}{"TDIGEST.CREATE", key, "COMPRESSION", compression}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type TDigestInfo struct {
Compression int64
Capacity int64
MergedNodes int64
UnmergedNodes int64
MergedWeight int64
UnmergedWeight int64
Observations int64
TotalCompressions int64
MemoryUsage int64
}
type TDigestInfoCmd struct {
baseCmd
val TDigestInfo
}
func NewTDigestInfoCmd(ctx context.Context, args ...interface{}) *TDigestInfoCmd {
return &TDigestInfoCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeTDigestInfo,
},
}
}
func (cmd *TDigestInfoCmd) SetVal(val TDigestInfo) {
cmd.val = val
}
func (cmd *TDigestInfoCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *TDigestInfoCmd) Val() TDigestInfo {
return cmd.val
}
func (cmd *TDigestInfoCmd) Result() (TDigestInfo, error) {
return cmd.val, cmd.err
}
func (cmd *TDigestInfoCmd) readReply(rd *proto.Reader) (err error) {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
var key string
var result TDigestInfo
for f := 0; f < n; f++ {
key, err = rd.ReadString()
if err != nil {
return err
}
switch key {
case "Compression":
result.Compression, err = rd.ReadInt()
case "Capacity":
result.Capacity, err = rd.ReadInt()
case "Merged nodes":
result.MergedNodes, err = rd.ReadInt()
case "Unmerged nodes":
result.UnmergedNodes, err = rd.ReadInt()
case "Merged weight":
result.MergedWeight, err = rd.ReadInt()
case "Unmerged weight":
result.UnmergedWeight, err = rd.ReadInt()
case "Observations":
result.Observations, err = rd.ReadInt()
case "Total compressions":
result.TotalCompressions, err = rd.ReadInt()
case "Memory usage":
result.MemoryUsage, err = rd.ReadInt()
default:
return fmt.Errorf("redis: tdigest.info unexpected key %s", key)
}
if err != nil {
return err
}
}
cmd.val = result
return nil
}
func (cmd *TDigestInfoCmd) Clone() Cmder {
return &TDigestInfoCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val, // TDigestInfo is a simple struct, can be copied directly
}
}
// TDigestInfo returns information about a t-Digest data structure.
// For more information - https://redis.io/commands/tdigest.info/
func (c cmdable) TDigestInfo(ctx context.Context, key string) *TDigestInfoCmd {
args := []interface{}{"TDIGEST.INFO", key}
cmd := NewTDigestInfoCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TDigestMax returns the maximum value from a t-Digest data structure.
// For more information - https://redis.io/commands/tdigest.max/
func (c cmdable) TDigestMax(ctx context.Context, key string) *FloatCmd {
args := []interface{}{"TDIGEST.MAX", key}
cmd := NewFloatCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type TDigestMergeOptions struct {
Compression int64
Override bool
}
// TDigestMerge merges multiple t-Digest data structures into a single t-Digest.
// This function also allows for specifying additional options such as compression and override behavior.
// Returns OK on success or an error if the operation could not be completed.
// For more information - https://redis.io/commands/tdigest.merge/
func (c cmdable) TDigestMerge(ctx context.Context, destKey string, options *TDigestMergeOptions, sourceKeys ...string) *StatusCmd {
args := []interface{}{"TDIGEST.MERGE", destKey, len(sourceKeys)}
for _, sourceKey := range sourceKeys {
args = append(args, sourceKey)
}
if options != nil {
if options.Compression != 0 {
args = append(args, "COMPRESSION", options.Compression)
}
if options.Override {
args = append(args, "OVERRIDE")
}
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TDigestMin returns the minimum value from a t-Digest data structure.
// For more information - https://redis.io/commands/tdigest.min/
func (c cmdable) TDigestMin(ctx context.Context, key string) *FloatCmd {
args := []interface{}{"TDIGEST.MIN", key}
cmd := NewFloatCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TDigestQuantile returns an array of quantile values for one or more elements in a t-Digest data structure.
// The quantile value for an element is the fraction of all elements in the t-Digest that are less than or equal to it.
// Returns an array of floats representing the quantile values for each element or an error if the operation could not be completed.
// For more information - https://redis.io/commands/tdigest.quantile/
func (c cmdable) TDigestQuantile(ctx context.Context, key string, elements ...float64) *FloatSliceCmd {
args := make([]interface{}, 2+len(elements))
args[0] = "TDIGEST.QUANTILE"
args[1] = key
for i, v := range elements {
args[2+i] = v
}
cmd := NewFloatSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TDigestRank returns an array of rank values for one or more elements in a t-Digest data structure.
// The rank of an element is its position in the sorted list of all elements in the t-Digest.
// Returns an array of integers representing the rank values for each element or an error if the operation could not be completed.
// For more information - https://redis.io/commands/tdigest.rank/
func (c cmdable) TDigestRank(ctx context.Context, key string, values ...float64) *IntSliceCmd {
args := make([]interface{}, 2+len(values))
args[0] = "TDIGEST.RANK"
args[1] = key
for i, v := range values {
args[i+2] = v
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TDigestReset resets a t-Digest data structure to its initial state.
// Returns OK on success or an error if the operation could not be completed.
// For more information - https://redis.io/commands/tdigest.reset/
func (c cmdable) TDigestReset(ctx context.Context, key string) *StatusCmd {
args := []interface{}{"TDIGEST.RESET", key}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TDigestRevRank returns an array of reverse rank values for one or more elements in a t-Digest data structure.
// The reverse rank of an element is its position in the sorted list of all elements in the t-Digest when sorted in descending order.
// Returns an array of integers representing the reverse rank values for each element or an error if the operation could not be completed.
// For more information - https://redis.io/commands/tdigest.revrank/
func (c cmdable) TDigestRevRank(ctx context.Context, key string, values ...float64) *IntSliceCmd {
args := make([]interface{}, 2+len(values))
args[0] = "TDIGEST.REVRANK"
args[1] = key
for i, v := range values {
args[2+i] = v
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TDigestTrimmedMean returns the trimmed mean value from a t-Digest data structure.
// The trimmed mean is calculated by removing a specified fraction of the highest and lowest values from the t-Digest and then calculating the mean of the remaining values.
// Returns a float representing the trimmed mean value or an error if the operation could not be completed.
// For more information - https://redis.io/commands/tdigest.trimmed_mean/
func (c cmdable) TDigestTrimmedMean(ctx context.Context, key string, lowCutQuantile, highCutQuantile float64) *FloatCmd {
args := []interface{}{"TDIGEST.TRIMMED_MEAN", key, lowCutQuantile, highCutQuantile}
cmd := NewFloatCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
package redis
import (
"context"
"fmt"
"strings"
"sync"
"time"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/otel"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/internal/proto"
"github.com/redis/go-redis/v9/push"
)
// PubSub implements Pub/Sub commands as described in
// https://redis.io/docs/latest/develop/pubsub. Message receiving is NOT safe
// for concurrent use by multiple goroutines.
//
// PubSub automatically reconnects to Redis Server and resubscribes
// to the channels in case of network errors.
type PubSub struct {
opt *Options
newConn func(ctx context.Context, addr string, channels []string) (*pool.Conn, error)
closeConn func(*pool.Conn) error
mu sync.Mutex
cn *pool.Conn
channels map[string]struct{}
patterns map[string]struct{}
schannels map[string]struct{}
closed bool
exit chan struct{}
cmd *Cmd
chOnce sync.Once
msgCh *channel
allCh *channel
// Push notification processor for handling generic push notifications
pushProcessor push.NotificationProcessor
// Cleanup callback for maintenanceNotifications upgrade tracking
onClose func()
}
func (c *PubSub) init() {
c.exit = make(chan struct{})
}
func (c *PubSub) String() string {
c.mu.Lock()
defer c.mu.Unlock()
channels := mapKeys(c.channels)
channels = append(channels, mapKeys(c.patterns)...)
channels = append(channels, mapKeys(c.schannels)...)
return fmt.Sprintf("PubSub(%s)", strings.Join(channels, ", "))
}
func (c *PubSub) connWithLock(ctx context.Context) (*pool.Conn, error) {
c.mu.Lock()
cn, err := c.conn(ctx, nil)
c.mu.Unlock()
return cn, err
}
func (c *PubSub) conn(ctx context.Context, newChannels []string) (*pool.Conn, error) {
if c.closed {
return nil, pool.ErrClosed
}
if c.cn != nil {
return c.cn, nil
}
if c.opt.Addr == "" {
// TODO(maintenanceNotifications):
// this is probably cluster client
// c.newConn will ignore the addr argument
// will be changed when we have maintenanceNotifications upgrades for cluster clients
c.opt.Addr = internal.RedisNull
}
channels := mapKeys(c.channels)
channels = append(channels, newChannels...)
cn, err := c.newConn(ctx, c.opt.Addr, channels)
if err != nil {
return nil, err
}
if err := c.resubscribe(ctx, cn); err != nil {
_ = c.closeConn(cn)
return nil, err
}
c.cn = cn
return cn, nil
}
func (c *PubSub) writeCmd(ctx context.Context, cn *pool.Conn, cmd Cmder) error {
return cn.WithWriter(ctx, c.opt.WriteTimeout, func(wr *proto.Writer) error {
return writeCmd(wr, cmd)
})
}
func (c *PubSub) resubscribe(ctx context.Context, cn *pool.Conn) error {
var firstErr error
if len(c.channels) > 0 {
firstErr = c._subscribe(ctx, cn, "subscribe", mapKeys(c.channels))
}
if len(c.patterns) > 0 {
err := c._subscribe(ctx, cn, "psubscribe", mapKeys(c.patterns))
if err != nil && firstErr == nil {
firstErr = err
}
}
if len(c.schannels) > 0 {
err := c._subscribe(ctx, cn, "ssubscribe", mapKeys(c.schannels))
if err != nil && firstErr == nil {
firstErr = err
}
}
return firstErr
}
func mapKeys(m map[string]struct{}) []string {
s := make([]string, len(m))
i := 0
for k := range m {
s[i] = k
i++
}
return s
}
func (c *PubSub) _subscribe(
ctx context.Context, cn *pool.Conn, redisCmd string, channels []string,
) error {
args := make([]interface{}, 0, 1+len(channels))
args = append(args, redisCmd)
for _, channel := range channels {
args = append(args, channel)
}
cmd := NewSliceCmd(ctx, args...)
return c.writeCmd(ctx, cn, cmd)
}
func (c *PubSub) releaseConnWithLock(
ctx context.Context,
cn *pool.Conn,
err error,
allowTimeout bool,
) {
c.mu.Lock()
c.releaseConn(ctx, cn, err, allowTimeout)
c.mu.Unlock()
}
func (c *PubSub) releaseConn(ctx context.Context, cn *pool.Conn, err error, allowTimeout bool) {
if c.cn != cn {
return
}
if !cn.IsUsable() || cn.ShouldHandoff() {
c.reconnect(ctx, fmt.Errorf("pubsub: connection is not usable"))
}
if isBadConn(err, allowTimeout, c.opt.Addr) {
c.reconnect(ctx, err)
}
}
func (c *PubSub) reconnect(ctx context.Context, reason error) {
if c.cn != nil && c.cn.ShouldHandoff() {
newEndpoint := c.cn.GetHandoffEndpoint()
// If new endpoint is NULL, use the original address
if newEndpoint == internal.RedisNull {
newEndpoint = c.opt.Addr
}
if newEndpoint != "" {
// Update the address in the options
oldAddr := c.cn.RemoteAddr().String()
c.opt.Addr = newEndpoint
internal.Logger.Printf(ctx, "pubsub: reconnecting to new endpoint %s (was %s)", newEndpoint, oldAddr)
}
}
_ = c.closeTheCn(reason)
_, _ = c.conn(ctx, nil)
}
func (c *PubSub) closeTheCn(reason error) error {
if c.cn == nil {
return nil
}
err := c.closeConn(c.cn)
c.cn = nil
return err
}
func (c *PubSub) Close() error {
c.mu.Lock()
defer c.mu.Unlock()
if c.closed {
return pool.ErrClosed
}
c.closed = true
close(c.exit)
// Call cleanup callback if set
if c.onClose != nil {
c.onClose()
}
return c.closeTheCn(pool.ErrClosed)
}
// Subscribe the client to the specified channels. It returns
// empty subscription if there are no channels.
func (c *PubSub) Subscribe(ctx context.Context, channels ...string) error {
c.mu.Lock()
defer c.mu.Unlock()
err := c.subscribe(ctx, "subscribe", channels...)
if c.channels == nil {
c.channels = make(map[string]struct{})
}
for _, s := range channels {
c.channels[s] = struct{}{}
}
return err
}
// PSubscribe the client to the given patterns. It returns
// empty subscription if there are no patterns.
func (c *PubSub) PSubscribe(ctx context.Context, patterns ...string) error {
c.mu.Lock()
defer c.mu.Unlock()
err := c.subscribe(ctx, "psubscribe", patterns...)
if c.patterns == nil {
c.patterns = make(map[string]struct{})
}
for _, s := range patterns {
c.patterns[s] = struct{}{}
}
return err
}
// SSubscribe Subscribes the client to the specified shard channels.
func (c *PubSub) SSubscribe(ctx context.Context, channels ...string) error {
c.mu.Lock()
defer c.mu.Unlock()
err := c.subscribe(ctx, "ssubscribe", channels...)
if c.schannels == nil {
c.schannels = make(map[string]struct{})
}
for _, s := range channels {
c.schannels[s] = struct{}{}
}
return err
}
// Unsubscribe the client from the given channels, or from all of
// them if none is given.
func (c *PubSub) Unsubscribe(ctx context.Context, channels ...string) error {
c.mu.Lock()
defer c.mu.Unlock()
if len(channels) > 0 {
for _, channel := range channels {
delete(c.channels, channel)
}
} else {
// Unsubscribe from all channels.
for channel := range c.channels {
delete(c.channels, channel)
}
}
err := c.subscribe(ctx, "unsubscribe", channels...)
return err
}
// PUnsubscribe the client from the given patterns, or from all of
// them if none is given.
func (c *PubSub) PUnsubscribe(ctx context.Context, patterns ...string) error {
c.mu.Lock()
defer c.mu.Unlock()
if len(patterns) > 0 {
for _, pattern := range patterns {
delete(c.patterns, pattern)
}
} else {
// Unsubscribe from all patterns.
for pattern := range c.patterns {
delete(c.patterns, pattern)
}
}
err := c.subscribe(ctx, "punsubscribe", patterns...)
return err
}
// SUnsubscribe unsubscribes the client from the given shard channels,
// or from all of them if none is given.
func (c *PubSub) SUnsubscribe(ctx context.Context, channels ...string) error {
c.mu.Lock()
defer c.mu.Unlock()
if len(channels) > 0 {
for _, channel := range channels {
delete(c.schannels, channel)
}
} else {
// Unsubscribe from all channels.
for channel := range c.schannels {
delete(c.schannels, channel)
}
}
err := c.subscribe(ctx, "sunsubscribe", channels...)
return err
}
func (c *PubSub) subscribe(ctx context.Context, redisCmd string, channels ...string) error {
cn, err := c.conn(ctx, channels)
if err != nil {
return err
}
err = c._subscribe(ctx, cn, redisCmd, channels)
c.releaseConn(ctx, cn, err, false)
return err
}
func (c *PubSub) Ping(ctx context.Context, payload ...string) error {
args := []interface{}{"ping"}
if len(payload) == 1 {
args = append(args, payload[0])
}
cmd := NewCmd(ctx, args...)
c.mu.Lock()
defer c.mu.Unlock()
cn, err := c.conn(ctx, nil)
if err != nil {
return err
}
err = c.writeCmd(ctx, cn, cmd)
c.releaseConn(ctx, cn, err, false)
return err
}
// Subscription received after a successful subscription to channel.
type Subscription struct {
// Can be "subscribe", "unsubscribe", "psubscribe" or "punsubscribe".
Kind string
// Channel name we have subscribed to.
Channel string
// Number of channels we are currently subscribed to.
Count int
}
func (m *Subscription) String() string {
return fmt.Sprintf("%s: %s", m.Kind, m.Channel)
}
// Message received as result of a PUBLISH command issued by another client.
type Message struct {
Channel string
Pattern string
Payload string
PayloadSlice []string
}
func (m *Message) String() string {
return fmt.Sprintf("Message<%s: %s>", m.Channel, m.Payload)
}
// Pong received as result of a PING command issued by another client.
type Pong struct {
Payload string
}
func (p *Pong) String() string {
if p.Payload != "" {
return fmt.Sprintf("Pong<%s>", p.Payload)
}
return "Pong"
}
func (c *PubSub) newMessage(ctx context.Context, cn *pool.Conn, reply interface{}) (interface{}, error) {
switch reply := reply.(type) {
case string:
return &Pong{
Payload: reply,
}, nil
case []interface{}:
switch kind := reply[0].(string); kind {
case "subscribe", "unsubscribe", "psubscribe", "punsubscribe", "ssubscribe", "sunsubscribe":
// Can be nil in case of "unsubscribe".
channel, _ := reply[1].(string)
return &Subscription{
Kind: kind,
Channel: channel,
Count: int(reply[2].(int64)),
}, nil
case "message", "smessage":
channel := reply[1].(string)
sharded := kind == "smessage"
switch payload := reply[2].(type) {
case string:
msg := &Message{
Channel: channel,
Payload: payload,
}
// Record PubSub message received
otel.RecordPubSubMessage(ctx, cn, "received", channel, sharded)
return msg, nil
case []interface{}:
ss := make([]string, len(payload))
for i, s := range payload {
ss[i] = s.(string)
}
msg := &Message{
Channel: channel,
PayloadSlice: ss,
}
// Record PubSub message received
otel.RecordPubSubMessage(ctx, cn, "received", channel, sharded)
return msg, nil
default:
return nil, fmt.Errorf("redis: unsupported pubsub message payload: %T", payload)
}
case "pmessage":
channel := reply[2].(string)
msg := &Message{
Pattern: reply[1].(string),
Channel: channel,
Payload: reply[3].(string),
}
// Record PubSub message received (pattern message, not sharded)
otel.RecordPubSubMessage(ctx, cn, "received", channel, false)
return msg, nil
case "pong":
return &Pong{
Payload: reply[1].(string),
}, nil
default:
return nil, fmt.Errorf("redis: unsupported pubsub message: %q", kind)
}
default:
return nil, fmt.Errorf("redis: unsupported pubsub message: %#v", reply)
}
}
// ReceiveTimeout acts like Receive but returns an error if message
// is not received in time. This is low-level API and in most cases
// Channel should be used instead.
func (c *PubSub) ReceiveTimeout(ctx context.Context, timeout time.Duration) (interface{}, error) {
if c.cmd == nil {
c.cmd = NewCmd(ctx)
}
// Don't hold the lock to allow subscriptions and pings.
cn, err := c.connWithLock(ctx)
if err != nil {
return nil, err
}
err = cn.WithReader(ctx, timeout, func(rd *proto.Reader) error {
// To be sure there are no buffered push notifications, we process them before reading the reply
if err := c.processPendingPushNotificationWithReader(ctx, cn, rd); err != nil {
// Log the error but don't fail the command execution
// Push notification processing errors shouldn't break normal Redis operations
internal.Logger.Printf(ctx, "push: conn[%d] error processing pending notifications before reading reply: %v", cn.GetID(), err)
}
return c.cmd.readReply(rd)
})
c.releaseConnWithLock(ctx, cn, err, timeout > 0)
if err != nil {
return nil, err
}
return c.newMessage(ctx, cn, c.cmd.Val())
}
// Receive returns a message as a Subscription, Message, Pong or error.
// See PubSub example for details. This is low-level API and in most cases
// Channel should be used instead.
// Receive returns a message as a Subscription, Message, Pong, or an error.
// See PubSub example for details. This is a low-level API and in most cases
// Channel should be used instead.
// This method blocks until a message is received or an error occurs.
// It may return early with an error if the context is canceled, the connection fails,
// or other internal errors occur.
func (c *PubSub) Receive(ctx context.Context) (interface{}, error) {
return c.ReceiveTimeout(ctx, 0)
}
// ReceiveMessage returns a Message or error ignoring Subscription and Pong
// messages. This is low-level API and in most cases Channel should be used
// instead.
func (c *PubSub) ReceiveMessage(ctx context.Context) (*Message, error) {
for {
msg, err := c.Receive(ctx)
if err != nil {
return nil, err
}
switch msg := msg.(type) {
case *Subscription:
// Ignore.
case *Pong:
// Ignore.
case *Message:
return msg, nil
default:
err := fmt.Errorf("redis: unknown message: %T", msg)
return nil, err
}
}
}
func (c *PubSub) getContext() context.Context {
if c.cmd != nil {
return c.cmd.ctx
}
return context.Background()
}
//------------------------------------------------------------------------------
// Channel returns a Go channel for concurrently receiving messages.
// The channel is closed together with the PubSub. If the Go channel
// is blocked full for 1 minute the message is dropped.
// Receive* APIs can not be used after channel is created.
//
// go-redis periodically sends ping messages to test connection health
// and re-subscribes if ping can not received for 1 minute.
func (c *PubSub) Channel(opts ...ChannelOption) <-chan *Message {
c.chOnce.Do(func() {
c.msgCh = newChannel(c, opts...)
c.msgCh.initMsgChan()
})
if c.msgCh == nil {
err := fmt.Errorf("redis: Channel can't be called after ChannelWithSubscriptions")
panic(err)
}
return c.msgCh.msgCh
}
// ChannelSize is like Channel, but creates a Go channel
// with specified buffer size.
//
// Deprecated: use Channel(WithChannelSize(size)), remove in v9.
func (c *PubSub) ChannelSize(size int) <-chan *Message {
return c.Channel(WithChannelSize(size))
}
// ChannelWithSubscriptions is like Channel, but message type can be either
// *Subscription or *Message. Subscription messages can be used to detect
// reconnections.
//
// ChannelWithSubscriptions can not be used together with Channel or ChannelSize.
func (c *PubSub) ChannelWithSubscriptions(opts ...ChannelOption) <-chan interface{} {
c.chOnce.Do(func() {
c.allCh = newChannel(c, opts...)
c.allCh.initAllChan()
})
if c.allCh == nil {
err := fmt.Errorf("redis: ChannelWithSubscriptions can't be called after Channel")
panic(err)
}
return c.allCh.allCh
}
func (c *PubSub) processPendingPushNotificationWithReader(ctx context.Context, cn *pool.Conn, rd *proto.Reader) error {
// Only process push notifications for RESP3 connections with a processor
if c.opt.Protocol != 3 || c.pushProcessor == nil {
return nil
}
// Create handler context with client, connection pool, and connection information
handlerCtx := c.pushNotificationHandlerContext(cn)
return c.pushProcessor.ProcessPendingNotifications(ctx, handlerCtx, rd)
}
func (c *PubSub) pushNotificationHandlerContext(cn *pool.Conn) push.NotificationHandlerContext {
// PubSub doesn't have a client or connection pool, so we pass nil for those
// PubSub connections are blocking
return push.NotificationHandlerContext{
PubSub: c,
Conn: cn,
IsBlocking: true,
}
}
type ChannelOption func(c *channel)
// WithChannelSize specifies the Go chan size that is used to buffer incoming messages.
//
// The default is 100 messages.
func WithChannelSize(size int) ChannelOption {
return func(c *channel) {
c.chanSize = size
}
}
// WithChannelHealthCheckInterval specifies the health check interval.
// PubSub will ping Redis Server if it does not receive any messages within the interval.
// To disable health check, use zero interval.
//
// The default is 3 seconds.
func WithChannelHealthCheckInterval(d time.Duration) ChannelOption {
return func(c *channel) {
c.checkInterval = d
}
}
// WithChannelSendTimeout specifies the channel send timeout after which
// the message is dropped.
//
// The default is 60 seconds.
func WithChannelSendTimeout(d time.Duration) ChannelOption {
return func(c *channel) {
c.chanSendTimeout = d
}
}
type channel struct {
pubSub *PubSub
msgCh chan *Message
allCh chan interface{}
ping chan struct{}
chanSize int
chanSendTimeout time.Duration
checkInterval time.Duration
}
func newChannel(pubSub *PubSub, opts ...ChannelOption) *channel {
c := &channel{
pubSub: pubSub,
chanSize: 100,
chanSendTimeout: time.Minute,
checkInterval: 3 * time.Second,
}
for _, opt := range opts {
opt(c)
}
if c.checkInterval > 0 {
c.initHealthCheck()
}
return c
}
func (c *channel) initHealthCheck() {
ctx := context.TODO()
c.ping = make(chan struct{}, 1)
go func() {
timer := time.NewTimer(time.Minute)
timer.Stop()
for {
timer.Reset(c.checkInterval)
select {
case <-c.ping:
if !timer.Stop() {
<-timer.C
}
case <-timer.C:
if pingErr := c.pubSub.Ping(ctx); pingErr != nil {
c.pubSub.mu.Lock()
c.pubSub.reconnect(ctx, pingErr)
c.pubSub.mu.Unlock()
}
case <-c.pubSub.exit:
return
}
}
}()
}
// initMsgChan must be in sync with initAllChan.
func (c *channel) initMsgChan() {
ctx := context.TODO()
c.msgCh = make(chan *Message, c.chanSize)
go func() {
timer := time.NewTimer(time.Minute)
timer.Stop()
var errCount int
for {
msg, err := c.pubSub.Receive(ctx)
if err != nil {
if err == pool.ErrClosed {
close(c.msgCh)
return
}
if errCount > 0 {
time.Sleep(100 * time.Millisecond)
}
errCount++
continue
}
errCount = 0
// Any message is as good as a ping.
select {
case c.ping <- struct{}{}:
default:
}
switch msg := msg.(type) {
case *Subscription:
// Ignore.
case *Pong:
// Ignore.
case *Message:
timer.Reset(c.chanSendTimeout)
select {
case c.msgCh <- msg:
if !timer.Stop() {
<-timer.C
}
case <-timer.C:
internal.Logger.Printf(
ctx, "redis: %v channel is full for %s (message is dropped)",
c, c.chanSendTimeout)
}
default:
internal.Logger.Printf(ctx, "redis: unknown message type: %T", msg)
}
}
}()
}
// initAllChan must be in sync with initMsgChan.
func (c *channel) initAllChan() {
ctx := context.TODO()
c.allCh = make(chan interface{}, c.chanSize)
go func() {
timer := time.NewTimer(time.Minute)
timer.Stop()
var errCount int
for {
msg, err := c.pubSub.Receive(ctx)
if err != nil {
if err == pool.ErrClosed {
close(c.allCh)
return
}
if errCount > 0 {
time.Sleep(100 * time.Millisecond)
}
errCount++
continue
}
errCount = 0
// Any message is as good as a ping.
select {
case c.ping <- struct{}{}:
default:
}
switch msg := msg.(type) {
case *Pong:
// Ignore.
case *Subscription, *Message:
timer.Reset(c.chanSendTimeout)
select {
case c.allCh <- msg:
if !timer.Stop() {
<-timer.C
}
case <-timer.C:
internal.Logger.Printf(
ctx, "redis: %v channel is full for %s (message is dropped)",
c, c.chanSendTimeout)
}
default:
internal.Logger.Printf(ctx, "redis: unknown message type: %T", msg)
}
}
}()
}
package redis
import (
"context"
"github.com/redis/go-redis/v9/internal/otel"
)
type PubSubCmdable interface {
Publish(ctx context.Context, channel string, message interface{}) *IntCmd
SPublish(ctx context.Context, channel string, message interface{}) *IntCmd
PubSubChannels(ctx context.Context, pattern string) *StringSliceCmd
PubSubNumSub(ctx context.Context, channels ...string) *MapStringIntCmd
PubSubNumPat(ctx context.Context) *IntCmd
PubSubShardChannels(ctx context.Context, pattern string) *StringSliceCmd
PubSubShardNumSub(ctx context.Context, channels ...string) *MapStringIntCmd
}
// Publish posts the message to the channel.
func (c cmdable) Publish(ctx context.Context, channel string, message interface{}) *IntCmd {
cmd := NewIntCmd(ctx, "publish", channel, message)
_ = c(ctx, cmd)
// Record PubSub message sent (if command succeeded)
if cmd.Err() == nil {
otel.RecordPubSubMessage(ctx, nil, "sent", channel, false)
}
return cmd
}
func (c cmdable) SPublish(ctx context.Context, channel string, message interface{}) *IntCmd {
cmd := NewIntCmd(ctx, "spublish", channel, message)
_ = c(ctx, cmd)
// Record PubSub message sent (if command succeeded)
if cmd.Err() == nil {
otel.RecordPubSubMessage(ctx, nil, "sent", channel, true)
}
return cmd
}
func (c cmdable) PubSubChannels(ctx context.Context, pattern string) *StringSliceCmd {
args := []interface{}{"pubsub", "channels"}
if pattern != "*" {
args = append(args, pattern)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PubSubNumSub(ctx context.Context, channels ...string) *MapStringIntCmd {
args := make([]interface{}, 2+len(channels))
args[0] = "pubsub"
args[1] = "numsub"
for i, channel := range channels {
args[2+i] = channel
}
cmd := NewMapStringIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PubSubShardChannels(ctx context.Context, pattern string) *StringSliceCmd {
args := []interface{}{"pubsub", "shardchannels"}
if pattern != "*" {
args = append(args, pattern)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PubSubShardNumSub(ctx context.Context, channels ...string) *MapStringIntCmd {
args := make([]interface{}, 2+len(channels))
args[0] = "pubsub"
args[1] = "shardnumsub"
for i, channel := range channels {
args[2+i] = channel
}
cmd := NewMapStringIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) PubSubNumPat(ctx context.Context) *IntCmd {
cmd := NewIntCmd(ctx, "pubsub", "numpat")
_ = c(ctx, cmd)
return cmd
}
package push
import (
"errors"
"fmt"
)
// Push notification error definitions
// This file contains all error types and messages used by the push notification system
// Error reason constants
const (
// HandlerReasons
ReasonHandlerNil = "handler cannot be nil"
ReasonHandlerExists = "cannot overwrite existing handler"
ReasonHandlerProtected = "handler is protected"
// ProcessorReasons
ReasonPushNotificationsDisabled = "push notifications are disabled"
)
// ProcessorType represents the type of processor involved in the error
// defined as a custom type for better readability and easier maintenance
type ProcessorType string
const (
// ProcessorTypes
ProcessorTypeProcessor = ProcessorType("processor")
ProcessorTypeVoidProcessor = ProcessorType("void_processor")
ProcessorTypeCustom = ProcessorType("custom")
)
// ProcessorOperation represents the operation being performed by the processor
// defined as a custom type for better readability and easier maintenance
type ProcessorOperation string
const (
// ProcessorOperations
ProcessorOperationProcess = ProcessorOperation("process")
ProcessorOperationRegister = ProcessorOperation("register")
ProcessorOperationUnregister = ProcessorOperation("unregister")
ProcessorOperationUnknown = ProcessorOperation("unknown")
)
// Common error variables for reuse
var (
// ErrHandlerNil is returned when attempting to register a nil handler
ErrHandlerNil = errors.New(ReasonHandlerNil)
)
// Registry errors
// ErrHandlerExists creates an error for when attempting to overwrite an existing handler
func ErrHandlerExists(pushNotificationName string) error {
return NewHandlerError(ProcessorOperationRegister, pushNotificationName, ReasonHandlerExists, nil)
}
// ErrProtectedHandler creates an error for when attempting to unregister a protected handler
func ErrProtectedHandler(pushNotificationName string) error {
return NewHandlerError(ProcessorOperationUnregister, pushNotificationName, ReasonHandlerProtected, nil)
}
// VoidProcessor errors
// ErrVoidProcessorRegister creates an error for when attempting to register a handler on void processor
func ErrVoidProcessorRegister(pushNotificationName string) error {
return NewProcessorError(ProcessorTypeVoidProcessor, ProcessorOperationRegister, pushNotificationName, ReasonPushNotificationsDisabled, nil)
}
// ErrVoidProcessorUnregister creates an error for when attempting to unregister a handler on void processor
func ErrVoidProcessorUnregister(pushNotificationName string) error {
return NewProcessorError(ProcessorTypeVoidProcessor, ProcessorOperationUnregister, pushNotificationName, ReasonPushNotificationsDisabled, nil)
}
// Error type definitions for advanced error handling
// HandlerError represents errors related to handler operations
type HandlerError struct {
Operation ProcessorOperation
PushNotificationName string
Reason string
Err error
}
func (e *HandlerError) Error() string {
if e.Err != nil {
return fmt.Sprintf("handler %s failed for '%s': %s (%v)", e.Operation, e.PushNotificationName, e.Reason, e.Err)
}
return fmt.Sprintf("handler %s failed for '%s': %s", e.Operation, e.PushNotificationName, e.Reason)
}
func (e *HandlerError) Unwrap() error {
return e.Err
}
// NewHandlerError creates a new HandlerError
func NewHandlerError(operation ProcessorOperation, pushNotificationName, reason string, err error) *HandlerError {
return &HandlerError{
Operation: operation,
PushNotificationName: pushNotificationName,
Reason: reason,
Err: err,
}
}
// ProcessorError represents errors related to processor operations
type ProcessorError struct {
ProcessorType ProcessorType // "processor", "void_processor"
Operation ProcessorOperation // "process", "register", "unregister"
PushNotificationName string // Name of the push notification involved
Reason string
Err error
}
func (e *ProcessorError) Error() string {
notifInfo := ""
if e.PushNotificationName != "" {
notifInfo = fmt.Sprintf(" for '%s'", e.PushNotificationName)
}
if e.Err != nil {
return fmt.Sprintf("%s %s failed%s: %s (%v)", e.ProcessorType, e.Operation, notifInfo, e.Reason, e.Err)
}
return fmt.Sprintf("%s %s failed%s: %s", e.ProcessorType, e.Operation, notifInfo, e.Reason)
}
func (e *ProcessorError) Unwrap() error {
return e.Err
}
// NewProcessorError creates a new ProcessorError
func NewProcessorError(processorType ProcessorType, operation ProcessorOperation, pushNotificationName, reason string, err error) *ProcessorError {
return &ProcessorError{
ProcessorType: processorType,
Operation: operation,
PushNotificationName: pushNotificationName,
Reason: reason,
Err: err,
}
}
// Helper functions for common error scenarios
// IsHandlerNilError checks if an error is due to a nil handler
func IsHandlerNilError(err error) bool {
return errors.Is(err, ErrHandlerNil)
}
// IsHandlerExistsError checks if an error is due to attempting to overwrite an existing handler.
// This function works correctly even when the error is wrapped.
func IsHandlerExistsError(err error) bool {
var handlerErr *HandlerError
if errors.As(err, &handlerErr) {
return handlerErr.Operation == ProcessorOperationRegister && handlerErr.Reason == ReasonHandlerExists
}
return false
}
// IsProtectedHandlerError checks if an error is due to attempting to unregister a protected handler.
// This function works correctly even when the error is wrapped.
func IsProtectedHandlerError(err error) bool {
var handlerErr *HandlerError
if errors.As(err, &handlerErr) {
return handlerErr.Operation == ProcessorOperationUnregister && handlerErr.Reason == ReasonHandlerProtected
}
return false
}
// IsVoidProcessorError checks if an error is due to void processor operations.
// This function works correctly even when the error is wrapped.
func IsVoidProcessorError(err error) bool {
var procErr *ProcessorError
if errors.As(err, &procErr) {
return procErr.ProcessorType == ProcessorTypeVoidProcessor && procErr.Reason == ReasonPushNotificationsDisabled
}
return false
}
package push
import (
"context"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/proto"
)
// NotificationProcessor defines the interface for push notification processors.
type NotificationProcessor interface {
// GetHandler returns the handler for a specific push notification name.
GetHandler(pushNotificationName string) NotificationHandler
// ProcessPendingNotifications checks for and processes any pending push notifications.
// To be used when it is known that there are notifications on the socket.
// It will try to read from the socket and if it is empty - it may block.
ProcessPendingNotifications(ctx context.Context, handlerCtx NotificationHandlerContext, rd *proto.Reader) error
// RegisterHandler registers a handler for a specific push notification name.
RegisterHandler(pushNotificationName string, handler NotificationHandler, protected bool) error
// UnregisterHandler removes a handler for a specific push notification name.
UnregisterHandler(pushNotificationName string) error
}
// Processor handles push notifications with a registry of handlers
type Processor struct {
registry *Registry
}
// NewProcessor creates a new push notification processor
func NewProcessor() *Processor {
return &Processor{
registry: NewRegistry(),
}
}
// GetHandler returns the handler for a specific push notification name
func (p *Processor) GetHandler(pushNotificationName string) NotificationHandler {
return p.registry.GetHandler(pushNotificationName)
}
// RegisterHandler registers a handler for a specific push notification name
func (p *Processor) RegisterHandler(pushNotificationName string, handler NotificationHandler, protected bool) error {
return p.registry.RegisterHandler(pushNotificationName, handler, protected)
}
// UnregisterHandler removes a handler for a specific push notification name
func (p *Processor) UnregisterHandler(pushNotificationName string) error {
return p.registry.UnregisterHandler(pushNotificationName)
}
// ProcessPendingNotifications checks for and processes any pending push notifications
// This method should be called by the client in WithReader before reading the reply
// It will try to read from the socket and if it is empty - it may block.
func (p *Processor) ProcessPendingNotifications(ctx context.Context, handlerCtx NotificationHandlerContext, rd *proto.Reader) error {
if rd == nil {
return nil
}
for {
// Check if there's data available to read
replyType, err := rd.PeekReplyType()
if err != nil {
// No more data available or error reading
// if timeout, it will be handled by the caller
break
}
// Only process push notifications (arrays starting with >)
if replyType != proto.RespPush {
break
}
// see if we should skip this notification
notificationName, err := rd.PeekPushNotificationName()
if err != nil {
break
}
if willHandleNotificationInClient(notificationName) {
break
}
// Read the push notification
reply, err := rd.ReadReply()
if err != nil {
internal.Logger.Printf(ctx, "push: error reading push notification: %v", err)
break
}
// Convert to slice of interfaces
notification, ok := reply.([]interface{})
if !ok {
break
}
// Handle the notification directly
if len(notification) > 0 {
// Extract the notification type (first element)
if notificationType, ok := notification[0].(string); ok {
// Get the handler for this notification type
if handler := p.registry.GetHandler(notificationType); handler != nil {
// Handle the notification
err := handler.HandlePushNotification(ctx, handlerCtx, notification)
if err != nil {
internal.Logger.Printf(ctx, "push: error handling push notification: %v", err)
}
}
}
}
}
return nil
}
// VoidProcessor discards all push notifications without processing them
type VoidProcessor struct{}
// NewVoidProcessor creates a new void push notification processor
func NewVoidProcessor() *VoidProcessor {
return &VoidProcessor{}
}
// GetHandler returns nil for void processor since it doesn't maintain handlers
func (v *VoidProcessor) GetHandler(_ string) NotificationHandler {
return nil
}
// RegisterHandler returns an error for void processor since it doesn't maintain handlers
func (v *VoidProcessor) RegisterHandler(pushNotificationName string, _ NotificationHandler, _ bool) error {
return ErrVoidProcessorRegister(pushNotificationName)
}
// UnregisterHandler returns an error for void processor since it doesn't maintain handlers
func (v *VoidProcessor) UnregisterHandler(pushNotificationName string) error {
return ErrVoidProcessorUnregister(pushNotificationName)
}
// ProcessPendingNotifications for VoidProcessor does nothing since push notifications
// are only available in RESP3 and this processor is used for RESP2 connections.
// This avoids unnecessary buffer scanning overhead.
// It does however read and discard all push notifications from the buffer to avoid
// them being interpreted as a reply.
// This method should be called by the client in WithReader before reading the reply
// to be sure there are no buffered push notifications.
// It will try to read from the socket and if it is empty - it may block.
func (v *VoidProcessor) ProcessPendingNotifications(_ context.Context, handlerCtx NotificationHandlerContext, rd *proto.Reader) error {
// read and discard all push notifications
if rd == nil {
return nil
}
for {
// Check if there's data available to read
replyType, err := rd.PeekReplyType()
if err != nil {
// No more data available or error reading
// if timeout, it will be handled by the caller
break
}
// Only process push notifications (arrays starting with >)
if replyType != proto.RespPush {
break
}
// see if we should skip this notification
notificationName, err := rd.PeekPushNotificationName()
if err != nil {
break
}
if willHandleNotificationInClient(notificationName) {
break
}
// Read the push notification
_, err = rd.ReadReply()
if err != nil {
internal.Logger.Printf(context.Background(), "push: error reading push notification: %v", err)
return nil
}
}
return nil
}
// willHandleNotificationInClient checks if a notification type should be ignored by the push notification
// processor and handled by other specialized systems instead (pub/sub, streams, keyspace, etc.).
func willHandleNotificationInClient(notificationType string) bool {
switch notificationType {
// Pub/Sub notifications - handled by pub/sub system
case "message", // Regular pub/sub message
"pmessage", // Pattern pub/sub message
"subscribe", // Subscription confirmation
"unsubscribe", // Unsubscription confirmation
"psubscribe", // Pattern subscription confirmation
"punsubscribe", // Pattern unsubscription confirmation
"smessage", // Sharded pub/sub message (Redis 7.0+)
"ssubscribe", // Sharded subscription confirmation
"sunsubscribe": // Sharded unsubscription confirmation
return true
default:
return false
}
}
package push
import (
"sync"
)
// Registry manages push notification handlers
type Registry struct {
mu sync.RWMutex
handlers map[string]NotificationHandler
protected map[string]bool
}
// NewRegistry creates a new push notification registry
func NewRegistry() *Registry {
return &Registry{
handlers: make(map[string]NotificationHandler),
protected: make(map[string]bool),
}
}
// RegisterHandler registers a handler for a specific push notification name
func (r *Registry) RegisterHandler(pushNotificationName string, handler NotificationHandler, protected bool) error {
if handler == nil {
return ErrHandlerNil
}
r.mu.Lock()
defer r.mu.Unlock()
// Check if handler already exists
if _, exists := r.protected[pushNotificationName]; exists {
return ErrHandlerExists(pushNotificationName)
}
r.handlers[pushNotificationName] = handler
r.protected[pushNotificationName] = protected
return nil
}
// GetHandler returns the handler for a specific push notification name
func (r *Registry) GetHandler(pushNotificationName string) NotificationHandler {
r.mu.RLock()
defer r.mu.RUnlock()
return r.handlers[pushNotificationName]
}
// UnregisterHandler removes a handler for a specific push notification name
func (r *Registry) UnregisterHandler(pushNotificationName string) error {
r.mu.Lock()
defer r.mu.Unlock()
// Check if handler is protected
if protected, exists := r.protected[pushNotificationName]; exists && protected {
return ErrProtectedHandler(pushNotificationName)
}
delete(r.handlers, pushNotificationName)
delete(r.protected, pushNotificationName)
return nil
}
package redis
import (
"github.com/redis/go-redis/v9/push"
)
// NewPushNotificationProcessor creates a new push notification processor
// This processor maintains a registry of handlers and processes push notifications
// It is used for RESP3 connections where push notifications are available
func NewPushNotificationProcessor() push.NotificationProcessor {
return push.NewProcessor()
}
// NewVoidPushNotificationProcessor creates a new void push notification processor
// This processor does not maintain any handlers and always returns nil for all operations
// It is used for RESP2 connections where push notifications are not available
// It can also be used to disable push notifications for RESP3 connections, where
// it will discard all push notifications without processing them
func NewVoidPushNotificationProcessor() push.NotificationProcessor {
return push.NewVoidProcessor()
}
package redis
import (
"context"
"errors"
"fmt"
"net"
"sync"
"sync/atomic"
"time"
"github.com/redis/go-redis/v9/auth"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/auth/streaming"
"github.com/redis/go-redis/v9/internal/hscan"
"github.com/redis/go-redis/v9/internal/otel"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/internal/proto"
"github.com/redis/go-redis/v9/maintnotifications"
"github.com/redis/go-redis/v9/push"
)
// Scanner internal/hscan.Scanner exposed interface.
type Scanner = hscan.Scanner
// Nil reply returned by Redis when key does not exist.
const Nil = proto.Nil
// SetLogger set custom log
// Use with VoidLogger to disable logging.
// If logger is nil, the call is ignored and the existing logger is kept.
func SetLogger(logger internal.Logging) {
if logger == nil {
return
}
internal.Logger = logger
}
// SetLogLevel sets the log level for the library.
func SetLogLevel(logLevel internal.LogLevelT) {
internal.LogLevel = logLevel
}
//------------------------------------------------------------------------------
type Hook interface {
DialHook(next DialHook) DialHook
ProcessHook(next ProcessHook) ProcessHook
ProcessPipelineHook(next ProcessPipelineHook) ProcessPipelineHook
}
type (
DialHook func(ctx context.Context, network, addr string) (net.Conn, error)
ProcessHook func(ctx context.Context, cmd Cmder) error
ProcessPipelineHook func(ctx context.Context, cmds []Cmder) error
)
type hooksMixin struct {
hooksMu *sync.RWMutex
slice []Hook
initial hooks
current hooks
}
func (hs *hooksMixin) initHooks(hooks hooks) {
hs.hooksMu = new(sync.RWMutex)
hs.initial = hooks
hs.chain()
}
type hooks struct {
dial DialHook
process ProcessHook
pipeline ProcessPipelineHook
txPipeline ProcessPipelineHook
}
func (h *hooks) setDefaults() {
if h.dial == nil {
h.dial = func(ctx context.Context, network, addr string) (net.Conn, error) { return nil, nil }
}
if h.process == nil {
h.process = func(ctx context.Context, cmd Cmder) error { return nil }
}
if h.pipeline == nil {
h.pipeline = func(ctx context.Context, cmds []Cmder) error { return nil }
}
if h.txPipeline == nil {
h.txPipeline = func(ctx context.Context, cmds []Cmder) error { return nil }
}
}
// AddHook is to add a hook to the queue.
// Hook is a function executed during network connection, command execution, and pipeline,
// it is a first-in-first-out stack queue (FIFO).
// You need to execute the next hook in each hook, unless you want to terminate the execution of the command.
// For example, you added hook-1, hook-2:
//
// client.AddHook(hook-1, hook-2)
//
// hook-1:
//
// func (Hook1) ProcessHook(next redis.ProcessHook) redis.ProcessHook {
// return func(ctx context.Context, cmd Cmder) error {
// print("hook-1 start")
// next(ctx, cmd)
// print("hook-1 end")
// return nil
// }
// }
//
// hook-2:
//
// func (Hook2) ProcessHook(next redis.ProcessHook) redis.ProcessHook {
// return func(ctx context.Context, cmd redis.Cmder) error {
// print("hook-2 start")
// next(ctx, cmd)
// print("hook-2 end")
// return nil
// }
// }
//
// The execution sequence is:
//
// hook-1 start -> hook-2 start -> exec redis cmd -> hook-2 end -> hook-1 end
//
// Please note: "next(ctx, cmd)" is very important, it will call the next hook,
// if "next(ctx, cmd)" is not executed, the redis command will not be executed.
func (hs *hooksMixin) AddHook(hook Hook) {
hs.slice = append(hs.slice, hook)
hs.chain()
}
func (hs *hooksMixin) chain() {
hs.initial.setDefaults()
hs.hooksMu.Lock()
defer hs.hooksMu.Unlock()
hs.current.dial = hs.initial.dial
hs.current.process = hs.initial.process
hs.current.pipeline = hs.initial.pipeline
hs.current.txPipeline = hs.initial.txPipeline
for i := len(hs.slice) - 1; i >= 0; i-- {
if wrapped := hs.slice[i].DialHook(hs.current.dial); wrapped != nil {
hs.current.dial = wrapped
}
if wrapped := hs.slice[i].ProcessHook(hs.current.process); wrapped != nil {
hs.current.process = wrapped
}
if wrapped := hs.slice[i].ProcessPipelineHook(hs.current.pipeline); wrapped != nil {
hs.current.pipeline = wrapped
}
if wrapped := hs.slice[i].ProcessPipelineHook(hs.current.txPipeline); wrapped != nil {
hs.current.txPipeline = wrapped
}
}
}
func (hs *hooksMixin) clone() hooksMixin {
hs.hooksMu.Lock()
defer hs.hooksMu.Unlock()
clone := *hs
l := len(clone.slice)
clone.slice = clone.slice[:l:l]
clone.hooksMu = new(sync.RWMutex)
return clone
}
func (hs *hooksMixin) withProcessHook(ctx context.Context, cmd Cmder, hook ProcessHook) error {
for i := len(hs.slice) - 1; i >= 0; i-- {
if wrapped := hs.slice[i].ProcessHook(hook); wrapped != nil {
hook = wrapped
}
}
return hook(ctx, cmd)
}
func (hs *hooksMixin) withProcessPipelineHook(
ctx context.Context, cmds []Cmder, hook ProcessPipelineHook,
) error {
for i := len(hs.slice) - 1; i >= 0; i-- {
if wrapped := hs.slice[i].ProcessPipelineHook(hook); wrapped != nil {
hook = wrapped
}
}
return hook(ctx, cmds)
}
func (hs *hooksMixin) dialHook(ctx context.Context, network, addr string) (net.Conn, error) {
// Access to hs.current is guarded by a read-only lock since it may be mutated by AddHook(...)
// while this dialer is concurrently accessed by the background connection pool population
// routine when MinIdleConns > 0.
hs.hooksMu.RLock()
current := hs.current
hs.hooksMu.RUnlock()
return current.dial(ctx, network, addr)
}
func (hs *hooksMixin) processHook(ctx context.Context, cmd Cmder) error {
return hs.current.process(ctx, cmd)
}
func (hs *hooksMixin) processPipelineHook(ctx context.Context, cmds []Cmder) error {
return hs.current.pipeline(ctx, cmds)
}
func (hs *hooksMixin) processTxPipelineHook(ctx context.Context, cmds []Cmder) error {
return hs.current.txPipeline(ctx, cmds)
}
//------------------------------------------------------------------------------
type baseClient struct {
opt *Options
optLock sync.RWMutex
connPool pool.Pooler
pubSubPool *pool.PubSubPool
hooksMixin
onClose func() error // hook called when client is closed
// Push notification processing
pushProcessor push.NotificationProcessor
// Maintenance notifications manager
maintNotificationsManager *maintnotifications.Manager
maintNotificationsManagerLock sync.RWMutex
// streamingCredentialsManager is used to manage streaming credentials
streamingCredentialsManager *streaming.Manager
}
func (c *baseClient) clone() *baseClient {
c.maintNotificationsManagerLock.RLock()
maintNotificationsManager := c.maintNotificationsManager
c.maintNotificationsManagerLock.RUnlock()
clone := &baseClient{
opt: c.opt,
connPool: c.connPool,
pubSubPool: c.pubSubPool,
onClose: c.onClose,
pushProcessor: c.pushProcessor,
maintNotificationsManager: maintNotificationsManager,
streamingCredentialsManager: c.streamingCredentialsManager,
}
return clone
}
func (c *baseClient) withTimeout(timeout time.Duration) *baseClient {
opt := c.opt.clone()
opt.ReadTimeout = timeout
opt.WriteTimeout = timeout
clone := c.clone()
clone.opt = opt
return clone
}
func (c *baseClient) String() string {
return fmt.Sprintf("Redis<%s db:%d>", c.getAddr(), c.opt.DB)
}
func (c *baseClient) getConn(ctx context.Context) (*pool.Conn, error) {
if c.opt.Limiter != nil {
err := c.opt.Limiter.Allow()
if err != nil {
return nil, err
}
}
cn, err := c._getConn(ctx)
if err != nil {
if c.opt.Limiter != nil {
c.opt.Limiter.ReportResult(err)
}
return nil, err
}
return cn, nil
}
func (c *baseClient) _getConn(ctx context.Context) (*pool.Conn, error) {
cn, err := c.connPool.Get(ctx)
if err != nil {
return nil, err
}
if cn.IsInited() {
return cn, nil
}
if err := c.initConn(ctx, cn); err != nil {
c.connPool.Remove(ctx, cn, err)
if err := errors.Unwrap(err); err != nil {
return nil, err
}
return nil, err
}
if dialStartNs := cn.GetDialStartNs(); dialStartNs > 0 {
if cb := pool.GetMetricConnectionCreateTimeCallback(); cb != nil {
duration := time.Duration(time.Now().UnixNano() - dialStartNs)
cb(ctx, duration, cn)
}
}
// initConn will transition to IDLE state, so we need to acquire it
// before returning it to the user.
if !cn.TryAcquire() {
return nil, fmt.Errorf("redis: connection is not usable")
}
return cn, nil
}
func (c *baseClient) reAuthConnection() func(poolCn *pool.Conn, credentials auth.Credentials) error {
return func(poolCn *pool.Conn, credentials auth.Credentials) error {
var err error
username, password := credentials.BasicAuth()
// Use background context - timeout is handled by ReadTimeout in WithReader/WithWriter
ctx := context.Background()
connPool := pool.NewSingleConnPool(c.connPool, poolCn)
// Pass hooks so that reauth commands are recorded/traced
cn := newConn(c.opt, connPool, &c.hooksMixin)
if username != "" {
err = cn.AuthACL(ctx, username, password).Err()
} else {
err = cn.Auth(ctx, password).Err()
}
return err
}
}
func (c *baseClient) onAuthenticationErr() func(poolCn *pool.Conn, err error) {
return func(poolCn *pool.Conn, err error) {
if err != nil {
if isBadConn(err, false, c.opt.Addr) {
// Close the connection to force a reconnection.
err := c.connPool.CloseConn(poolCn)
if err != nil {
internal.Logger.Printf(context.Background(), "redis: failed to close connection: %v", err)
// try to close the network connection directly
// so that no resource is leaked
err := poolCn.Close()
if err != nil {
internal.Logger.Printf(context.Background(), "redis: failed to close network connection: %v", err)
}
}
}
internal.Logger.Printf(context.Background(), "redis: re-authentication failed: %v", err)
}
}
}
func (c *baseClient) wrappedOnClose(newOnClose func() error) func() error {
onClose := c.onClose
return func() error {
var firstErr error
err := newOnClose()
// Even if we have an error we would like to execute the onClose hook
// if it exists. We will return the first error that occurred.
// This is to keep error handling consistent with the rest of the code.
if err != nil {
firstErr = err
}
if onClose != nil {
err = onClose()
if err != nil && firstErr == nil {
firstErr = err
}
}
return firstErr
}
}
func (c *baseClient) initConn(ctx context.Context, cn *pool.Conn) error {
// This function is called in two scenarios:
// 1. First-time init: Connection is in CREATED state (from pool.Get())
// - We need to transition CREATED → INITIALIZING and do the initialization
// - If another goroutine is already initializing, we WAIT for it to finish
// 2. Re-initialization: Connection is in INITIALIZING state (from SetNetConnAndInitConn())
// - We're already in INITIALIZING, so just proceed with initialization
currentState := cn.GetStateMachine().GetState()
// Fast path: Check if already initialized (IDLE or IN_USE)
if currentState == pool.StateIdle || currentState == pool.StateInUse {
return nil
}
// If in CREATED state, try to transition to INITIALIZING
if currentState == pool.StateCreated {
finalState, err := cn.GetStateMachine().TryTransition([]pool.ConnState{pool.StateCreated}, pool.StateInitializing)
if err != nil {
// Another goroutine is initializing or connection is in unexpected state
// Check what state we're in now
if finalState == pool.StateIdle || finalState == pool.StateInUse {
// Already initialized by another goroutine
return nil
}
if finalState == pool.StateInitializing {
// Another goroutine is initializing - WAIT for it to complete
// Use a context with timeout = min(remaining command timeout, DialTimeout)
// This prevents waiting too long while respecting the caller's deadline
var waitCtx context.Context
var cancel context.CancelFunc
dialTimeout := c.opt.DialTimeout
if cmdDeadline, hasCmdDeadline := ctx.Deadline(); hasCmdDeadline {
// Calculate remaining time until command deadline
remainingTime := time.Until(cmdDeadline)
// Use the minimum of remaining time and DialTimeout
if remainingTime < dialTimeout {
// Command deadline is sooner, use it
waitCtx = ctx
} else {
// DialTimeout is shorter, cap the wait at DialTimeout
waitCtx, cancel = context.WithTimeout(ctx, dialTimeout)
}
} else {
// No command deadline, use DialTimeout to prevent waiting indefinitely
waitCtx, cancel = context.WithTimeout(ctx, dialTimeout)
}
if cancel != nil {
defer cancel()
}
finalState, err := cn.GetStateMachine().AwaitAndTransition(
waitCtx,
[]pool.ConnState{pool.StateIdle, pool.StateInUse},
pool.StateIdle, // Target is IDLE (but we're already there, so this is a no-op)
)
if err != nil {
return err
}
// Verify we're now initialized
if finalState == pool.StateIdle || finalState == pool.StateInUse {
return nil
}
// Unexpected state after waiting
return fmt.Errorf("connection in unexpected state after initialization: %s", finalState)
}
// Unexpected state (CLOSED, UNUSABLE, etc.)
return err
}
}
// At this point, we're in INITIALIZING state and we own the initialization
// If we fail, we must transition to CLOSED
var initErr error
connPool := pool.NewSingleConnPool(c.connPool, cn)
conn := newConn(c.opt, connPool, &c.hooksMixin)
username, password := "", ""
if c.opt.StreamingCredentialsProvider != nil {
credListener, initErr := c.streamingCredentialsManager.Listener(
cn,
c.reAuthConnection(),
c.onAuthenticationErr(),
)
if initErr != nil {
cn.GetStateMachine().Transition(pool.StateClosed)
return fmt.Errorf("failed to create credentials listener: %w", initErr)
}
credentials, unsubscribeFromCredentialsProvider, initErr := c.opt.StreamingCredentialsProvider.
Subscribe(credListener)
if initErr != nil {
cn.GetStateMachine().Transition(pool.StateClosed)
return fmt.Errorf("failed to subscribe to streaming credentials: %w", initErr)
}
c.onClose = c.wrappedOnClose(unsubscribeFromCredentialsProvider)
cn.SetOnClose(unsubscribeFromCredentialsProvider)
username, password = credentials.BasicAuth()
} else if c.opt.CredentialsProviderContext != nil {
username, password, initErr = c.opt.CredentialsProviderContext(ctx)
if initErr != nil {
cn.GetStateMachine().Transition(pool.StateClosed)
return fmt.Errorf("failed to get credentials from context provider: %w", initErr)
}
} else if c.opt.CredentialsProvider != nil {
username, password = c.opt.CredentialsProvider()
} else if c.opt.Username != "" || c.opt.Password != "" {
username, password = c.opt.Username, c.opt.Password
}
// for redis-server versions that do not support the HELLO command,
// RESP2 will continue to be used.
if initErr = conn.Hello(ctx, c.opt.Protocol, username, password, c.opt.ClientName).Err(); initErr == nil {
// Authentication successful with HELLO command
} else if !isRedisError(initErr) {
// When the server responds with the RESP protocol and the result is not a normal
// execution result of the HELLO command, we consider it to be an indication that
// the server does not support the HELLO command.
// The server may be a redis-server that does not support the HELLO command,
// or it could be DragonflyDB or a third-party redis-proxy. They all respond
// with different error string results for unsupported commands, making it
// difficult to rely on error strings to determine all results.
cn.GetStateMachine().Transition(pool.StateClosed)
return initErr
} else if password != "" {
// Try legacy AUTH command if HELLO failed
if username != "" {
initErr = conn.AuthACL(ctx, username, password).Err()
} else {
initErr = conn.Auth(ctx, password).Err()
}
if initErr != nil {
cn.GetStateMachine().Transition(pool.StateClosed)
return fmt.Errorf("failed to authenticate: %w", initErr)
}
}
_, initErr = conn.Pipelined(ctx, func(pipe Pipeliner) error {
if c.opt.DB > 0 {
pipe.Select(ctx, c.opt.DB)
}
if c.opt.readOnly {
pipe.ReadOnly(ctx)
}
if c.opt.ClientName != "" {
pipe.ClientSetName(ctx, c.opt.ClientName)
}
return nil
})
if initErr != nil {
cn.GetStateMachine().Transition(pool.StateClosed)
return fmt.Errorf("failed to initialize connection options: %w", initErr)
}
// Enable maintnotifications if maintnotifications are configured
c.optLock.RLock()
maintNotifEnabled := c.opt.MaintNotificationsConfig != nil && c.opt.MaintNotificationsConfig.Mode != maintnotifications.ModeDisabled
protocol := c.opt.Protocol
var endpointType maintnotifications.EndpointType
if maintNotifEnabled {
endpointType = c.opt.MaintNotificationsConfig.EndpointType
}
c.optLock.RUnlock()
var maintNotifHandshakeErr error
if maintNotifEnabled && protocol == 3 {
maintNotifHandshakeErr = conn.ClientMaintNotifications(
ctx,
true,
endpointType.String(),
).Err()
if maintNotifHandshakeErr != nil {
if !isRedisError(maintNotifHandshakeErr) {
// if not redis error, fail the connection
cn.GetStateMachine().Transition(pool.StateClosed)
return maintNotifHandshakeErr
}
c.optLock.Lock()
// handshake failed - check and modify config atomically
switch c.opt.MaintNotificationsConfig.Mode {
case maintnotifications.ModeEnabled:
// enabled mode, fail the connection
c.optLock.Unlock()
cn.GetStateMachine().Transition(pool.StateClosed)
// Record handshake failure metric
if errorCallback := pool.GetMetricErrorCallback(); errorCallback != nil {
errorCallback(ctx, "HANDSHAKE_FAILED", cn, "HANDSHAKE_FAILED", true, 0)
}
return fmt.Errorf("failed to enable maintnotifications: %w", maintNotifHandshakeErr)
default: // will handle auto and any other
// Disabling logging here as it's too noisy.
// TODO: Enable when we have a better logging solution for log levels
// internal.Logger.Printf(ctx, "auto mode fallback: maintnotifications disabled due to handshake error: %v", maintNotifHandshakeErr)
c.opt.MaintNotificationsConfig.Mode = maintnotifications.ModeDisabled
c.optLock.Unlock()
// auto mode, disable maintnotifications and continue
if initErr := c.disableMaintNotificationsUpgrades(); initErr != nil {
// Log error but continue - auto mode should be resilient
internal.Logger.Printf(ctx, "failed to disable maintnotifications in auto mode: %v", initErr)
}
}
} else {
// handshake was executed successfully
// to make sure that the handshake will be executed on other connections as well if it was successfully
// executed on this connection, we will force the handshake to be executed on all connections
c.optLock.Lock()
c.opt.MaintNotificationsConfig.Mode = maintnotifications.ModeEnabled
c.optLock.Unlock()
}
}
if !c.opt.DisableIdentity && !c.opt.DisableIndentity {
libName := ""
libVer := Version()
if c.opt.IdentitySuffix != "" {
libName = c.opt.IdentitySuffix
}
p := conn.Pipeline()
p.ClientSetInfo(ctx, WithLibraryName(libName))
p.ClientSetInfo(ctx, WithLibraryVersion(libVer))
// Handle network errors (e.g. timeouts) in CLIENT SETINFO to avoid
// out of order responses later on.
if _, initErr = p.Exec(ctx); initErr != nil && !isRedisError(initErr) {
cn.GetStateMachine().Transition(pool.StateClosed)
return initErr
}
}
// Set the connection initialization function for potential reconnections
// This must be set before transitioning to IDLE so that handoff/reauth can use it
cn.SetInitConnFunc(c.createInitConnFunc())
// Initialization succeeded - transition to IDLE state
// This marks the connection as initialized and ready for use
// NOTE: The connection is still owned by the calling goroutine at this point
// and won't be available to other goroutines until it's Put() back into the pool
cn.GetStateMachine().Transition(pool.StateIdle)
// Call OnConnect hook if configured
// The connection is in IDLE state but still owned by this goroutine
// If OnConnect needs to send commands, it can use the connection safely
if c.opt.OnConnect != nil {
if initErr = c.opt.OnConnect(ctx, conn); initErr != nil {
// OnConnect failed - transition to closed
cn.GetStateMachine().Transition(pool.StateClosed)
return initErr
}
}
return nil
}
func (c *baseClient) releaseConn(ctx context.Context, cn *pool.Conn, err error) {
if c.opt.Limiter != nil {
c.opt.Limiter.ReportResult(err)
}
if isBadConn(err, false, c.opt.Addr) {
c.connPool.Remove(ctx, cn, err)
} else {
// process any pending push notifications before returning the connection to the pool
if err := c.processPushNotifications(ctx, cn); err != nil {
internal.Logger.Printf(ctx, "push: error processing pending notifications before releasing connection: %v", err)
}
c.connPool.Put(ctx, cn)
}
}
func (c *baseClient) withConn(
ctx context.Context, fn func(context.Context, *pool.Conn) error,
) error {
cn, err := c.getConn(ctx)
if err != nil {
return err
}
var fnErr error
defer func() {
c.releaseConn(ctx, cn, fnErr)
}()
fnErr = fn(ctx, cn)
return fnErr
}
func (c *baseClient) dial(ctx context.Context, network, addr string) (net.Conn, error) {
return c.opt.Dialer(ctx, network, addr)
}
func (c *baseClient) process(ctx context.Context, cmd Cmder) error {
// Start measuring total operation duration (includes all retries)
// Only call time.Now() if operation duration callback is set to avoid overhead
var operationStart time.Time
opDurationCallback := otel.GetOperationDurationCallback()
if opDurationCallback != nil {
operationStart = time.Now()
}
var lastConn *pool.Conn
var lastErr error
totalAttempts := 0
for attempt := 0; attempt <= c.opt.MaxRetries; attempt++ {
totalAttempts++
attempt := attempt
retry, cn, err := c._process(ctx, cmd, attempt)
if cn != nil {
lastConn = cn
}
if err == nil || !retry {
// Record total operation duration
if opDurationCallback != nil {
operationDuration := time.Since(operationStart)
opDurationCallback(ctx, operationDuration, cmd, totalAttempts, err, lastConn, c.opt.DB)
}
if err != nil {
if errorCallback := pool.GetMetricErrorCallback(); errorCallback != nil {
errorType, statusCode, isInternal := classifyCommandError(err)
errorCallback(ctx, errorType, lastConn, statusCode, isInternal, totalAttempts-1)
}
}
return err
}
lastErr = err
}
// Record failed operation after all retries
if opDurationCallback != nil {
operationDuration := time.Since(operationStart)
opDurationCallback(ctx, operationDuration, cmd, totalAttempts, lastErr, lastConn, c.opt.DB)
}
// Record error metric for exhausted retries
if errorCallback := pool.GetMetricErrorCallback(); errorCallback != nil {
errorType, statusCode, isInternal := classifyCommandError(lastErr)
errorCallback(ctx, errorType, lastConn, statusCode, isInternal, totalAttempts-1)
}
return lastErr
}
// classifyCommandError classifies an error for metrics reporting.
// Returns: errorType, statusCode, isInternal
// - errorType: A string describing the error type (e.g., "TIMEOUT", "NETWORK", "ERR")
// - statusCode: The Redis error prefix or error category
// - isInternal: true for network/timeout errors, false for Redis server errors
func classifyCommandError(err error) (errorType, statusCode string, isInternal bool) {
if err == nil {
return "", "", false
}
errStr := err.Error()
// Check for timeout errors
if netErr, ok := err.(net.Error); ok && netErr.Timeout() {
return "TIMEOUT", "TIMEOUT", true
}
// Check for network errors
if _, ok := err.(net.Error); ok {
return "NETWORK", "NETWORK", true
}
// Check for context errors
if errors.Is(err, context.Canceled) {
return "CONTEXT_CANCELED", "CONTEXT_CANCELED", true
}
if errors.Is(err, context.DeadlineExceeded) {
return "CONTEXT_TIMEOUT", "CONTEXT_TIMEOUT", true
}
// Check for Redis errors
// Examples: "ERR ...", "WRONGTYPE ...", "CLUSTERDOWN ..."
if len(errStr) > 0 {
// Find the first space to extract the prefix
spaceIdx := 0
for i, c := range errStr {
if c == ' ' {
spaceIdx = i
break
}
}
if spaceIdx == 0 {
spaceIdx = len(errStr)
}
prefix := errStr[:spaceIdx]
isUppercase := true
for _, c := range prefix {
if c < 'A' || c > 'Z' {
isUppercase = false
break
}
}
if isUppercase && len(prefix) > 0 {
return prefix, prefix, false
}
}
return "UNKNOWN", "UNKNOWN", true
}
func (c *baseClient) assertUnstableCommand(cmd Cmder) (bool, error) {
switch cmd.(type) {
case *AggregateCmd, *FTInfoCmd, *FTSpellCheckCmd, *FTSearchCmd, *FTSynDumpCmd:
if c.opt.UnstableResp3 {
return true, nil
} else {
return false, fmt.Errorf("RESP3 responses for this command are disabled because they may still change. Please set the flag UnstableResp3. See the README and the release notes for guidance")
}
default:
return false, nil
}
}
func (c *baseClient) _process(ctx context.Context, cmd Cmder, attempt int) (bool, *pool.Conn, error) {
if attempt > 0 {
if err := internal.Sleep(ctx, c.retryBackoff(attempt)); err != nil {
return false, nil, err
}
}
var usedConn *pool.Conn
retryTimeout := uint32(0)
if err := c.withConn(ctx, func(ctx context.Context, cn *pool.Conn) error {
usedConn = cn
// Process any pending push notifications before executing the command
if err := c.processPushNotifications(ctx, cn); err != nil {
internal.Logger.Printf(ctx, "push: error processing pending notifications before command: %v", err)
}
if err := cn.WithWriter(c.context(ctx), c.opt.WriteTimeout, func(wr *proto.Writer) error {
return writeCmd(wr, cmd)
}); err != nil {
atomic.StoreUint32(&retryTimeout, 1)
return err
}
readReplyFunc := cmd.readReply
// Apply unstable RESP3 search module.
if c.opt.Protocol != 2 {
useRawReply, err := c.assertUnstableCommand(cmd)
if err != nil {
return err
}
if useRawReply {
readReplyFunc = cmd.readRawReply
}
}
if err := cn.WithReader(c.context(ctx), c.cmdTimeout(cmd), func(rd *proto.Reader) error {
// To be sure there are no buffered push notifications, we process them before reading the reply
if err := c.processPendingPushNotificationWithReader(ctx, cn, rd); err != nil {
internal.Logger.Printf(ctx, "push: error processing pending notifications before reading reply: %v", err)
}
return readReplyFunc(rd)
}); err != nil {
if cmd.readTimeout() == nil {
atomic.StoreUint32(&retryTimeout, 1)
} else {
atomic.StoreUint32(&retryTimeout, 0)
}
return err
}
return nil
}); err != nil {
retry := shouldRetry(err, atomic.LoadUint32(&retryTimeout) == 1)
return retry, usedConn, err
}
return false, usedConn, nil
}
func (c *baseClient) retryBackoff(attempt int) time.Duration {
return internal.RetryBackoff(attempt, c.opt.MinRetryBackoff, c.opt.MaxRetryBackoff)
}
func (c *baseClient) cmdTimeout(cmd Cmder) time.Duration {
if timeout := cmd.readTimeout(); timeout != nil {
t := *timeout
if t == 0 {
return 0
}
return t + 10*time.Second
}
return c.opt.ReadTimeout
}
// context returns the context for the current connection.
// If the context timeout is enabled, it returns the original context.
// Otherwise, it returns a new background context.
func (c *baseClient) context(ctx context.Context) context.Context {
if c.opt.ContextTimeoutEnabled {
return ctx
}
return context.Background()
}
// createInitConnFunc creates a connection initialization function that can be used for reconnections.
func (c *baseClient) createInitConnFunc() func(context.Context, *pool.Conn) error {
return func(ctx context.Context, cn *pool.Conn) error {
return c.initConn(ctx, cn)
}
}
// enableMaintNotificationsUpgrades initializes the maintnotifications upgrade manager and pool hook.
// This function is called during client initialization.
// will register push notification handlers for all maintenance upgrade events.
// will start background workers for handoff processing in the pool hook.
func (c *baseClient) enableMaintNotificationsUpgrades() error {
// Create client adapter
clientAdapterInstance := newClientAdapter(c)
// Create maintnotifications manager directly
manager, err := maintnotifications.NewManager(clientAdapterInstance, c.connPool, c.opt.MaintNotificationsConfig)
if err != nil {
return err
}
// Set the manager reference and initialize pool hook
c.maintNotificationsManagerLock.Lock()
c.maintNotificationsManager = manager
c.maintNotificationsManagerLock.Unlock()
// Initialize pool hook (safe to call without lock since manager is now set)
manager.InitPoolHook(c.dialHook)
return nil
}
func (c *baseClient) disableMaintNotificationsUpgrades() error {
c.maintNotificationsManagerLock.Lock()
defer c.maintNotificationsManagerLock.Unlock()
// Close the maintnotifications manager
if c.maintNotificationsManager != nil {
// Closing the manager will also shutdown the pool hook
// and remove it from the pool
c.maintNotificationsManager.Close()
c.maintNotificationsManager = nil
}
return nil
}
// Close closes the client, releasing any open resources.
//
// It is rare to Close a Client, as the Client is meant to be
// long-lived and shared between many goroutines.
func (c *baseClient) Close() error {
var firstErr error
// Close maintnotifications manager first
if err := c.disableMaintNotificationsUpgrades(); err != nil {
firstErr = err
}
if c.onClose != nil {
if err := c.onClose(); err != nil && firstErr == nil {
firstErr = err
}
}
// Unregister pools from OTel before closing them
otel.UnregisterPools(c.connPool, c.pubSubPool)
if c.connPool != nil {
if err := c.connPool.Close(); err != nil && firstErr == nil {
firstErr = err
}
}
if c.pubSubPool != nil {
if err := c.pubSubPool.Close(); err != nil && firstErr == nil {
firstErr = err
}
}
return firstErr
}
func (c *baseClient) getAddr() string {
return c.opt.Addr
}
func (c *baseClient) processPipeline(ctx context.Context, cmds []Cmder) error {
if err := c.generalProcessPipeline(ctx, cmds, c.pipelineProcessCmds, "PIPELINE"); err != nil {
return err
}
return cmdsFirstErr(cmds)
}
func (c *baseClient) processTxPipeline(ctx context.Context, cmds []Cmder) error {
if err := c.generalProcessPipeline(ctx, cmds, c.txPipelineProcessCmds, "MULTI"); err != nil {
return err
}
return cmdsFirstErr(cmds)
}
type pipelineProcessor func(context.Context, *pool.Conn, []Cmder) (bool, error)
func (c *baseClient) generalProcessPipeline(
ctx context.Context, cmds []Cmder, p pipelineProcessor, operationName string,
) error {
// Only call time.Now() if pipeline operation duration callback is set to avoid overhead
var operationStart time.Time
pipelineOpDurationCallback := otel.GetPipelineOperationDurationCallback()
if pipelineOpDurationCallback != nil {
operationStart = time.Now()
}
var lastConn *pool.Conn
totalAttempts := 0
var lastErr error
for attempt := 0; attempt <= c.opt.MaxRetries; attempt++ {
totalAttempts++
if attempt > 0 {
if err := internal.Sleep(ctx, c.retryBackoff(attempt)); err != nil {
setCmdsErr(cmds, err)
if pipelineOpDurationCallback != nil {
operationDuration := time.Since(operationStart)
pipelineOpDurationCallback(ctx, operationDuration, operationName, len(cmds), totalAttempts, err, lastConn, c.opt.DB)
}
return err
}
}
// Enable retries by default to retry dial errors returned by withConn.
canRetry := true
lastErr = c.withConn(ctx, func(ctx context.Context, cn *pool.Conn) error {
lastConn = cn
// Process any pending push notifications before executing the pipeline
if err := c.processPushNotifications(ctx, cn); err != nil {
internal.Logger.Printf(ctx, "push: error processing pending notifications before processing pipeline: %v", err)
}
var err error
canRetry, err = p(ctx, cn, cmds)
return err
})
if lastErr == nil || !canRetry || !shouldRetry(lastErr, true) {
// The error should be set here only when failing to obtain the conn.
if !isRedisError(lastErr) {
setCmdsErr(cmds, lastErr)
}
if pipelineOpDurationCallback != nil {
operationDuration := time.Since(operationStart)
pipelineOpDurationCallback(ctx, operationDuration, operationName, len(cmds), totalAttempts, lastErr, lastConn, c.opt.DB)
}
if lastErr != nil {
if errorCallback := pool.GetMetricErrorCallback(); errorCallback != nil {
errorType, statusCode, isInternal := classifyCommandError(lastErr)
errorCallback(ctx, errorType, lastConn, statusCode, isInternal, totalAttempts-1)
}
}
return lastErr
}
}
if pipelineOpDurationCallback != nil {
operationDuration := time.Since(operationStart)
pipelineOpDurationCallback(ctx, operationDuration, operationName, len(cmds), totalAttempts, lastErr, lastConn, c.opt.DB)
}
if errorCallback := pool.GetMetricErrorCallback(); errorCallback != nil {
errorType, statusCode, isInternal := classifyCommandError(lastErr)
errorCallback(ctx, errorType, lastConn, statusCode, isInternal, totalAttempts-1)
}
return lastErr
}
func (c *baseClient) pipelineProcessCmds(
ctx context.Context, cn *pool.Conn, cmds []Cmder,
) (bool, error) {
// Process any pending push notifications before executing the pipeline
if err := c.processPushNotifications(ctx, cn); err != nil {
internal.Logger.Printf(ctx, "push: error processing pending notifications before writing pipeline: %v", err)
}
if err := cn.WithWriter(c.context(ctx), c.opt.WriteTimeout, func(wr *proto.Writer) error {
return writeCmds(wr, cmds)
}); err != nil {
setCmdsErr(cmds, err)
return true, err
}
if err := cn.WithReader(c.context(ctx), c.opt.ReadTimeout, func(rd *proto.Reader) error {
// read all replies
return c.pipelineReadCmds(ctx, cn, rd, cmds)
}); err != nil {
return true, err
}
return false, nil
}
func (c *baseClient) pipelineReadCmds(ctx context.Context, cn *pool.Conn, rd *proto.Reader, cmds []Cmder) error {
for i, cmd := range cmds {
// To be sure there are no buffered push notifications, we process them before reading the reply
if err := c.processPendingPushNotificationWithReader(ctx, cn, rd); err != nil {
internal.Logger.Printf(ctx, "push: error processing pending notifications before reading reply: %v", err)
}
err := cmd.readReply(rd)
cmd.SetErr(err)
if err != nil && !isRedisError(err) {
setCmdsErr(cmds[i+1:], err)
return err
}
}
// Retry errors like "LOADING redis is loading the dataset in memory".
return cmds[0].Err()
}
func (c *baseClient) txPipelineProcessCmds(
ctx context.Context, cn *pool.Conn, cmds []Cmder,
) (bool, error) {
// Process any pending push notifications before executing the transaction pipeline
if err := c.processPushNotifications(ctx, cn); err != nil {
internal.Logger.Printf(ctx, "push: error processing pending notifications before transaction: %v", err)
}
if err := cn.WithWriter(c.context(ctx), c.opt.WriteTimeout, func(wr *proto.Writer) error {
return writeCmds(wr, cmds)
}); err != nil {
setCmdsErr(cmds, err)
return true, err
}
if err := cn.WithReader(c.context(ctx), c.opt.ReadTimeout, func(rd *proto.Reader) error {
statusCmd := cmds[0].(*StatusCmd)
// Trim multi and exec.
trimmedCmds := cmds[1 : len(cmds)-1]
if err := c.txPipelineReadQueued(ctx, cn, rd, statusCmd, trimmedCmds); err != nil {
setCmdsErr(cmds, err)
return err
}
// Read replies.
return c.pipelineReadCmds(ctx, cn, rd, trimmedCmds)
}); err != nil {
return false, err
}
return false, nil
}
// txPipelineReadQueued reads queued replies from the Redis server.
// It returns an error if the server returns an error or if the number of replies does not match the number of commands.
func (c *baseClient) txPipelineReadQueued(ctx context.Context, cn *pool.Conn, rd *proto.Reader, statusCmd *StatusCmd, cmds []Cmder) error {
// To be sure there are no buffered push notifications, we process them before reading the reply
if err := c.processPendingPushNotificationWithReader(ctx, cn, rd); err != nil {
internal.Logger.Printf(ctx, "push: error processing pending notifications before reading reply: %v", err)
}
// Parse +OK.
if err := statusCmd.readReply(rd); err != nil {
return err
}
// Parse +QUEUED.
for _, cmd := range cmds {
// To be sure there are no buffered push notifications, we process them before reading the reply
if err := c.processPendingPushNotificationWithReader(ctx, cn, rd); err != nil {
internal.Logger.Printf(ctx, "push: error processing pending notifications before reading reply: %v", err)
}
if err := statusCmd.readReply(rd); err != nil {
cmd.SetErr(err)
if !isRedisError(err) {
return err
}
}
}
// To be sure there are no buffered push notifications, we process them before reading the reply
if err := c.processPendingPushNotificationWithReader(ctx, cn, rd); err != nil {
internal.Logger.Printf(ctx, "push: error processing pending notifications before reading reply: %v", err)
}
// Parse number of replies.
line, err := rd.ReadLine()
if err != nil {
if err == Nil {
err = TxFailedErr
}
return err
}
if line[0] != proto.RespArray {
return fmt.Errorf("redis: expected '*', but got line %q", line)
}
return nil
}
//------------------------------------------------------------------------------
// Client is a Redis client representing a pool of zero or more underlying connections.
// It's safe for concurrent use by multiple goroutines.
//
// Client creates and frees connections automatically; it also maintains a free pool
// of idle connections. You can control the pool size with Config.PoolSize option.
type Client struct {
*baseClient
cmdable
}
// NewClient returns a client to the Redis Server specified by Options.
func NewClient(opt *Options) *Client {
if opt == nil {
panic("redis: NewClient nil options")
}
// clone to not share options with the caller
opt = opt.clone()
opt.init()
// Push notifications are always enabled for RESP3 (cannot be disabled)
c := Client{
baseClient: &baseClient{
opt: opt,
},
}
c.init()
// Initialize push notification processor using shared helper
// Use void processor for RESP2 connections (push notifications not available)
c.pushProcessor = initializePushProcessor(opt)
// set opt push processor for child clients
c.opt.PushNotificationProcessor = c.pushProcessor
// Generate unique pool names for metrics
uniqueID := generateUniqueID()
mainPoolName := opt.Addr + "_" + uniqueID
pubsubPoolName := opt.Addr + "_" + uniqueID + "_pubsub"
// Create connection pools
var err error
c.connPool, err = newConnPool(opt, c.dialHook, mainPoolName)
if err != nil {
panic(fmt.Errorf("redis: failed to create connection pool: %w", err))
}
c.pubSubPool, err = newPubSubPool(opt, c.dialHook, pubsubPoolName)
if err != nil {
panic(fmt.Errorf("redis: failed to create pubsub pool: %w", err))
}
if opt.StreamingCredentialsProvider != nil {
c.streamingCredentialsManager = streaming.NewManager(c.connPool, c.opt.PoolTimeout)
c.connPool.AddPoolHook(c.streamingCredentialsManager.PoolHook())
}
// Initialize maintnotifications first if enabled and protocol is RESP3
if opt.MaintNotificationsConfig != nil && opt.MaintNotificationsConfig.Mode != maintnotifications.ModeDisabled && opt.Protocol == 3 {
err := c.enableMaintNotificationsUpgrades()
if err != nil {
internal.Logger.Printf(context.Background(), "failed to initialize maintnotifications: %v", err)
if opt.MaintNotificationsConfig.Mode == maintnotifications.ModeEnabled {
/*
Design decision: panic here to fail fast if maintnotifications cannot be enabled when explicitly requested.
We choose to panic instead of returning an error to avoid breaking the existing client API, which does not expect
an error from NewClient. This ensures that misconfiguration or critical initialization failures are surfaced
immediately, rather than allowing the client to continue in a partially initialized or inconsistent state.
Clients relying on maintnotifications should be aware that initialization errors will cause a panic, and should
handle this accordingly (e.g., via recover or by validating configuration before calling NewClient).
This approach is only used when MaintNotificationsConfig.Mode is MaintNotificationsEnabled, indicating that maintnotifications
upgrades are required for correct operation. In other modes, initialization failures are logged but do not panic.
*/
panic(fmt.Errorf("failed to enable maintnotifications: %w", err))
}
}
}
// Register pools with OTel recorder if it supports pool registration
// This allows async gauge metrics to pull stats from pools periodically
otel.RegisterPools(c.connPool, c.pubSubPool, opt.Addr)
return &c
}
func (c *Client) init() {
c.cmdable = c.Process
c.initHooks(hooks{
dial: c.baseClient.dial,
process: c.baseClient.process,
pipeline: c.baseClient.processPipeline,
txPipeline: c.baseClient.processTxPipeline,
})
}
func (c *Client) WithTimeout(timeout time.Duration) *Client {
clone := *c
clone.baseClient = c.baseClient.withTimeout(timeout)
clone.init()
return &clone
}
func (c *Client) Conn() *Conn {
return newConn(c.opt, pool.NewStickyConnPool(c.connPool), &c.hooksMixin)
}
func (c *Client) Process(ctx context.Context, cmd Cmder) error {
err := c.processHook(ctx, cmd)
cmd.SetErr(err)
return err
}
// Options returns read-only Options that were used to create the client.
func (c *Client) Options() *Options {
return c.opt
}
// NodeAddress returns the address of the Redis node as reported by the server.
// For cluster clients, this is the endpoint from CLUSTER SLOTS before any transformation
// (e.g., loopback replacement). For standalone clients, this defaults to Addr.
//
// This is useful for matching the source field in maintenance notifications
// (e.g. SMIGRATED).
func (c *Client) NodeAddress() string {
return c.opt.NodeAddress
}
// GetMaintNotificationsManager returns the maintnotifications manager instance for monitoring and control.
// Returns nil if maintnotifications are not enabled.
func (c *Client) GetMaintNotificationsManager() *maintnotifications.Manager {
c.maintNotificationsManagerLock.RLock()
defer c.maintNotificationsManagerLock.RUnlock()
return c.maintNotificationsManager
}
// initializePushProcessor initializes the push notification processor for any client type.
// This is a shared helper to avoid duplication across NewClient, NewFailoverClient, and NewSentinelClient.
func initializePushProcessor(opt *Options) push.NotificationProcessor {
// Always use custom processor if provided
if opt.PushNotificationProcessor != nil {
return opt.PushNotificationProcessor
}
// Push notifications are always enabled for RESP3, disabled for RESP2
if opt.Protocol == 3 {
// Create default processor for RESP3 connections
return NewPushNotificationProcessor()
}
// Create void processor for RESP2 connections (push notifications not available)
return NewVoidPushNotificationProcessor()
}
// RegisterPushNotificationHandler registers a handler for a specific push notification name.
// Returns an error if a handler is already registered for this push notification name.
// If protected is true, the handler cannot be unregistered.
func (c *Client) RegisterPushNotificationHandler(pushNotificationName string, handler push.NotificationHandler, protected bool) error {
return c.pushProcessor.RegisterHandler(pushNotificationName, handler, protected)
}
// GetPushNotificationHandler returns the handler for a specific push notification name.
// Returns nil if no handler is registered for the given name.
func (c *Client) GetPushNotificationHandler(pushNotificationName string) push.NotificationHandler {
return c.pushProcessor.GetHandler(pushNotificationName)
}
type PoolStats pool.Stats
// PoolStats returns connection pool stats.
func (c *Client) PoolStats() *PoolStats {
stats := c.connPool.Stats()
stats.PubSubStats = *(c.pubSubPool.Stats())
return (*PoolStats)(stats)
}
func (c *Client) Pipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.Pipeline().Pipelined(ctx, fn)
}
func (c *Client) Pipeline() Pipeliner {
pipe := Pipeline{
exec: pipelineExecer(c.processPipelineHook),
}
pipe.init()
return &pipe
}
func (c *Client) TxPipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.TxPipeline().Pipelined(ctx, fn)
}
// TxPipeline acts like Pipeline, but wraps queued commands with MULTI/EXEC.
func (c *Client) TxPipeline() Pipeliner {
pipe := Pipeline{
exec: func(ctx context.Context, cmds []Cmder) error {
cmds = wrapMultiExec(ctx, cmds)
return c.processTxPipelineHook(ctx, cmds)
},
}
pipe.init()
return &pipe
}
func (c *Client) pubSub() *PubSub {
pubsub := &PubSub{
opt: c.opt,
newConn: func(ctx context.Context, addr string, channels []string) (*pool.Conn, error) {
cn, err := c.pubSubPool.NewConn(ctx, c.opt.Network, addr, channels)
if err != nil {
return nil, err
}
// will return nil if already initialized
err = c.initConn(ctx, cn)
if err != nil {
_ = cn.Close()
return nil, err
}
// Track connection in PubSubPool
c.pubSubPool.TrackConn(cn)
return cn, nil
},
closeConn: func(cn *pool.Conn) error {
// Untrack connection from PubSubPool
c.pubSubPool.UntrackConn(cn)
_ = cn.Close()
return nil
},
pushProcessor: c.pushProcessor,
}
pubsub.init()
return pubsub
}
// Subscribe subscribes the client to the specified channels.
// Channels can be omitted to create empty subscription.
// Note that this method does not wait on a response from Redis, so the
// subscription may not be active immediately. To force the connection to wait,
// you may call the Receive() method on the returned *PubSub like so:
//
// sub := client.Subscribe(queryResp)
// iface, err := sub.Receive()
// if err != nil {
// // handle error
// }
//
// // Should be *Subscription, but others are possible if other actions have been
// // taken on sub since it was created.
// switch iface.(type) {
// case *Subscription:
// // subscribe succeeded
// case *Message:
// // received first message
// case *Pong:
// // pong received
// default:
// // handle error
// }
//
// ch := sub.Channel()
func (c *Client) Subscribe(ctx context.Context, channels ...string) *PubSub {
pubsub := c.pubSub()
if len(channels) > 0 {
_ = pubsub.Subscribe(ctx, channels...)
}
return pubsub
}
// PSubscribe subscribes the client to the given patterns.
// Patterns can be omitted to create empty subscription.
func (c *Client) PSubscribe(ctx context.Context, channels ...string) *PubSub {
pubsub := c.pubSub()
if len(channels) > 0 {
_ = pubsub.PSubscribe(ctx, channels...)
}
return pubsub
}
// SSubscribe Subscribes the client to the specified shard channels.
// Channels can be omitted to create empty subscription.
func (c *Client) SSubscribe(ctx context.Context, channels ...string) *PubSub {
pubsub := c.pubSub()
if len(channels) > 0 {
_ = pubsub.SSubscribe(ctx, channels...)
}
return pubsub
}
//------------------------------------------------------------------------------
// Conn represents a single Redis connection rather than a pool of connections.
// Prefer running commands from Client unless there is a specific need
// for a continuous single Redis connection.
type Conn struct {
baseClient
cmdable
statefulCmdable
}
// newConn is a helper func to create a new Conn instance.
// the Conn instance is not thread-safe and should not be shared between goroutines.
// the parentHooks will be cloned, no need to clone before passing it.
func newConn(opt *Options, connPool pool.Pooler, parentHooks *hooksMixin) *Conn {
c := Conn{
baseClient: baseClient{
opt: opt,
connPool: connPool,
},
}
if parentHooks != nil {
c.hooksMixin = parentHooks.clone()
}
// Initialize push notification processor using shared helper
// Use void processor for RESP2 connections (push notifications not available)
c.pushProcessor = initializePushProcessor(opt)
c.cmdable = c.Process
c.statefulCmdable = c.Process
c.initHooks(hooks{
dial: c.baseClient.dial,
process: c.baseClient.process,
pipeline: c.baseClient.processPipeline,
txPipeline: c.baseClient.processTxPipeline,
})
return &c
}
func (c *Conn) Process(ctx context.Context, cmd Cmder) error {
err := c.processHook(ctx, cmd)
cmd.SetErr(err)
return err
}
// RegisterPushNotificationHandler registers a handler for a specific push notification name.
// Returns an error if a handler is already registered for this push notification name.
// If protected is true, the handler cannot be unregistered.
func (c *Conn) RegisterPushNotificationHandler(pushNotificationName string, handler push.NotificationHandler, protected bool) error {
return c.pushProcessor.RegisterHandler(pushNotificationName, handler, protected)
}
func (c *Conn) Pipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.Pipeline().Pipelined(ctx, fn)
}
func (c *Conn) Pipeline() Pipeliner {
pipe := Pipeline{
exec: c.processPipelineHook,
}
pipe.init()
return &pipe
}
func (c *Conn) TxPipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.TxPipeline().Pipelined(ctx, fn)
}
// TxPipeline acts like Pipeline, but wraps queued commands with MULTI/EXEC.
func (c *Conn) TxPipeline() Pipeliner {
pipe := Pipeline{
exec: func(ctx context.Context, cmds []Cmder) error {
cmds = wrapMultiExec(ctx, cmds)
return c.processTxPipelineHook(ctx, cmds)
},
}
pipe.init()
return &pipe
}
// processPushNotifications processes all pending push notifications on a connection
// This ensures that cluster topology changes are handled immediately before the connection is used
// This method should be called by the client before using WithReader for command execution
//
// Performance optimization: Skip the expensive MaybeHasData() syscall if a health check
// was performed recently (within 5 seconds). The health check already verified the connection
// is healthy and checked for unexpected data (push notifications).
func (c *baseClient) processPushNotifications(ctx context.Context, cn *pool.Conn) error {
// Only process push notifications for RESP3 connections with a processor
if c.opt.Protocol != 3 || c.pushProcessor == nil {
return nil
}
// Performance optimization: Skip MaybeHasData() syscall if health check was recent
// If the connection was health-checked within the last 5 seconds, we can skip the
// expensive syscall since the health check already verified no unexpected data.
// This is safe because:
// 0. lastHealthCheckNs is set in pool/conn.go:putConn() after a successful health check
// 1. Health check (connCheck) uses the same syscall (Recvfrom with MSG_PEEK)
// 2. If push notifications arrived, they would have been detected by health check
// 3. 5 seconds is short enough that connection state is still fresh
// 4. Push notifications will be processed by the next WithReader call
// used it is set on getConn, so we should use another timer (lastPutAt?)
lastHealthCheckNs := cn.LastPutAtNs()
if lastHealthCheckNs > 0 {
// Use pool's cached time to avoid expensive time.Now() syscall
nowNs := pool.GetCachedTimeNs()
if nowNs-lastHealthCheckNs < int64(5*time.Second) {
// Recent health check confirmed no unexpected data, skip the syscall
return nil
}
}
// Check if there is any data to read before processing
// This is an optimization on UNIX systems where MaybeHasData is a syscall
// On Windows, MaybeHasData always returns true, so this check is a no-op
if !cn.MaybeHasData() {
return nil
}
// Use WithReader to access the reader and process push notifications
// This is critical for maintnotifications to work properly
// NOTE: almost no timeouts are set for this read, so it should not block
// longer than necessary, 10us should be plenty of time to read if there are any push notifications
// on the socket.
return cn.WithReader(ctx, 10*time.Microsecond, func(rd *proto.Reader) error {
// Create handler context with client, connection pool, and connection information
handlerCtx := c.pushNotificationHandlerContext(cn)
return c.pushProcessor.ProcessPendingNotifications(ctx, handlerCtx, rd)
})
}
// processPendingPushNotificationWithReader processes all pending push notifications on a connection
// This method should be called by the client in WithReader before reading the reply
func (c *baseClient) processPendingPushNotificationWithReader(ctx context.Context, cn *pool.Conn, rd *proto.Reader) error {
// if we have the reader, we don't need to check for data on the socket, we are waiting
// for either a reply or a push notification, so we can block until we get a reply or reach the timeout
if c.opt.Protocol != 3 || c.pushProcessor == nil {
return nil
}
// Create handler context with client, connection pool, and connection information
handlerCtx := c.pushNotificationHandlerContext(cn)
return c.pushProcessor.ProcessPendingNotifications(ctx, handlerCtx, rd)
}
// pushNotificationHandlerContext creates a handler context for push notification processing
func (c *baseClient) pushNotificationHandlerContext(cn *pool.Conn) push.NotificationHandlerContext {
return push.NotificationHandlerContext{
Client: c,
ConnPool: c.connPool,
Conn: cn, // Wrap in adapter for easier interface access
}
}
package redis
import "time"
// NewCmdResult returns a Cmd initialised with val and err for testing.
func NewCmdResult(val interface{}, err error) *Cmd {
var cmd Cmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewSliceResult returns a SliceCmd initialised with val and err for testing.
func NewSliceResult(val []interface{}, err error) *SliceCmd {
var cmd SliceCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewStatusResult returns a StatusCmd initialised with val and err for testing.
func NewStatusResult(val string, err error) *StatusCmd {
var cmd StatusCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewIntResult returns an IntCmd initialised with val and err for testing.
func NewIntResult(val int64, err error) *IntCmd {
var cmd IntCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewDurationResult returns a DurationCmd initialised with val and err for testing.
func NewDurationResult(val time.Duration, err error) *DurationCmd {
var cmd DurationCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewBoolResult returns a BoolCmd initialised with val and err for testing.
func NewBoolResult(val bool, err error) *BoolCmd {
var cmd BoolCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewStringResult returns a StringCmd initialised with val and err for testing.
func NewStringResult(val string, err error) *StringCmd {
var cmd StringCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewFloatResult returns a FloatCmd initialised with val and err for testing.
func NewFloatResult(val float64, err error) *FloatCmd {
var cmd FloatCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewStringSliceResult returns a StringSliceCmd initialised with val and err for testing.
func NewStringSliceResult(val []string, err error) *StringSliceCmd {
var cmd StringSliceCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewBoolSliceResult returns a BoolSliceCmd initialised with val and err for testing.
func NewBoolSliceResult(val []bool, err error) *BoolSliceCmd {
var cmd BoolSliceCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewFloatSliceResult returns a FloatSliceCmd initialised with val and err for testing.
func NewFloatSliceResult(val []float64, err error) *FloatSliceCmd {
var cmd FloatSliceCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewMapStringStringResult returns a MapStringStringCmd initialised with val and err for testing.
func NewMapStringStringResult(val map[string]string, err error) *MapStringStringCmd {
var cmd MapStringStringCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewMapStringIntCmdResult returns a MapStringIntCmd initialised with val and err for testing.
func NewMapStringIntCmdResult(val map[string]int64, err error) *MapStringIntCmd {
var cmd MapStringIntCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewTimeCmdResult returns a TimeCmd initialised with val and err for testing.
func NewTimeCmdResult(val time.Time, err error) *TimeCmd {
var cmd TimeCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewZSliceCmdResult returns a ZSliceCmd initialised with val and err for testing.
func NewZSliceCmdResult(val []Z, err error) *ZSliceCmd {
var cmd ZSliceCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewZWithKeyCmdResult returns a ZWithKeyCmd initialised with val and err for testing.
func NewZWithKeyCmdResult(val *ZWithKey, err error) *ZWithKeyCmd {
var cmd ZWithKeyCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewScanCmdResult returns a ScanCmd initialised with val and err for testing.
func NewScanCmdResult(keys []string, cursor uint64, err error) *ScanCmd {
var cmd ScanCmd
cmd.page = keys
cmd.cursor = cursor
cmd.SetErr(err)
return &cmd
}
// NewClusterSlotsCmdResult returns a ClusterSlotsCmd initialised with val and err for testing.
func NewClusterSlotsCmdResult(val []ClusterSlot, err error) *ClusterSlotsCmd {
var cmd ClusterSlotsCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewGeoLocationCmdResult returns a GeoLocationCmd initialised with val and err for testing.
func NewGeoLocationCmdResult(val []GeoLocation, err error) *GeoLocationCmd {
var cmd GeoLocationCmd
cmd.locations = val
cmd.SetErr(err)
return &cmd
}
// NewGeoPosCmdResult returns a GeoPosCmd initialised with val and err for testing.
func NewGeoPosCmdResult(val []*GeoPos, err error) *GeoPosCmd {
var cmd GeoPosCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewCommandsInfoCmdResult returns a CommandsInfoCmd initialised with val and err for testing.
func NewCommandsInfoCmdResult(val map[string]*CommandInfo, err error) *CommandsInfoCmd {
var cmd CommandsInfoCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewXMessageSliceCmdResult returns a XMessageSliceCmd initialised with val and err for testing.
func NewXMessageSliceCmdResult(val []XMessage, err error) *XMessageSliceCmd {
var cmd XMessageSliceCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewXStreamSliceCmdResult returns a XStreamSliceCmd initialised with val and err for testing.
func NewXStreamSliceCmdResult(val []XStream, err error) *XStreamSliceCmd {
var cmd XStreamSliceCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
// NewXPendingResult returns a XPendingCmd initialised with val and err for testing.
func NewXPendingResult(val *XPending, err error) *XPendingCmd {
var cmd XPendingCmd
cmd.val = val
cmd.SetErr(err)
return &cmd
}
package redis
import (
"context"
"crypto/tls"
"errors"
"fmt"
"net"
"strconv"
"sync"
"sync/atomic"
"time"
"github.com/cespare/xxhash/v2"
"github.com/dgryski/go-rendezvous" //nolint
"github.com/redis/go-redis/v9/auth"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/hashtag"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/internal/proto"
"github.com/redis/go-redis/v9/internal/rand"
)
var errRingShardsDown = errors.New("redis: all ring shards are down")
// defaultHeartbeatFn is the default function used to check the shard liveness
var defaultHeartbeatFn = func(ctx context.Context, client *Client) bool {
err := client.Ping(ctx).Err()
return err == nil || err == pool.ErrPoolTimeout
}
//------------------------------------------------------------------------------
type ConsistentHash interface {
Get(string) string
}
type rendezvousWrapper struct {
*rendezvous.Rendezvous
}
func (w rendezvousWrapper) Get(key string) string {
return w.Lookup(key)
}
func newRendezvous(shards []string) ConsistentHash {
return rendezvousWrapper{rendezvous.New(shards, xxhash.Sum64String)}
}
//------------------------------------------------------------------------------
// RingOptions are used to configure a ring client and should be
// passed to NewRing.
type RingOptions struct {
// Map of name => host:port addresses of ring shards.
Addrs map[string]string
// NewClient creates a shard client with provided options.
NewClient func(opt *Options) *Client
// ClientName will execute the `CLIENT SETNAME ClientName` command for each conn.
ClientName string
// Frequency of executing HeartbeatFn to check shards availability.
// Shard is considered down after 3 subsequent failed checks.
HeartbeatFrequency time.Duration
// A function used to check the shard liveness
// if not set, defaults to defaultHeartbeatFn
HeartbeatFn func(ctx context.Context, client *Client) bool
// NewConsistentHash returns a consistent hash that is used
// to distribute keys across the shards.
//
// See https://medium.com/@dgryski/consistent-hashing-algorithmic-tradeoffs-ef6b8e2fcae8
// for consistent hashing algorithmic tradeoffs.
NewConsistentHash func(shards []string) ConsistentHash
// Following options are copied from Options struct.
Dialer func(ctx context.Context, network, addr string) (net.Conn, error)
OnConnect func(ctx context.Context, cn *Conn) error
Protocol int
Username string
Password string
// CredentialsProvider allows the username and password to be updated
// before reconnecting. It should return the current username and password.
CredentialsProvider func() (username string, password string)
// CredentialsProviderContext is an enhanced parameter of CredentialsProvider,
// done to maintain API compatibility. In the future,
// there might be a merge between CredentialsProviderContext and CredentialsProvider.
// There will be a conflict between them; if CredentialsProviderContext exists, we will ignore CredentialsProvider.
CredentialsProviderContext func(ctx context.Context) (username string, password string, err error)
// StreamingCredentialsProvider is used to retrieve the credentials
// for the connection from an external source. Those credentials may change
// during the connection lifetime. This is useful for managed identity
// scenarios where the credentials are retrieved from an external source.
//
// Currently, this is a placeholder for the future implementation.
StreamingCredentialsProvider auth.StreamingCredentialsProvider
DB int
MaxRetries int
MinRetryBackoff time.Duration
MaxRetryBackoff time.Duration
DialTimeout time.Duration
// DialerRetries is the maximum number of retry attempts when dialing fails.
//
// default: 5
DialerRetries int
// DialerRetryTimeout is the backoff duration between retry attempts.
//
// default: 100 milliseconds
DialerRetryTimeout time.Duration
ReadTimeout time.Duration
WriteTimeout time.Duration
ContextTimeoutEnabled bool
// PoolFIFO uses FIFO mode for each node connection pool GET/PUT (default LIFO).
PoolFIFO bool
PoolSize int
PoolTimeout time.Duration
MinIdleConns int
MaxIdleConns int
MaxActiveConns int
ConnMaxIdleTime time.Duration
ConnMaxLifetime time.Duration
ConnMaxLifetimeJitter time.Duration
// ReadBufferSize is the size of the bufio.Reader buffer for each connection.
// Larger buffers can improve performance for commands that return large responses.
// Smaller buffers can improve memory usage for larger pools.
//
// default: 32KiB (32768 bytes)
ReadBufferSize int
// WriteBufferSize is the size of the bufio.Writer buffer for each connection.
// Larger buffers can improve performance for large pipelines and commands with many arguments.
// Smaller buffers can improve memory usage for larger pools.
//
// default: 32KiB (32768 bytes)
WriteBufferSize int
TLSConfig *tls.Config
Limiter Limiter
// DisableIndentity - Disable set-lib on connect.
//
// default: false
//
// Deprecated: Use DisableIdentity instead.
DisableIndentity bool
// DisableIdentity is used to disable CLIENT SETINFO command on connect.
//
// default: false
DisableIdentity bool
IdentitySuffix string
UnstableResp3 bool
}
func (opt *RingOptions) init() {
if opt.NewClient == nil {
opt.NewClient = func(opt *Options) *Client {
return NewClient(opt)
}
}
if opt.HeartbeatFrequency == 0 {
opt.HeartbeatFrequency = 500 * time.Millisecond
}
if opt.HeartbeatFn == nil {
opt.HeartbeatFn = defaultHeartbeatFn
}
if opt.NewConsistentHash == nil {
opt.NewConsistentHash = newRendezvous
}
switch opt.MaxRetries {
case -1:
opt.MaxRetries = 0
case 0:
opt.MaxRetries = 3
}
switch opt.MinRetryBackoff {
case -1:
opt.MinRetryBackoff = 0
case 0:
opt.MinRetryBackoff = 8 * time.Millisecond
}
switch opt.MaxRetryBackoff {
case -1:
opt.MaxRetryBackoff = 0
case 0:
opt.MaxRetryBackoff = 512 * time.Millisecond
}
if opt.ReadBufferSize == 0 {
opt.ReadBufferSize = proto.DefaultBufferSize
}
if opt.WriteBufferSize == 0 {
opt.WriteBufferSize = proto.DefaultBufferSize
}
}
func (opt *RingOptions) clientOptions() *Options {
return &Options{
ClientName: opt.ClientName,
Dialer: opt.Dialer,
OnConnect: opt.OnConnect,
Protocol: opt.Protocol,
Username: opt.Username,
Password: opt.Password,
CredentialsProvider: opt.CredentialsProvider,
CredentialsProviderContext: opt.CredentialsProviderContext,
StreamingCredentialsProvider: opt.StreamingCredentialsProvider,
DB: opt.DB,
MaxRetries: -1,
DialTimeout: opt.DialTimeout,
DialerRetries: opt.DialerRetries,
DialerRetryTimeout: opt.DialerRetryTimeout,
ReadTimeout: opt.ReadTimeout,
WriteTimeout: opt.WriteTimeout,
ContextTimeoutEnabled: opt.ContextTimeoutEnabled,
PoolFIFO: opt.PoolFIFO,
PoolSize: opt.PoolSize,
PoolTimeout: opt.PoolTimeout,
MinIdleConns: opt.MinIdleConns,
MaxIdleConns: opt.MaxIdleConns,
MaxActiveConns: opt.MaxActiveConns,
ConnMaxIdleTime: opt.ConnMaxIdleTime,
ConnMaxLifetime: opt.ConnMaxLifetime,
ConnMaxLifetimeJitter: opt.ConnMaxLifetimeJitter,
ReadBufferSize: opt.ReadBufferSize,
WriteBufferSize: opt.WriteBufferSize,
TLSConfig: opt.TLSConfig,
Limiter: opt.Limiter,
DisableIdentity: opt.DisableIdentity,
DisableIndentity: opt.DisableIndentity,
IdentitySuffix: opt.IdentitySuffix,
UnstableResp3: opt.UnstableResp3,
}
}
//------------------------------------------------------------------------------
type ringShard struct {
Client *Client
down int32
addr string
}
func newRingShard(opt *RingOptions, addr string) *ringShard {
clopt := opt.clientOptions()
clopt.Addr = addr
return &ringShard{
Client: opt.NewClient(clopt),
addr: addr,
}
}
func (shard *ringShard) String() string {
var state string
if shard.IsUp() {
state = "up"
} else {
state = "down"
}
return fmt.Sprintf("%s is %s", shard.Client, state)
}
func (shard *ringShard) IsDown() bool {
const threshold = 3
return atomic.LoadInt32(&shard.down) >= threshold
}
func (shard *ringShard) IsUp() bool {
return !shard.IsDown()
}
// Vote votes to set shard state and returns true if state was changed.
func (shard *ringShard) Vote(up bool) bool {
if up {
changed := shard.IsDown()
atomic.StoreInt32(&shard.down, 0)
return changed
}
if shard.IsDown() {
return false
}
atomic.AddInt32(&shard.down, 1)
return shard.IsDown()
}
//------------------------------------------------------------------------------
type ringSharding struct {
opt *RingOptions
mu sync.RWMutex
shards *ringShards
closed bool
hash ConsistentHash
numShard int
onNewNode []func(rdb *Client)
// ensures exclusive access to SetAddrs so there is no need
// to hold mu for the duration of potentially long shard creation
setAddrsMu sync.Mutex
}
type ringShards struct {
m map[string]*ringShard
list []*ringShard
}
func newRingSharding(opt *RingOptions) *ringSharding {
c := &ringSharding{
opt: opt,
}
c.SetAddrs(opt.Addrs)
return c
}
func (c *ringSharding) OnNewNode(fn func(rdb *Client)) {
c.mu.Lock()
c.onNewNode = append(c.onNewNode, fn)
c.mu.Unlock()
}
// SetAddrs replaces the shards in use, such that you can increase and
// decrease number of shards, that you use. It will reuse shards that
// existed before and close the ones that will not be used anymore.
func (c *ringSharding) SetAddrs(addrs map[string]string) {
c.setAddrsMu.Lock()
defer c.setAddrsMu.Unlock()
cleanup := func(shards map[string]*ringShard) {
for addr, shard := range shards {
if err := shard.Client.Close(); err != nil {
internal.Logger.Printf(context.Background(), "shard.Close %s failed: %s", addr, err)
}
}
}
c.mu.RLock()
if c.closed {
c.mu.RUnlock()
return
}
existing := c.shards
c.mu.RUnlock()
shards, created, unused := c.newRingShards(addrs, existing)
c.mu.Lock()
if c.closed {
cleanup(created)
c.mu.Unlock()
return
}
c.shards = shards
c.rebalanceLocked()
c.mu.Unlock()
cleanup(unused)
}
func (c *ringSharding) newRingShards(
addrs map[string]string, existing *ringShards,
) (shards *ringShards, created, unused map[string]*ringShard) {
shards = &ringShards{m: make(map[string]*ringShard, len(addrs))}
created = make(map[string]*ringShard) // indexed by addr
unused = make(map[string]*ringShard) // indexed by addr
if existing != nil {
for _, shard := range existing.list {
unused[shard.addr] = shard
}
}
for name, addr := range addrs {
if shard, ok := unused[addr]; ok {
shards.m[name] = shard
delete(unused, addr)
} else {
shard := newRingShard(c.opt, addr)
shards.m[name] = shard
created[addr] = shard
for _, fn := range c.onNewNode {
fn(shard.Client)
}
}
}
for _, shard := range shards.m {
shards.list = append(shards.list, shard)
}
return
}
// Warning: External exposure of `c.shards.list` may cause data races.
// So keep internal or implement deep copy if exposed.
func (c *ringSharding) List() []*ringShard {
c.mu.RLock()
defer c.mu.RUnlock()
if c.closed {
return nil
}
return c.shards.list
}
func (c *ringSharding) Hash(key string) string {
key = hashtag.Key(key)
var hash string
c.mu.RLock()
defer c.mu.RUnlock()
if c.numShard > 0 {
hash = c.hash.Get(key)
}
return hash
}
func (c *ringSharding) GetByKey(key string) (*ringShard, error) {
key = hashtag.Key(key)
c.mu.RLock()
defer c.mu.RUnlock()
if c.closed {
return nil, pool.ErrClosed
}
if c.numShard == 0 {
return nil, errRingShardsDown
}
shardName := c.hash.Get(key)
if shardName == "" {
return nil, errRingShardsDown
}
return c.shards.m[shardName], nil
}
func (c *ringSharding) GetByName(shardName string) (*ringShard, error) {
if shardName == "" {
return c.Random()
}
c.mu.RLock()
defer c.mu.RUnlock()
shard, ok := c.shards.m[shardName]
if !ok {
return nil, errors.New("redis: the shard is not in the ring")
}
return shard, nil
}
func (c *ringSharding) Random() (*ringShard, error) {
return c.GetByKey(strconv.Itoa(rand.Int()))
}
// Heartbeat monitors state of each shard in the ring.
func (c *ringSharding) Heartbeat(ctx context.Context, frequency time.Duration) {
ticker := time.NewTicker(frequency)
defer ticker.Stop()
for {
select {
case <-ticker.C:
var rebalance bool
// note: `c.List()` return a shadow copy of `[]*ringShard`.
for _, shard := range c.List() {
isUp := c.opt.HeartbeatFn(ctx, shard.Client)
if shard.Vote(isUp) {
internal.Logger.Printf(ctx, "ring shard state changed: %s", shard)
rebalance = true
}
}
if rebalance {
c.mu.Lock()
c.rebalanceLocked()
c.mu.Unlock()
}
case <-ctx.Done():
return
}
}
}
// rebalanceLocked removes dead shards from the Ring.
// Requires c.mu locked.
func (c *ringSharding) rebalanceLocked() {
if c.closed {
return
}
if c.shards == nil {
return
}
liveShards := make([]string, 0, len(c.shards.m))
for name, shard := range c.shards.m {
if shard.IsUp() {
liveShards = append(liveShards, name)
}
}
c.hash = c.opt.NewConsistentHash(liveShards)
c.numShard = len(liveShards)
}
func (c *ringSharding) Len() int {
c.mu.RLock()
defer c.mu.RUnlock()
return c.numShard
}
func (c *ringSharding) Close() error {
c.mu.Lock()
defer c.mu.Unlock()
if c.closed {
return nil
}
c.closed = true
var firstErr error
for _, shard := range c.shards.list {
if err := shard.Client.Close(); err != nil && firstErr == nil {
firstErr = err
}
}
c.hash = nil
c.shards = nil
c.numShard = 0
return firstErr
}
//------------------------------------------------------------------------------
// Ring is a Redis client that uses consistent hashing to distribute
// keys across multiple Redis servers (shards). It's safe for
// concurrent use by multiple goroutines.
//
// Ring monitors the state of each shard and removes dead shards from
// the ring. When a shard comes online it is added back to the ring. This
// gives you maximum availability and partition tolerance, but no
// consistency between different shards or even clients. Each client
// uses shards that are available to the client and does not do any
// coordination when shard state is changed.
//
// Ring should be used when you need multiple Redis servers for caching
// and can tolerate losing data when one of the servers dies.
// Otherwise you should use Redis Cluster.
type Ring struct {
cmdable
hooksMixin
opt *RingOptions
sharding *ringSharding
cmdsInfoCache *cmdsInfoCache
heartbeatCancelFn context.CancelFunc
}
func NewRing(opt *RingOptions) *Ring {
if opt == nil {
panic("redis: NewRing nil options")
}
opt.init()
hbCtx, hbCancel := context.WithCancel(context.Background())
ring := Ring{
opt: opt,
sharding: newRingSharding(opt),
heartbeatCancelFn: hbCancel,
}
ring.cmdsInfoCache = newCmdsInfoCache(ring.cmdsInfo)
ring.cmdable = ring.Process
ring.initHooks(hooks{
process: ring.process,
pipeline: func(ctx context.Context, cmds []Cmder) error {
return ring.generalProcessPipeline(ctx, cmds, false)
},
txPipeline: func(ctx context.Context, cmds []Cmder) error {
return ring.generalProcessPipeline(ctx, cmds, true)
},
})
go ring.sharding.Heartbeat(hbCtx, opt.HeartbeatFrequency)
return &ring
}
func (c *Ring) SetAddrs(addrs map[string]string) {
c.sharding.SetAddrs(addrs)
}
func (c *Ring) Process(ctx context.Context, cmd Cmder) error {
err := c.processHook(ctx, cmd)
cmd.SetErr(err)
return err
}
// Options returns read-only Options that were used to create the client.
func (c *Ring) Options() *RingOptions {
return c.opt
}
func (c *Ring) retryBackoff(attempt int) time.Duration {
return internal.RetryBackoff(attempt, c.opt.MinRetryBackoff, c.opt.MaxRetryBackoff)
}
// PoolStats returns accumulated connection pool stats.
func (c *Ring) PoolStats() *PoolStats {
// note: `c.List()` return a shadow copy of `[]*ringShard`.
shards := c.sharding.List()
var acc PoolStats
for _, shard := range shards {
s := shard.Client.connPool.Stats()
acc.Hits += s.Hits
acc.Misses += s.Misses
acc.Timeouts += s.Timeouts
acc.TotalConns += s.TotalConns
acc.IdleConns += s.IdleConns
}
return &acc
}
// Len returns the current number of shards in the ring.
func (c *Ring) Len() int {
return c.sharding.Len()
}
// Subscribe subscribes the client to the specified channels.
func (c *Ring) Subscribe(ctx context.Context, channels ...string) *PubSub {
if len(channels) == 0 {
panic("at least one channel is required")
}
shard, err := c.sharding.GetByKey(channels[0])
if err != nil {
// TODO: return PubSub with sticky error
panic(err)
}
return shard.Client.Subscribe(ctx, channels...)
}
// PSubscribe subscribes the client to the given patterns.
func (c *Ring) PSubscribe(ctx context.Context, channels ...string) *PubSub {
if len(channels) == 0 {
panic("at least one channel is required")
}
shard, err := c.sharding.GetByKey(channels[0])
if err != nil {
// TODO: return PubSub with sticky error
panic(err)
}
return shard.Client.PSubscribe(ctx, channels...)
}
// SSubscribe Subscribes the client to the specified shard channels.
func (c *Ring) SSubscribe(ctx context.Context, channels ...string) *PubSub {
if len(channels) == 0 {
panic("at least one channel is required")
}
shard, err := c.sharding.GetByKey(channels[0])
if err != nil {
// TODO: return PubSub with sticky error
panic(err)
}
return shard.Client.SSubscribe(ctx, channels...)
}
func (c *Ring) OnNewNode(fn func(rdb *Client)) {
c.sharding.OnNewNode(fn)
}
// ForEachShard concurrently calls the fn on each live shard in the ring.
// It returns the first error if any.
func (c *Ring) ForEachShard(
ctx context.Context,
fn func(ctx context.Context, client *Client) error,
) error {
// note: `c.List()` return a shadow copy of `[]*ringShard`.
shards := c.sharding.List()
var wg sync.WaitGroup
errCh := make(chan error, 1)
for _, shard := range shards {
if shard.IsDown() {
continue
}
wg.Add(1)
go func(shard *ringShard) {
defer wg.Done()
err := fn(ctx, shard.Client)
if err != nil {
select {
case errCh <- err:
default:
}
}
}(shard)
}
wg.Wait()
select {
case err := <-errCh:
return err
default:
return nil
}
}
func (c *Ring) cmdsInfo(ctx context.Context) (map[string]*CommandInfo, error) {
// note: `c.List()` return a shadow copy of `[]*ringShard`.
shards := c.sharding.List()
var firstErr error
for _, shard := range shards {
cmdsInfo, err := shard.Client.Command(ctx).Result()
if err == nil {
return cmdsInfo, nil
}
if firstErr == nil {
firstErr = err
}
}
if firstErr == nil {
return nil, errRingShardsDown
}
return nil, firstErr
}
func (c *Ring) cmdShard(cmd Cmder) (*ringShard, error) {
pos := cmdFirstKeyPos(cmd)
if pos == 0 {
return c.sharding.Random()
}
firstKey := cmd.stringArg(pos)
return c.sharding.GetByKey(firstKey)
}
func (c *Ring) process(ctx context.Context, cmd Cmder) error {
var lastErr error
for attempt := 0; attempt <= c.opt.MaxRetries; attempt++ {
if attempt > 0 {
if err := internal.Sleep(ctx, c.retryBackoff(attempt)); err != nil {
return err
}
}
shard, err := c.cmdShard(cmd)
if err != nil {
return err
}
lastErr = shard.Client.Process(ctx, cmd)
if lastErr == nil || !shouldRetry(lastErr, cmd.readTimeout() == nil) {
return lastErr
}
}
return lastErr
}
func (c *Ring) Pipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.Pipeline().Pipelined(ctx, fn)
}
func (c *Ring) Pipeline() Pipeliner {
pipe := Pipeline{
exec: pipelineExecer(c.processPipelineHook),
}
pipe.init()
return &pipe
}
func (c *Ring) TxPipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.TxPipeline().Pipelined(ctx, fn)
}
func (c *Ring) TxPipeline() Pipeliner {
pipe := Pipeline{
exec: func(ctx context.Context, cmds []Cmder) error {
cmds = wrapMultiExec(ctx, cmds)
return c.processTxPipelineHook(ctx, cmds)
},
}
pipe.init()
return &pipe
}
func (c *Ring) generalProcessPipeline(
ctx context.Context, cmds []Cmder, tx bool,
) error {
if tx {
// Trim multi .. exec.
cmds = cmds[1 : len(cmds)-1]
}
cmdsMap := make(map[string][]Cmder)
for _, cmd := range cmds {
hash := cmd.stringArg(cmdFirstKeyPos(cmd))
if hash != "" {
hash = c.sharding.Hash(hash)
}
cmdsMap[hash] = append(cmdsMap[hash], cmd)
}
var wg sync.WaitGroup
errs := make(chan error, len(cmdsMap))
for hash, cmds := range cmdsMap {
wg.Add(1)
go func(hash string, cmds []Cmder) {
defer wg.Done()
// TODO: retry?
shard, err := c.sharding.GetByName(hash)
if err != nil {
setCmdsErr(cmds, err)
return
}
hook := shard.Client.processPipelineHook
if tx {
cmds = wrapMultiExec(ctx, cmds)
hook = shard.Client.processTxPipelineHook
}
if err = hook(ctx, cmds); err != nil {
errs <- err
}
}(hash, cmds)
}
wg.Wait()
close(errs)
if err := <-errs; err != nil {
return err
}
return cmdsFirstErr(cmds)
}
func (c *Ring) Watch(ctx context.Context, fn func(*Tx) error, keys ...string) error {
if len(keys) == 0 {
return fmt.Errorf("redis: Watch requires at least one key")
}
var shards []*ringShard
for _, key := range keys {
if key != "" {
shard, err := c.sharding.GetByKey(key)
if err != nil {
return err
}
shards = append(shards, shard)
}
}
if len(shards) == 0 {
return fmt.Errorf("redis: Watch requires at least one shard")
}
if len(shards) > 1 {
for _, shard := range shards[1:] {
if shard.Client != shards[0].Client {
err := fmt.Errorf("redis: Watch requires all keys to be in the same shard")
return err
}
}
}
return shards[0].Client.Watch(ctx, fn, keys...)
}
// Close closes the ring client, releasing any open resources.
//
// It is rare to Close a Ring, as the Ring is meant to be long-lived
// and shared between many goroutines.
func (c *Ring) Close() error {
c.heartbeatCancelFn()
return c.sharding.Close()
}
// GetShardClients returns a list of all shard clients in the ring.
// This can be used to create dedicated connections (e.g., PubSub) for each shard.
func (c *Ring) GetShardClients() []*Client {
shards := c.sharding.List()
clients := make([]*Client, 0, len(shards))
for _, shard := range shards {
if shard.IsUp() {
clients = append(clients, shard.Client)
}
}
return clients
}
// GetShardClientForKey returns the shard client that would handle the given key.
// This can be used to determine which shard a particular key/channel would be routed to.
func (c *Ring) GetShardClientForKey(key string) (*Client, error) {
shard, err := c.sharding.GetByKey(key)
if err != nil {
return nil, err
}
return shard.Client, nil
}
package redis
import (
"context"
"crypto/sha1"
"encoding/hex"
"io"
)
type Scripter interface {
Eval(ctx context.Context, script string, keys []string, args ...interface{}) *Cmd
EvalSha(ctx context.Context, sha1 string, keys []string, args ...interface{}) *Cmd
EvalRO(ctx context.Context, script string, keys []string, args ...interface{}) *Cmd
EvalShaRO(ctx context.Context, sha1 string, keys []string, args ...interface{}) *Cmd
ScriptExists(ctx context.Context, hashes ...string) *BoolSliceCmd
ScriptLoad(ctx context.Context, script string) *StringCmd
}
var (
_ Scripter = (*Client)(nil)
_ Scripter = (*Ring)(nil)
_ Scripter = (*ClusterClient)(nil)
)
type Script struct {
src, hash string
}
func NewScript(src string) *Script {
h := sha1.New()
_, _ = io.WriteString(h, src)
return &Script{
src: src,
hash: hex.EncodeToString(h.Sum(nil)),
}
}
func (s *Script) Hash() string {
return s.hash
}
func (s *Script) Load(ctx context.Context, c Scripter) *StringCmd {
return c.ScriptLoad(ctx, s.src)
}
func (s *Script) Exists(ctx context.Context, c Scripter) *BoolSliceCmd {
return c.ScriptExists(ctx, s.hash)
}
func (s *Script) Eval(ctx context.Context, c Scripter, keys []string, args ...interface{}) *Cmd {
return c.Eval(ctx, s.src, keys, args...)
}
func (s *Script) EvalRO(ctx context.Context, c Scripter, keys []string, args ...interface{}) *Cmd {
return c.EvalRO(ctx, s.src, keys, args...)
}
func (s *Script) EvalSha(ctx context.Context, c Scripter, keys []string, args ...interface{}) *Cmd {
return c.EvalSha(ctx, s.hash, keys, args...)
}
func (s *Script) EvalShaRO(ctx context.Context, c Scripter, keys []string, args ...interface{}) *Cmd {
return c.EvalShaRO(ctx, s.hash, keys, args...)
}
// Run optimistically uses EVALSHA to run the script. If script does not exist
// it is retried using EVAL.
func (s *Script) Run(ctx context.Context, c Scripter, keys []string, args ...interface{}) *Cmd {
r := s.EvalSha(ctx, c, keys, args...)
if HasErrorPrefix(r.Err(), "NOSCRIPT") {
return s.Eval(ctx, c, keys, args...)
}
return r
}
// RunRO optimistically uses EVALSHA_RO to run the script. If script does not exist
// it is retried using EVAL_RO.
func (s *Script) RunRO(ctx context.Context, c Scripter, keys []string, args ...interface{}) *Cmd {
r := s.EvalShaRO(ctx, c, keys, args...)
if HasErrorPrefix(r.Err(), "NOSCRIPT") {
return s.EvalRO(ctx, c, keys, args...)
}
return r
}
package redis
import "context"
type ScriptingFunctionsCmdable interface {
Eval(ctx context.Context, script string, keys []string, args ...interface{}) *Cmd
EvalSha(ctx context.Context, sha1 string, keys []string, args ...interface{}) *Cmd
EvalRO(ctx context.Context, script string, keys []string, args ...interface{}) *Cmd
EvalShaRO(ctx context.Context, sha1 string, keys []string, args ...interface{}) *Cmd
ScriptExists(ctx context.Context, hashes ...string) *BoolSliceCmd
ScriptFlush(ctx context.Context) *StatusCmd
ScriptKill(ctx context.Context) *StatusCmd
ScriptLoad(ctx context.Context, script string) *StringCmd
FunctionLoad(ctx context.Context, code string) *StringCmd
FunctionLoadReplace(ctx context.Context, code string) *StringCmd
FunctionDelete(ctx context.Context, libName string) *StringCmd
FunctionFlush(ctx context.Context) *StringCmd
FunctionKill(ctx context.Context) *StringCmd
FunctionFlushAsync(ctx context.Context) *StringCmd
FunctionList(ctx context.Context, q FunctionListQuery) *FunctionListCmd
FunctionDump(ctx context.Context) *StringCmd
FunctionRestore(ctx context.Context, libDump string) *StringCmd
FunctionStats(ctx context.Context) *FunctionStatsCmd
FCall(ctx context.Context, function string, keys []string, args ...interface{}) *Cmd
FCallRo(ctx context.Context, function string, keys []string, args ...interface{}) *Cmd
FCallRO(ctx context.Context, function string, keys []string, args ...interface{}) *Cmd
}
func (c cmdable) Eval(ctx context.Context, script string, keys []string, args ...interface{}) *Cmd {
return c.eval(ctx, "eval", script, keys, args...)
}
func (c cmdable) EvalRO(ctx context.Context, script string, keys []string, args ...interface{}) *Cmd {
return c.eval(ctx, "eval_ro", script, keys, args...)
}
func (c cmdable) EvalSha(ctx context.Context, sha1 string, keys []string, args ...interface{}) *Cmd {
return c.eval(ctx, "evalsha", sha1, keys, args...)
}
func (c cmdable) EvalShaRO(ctx context.Context, sha1 string, keys []string, args ...interface{}) *Cmd {
return c.eval(ctx, "evalsha_ro", sha1, keys, args...)
}
func (c cmdable) eval(ctx context.Context, name, payload string, keys []string, args ...interface{}) *Cmd {
cmdArgs := make([]interface{}, 3+len(keys), 3+len(keys)+len(args))
cmdArgs[0] = name
cmdArgs[1] = payload
cmdArgs[2] = len(keys)
for i, key := range keys {
cmdArgs[3+i] = key
}
cmdArgs = appendArgs(cmdArgs, args)
cmd := NewCmd(ctx, cmdArgs...)
// it is possible that only args exist without a key.
// rdb.eval(ctx, eval, script, nil, arg1, arg2)
if len(keys) > 0 {
cmd.SetFirstKeyPos(3)
}
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ScriptExists(ctx context.Context, hashes ...string) *BoolSliceCmd {
args := make([]interface{}, 2+len(hashes))
args[0] = "script"
args[1] = "exists"
for i, hash := range hashes {
args[2+i] = hash
}
cmd := NewBoolSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ScriptFlush(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "script", "flush")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ScriptKill(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "script", "kill")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ScriptLoad(ctx context.Context, script string) *StringCmd {
cmd := NewStringCmd(ctx, "script", "load", script)
_ = c(ctx, cmd)
return cmd
}
// ------------------------------------------------------------------------------
// FunctionListQuery is used with FunctionList to query for Redis libraries
//
// LibraryNamePattern - Use an empty string to get all libraries.
// - Use a glob-style pattern to match multiple libraries with a matching name
// - Use a library's full name to match a single library
// WithCode - If true, it will return the code of the library
type FunctionListQuery struct {
LibraryNamePattern string
WithCode bool
}
func (c cmdable) FunctionLoad(ctx context.Context, code string) *StringCmd {
cmd := NewStringCmd(ctx, "function", "load", code)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionLoadReplace(ctx context.Context, code string) *StringCmd {
cmd := NewStringCmd(ctx, "function", "load", "replace", code)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionDelete(ctx context.Context, libName string) *StringCmd {
cmd := NewStringCmd(ctx, "function", "delete", libName)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionFlush(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "function", "flush")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionKill(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "function", "kill")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionFlushAsync(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "function", "flush", "async")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionList(ctx context.Context, q FunctionListQuery) *FunctionListCmd {
args := make([]interface{}, 2, 5)
args[0] = "function"
args[1] = "list"
if q.LibraryNamePattern != "" {
args = append(args, "libraryname", q.LibraryNamePattern)
}
if q.WithCode {
args = append(args, "withcode")
}
cmd := NewFunctionListCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionDump(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "function", "dump")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionRestore(ctx context.Context, libDump string) *StringCmd {
cmd := NewStringCmd(ctx, "function", "restore", libDump)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FunctionStats(ctx context.Context) *FunctionStatsCmd {
cmd := NewFunctionStatsCmd(ctx, "function", "stats")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) FCall(ctx context.Context, function string, keys []string, args ...interface{}) *Cmd {
cmdArgs := fcallArgs("fcall", function, keys, args...)
cmd := NewCmd(ctx, cmdArgs...)
if len(keys) > 0 {
cmd.SetFirstKeyPos(3)
}
_ = c(ctx, cmd)
return cmd
}
// FCallRo this function simply calls FCallRO,
// Deprecated: to maintain convention FCallRO.
func (c cmdable) FCallRo(ctx context.Context, function string, keys []string, args ...interface{}) *Cmd {
return c.FCallRO(ctx, function, keys, args...)
}
func (c cmdable) FCallRO(ctx context.Context, function string, keys []string, args ...interface{}) *Cmd {
cmdArgs := fcallArgs("fcall_ro", function, keys, args...)
cmd := NewCmd(ctx, cmdArgs...)
if len(keys) > 0 {
cmd.SetFirstKeyPos(3)
}
_ = c(ctx, cmd)
return cmd
}
func fcallArgs(command string, function string, keys []string, args ...interface{}) []interface{} {
cmdArgs := make([]interface{}, 3+len(keys), 3+len(keys)+len(args))
cmdArgs[0] = command
cmdArgs[1] = function
cmdArgs[2] = len(keys)
for i, key := range keys {
cmdArgs[3+i] = key
}
cmdArgs = append(cmdArgs, args...)
return cmdArgs
}
package redis
import (
"context"
)
// ----------------------
// Search Module Builders
// ----------------------
// SearchBuilder provides a fluent API for FT.SEARCH
// (see original FTSearchOptions for all options).
// EXPERIMENTAL: this API is subject to change, use with caution.
type SearchBuilder struct {
c *Client
ctx context.Context
index string
query string
options *FTSearchOptions
}
// NewSearchBuilder creates a new SearchBuilder for FT.SEARCH commands.
// EXPERIMENTAL: this API is subject to change, use with caution.
func (c *Client) NewSearchBuilder(ctx context.Context, index, query string) *SearchBuilder {
b := &SearchBuilder{c: c, ctx: ctx, index: index, query: query, options: &FTSearchOptions{LimitOffset: -1}}
return b
}
// WithScores includes WITHSCORES.
func (b *SearchBuilder) WithScores() *SearchBuilder {
b.options.WithScores = true
return b
}
// NoContent includes NOCONTENT.
func (b *SearchBuilder) NoContent() *SearchBuilder { b.options.NoContent = true; return b }
// Verbatim includes VERBATIM.
func (b *SearchBuilder) Verbatim() *SearchBuilder { b.options.Verbatim = true; return b }
// NoStopWords includes NOSTOPWORDS.
func (b *SearchBuilder) NoStopWords() *SearchBuilder { b.options.NoStopWords = true; return b }
// WithPayloads includes WITHPAYLOADS.
func (b *SearchBuilder) WithPayloads() *SearchBuilder {
b.options.WithPayloads = true
return b
}
// WithSortKeys includes WITHSORTKEYS.
func (b *SearchBuilder) WithSortKeys() *SearchBuilder {
b.options.WithSortKeys = true
return b
}
// Filter adds a FILTER clause: FILTER <field> <min> <max>.
func (b *SearchBuilder) Filter(field string, min, max interface{}) *SearchBuilder {
b.options.Filters = append(b.options.Filters, FTSearchFilter{
FieldName: field,
Min: min,
Max: max,
})
return b
}
// GeoFilter adds a GEOFILTER clause: GEOFILTER <field> <lon> <lat> <radius> <unit>.
func (b *SearchBuilder) GeoFilter(field string, lon, lat, radius float64, unit string) *SearchBuilder {
b.options.GeoFilter = append(b.options.GeoFilter, FTSearchGeoFilter{
FieldName: field,
Longitude: lon,
Latitude: lat,
Radius: radius,
Unit: unit,
})
return b
}
// InKeys restricts the search to the given keys.
func (b *SearchBuilder) InKeys(keys ...interface{}) *SearchBuilder {
b.options.InKeys = append(b.options.InKeys, keys...)
return b
}
// InFields restricts the search to the given fields.
func (b *SearchBuilder) InFields(fields ...interface{}) *SearchBuilder {
b.options.InFields = append(b.options.InFields, fields...)
return b
}
// ReturnFields adds simple RETURN <n> <field>...
func (b *SearchBuilder) ReturnFields(fields ...string) *SearchBuilder {
for _, f := range fields {
b.options.Return = append(b.options.Return, FTSearchReturn{FieldName: f})
}
return b
}
// ReturnAs adds RETURN <field> AS <alias>.
func (b *SearchBuilder) ReturnAs(field, alias string) *SearchBuilder {
b.options.Return = append(b.options.Return, FTSearchReturn{FieldName: field, As: alias})
return b
}
// Slop adds SLOP <n>.
func (b *SearchBuilder) Slop(slop int) *SearchBuilder {
b.options.Slop = slop
return b
}
// Timeout adds TIMEOUT <ms>.
func (b *SearchBuilder) Timeout(timeout int) *SearchBuilder {
b.options.Timeout = timeout
return b
}
// InOrder includes INORDER.
func (b *SearchBuilder) InOrder() *SearchBuilder {
b.options.InOrder = true
return b
}
// Language sets LANGUAGE <lang>.
func (b *SearchBuilder) Language(lang string) *SearchBuilder {
b.options.Language = lang
return b
}
// Expander sets EXPANDER <expander>.
func (b *SearchBuilder) Expander(expander string) *SearchBuilder {
b.options.Expander = expander
return b
}
// Scorer sets SCORER <scorer>.
func (b *SearchBuilder) Scorer(scorer string) *SearchBuilder {
b.options.Scorer = scorer
return b
}
// ExplainScore includes EXPLAINSCORE.
func (b *SearchBuilder) ExplainScore() *SearchBuilder {
b.options.ExplainScore = true
return b
}
// Payload sets PAYLOAD <payload>.
func (b *SearchBuilder) Payload(payload string) *SearchBuilder {
b.options.Payload = payload
return b
}
// SortBy adds SORTBY <field> ASC|DESC.
func (b *SearchBuilder) SortBy(field string, asc bool) *SearchBuilder {
b.options.SortBy = append(b.options.SortBy, FTSearchSortBy{
FieldName: field,
Asc: asc,
Desc: !asc,
})
return b
}
// WithSortByCount includes WITHCOUNT (when used with SortBy).
func (b *SearchBuilder) WithSortByCount() *SearchBuilder {
b.options.SortByWithCount = true
return b
}
// Param adds a single PARAMS <k> <v>.
func (b *SearchBuilder) Param(key string, value interface{}) *SearchBuilder {
if b.options.Params == nil {
b.options.Params = make(map[string]interface{}, 1)
}
b.options.Params[key] = value
return b
}
// ParamsMap adds multiple PARAMS at once.
func (b *SearchBuilder) ParamsMap(p map[string]interface{}) *SearchBuilder {
if b.options.Params == nil {
b.options.Params = make(map[string]interface{}, len(p))
}
for k, v := range p {
b.options.Params[k] = v
}
return b
}
// Dialect sets DIALECT <version>.
func (b *SearchBuilder) Dialect(version int) *SearchBuilder {
b.options.DialectVersion = version
return b
}
// Limit sets OFFSET and COUNT. CountOnly uses LIMIT 0 0.
func (b *SearchBuilder) Limit(offset, count int) *SearchBuilder {
b.options.LimitOffset = offset
b.options.Limit = count
return b
}
func (b *SearchBuilder) CountOnly() *SearchBuilder { b.options.CountOnly = true; return b }
// Run executes FT.SEARCH and returns a typed result.
func (b *SearchBuilder) Run() (FTSearchResult, error) {
cmd := b.c.FTSearchWithArgs(b.ctx, b.index, b.query, b.options)
return cmd.Result()
}
// ----------------------
// AggregateBuilder for FT.AGGREGATE
// ----------------------
type AggregateBuilder struct {
c *Client
ctx context.Context
index string
query string
options *FTAggregateOptions
}
// NewAggregateBuilder creates a new AggregateBuilder for FT.AGGREGATE commands.
// EXPERIMENTAL: this API is subject to change, use with caution.
func (c *Client) NewAggregateBuilder(ctx context.Context, index, query string) *AggregateBuilder {
return &AggregateBuilder{c: c, ctx: ctx, index: index, query: query, options: &FTAggregateOptions{LimitOffset: -1}}
}
// Verbatim includes VERBATIM.
func (b *AggregateBuilder) Verbatim() *AggregateBuilder { b.options.Verbatim = true; return b }
// AddScores includes ADDSCORES.
func (b *AggregateBuilder) AddScores() *AggregateBuilder { b.options.AddScores = true; return b }
// Scorer sets SCORER <scorer>.
func (b *AggregateBuilder) Scorer(s string) *AggregateBuilder {
b.options.Scorer = s
return b
}
// LoadAll includes LOAD * (mutually exclusive with Load).
func (b *AggregateBuilder) LoadAll() *AggregateBuilder {
b.options.LoadAll = true
return b
}
// Load adds LOAD <n> <field> [AS alias]...
// You can call it multiple times for multiple fields.
func (b *AggregateBuilder) Load(field string, alias ...string) *AggregateBuilder {
// each Load entry becomes one element in options.Load
l := FTAggregateLoad{Field: field}
if len(alias) > 0 {
l.As = alias[0]
}
b.options.Load = append(b.options.Load, l)
return b
}
// Timeout sets TIMEOUT <ms>.
func (b *AggregateBuilder) Timeout(ms int) *AggregateBuilder {
b.options.Timeout = ms
return b
}
// Apply adds APPLY <field> [AS alias].
func (b *AggregateBuilder) Apply(field string, alias ...string) *AggregateBuilder {
a := FTAggregateApply{Field: field}
if len(alias) > 0 {
a.As = alias[0]
}
b.options.Apply = append(b.options.Apply, a)
return b
}
// GroupBy starts a new GROUPBY <fields...> clause.
func (b *AggregateBuilder) GroupBy(fields ...interface{}) *AggregateBuilder {
b.options.GroupBy = append(b.options.GroupBy, FTAggregateGroupBy{
Fields: fields,
})
return b
}
// Reduce adds a REDUCE <fn> [<#args> <args...>] clause to the *last* GROUPBY.
func (b *AggregateBuilder) Reduce(fn SearchAggregator, args ...interface{}) *AggregateBuilder {
if len(b.options.GroupBy) == 0 {
// no GROUPBY yet — nothing to attach to
return b
}
idx := len(b.options.GroupBy) - 1
b.options.GroupBy[idx].Reduce = append(b.options.GroupBy[idx].Reduce, FTAggregateReducer{
Reducer: fn,
Args: args,
})
return b
}
// ReduceAs does the same but also sets an alias: REDUCE <fn> … AS <alias>
func (b *AggregateBuilder) ReduceAs(fn SearchAggregator, alias string, args ...interface{}) *AggregateBuilder {
if len(b.options.GroupBy) == 0 {
return b
}
idx := len(b.options.GroupBy) - 1
b.options.GroupBy[idx].Reduce = append(b.options.GroupBy[idx].Reduce, FTAggregateReducer{
Reducer: fn,
Args: args,
As: alias,
})
return b
}
// SortBy adds SORTBY <field> ASC|DESC.
func (b *AggregateBuilder) SortBy(field string, asc bool) *AggregateBuilder {
sb := FTAggregateSortBy{FieldName: field, Asc: asc, Desc: !asc}
b.options.SortBy = append(b.options.SortBy, sb)
return b
}
// SortByMax sets MAX <n> (only if SortBy was called).
func (b *AggregateBuilder) SortByMax(max int) *AggregateBuilder {
b.options.SortByMax = max
return b
}
// Filter sets FILTER <expr>.
func (b *AggregateBuilder) Filter(expr string) *AggregateBuilder {
b.options.Filter = expr
return b
}
// WithCursor enables WITHCURSOR [COUNT <n>] [MAXIDLE <ms>].
func (b *AggregateBuilder) WithCursor(count, maxIdle int) *AggregateBuilder {
b.options.WithCursor = true
if b.options.WithCursorOptions == nil {
b.options.WithCursorOptions = &FTAggregateWithCursor{}
}
b.options.WithCursorOptions.Count = count
b.options.WithCursorOptions.MaxIdle = maxIdle
return b
}
// Params adds PARAMS <k v> pairs.
func (b *AggregateBuilder) Params(p map[string]interface{}) *AggregateBuilder {
if b.options.Params == nil {
b.options.Params = make(map[string]interface{}, len(p))
}
for k, v := range p {
b.options.Params[k] = v
}
return b
}
// Dialect sets DIALECT <version>.
func (b *AggregateBuilder) Dialect(version int) *AggregateBuilder {
b.options.DialectVersion = version
return b
}
// Run executes FT.AGGREGATE and returns a typed result.
func (b *AggregateBuilder) Run() (*FTAggregateResult, error) {
cmd := b.c.FTAggregateWithArgs(b.ctx, b.index, b.query, b.options)
return cmd.Result()
}
// ----------------------
// CreateIndexBuilder for FT.CREATE
// ----------------------
// CreateIndexBuilder is builder for FT.CREATE
// EXPERIMENTAL: this API is subject to change, use with caution.
type CreateIndexBuilder struct {
c *Client
ctx context.Context
index string
options *FTCreateOptions
schema []*FieldSchema
}
// NewCreateIndexBuilder creates a new CreateIndexBuilder for FT.CREATE commands.
// EXPERIMENTAL: this API is subject to change, use with caution.
func (c *Client) NewCreateIndexBuilder(ctx context.Context, index string) *CreateIndexBuilder {
return &CreateIndexBuilder{c: c, ctx: ctx, index: index, options: &FTCreateOptions{}}
}
// OnHash sets ON HASH.
func (b *CreateIndexBuilder) OnHash() *CreateIndexBuilder { b.options.OnHash = true; return b }
// OnJSON sets ON JSON.
func (b *CreateIndexBuilder) OnJSON() *CreateIndexBuilder { b.options.OnJSON = true; return b }
// Prefix sets PREFIX.
func (b *CreateIndexBuilder) Prefix(prefixes ...interface{}) *CreateIndexBuilder {
b.options.Prefix = prefixes
return b
}
// Filter sets FILTER.
func (b *CreateIndexBuilder) Filter(filter string) *CreateIndexBuilder {
b.options.Filter = filter
return b
}
// DefaultLanguage sets LANGUAGE.
func (b *CreateIndexBuilder) DefaultLanguage(lang string) *CreateIndexBuilder {
b.options.DefaultLanguage = lang
return b
}
// LanguageField sets LANGUAGE_FIELD.
func (b *CreateIndexBuilder) LanguageField(field string) *CreateIndexBuilder {
b.options.LanguageField = field
return b
}
// Score sets SCORE.
func (b *CreateIndexBuilder) Score(score float64) *CreateIndexBuilder {
b.options.Score = score
return b
}
// ScoreField sets SCORE_FIELD.
func (b *CreateIndexBuilder) ScoreField(field string) *CreateIndexBuilder {
b.options.ScoreField = field
return b
}
// PayloadField sets PAYLOAD_FIELD.
func (b *CreateIndexBuilder) PayloadField(field string) *CreateIndexBuilder {
b.options.PayloadField = field
return b
}
// NoOffsets includes NOOFFSETS.
func (b *CreateIndexBuilder) NoOffsets() *CreateIndexBuilder { b.options.NoOffsets = true; return b }
// Temporary sets TEMPORARY seconds.
func (b *CreateIndexBuilder) Temporary(sec int) *CreateIndexBuilder {
b.options.Temporary = sec
return b
}
// NoHL includes NOHL.
func (b *CreateIndexBuilder) NoHL() *CreateIndexBuilder { b.options.NoHL = true; return b }
// NoFields includes NOFIELDS.
func (b *CreateIndexBuilder) NoFields() *CreateIndexBuilder { b.options.NoFields = true; return b }
// NoFreqs includes NOFREQS.
func (b *CreateIndexBuilder) NoFreqs() *CreateIndexBuilder { b.options.NoFreqs = true; return b }
// StopWords sets STOPWORDS.
func (b *CreateIndexBuilder) StopWords(words ...interface{}) *CreateIndexBuilder {
b.options.StopWords = words
return b
}
// SkipInitialScan includes SKIPINITIALSCAN.
func (b *CreateIndexBuilder) SkipInitialScan() *CreateIndexBuilder {
b.options.SkipInitialScan = true
return b
}
// Schema adds a FieldSchema.
func (b *CreateIndexBuilder) Schema(field *FieldSchema) *CreateIndexBuilder {
b.schema = append(b.schema, field)
return b
}
// Run executes FT.CREATE and returns the status.
func (b *CreateIndexBuilder) Run() (string, error) {
cmd := b.c.FTCreate(b.ctx, b.index, b.options, b.schema...)
return cmd.Result()
}
// ----------------------
// DropIndexBuilder for FT.DROPINDEX
// ----------------------
// DropIndexBuilder is a builder for FT.DROPINDEX
// EXPERIMENTAL: this API is subject to change, use with caution.
type DropIndexBuilder struct {
c *Client
ctx context.Context
index string
options *FTDropIndexOptions
}
// NewDropIndexBuilder creates a new DropIndexBuilder for FT.DROPINDEX commands.
// EXPERIMENTAL: this API is subject to change, use with caution.
func (c *Client) NewDropIndexBuilder(ctx context.Context, index string) *DropIndexBuilder {
return &DropIndexBuilder{c: c, ctx: ctx, index: index}
}
// DeleteRuncs includes DD.
func (b *DropIndexBuilder) DeleteDocs() *DropIndexBuilder { b.options.DeleteDocs = true; return b }
// Run executes FT.DROPINDEX.
func (b *DropIndexBuilder) Run() (string, error) {
cmd := b.c.FTDropIndexWithArgs(b.ctx, b.index, b.options)
return cmd.Result()
}
// ----------------------
// AliasBuilder for FT.ALIAS* commands
// ----------------------
// AliasBuilder is builder for FT.ALIAS* commands
// EXPERIMENTAL: this API is subject to change, use with caution.
type AliasBuilder struct {
c *Client
ctx context.Context
alias string
index string
action string // add|del|update
}
// NewAliasBuilder creates a new AliasBuilder for FT.ALIAS* commands.
// EXPERIMENTAL: this API is subject to change, use with caution.
func (c *Client) NewAliasBuilder(ctx context.Context, alias string) *AliasBuilder {
return &AliasBuilder{c: c, ctx: ctx, alias: alias}
}
// Action sets the action for the alias builder.
func (b *AliasBuilder) Action(action string) *AliasBuilder {
b.action = action
return b
}
// Add sets the action to "add" and requires an index.
func (b *AliasBuilder) Add(index string) *AliasBuilder {
b.action = "add"
b.index = index
return b
}
// Del sets the action to "del".
func (b *AliasBuilder) Del() *AliasBuilder {
b.action = "del"
return b
}
// Update sets the action to "update" and requires an index.
func (b *AliasBuilder) Update(index string) *AliasBuilder {
b.action = "update"
b.index = index
return b
}
// Run executes the configured alias command.
func (b *AliasBuilder) Run() (string, error) {
switch b.action {
case "add":
cmd := b.c.FTAliasAdd(b.ctx, b.index, b.alias)
return cmd.Result()
case "del":
cmd := b.c.FTAliasDel(b.ctx, b.alias)
return cmd.Result()
case "update":
cmd := b.c.FTAliasUpdate(b.ctx, b.index, b.alias)
return cmd.Result()
}
return "", nil
}
// ----------------------
// ExplainBuilder for FT.EXPLAIN
// ----------------------
// ExplainBuilder is builder for FT.EXPLAIN
// EXPERIMENTAL: this API is subject to change, use with caution.
type ExplainBuilder struct {
c *Client
ctx context.Context
index string
query string
options *FTExplainOptions
}
// NewExplainBuilder creates a new ExplainBuilder for FT.EXPLAIN commands.
// EXPERIMENTAL: this API is subject to change, use with caution.
func (c *Client) NewExplainBuilder(ctx context.Context, index, query string) *ExplainBuilder {
return &ExplainBuilder{c: c, ctx: ctx, index: index, query: query, options: &FTExplainOptions{}}
}
// Dialect sets dialect for EXPLAINCLI.
func (b *ExplainBuilder) Dialect(d string) *ExplainBuilder { b.options.Dialect = d; return b }
// Run executes FT.EXPLAIN and returns the plan.
func (b *ExplainBuilder) Run() (string, error) {
cmd := b.c.FTExplainWithArgs(b.ctx, b.index, b.query, b.options)
return cmd.Result()
}
// ----------------------
// InfoBuilder for FT.INFO
// ----------------------
type FTInfoBuilder struct {
c *Client
ctx context.Context
index string
}
// NewSearchInfoBuilder creates a new FTInfoBuilder for FT.INFO commands.
func (c *Client) NewSearchInfoBuilder(ctx context.Context, index string) *FTInfoBuilder {
return &FTInfoBuilder{c: c, ctx: ctx, index: index}
}
// Run executes FT.INFO and returns detailed info.
func (b *FTInfoBuilder) Run() (FTInfoResult, error) {
cmd := b.c.FTInfo(b.ctx, b.index)
return cmd.Result()
}
// ----------------------
// SpellCheckBuilder for FT.SPELLCHECK
// ----------------------
// SpellCheckBuilder is builder for FT.SPELLCHECK
// EXPERIMENTAL: this API is subject to change, use with caution.
type SpellCheckBuilder struct {
c *Client
ctx context.Context
index string
query string
options *FTSpellCheckOptions
}
// NewSpellCheckBuilder creates a new SpellCheckBuilder for FT.SPELLCHECK commands.
// EXPERIMENTAL: this API is subject to change, use with caution.
func (c *Client) NewSpellCheckBuilder(ctx context.Context, index, query string) *SpellCheckBuilder {
return &SpellCheckBuilder{c: c, ctx: ctx, index: index, query: query, options: &FTSpellCheckOptions{}}
}
// Distance sets MAXDISTANCE.
func (b *SpellCheckBuilder) Distance(d int) *SpellCheckBuilder { b.options.Distance = d; return b }
// Terms sets INCLUDE or EXCLUDE terms.
func (b *SpellCheckBuilder) Terms(include bool, dictionary string, terms ...interface{}) *SpellCheckBuilder {
if b.options.Terms == nil {
b.options.Terms = &FTSpellCheckTerms{}
}
if include {
b.options.Terms.Inclusion = "INCLUDE"
} else {
b.options.Terms.Inclusion = "EXCLUDE"
}
b.options.Terms.Dictionary = dictionary
b.options.Terms.Terms = terms
return b
}
// Dialect sets dialect version.
func (b *SpellCheckBuilder) Dialect(d int) *SpellCheckBuilder { b.options.Dialect = d; return b }
// Run executes FT.SPELLCHECK and returns suggestions.
func (b *SpellCheckBuilder) Run() ([]SpellCheckResult, error) {
cmd := b.c.FTSpellCheckWithArgs(b.ctx, b.index, b.query, b.options)
return cmd.Result()
}
// ----------------------
// DictBuilder for FT.DICT* commands
// ----------------------
// DictBuilder is builder for FT.DICT* commands
// EXPERIMENTAL: this API is subject to change, use with caution.
type DictBuilder struct {
c *Client
ctx context.Context
dict string
terms []interface{}
action string // add|del|dump
}
// NewDictBuilder creates a new DictBuilder for FT.DICT* commands.
// EXPERIMENTAL: this API is subject to change, use with caution.
func (c *Client) NewDictBuilder(ctx context.Context, dict string) *DictBuilder {
return &DictBuilder{c: c, ctx: ctx, dict: dict}
}
// Action sets the action for the dictionary builder.
func (b *DictBuilder) Action(action string) *DictBuilder {
b.action = action
return b
}
// Add sets the action to "add" and requires terms.
func (b *DictBuilder) Add(terms ...interface{}) *DictBuilder {
b.action = "add"
b.terms = terms
return b
}
// Del sets the action to "del" and requires terms.
func (b *DictBuilder) Del(terms ...interface{}) *DictBuilder {
b.action = "del"
b.terms = terms
return b
}
// Dump sets the action to "dump".
func (b *DictBuilder) Dump() *DictBuilder {
b.action = "dump"
return b
}
// Run executes the configured dictionary command.
func (b *DictBuilder) Run() (interface{}, error) {
switch b.action {
case "add":
cmd := b.c.FTDictAdd(b.ctx, b.dict, b.terms...)
return cmd.Result()
case "del":
cmd := b.c.FTDictDel(b.ctx, b.dict, b.terms...)
return cmd.Result()
case "dump":
cmd := b.c.FTDictDump(b.ctx, b.dict)
return cmd.Result()
}
return nil, nil
}
// ----------------------
// TagValsBuilder for FT.TAGVALS
// ----------------------
// TagValsBuilder is builder for FT.TAGVALS
// EXPERIMENTAL: this API is subject to change, use with caution.
type TagValsBuilder struct {
c *Client
ctx context.Context
index string
field string
}
// NewTagValsBuilder creates a new TagValsBuilder for FT.TAGVALS commands.
// EXPERIMENTAL: this API is subject to change, use with caution.
func (c *Client) NewTagValsBuilder(ctx context.Context, index, field string) *TagValsBuilder {
return &TagValsBuilder{c: c, ctx: ctx, index: index, field: field}
}
// Run executes FT.TAGVALS and returns tag values.
func (b *TagValsBuilder) Run() ([]string, error) {
cmd := b.c.FTTagVals(b.ctx, b.index, b.field)
return cmd.Result()
}
// ----------------------
// CursorBuilder for FT.CURSOR*
// ----------------------
// CursorBuilder is builder for FT.CURSOR* commands
// EXPERIMENTAL: this API is subject to change, use with caution.
type CursorBuilder struct {
c *Client
ctx context.Context
index string
cursorId int64
count int
action string // read|del
}
// NewCursorBuilder creates a new CursorBuilder for FT.CURSOR* commands.
// EXPERIMENTAL: this API is subject to change, use with caution.
func (c *Client) NewCursorBuilder(ctx context.Context, index string, cursorId int64) *CursorBuilder {
return &CursorBuilder{c: c, ctx: ctx, index: index, cursorId: cursorId}
}
// Action sets the action for the cursor builder.
func (b *CursorBuilder) Action(action string) *CursorBuilder {
b.action = action
return b
}
// Read sets the action to "read".
func (b *CursorBuilder) Read() *CursorBuilder {
b.action = "read"
return b
}
// Del sets the action to "del".
func (b *CursorBuilder) Del() *CursorBuilder {
b.action = "del"
return b
}
// Count for READ.
func (b *CursorBuilder) Count(count int) *CursorBuilder { b.count = count; return b }
// Run executes the cursor command.
func (b *CursorBuilder) Run() (interface{}, error) {
switch b.action {
case "read":
cmd := b.c.FTCursorRead(b.ctx, b.index, int(b.cursorId), b.count)
return cmd.Result()
case "del":
cmd := b.c.FTCursorDel(b.ctx, b.index, int(b.cursorId))
return cmd.Result()
}
return nil, nil
}
// ----------------------
// SynUpdateBuilder for FT.SYNUPDATE
// ----------------------
// SyncUpdateBuilder is builder for FT.SYNCUPDATE
// EXPERIMENTAL: this API is subject to change, use with caution.
type SynUpdateBuilder struct {
c *Client
ctx context.Context
index string
groupId interface{}
options *FTSynUpdateOptions
terms []interface{}
}
// NewSynUpdateBuilder creates a new SynUpdateBuilder for FT.SYNUPDATE commands.
// EXPERIMENTAL: this API is subject to change, use with caution.
func (c *Client) NewSynUpdateBuilder(ctx context.Context, index string, groupId interface{}) *SynUpdateBuilder {
return &SynUpdateBuilder{c: c, ctx: ctx, index: index, groupId: groupId, options: &FTSynUpdateOptions{}}
}
// SkipInitialScan includes SKIPINITIALSCAN.
func (b *SynUpdateBuilder) SkipInitialScan() *SynUpdateBuilder {
b.options.SkipInitialScan = true
return b
}
// Terms adds synonyms to the group.
func (b *SynUpdateBuilder) Terms(terms ...interface{}) *SynUpdateBuilder { b.terms = terms; return b }
// Run executes FT.SYNUPDATE.
func (b *SynUpdateBuilder) Run() (string, error) {
cmd := b.c.FTSynUpdateWithArgs(b.ctx, b.index, b.groupId, b.options, b.terms)
return cmd.Result()
}
package redis
import (
"context"
"fmt"
"strconv"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/proto"
)
type SearchCmdable interface {
FT_List(ctx context.Context) *StringSliceCmd
FTAggregate(ctx context.Context, index string, query string) *MapStringInterfaceCmd
FTAggregateWithArgs(ctx context.Context, index string, query string, options *FTAggregateOptions) *AggregateCmd
FTAliasAdd(ctx context.Context, index string, alias string) *StatusCmd
FTAliasDel(ctx context.Context, alias string) *StatusCmd
FTAliasUpdate(ctx context.Context, index string, alias string) *StatusCmd
FTAlter(ctx context.Context, index string, skipInitialScan bool, definition []interface{}) *StatusCmd
FTConfigGet(ctx context.Context, option string) *MapMapStringInterfaceCmd
FTConfigSet(ctx context.Context, option string, value interface{}) *StatusCmd
FTCreate(ctx context.Context, index string, options *FTCreateOptions, schema ...*FieldSchema) *StatusCmd
FTCursorDel(ctx context.Context, index string, cursorId int) *StatusCmd
FTCursorRead(ctx context.Context, index string, cursorId int, count int) *MapStringInterfaceCmd
FTDictAdd(ctx context.Context, dict string, term ...interface{}) *IntCmd
FTDictDel(ctx context.Context, dict string, term ...interface{}) *IntCmd
FTDictDump(ctx context.Context, dict string) *StringSliceCmd
FTDropIndex(ctx context.Context, index string) *StatusCmd
FTDropIndexWithArgs(ctx context.Context, index string, options *FTDropIndexOptions) *StatusCmd
FTExplain(ctx context.Context, index string, query string) *StringCmd
FTExplainWithArgs(ctx context.Context, index string, query string, options *FTExplainOptions) *StringCmd
FTHybrid(ctx context.Context, index string, searchExpr string, vectorField string, vectorData Vector) *FTHybridCmd
FTHybridWithArgs(ctx context.Context, index string, options *FTHybridOptions) *FTHybridCmd
FTInfo(ctx context.Context, index string) *FTInfoCmd
FTSpellCheck(ctx context.Context, index string, query string) *FTSpellCheckCmd
FTSpellCheckWithArgs(ctx context.Context, index string, query string, options *FTSpellCheckOptions) *FTSpellCheckCmd
FTSearch(ctx context.Context, index string, query string) *FTSearchCmd
FTSearchWithArgs(ctx context.Context, index string, query string, options *FTSearchOptions) *FTSearchCmd
FTSynDump(ctx context.Context, index string) *FTSynDumpCmd
FTSynUpdate(ctx context.Context, index string, synGroupId interface{}, terms []interface{}) *StatusCmd
FTSynUpdateWithArgs(ctx context.Context, index string, synGroupId interface{}, options *FTSynUpdateOptions, terms []interface{}) *StatusCmd
FTTagVals(ctx context.Context, index string, field string) *StringSliceCmd
}
type FTCreateOptions struct {
OnHash bool
OnJSON bool
Prefix []interface{}
Filter string
DefaultLanguage string
LanguageField string
Score float64
ScoreField string
PayloadField string
MaxTextFields int
NoOffsets bool
Temporary int
NoHL bool
NoFields bool
NoFreqs bool
StopWords []interface{}
SkipInitialScan bool
}
type FieldSchema struct {
FieldName string
As string
FieldType SearchFieldType
Sortable bool
UNF bool
NoStem bool
NoIndex bool
PhoneticMatcher string
Weight float64
Separator string
CaseSensitive bool
WithSuffixtrie bool
VectorArgs *FTVectorArgs
GeoShapeFieldType string
IndexEmpty bool
IndexMissing bool
}
type FTVectorArgs struct {
FlatOptions *FTFlatOptions
HNSWOptions *FTHNSWOptions
VamanaOptions *FTVamanaOptions
}
type FTFlatOptions struct {
Type string
Dim int
DistanceMetric string
InitialCapacity int
BlockSize int
}
type FTHNSWOptions struct {
Type string
Dim int
DistanceMetric string
InitialCapacity int
MaxEdgesPerNode int
MaxAllowedEdgesPerNode int
EFRunTime int
Epsilon float64
}
type FTVamanaOptions struct {
Type string
Dim int
DistanceMetric string
Compression string
ConstructionWindowSize int
GraphMaxDegree int
SearchWindowSize int
Epsilon float64
TrainingThreshold int
ReduceDim int
}
type FTDropIndexOptions struct {
DeleteDocs bool
}
type SpellCheckTerms struct {
Include bool
Exclude bool
Dictionary string
}
type FTExplainOptions struct {
// Dialect 1,3 and 4 are deprecated since redis 8.0
Dialect string
}
type FTSynUpdateOptions struct {
SkipInitialScan bool
}
type SearchAggregator int
const (
SearchInvalid = SearchAggregator(iota)
SearchAvg
SearchSum
SearchMin
SearchMax
SearchCount
SearchCountDistinct
SearchCountDistinctish
SearchStdDev
SearchQuantile
SearchToList
SearchFirstValue
SearchRandomSample
)
func (a SearchAggregator) String() string {
switch a {
case SearchInvalid:
return ""
case SearchAvg:
return "AVG"
case SearchSum:
return "SUM"
case SearchMin:
return "MIN"
case SearchMax:
return "MAX"
case SearchCount:
return "COUNT"
case SearchCountDistinct:
return "COUNT_DISTINCT"
case SearchCountDistinctish:
return "COUNT_DISTINCTISH"
case SearchStdDev:
return "STDDEV"
case SearchQuantile:
return "QUANTILE"
case SearchToList:
return "TOLIST"
case SearchFirstValue:
return "FIRST_VALUE"
case SearchRandomSample:
return "RANDOM_SAMPLE"
default:
return ""
}
}
type SearchFieldType int
const (
SearchFieldTypeInvalid = SearchFieldType(iota)
SearchFieldTypeNumeric
SearchFieldTypeTag
SearchFieldTypeText
SearchFieldTypeGeo
SearchFieldTypeVector
SearchFieldTypeGeoShape
)
func (t SearchFieldType) String() string {
switch t {
case SearchFieldTypeInvalid:
return ""
case SearchFieldTypeNumeric:
return "NUMERIC"
case SearchFieldTypeTag:
return "TAG"
case SearchFieldTypeText:
return "TEXT"
case SearchFieldTypeGeo:
return "GEO"
case SearchFieldTypeVector:
return "VECTOR"
case SearchFieldTypeGeoShape:
return "GEOSHAPE"
default:
return "TEXT"
}
}
// Each AggregateReducer have different args.
// Please follow https://redis.io/docs/interact/search-and-query/search/aggregations/#supported-groupby-reducers for more information.
type FTAggregateReducer struct {
Reducer SearchAggregator
Args []interface{}
As string
}
type FTAggregateGroupBy struct {
Fields []interface{}
Reduce []FTAggregateReducer
}
type FTAggregateSortBy struct {
FieldName string
Asc bool
Desc bool
}
type FTAggregateApply struct {
Field string
As string
}
type FTAggregateLoad struct {
Field string
As string
}
type FTAggregateWithCursor struct {
Count int
MaxIdle int
}
type FTAggregateOptions struct {
Verbatim bool
LoadAll bool
Load []FTAggregateLoad
Timeout int
GroupBy []FTAggregateGroupBy
SortBy []FTAggregateSortBy
SortByMax int
// Scorer is used to set scoring function, if not set passed, a default will be used.
// The default scorer depends on the Redis version:
// - `BM25` for Redis >= 8
// - `TFIDF` for Redis < 8
Scorer string
// AddScores is available in Redis CE 8
AddScores bool
Apply []FTAggregateApply
LimitOffset int
Limit int
Filter string
WithCursor bool
WithCursorOptions *FTAggregateWithCursor
Params map[string]interface{}
// Dialect 1,3 and 4 are deprecated since redis 8.0
DialectVersion int
}
type FTSearchFilter struct {
FieldName interface{}
Min interface{}
Max interface{}
}
type FTSearchGeoFilter struct {
FieldName string
Longitude float64
Latitude float64
Radius float64
Unit string
}
type FTSearchReturn struct {
FieldName string
As string
}
type FTSearchSortBy struct {
FieldName string
Asc bool
Desc bool
}
// FTSearchOptions hold options that can be passed to the FT.SEARCH command.
// More information about the options can be found
// in the documentation for FT.SEARCH https://redis.io/docs/latest/commands/ft.search/
type FTSearchOptions struct {
NoContent bool
Verbatim bool
NoStopWords bool
WithScores bool
WithPayloads bool
WithSortKeys bool
Filters []FTSearchFilter
GeoFilter []FTSearchGeoFilter
InKeys []interface{}
InFields []interface{}
Return []FTSearchReturn
Slop int
Timeout int
InOrder bool
Language string
Expander string
// Scorer is used to set scoring function, if not set passed, a default will be used.
// The default scorer depends on the Redis version:
// - `BM25` for Redis >= 8
// - `TFIDF` for Redis < 8
Scorer string
ExplainScore bool
Payload string
SortBy []FTSearchSortBy
SortByWithCount bool
LimitOffset int
Limit int
// CountOnly sets LIMIT 0 0 to get the count - number of documents in the result set without actually returning the result set.
// When using this option, the Limit and LimitOffset options are ignored.
CountOnly bool
Params map[string]interface{}
// Dialect 1,3 and 4 are deprecated since redis 8.0
DialectVersion int
}
// FTHybridCombineMethod represents the fusion method for combining search and vector results
type FTHybridCombineMethod string
const (
FTHybridCombineRRF FTHybridCombineMethod = "RRF"
FTHybridCombineLinear FTHybridCombineMethod = "LINEAR"
FTHybridCombineFunction FTHybridCombineMethod = "FUNCTION"
)
// FTHybridSearchExpression represents a search expression in hybrid search
type FTHybridSearchExpression struct {
Query string
Scorer string
ScorerParams []interface{}
YieldScoreAs string
}
type FTHybridVectorMethod = string
const (
KNN FTHybridCombineMethod = "KNN"
RANGE FTHybridCombineMethod = "RANGE"
)
// FTHybridVectorExpression represents a vector expression in hybrid search
type FTHybridVectorExpression struct {
VectorField string
VectorData Vector
// VectorParamName specifies the parameter name for passing vector data via PARAMS mechanism.
// REQUIRED for Redis 8.6+ (inline vector blobs are not supported in 8.6+).
// Optional for Redis 8.4-8.5 (both inline and PARAMS are supported).
// When set, the vector blob will be passed as: VSIM @field $VectorParamName PARAMS ... VectorParamName <blob>
// When empty, the vector blob will be inlined: VSIM @field <blob> (fails on Redis 8.6+)
VectorParamName string
Method FTHybridVectorMethod
MethodParams []interface{}
Filter string
YieldScoreAs string
}
// FTHybridCombineOptions represents options for result fusion
type FTHybridCombineOptions struct {
Method FTHybridCombineMethod
Count int
Window int // For RRF
Constant float64 // For RRF
Alpha float64 // For LINEAR
Beta float64 // For LINEAR
YieldScoreAs string
}
// FTHybridGroupBy represents GROUP BY functionality
type FTHybridGroupBy struct {
Count int
Fields []string
ReduceFunc string
ReduceCount int
ReduceParams []interface{}
}
// FTHybridApply represents APPLY functionality
type FTHybridApply struct {
Expression string
AsField string
}
// FTHybridWithCursor represents cursor configuration for hybrid search
type FTHybridWithCursor struct {
Count int // Number of results to return per cursor read
MaxIdle int // Maximum idle time in milliseconds before cursor is automatically deleted
}
// FTHybridOptions hold options that can be passed to the FT.HYBRID command
type FTHybridOptions struct {
CountExpressions int // Number of search/vector expressions
SearchExpressions []FTHybridSearchExpression // Multiple search expressions
VectorExpressions []FTHybridVectorExpression // Multiple vector expressions
Combine *FTHybridCombineOptions // Fusion step options
Load []string // Projected fields
GroupBy *FTHybridGroupBy // Aggregation grouping
Apply []FTHybridApply // Field transformations
SortBy []FTSearchSortBy // Reuse from FTSearch
Filter string // Post-filter expression
LimitOffset int // Result limiting
Limit int
Params map[string]interface{} // Parameter substitution
ExplainScore bool // Include score explanations
Timeout int // Runtime timeout
WithCursor bool // Enable cursor support for large result sets
WithCursorOptions *FTHybridWithCursor // Cursor configuration options
}
type FTSynDumpResult struct {
Term string
Synonyms []string
}
type FTSynDumpCmd struct {
baseCmd
val []FTSynDumpResult
}
type FTAggregateResult struct {
Total int
Rows []AggregateRow
}
type AggregateRow struct {
Fields map[string]interface{}
}
type AggregateCmd struct {
baseCmd
val *FTAggregateResult
}
type FTInfoResult struct {
IndexErrors IndexErrors
Attributes []FTAttribute
BytesPerRecordAvg string
Cleaning int
CursorStats CursorStats
DialectStats map[string]int
DocTableSizeMB float64
FieldStatistics []FieldStatistic
GCStats GCStats
GeoshapesSzMB float64
HashIndexingFailures int
IndexDefinition IndexDefinition
IndexName string
IndexOptions []string
Indexing int
InvertedSzMB float64
KeyTableSizeMB float64
MaxDocID int
NumDocs int
NumRecords int
NumTerms int
NumberOfUses int
OffsetBitsPerRecordAvg string
OffsetVectorsSzMB float64
OffsetsPerTermAvg string
PercentIndexed float64
RecordsPerDocAvg string
SortableValuesSizeMB float64
TagOverheadSzMB float64
TextOverheadSzMB float64
TotalIndexMemorySzMB float64
TotalIndexingTime int
TotalInvertedIndexBlocks int
VectorIndexSzMB float64
}
type IndexErrors struct {
IndexingFailures int
LastIndexingError string
LastIndexingErrorKey string
}
type FTAttribute struct {
Identifier string
Attribute string
Type string
Weight float64
Sortable bool
NoStem bool
NoIndex bool
UNF bool
PhoneticMatcher string
CaseSensitive bool
WithSuffixtrie bool
// Vector specific attributes
Algorithm string
DataType string
Dim int
DistanceMetric string
M int
EFConstruction int
}
type CursorStats struct {
GlobalIdle int
GlobalTotal int
IndexCapacity int
IndexTotal int
}
type FieldStatistic struct {
Identifier string
Attribute string
IndexErrors IndexErrors
}
type GCStats struct {
BytesCollected int
TotalMsRun int
TotalCycles int
AverageCycleTimeMs string
LastRunTimeMs int
GCNumericTreesMissed int
GCBlocksDenied int
}
type IndexDefinition struct {
KeyType string
Prefixes []string
DefaultScore float64
}
type FTSpellCheckOptions struct {
Distance int
Terms *FTSpellCheckTerms
// Dialect 1,3 and 4 are deprecated since redis 8.0
Dialect int
}
type FTSpellCheckTerms struct {
Inclusion string // Either "INCLUDE" or "EXCLUDE"
Dictionary string
Terms []interface{}
}
type SpellCheckResult struct {
Term string
Suggestions []SpellCheckSuggestion
}
type SpellCheckSuggestion struct {
Score float64
Suggestion string
}
type FTSearchResult struct {
Total int
Docs []Document
}
type Document struct {
ID string
Score *float64
Payload *string
SortKey *string
Fields map[string]string
Error error
}
type AggregateQuery []interface{}
// FT_List - Lists all the existing indexes in the database.
// For more information, please refer to the Redis documentation:
// [FT._LIST]: (https://redis.io/commands/ft._list/)
func (c cmdable) FT_List(ctx context.Context) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "FT._LIST")
_ = c(ctx, cmd)
return cmd
}
// FTAggregate - Performs a search query on an index and applies a series of aggregate transformations to the result.
// The 'index' parameter specifies the index to search, and the 'query' parameter specifies the search query.
// For more information, please refer to the Redis documentation:
// [FT.AGGREGATE]: (https://redis.io/commands/ft.aggregate/)
func (c cmdable) FTAggregate(ctx context.Context, index string, query string) *MapStringInterfaceCmd {
args := []interface{}{"FT.AGGREGATE", index, query}
cmd := NewMapStringInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func FTAggregateQuery(query string, options *FTAggregateOptions) (AggregateQuery, error) {
queryArgs := []interface{}{query}
if options != nil {
if options.Verbatim {
queryArgs = append(queryArgs, "VERBATIM")
}
if options.Scorer != "" {
queryArgs = append(queryArgs, "SCORER", options.Scorer)
}
if options.AddScores {
queryArgs = append(queryArgs, "ADDSCORES")
}
if options.LoadAll && options.Load != nil {
return nil, fmt.Errorf("FT.AGGREGATE: LOADALL and LOAD are mutually exclusive")
}
if options.LoadAll {
queryArgs = append(queryArgs, "LOAD", "*")
}
if options.Load != nil {
queryArgs = append(queryArgs, "LOAD", len(options.Load))
index, count := len(queryArgs)-1, 0
for _, load := range options.Load {
queryArgs = append(queryArgs, load.Field)
count++
if load.As != "" {
queryArgs = append(queryArgs, "AS", load.As)
count += 2
}
}
queryArgs[index] = count
}
if options.Timeout > 0 {
queryArgs = append(queryArgs, "TIMEOUT", options.Timeout)
}
for _, apply := range options.Apply {
queryArgs = append(queryArgs, "APPLY", apply.Field)
if apply.As != "" {
queryArgs = append(queryArgs, "AS", apply.As)
}
}
if options.GroupBy != nil {
for _, groupBy := range options.GroupBy {
queryArgs = append(queryArgs, "GROUPBY", len(groupBy.Fields))
queryArgs = append(queryArgs, groupBy.Fields...)
for _, reducer := range groupBy.Reduce {
queryArgs = append(queryArgs, "REDUCE")
queryArgs = append(queryArgs, reducer.Reducer.String())
if reducer.Args != nil {
queryArgs = append(queryArgs, len(reducer.Args))
queryArgs = append(queryArgs, reducer.Args...)
} else {
queryArgs = append(queryArgs, 0)
}
if reducer.As != "" {
queryArgs = append(queryArgs, "AS", reducer.As)
}
}
}
}
if options.SortBy != nil {
queryArgs = append(queryArgs, "SORTBY")
sortByOptions := []interface{}{}
for _, sortBy := range options.SortBy {
sortByOptions = append(sortByOptions, sortBy.FieldName)
if sortBy.Asc && sortBy.Desc {
return nil, fmt.Errorf("FT.AGGREGATE: ASC and DESC are mutually exclusive")
}
if sortBy.Asc {
sortByOptions = append(sortByOptions, "ASC")
}
if sortBy.Desc {
sortByOptions = append(sortByOptions, "DESC")
}
}
queryArgs = append(queryArgs, len(sortByOptions))
queryArgs = append(queryArgs, sortByOptions...)
}
if options.SortByMax > 0 {
queryArgs = append(queryArgs, "MAX", options.SortByMax)
}
if options.LimitOffset >= 0 && options.Limit > 0 {
queryArgs = append(queryArgs, "LIMIT", options.LimitOffset, options.Limit)
}
if options.Filter != "" {
queryArgs = append(queryArgs, "FILTER", options.Filter)
}
if options.WithCursor {
queryArgs = append(queryArgs, "WITHCURSOR")
if options.WithCursorOptions != nil {
if options.WithCursorOptions.Count > 0 {
queryArgs = append(queryArgs, "COUNT", options.WithCursorOptions.Count)
}
if options.WithCursorOptions.MaxIdle > 0 {
queryArgs = append(queryArgs, "MAXIDLE", options.WithCursorOptions.MaxIdle)
}
}
}
if options.Params != nil {
queryArgs = append(queryArgs, "PARAMS", len(options.Params)*2)
for key, value := range options.Params {
queryArgs = append(queryArgs, key, value)
}
}
if options.DialectVersion > 0 {
queryArgs = append(queryArgs, "DIALECT", options.DialectVersion)
} else {
queryArgs = append(queryArgs, "DIALECT", 2)
}
}
return queryArgs, nil
}
func ProcessAggregateResult(data []interface{}) (*FTAggregateResult, error) {
if len(data) == 0 {
return nil, fmt.Errorf("no data returned")
}
total, ok := data[0].(int64)
if !ok {
return nil, fmt.Errorf("invalid total format")
}
rows := make([]AggregateRow, 0, len(data)-1)
for _, row := range data[1:] {
fields, ok := row.([]interface{})
if !ok {
return nil, fmt.Errorf("invalid row format")
}
rowMap := make(map[string]interface{})
for i := 0; i < len(fields); i += 2 {
key, ok := fields[i].(string)
if !ok {
return nil, fmt.Errorf("invalid field key format")
}
value := fields[i+1]
rowMap[key] = value
}
rows = append(rows, AggregateRow{Fields: rowMap})
}
result := &FTAggregateResult{
Total: int(total),
Rows: rows,
}
return result, nil
}
func NewAggregateCmd(ctx context.Context, args ...interface{}) *AggregateCmd {
return &AggregateCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeAggregate,
},
}
}
func (cmd *AggregateCmd) SetVal(val *FTAggregateResult) {
cmd.val = val
}
func (cmd *AggregateCmd) Val() *FTAggregateResult {
return cmd.val
}
func (cmd *AggregateCmd) Result() (*FTAggregateResult, error) {
return cmd.val, cmd.err
}
func (cmd *AggregateCmd) RawVal() interface{} {
return cmd.rawVal
}
func (cmd *AggregateCmd) RawResult() (interface{}, error) {
return cmd.rawVal, cmd.err
}
func (cmd *AggregateCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *AggregateCmd) readReply(rd *proto.Reader) (err error) {
data, err := rd.ReadSlice()
if err != nil {
return err
}
cmd.val, err = ProcessAggregateResult(data)
if err != nil {
return err
}
return nil
}
func (cmd *AggregateCmd) Clone() Cmder {
var val *FTAggregateResult
if cmd.val != nil {
val = &FTAggregateResult{
Total: cmd.val.Total,
}
if cmd.val.Rows != nil {
val.Rows = make([]AggregateRow, len(cmd.val.Rows))
for i, row := range cmd.val.Rows {
val.Rows[i] = AggregateRow{}
if row.Fields != nil {
val.Rows[i].Fields = make(map[string]interface{}, len(row.Fields))
for k, v := range row.Fields {
val.Rows[i].Fields[k] = v
}
}
}
}
}
return &AggregateCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
// FTAggregateWithArgs - Performs a search query on an index and applies a series of aggregate transformations to the result.
// The 'index' parameter specifies the index to search, and the 'query' parameter specifies the search query.
// This function also allows for specifying additional options such as: Verbatim, LoadAll, Load, Timeout, GroupBy, SortBy, SortByMax, Apply, LimitOffset, Limit, Filter, WithCursor, Params, and DialectVersion.
// For more information, please refer to the Redis documentation:
// [FT.AGGREGATE]: (https://redis.io/commands/ft.aggregate/)
func (c cmdable) FTAggregateWithArgs(ctx context.Context, index string, query string, options *FTAggregateOptions) *AggregateCmd {
args := []interface{}{"FT.AGGREGATE", index, query}
if options != nil {
if options.Verbatim {
args = append(args, "VERBATIM")
}
if options.Scorer != "" {
args = append(args, "SCORER", options.Scorer)
}
if options.AddScores {
args = append(args, "ADDSCORES")
}
if options.LoadAll && options.Load != nil {
cmd := NewAggregateCmd(ctx, args...)
cmd.SetErr(fmt.Errorf("FT.AGGREGATE: LOADALL and LOAD are mutually exclusive"))
return cmd
}
if options.LoadAll {
args = append(args, "LOAD", "*")
}
if options.Load != nil {
args = append(args, "LOAD", len(options.Load))
index, count := len(args)-1, 0
for _, load := range options.Load {
args = append(args, load.Field)
count++
if load.As != "" {
args = append(args, "AS", load.As)
count += 2
}
}
args[index] = count
}
if options.Timeout > 0 {
args = append(args, "TIMEOUT", options.Timeout)
}
for _, apply := range options.Apply {
args = append(args, "APPLY", apply.Field)
if apply.As != "" {
args = append(args, "AS", apply.As)
}
}
if options.GroupBy != nil {
for _, groupBy := range options.GroupBy {
args = append(args, "GROUPBY", len(groupBy.Fields))
args = append(args, groupBy.Fields...)
for _, reducer := range groupBy.Reduce {
args = append(args, "REDUCE")
args = append(args, reducer.Reducer.String())
if reducer.Args != nil {
args = append(args, len(reducer.Args))
args = append(args, reducer.Args...)
} else {
args = append(args, 0)
}
if reducer.As != "" {
args = append(args, "AS", reducer.As)
}
}
}
}
if options.SortBy != nil {
args = append(args, "SORTBY")
sortByOptions := []interface{}{}
for _, sortBy := range options.SortBy {
sortByOptions = append(sortByOptions, sortBy.FieldName)
if sortBy.Asc && sortBy.Desc {
cmd := NewAggregateCmd(ctx, args...)
cmd.SetErr(fmt.Errorf("FT.AGGREGATE: ASC and DESC are mutually exclusive"))
return cmd
}
if sortBy.Asc {
sortByOptions = append(sortByOptions, "ASC")
}
if sortBy.Desc {
sortByOptions = append(sortByOptions, "DESC")
}
}
args = append(args, len(sortByOptions))
args = append(args, sortByOptions...)
}
if options.SortByMax > 0 {
args = append(args, "MAX", options.SortByMax)
}
if options.LimitOffset >= 0 && options.Limit > 0 {
args = append(args, "LIMIT", options.LimitOffset, options.Limit)
}
if options.Filter != "" {
args = append(args, "FILTER", options.Filter)
}
if options.WithCursor {
args = append(args, "WITHCURSOR")
if options.WithCursorOptions != nil {
if options.WithCursorOptions.Count > 0 {
args = append(args, "COUNT", options.WithCursorOptions.Count)
}
if options.WithCursorOptions.MaxIdle > 0 {
args = append(args, "MAXIDLE", options.WithCursorOptions.MaxIdle)
}
}
}
if options.Params != nil {
args = append(args, "PARAMS", len(options.Params)*2)
for key, value := range options.Params {
args = append(args, key, value)
}
}
if options.DialectVersion > 0 {
args = append(args, "DIALECT", options.DialectVersion)
} else {
args = append(args, "DIALECT", 2)
}
}
cmd := NewAggregateCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// FTAliasAdd - Adds an alias to an index.
// The 'index' parameter specifies the index to which the alias is added, and the 'alias' parameter specifies the alias.
// For more information, please refer to the Redis documentation:
// [FT.ALIASADD]: (https://redis.io/commands/ft.aliasadd/)
func (c cmdable) FTAliasAdd(ctx context.Context, index string, alias string) *StatusCmd {
args := []interface{}{"FT.ALIASADD", alias, index}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// FTAliasDel - Removes an alias from an index.
// The 'alias' parameter specifies the alias to be removed.
// For more information, please refer to the Redis documentation:
// [FT.ALIASDEL]: (https://redis.io/commands/ft.aliasdel/)
func (c cmdable) FTAliasDel(ctx context.Context, alias string) *StatusCmd {
cmd := NewStatusCmd(ctx, "FT.ALIASDEL", alias)
_ = c(ctx, cmd)
return cmd
}
// FTAliasUpdate - Updates an alias to an index.
// The 'index' parameter specifies the index to which the alias is updated, and the 'alias' parameter specifies the alias.
// If the alias already exists for a different index, it updates the alias to point to the specified index instead.
// For more information, please refer to the Redis documentation:
// [FT.ALIASUPDATE]: (https://redis.io/commands/ft.aliasupdate/)
func (c cmdable) FTAliasUpdate(ctx context.Context, index string, alias string) *StatusCmd {
cmd := NewStatusCmd(ctx, "FT.ALIASUPDATE", alias, index)
_ = c(ctx, cmd)
return cmd
}
// FTAlter - Alters the definition of an existing index.
// The 'index' parameter specifies the index to alter, and the 'skipInitialScan' parameter specifies whether to skip the initial scan.
// The 'definition' parameter specifies the new definition for the index.
// For more information, please refer to the Redis documentation:
// [FT.ALTER]: (https://redis.io/commands/ft.alter/)
func (c cmdable) FTAlter(ctx context.Context, index string, skipInitialScan bool, definition []interface{}) *StatusCmd {
args := []interface{}{"FT.ALTER", index}
if skipInitialScan {
args = append(args, "SKIPINITIALSCAN")
}
args = append(args, "SCHEMA", "ADD")
args = append(args, definition...)
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Retrieves the value of a RediSearch configuration parameter.
// The 'option' parameter specifies the configuration parameter to retrieve.
// For more information, please refer to the Redis [FT.CONFIG GET] documentation.
//
// Deprecated: FTConfigGet is deprecated in Redis 8.
// All configuration will be done with the CONFIG GET command.
// For more information check [Client.ConfigGet] and [CONFIG GET Documentation]
//
// [CONFIG GET Documentation]: https://redis.io/commands/config-get/
// [FT.CONFIG GET]: https://redis.io/commands/ft.config-get/
func (c cmdable) FTConfigGet(ctx context.Context, option string) *MapMapStringInterfaceCmd {
cmd := NewMapMapStringInterfaceCmd(ctx, "FT.CONFIG", "GET", option)
_ = c(ctx, cmd)
return cmd
}
// Sets the value of a RediSearch configuration parameter.
// The 'option' parameter specifies the configuration parameter to set, and the 'value' parameter specifies the new value.
// For more information, please refer to the Redis [FT.CONFIG SET] documentation.
//
// Deprecated: FTConfigSet is deprecated in Redis 8.
// All configuration will be done with the CONFIG SET command.
// For more information check [Client.ConfigSet] and [CONFIG SET Documentation]
//
// [CONFIG SET Documentation]: https://redis.io/commands/config-set/
// [FT.CONFIG SET]: https://redis.io/commands/ft.config-set/
func (c cmdable) FTConfigSet(ctx context.Context, option string, value interface{}) *StatusCmd {
cmd := NewStatusCmd(ctx, "FT.CONFIG", "SET", option, value)
_ = c(ctx, cmd)
return cmd
}
// FTCreate - Creates a new index with the given options and schema.
// The 'index' parameter specifies the name of the index to create.
// The 'options' parameter specifies various options for the index, such as:
// whether to index hashes or JSONs, prefixes, filters, default language, score, score field, payload field, etc.
// The 'schema' parameter specifies the schema for the index, which includes the field name, field type, etc.
// For more information, please refer to the Redis documentation:
// [FT.CREATE]: (https://redis.io/commands/ft.create/)
func (c cmdable) FTCreate(ctx context.Context, index string, options *FTCreateOptions, schema ...*FieldSchema) *StatusCmd {
args := []interface{}{"FT.CREATE", index}
if options != nil {
if options.OnHash && !options.OnJSON {
args = append(args, "ON", "HASH")
}
if options.OnJSON && !options.OnHash {
args = append(args, "ON", "JSON")
}
if options.OnHash && options.OnJSON {
cmd := NewStatusCmd(ctx, args...)
cmd.SetErr(fmt.Errorf("FT.CREATE: ON HASH and ON JSON are mutually exclusive"))
return cmd
}
if options.Prefix != nil {
args = append(args, "PREFIX", len(options.Prefix))
args = append(args, options.Prefix...)
}
if options.Filter != "" {
args = append(args, "FILTER", options.Filter)
}
if options.DefaultLanguage != "" {
args = append(args, "LANGUAGE", options.DefaultLanguage)
}
if options.LanguageField != "" {
args = append(args, "LANGUAGE_FIELD", options.LanguageField)
}
if options.Score > 0 {
args = append(args, "SCORE", options.Score)
}
if options.ScoreField != "" {
args = append(args, "SCORE_FIELD", options.ScoreField)
}
if options.PayloadField != "" {
args = append(args, "PAYLOAD_FIELD", options.PayloadField)
}
if options.MaxTextFields > 0 {
args = append(args, "MAXTEXTFIELDS", options.MaxTextFields)
}
if options.NoOffsets {
args = append(args, "NOOFFSETS")
}
if options.Temporary > 0 {
args = append(args, "TEMPORARY", options.Temporary)
}
if options.NoHL {
args = append(args, "NOHL")
}
if options.NoFields {
args = append(args, "NOFIELDS")
}
if options.NoFreqs {
args = append(args, "NOFREQS")
}
if options.StopWords != nil {
args = append(args, "STOPWORDS", len(options.StopWords))
args = append(args, options.StopWords...)
}
if options.SkipInitialScan {
args = append(args, "SKIPINITIALSCAN")
}
}
if schema == nil {
cmd := NewStatusCmd(ctx, args...)
cmd.SetErr(fmt.Errorf("FT.CREATE: SCHEMA is required"))
return cmd
}
args = append(args, "SCHEMA")
for _, schema := range schema {
if schema.FieldName == "" || schema.FieldType == SearchFieldTypeInvalid {
cmd := NewStatusCmd(ctx, args...)
cmd.SetErr(fmt.Errorf("FT.CREATE: SCHEMA FieldName and FieldType are required"))
return cmd
}
args = append(args, schema.FieldName)
if schema.As != "" {
args = append(args, "AS", schema.As)
}
args = append(args, schema.FieldType.String())
if schema.VectorArgs != nil {
if schema.FieldType != SearchFieldTypeVector {
cmd := NewStatusCmd(ctx, args...)
cmd.SetErr(fmt.Errorf("FT.CREATE: SCHEMA FieldType VECTOR is required for VectorArgs"))
return cmd
}
// Check mutual exclusivity of vector options
optionCount := 0
if schema.VectorArgs.FlatOptions != nil {
optionCount++
}
if schema.VectorArgs.HNSWOptions != nil {
optionCount++
}
if schema.VectorArgs.VamanaOptions != nil {
optionCount++
}
if optionCount != 1 {
cmd := NewStatusCmd(ctx, args...)
cmd.SetErr(fmt.Errorf("FT.CREATE: SCHEMA VectorArgs must have exactly one of FlatOptions, HNSWOptions, or VamanaOptions"))
return cmd
}
if schema.VectorArgs.FlatOptions != nil {
args = append(args, "FLAT")
if schema.VectorArgs.FlatOptions.Type == "" || schema.VectorArgs.FlatOptions.Dim == 0 || schema.VectorArgs.FlatOptions.DistanceMetric == "" {
cmd := NewStatusCmd(ctx, args...)
cmd.SetErr(fmt.Errorf("FT.CREATE: Type, Dim and DistanceMetric are required for VECTOR FLAT"))
return cmd
}
flatArgs := []interface{}{
"TYPE", schema.VectorArgs.FlatOptions.Type,
"DIM", schema.VectorArgs.FlatOptions.Dim,
"DISTANCE_METRIC", schema.VectorArgs.FlatOptions.DistanceMetric,
}
if schema.VectorArgs.FlatOptions.InitialCapacity > 0 {
flatArgs = append(flatArgs, "INITIAL_CAP", schema.VectorArgs.FlatOptions.InitialCapacity)
}
if schema.VectorArgs.FlatOptions.BlockSize > 0 {
flatArgs = append(flatArgs, "BLOCK_SIZE", schema.VectorArgs.FlatOptions.BlockSize)
}
args = append(args, len(flatArgs))
args = append(args, flatArgs...)
}
if schema.VectorArgs.HNSWOptions != nil {
args = append(args, "HNSW")
if schema.VectorArgs.HNSWOptions.Type == "" || schema.VectorArgs.HNSWOptions.Dim == 0 || schema.VectorArgs.HNSWOptions.DistanceMetric == "" {
cmd := NewStatusCmd(ctx, args...)
cmd.SetErr(fmt.Errorf("FT.CREATE: Type, Dim and DistanceMetric are required for VECTOR HNSW"))
return cmd
}
hnswArgs := []interface{}{
"TYPE", schema.VectorArgs.HNSWOptions.Type,
"DIM", schema.VectorArgs.HNSWOptions.Dim,
"DISTANCE_METRIC", schema.VectorArgs.HNSWOptions.DistanceMetric,
}
if schema.VectorArgs.HNSWOptions.InitialCapacity > 0 {
hnswArgs = append(hnswArgs, "INITIAL_CAP", schema.VectorArgs.HNSWOptions.InitialCapacity)
}
if schema.VectorArgs.HNSWOptions.MaxEdgesPerNode > 0 {
hnswArgs = append(hnswArgs, "M", schema.VectorArgs.HNSWOptions.MaxEdgesPerNode)
}
if schema.VectorArgs.HNSWOptions.MaxAllowedEdgesPerNode > 0 {
hnswArgs = append(hnswArgs, "EF_CONSTRUCTION", schema.VectorArgs.HNSWOptions.MaxAllowedEdgesPerNode)
}
if schema.VectorArgs.HNSWOptions.EFRunTime > 0 {
hnswArgs = append(hnswArgs, "EF_RUNTIME", schema.VectorArgs.HNSWOptions.EFRunTime)
}
if schema.VectorArgs.HNSWOptions.Epsilon > 0 {
hnswArgs = append(hnswArgs, "EPSILON", schema.VectorArgs.HNSWOptions.Epsilon)
}
args = append(args, len(hnswArgs))
args = append(args, hnswArgs...)
}
if schema.VectorArgs.VamanaOptions != nil {
args = append(args, "SVS-VAMANA")
if schema.VectorArgs.VamanaOptions.Type == "" || schema.VectorArgs.VamanaOptions.Dim == 0 || schema.VectorArgs.VamanaOptions.DistanceMetric == "" {
cmd := NewStatusCmd(ctx, args...)
cmd.SetErr(fmt.Errorf("FT.CREATE: Type, Dim and DistanceMetric are required for VECTOR VAMANA"))
return cmd
}
vamanaArgs := []interface{}{
"TYPE", schema.VectorArgs.VamanaOptions.Type,
"DIM", schema.VectorArgs.VamanaOptions.Dim,
"DISTANCE_METRIC", schema.VectorArgs.VamanaOptions.DistanceMetric,
}
if schema.VectorArgs.VamanaOptions.Compression != "" {
vamanaArgs = append(vamanaArgs, "COMPRESSION", schema.VectorArgs.VamanaOptions.Compression)
}
if schema.VectorArgs.VamanaOptions.ConstructionWindowSize > 0 {
vamanaArgs = append(vamanaArgs, "CONSTRUCTION_WINDOW_SIZE", schema.VectorArgs.VamanaOptions.ConstructionWindowSize)
}
if schema.VectorArgs.VamanaOptions.GraphMaxDegree > 0 {
vamanaArgs = append(vamanaArgs, "GRAPH_MAX_DEGREE", schema.VectorArgs.VamanaOptions.GraphMaxDegree)
}
if schema.VectorArgs.VamanaOptions.SearchWindowSize > 0 {
vamanaArgs = append(vamanaArgs, "SEARCH_WINDOW_SIZE", schema.VectorArgs.VamanaOptions.SearchWindowSize)
}
if schema.VectorArgs.VamanaOptions.Epsilon > 0 {
vamanaArgs = append(vamanaArgs, "EPSILON", schema.VectorArgs.VamanaOptions.Epsilon)
}
if schema.VectorArgs.VamanaOptions.TrainingThreshold > 0 {
vamanaArgs = append(vamanaArgs, "TRAINING_THRESHOLD", schema.VectorArgs.VamanaOptions.TrainingThreshold)
}
if schema.VectorArgs.VamanaOptions.ReduceDim > 0 {
vamanaArgs = append(vamanaArgs, "REDUCE", schema.VectorArgs.VamanaOptions.ReduceDim)
}
args = append(args, len(vamanaArgs))
args = append(args, vamanaArgs...)
}
}
if schema.GeoShapeFieldType != "" {
if schema.FieldType != SearchFieldTypeGeoShape {
cmd := NewStatusCmd(ctx, args...)
cmd.SetErr(fmt.Errorf("FT.CREATE: SCHEMA FieldType GEOSHAPE is required for GeoShapeFieldType"))
return cmd
}
args = append(args, schema.GeoShapeFieldType)
}
if schema.NoStem {
args = append(args, "NOSTEM")
}
if schema.Sortable {
args = append(args, "SORTABLE")
}
if schema.UNF {
args = append(args, "UNF")
}
if schema.NoIndex {
args = append(args, "NOINDEX")
}
if schema.PhoneticMatcher != "" {
args = append(args, "PHONETIC", schema.PhoneticMatcher)
}
if schema.Weight > 0 {
args = append(args, "WEIGHT", schema.Weight)
}
if schema.Separator != "" {
args = append(args, "SEPARATOR", schema.Separator)
}
if schema.CaseSensitive {
args = append(args, "CASESENSITIVE")
}
if schema.WithSuffixtrie {
args = append(args, "WITHSUFFIXTRIE")
}
if schema.IndexEmpty {
args = append(args, "INDEXEMPTY")
}
if schema.IndexMissing {
args = append(args, "INDEXMISSING")
}
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// FTCursorDel - Deletes a cursor from an existing index.
// The 'index' parameter specifies the index from which to delete the cursor, and the 'cursorId' parameter specifies the ID of the cursor to delete.
// For more information, please refer to the Redis documentation:
// [FT.CURSOR DEL]: (https://redis.io/commands/ft.cursor-del/)
func (c cmdable) FTCursorDel(ctx context.Context, index string, cursorId int) *StatusCmd {
cmd := NewStatusCmd(ctx, "FT.CURSOR", "DEL", index, cursorId)
_ = c(ctx, cmd)
return cmd
}
// FTCursorRead - Reads the next results from an existing cursor.
// The 'index' parameter specifies the index from which to read the cursor, the 'cursorId' parameter specifies the ID of the cursor to read, and the 'count' parameter specifies the number of results to read.
// For more information, please refer to the Redis documentation:
// [FT.CURSOR READ]: (https://redis.io/commands/ft.cursor-read/)
func (c cmdable) FTCursorRead(ctx context.Context, index string, cursorId int, count int) *MapStringInterfaceCmd {
args := []interface{}{"FT.CURSOR", "READ", index, cursorId}
if count > 0 {
args = append(args, "COUNT", count)
}
cmd := NewMapStringInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// FTDictAdd - Adds terms to a dictionary.
// The 'dict' parameter specifies the dictionary to which to add the terms, and the 'term' parameter specifies the terms to add.
// For more information, please refer to the Redis documentation:
// [FT.DICTADD]: (https://redis.io/commands/ft.dictadd/)
func (c cmdable) FTDictAdd(ctx context.Context, dict string, term ...interface{}) *IntCmd {
args := []interface{}{"FT.DICTADD", dict}
args = append(args, term...)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// FTDictDel - Deletes terms from a dictionary.
// The 'dict' parameter specifies the dictionary from which to delete the terms, and the 'term' parameter specifies the terms to delete.
// For more information, please refer to the Redis documentation:
// [FT.DICTDEL]: (https://redis.io/commands/ft.dictdel/)
func (c cmdable) FTDictDel(ctx context.Context, dict string, term ...interface{}) *IntCmd {
args := []interface{}{"FT.DICTDEL", dict}
args = append(args, term...)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// FTDictDump - Returns all terms in the specified dictionary.
// The 'dict' parameter specifies the dictionary from which to return the terms.
// For more information, please refer to the Redis documentation:
// [FT.DICTDUMP]: (https://redis.io/commands/ft.dictdump/)
func (c cmdable) FTDictDump(ctx context.Context, dict string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "FT.DICTDUMP", dict)
_ = c(ctx, cmd)
return cmd
}
// FTDropIndex - Deletes an index.
// The 'index' parameter specifies the index to delete.
// For more information, please refer to the Redis documentation:
// [FT.DROPINDEX]: (https://redis.io/commands/ft.dropindex/)
func (c cmdable) FTDropIndex(ctx context.Context, index string) *StatusCmd {
args := []interface{}{"FT.DROPINDEX", index}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// FTDropIndexWithArgs - Deletes an index with options.
// The 'index' parameter specifies the index to delete, and the 'options' parameter specifies the DeleteDocs option for docs deletion.
// For more information, please refer to the Redis documentation:
// [FT.DROPINDEX]: (https://redis.io/commands/ft.dropindex/)
func (c cmdable) FTDropIndexWithArgs(ctx context.Context, index string, options *FTDropIndexOptions) *StatusCmd {
args := []interface{}{"FT.DROPINDEX", index}
if options != nil {
if options.DeleteDocs {
args = append(args, "DD")
}
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// FTExplain - Returns the execution plan for a complex query.
// The 'index' parameter specifies the index to query, and the 'query' parameter specifies the query string.
// For more information, please refer to the Redis documentation:
// [FT.EXPLAIN]: (https://redis.io/commands/ft.explain/)
func (c cmdable) FTExplain(ctx context.Context, index string, query string) *StringCmd {
cmd := NewStringCmd(ctx, "FT.EXPLAIN", index, query)
_ = c(ctx, cmd)
return cmd
}
// FTExplainWithArgs - Returns the execution plan for a complex query with options.
// The 'index' parameter specifies the index to query, the 'query' parameter specifies the query string, and the 'options' parameter specifies the Dialect for the query.
// For more information, please refer to the Redis documentation:
// [FT.EXPLAIN]: (https://redis.io/commands/ft.explain/)
func (c cmdable) FTExplainWithArgs(ctx context.Context, index string, query string, options *FTExplainOptions) *StringCmd {
args := []interface{}{"FT.EXPLAIN", index, query}
if options.Dialect != "" {
args = append(args, "DIALECT", options.Dialect)
} else {
args = append(args, "DIALECT", 2)
}
cmd := NewStringCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// FTExplainCli - Returns the execution plan for a complex query. [Not Implemented]
// For more information, see https://redis.io/commands/ft.explaincli/
func (c cmdable) FTExplainCli(ctx context.Context, key, path string) error {
return fmt.Errorf("FTExplainCli is not implemented")
}
func parseFTInfo(data map[string]interface{}) (FTInfoResult, error) {
var ftInfo FTInfoResult
// Manually parse each field from the map
if indexErrors, ok := data["Index Errors"].([]interface{}); ok {
ftInfo.IndexErrors = IndexErrors{
IndexingFailures: internal.ToInteger(indexErrors[1]),
LastIndexingError: internal.ToString(indexErrors[3]),
LastIndexingErrorKey: internal.ToString(indexErrors[5]),
}
}
if attributes, ok := data["attributes"].([]interface{}); ok {
for _, attr := range attributes {
if attrMap, ok := attr.([]interface{}); ok {
att := FTAttribute{}
attrLen := len(attrMap)
for i := 0; i < attrLen; i++ {
if internal.ToLower(internal.ToString(attrMap[i])) == "attribute" && i+1 < attrLen {
att.Attribute = internal.ToString(attrMap[i+1])
i++
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "identifier" && i+1 < attrLen {
att.Identifier = internal.ToString(attrMap[i+1])
i++
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "type" && i+1 < attrLen {
att.Type = internal.ToString(attrMap[i+1])
i++
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "weight" && i+1 < attrLen {
att.Weight = internal.ToFloat(attrMap[i+1])
i++
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "nostem" {
att.NoStem = true
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "sortable" {
att.Sortable = true
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "noindex" {
att.NoIndex = true
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "unf" {
att.UNF = true
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "phonetic" && i+1 < attrLen {
att.PhoneticMatcher = internal.ToString(attrMap[i+1])
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "case_sensitive" {
att.CaseSensitive = true
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "withsuffixtrie" {
att.WithSuffixtrie = true
continue
}
// vector specific attributes
if internal.ToLower(internal.ToString(attrMap[i])) == "algorithm" && i+1 < attrLen {
att.Algorithm = internal.ToString(attrMap[i+1])
i++
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "data_type" && i+1 < attrLen {
att.DataType = internal.ToString(attrMap[i+1])
i++
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "dim" && i+1 < attrLen {
att.Dim = internal.ToInteger(attrMap[i+1])
i++
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "distance_metric" && i+1 < attrLen {
att.DistanceMetric = internal.ToString(attrMap[i+1])
i++
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "m" && i+1 < attrLen {
att.M = internal.ToInteger(attrMap[i+1])
i++
continue
}
if internal.ToLower(internal.ToString(attrMap[i])) == "ef_construction" && i+1 < attrLen {
att.EFConstruction = internal.ToInteger(attrMap[i+1])
i++
continue
}
}
ftInfo.Attributes = append(ftInfo.Attributes, att)
}
}
}
ftInfo.BytesPerRecordAvg = internal.ToString(data["bytes_per_record_avg"])
ftInfo.Cleaning = internal.ToInteger(data["cleaning"])
if cursorStats, ok := data["cursor_stats"].([]interface{}); ok {
ftInfo.CursorStats = CursorStats{
GlobalIdle: internal.ToInteger(cursorStats[1]),
GlobalTotal: internal.ToInteger(cursorStats[3]),
IndexCapacity: internal.ToInteger(cursorStats[5]),
IndexTotal: internal.ToInteger(cursorStats[7]),
}
}
if dialectStats, ok := data["dialect_stats"].([]interface{}); ok {
ftInfo.DialectStats = make(map[string]int)
for i := 0; i < len(dialectStats); i += 2 {
ftInfo.DialectStats[internal.ToString(dialectStats[i])] = internal.ToInteger(dialectStats[i+1])
}
}
ftInfo.DocTableSizeMB = internal.ToFloat(data["doc_table_size_mb"])
if fieldStats, ok := data["field statistics"].([]interface{}); ok {
for _, stat := range fieldStats {
if statMap, ok := stat.([]interface{}); ok {
ftInfo.FieldStatistics = append(ftInfo.FieldStatistics, FieldStatistic{
Identifier: internal.ToString(statMap[1]),
Attribute: internal.ToString(statMap[3]),
IndexErrors: IndexErrors{
IndexingFailures: internal.ToInteger(statMap[5].([]interface{})[1]),
LastIndexingError: internal.ToString(statMap[5].([]interface{})[3]),
LastIndexingErrorKey: internal.ToString(statMap[5].([]interface{})[5]),
},
})
}
}
}
if gcStats, ok := data["gc_stats"].([]interface{}); ok {
ftInfo.GCStats = GCStats{}
for i := 0; i < len(gcStats); i += 2 {
if internal.ToLower(internal.ToString(gcStats[i])) == "bytes_collected" {
ftInfo.GCStats.BytesCollected = internal.ToInteger(gcStats[i+1])
continue
}
if internal.ToLower(internal.ToString(gcStats[i])) == "total_ms_run" {
ftInfo.GCStats.TotalMsRun = internal.ToInteger(gcStats[i+1])
continue
}
if internal.ToLower(internal.ToString(gcStats[i])) == "total_cycles" {
ftInfo.GCStats.TotalCycles = internal.ToInteger(gcStats[i+1])
continue
}
if internal.ToLower(internal.ToString(gcStats[i])) == "average_cycle_time_ms" {
ftInfo.GCStats.AverageCycleTimeMs = internal.ToString(gcStats[i+1])
continue
}
if internal.ToLower(internal.ToString(gcStats[i])) == "last_run_time_ms" {
ftInfo.GCStats.LastRunTimeMs = internal.ToInteger(gcStats[i+1])
continue
}
if internal.ToLower(internal.ToString(gcStats[i])) == "gc_numeric_trees_missed" {
ftInfo.GCStats.GCNumericTreesMissed = internal.ToInteger(gcStats[i+1])
continue
}
if internal.ToLower(internal.ToString(gcStats[i])) == "gc_blocks_denied" {
ftInfo.GCStats.GCBlocksDenied = internal.ToInteger(gcStats[i+1])
continue
}
}
}
ftInfo.GeoshapesSzMB = internal.ToFloat(data["geoshapes_sz_mb"])
ftInfo.HashIndexingFailures = internal.ToInteger(data["hash_indexing_failures"])
if indexDef, ok := data["index_definition"].([]interface{}); ok {
ftInfo.IndexDefinition = IndexDefinition{
KeyType: internal.ToString(indexDef[1]),
Prefixes: internal.ToStringSlice(indexDef[3]),
DefaultScore: internal.ToFloat(indexDef[5]),
}
}
ftInfo.IndexName = internal.ToString(data["index_name"])
ftInfo.IndexOptions = internal.ToStringSlice(data["index_options"].([]interface{}))
ftInfo.Indexing = internal.ToInteger(data["indexing"])
ftInfo.InvertedSzMB = internal.ToFloat(data["inverted_sz_mb"])
ftInfo.KeyTableSizeMB = internal.ToFloat(data["key_table_size_mb"])
ftInfo.MaxDocID = internal.ToInteger(data["max_doc_id"])
ftInfo.NumDocs = internal.ToInteger(data["num_docs"])
ftInfo.NumRecords = internal.ToInteger(data["num_records"])
ftInfo.NumTerms = internal.ToInteger(data["num_terms"])
ftInfo.NumberOfUses = internal.ToInteger(data["number_of_uses"])
ftInfo.OffsetBitsPerRecordAvg = internal.ToString(data["offset_bits_per_record_avg"])
ftInfo.OffsetVectorsSzMB = internal.ToFloat(data["offset_vectors_sz_mb"])
ftInfo.OffsetsPerTermAvg = internal.ToString(data["offsets_per_term_avg"])
ftInfo.PercentIndexed = internal.ToFloat(data["percent_indexed"])
ftInfo.RecordsPerDocAvg = internal.ToString(data["records_per_doc_avg"])
ftInfo.SortableValuesSizeMB = internal.ToFloat(data["sortable_values_size_mb"])
ftInfo.TagOverheadSzMB = internal.ToFloat(data["tag_overhead_sz_mb"])
ftInfo.TextOverheadSzMB = internal.ToFloat(data["text_overhead_sz_mb"])
ftInfo.TotalIndexMemorySzMB = internal.ToFloat(data["total_index_memory_sz_mb"])
ftInfo.TotalIndexingTime = internal.ToInteger(data["total_indexing_time"])
ftInfo.TotalInvertedIndexBlocks = internal.ToInteger(data["total_inverted_index_blocks"])
ftInfo.VectorIndexSzMB = internal.ToFloat(data["vector_index_sz_mb"])
return ftInfo, nil
}
type FTInfoCmd struct {
baseCmd
val FTInfoResult
}
func newFTInfoCmd(ctx context.Context, args ...interface{}) *FTInfoCmd {
return &FTInfoCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeFTInfo,
},
}
}
func (cmd *FTInfoCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *FTInfoCmd) SetVal(val FTInfoResult) {
cmd.val = val
}
func (cmd *FTInfoCmd) Result() (FTInfoResult, error) {
return cmd.val, cmd.err
}
func (cmd *FTInfoCmd) Val() FTInfoResult {
return cmd.val
}
func (cmd *FTInfoCmd) RawVal() interface{} {
return cmd.rawVal
}
func (cmd *FTInfoCmd) RawResult() (interface{}, error) {
return cmd.rawVal, cmd.err
}
func (cmd *FTInfoCmd) readReply(rd *proto.Reader) (err error) {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
data := make(map[string]interface{}, n)
for i := 0; i < n; i++ {
k, err := rd.ReadString()
if err != nil {
return err
}
v, err := rd.ReadReply()
if err != nil {
if err == Nil {
data[k] = Nil
continue
}
if err, ok := err.(proto.RedisError); ok {
data[k] = err
continue
}
return err
}
data[k] = v
}
cmd.val, err = parseFTInfo(data)
if err != nil {
return err
}
return nil
}
func (cmd *FTInfoCmd) Clone() Cmder {
val := FTInfoResult{
IndexErrors: cmd.val.IndexErrors,
BytesPerRecordAvg: cmd.val.BytesPerRecordAvg,
Cleaning: cmd.val.Cleaning,
CursorStats: cmd.val.CursorStats,
DocTableSizeMB: cmd.val.DocTableSizeMB,
GCStats: cmd.val.GCStats,
GeoshapesSzMB: cmd.val.GeoshapesSzMB,
HashIndexingFailures: cmd.val.HashIndexingFailures,
IndexDefinition: cmd.val.IndexDefinition,
IndexName: cmd.val.IndexName,
Indexing: cmd.val.Indexing,
InvertedSzMB: cmd.val.InvertedSzMB,
KeyTableSizeMB: cmd.val.KeyTableSizeMB,
MaxDocID: cmd.val.MaxDocID,
NumDocs: cmd.val.NumDocs,
NumRecords: cmd.val.NumRecords,
NumTerms: cmd.val.NumTerms,
NumberOfUses: cmd.val.NumberOfUses,
OffsetBitsPerRecordAvg: cmd.val.OffsetBitsPerRecordAvg,
OffsetVectorsSzMB: cmd.val.OffsetVectorsSzMB,
OffsetsPerTermAvg: cmd.val.OffsetsPerTermAvg,
PercentIndexed: cmd.val.PercentIndexed,
RecordsPerDocAvg: cmd.val.RecordsPerDocAvg,
SortableValuesSizeMB: cmd.val.SortableValuesSizeMB,
TagOverheadSzMB: cmd.val.TagOverheadSzMB,
TextOverheadSzMB: cmd.val.TextOverheadSzMB,
TotalIndexMemorySzMB: cmd.val.TotalIndexMemorySzMB,
TotalIndexingTime: cmd.val.TotalIndexingTime,
TotalInvertedIndexBlocks: cmd.val.TotalInvertedIndexBlocks,
VectorIndexSzMB: cmd.val.VectorIndexSzMB,
}
// Clone slices and maps
if cmd.val.Attributes != nil {
val.Attributes = make([]FTAttribute, len(cmd.val.Attributes))
copy(val.Attributes, cmd.val.Attributes)
}
if cmd.val.DialectStats != nil {
val.DialectStats = make(map[string]int, len(cmd.val.DialectStats))
for k, v := range cmd.val.DialectStats {
val.DialectStats[k] = v
}
}
if cmd.val.FieldStatistics != nil {
val.FieldStatistics = make([]FieldStatistic, len(cmd.val.FieldStatistics))
copy(val.FieldStatistics, cmd.val.FieldStatistics)
}
if cmd.val.IndexOptions != nil {
val.IndexOptions = make([]string, len(cmd.val.IndexOptions))
copy(val.IndexOptions, cmd.val.IndexOptions)
}
if cmd.val.IndexDefinition.Prefixes != nil {
val.IndexDefinition.Prefixes = make([]string, len(cmd.val.IndexDefinition.Prefixes))
copy(val.IndexDefinition.Prefixes, cmd.val.IndexDefinition.Prefixes)
}
return &FTInfoCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
// FTInfo - Retrieves information about an index.
// The 'index' parameter specifies the index to retrieve information about.
// For more information, please refer to the Redis documentation:
// [FT.INFO]: (https://redis.io/commands/ft.info/)
func (c cmdable) FTInfo(ctx context.Context, index string) *FTInfoCmd {
cmd := newFTInfoCmd(ctx, "FT.INFO", index)
_ = c(ctx, cmd)
return cmd
}
// FTSpellCheck - Checks a query string for spelling errors.
// For more details about spellcheck query please follow:
// https://redis.io/docs/interact/search-and-query/advanced-concepts/spellcheck/
// For more information, please refer to the Redis documentation:
// [FT.SPELLCHECK]: (https://redis.io/commands/ft.spellcheck/)
func (c cmdable) FTSpellCheck(ctx context.Context, index string, query string) *FTSpellCheckCmd {
args := []interface{}{"FT.SPELLCHECK", index, query}
cmd := newFTSpellCheckCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// FTSpellCheckWithArgs - Checks a query string for spelling errors with additional options.
// For more details about spellcheck query please follow:
// https://redis.io/docs/interact/search-and-query/advanced-concepts/spellcheck/
// For more information, please refer to the Redis documentation:
// [FT.SPELLCHECK]: (https://redis.io/commands/ft.spellcheck/)
func (c cmdable) FTSpellCheckWithArgs(ctx context.Context, index string, query string, options *FTSpellCheckOptions) *FTSpellCheckCmd {
args := []interface{}{"FT.SPELLCHECK", index, query}
if options != nil {
if options.Distance > 0 {
args = append(args, "DISTANCE", options.Distance)
}
if options.Terms != nil {
args = append(args, "TERMS", options.Terms.Inclusion, options.Terms.Dictionary)
args = append(args, options.Terms.Terms...)
}
if options.Dialect > 0 {
args = append(args, "DIALECT", options.Dialect)
} else {
args = append(args, "DIALECT", 2)
}
}
cmd := newFTSpellCheckCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type FTSpellCheckCmd struct {
baseCmd
val []SpellCheckResult
}
func newFTSpellCheckCmd(ctx context.Context, args ...interface{}) *FTSpellCheckCmd {
return &FTSpellCheckCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeFTSpellCheck,
},
}
}
func (cmd *FTSpellCheckCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *FTSpellCheckCmd) SetVal(val []SpellCheckResult) {
cmd.val = val
}
func (cmd *FTSpellCheckCmd) Result() ([]SpellCheckResult, error) {
return cmd.val, cmd.err
}
func (cmd *FTSpellCheckCmd) Val() []SpellCheckResult {
return cmd.val
}
func (cmd *FTSpellCheckCmd) RawVal() interface{} {
return cmd.rawVal
}
func (cmd *FTSpellCheckCmd) RawResult() (interface{}, error) {
return cmd.rawVal, cmd.err
}
func (cmd *FTSpellCheckCmd) readReply(rd *proto.Reader) (err error) {
data, err := rd.ReadSlice()
if err != nil {
return err
}
cmd.val, err = parseFTSpellCheck(data)
if err != nil {
return err
}
return nil
}
func parseFTSpellCheck(data []interface{}) ([]SpellCheckResult, error) {
results := make([]SpellCheckResult, 0, len(data))
for _, termData := range data {
termInfo, ok := termData.([]interface{})
if !ok || len(termInfo) != 3 {
return nil, fmt.Errorf("invalid term format")
}
term, ok := termInfo[1].(string)
if !ok {
return nil, fmt.Errorf("invalid term format")
}
suggestionsData, ok := termInfo[2].([]interface{})
if !ok {
return nil, fmt.Errorf("invalid suggestions format")
}
suggestions := make([]SpellCheckSuggestion, 0, len(suggestionsData))
for _, suggestionData := range suggestionsData {
suggestionInfo, ok := suggestionData.([]interface{})
if !ok || len(suggestionInfo) != 2 {
return nil, fmt.Errorf("invalid suggestion format")
}
scoreStr, ok := suggestionInfo[0].(string)
if !ok {
return nil, fmt.Errorf("invalid suggestion score format")
}
score, err := strconv.ParseFloat(scoreStr, 64)
if err != nil {
return nil, fmt.Errorf("invalid suggestion score value")
}
suggestion, ok := suggestionInfo[1].(string)
if !ok {
return nil, fmt.Errorf("invalid suggestion format")
}
suggestions = append(suggestions, SpellCheckSuggestion{
Score: score,
Suggestion: suggestion,
})
}
results = append(results, SpellCheckResult{
Term: term,
Suggestions: suggestions,
})
}
return results, nil
}
func (cmd *FTSpellCheckCmd) Clone() Cmder {
var val []SpellCheckResult
if cmd.val != nil {
val = make([]SpellCheckResult, len(cmd.val))
for i, result := range cmd.val {
val[i] = SpellCheckResult{
Term: result.Term,
}
if result.Suggestions != nil {
val[i].Suggestions = make([]SpellCheckSuggestion, len(result.Suggestions))
copy(val[i].Suggestions, result.Suggestions)
}
}
}
return &FTSpellCheckCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
func parseFTSearch(data []interface{}, noContent, withScores, withPayloads, withSortKeys bool) (FTSearchResult, error) {
if len(data) < 1 {
return FTSearchResult{}, fmt.Errorf("unexpected search result format")
}
total, ok := data[0].(int64)
if !ok {
return FTSearchResult{}, fmt.Errorf("invalid total results format")
}
var results []Document
for i := 1; i < len(data); {
docID, ok := data[i].(string)
if !ok {
return FTSearchResult{}, fmt.Errorf("invalid document ID format")
}
doc := Document{
ID: docID,
Fields: make(map[string]string),
}
i++
if noContent {
results = append(results, doc)
continue
}
if withScores && i < len(data) {
if scoreStr, ok := data[i].(string); ok {
score, err := strconv.ParseFloat(scoreStr, 64)
if err != nil {
return FTSearchResult{}, fmt.Errorf("invalid score format")
}
doc.Score = &score
i++
}
}
if withPayloads && i < len(data) {
if payload, ok := data[i].(string); ok {
doc.Payload = &payload
i++
}
}
if withSortKeys && i < len(data) {
if sortKey, ok := data[i].(string); ok {
doc.SortKey = &sortKey
i++
}
}
if i < len(data) {
fields, ok := data[i].([]interface{})
if !ok {
if data[i] == proto.Nil || data[i] == nil {
doc.Error = proto.Nil
doc.Fields = map[string]string{}
fields = []interface{}{}
} else {
return FTSearchResult{}, fmt.Errorf("invalid document fields format")
}
}
for j := 0; j < len(fields); j += 2 {
key, ok := fields[j].(string)
if !ok {
return FTSearchResult{}, fmt.Errorf("invalid field key format")
}
value, ok := fields[j+1].(string)
if !ok {
return FTSearchResult{}, fmt.Errorf("invalid field value format")
}
doc.Fields[key] = value
}
i++
}
results = append(results, doc)
}
return FTSearchResult{
Total: int(total),
Docs: results,
}, nil
}
type FTSearchCmd struct {
baseCmd
val FTSearchResult
options *FTSearchOptions
}
func newFTSearchCmd(ctx context.Context, options *FTSearchOptions, args ...interface{}) *FTSearchCmd {
return &FTSearchCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeFTSearch,
},
options: options,
}
}
func (cmd *FTSearchCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *FTSearchCmd) SetVal(val FTSearchResult) {
cmd.val = val
}
func (cmd *FTSearchCmd) Result() (FTSearchResult, error) {
return cmd.val, cmd.err
}
func (cmd *FTSearchCmd) Val() FTSearchResult {
return cmd.val
}
func (cmd *FTSearchCmd) RawVal() interface{} {
return cmd.rawVal
}
func (cmd *FTSearchCmd) RawResult() (interface{}, error) {
return cmd.rawVal, cmd.err
}
func (cmd *FTSearchCmd) readReply(rd *proto.Reader) (err error) {
data, err := rd.ReadSlice()
if err != nil {
return err
}
cmd.val, err = parseFTSearch(data, cmd.options.NoContent, cmd.options.WithScores, cmd.options.WithPayloads, cmd.options.WithSortKeys)
if err != nil {
return err
}
return nil
}
func (cmd *FTSearchCmd) Clone() Cmder {
val := FTSearchResult{
Total: cmd.val.Total,
}
if cmd.val.Docs != nil {
val.Docs = make([]Document, len(cmd.val.Docs))
for i, doc := range cmd.val.Docs {
val.Docs[i] = Document{
ID: doc.ID,
Score: doc.Score,
Payload: doc.Payload,
SortKey: doc.SortKey,
}
if doc.Fields != nil {
val.Docs[i].Fields = make(map[string]string, len(doc.Fields))
for k, v := range doc.Fields {
val.Docs[i].Fields[k] = v
}
}
}
}
var options *FTSearchOptions
if cmd.options != nil {
options = &FTSearchOptions{
NoContent: cmd.options.NoContent,
Verbatim: cmd.options.Verbatim,
NoStopWords: cmd.options.NoStopWords,
WithScores: cmd.options.WithScores,
WithPayloads: cmd.options.WithPayloads,
WithSortKeys: cmd.options.WithSortKeys,
Slop: cmd.options.Slop,
Timeout: cmd.options.Timeout,
InOrder: cmd.options.InOrder,
Language: cmd.options.Language,
Expander: cmd.options.Expander,
Scorer: cmd.options.Scorer,
ExplainScore: cmd.options.ExplainScore,
Payload: cmd.options.Payload,
SortByWithCount: cmd.options.SortByWithCount,
LimitOffset: cmd.options.LimitOffset,
Limit: cmd.options.Limit,
CountOnly: cmd.options.CountOnly,
DialectVersion: cmd.options.DialectVersion,
}
// Clone slices and maps
if cmd.options.Filters != nil {
options.Filters = make([]FTSearchFilter, len(cmd.options.Filters))
copy(options.Filters, cmd.options.Filters)
}
if cmd.options.GeoFilter != nil {
options.GeoFilter = make([]FTSearchGeoFilter, len(cmd.options.GeoFilter))
copy(options.GeoFilter, cmd.options.GeoFilter)
}
if cmd.options.InKeys != nil {
options.InKeys = make([]interface{}, len(cmd.options.InKeys))
copy(options.InKeys, cmd.options.InKeys)
}
if cmd.options.InFields != nil {
options.InFields = make([]interface{}, len(cmd.options.InFields))
copy(options.InFields, cmd.options.InFields)
}
if cmd.options.Return != nil {
options.Return = make([]FTSearchReturn, len(cmd.options.Return))
copy(options.Return, cmd.options.Return)
}
if cmd.options.SortBy != nil {
options.SortBy = make([]FTSearchSortBy, len(cmd.options.SortBy))
copy(options.SortBy, cmd.options.SortBy)
}
if cmd.options.Params != nil {
options.Params = make(map[string]interface{}, len(cmd.options.Params))
for k, v := range cmd.options.Params {
options.Params[k] = v
}
}
}
return &FTSearchCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
options: options,
}
}
// FTHybridResult represents the result of a hybrid search operation
type FTHybridResult struct {
TotalResults int
Results []map[string]interface{}
Warnings []string
ExecutionTime float64
}
// FTHybridCursorResult represents cursor result for hybrid search
type FTHybridCursorResult struct {
SearchCursorID int
VsimCursorID int
}
type FTHybridCmd struct {
baseCmd
val FTHybridResult
cursorVal *FTHybridCursorResult
options *FTHybridOptions
withCursor bool
}
func newFTHybridCmd(ctx context.Context, options *FTHybridOptions, args ...interface{}) *FTHybridCmd {
var withCursor bool
if options != nil && options.WithCursor {
withCursor = true
}
return &FTHybridCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
},
options: options,
withCursor: withCursor,
}
}
func (cmd *FTHybridCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *FTHybridCmd) SetVal(val FTHybridResult) {
cmd.val = val
}
func (cmd *FTHybridCmd) Result() (FTHybridResult, error) {
return cmd.val, cmd.err
}
func (cmd *FTHybridCmd) CursorResult() (*FTHybridCursorResult, error) {
return cmd.cursorVal, cmd.err
}
func (cmd *FTHybridCmd) Val() FTHybridResult {
return cmd.val
}
func (cmd *FTHybridCmd) CursorVal() *FTHybridCursorResult {
return cmd.cursorVal
}
func (cmd *FTHybridCmd) RawVal() interface{} {
return cmd.rawVal
}
func (cmd *FTHybridCmd) RawResult() (interface{}, error) {
return cmd.rawVal, cmd.err
}
func parseFTHybrid(data []interface{}, withCursor bool) (FTHybridResult, *FTHybridCursorResult, error) {
// Convert to map
resultMap := make(map[string]interface{})
for i := 0; i < len(data); i += 2 {
if i+1 < len(data) {
key, ok := data[i].(string)
if !ok {
return FTHybridResult{}, nil, fmt.Errorf("invalid key type at index %d", i)
}
resultMap[key] = data[i+1]
}
}
// Handle cursor result
if withCursor {
searchCursorID, ok1 := resultMap["SEARCH"].(int64)
vsimCursorID, ok2 := resultMap["VSIM"].(int64)
if !ok1 || !ok2 {
return FTHybridResult{}, nil, fmt.Errorf("invalid cursor result format")
}
return FTHybridResult{}, &FTHybridCursorResult{
SearchCursorID: int(searchCursorID),
VsimCursorID: int(vsimCursorID),
}, nil
}
// Parse regular result
totalResults, ok := resultMap["total_results"].(int64)
if !ok {
return FTHybridResult{}, nil, fmt.Errorf("invalid total_results format")
}
resultsData, ok := resultMap["results"].([]interface{})
if !ok {
return FTHybridResult{}, nil, fmt.Errorf("invalid results format")
}
// Parse each result item
results := make([]map[string]interface{}, 0, len(resultsData))
for _, item := range resultsData {
// Try parsing as map[string]interface{} first (RESP3 format)
if itemMap, ok := item.(map[string]interface{}); ok {
results = append(results, itemMap)
continue
}
// Try parsing as map[interface{}]interface{} (alternative RESP3 format)
if rawMap, ok := item.(map[interface{}]interface{}); ok {
itemMap := make(map[string]interface{})
for k, v := range rawMap {
if keyStr, ok := k.(string); ok {
itemMap[keyStr] = v
}
}
results = append(results, itemMap)
continue
}
// Fall back to array format (RESP2 format - key-value pairs)
itemData, ok := item.([]interface{})
if !ok {
return FTHybridResult{}, nil, fmt.Errorf("invalid result item format")
}
itemMap := make(map[string]interface{})
for i := 0; i < len(itemData); i += 2 {
if i+1 < len(itemData) {
key, ok := itemData[i].(string)
if !ok {
return FTHybridResult{}, nil, fmt.Errorf("invalid item key format")
}
itemMap[key] = itemData[i+1]
}
}
results = append(results, itemMap)
}
// Parse warnings (optional field)
var warnings []string
if warningsData, ok := resultMap["warnings"].([]interface{}); ok {
warnings = make([]string, 0, len(warningsData))
for _, w := range warningsData {
if ws, ok := w.(string); ok {
warnings = append(warnings, ws)
}
}
}
// Parse execution time (optional field)
var executionTime float64
if execTimeVal, exists := resultMap["execution_time"]; exists {
switch v := execTimeVal.(type) {
case string:
var err error
executionTime, err = strconv.ParseFloat(v, 64)
if err != nil {
return FTHybridResult{}, nil, fmt.Errorf("invalid execution_time format: %v", err)
}
case float64:
executionTime = v
case int64:
executionTime = float64(v)
}
}
return FTHybridResult{
TotalResults: int(totalResults),
Results: results,
Warnings: warnings,
ExecutionTime: executionTime,
}, nil, nil
}
func (cmd *FTHybridCmd) readReply(rd *proto.Reader) (err error) {
data, err := rd.ReadSlice()
if err != nil {
return err
}
result, cursorResult, err := parseFTHybrid(data, cmd.withCursor)
if err != nil {
return err
}
if cmd.withCursor {
cmd.cursorVal = cursorResult
} else {
cmd.val = result
}
return nil
}
func (cmd *FTHybridCmd) Clone() Cmder {
val := FTHybridResult{
TotalResults: cmd.val.TotalResults,
ExecutionTime: cmd.val.ExecutionTime,
}
if cmd.val.Results != nil {
val.Results = make([]map[string]interface{}, len(cmd.val.Results))
for i, result := range cmd.val.Results {
val.Results[i] = make(map[string]interface{}, len(result))
for k, v := range result {
val.Results[i][k] = v
}
}
}
if cmd.val.Warnings != nil {
val.Warnings = make([]string, len(cmd.val.Warnings))
copy(val.Warnings, cmd.val.Warnings)
}
var cursorVal *FTHybridCursorResult
if cmd.cursorVal != nil {
cursorVal = &FTHybridCursorResult{
SearchCursorID: cmd.cursorVal.SearchCursorID,
VsimCursorID: cmd.cursorVal.VsimCursorID,
}
}
var options *FTHybridOptions
if cmd.options != nil {
options = &FTHybridOptions{
CountExpressions: cmd.options.CountExpressions,
Load: cmd.options.Load,
Filter: cmd.options.Filter,
LimitOffset: cmd.options.LimitOffset,
Limit: cmd.options.Limit,
ExplainScore: cmd.options.ExplainScore,
Timeout: cmd.options.Timeout,
WithCursor: cmd.options.WithCursor,
}
// Clone slices and maps
if cmd.options.SearchExpressions != nil {
options.SearchExpressions = make([]FTHybridSearchExpression, len(cmd.options.SearchExpressions))
copy(options.SearchExpressions, cmd.options.SearchExpressions)
}
if cmd.options.VectorExpressions != nil {
options.VectorExpressions = make([]FTHybridVectorExpression, len(cmd.options.VectorExpressions))
copy(options.VectorExpressions, cmd.options.VectorExpressions)
}
if cmd.options.Combine != nil {
options.Combine = &FTHybridCombineOptions{
Method: cmd.options.Combine.Method,
Count: cmd.options.Combine.Count,
Window: cmd.options.Combine.Window,
Constant: cmd.options.Combine.Constant,
Alpha: cmd.options.Combine.Alpha,
Beta: cmd.options.Combine.Beta,
YieldScoreAs: cmd.options.Combine.YieldScoreAs,
}
}
if cmd.options.GroupBy != nil {
options.GroupBy = &FTHybridGroupBy{
Count: cmd.options.GroupBy.Count,
ReduceFunc: cmd.options.GroupBy.ReduceFunc,
ReduceCount: cmd.options.GroupBy.ReduceCount,
}
if cmd.options.GroupBy.Fields != nil {
options.GroupBy.Fields = make([]string, len(cmd.options.GroupBy.Fields))
copy(options.GroupBy.Fields, cmd.options.GroupBy.Fields)
}
if cmd.options.GroupBy.ReduceParams != nil {
options.GroupBy.ReduceParams = make([]interface{}, len(cmd.options.GroupBy.ReduceParams))
copy(options.GroupBy.ReduceParams, cmd.options.GroupBy.ReduceParams)
}
}
if cmd.options.Apply != nil {
options.Apply = make([]FTHybridApply, len(cmd.options.Apply))
copy(options.Apply, cmd.options.Apply)
}
if cmd.options.SortBy != nil {
options.SortBy = make([]FTSearchSortBy, len(cmd.options.SortBy))
copy(options.SortBy, cmd.options.SortBy)
}
if cmd.options.Params != nil {
options.Params = make(map[string]interface{}, len(cmd.options.Params))
for k, v := range cmd.options.Params {
options.Params[k] = v
}
}
if cmd.options.WithCursorOptions != nil {
options.WithCursorOptions = &FTHybridWithCursor{
MaxIdle: cmd.options.WithCursorOptions.MaxIdle,
Count: cmd.options.WithCursorOptions.Count,
}
}
}
return &FTHybridCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
cursorVal: cursorVal,
options: options,
withCursor: cmd.withCursor,
}
}
// FTSearch - Executes a search query on an index.
// The 'index' parameter specifies the index to search, and the 'query' parameter specifies the search query.
// For more information, please refer to the Redis documentation about [FT.SEARCH].
//
// [FT.SEARCH]: (https://redis.io/commands/ft.search/)
func (c cmdable) FTSearch(ctx context.Context, index string, query string) *FTSearchCmd {
args := []interface{}{"FT.SEARCH", index, query}
cmd := newFTSearchCmd(ctx, &FTSearchOptions{}, args...)
_ = c(ctx, cmd)
return cmd
}
type SearchQuery []interface{}
// FTSearchQuery - Executes a search query on an index with additional options.
// The 'index' parameter specifies the index to search, the 'query' parameter specifies the search query,
// and the 'options' parameter specifies additional options for the search.
// For more information, please refer to the Redis documentation about [FT.SEARCH].
//
// [FT.SEARCH]: (https://redis.io/commands/ft.search/)
func FTSearchQuery(query string, options *FTSearchOptions) (SearchQuery, error) {
queryArgs := []interface{}{query}
if options != nil {
if options.NoContent {
queryArgs = append(queryArgs, "NOCONTENT")
}
if options.Verbatim {
queryArgs = append(queryArgs, "VERBATIM")
}
if options.NoStopWords {
queryArgs = append(queryArgs, "NOSTOPWORDS")
}
if options.WithScores {
queryArgs = append(queryArgs, "WITHSCORES")
}
if options.WithPayloads {
queryArgs = append(queryArgs, "WITHPAYLOADS")
}
if options.WithSortKeys {
queryArgs = append(queryArgs, "WITHSORTKEYS")
}
if options.Filters != nil {
for _, filter := range options.Filters {
queryArgs = append(queryArgs, "FILTER", filter.FieldName, filter.Min, filter.Max)
}
}
if options.GeoFilter != nil {
for _, geoFilter := range options.GeoFilter {
queryArgs = append(queryArgs, "GEOFILTER", geoFilter.FieldName, geoFilter.Longitude, geoFilter.Latitude, geoFilter.Radius, geoFilter.Unit)
}
}
if options.InKeys != nil {
queryArgs = append(queryArgs, "INKEYS", len(options.InKeys))
queryArgs = append(queryArgs, options.InKeys...)
}
if options.InFields != nil {
queryArgs = append(queryArgs, "INFIELDS", len(options.InFields))
queryArgs = append(queryArgs, options.InFields...)
}
if options.Return != nil {
queryArgs = append(queryArgs, "RETURN")
queryArgsReturn := []interface{}{}
for _, ret := range options.Return {
queryArgsReturn = append(queryArgsReturn, ret.FieldName)
if ret.As != "" {
queryArgsReturn = append(queryArgsReturn, "AS", ret.As)
}
}
queryArgs = append(queryArgs, len(queryArgsReturn))
queryArgs = append(queryArgs, queryArgsReturn...)
}
if options.Slop > 0 {
queryArgs = append(queryArgs, "SLOP", options.Slop)
}
if options.Timeout > 0 {
queryArgs = append(queryArgs, "TIMEOUT", options.Timeout)
}
if options.InOrder {
queryArgs = append(queryArgs, "INORDER")
}
if options.Language != "" {
queryArgs = append(queryArgs, "LANGUAGE", options.Language)
}
if options.Expander != "" {
queryArgs = append(queryArgs, "EXPANDER", options.Expander)
}
if options.Scorer != "" {
queryArgs = append(queryArgs, "SCORER", options.Scorer)
}
if options.ExplainScore {
queryArgs = append(queryArgs, "EXPLAINSCORE")
}
if options.Payload != "" {
queryArgs = append(queryArgs, "PAYLOAD", options.Payload)
}
if options.SortBy != nil {
queryArgs = append(queryArgs, "SORTBY")
for _, sortBy := range options.SortBy {
queryArgs = append(queryArgs, sortBy.FieldName)
if sortBy.Asc && sortBy.Desc {
return nil, fmt.Errorf("FT.SEARCH: ASC and DESC are mutually exclusive")
}
if sortBy.Asc {
queryArgs = append(queryArgs, "ASC")
}
if sortBy.Desc {
queryArgs = append(queryArgs, "DESC")
}
}
if options.SortByWithCount {
queryArgs = append(queryArgs, "WITHCOUNT")
}
}
if options.LimitOffset >= 0 && options.Limit > 0 {
queryArgs = append(queryArgs, "LIMIT", options.LimitOffset, options.Limit)
}
if options.Params != nil {
queryArgs = append(queryArgs, "PARAMS", len(options.Params)*2)
for key, value := range options.Params {
queryArgs = append(queryArgs, key, value)
}
}
if options.DialectVersion > 0 {
queryArgs = append(queryArgs, "DIALECT", options.DialectVersion)
} else {
queryArgs = append(queryArgs, "DIALECT", 2)
}
}
return queryArgs, nil
}
// FTSearchWithArgs - Executes a search query on an index with additional options.
// The 'index' parameter specifies the index to search, the 'query' parameter specifies the search query,
// and the 'options' parameter specifies additional options for the search.
// For more information, please refer to the Redis documentation about [FT.SEARCH].
//
// [FT.SEARCH]: (https://redis.io/commands/ft.search/)
func (c cmdable) FTSearchWithArgs(ctx context.Context, index string, query string, options *FTSearchOptions) *FTSearchCmd {
args := []interface{}{"FT.SEARCH", index, query}
if options != nil {
if options.NoContent {
args = append(args, "NOCONTENT")
}
if options.Verbatim {
args = append(args, "VERBATIM")
}
if options.NoStopWords {
args = append(args, "NOSTOPWORDS")
}
if options.WithScores {
args = append(args, "WITHSCORES")
}
if options.WithPayloads {
args = append(args, "WITHPAYLOADS")
}
if options.WithSortKeys {
args = append(args, "WITHSORTKEYS")
}
if options.Filters != nil {
for _, filter := range options.Filters {
args = append(args, "FILTER", filter.FieldName, filter.Min, filter.Max)
}
}
if options.GeoFilter != nil {
for _, geoFilter := range options.GeoFilter {
args = append(args, "GEOFILTER", geoFilter.FieldName, geoFilter.Longitude, geoFilter.Latitude, geoFilter.Radius, geoFilter.Unit)
}
}
if options.InKeys != nil {
args = append(args, "INKEYS", len(options.InKeys))
args = append(args, options.InKeys...)
}
if options.InFields != nil {
args = append(args, "INFIELDS", len(options.InFields))
args = append(args, options.InFields...)
}
if options.Return != nil {
args = append(args, "RETURN")
argsReturn := []interface{}{}
for _, ret := range options.Return {
argsReturn = append(argsReturn, ret.FieldName)
if ret.As != "" {
argsReturn = append(argsReturn, "AS", ret.As)
}
}
args = append(args, len(argsReturn))
args = append(args, argsReturn...)
}
if options.Slop > 0 {
args = append(args, "SLOP", options.Slop)
}
if options.Timeout > 0 {
args = append(args, "TIMEOUT", options.Timeout)
}
if options.InOrder {
args = append(args, "INORDER")
}
if options.Language != "" {
args = append(args, "LANGUAGE", options.Language)
}
if options.Expander != "" {
args = append(args, "EXPANDER", options.Expander)
}
if options.Scorer != "" {
args = append(args, "SCORER", options.Scorer)
}
if options.ExplainScore {
args = append(args, "EXPLAINSCORE")
}
if options.Payload != "" {
args = append(args, "PAYLOAD", options.Payload)
}
if options.SortBy != nil {
args = append(args, "SORTBY")
for _, sortBy := range options.SortBy {
args = append(args, sortBy.FieldName)
if sortBy.Asc && sortBy.Desc {
cmd := newFTSearchCmd(ctx, options, args...)
cmd.SetErr(fmt.Errorf("FT.SEARCH: ASC and DESC are mutually exclusive"))
return cmd
}
if sortBy.Asc {
args = append(args, "ASC")
}
if sortBy.Desc {
args = append(args, "DESC")
}
}
if options.SortByWithCount {
args = append(args, "WITHCOUNT")
}
}
if options.CountOnly {
args = append(args, "LIMIT", 0, 0)
} else {
if options.LimitOffset >= 0 && options.Limit > 0 || options.LimitOffset > 0 && options.Limit == 0 {
args = append(args, "LIMIT", options.LimitOffset, options.Limit)
}
}
if options.Params != nil {
args = append(args, "PARAMS", len(options.Params)*2)
for key, value := range options.Params {
args = append(args, key, value)
}
}
if options.DialectVersion > 0 {
args = append(args, "DIALECT", options.DialectVersion)
} else {
args = append(args, "DIALECT", 2)
}
}
cmd := newFTSearchCmd(ctx, options, args...)
_ = c(ctx, cmd)
return cmd
}
func NewFTSynDumpCmd(ctx context.Context, args ...interface{}) *FTSynDumpCmd {
return &FTSynDumpCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeFTSynDump,
},
}
}
func (cmd *FTSynDumpCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *FTSynDumpCmd) SetVal(val []FTSynDumpResult) {
cmd.val = val
}
func (cmd *FTSynDumpCmd) Val() []FTSynDumpResult {
return cmd.val
}
func (cmd *FTSynDumpCmd) Result() ([]FTSynDumpResult, error) {
return cmd.val, cmd.err
}
func (cmd *FTSynDumpCmd) RawVal() interface{} {
return cmd.rawVal
}
func (cmd *FTSynDumpCmd) RawResult() (interface{}, error) {
return cmd.rawVal, cmd.err
}
func (cmd *FTSynDumpCmd) readReply(rd *proto.Reader) error {
termSynonymPairs, err := rd.ReadSlice()
if err != nil {
return err
}
var results []FTSynDumpResult
for i := 0; i < len(termSynonymPairs); i += 2 {
term, ok := termSynonymPairs[i].(string)
if !ok {
return fmt.Errorf("invalid term format")
}
synonyms, ok := termSynonymPairs[i+1].([]interface{})
if !ok {
return fmt.Errorf("invalid synonyms format")
}
synonymList := make([]string, len(synonyms))
for j, syn := range synonyms {
synonym, ok := syn.(string)
if !ok {
return fmt.Errorf("invalid synonym format")
}
synonymList[j] = synonym
}
results = append(results, FTSynDumpResult{
Term: term,
Synonyms: synonymList,
})
}
cmd.val = results
return nil
}
func (cmd *FTSynDumpCmd) Clone() Cmder {
var val []FTSynDumpResult
if cmd.val != nil {
val = make([]FTSynDumpResult, len(cmd.val))
for i, result := range cmd.val {
val[i] = FTSynDumpResult{
Term: result.Term,
}
if result.Synonyms != nil {
val[i].Synonyms = make([]string, len(result.Synonyms))
copy(val[i].Synonyms, result.Synonyms)
}
}
}
return &FTSynDumpCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
// FTSynDump - Dumps the contents of a synonym group.
// The 'index' parameter specifies the index to dump.
// For more information, please refer to the Redis documentation:
// [FT.SYNDUMP]: (https://redis.io/commands/ft.syndump/)
func (c cmdable) FTSynDump(ctx context.Context, index string) *FTSynDumpCmd {
cmd := NewFTSynDumpCmd(ctx, "FT.SYNDUMP", index)
_ = c(ctx, cmd)
return cmd
}
// FTSynUpdate - Creates or updates a synonym group with additional terms.
// The 'index' parameter specifies the index to update, the 'synGroupId' parameter specifies the synonym group id, and the 'terms' parameter specifies the additional terms.
// For more information, please refer to the Redis documentation:
// [FT.SYNUPDATE]: (https://redis.io/commands/ft.synupdate/)
func (c cmdable) FTSynUpdate(ctx context.Context, index string, synGroupId interface{}, terms []interface{}) *StatusCmd {
args := []interface{}{"FT.SYNUPDATE", index, synGroupId}
args = append(args, terms...)
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// FTSynUpdateWithArgs - Creates or updates a synonym group with additional terms and options.
// The 'index' parameter specifies the index to update, the 'synGroupId' parameter specifies the synonym group id, the 'options' parameter specifies additional options for the update, and the 'terms' parameter specifies the additional terms.
// For more information, please refer to the Redis documentation:
// [FT.SYNUPDATE]: (https://redis.io/commands/ft.synupdate/)
func (c cmdable) FTSynUpdateWithArgs(ctx context.Context, index string, synGroupId interface{}, options *FTSynUpdateOptions, terms []interface{}) *StatusCmd {
args := []interface{}{"FT.SYNUPDATE", index, synGroupId}
if options.SkipInitialScan {
args = append(args, "SKIPINITIALSCAN")
}
args = append(args, terms...)
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// FTTagVals - Returns all distinct values indexed in a tag field.
// The 'index' parameter specifies the index to check, and the 'field' parameter specifies the tag field to retrieve values from.
// For more information, please refer to the Redis documentation:
// [FT.TAGVALS]: (https://redis.io/commands/ft.tagvals/)
func (c cmdable) FTTagVals(ctx context.Context, index string, field string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "FT.TAGVALS", index, field)
_ = c(ctx, cmd)
return cmd
}
// FTHybrid - Executes a hybrid search combining full-text search and vector similarity
// The 'index' parameter specifies the index to search, 'searchExpr' is the search query,
// 'vectorField' is the name of the vector field, and 'vectorData' is the vector to search with.
// FTHybrid is still experimental, the command behaviour and signature may change
func (c cmdable) FTHybrid(ctx context.Context, index string, searchExpr string, vectorField string, vectorData Vector) *FTHybridCmd {
options := &FTHybridOptions{
CountExpressions: 2,
SearchExpressions: []FTHybridSearchExpression{
{Query: searchExpr},
},
VectorExpressions: []FTHybridVectorExpression{
{VectorField: vectorField, VectorData: vectorData},
},
}
return c.FTHybridWithArgs(ctx, index, options)
}
// FTHybridWithArgs - Executes a hybrid search with advanced options
// FTHybridWithArgs is still experimental, the command behaviour and signature may change
func (c cmdable) FTHybridWithArgs(ctx context.Context, index string, options *FTHybridOptions) *FTHybridCmd {
args := []interface{}{"FT.HYBRID", index}
if options != nil {
// Add search expressions
for _, searchExpr := range options.SearchExpressions {
args = append(args, "SEARCH", searchExpr.Query)
if searchExpr.Scorer != "" {
args = append(args, "SCORER", searchExpr.Scorer)
if len(searchExpr.ScorerParams) > 0 {
args = append(args, searchExpr.ScorerParams...)
}
}
if searchExpr.YieldScoreAs != "" {
args = append(args, "YIELD_SCORE_AS", searchExpr.YieldScoreAs)
}
}
// Add vector expressions
for _, vectorExpr := range options.VectorExpressions {
args = append(args, "VSIM", "@"+vectorExpr.VectorField)
// For FT.HYBRID, we need to send just the raw vector bytes, not the Value() format
// Value() returns [format, data] but FT.HYBRID expects just the blob
vectorValue := vectorExpr.VectorData.Value()
var vectorBlob interface{}
if len(vectorValue) >= 2 {
// vectorValue is [format, data, ...] - we only want the data part
vectorBlob = vectorValue[1]
} else {
// Fallback for unexpected format
vectorBlob = vectorValue
}
// If VectorParamName is provided, use PARAMS mechanism (required for Redis 8.6+)
// If not provided, inline the vector blob (works on Redis 8.4/8.5, fails on 8.6+)
if vectorExpr.VectorParamName != "" {
// Use PARAMS mechanism
args = append(args, "$"+vectorExpr.VectorParamName)
if options.Params == nil {
options.Params = make(map[string]interface{})
}
options.Params[vectorExpr.VectorParamName] = vectorBlob
} else {
// Inline the vector blob (deprecated in Redis 8.6+)
args = append(args, vectorBlob)
}
if vectorExpr.Method != "" {
args = append(args, vectorExpr.Method)
if len(vectorExpr.MethodParams) > 0 {
// MethodParams should be key-value pairs, count them
args = append(args, len(vectorExpr.MethodParams))
args = append(args, vectorExpr.MethodParams...)
}
}
if vectorExpr.Filter != "" {
args = append(args, "FILTER", vectorExpr.Filter)
}
if vectorExpr.YieldScoreAs != "" {
args = append(args, "YIELD_SCORE_AS", vectorExpr.YieldScoreAs)
}
}
// Add combine/fusion options
if options.Combine != nil {
// Build combine parameters
combineParams := []interface{}{}
switch options.Combine.Method {
case FTHybridCombineRRF:
if options.Combine.Window > 0 {
combineParams = append(combineParams, "WINDOW", options.Combine.Window)
}
if options.Combine.Constant > 0 {
combineParams = append(combineParams, "CONSTANT", options.Combine.Constant)
}
case FTHybridCombineLinear:
if options.Combine.Alpha > 0 {
combineParams = append(combineParams, "ALPHA", options.Combine.Alpha)
}
if options.Combine.Beta > 0 {
combineParams = append(combineParams, "BETA", options.Combine.Beta)
}
}
if options.Combine.YieldScoreAs != "" {
combineParams = append(combineParams, "YIELD_SCORE_AS", options.Combine.YieldScoreAs)
}
// Add COMBINE with method and parameter count
args = append(args, "COMBINE", string(options.Combine.Method))
if len(combineParams) > 0 {
args = append(args, len(combineParams))
args = append(args, combineParams...)
}
}
// Add LOAD (projected fields)
if len(options.Load) > 0 {
args = append(args, "LOAD", len(options.Load))
for _, field := range options.Load {
args = append(args, field)
}
}
// Add GROUPBY
if options.GroupBy != nil {
args = append(args, "GROUPBY", options.GroupBy.Count)
for _, field := range options.GroupBy.Fields {
args = append(args, field)
}
if options.GroupBy.ReduceFunc != "" {
args = append(args, "REDUCE", options.GroupBy.ReduceFunc, options.GroupBy.ReduceCount)
args = append(args, options.GroupBy.ReduceParams...)
}
}
// Add APPLY transformations
for _, apply := range options.Apply {
args = append(args, "APPLY", apply.Expression, "AS", apply.AsField)
}
// Add SORTBY
if len(options.SortBy) > 0 {
sortByOptions := []interface{}{}
for _, sortBy := range options.SortBy {
sortByOptions = append(sortByOptions, sortBy.FieldName)
if sortBy.Asc && sortBy.Desc {
cmd := newFTHybridCmd(ctx, options, args...)
cmd.SetErr(fmt.Errorf("FT.HYBRID: ASC and DESC are mutually exclusive"))
return cmd
}
if sortBy.Asc {
sortByOptions = append(sortByOptions, "ASC")
}
if sortBy.Desc {
sortByOptions = append(sortByOptions, "DESC")
}
}
args = append(args, "SORTBY", len(sortByOptions))
args = append(args, sortByOptions...)
}
// Add FILTER (post-filter)
if options.Filter != "" {
args = append(args, "FILTER", options.Filter)
}
// Add LIMIT
if options.LimitOffset >= 0 && options.Limit > 0 || options.LimitOffset > 0 && options.Limit == 0 {
args = append(args, "LIMIT", options.LimitOffset, options.Limit)
}
// Add PARAMS
if len(options.Params) > 0 {
args = append(args, "PARAMS", len(options.Params)*2)
for key, value := range options.Params {
// Parameter keys should already have '$' prefix from the user
// Don't add it again if it's already there
args = append(args, key, value)
}
}
// Add EXPLAINSCORE
if options.ExplainScore {
args = append(args, "EXPLAINSCORE")
}
// Add TIMEOUT
if options.Timeout > 0 {
args = append(args, "TIMEOUT", options.Timeout)
}
// Add WITHCURSOR support
if options.WithCursor {
args = append(args, "WITHCURSOR")
if options.WithCursorOptions != nil {
if options.WithCursorOptions.Count > 0 {
args = append(args, "COUNT", options.WithCursorOptions.Count)
}
if options.WithCursorOptions.MaxIdle > 0 {
args = append(args, "MAXIDLE", options.WithCursorOptions.MaxIdle)
}
}
}
}
cmd := newFTHybridCmd(ctx, options, args...)
_ = c(ctx, cmd)
return cmd
}
package redis
import (
"context"
"crypto/tls"
"errors"
"fmt"
"net"
"net/url"
"strconv"
"strings"
"sync"
"time"
"github.com/redis/go-redis/v9/auth"
"github.com/redis/go-redis/v9/internal"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/internal/rand"
"github.com/redis/go-redis/v9/maintnotifications"
"github.com/redis/go-redis/v9/push"
)
//------------------------------------------------------------------------------
// FailoverOptions are used to configure a failover client and should
// be passed to NewFailoverClient.
type FailoverOptions struct {
// The master name.
MasterName string
// A seed list of host:port addresses of sentinel nodes.
SentinelAddrs []string
// ClientName will execute the `CLIENT SETNAME ClientName` command for each conn.
ClientName string
// If specified with SentinelPassword, enables ACL-based authentication (via
// AUTH <user> <pass>).
SentinelUsername string
// Sentinel password from "requirepass <password>" (if enabled) in Sentinel
// configuration, or, if SentinelUsername is also supplied, used for ACL-based
// authentication.
SentinelPassword string
// Allows routing read-only commands to the closest master or replica node.
// This option only works with NewFailoverClusterClient.
RouteByLatency bool
// Allows routing read-only commands to the random master or replica node.
// This option only works with NewFailoverClusterClient.
RouteRandomly bool
// Route all commands to replica read-only nodes.
ReplicaOnly bool
// Use replicas disconnected with master when cannot get connected replicas
// Now, this option only works in RandomReplicaAddr function.
UseDisconnectedReplicas bool
// Following options are copied from Options struct.
Dialer func(ctx context.Context, network, addr string) (net.Conn, error)
OnConnect func(ctx context.Context, cn *Conn) error
Protocol int
Username string
Password string
// Push notifications are always enabled for RESP3 connections
// CredentialsProvider allows the username and password to be updated
// before reconnecting. It should return the current username and password.
CredentialsProvider func() (username string, password string)
// CredentialsProviderContext is an enhanced parameter of CredentialsProvider,
// done to maintain API compatibility. In the future,
// there might be a merge between CredentialsProviderContext and CredentialsProvider.
// There will be a conflict between them; if CredentialsProviderContext exists, we will ignore CredentialsProvider.
CredentialsProviderContext func(ctx context.Context) (username string, password string, err error)
// StreamingCredentialsProvider is used to retrieve the credentials
// for the connection from an external source. Those credentials may change
// during the connection lifetime. This is useful for managed identity
// scenarios where the credentials are retrieved from an external source.
//
// Currently, this is a placeholder for the future implementation.
StreamingCredentialsProvider auth.StreamingCredentialsProvider
DB int
MaxRetries int
MinRetryBackoff time.Duration
MaxRetryBackoff time.Duration
DialTimeout time.Duration
// DialerRetries is the maximum number of retry attempts when dialing fails.
//
// default: 5
DialerRetries int
// DialerRetryTimeout is the backoff duration between retry attempts.
//
// default: 100 milliseconds
DialerRetryTimeout time.Duration
ReadTimeout time.Duration
WriteTimeout time.Duration
ContextTimeoutEnabled bool
// ReadBufferSize is the size of the bufio.Reader buffer for each connection.
// Larger buffers can improve performance for commands that return large responses.
// Smaller buffers can improve memory usage for larger pools.
//
// default: 32KiB (32768 bytes)
ReadBufferSize int
// WriteBufferSize is the size of the bufio.Writer buffer for each connection.
// Larger buffers can improve performance for large pipelines and commands with many arguments.
// Smaller buffers can improve memory usage for larger pools.
//
// default: 32KiB (32768 bytes)
WriteBufferSize int
PoolFIFO bool
PoolSize int
// MaxConcurrentDials is the maximum number of concurrent connection creation goroutines.
// If <= 0, defaults to PoolSize. If > PoolSize, it will be capped at PoolSize.
MaxConcurrentDials int
PoolTimeout time.Duration
MinIdleConns int
MaxIdleConns int
MaxActiveConns int
ConnMaxIdleTime time.Duration
ConnMaxLifetime time.Duration
ConnMaxLifetimeJitter time.Duration
TLSConfig *tls.Config
// DisableIndentity - Disable set-lib on connect.
//
// default: false
//
// Deprecated: Use DisableIdentity instead.
DisableIndentity bool
// DisableIdentity is used to disable CLIENT SETINFO command on connect.
//
// default: false
DisableIdentity bool
IdentitySuffix string
// FailingTimeoutSeconds is the timeout in seconds for marking a cluster node as failing.
// When a node is marked as failing, it will be avoided for this duration.
// Only applies to failover cluster clients. Default is 15 seconds.
FailingTimeoutSeconds int
UnstableResp3 bool
// PushNotificationProcessor is the processor for handling push notifications.
// If nil, a default processor will be created for RESP3 connections.
PushNotificationProcessor push.NotificationProcessor
// MaintNotificationsConfig is not supported for FailoverClients at the moment
// MaintNotificationsConfig provides custom configuration for maintnotifications upgrades.
// When MaintNotificationsConfig.Mode is not "disabled", the client will handle
// upgrade notifications gracefully and manage connection/pool state transitions
// seamlessly. Requires Protocol: 3 (RESP3) for push notifications.
// If nil, maintnotifications upgrades are disabled.
// (however if Mode is nil, it defaults to "auto" - enable if server supports it)
//MaintNotificationsConfig *maintnotifications.Config
}
func (opt *FailoverOptions) clientOptions() *Options {
return &Options{
Addr: "FailoverClient",
ClientName: opt.ClientName,
Dialer: opt.Dialer,
OnConnect: opt.OnConnect,
DB: opt.DB,
Protocol: opt.Protocol,
Username: opt.Username,
Password: opt.Password,
CredentialsProvider: opt.CredentialsProvider,
CredentialsProviderContext: opt.CredentialsProviderContext,
StreamingCredentialsProvider: opt.StreamingCredentialsProvider,
MaxRetries: opt.MaxRetries,
MinRetryBackoff: opt.MinRetryBackoff,
MaxRetryBackoff: opt.MaxRetryBackoff,
ReadBufferSize: opt.ReadBufferSize,
WriteBufferSize: opt.WriteBufferSize,
DialTimeout: opt.DialTimeout,
DialerRetries: opt.DialerRetries,
DialerRetryTimeout: opt.DialerRetryTimeout,
ReadTimeout: opt.ReadTimeout,
WriteTimeout: opt.WriteTimeout,
ContextTimeoutEnabled: opt.ContextTimeoutEnabled,
PoolFIFO: opt.PoolFIFO,
PoolSize: opt.PoolSize,
MaxConcurrentDials: opt.MaxConcurrentDials,
PoolTimeout: opt.PoolTimeout,
MinIdleConns: opt.MinIdleConns,
MaxIdleConns: opt.MaxIdleConns,
MaxActiveConns: opt.MaxActiveConns,
ConnMaxIdleTime: opt.ConnMaxIdleTime,
ConnMaxLifetime: opt.ConnMaxLifetime,
ConnMaxLifetimeJitter: opt.ConnMaxLifetimeJitter,
TLSConfig: opt.TLSConfig,
DisableIdentity: opt.DisableIdentity,
DisableIndentity: opt.DisableIndentity,
IdentitySuffix: opt.IdentitySuffix,
UnstableResp3: opt.UnstableResp3,
PushNotificationProcessor: opt.PushNotificationProcessor,
MaintNotificationsConfig: &maintnotifications.Config{
Mode: maintnotifications.ModeDisabled,
},
}
}
func (opt *FailoverOptions) sentinelOptions(addr string) *Options {
return &Options{
Addr: addr,
ClientName: opt.ClientName,
Dialer: opt.Dialer,
OnConnect: opt.OnConnect,
DB: 0,
Username: opt.SentinelUsername,
Password: opt.SentinelPassword,
MaxRetries: opt.MaxRetries,
MinRetryBackoff: opt.MinRetryBackoff,
MaxRetryBackoff: opt.MaxRetryBackoff,
// The sentinel client uses a 4KiB read/write buffer size.
ReadBufferSize: 4096,
WriteBufferSize: 4096,
DialTimeout: opt.DialTimeout,
DialerRetries: opt.DialerRetries,
DialerRetryTimeout: opt.DialerRetryTimeout,
ReadTimeout: opt.ReadTimeout,
WriteTimeout: opt.WriteTimeout,
ContextTimeoutEnabled: opt.ContextTimeoutEnabled,
PoolFIFO: opt.PoolFIFO,
PoolSize: opt.PoolSize,
MaxConcurrentDials: opt.MaxConcurrentDials,
PoolTimeout: opt.PoolTimeout,
MinIdleConns: opt.MinIdleConns,
MaxIdleConns: opt.MaxIdleConns,
MaxActiveConns: opt.MaxActiveConns,
ConnMaxIdleTime: opt.ConnMaxIdleTime,
ConnMaxLifetime: opt.ConnMaxLifetime,
ConnMaxLifetimeJitter: opt.ConnMaxLifetimeJitter,
TLSConfig: opt.TLSConfig,
DisableIdentity: opt.DisableIdentity,
DisableIndentity: opt.DisableIndentity,
IdentitySuffix: opt.IdentitySuffix,
UnstableResp3: opt.UnstableResp3,
PushNotificationProcessor: opt.PushNotificationProcessor,
MaintNotificationsConfig: &maintnotifications.Config{
Mode: maintnotifications.ModeDisabled,
},
}
}
func (opt *FailoverOptions) clusterOptions() *ClusterOptions {
return &ClusterOptions{
ClientName: opt.ClientName,
Dialer: opt.Dialer,
OnConnect: opt.OnConnect,
Protocol: opt.Protocol,
Username: opt.Username,
Password: opt.Password,
CredentialsProvider: opt.CredentialsProvider,
CredentialsProviderContext: opt.CredentialsProviderContext,
StreamingCredentialsProvider: opt.StreamingCredentialsProvider,
MaxRedirects: opt.MaxRetries,
ReadOnly: opt.ReplicaOnly,
RouteByLatency: opt.RouteByLatency,
RouteRandomly: opt.RouteRandomly,
MinRetryBackoff: opt.MinRetryBackoff,
MaxRetryBackoff: opt.MaxRetryBackoff,
ReadBufferSize: opt.ReadBufferSize,
WriteBufferSize: opt.WriteBufferSize,
DialTimeout: opt.DialTimeout,
DialerRetries: opt.DialerRetries,
DialerRetryTimeout: opt.DialerRetryTimeout,
ReadTimeout: opt.ReadTimeout,
WriteTimeout: opt.WriteTimeout,
ContextTimeoutEnabled: opt.ContextTimeoutEnabled,
PoolFIFO: opt.PoolFIFO,
PoolSize: opt.PoolSize,
MaxConcurrentDials: opt.MaxConcurrentDials,
PoolTimeout: opt.PoolTimeout,
MinIdleConns: opt.MinIdleConns,
MaxIdleConns: opt.MaxIdleConns,
MaxActiveConns: opt.MaxActiveConns,
ConnMaxIdleTime: opt.ConnMaxIdleTime,
ConnMaxLifetime: opt.ConnMaxLifetime,
TLSConfig: opt.TLSConfig,
DisableIdentity: opt.DisableIdentity,
DisableIndentity: opt.DisableIndentity,
IdentitySuffix: opt.IdentitySuffix,
FailingTimeoutSeconds: opt.FailingTimeoutSeconds,
PushNotificationProcessor: opt.PushNotificationProcessor,
MaintNotificationsConfig: &maintnotifications.Config{
Mode: maintnotifications.ModeDisabled,
},
}
}
// ParseFailoverURL parses a URL into FailoverOptions that can be used to connect to Redis.
// The URL must be in the form:
//
// redis://<user>:<password>@<host>:<port>/<db_number>
// or
// rediss://<user>:<password>@<host>:<port>/<db_number>
//
// To add additional addresses, specify the query parameter, "addr" one or more times. e.g:
//
// redis://<user>:<password>@<host>:<port>/<db_number>?addr=<host2>:<port2>&addr=<host3>:<port3>
// or
// rediss://<user>:<password>@<host>:<port>/<db_number>?addr=<host2>:<port2>&addr=<host3>:<port3>
//
// Most Option fields can be set using query parameters, with the following restrictions:
// - field names are mapped using snake-case conversion: to set MaxRetries, use max_retries
// - only scalar type fields are supported (bool, int, time.Duration)
// - for time.Duration fields, values must be a valid input for time.ParseDuration();
// additionally a plain integer as value (i.e. without unit) is interpreted as seconds
// - to disable a duration field, use value less than or equal to 0; to use the default
// value, leave the value blank or remove the parameter
// - only the last value is interpreted if a parameter is given multiple times
// - fields "network", "addr", "sentinel_username" and "sentinel_password" can only be set using other
// URL attributes (scheme, host, userinfo, resp.), query parameters using these
// names will be treated as unknown parameters
// - unknown parameter names will result in an error
// - use "skip_verify=true" to ignore TLS certificate validation
//
// Example:
//
// redis://user:password@localhost:6789?master_name=mymaster&dial_timeout=3&read_timeout=6s&addr=localhost:6790&addr=localhost:6791
// is equivalent to:
// &FailoverOptions{
// MasterName: "mymaster",
// Addr: ["localhost:6789", "localhost:6790", "localhost:6791"]
// DialTimeout: 3 * time.Second, // no time unit = seconds
// ReadTimeout: 6 * time.Second,
// }
func ParseFailoverURL(redisURL string) (*FailoverOptions, error) {
u, err := url.Parse(redisURL)
if err != nil {
return nil, err
}
return setupFailoverConn(u)
}
func setupFailoverConn(u *url.URL) (*FailoverOptions, error) {
o := &FailoverOptions{}
o.SentinelUsername, o.SentinelPassword = getUserPassword(u)
h, p := getHostPortWithDefaults(u)
o.SentinelAddrs = append(o.SentinelAddrs, net.JoinHostPort(h, p))
switch u.Scheme {
case "rediss":
o.TLSConfig = &tls.Config{ServerName: h, MinVersion: tls.VersionTLS12}
case "redis":
o.TLSConfig = nil
default:
return nil, fmt.Errorf("redis: invalid URL scheme: %s", u.Scheme)
}
f := strings.FieldsFunc(u.Path, func(r rune) bool {
return r == '/'
})
switch len(f) {
case 0:
o.DB = 0
case 1:
var err error
if o.DB, err = strconv.Atoi(f[0]); err != nil {
return nil, fmt.Errorf("redis: invalid database number: %q", f[0])
}
default:
return nil, fmt.Errorf("redis: invalid URL path: %s", u.Path)
}
return setupFailoverConnParams(u, o)
}
func setupFailoverConnParams(u *url.URL, o *FailoverOptions) (*FailoverOptions, error) {
q := queryOptions{q: u.Query()}
o.MasterName = q.string("master_name")
o.ClientName = q.string("client_name")
o.RouteByLatency = q.bool("route_by_latency")
o.RouteRandomly = q.bool("route_randomly")
o.ReplicaOnly = q.bool("replica_only")
o.UseDisconnectedReplicas = q.bool("use_disconnected_replicas")
o.Protocol = q.int("protocol")
o.Username = q.string("username")
o.Password = q.string("password")
o.MaxRetries = q.int("max_retries")
o.MinRetryBackoff = q.duration("min_retry_backoff")
o.MaxRetryBackoff = q.duration("max_retry_backoff")
o.DialTimeout = q.duration("dial_timeout")
o.DialerRetries = q.int("dialer_retries")
o.DialerRetryTimeout = q.duration("dialer_retry_timeout")
o.ReadTimeout = q.duration("read_timeout")
o.WriteTimeout = q.duration("write_timeout")
o.ContextTimeoutEnabled = q.bool("context_timeout_enabled")
o.PoolFIFO = q.bool("pool_fifo")
o.PoolSize = q.int("pool_size")
o.MaxConcurrentDials = q.int("max_concurrent_dials")
o.MinIdleConns = q.int("min_idle_conns")
o.MaxIdleConns = q.int("max_idle_conns")
o.MaxActiveConns = q.int("max_active_conns")
o.ConnMaxLifetime = q.duration("conn_max_lifetime")
if q.has("conn_max_lifetime_jitter") {
o.ConnMaxLifetimeJitter = min(q.duration("conn_max_lifetime_jitter"), o.ConnMaxLifetime)
}
o.ConnMaxIdleTime = q.duration("conn_max_idle_time")
o.PoolTimeout = q.duration("pool_timeout")
o.DisableIdentity = q.bool("disableIdentity")
o.IdentitySuffix = q.string("identitySuffix")
o.UnstableResp3 = q.bool("unstable_resp3")
if q.err != nil {
return nil, q.err
}
if tmp := q.string("db"); tmp != "" {
db, err := strconv.Atoi(tmp)
if err != nil {
return nil, fmt.Errorf("redis: invalid database number: %w", err)
}
o.DB = db
}
addrs := q.strings("addr")
for _, addr := range addrs {
h, p, err := net.SplitHostPort(addr)
if err != nil || h == "" || p == "" {
return nil, fmt.Errorf("redis: unable to parse addr param: %s", addr)
}
o.SentinelAddrs = append(o.SentinelAddrs, net.JoinHostPort(h, p))
}
if o.TLSConfig != nil && q.has("skip_verify") {
o.TLSConfig.InsecureSkipVerify = q.bool("skip_verify")
}
// any parameters left?
if r := q.remaining(); len(r) > 0 {
return nil, fmt.Errorf("redis: unexpected option: %s", strings.Join(r, ", "))
}
return o, nil
}
// NewFailoverClient returns a Redis client that uses Redis Sentinel
// for automatic failover. It's safe for concurrent use by multiple
// goroutines.
func NewFailoverClient(failoverOpt *FailoverOptions) *Client {
if failoverOpt == nil {
panic("redis: NewFailoverClient nil options")
}
if failoverOpt.RouteByLatency {
panic("to route commands by latency, use NewFailoverClusterClient")
}
if failoverOpt.RouteRandomly {
panic("to route commands randomly, use NewFailoverClusterClient")
}
sentinelAddrs := make([]string, len(failoverOpt.SentinelAddrs))
copy(sentinelAddrs, failoverOpt.SentinelAddrs)
rand.Shuffle(len(sentinelAddrs), func(i, j int) {
sentinelAddrs[i], sentinelAddrs[j] = sentinelAddrs[j], sentinelAddrs[i]
})
failover := &sentinelFailover{
opt: failoverOpt,
sentinelAddrs: sentinelAddrs,
}
opt := failoverOpt.clientOptions()
opt.Dialer = masterReplicaDialer(failover)
opt.init()
rdb := &Client{
baseClient: &baseClient{
opt: opt,
},
}
rdb.init()
// Initialize push notification processor using shared helper
// Use void processor by default for RESP2 connections
rdb.pushProcessor = initializePushProcessor(opt)
// Generate unique pool names for metrics
uniqueID := generateUniqueID()
mainPoolName := opt.Addr + "_" + uniqueID
pubsubPoolName := opt.Addr + "_" + uniqueID + "_pubsub"
var err error
rdb.connPool, err = newConnPool(opt, rdb.dialHook, mainPoolName)
if err != nil {
panic(fmt.Errorf("redis: failed to create connection pool: %w", err))
}
rdb.pubSubPool, err = newPubSubPool(opt, rdb.dialHook, pubsubPoolName)
if err != nil {
panic(fmt.Errorf("redis: failed to create pubsub pool: %w", err))
}
rdb.onClose = rdb.wrappedOnClose(failover.Close)
failover.mu.Lock()
failover.onFailover = func(ctx context.Context, addr string) {
if connPool, ok := rdb.connPool.(*pool.ConnPool); ok {
_ = connPool.Filter(func(cn *pool.Conn) bool {
return cn.RemoteAddr().String() != addr
})
}
}
failover.mu.Unlock()
return rdb
}
func masterReplicaDialer(
failover *sentinelFailover,
) func(ctx context.Context, network, addr string) (net.Conn, error) {
return func(ctx context.Context, network, _ string) (net.Conn, error) {
var addr string
var err error
if failover.opt.ReplicaOnly {
addr, err = failover.RandomReplicaAddr(ctx)
} else {
addr, err = failover.MasterAddr(ctx)
if err == nil {
failover.trySwitchMaster(ctx, addr)
}
}
if err != nil {
return nil, err
}
if failover.opt.Dialer != nil {
return failover.opt.Dialer(ctx, network, addr)
}
netDialer := &net.Dialer{
Timeout: failover.opt.DialTimeout,
KeepAlive: 5 * time.Minute,
}
if failover.opt.TLSConfig == nil {
return netDialer.DialContext(ctx, network, addr)
}
return tls.DialWithDialer(netDialer, network, addr, failover.opt.TLSConfig)
}
}
//------------------------------------------------------------------------------
// SentinelClient is a client for a Redis Sentinel.
type SentinelClient struct {
*baseClient
}
func NewSentinelClient(opt *Options) *SentinelClient {
if opt == nil {
panic("redis: NewSentinelClient nil options")
}
opt.init()
c := &SentinelClient{
baseClient: &baseClient{
opt: opt,
},
}
// Initialize push notification processor using shared helper
// Use void processor for Sentinel clients
c.pushProcessor = NewVoidPushNotificationProcessor()
c.initHooks(hooks{
dial: c.baseClient.dial,
process: c.baseClient.process,
})
// Generate unique pool names for metrics
uniqueID := generateUniqueID()
mainPoolName := opt.Addr + "_" + uniqueID
pubsubPoolName := opt.Addr + "_" + uniqueID + "_pubsub"
var err error
c.connPool, err = newConnPool(opt, c.dialHook, mainPoolName)
if err != nil {
panic(fmt.Errorf("redis: failed to create connection pool: %w", err))
}
c.pubSubPool, err = newPubSubPool(opt, c.dialHook, pubsubPoolName)
if err != nil {
panic(fmt.Errorf("redis: failed to create pubsub pool: %w", err))
}
return c
}
// GetPushNotificationHandler returns the handler for a specific push notification name.
// Returns nil if no handler is registered for the given name.
func (c *SentinelClient) GetPushNotificationHandler(pushNotificationName string) push.NotificationHandler {
return c.pushProcessor.GetHandler(pushNotificationName)
}
// RegisterPushNotificationHandler registers a handler for a specific push notification name.
// Returns an error if a handler is already registered for this push notification name.
// If protected is true, the handler cannot be unregistered.
func (c *SentinelClient) RegisterPushNotificationHandler(pushNotificationName string, handler push.NotificationHandler, protected bool) error {
return c.pushProcessor.RegisterHandler(pushNotificationName, handler, protected)
}
func (c *SentinelClient) Process(ctx context.Context, cmd Cmder) error {
err := c.processHook(ctx, cmd)
cmd.SetErr(err)
return err
}
func (c *SentinelClient) pubSub() *PubSub {
pubsub := &PubSub{
opt: c.opt,
newConn: func(ctx context.Context, addr string, channels []string) (*pool.Conn, error) {
cn, err := c.pubSubPool.NewConn(ctx, c.opt.Network, addr, channels)
if err != nil {
return nil, err
}
// will return nil if already initialized
err = c.initConn(ctx, cn)
if err != nil {
_ = cn.Close()
return nil, err
}
// Track connection in PubSubPool
c.pubSubPool.TrackConn(cn)
return cn, nil
},
closeConn: func(cn *pool.Conn) error {
// Untrack connection from PubSubPool
c.pubSubPool.UntrackConn(cn)
_ = cn.Close()
return nil
},
pushProcessor: c.pushProcessor,
}
pubsub.init()
return pubsub
}
// Ping is used to test if a connection is still alive, or to
// measure latency.
func (c *SentinelClient) Ping(ctx context.Context) *StringCmd {
cmd := NewStringCmd(ctx, "ping")
_ = c.Process(ctx, cmd)
return cmd
}
// Subscribe subscribes the client to the specified channels.
// Channels can be omitted to create empty subscription.
func (c *SentinelClient) Subscribe(ctx context.Context, channels ...string) *PubSub {
pubsub := c.pubSub()
if len(channels) > 0 {
_ = pubsub.Subscribe(ctx, channels...)
}
return pubsub
}
// PSubscribe subscribes the client to the given patterns.
// Patterns can be omitted to create empty subscription.
func (c *SentinelClient) PSubscribe(ctx context.Context, channels ...string) *PubSub {
pubsub := c.pubSub()
if len(channels) > 0 {
_ = pubsub.PSubscribe(ctx, channels...)
}
return pubsub
}
func (c *SentinelClient) GetMasterAddrByName(ctx context.Context, name string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "sentinel", "get-master-addr-by-name", name)
_ = c.Process(ctx, cmd)
return cmd
}
func (c *SentinelClient) Sentinels(ctx context.Context, name string) *MapStringStringSliceCmd {
cmd := NewMapStringStringSliceCmd(ctx, "sentinel", "sentinels", name)
_ = c.Process(ctx, cmd)
return cmd
}
// Failover forces a failover as if the master was not reachable, and without
// asking for agreement to other Sentinels.
func (c *SentinelClient) Failover(ctx context.Context, name string) *StatusCmd {
cmd := NewStatusCmd(ctx, "sentinel", "failover", name)
_ = c.Process(ctx, cmd)
return cmd
}
// Reset resets all the masters with matching name. The pattern argument is a
// glob-style pattern. The reset process clears any previous state in a master
// (including a failover in progress), and removes every replica and sentinel
// already discovered and associated with the master.
func (c *SentinelClient) Reset(ctx context.Context, pattern string) *IntCmd {
cmd := NewIntCmd(ctx, "sentinel", "reset", pattern)
_ = c.Process(ctx, cmd)
return cmd
}
// FlushConfig forces Sentinel to rewrite its configuration on disk, including
// the current Sentinel state.
func (c *SentinelClient) FlushConfig(ctx context.Context) *StatusCmd {
cmd := NewStatusCmd(ctx, "sentinel", "flushconfig")
_ = c.Process(ctx, cmd)
return cmd
}
// Master shows the state and info of the specified master.
func (c *SentinelClient) Master(ctx context.Context, name string) *MapStringStringCmd {
cmd := NewMapStringStringCmd(ctx, "sentinel", "master", name)
_ = c.Process(ctx, cmd)
return cmd
}
// Masters shows a list of monitored masters and their state.
func (c *SentinelClient) Masters(ctx context.Context) *SliceCmd {
cmd := NewSliceCmd(ctx, "sentinel", "masters")
_ = c.Process(ctx, cmd)
return cmd
}
// Replicas shows a list of replicas for the specified master and their state.
func (c *SentinelClient) Replicas(ctx context.Context, name string) *MapStringStringSliceCmd {
cmd := NewMapStringStringSliceCmd(ctx, "sentinel", "replicas", name)
_ = c.Process(ctx, cmd)
return cmd
}
// CkQuorum checks if the current Sentinel configuration is able to reach the
// quorum needed to failover a master, and the majority needed to authorize the
// failover. This command should be used in monitoring systems to check if a
// Sentinel deployment is ok.
func (c *SentinelClient) CkQuorum(ctx context.Context, name string) *StringCmd {
cmd := NewStringCmd(ctx, "sentinel", "ckquorum", name)
_ = c.Process(ctx, cmd)
return cmd
}
// Monitor tells the Sentinel to start monitoring a new master with the specified
// name, ip, port, and quorum.
func (c *SentinelClient) Monitor(ctx context.Context, name, ip, port, quorum string) *StringCmd {
cmd := NewStringCmd(ctx, "sentinel", "monitor", name, ip, port, quorum)
_ = c.Process(ctx, cmd)
return cmd
}
// Set is used in order to change configuration parameters of a specific master.
func (c *SentinelClient) Set(ctx context.Context, name, option, value string) *StringCmd {
cmd := NewStringCmd(ctx, "sentinel", "set", name, option, value)
_ = c.Process(ctx, cmd)
return cmd
}
// Remove is used in order to remove the specified master: the master will no
// longer be monitored, and will totally be removed from the internal state of
// the Sentinel.
func (c *SentinelClient) Remove(ctx context.Context, name string) *StringCmd {
cmd := NewStringCmd(ctx, "sentinel", "remove", name)
_ = c.Process(ctx, cmd)
return cmd
}
//------------------------------------------------------------------------------
type sentinelFailover struct {
opt *FailoverOptions
sentinelAddrs []string
onFailover func(ctx context.Context, addr string)
onUpdate func(ctx context.Context)
mu sync.RWMutex
masterAddr string
sentinel *SentinelClient
pubsub *PubSub
}
func (c *sentinelFailover) Close() error {
c.mu.Lock()
defer c.mu.Unlock()
if c.sentinel != nil {
return c.closeSentinel()
}
return nil
}
func (c *sentinelFailover) closeSentinel() error {
firstErr := c.pubsub.Close()
c.pubsub = nil
err := c.sentinel.Close()
if err != nil && firstErr == nil {
firstErr = err
}
c.sentinel = nil
return firstErr
}
func (c *sentinelFailover) RandomReplicaAddr(ctx context.Context) (string, error) {
if c.opt == nil {
return "", errors.New("opt is nil")
}
addresses, err := c.replicaAddrs(ctx, false)
if err != nil {
return "", err
}
if len(addresses) == 0 && c.opt.UseDisconnectedReplicas {
addresses, err = c.replicaAddrs(ctx, true)
if err != nil {
return "", err
}
}
if len(addresses) == 0 {
return c.MasterAddr(ctx)
}
return addresses[rand.Intn(len(addresses))], nil
}
func (c *sentinelFailover) MasterAddr(ctx context.Context) (string, error) {
c.mu.RLock()
sentinel := c.sentinel
c.mu.RUnlock()
if sentinel != nil {
addr, err := c.getMasterAddr(ctx, sentinel)
if err != nil {
if isContextError(ctx.Err()) {
return "", err
}
// Continue on other errors
internal.Logger.Printf(ctx, "sentinel: GetMasterAddrByName name=%q failed: %s",
c.opt.MasterName, err)
} else {
return addr, nil
}
}
c.mu.Lock()
defer c.mu.Unlock()
if c.sentinel != nil {
addr, err := c.getMasterAddr(ctx, c.sentinel)
if err != nil {
_ = c.closeSentinel()
if isContextError(ctx.Err()) {
return "", err
}
// Continue on other errors
internal.Logger.Printf(ctx, "sentinel: GetMasterAddrByName name=%q failed: %s",
c.opt.MasterName, err)
} else {
return addr, nil
}
}
// short circuit if no sentinels configured
if len(c.sentinelAddrs) == 0 {
return "", errors.New("redis: no sentinels configured")
}
var (
masterAddr string
wg sync.WaitGroup
once sync.Once
errCh = make(chan error, len(c.sentinelAddrs))
)
ctx, cancel := context.WithCancel(ctx)
defer cancel()
for i, sentinelAddr := range c.sentinelAddrs {
wg.Add(1)
go func(i int, addr string) {
defer wg.Done()
sentinelCli := NewSentinelClient(c.opt.sentinelOptions(addr))
addrVal, err := sentinelCli.GetMasterAddrByName(ctx, c.opt.MasterName).Result()
if err != nil {
internal.Logger.Printf(ctx, "sentinel: GetMasterAddrByName addr=%s, master=%q failed: %s",
addr, c.opt.MasterName, err)
_ = sentinelCli.Close()
errCh <- err
return
}
once.Do(func() {
masterAddr = net.JoinHostPort(addrVal[0], addrVal[1])
// Push working sentinel to the top
c.sentinelAddrs[0], c.sentinelAddrs[i] = c.sentinelAddrs[i], c.sentinelAddrs[0]
c.setSentinel(ctx, sentinelCli)
internal.Logger.Printf(ctx, "sentinel: selected addr=%s masterAddr=%s", addr, masterAddr)
cancel()
})
}(i, sentinelAddr)
}
wg.Wait()
close(errCh)
if masterAddr != "" {
return masterAddr, nil
}
errs := make([]error, 0, len(errCh))
for err := range errCh {
errs = append(errs, err)
}
return "", fmt.Errorf("redis: all sentinels specified in configuration are unreachable: %w", errors.Join(errs...))
}
func (c *sentinelFailover) replicaAddrs(ctx context.Context, useDisconnected bool) ([]string, error) {
c.mu.RLock()
sentinel := c.sentinel
c.mu.RUnlock()
if sentinel != nil {
addrs, err := c.getReplicaAddrs(ctx, sentinel)
if err != nil {
if isContextError(ctx.Err()) {
return nil, err
}
// Continue on other errors
internal.Logger.Printf(ctx, "sentinel: Replicas name=%q failed: %s",
c.opt.MasterName, err)
} else if len(addrs) > 0 {
return addrs, nil
}
}
c.mu.Lock()
defer c.mu.Unlock()
if c.sentinel != nil {
addrs, err := c.getReplicaAddrs(ctx, c.sentinel)
if err != nil {
_ = c.closeSentinel()
if isContextError(ctx.Err()) {
return nil, err
}
// Continue on other errors
internal.Logger.Printf(ctx, "sentinel: Replicas name=%q failed: %s",
c.opt.MasterName, err)
} else if len(addrs) > 0 {
return addrs, nil
} else {
// No error and no replicas.
_ = c.closeSentinel()
}
}
var sentinelReachable bool
for i, sentinelAddr := range c.sentinelAddrs {
sentinel := NewSentinelClient(c.opt.sentinelOptions(sentinelAddr))
replicas, err := sentinel.Replicas(ctx, c.opt.MasterName).Result()
if err != nil {
_ = sentinel.Close()
if isContextError(ctx.Err()) {
return nil, err
}
internal.Logger.Printf(ctx, "sentinel: Replicas master=%q failed: %s",
c.opt.MasterName, err)
continue
}
sentinelReachable = true
addrs := parseReplicaAddrs(replicas, useDisconnected)
if len(addrs) == 0 {
continue
}
// Push working sentinel to the top.
c.sentinelAddrs[0], c.sentinelAddrs[i] = c.sentinelAddrs[i], c.sentinelAddrs[0]
c.setSentinel(ctx, sentinel)
return addrs, nil
}
if sentinelReachable {
return []string{}, nil
}
return []string{}, errors.New("redis: all sentinels specified in configuration are unreachable")
}
func (c *sentinelFailover) getMasterAddr(ctx context.Context, sentinel *SentinelClient) (string, error) {
addr, err := sentinel.GetMasterAddrByName(ctx, c.opt.MasterName).Result()
if err != nil {
return "", err
}
return net.JoinHostPort(addr[0], addr[1]), nil
}
func (c *sentinelFailover) getReplicaAddrs(ctx context.Context, sentinel *SentinelClient) ([]string, error) {
addrs, err := sentinel.Replicas(ctx, c.opt.MasterName).Result()
if err != nil {
internal.Logger.Printf(ctx, "sentinel: Replicas name=%q failed: %s",
c.opt.MasterName, err)
return nil, err
}
return parseReplicaAddrs(addrs, false), nil
}
func parseReplicaAddrs(addrs []map[string]string, keepDisconnected bool) []string {
nodes := make([]string, 0, len(addrs))
for _, node := range addrs {
isDown := false
if flags, ok := node["flags"]; ok {
for _, flag := range strings.Split(flags, ",") {
switch flag {
case "s_down", "o_down":
isDown = true
case "disconnected":
if !keepDisconnected {
isDown = true
}
}
}
}
if !isDown && node["ip"] != "" && node["port"] != "" {
nodes = append(nodes, net.JoinHostPort(node["ip"], node["port"]))
}
}
return nodes
}
func (c *sentinelFailover) trySwitchMaster(ctx context.Context, addr string) {
c.mu.RLock()
currentAddr := c.masterAddr //nolint:ifshort
c.mu.RUnlock()
if addr == currentAddr {
return
}
c.mu.Lock()
defer c.mu.Unlock()
if addr == c.masterAddr {
return
}
c.masterAddr = addr
internal.Logger.Printf(ctx, "sentinel: new master=%q addr=%q",
c.opt.MasterName, addr)
if c.onFailover != nil {
c.onFailover(ctx, addr)
}
}
func (c *sentinelFailover) setSentinel(ctx context.Context, sentinel *SentinelClient) {
if c.sentinel != nil {
panic("not reached")
}
c.sentinel = sentinel
c.discoverSentinels(ctx)
c.pubsub = sentinel.Subscribe(ctx, "+switch-master", "+replica-reconf-done")
go c.listen(c.pubsub)
}
func (c *sentinelFailover) discoverSentinels(ctx context.Context) {
sentinels, err := c.sentinel.Sentinels(ctx, c.opt.MasterName).Result()
if err != nil {
internal.Logger.Printf(ctx, "sentinel: Sentinels master=%q failed: %s", c.opt.MasterName, err)
return
}
for _, sentinel := range sentinels {
ip, ok := sentinel["ip"]
if !ok {
continue
}
port, ok := sentinel["port"]
if !ok {
continue
}
if ip != "" && port != "" {
sentinelAddr := net.JoinHostPort(ip, port)
if !contains(c.sentinelAddrs, sentinelAddr) {
internal.Logger.Printf(ctx, "sentinel: discovered new sentinel=%q for master=%q",
sentinelAddr, c.opt.MasterName)
c.sentinelAddrs = append(c.sentinelAddrs, sentinelAddr)
}
}
}
}
func (c *sentinelFailover) listen(pubsub *PubSub) {
ctx := context.TODO()
if c.onUpdate != nil {
c.onUpdate(ctx)
}
ch := pubsub.Channel()
for msg := range ch {
if msg.Channel == "+switch-master" {
parts := strings.Split(msg.Payload, " ")
if parts[0] != c.opt.MasterName {
internal.Logger.Printf(pubsub.getContext(), "sentinel: ignore addr for master=%q", parts[0])
continue
}
addr := net.JoinHostPort(parts[3], parts[4])
c.trySwitchMaster(pubsub.getContext(), addr)
}
if c.onUpdate != nil {
c.onUpdate(ctx)
}
}
}
func contains(slice []string, str string) bool {
for _, s := range slice {
if s == str {
return true
}
}
return false
}
//------------------------------------------------------------------------------
// NewFailoverClusterClient returns a client that supports routing read-only commands
// to a replica node.
func NewFailoverClusterClient(failoverOpt *FailoverOptions) *ClusterClient {
if failoverOpt == nil {
panic("redis: NewFailoverClusterClient nil options")
}
sentinelAddrs := make([]string, len(failoverOpt.SentinelAddrs))
copy(sentinelAddrs, failoverOpt.SentinelAddrs)
failover := &sentinelFailover{
opt: failoverOpt,
sentinelAddrs: sentinelAddrs,
}
opt := failoverOpt.clusterOptions()
if failoverOpt.DB != 0 {
onConnect := opt.OnConnect
opt.OnConnect = func(ctx context.Context, cn *Conn) error {
if err := cn.Select(ctx, failoverOpt.DB).Err(); err != nil {
return err
}
if onConnect != nil {
return onConnect(ctx, cn)
}
return nil
}
}
opt.ClusterSlots = func(ctx context.Context) ([]ClusterSlot, error) {
masterAddr, err := failover.MasterAddr(ctx)
if err != nil {
return nil, err
}
nodes := []ClusterNode{{
Addr: masterAddr,
}}
replicaAddrs, err := failover.replicaAddrs(ctx, false)
if err != nil {
return nil, err
}
for _, replicaAddr := range replicaAddrs {
nodes = append(nodes, ClusterNode{
Addr: replicaAddr,
})
}
slots := []ClusterSlot{
{
Start: 0,
End: 16383,
Nodes: nodes,
},
}
return slots, nil
}
c := NewClusterClient(opt)
failover.mu.Lock()
failover.onUpdate = func(ctx context.Context) {
c.ReloadState(ctx)
}
failover.mu.Unlock()
return c
}
package redis
import (
"context"
"github.com/redis/go-redis/v9/internal/hashtag"
)
// SetCmdable is an interface for Redis set commands.
// Sets are unordered collections of unique strings.
type SetCmdable interface {
SAdd(ctx context.Context, key string, members ...interface{}) *IntCmd
SCard(ctx context.Context, key string) *IntCmd
SDiff(ctx context.Context, keys ...string) *StringSliceCmd
SDiffStore(ctx context.Context, destination string, keys ...string) *IntCmd
SInter(ctx context.Context, keys ...string) *StringSliceCmd
SInterCard(ctx context.Context, limit int64, keys ...string) *IntCmd
SInterStore(ctx context.Context, destination string, keys ...string) *IntCmd
SIsMember(ctx context.Context, key string, member interface{}) *BoolCmd
SMIsMember(ctx context.Context, key string, members ...interface{}) *BoolSliceCmd
SMembers(ctx context.Context, key string) *StringSliceCmd
SMembersMap(ctx context.Context, key string) *StringStructMapCmd
SMove(ctx context.Context, source, destination string, member interface{}) *BoolCmd
SPop(ctx context.Context, key string) *StringCmd
SPopN(ctx context.Context, key string, count int64) *StringSliceCmd
SRandMember(ctx context.Context, key string) *StringCmd
SRandMemberN(ctx context.Context, key string, count int64) *StringSliceCmd
SRem(ctx context.Context, key string, members ...interface{}) *IntCmd
SScan(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd
SUnion(ctx context.Context, keys ...string) *StringSliceCmd
SUnionStore(ctx context.Context, destination string, keys ...string) *IntCmd
}
// Returns the number of elements that were added to the set, not including all
// the elements already present in the set.
//
// For more information about the command please refer to [SADD].
//
// [SADD]: (https://redis.io/docs/latest/commands/sadd/)
func (c cmdable) SAdd(ctx context.Context, key string, members ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(members))
args[0] = "sadd"
args[1] = key
args = appendArgs(args, members)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Returns the set cardinality (number of elements) of the set stored at key.
// Returns 0 if key does not exist.
//
// For more information about the command please refer to [SCARD].
//
// [SCARD]: (https://redis.io/docs/latest/commands/scard/)
func (c cmdable) SCard(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "scard", key)
_ = c(ctx, cmd)
return cmd
}
// Returns the members of the set resulting from the difference between the first set
// and all the successive sets.
// Keys that do not exist are considered to be empty sets.
//
// For more information about the command please refer to [SDIFF].
//
// [SDIFF]: (https://redis.io/docs/latest/commands/sdiff/)
func (c cmdable) SDiff(ctx context.Context, keys ...string) *StringSliceCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "sdiff"
for i, key := range keys {
args[1+i] = key
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Stores the members of the set resulting from the difference between the first set
// and all the successive sets into destination.
// If destination already exists, it is overwritten.
//
// For more information about the command please refer to [SDIFFSTORE].
//
// [SDIFFSTORE]: (https://redis.io/docs/latest/commands/sdiffstore/)
func (c cmdable) SDiffStore(ctx context.Context, destination string, keys ...string) *IntCmd {
args := make([]interface{}, 2+len(keys))
args[0] = "sdiffstore"
args[1] = destination
for i, key := range keys {
args[2+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Returns the members of the set resulting from the intersection of all the given sets.
// Keys that do not exist are considered to be empty sets.
// With one of the keys being an empty set, the resulting set is also empty.
//
// For more information about the command please refer to [SINTER].
//
// [SINTER]: (https://redis.io/docs/latest/commands/sinter/)
func (c cmdable) SInter(ctx context.Context, keys ...string) *StringSliceCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "sinter"
for i, key := range keys {
args[1+i] = key
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Returns the cardinality of the set resulting from the intersection of all the given sets.
// Keys that do not exist are considered to be empty sets.
// With one of the keys being an empty set, the resulting set is also empty.
//
// The limit parameter sets an upper bound on the number of results returned.
// If limit is 0, no limit is applied.
//
// For more information about the command please refer to [SINTERCARD].
//
// [SINTERCARD]: (https://redis.io/docs/latest/commands/sintercard/)
func (c cmdable) SInterCard(ctx context.Context, limit int64, keys ...string) *IntCmd {
numKeys := len(keys)
args := make([]interface{}, 4+numKeys)
args[0] = "sintercard"
args[1] = numKeys
for i, key := range keys {
args[2+i] = key
}
args[2+numKeys] = "limit"
args[3+numKeys] = limit
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Stores the members of the set resulting from the intersection of all the given sets
// into destination.
// If destination already exists, it is overwritten.
//
// For more information about the command please refer to [SINTERSTORE].
//
// [SINTERSTORE]: (https://redis.io/docs/latest/commands/sinterstore/)
func (c cmdable) SInterStore(ctx context.Context, destination string, keys ...string) *IntCmd {
args := make([]interface{}, 2+len(keys))
args[0] = "sinterstore"
args[1] = destination
for i, key := range keys {
args[2+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Returns if member is a member of the set stored at key.
// Returns true if the element is a member of the set, false if it is not a member
// or if key does not exist.
//
// For more information about the command please refer to [SISMEMBER].
//
// [SISMEMBER]: (https://redis.io/docs/latest/commands/sismember/)
func (c cmdable) SIsMember(ctx context.Context, key string, member interface{}) *BoolCmd {
cmd := NewBoolCmd(ctx, "sismember", key, member)
_ = c(ctx, cmd)
return cmd
}
// Returns whether each member is a member of the set stored at key.
// For each member, returns true if the element is a member of the set, false if it is not
// a member or if key does not exist.
//
// For more information about the command please refer to [SMISMEMBER].
//
// [SMISMEMBER]: (https://redis.io/docs/latest/commands/smismember/)
func (c cmdable) SMIsMember(ctx context.Context, key string, members ...interface{}) *BoolSliceCmd {
args := make([]interface{}, 2, 2+len(members))
args[0] = "smismember"
args[1] = key
args = appendArgs(args, members)
cmd := NewBoolSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Returns all the members of the set value stored at key.
// Returns an empty slice if key does not exist.
//
// For more information about the command please refer to [SMEMBERS].
//
// [SMEMBERS]: (https://redis.io/docs/latest/commands/smembers/)
func (c cmdable) SMembers(ctx context.Context, key string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "smembers", key)
_ = c(ctx, cmd)
return cmd
}
// Returns all the members of the set value stored at key as a map.
// Returns an empty map if key does not exist.
//
// For more information about the command please refer to [SMEMBERS].
//
// [SMEMBERS]: (https://redis.io/docs/latest/commands/smembers/)
func (c cmdable) SMembersMap(ctx context.Context, key string) *StringStructMapCmd {
cmd := NewStringStructMapCmd(ctx, "smembers", key)
_ = c(ctx, cmd)
return cmd
}
// Moves member from the set at source to the set at destination.
// This operation is atomic. In every given moment the element will appear to be a member
// of source or destination for other clients.
//
// For more information about the command please refer to [SMOVE].
//
// [SMOVE]: (https://redis.io/docs/latest/commands/smove/)
func (c cmdable) SMove(ctx context.Context, source, destination string, member interface{}) *BoolCmd {
cmd := NewBoolCmd(ctx, "smove", source, destination, member)
_ = c(ctx, cmd)
return cmd
}
// Removes and returns one or more random members from the set value stored at key.
// This version returns a single random member.
//
// For more information about the command please refer to [SPOP].
//
// [SPOP]: (https://redis.io/docs/latest/commands/spop/)
func (c cmdable) SPop(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "spop", key)
_ = c(ctx, cmd)
return cmd
}
// Removes and returns one or more random members from the set value stored at key.
// This version returns up to count random members.
//
// For more information about the command please refer to [SPOP].
//
// [SPOP]: (https://redis.io/docs/latest/commands/spop/)
func (c cmdable) SPopN(ctx context.Context, key string, count int64) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "spop", key, count)
_ = c(ctx, cmd)
return cmd
}
// Returns a random member from the set value stored at key.
// This version returns a single random member without removing it.
//
// For more information about the command please refer to [SRANDMEMBER].
//
// [SRANDMEMBER]: (https://redis.io/docs/latest/commands/srandmember/)
func (c cmdable) SRandMember(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "srandmember", key)
_ = c(ctx, cmd)
return cmd
}
// Returns an array of random members from the set value stored at key.
// This version returns up to count random members without removing them.
// When called with a positive count, returns distinct elements.
// When called with a negative count, allows for repeated elements.
//
// For more information about the command please refer to [SRANDMEMBER].
//
// [SRANDMEMBER]: (https://redis.io/docs/latest/commands/srandmember/)
func (c cmdable) SRandMemberN(ctx context.Context, key string, count int64) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "srandmember", key, count)
_ = c(ctx, cmd)
return cmd
}
// Removes the specified members from the set stored at key.
// Specified members that are not a member of this set are ignored.
// If key does not exist, it is treated as an empty set and this command returns 0.
//
// For more information about the command please refer to [SREM].
//
// [SREM]: (https://redis.io/docs/latest/commands/srem/)
func (c cmdable) SRem(ctx context.Context, key string, members ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(members))
args[0] = "srem"
args[1] = key
args = appendArgs(args, members)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Returns the members of the set resulting from the union of all the given sets.
// Keys that do not exist are considered to be empty sets.
//
// For more information about the command please refer to [SUNION].
//
// [SUNION]: (https://redis.io/docs/latest/commands/sunion/)
func (c cmdable) SUnion(ctx context.Context, keys ...string) *StringSliceCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "sunion"
for i, key := range keys {
args[1+i] = key
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Stores the members of the set resulting from the union of all the given sets
// into destination.
// If destination already exists, it is overwritten.
//
// For more information about the command please refer to [SUNIONSTORE].
//
// [SUNIONSTORE]: (https://redis.io/docs/latest/commands/sunionstore/)
func (c cmdable) SUnionStore(ctx context.Context, destination string, keys ...string) *IntCmd {
args := make([]interface{}, 2+len(keys))
args[0] = "sunionstore"
args[1] = destination
for i, key := range keys {
args[2+i] = key
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Incrementally iterates the set elements stored at key.
// This is a cursor-based iterator that allows scanning large sets efficiently.
//
// Parameters:
// - cursor: The cursor value for the iteration (use 0 to start a new scan)
// - match: Optional pattern to match elements (empty string means no pattern)
// - count: Optional hint about how many elements to return per iteration
//
// For more information about the command please refer to [SSCAN].
//
// [SSCAN]: (https://redis.io/docs/latest/commands/sscan/)
func (c cmdable) SScan(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd {
args := []interface{}{"sscan", key, cursor}
if match != "" {
args = append(args, "match", match)
}
if count > 0 {
args = append(args, "count", count)
}
cmd := NewScanCmd(ctx, c, args...)
if hashtag.Present(match) {
cmd.SetFirstKeyPos(4)
}
_ = c(ctx, cmd)
return cmd
}
package redis
import (
"context"
"errors"
"strings"
"time"
"github.com/redis/go-redis/v9/internal/hashtag"
)
type SortedSetCmdable interface {
BZPopMax(ctx context.Context, timeout time.Duration, keys ...string) *ZWithKeyCmd
BZPopMin(ctx context.Context, timeout time.Duration, keys ...string) *ZWithKeyCmd
BZMPop(ctx context.Context, timeout time.Duration, order string, count int64, keys ...string) *ZSliceWithKeyCmd
ZAdd(ctx context.Context, key string, members ...Z) *IntCmd
ZAddLT(ctx context.Context, key string, members ...Z) *IntCmd
ZAddGT(ctx context.Context, key string, members ...Z) *IntCmd
ZAddNX(ctx context.Context, key string, members ...Z) *IntCmd
ZAddXX(ctx context.Context, key string, members ...Z) *IntCmd
ZAddArgs(ctx context.Context, key string, args ZAddArgs) *IntCmd
ZAddArgsIncr(ctx context.Context, key string, args ZAddArgs) *FloatCmd
ZCard(ctx context.Context, key string) *IntCmd
ZCount(ctx context.Context, key, min, max string) *IntCmd
ZLexCount(ctx context.Context, key, min, max string) *IntCmd
ZIncrBy(ctx context.Context, key string, increment float64, member string) *FloatCmd
ZInter(ctx context.Context, store *ZStore) *StringSliceCmd
ZInterWithScores(ctx context.Context, store *ZStore) *ZSliceCmd
ZInterCard(ctx context.Context, limit int64, keys ...string) *IntCmd
ZInterStore(ctx context.Context, destination string, store *ZStore) *IntCmd
ZMPop(ctx context.Context, order string, count int64, keys ...string) *ZSliceWithKeyCmd
ZMScore(ctx context.Context, key string, members ...string) *FloatSliceCmd
ZPopMax(ctx context.Context, key string, count ...int64) *ZSliceCmd
ZPopMin(ctx context.Context, key string, count ...int64) *ZSliceCmd
ZRange(ctx context.Context, key string, start, stop int64) *StringSliceCmd
ZRangeWithScores(ctx context.Context, key string, start, stop int64) *ZSliceCmd
ZRangeByScore(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd
ZRangeByLex(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd
ZRangeByScoreWithScores(ctx context.Context, key string, opt *ZRangeBy) *ZSliceCmd
ZRangeArgs(ctx context.Context, z ZRangeArgs) *StringSliceCmd
ZRangeArgsWithScores(ctx context.Context, z ZRangeArgs) *ZSliceCmd
ZRangeStore(ctx context.Context, dst string, z ZRangeArgs) *IntCmd
ZRank(ctx context.Context, key, member string) *IntCmd
ZRankWithScore(ctx context.Context, key, member string) *RankWithScoreCmd
ZRem(ctx context.Context, key string, members ...interface{}) *IntCmd
ZRemRangeByRank(ctx context.Context, key string, start, stop int64) *IntCmd
ZRemRangeByScore(ctx context.Context, key, min, max string) *IntCmd
ZRemRangeByLex(ctx context.Context, key, min, max string) *IntCmd
ZRevRange(ctx context.Context, key string, start, stop int64) *StringSliceCmd
ZRevRangeWithScores(ctx context.Context, key string, start, stop int64) *ZSliceCmd
ZRevRangeByScore(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd
ZRevRangeByLex(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd
ZRevRangeByScoreWithScores(ctx context.Context, key string, opt *ZRangeBy) *ZSliceCmd
ZRevRank(ctx context.Context, key, member string) *IntCmd
ZRevRankWithScore(ctx context.Context, key, member string) *RankWithScoreCmd
ZScore(ctx context.Context, key, member string) *FloatCmd
ZUnionStore(ctx context.Context, dest string, store *ZStore) *IntCmd
ZRandMember(ctx context.Context, key string, count int) *StringSliceCmd
ZRandMemberWithScores(ctx context.Context, key string, count int) *ZSliceCmd
ZUnion(ctx context.Context, store ZStore) *StringSliceCmd
ZUnionWithScores(ctx context.Context, store ZStore) *ZSliceCmd
ZDiff(ctx context.Context, keys ...string) *StringSliceCmd
ZDiffWithScores(ctx context.Context, keys ...string) *ZSliceCmd
ZDiffStore(ctx context.Context, destination string, keys ...string) *IntCmd
ZScan(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd
}
// BZPopMax Redis `BZPOPMAX key [key ...] timeout` command.
func (c cmdable) BZPopMax(ctx context.Context, timeout time.Duration, keys ...string) *ZWithKeyCmd {
args := make([]interface{}, 1+len(keys)+1)
args[0] = "bzpopmax"
for i, key := range keys {
args[1+i] = key
}
args[len(args)-1] = formatSec(ctx, timeout)
cmd := NewZWithKeyCmd(ctx, args...)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
// BZPopMin Redis `BZPOPMIN key [key ...] timeout` command.
func (c cmdable) BZPopMin(ctx context.Context, timeout time.Duration, keys ...string) *ZWithKeyCmd {
args := make([]interface{}, 1+len(keys)+1)
args[0] = "bzpopmin"
for i, key := range keys {
args[1+i] = key
}
args[len(args)-1] = formatSec(ctx, timeout)
cmd := NewZWithKeyCmd(ctx, args...)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
// BZMPop is the blocking variant of ZMPOP.
// When any of the sorted sets contains elements, this command behaves exactly like ZMPOP.
// When all sorted sets are empty, Redis will block the connection until another client adds members to one of the keys or until the timeout elapses.
// A timeout of zero can be used to block indefinitely.
// example: client.BZMPop(ctx, 0,"max", 1, "set")
func (c cmdable) BZMPop(ctx context.Context, timeout time.Duration, order string, count int64, keys ...string) *ZSliceWithKeyCmd {
args := make([]interface{}, 3+len(keys), 6+len(keys))
args[0] = "bzmpop"
args[1] = formatSec(ctx, timeout)
args[2] = len(keys)
for i, key := range keys {
args[3+i] = key
}
args = append(args, strings.ToLower(order), "count", count)
cmd := NewZSliceWithKeyCmd(ctx, args...)
cmd.setReadTimeout(timeout)
_ = c(ctx, cmd)
return cmd
}
// ZAddArgs WARN: The GT, LT and NX options are mutually exclusive.
type ZAddArgs struct {
NX bool
XX bool
LT bool
GT bool
Ch bool
Members []Z
}
func (c cmdable) zAddArgs(key string, args ZAddArgs, incr bool) []interface{} {
a := make([]interface{}, 0, 6+2*len(args.Members))
a = append(a, "zadd", key)
// The GT, LT and NX options are mutually exclusive.
if args.NX {
a = append(a, "nx")
} else {
if args.XX {
a = append(a, "xx")
}
if args.GT {
a = append(a, "gt")
} else if args.LT {
a = append(a, "lt")
}
}
if args.Ch {
a = append(a, "ch")
}
if incr {
a = append(a, "incr")
}
for _, m := range args.Members {
a = append(a, m.Score)
a = append(a, m.Member)
}
return a
}
func (c cmdable) ZAddArgs(ctx context.Context, key string, args ZAddArgs) *IntCmd {
cmd := NewIntCmd(ctx, c.zAddArgs(key, args, false)...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZAddArgsIncr(ctx context.Context, key string, args ZAddArgs) *FloatCmd {
cmd := NewFloatCmd(ctx, c.zAddArgs(key, args, true)...)
_ = c(ctx, cmd)
return cmd
}
// ZAdd Redis `ZADD key score member [score member ...]` command.
func (c cmdable) ZAdd(ctx context.Context, key string, members ...Z) *IntCmd {
return c.ZAddArgs(ctx, key, ZAddArgs{
Members: members,
})
}
// ZAddLT Redis `ZADD key LT score member [score member ...]` command.
func (c cmdable) ZAddLT(ctx context.Context, key string, members ...Z) *IntCmd {
return c.ZAddArgs(ctx, key, ZAddArgs{
LT: true,
Members: members,
})
}
// ZAddGT Redis `ZADD key GT score member [score member ...]` command.
func (c cmdable) ZAddGT(ctx context.Context, key string, members ...Z) *IntCmd {
return c.ZAddArgs(ctx, key, ZAddArgs{
GT: true,
Members: members,
})
}
// ZAddNX Redis `ZADD key NX score member [score member ...]` command.
func (c cmdable) ZAddNX(ctx context.Context, key string, members ...Z) *IntCmd {
return c.ZAddArgs(ctx, key, ZAddArgs{
NX: true,
Members: members,
})
}
// ZAddXX Redis `ZADD key XX score member [score member ...]` command.
func (c cmdable) ZAddXX(ctx context.Context, key string, members ...Z) *IntCmd {
return c.ZAddArgs(ctx, key, ZAddArgs{
XX: true,
Members: members,
})
}
func (c cmdable) ZCard(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "zcard", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZCount(ctx context.Context, key, min, max string) *IntCmd {
cmd := NewIntCmd(ctx, "zcount", key, min, max)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZLexCount(ctx context.Context, key, min, max string) *IntCmd {
cmd := NewIntCmd(ctx, "zlexcount", key, min, max)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZIncrBy(ctx context.Context, key string, increment float64, member string) *FloatCmd {
cmd := NewFloatCmd(ctx, "zincrby", key, increment, member)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZInterStore(ctx context.Context, destination string, store *ZStore) *IntCmd {
args := make([]interface{}, 0, 3+store.len())
args = append(args, "zinterstore", destination, len(store.Keys))
args = store.appendArgs(args)
cmd := NewIntCmd(ctx, args...)
cmd.SetFirstKeyPos(3)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZInter(ctx context.Context, store *ZStore) *StringSliceCmd {
args := make([]interface{}, 0, 2+store.len())
args = append(args, "zinter", len(store.Keys))
args = store.appendArgs(args)
cmd := NewStringSliceCmd(ctx, args...)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZInterWithScores(ctx context.Context, store *ZStore) *ZSliceCmd {
args := make([]interface{}, 0, 3+store.len())
args = append(args, "zinter", len(store.Keys))
args = store.appendArgs(args)
args = append(args, "withscores")
cmd := NewZSliceCmd(ctx, args...)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZInterCard(ctx context.Context, limit int64, keys ...string) *IntCmd {
numKeys := len(keys)
args := make([]interface{}, 4+numKeys)
args[0] = "zintercard"
args[1] = numKeys
for i, key := range keys {
args[2+i] = key
}
args[2+numKeys] = "limit"
args[3+numKeys] = limit
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// ZMPop Pops one or more elements with the highest or lowest score from the first non-empty sorted set key from the list of provided key names.
// direction: "max" (highest score) or "min" (lowest score), count: > 0
// example: client.ZMPop(ctx, "max", 5, "set1", "set2")
func (c cmdable) ZMPop(ctx context.Context, order string, count int64, keys ...string) *ZSliceWithKeyCmd {
args := make([]interface{}, 2+len(keys), 5+len(keys))
args[0] = "zmpop"
args[1] = len(keys)
for i, key := range keys {
args[2+i] = key
}
args = append(args, strings.ToLower(order), "count", count)
cmd := NewZSliceWithKeyCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZMScore(ctx context.Context, key string, members ...string) *FloatSliceCmd {
args := make([]interface{}, 2+len(members))
args[0] = "zmscore"
args[1] = key
for i, member := range members {
args[2+i] = member
}
cmd := NewFloatSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZPopMax(ctx context.Context, key string, count ...int64) *ZSliceCmd {
args := []interface{}{
"zpopmax",
key,
}
switch len(count) {
case 0:
break
case 1:
args = append(args, count[0])
default:
cmd := NewZSliceCmd(ctx)
cmd.SetErr(errors.New("too many arguments"))
return cmd
}
cmd := NewZSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZPopMin(ctx context.Context, key string, count ...int64) *ZSliceCmd {
args := []interface{}{
"zpopmin",
key,
}
switch len(count) {
case 0:
break
case 1:
args = append(args, count[0])
default:
cmd := NewZSliceCmd(ctx)
cmd.SetErr(errors.New("too many arguments"))
return cmd
}
cmd := NewZSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// ZRangeArgs is all the options of the ZRange command.
// In version> 6.2.0, you can replace the(cmd):
//
// ZREVRANGE,
// ZRANGEBYSCORE,
// ZREVRANGEBYSCORE,
// ZRANGEBYLEX,
// ZREVRANGEBYLEX.
//
// Please pay attention to your redis-server version.
//
// Rev, ByScore, ByLex and Offset+Count options require redis-server 6.2.0 and higher.
type ZRangeArgs struct {
Key string
// When the ByScore option is provided, the open interval(exclusive) can be set.
// By default, the score intervals specified by <Start> and <Stop> are closed (inclusive).
// It is similar to the deprecated(6.2.0+) ZRangeByScore command.
// For example:
// ZRangeArgs{
// Key: "example-key",
// Start: "(3",
// Stop: 8,
// ByScore: true,
// }
// cmd: "ZRange example-key (3 8 ByScore" (3 < score <= 8).
//
// For the ByLex option, it is similar to the deprecated(6.2.0+) ZRangeByLex command.
// You can set the <Start> and <Stop> options as follows:
// ZRangeArgs{
// Key: "example-key",
// Start: "[abc",
// Stop: "(def",
// ByLex: true,
// }
// cmd: "ZRange example-key [abc (def ByLex"
//
// For normal cases (ByScore==false && ByLex==false), <Start> and <Stop> should be set to the index range (int).
// You can read the documentation for more information: https://redis.io/commands/zrange
Start interface{}
Stop interface{}
// The ByScore and ByLex options are mutually exclusive.
ByScore bool
ByLex bool
Rev bool
// limit offset count.
Offset int64
Count int64
}
func (z ZRangeArgs) appendArgs(args []interface{}) []interface{} {
// For Rev+ByScore/ByLex, we need to adjust the position of <Start> and <Stop>.
if z.Rev && (z.ByScore || z.ByLex) {
args = append(args, z.Key, z.Stop, z.Start)
} else {
args = append(args, z.Key, z.Start, z.Stop)
}
if z.ByScore {
args = append(args, "byscore")
} else if z.ByLex {
args = append(args, "bylex")
}
if z.Rev {
args = append(args, "rev")
}
if z.Offset != 0 || z.Count != 0 {
args = append(args, "limit", z.Offset, z.Count)
}
return args
}
func (c cmdable) ZRangeArgs(ctx context.Context, z ZRangeArgs) *StringSliceCmd {
args := make([]interface{}, 0, 9)
args = append(args, "zrange")
args = z.appendArgs(args)
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRangeArgsWithScores(ctx context.Context, z ZRangeArgs) *ZSliceCmd {
args := make([]interface{}, 0, 10)
args = append(args, "zrange")
args = z.appendArgs(args)
args = append(args, "withscores")
cmd := NewZSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRange(ctx context.Context, key string, start, stop int64) *StringSliceCmd {
return c.ZRangeArgs(ctx, ZRangeArgs{
Key: key,
Start: start,
Stop: stop,
})
}
func (c cmdable) ZRangeWithScores(ctx context.Context, key string, start, stop int64) *ZSliceCmd {
return c.ZRangeArgsWithScores(ctx, ZRangeArgs{
Key: key,
Start: start,
Stop: stop,
})
}
type ZRangeBy struct {
Min, Max string
Offset, Count int64
}
func (c cmdable) zRangeBy(ctx context.Context, zcmd, key string, opt *ZRangeBy, withScores bool) *StringSliceCmd {
args := []interface{}{zcmd, key, opt.Min, opt.Max}
if withScores {
args = append(args, "withscores")
}
if opt.Offset != 0 || opt.Count != 0 {
args = append(
args,
"limit",
opt.Offset,
opt.Count,
)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// ZRangeByScore returns members in a sorted set within a range of scores.
//
// Deprecated: Use ZRangeArgs with ByScore option instead as of Redis 6.2.0.
func (c cmdable) ZRangeByScore(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd {
return c.zRangeBy(ctx, "zrangebyscore", key, opt, false)
}
// ZRangeByLex returns members in a sorted set within a lexicographical range.
//
// Deprecated: Use ZRangeArgs with ByLex option instead as of Redis 6.2.0.
func (c cmdable) ZRangeByLex(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd {
return c.zRangeBy(ctx, "zrangebylex", key, opt, false)
}
func (c cmdable) ZRangeByScoreWithScores(ctx context.Context, key string, opt *ZRangeBy) *ZSliceCmd {
args := []interface{}{"zrangebyscore", key, opt.Min, opt.Max, "withscores"}
if opt.Offset != 0 || opt.Count != 0 {
args = append(
args,
"limit",
opt.Offset,
opt.Count,
)
}
cmd := NewZSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRangeStore(ctx context.Context, dst string, z ZRangeArgs) *IntCmd {
args := make([]interface{}, 0, 10)
args = append(args, "zrangestore", dst)
args = z.appendArgs(args)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRank(ctx context.Context, key, member string) *IntCmd {
cmd := NewIntCmd(ctx, "zrank", key, member)
_ = c(ctx, cmd)
return cmd
}
// ZRankWithScore according to the Redis documentation, if member does not exist
// in the sorted set or key does not exist, it will return a redis.Nil error.
func (c cmdable) ZRankWithScore(ctx context.Context, key, member string) *RankWithScoreCmd {
cmd := NewRankWithScoreCmd(ctx, "zrank", key, member, "withscore")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRem(ctx context.Context, key string, members ...interface{}) *IntCmd {
args := make([]interface{}, 2, 2+len(members))
args[0] = "zrem"
args[1] = key
args = appendArgs(args, members)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRemRangeByRank(ctx context.Context, key string, start, stop int64) *IntCmd {
cmd := NewIntCmd(
ctx,
"zremrangebyrank",
key,
start,
stop,
)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRemRangeByScore(ctx context.Context, key, min, max string) *IntCmd {
cmd := NewIntCmd(ctx, "zremrangebyscore", key, min, max)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRemRangeByLex(ctx context.Context, key, min, max string) *IntCmd {
cmd := NewIntCmd(ctx, "zremrangebylex", key, min, max)
_ = c(ctx, cmd)
return cmd
}
// ZRevRange returns members in a sorted set within a range of indexes in reverse order.
//
// Deprecated: Use ZRangeArgs with Rev option instead as of Redis 6.2.0.
func (c cmdable) ZRevRange(ctx context.Context, key string, start, stop int64) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "zrevrange", key, start, stop)
_ = c(ctx, cmd)
return cmd
}
// ZRevRangeWithScores according to the Redis documentation, if member does not exist
// in the sorted set or key does not exist, it will return a redis.Nil error.
func (c cmdable) ZRevRangeWithScores(ctx context.Context, key string, start, stop int64) *ZSliceCmd {
cmd := NewZSliceCmd(ctx, "zrevrange", key, start, stop, "withscores")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) zRevRangeBy(ctx context.Context, zcmd, key string, opt *ZRangeBy) *StringSliceCmd {
args := []interface{}{zcmd, key, opt.Max, opt.Min}
if opt.Offset != 0 || opt.Count != 0 {
args = append(
args,
"limit",
opt.Offset,
opt.Count,
)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// ZRevRangeByScore returns members in a sorted set within a range of scores in reverse order.
//
// Deprecated: Use ZRangeArgs with Rev and ByScore options instead as of Redis 6.2.0.
func (c cmdable) ZRevRangeByScore(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd {
return c.zRevRangeBy(ctx, "zrevrangebyscore", key, opt)
}
// ZRevRangeByLex returns members in a sorted set within a lexicographical range in reverse order.
//
// Deprecated: Use ZRangeArgs with Rev and ByLex options instead as of Redis 6.2.0.
func (c cmdable) ZRevRangeByLex(ctx context.Context, key string, opt *ZRangeBy) *StringSliceCmd {
return c.zRevRangeBy(ctx, "zrevrangebylex", key, opt)
}
func (c cmdable) ZRevRangeByScoreWithScores(ctx context.Context, key string, opt *ZRangeBy) *ZSliceCmd {
args := []interface{}{"zrevrangebyscore", key, opt.Max, opt.Min, "withscores"}
if opt.Offset != 0 || opt.Count != 0 {
args = append(
args,
"limit",
opt.Offset,
opt.Count,
)
}
cmd := NewZSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRevRank(ctx context.Context, key, member string) *IntCmd {
cmd := NewIntCmd(ctx, "zrevrank", key, member)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZRevRankWithScore(ctx context.Context, key, member string) *RankWithScoreCmd {
cmd := NewRankWithScoreCmd(ctx, "zrevrank", key, member, "withscore")
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZScore(ctx context.Context, key, member string) *FloatCmd {
cmd := NewFloatCmd(ctx, "zscore", key, member)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZUnion(ctx context.Context, store ZStore) *StringSliceCmd {
args := make([]interface{}, 0, 2+store.len())
args = append(args, "zunion", len(store.Keys))
args = store.appendArgs(args)
cmd := NewStringSliceCmd(ctx, args...)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZUnionWithScores(ctx context.Context, store ZStore) *ZSliceCmd {
args := make([]interface{}, 0, 3+store.len())
args = append(args, "zunion", len(store.Keys))
args = store.appendArgs(args)
args = append(args, "withscores")
cmd := NewZSliceCmd(ctx, args...)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZUnionStore(ctx context.Context, dest string, store *ZStore) *IntCmd {
args := make([]interface{}, 0, 3+store.len())
args = append(args, "zunionstore", dest, len(store.Keys))
args = store.appendArgs(args)
cmd := NewIntCmd(ctx, args...)
cmd.SetFirstKeyPos(3)
_ = c(ctx, cmd)
return cmd
}
// ZRandMember redis-server version >= 6.2.0.
func (c cmdable) ZRandMember(ctx context.Context, key string, count int) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "zrandmember", key, count)
_ = c(ctx, cmd)
return cmd
}
// ZRandMemberWithScores redis-server version >= 6.2.0.
func (c cmdable) ZRandMemberWithScores(ctx context.Context, key string, count int) *ZSliceCmd {
cmd := NewZSliceCmd(ctx, "zrandmember", key, count, "withscores")
_ = c(ctx, cmd)
return cmd
}
// ZDiff redis-server version >= 6.2.0.
func (c cmdable) ZDiff(ctx context.Context, keys ...string) *StringSliceCmd {
args := make([]interface{}, 2+len(keys))
args[0] = "zdiff"
args[1] = len(keys)
for i, key := range keys {
args[i+2] = key
}
cmd := NewStringSliceCmd(ctx, args...)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
// ZDiffWithScores redis-server version >= 6.2.0.
func (c cmdable) ZDiffWithScores(ctx context.Context, keys ...string) *ZSliceCmd {
args := make([]interface{}, 3+len(keys))
args[0] = "zdiff"
args[1] = len(keys)
for i, key := range keys {
args[i+2] = key
}
args[len(keys)+2] = "withscores"
cmd := NewZSliceCmd(ctx, args...)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
// ZDiffStore redis-server version >=6.2.0.
func (c cmdable) ZDiffStore(ctx context.Context, destination string, keys ...string) *IntCmd {
args := make([]interface{}, 0, 3+len(keys))
args = append(args, "zdiffstore", destination, len(keys))
for _, key := range keys {
args = append(args, key)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) ZScan(ctx context.Context, key string, cursor uint64, match string, count int64) *ScanCmd {
args := []interface{}{"zscan", key, cursor}
if match != "" {
args = append(args, "match", match)
}
if count > 0 {
args = append(args, "count", count)
}
cmd := NewScanCmd(ctx, c, args...)
if hashtag.Present(match) {
cmd.SetFirstKeyPos(4)
}
_ = c(ctx, cmd)
return cmd
}
// Z represents sorted set member.
type Z struct {
Score float64
Member interface{}
}
// ZWithKey represents sorted set member including the name of the key where it was popped.
type ZWithKey struct {
Z
Key string
}
// ZStore is used as an arg to ZInter/ZInterStore and ZUnion/ZUnionStore.
type ZStore struct {
Keys []string
Weights []float64
// Can be SUM, MIN or MAX.
Aggregate string
}
func (z ZStore) len() (n int) {
n = len(z.Keys)
if len(z.Weights) > 0 {
n += 1 + len(z.Weights)
}
if z.Aggregate != "" {
n += 2
}
return n
}
func (z ZStore) appendArgs(args []interface{}) []interface{} {
for _, key := range z.Keys {
args = append(args, key)
}
if len(z.Weights) > 0 {
args = append(args, "weights")
for _, weights := range z.Weights {
args = append(args, weights)
}
}
if z.Aggregate != "" {
args = append(args, "aggregate", z.Aggregate)
}
return args
}
package redis
import (
"context"
"strconv"
"strings"
"time"
"github.com/redis/go-redis/v9/internal/otel"
)
type StreamCmdable interface {
XAdd(ctx context.Context, a *XAddArgs) *StringCmd
XAckDel(ctx context.Context, stream string, group string, mode string, ids ...string) *SliceCmd
XDel(ctx context.Context, stream string, ids ...string) *IntCmd
XDelEx(ctx context.Context, stream string, mode string, ids ...string) *SliceCmd
XLen(ctx context.Context, stream string) *IntCmd
XRange(ctx context.Context, stream, start, stop string) *XMessageSliceCmd
XRangeN(ctx context.Context, stream, start, stop string, count int64) *XMessageSliceCmd
XRevRange(ctx context.Context, stream string, start, stop string) *XMessageSliceCmd
XRevRangeN(ctx context.Context, stream string, start, stop string, count int64) *XMessageSliceCmd
XRead(ctx context.Context, a *XReadArgs) *XStreamSliceCmd
XReadStreams(ctx context.Context, streams ...string) *XStreamSliceCmd
XGroupCreate(ctx context.Context, stream, group, start string) *StatusCmd
XGroupCreateMkStream(ctx context.Context, stream, group, start string) *StatusCmd
XGroupSetID(ctx context.Context, stream, group, start string) *StatusCmd
XGroupDestroy(ctx context.Context, stream, group string) *IntCmd
XGroupCreateConsumer(ctx context.Context, stream, group, consumer string) *IntCmd
XGroupDelConsumer(ctx context.Context, stream, group, consumer string) *IntCmd
XReadGroup(ctx context.Context, a *XReadGroupArgs) *XStreamSliceCmd
XAck(ctx context.Context, stream, group string, ids ...string) *IntCmd
XPending(ctx context.Context, stream, group string) *XPendingCmd
XPendingExt(ctx context.Context, a *XPendingExtArgs) *XPendingExtCmd
XClaim(ctx context.Context, a *XClaimArgs) *XMessageSliceCmd
XClaimJustID(ctx context.Context, a *XClaimArgs) *StringSliceCmd
XAutoClaim(ctx context.Context, a *XAutoClaimArgs) *XAutoClaimCmd
XAutoClaimJustID(ctx context.Context, a *XAutoClaimArgs) *XAutoClaimJustIDCmd
XTrimMaxLen(ctx context.Context, key string, maxLen int64) *IntCmd
XTrimMaxLenApprox(ctx context.Context, key string, maxLen, limit int64) *IntCmd
XTrimMaxLenMode(ctx context.Context, key string, maxLen int64, mode string) *IntCmd
XTrimMaxLenApproxMode(ctx context.Context, key string, maxLen, limit int64, mode string) *IntCmd
XTrimMinID(ctx context.Context, key string, minID string) *IntCmd
XTrimMinIDApprox(ctx context.Context, key string, minID string, limit int64) *IntCmd
XTrimMinIDMode(ctx context.Context, key string, minID string, mode string) *IntCmd
XTrimMinIDApproxMode(ctx context.Context, key string, minID string, limit int64, mode string) *IntCmd
XInfoGroups(ctx context.Context, key string) *XInfoGroupsCmd
XInfoStream(ctx context.Context, key string) *XInfoStreamCmd
XInfoStreamFull(ctx context.Context, key string, count int) *XInfoStreamFullCmd
XInfoConsumers(ctx context.Context, key string, group string) *XInfoConsumersCmd
XCfgSet(ctx context.Context, a *XCfgSetArgs) *StatusCmd
}
// XAddArgs accepts values in the following formats:
// - XAddArgs.Values = []interface{}{"key1", "value1", "key2", "value2"}
// - XAddArgs.Values = []string("key1", "value1", "key2", "value2")
// - XAddArgs.Values = map[string]interface{}{"key1": "value1", "key2": "value2"}
//
// Note that map will not preserve the order of key-value pairs.
// MaxLen/MaxLenApprox and MinID are in conflict, only one of them can be used.
//
// For idempotent production (at-most-once production):
// - ProducerID: A unique identifier for the producer (required for both IDMP and IDMPAUTO)
// - IdempotentID: A unique identifier for the message (used with IDMP)
// - IdempotentAuto: If true, Redis will auto-generate an idempotent ID based on message content (IDMPAUTO)
//
// ProducerID and IdempotentID are mutually exclusive with IdempotentAuto.
// When using idempotent production, ID must be "*" or empty.
type XAddArgs struct {
Stream string
NoMkStream bool
MaxLen int64 // MAXLEN N
MinID string
// Approx causes MaxLen and MinID to use "~" matcher (instead of "=").
Approx bool
Limit int64
Mode string
ID string
Values interface{}
ProducerID string // Producer ID for idempotent production (IDMP or IDMPAUTO)
IdempotentID string // Idempotent ID for IDMP
IdempotentAuto bool // Use IDMPAUTO to auto-generate idempotent ID based on content
}
func (c cmdable) XAdd(ctx context.Context, a *XAddArgs) *StringCmd {
args := make([]interface{}, 0, 15)
args = append(args, "xadd", a.Stream)
if a.NoMkStream {
args = append(args, "nomkstream")
}
if a.Mode != "" {
args = append(args, a.Mode)
}
if a.ProducerID != "" {
if a.IdempotentAuto {
// IDMPAUTO pid
args = append(args, "idmpauto", a.ProducerID)
} else if a.IdempotentID != "" {
// IDMP pid iid
args = append(args, "idmp", a.ProducerID, a.IdempotentID)
}
}
switch {
case a.MaxLen > 0:
if a.Approx {
args = append(args, "maxlen", "~", a.MaxLen)
} else {
args = append(args, "maxlen", "=", a.MaxLen)
}
case a.MinID != "":
if a.Approx {
args = append(args, "minid", "~", a.MinID)
} else {
args = append(args, "minid", "=", a.MinID)
}
}
if a.Limit > 0 {
args = append(args, "limit", a.Limit)
}
if a.ID != "" {
args = append(args, a.ID)
} else {
args = append(args, "*")
}
args = appendArg(args, a.Values)
cmd := NewStringCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XAckDel(ctx context.Context, stream string, group string, mode string, ids ...string) *SliceCmd {
args := []interface{}{"xackdel", stream, group, mode, "ids", len(ids)}
for _, id := range ids {
args = append(args, id)
}
cmd := NewSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XDel(ctx context.Context, stream string, ids ...string) *IntCmd {
args := []interface{}{"xdel", stream}
for _, id := range ids {
args = append(args, id)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XDelEx(ctx context.Context, stream string, mode string, ids ...string) *SliceCmd {
args := []interface{}{"xdelex", stream, mode, "ids", len(ids)}
for _, id := range ids {
args = append(args, id)
}
cmd := NewSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XLen(ctx context.Context, stream string) *IntCmd {
cmd := NewIntCmd(ctx, "xlen", stream)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XRange(ctx context.Context, stream, start, stop string) *XMessageSliceCmd {
cmd := NewXMessageSliceCmd(ctx, "xrange", stream, start, stop)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XRangeN(ctx context.Context, stream, start, stop string, count int64) *XMessageSliceCmd {
cmd := NewXMessageSliceCmd(ctx, "xrange", stream, start, stop, "count", count)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XRevRange(ctx context.Context, stream, start, stop string) *XMessageSliceCmd {
cmd := NewXMessageSliceCmd(ctx, "xrevrange", stream, start, stop)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XRevRangeN(ctx context.Context, stream, start, stop string, count int64) *XMessageSliceCmd {
cmd := NewXMessageSliceCmd(ctx, "xrevrange", stream, start, stop, "count", count)
_ = c(ctx, cmd)
return cmd
}
type XReadArgs struct {
Streams []string // list of streams and ids, e.g. stream1 stream2 id1 id2
Count int64
Block time.Duration
ID string
}
func (c cmdable) XRead(ctx context.Context, a *XReadArgs) *XStreamSliceCmd {
args := make([]interface{}, 0, 2*len(a.Streams)+6)
args = append(args, "xread")
keyPos := int8(1)
if a.Count > 0 {
args = append(args, "count")
args = append(args, a.Count)
keyPos += 2
}
if a.Block >= 0 {
args = append(args, "block")
args = append(args, int64(a.Block/time.Millisecond))
keyPos += 2
}
args = append(args, "streams")
keyPos++
for _, s := range a.Streams {
args = append(args, s)
}
if a.ID != "" {
for range a.Streams {
args = append(args, a.ID)
}
}
cmd := NewXStreamSliceCmd(ctx, args...)
if a.Block >= 0 {
cmd.setReadTimeout(a.Block)
}
cmd.SetFirstKeyPos(keyPos)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XReadStreams(ctx context.Context, streams ...string) *XStreamSliceCmd {
return c.XRead(ctx, &XReadArgs{
Streams: streams,
Block: -1,
})
}
func (c cmdable) XGroupCreate(ctx context.Context, stream, group, start string) *StatusCmd {
cmd := NewStatusCmd(ctx, "xgroup", "create", stream, group, start)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XGroupCreateMkStream(ctx context.Context, stream, group, start string) *StatusCmd {
cmd := NewStatusCmd(ctx, "xgroup", "create", stream, group, start, "mkstream")
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XGroupSetID(ctx context.Context, stream, group, start string) *StatusCmd {
cmd := NewStatusCmd(ctx, "xgroup", "setid", stream, group, start)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XGroupDestroy(ctx context.Context, stream, group string) *IntCmd {
cmd := NewIntCmd(ctx, "xgroup", "destroy", stream, group)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XGroupCreateConsumer(ctx context.Context, stream, group, consumer string) *IntCmd {
cmd := NewIntCmd(ctx, "xgroup", "createconsumer", stream, group, consumer)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XGroupDelConsumer(ctx context.Context, stream, group, consumer string) *IntCmd {
cmd := NewIntCmd(ctx, "xgroup", "delconsumer", stream, group, consumer)
cmd.SetFirstKeyPos(2)
_ = c(ctx, cmd)
return cmd
}
type XReadGroupArgs struct {
Group string
Consumer string
Streams []string // list of streams and ids, e.g. stream1 stream2 id1 id2
Count int64
Block time.Duration
NoAck bool
Claim time.Duration // Claim idle pending entries older than this duration
}
func (c cmdable) XReadGroup(ctx context.Context, a *XReadGroupArgs) *XStreamSliceCmd {
args := make([]interface{}, 0, 10+len(a.Streams))
args = append(args, "xreadgroup", "group", a.Group, a.Consumer)
keyPos := int8(4)
if a.Count > 0 {
args = append(args, "count", a.Count)
keyPos += 2
}
if a.Block >= 0 {
args = append(args, "block", int64(a.Block/time.Millisecond))
keyPos += 2
}
if a.NoAck {
args = append(args, "noack")
keyPos++
}
if a.Claim > 0 {
args = append(args, "claim", int64(a.Claim/time.Millisecond))
keyPos += 2
}
args = append(args, "streams")
keyPos++
for _, s := range a.Streams {
args = append(args, s)
}
cmd := NewXStreamSliceCmd(ctx, args...)
if a.Block >= 0 {
cmd.setReadTimeout(a.Block)
}
cmd.SetFirstKeyPos(keyPos)
_ = c(ctx, cmd)
// Record stream lag for each message (if command succeeded)
if cmd.Err() == nil {
streams := cmd.Val()
for _, stream := range streams {
for _, msg := range stream.Messages {
// Parse message ID to extract timestamp (format: "millisecondsTime-sequenceNumber")
if parts := strings.SplitN(msg.ID, "-", 2); len(parts) == 2 {
if timestampMs, err := strconv.ParseInt(parts[0], 10, 64); err == nil {
// Calculate lag (time since message was created)
messageTime := time.Unix(0, timestampMs*int64(time.Millisecond))
lag := time.Since(messageTime)
// Record lag metric
otel.RecordStreamLag(ctx, lag, nil, stream.Stream, a.Group, a.Consumer)
}
}
}
}
}
return cmd
}
func (c cmdable) XAck(ctx context.Context, stream, group string, ids ...string) *IntCmd {
args := []interface{}{"xack", stream, group}
for _, id := range ids {
args = append(args, id)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XPending(ctx context.Context, stream, group string) *XPendingCmd {
cmd := NewXPendingCmd(ctx, "xpending", stream, group)
_ = c(ctx, cmd)
return cmd
}
type XPendingExtArgs struct {
Stream string
Group string
Idle time.Duration
Start string
End string
Count int64
Consumer string
}
func (c cmdable) XPendingExt(ctx context.Context, a *XPendingExtArgs) *XPendingExtCmd {
args := make([]interface{}, 0, 9)
args = append(args, "xpending", a.Stream, a.Group)
if a.Idle != 0 {
args = append(args, "idle", formatMs(ctx, a.Idle))
}
args = append(args, a.Start, a.End, a.Count)
if a.Consumer != "" {
args = append(args, a.Consumer)
}
cmd := NewXPendingExtCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type XAutoClaimArgs struct {
Stream string
Group string
MinIdle time.Duration
Start string
Count int64
Consumer string
}
func (c cmdable) XAutoClaim(ctx context.Context, a *XAutoClaimArgs) *XAutoClaimCmd {
args := xAutoClaimArgs(ctx, a)
cmd := NewXAutoClaimCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XAutoClaimJustID(ctx context.Context, a *XAutoClaimArgs) *XAutoClaimJustIDCmd {
args := xAutoClaimArgs(ctx, a)
args = append(args, "justid")
cmd := NewXAutoClaimJustIDCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func xAutoClaimArgs(ctx context.Context, a *XAutoClaimArgs) []interface{} {
args := make([]interface{}, 0, 8)
args = append(args, "xautoclaim", a.Stream, a.Group, a.Consumer, formatMs(ctx, a.MinIdle), a.Start)
if a.Count > 0 {
args = append(args, "count", a.Count)
}
return args
}
type XClaimArgs struct {
Stream string
Group string
Consumer string
MinIdle time.Duration
Messages []string
}
func (c cmdable) XClaim(ctx context.Context, a *XClaimArgs) *XMessageSliceCmd {
args := xClaimArgs(a)
cmd := NewXMessageSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XClaimJustID(ctx context.Context, a *XClaimArgs) *StringSliceCmd {
args := xClaimArgs(a)
args = append(args, "justid")
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func xClaimArgs(a *XClaimArgs) []interface{} {
args := make([]interface{}, 0, 5+len(a.Messages))
args = append(args,
"xclaim",
a.Stream,
a.Group, a.Consumer,
int64(a.MinIdle/time.Millisecond))
for _, id := range a.Messages {
args = append(args, id)
}
return args
}
// TODO: refactor xTrim, xTrimMode and the wrappers over the functions
// xTrim If approx is true, add the "~" parameter, otherwise it is the default "=" (redis default).
// example:
//
// XTRIM key MAXLEN/MINID threshold LIMIT limit.
// XTRIM key MAXLEN/MINID ~ threshold LIMIT limit.
//
// The redis-server version is lower than 6.2, please set limit to 0.
func (c cmdable) xTrim(
ctx context.Context, key, strategy string,
approx bool, threshold interface{}, limit int64,
) *IntCmd {
args := make([]interface{}, 0, 7)
args = append(args, "xtrim", key, strategy)
if approx {
args = append(args, "~")
} else {
args = append(args, "=")
}
args = append(args, threshold)
if limit > 0 {
args = append(args, "limit", limit)
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// XTrimMaxLen No `~` rules are used, `limit` cannot be used.
// cmd: XTRIM key MAXLEN maxLen
func (c cmdable) XTrimMaxLen(ctx context.Context, key string, maxLen int64) *IntCmd {
return c.xTrim(ctx, key, "maxlen", false, maxLen, 0)
}
func (c cmdable) XTrimMaxLenApprox(ctx context.Context, key string, maxLen, limit int64) *IntCmd {
return c.xTrim(ctx, key, "maxlen", true, maxLen, limit)
}
func (c cmdable) XTrimMinID(ctx context.Context, key string, minID string) *IntCmd {
return c.xTrim(ctx, key, "minid", false, minID, 0)
}
func (c cmdable) XTrimMinIDApprox(ctx context.Context, key string, minID string, limit int64) *IntCmd {
return c.xTrim(ctx, key, "minid", true, minID, limit)
}
func (c cmdable) xTrimMode(
ctx context.Context, key, strategy string,
approx bool, threshold interface{}, limit int64,
mode string,
) *IntCmd {
args := make([]interface{}, 0, 7)
args = append(args, "xtrim", key, strategy)
if approx {
args = append(args, "~")
} else {
args = append(args, "=")
}
args = append(args, threshold)
if limit > 0 {
args = append(args, "limit", limit)
}
args = append(args, mode)
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XTrimMaxLenMode(ctx context.Context, key string, maxLen int64, mode string) *IntCmd {
return c.xTrimMode(ctx, key, "maxlen", false, maxLen, 0, mode)
}
func (c cmdable) XTrimMaxLenApproxMode(ctx context.Context, key string, maxLen, limit int64, mode string) *IntCmd {
return c.xTrimMode(ctx, key, "maxlen", true, maxLen, limit, mode)
}
func (c cmdable) XTrimMinIDMode(ctx context.Context, key string, minID string, mode string) *IntCmd {
return c.xTrimMode(ctx, key, "minid", false, minID, 0, mode)
}
func (c cmdable) XTrimMinIDApproxMode(ctx context.Context, key string, minID string, limit int64, mode string) *IntCmd {
return c.xTrimMode(ctx, key, "minid", true, minID, limit, mode)
}
func (c cmdable) XInfoConsumers(ctx context.Context, key string, group string) *XInfoConsumersCmd {
cmd := NewXInfoConsumersCmd(ctx, key, group)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XInfoGroups(ctx context.Context, key string) *XInfoGroupsCmd {
cmd := NewXInfoGroupsCmd(ctx, key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) XInfoStream(ctx context.Context, key string) *XInfoStreamCmd {
cmd := NewXInfoStreamCmd(ctx, key)
_ = c(ctx, cmd)
return cmd
}
// XInfoStreamFull XINFO STREAM FULL [COUNT count]
// redis-server >= 6.0.
func (c cmdable) XInfoStreamFull(ctx context.Context, key string, count int) *XInfoStreamFullCmd {
args := make([]interface{}, 0, 6)
args = append(args, "xinfo", "stream", key, "full")
if count > 0 {
args = append(args, "count", count)
}
cmd := NewXInfoStreamFullCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// XCfgSetArgs represents the arguments for the XCFGSET command.
// Duration is the duration, in seconds, that Redis keeps each idempotent ID.
// MaxSize is the maximum number of most recent idempotent IDs that Redis keeps for each producer ID.
type XCfgSetArgs struct {
Stream string
Duration int64
MaxSize int64
}
// XCfgSet sets the idempotent production configuration for a stream.
// XCFGSET key [IDMP-DURATION duration] [IDMP-MAXSIZE maxsize]
func (c cmdable) XCfgSet(ctx context.Context, a *XCfgSetArgs) *StatusCmd {
args := make([]interface{}, 0, 6)
args = append(args, "xcfgset", a.Stream)
if a.Duration > 0 {
args = append(args, "idmp-duration", a.Duration)
}
if a.MaxSize > 0 {
args = append(args, "idmp-maxsize", a.MaxSize)
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
package redis
import (
"context"
"fmt"
"time"
)
type StringCmdable interface {
Append(ctx context.Context, key, value string) *IntCmd
Decr(ctx context.Context, key string) *IntCmd
DecrBy(ctx context.Context, key string, decrement int64) *IntCmd
DelExArgs(ctx context.Context, key string, a DelExArgs) *IntCmd
Digest(ctx context.Context, key string) *DigestCmd
Get(ctx context.Context, key string) *StringCmd
GetRange(ctx context.Context, key string, start, end int64) *StringCmd
GetSet(ctx context.Context, key string, value interface{}) *StringCmd
GetEx(ctx context.Context, key string, expiration time.Duration) *StringCmd
GetDel(ctx context.Context, key string) *StringCmd
Incr(ctx context.Context, key string) *IntCmd
IncrBy(ctx context.Context, key string, value int64) *IntCmd
IncrByFloat(ctx context.Context, key string, value float64) *FloatCmd
LCS(ctx context.Context, q *LCSQuery) *LCSCmd
MGet(ctx context.Context, keys ...string) *SliceCmd
MSet(ctx context.Context, values ...interface{}) *StatusCmd
MSetNX(ctx context.Context, values ...interface{}) *BoolCmd
MSetEX(ctx context.Context, args MSetEXArgs, values ...interface{}) *IntCmd
Set(ctx context.Context, key string, value interface{}, expiration time.Duration) *StatusCmd
SetArgs(ctx context.Context, key string, value interface{}, a SetArgs) *StatusCmd
SetEx(ctx context.Context, key string, value interface{}, expiration time.Duration) *StatusCmd
SetIFEQ(ctx context.Context, key string, value interface{}, matchValue interface{}, expiration time.Duration) *StatusCmd
SetIFEQGet(ctx context.Context, key string, value interface{}, matchValue interface{}, expiration time.Duration) *StringCmd
SetIFNE(ctx context.Context, key string, value interface{}, matchValue interface{}, expiration time.Duration) *StatusCmd
SetIFNEGet(ctx context.Context, key string, value interface{}, matchValue interface{}, expiration time.Duration) *StringCmd
SetIFDEQ(ctx context.Context, key string, value interface{}, matchDigest uint64, expiration time.Duration) *StatusCmd
SetIFDEQGet(ctx context.Context, key string, value interface{}, matchDigest uint64, expiration time.Duration) *StringCmd
SetIFDNE(ctx context.Context, key string, value interface{}, matchDigest uint64, expiration time.Duration) *StatusCmd
SetIFDNEGet(ctx context.Context, key string, value interface{}, matchDigest uint64, expiration time.Duration) *StringCmd
SetNX(ctx context.Context, key string, value interface{}, expiration time.Duration) *BoolCmd
SetXX(ctx context.Context, key string, value interface{}, expiration time.Duration) *BoolCmd
SetRange(ctx context.Context, key string, offset int64, value string) *IntCmd
StrLen(ctx context.Context, key string) *IntCmd
}
func (c cmdable) Append(ctx context.Context, key, value string) *IntCmd {
cmd := NewIntCmd(ctx, "append", key, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Decr(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "decr", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) DecrBy(ctx context.Context, key string, decrement int64) *IntCmd {
cmd := NewIntCmd(ctx, "decrby", key, decrement)
_ = c(ctx, cmd)
return cmd
}
// DelExArgs provides arguments for the DelExArgs function.
type DelExArgs struct {
// Mode can be `IFEQ`, `IFNE`, `IFDEQ`, or `IFDNE`.
Mode string
// MatchValue is used with IFEQ/IFNE modes for compare-and-delete operations.
// - IFEQ: only delete if current value equals MatchValue
// - IFNE: only delete if current value does not equal MatchValue
MatchValue interface{}
// MatchDigest is used with IFDEQ/IFDNE modes for digest-based compare-and-delete.
// - IFDEQ: only delete if current value's digest equals MatchDigest
// - IFDNE: only delete if current value's digest does not equal MatchDigest
//
// The digest is a uint64 xxh3 hash value.
//
// For examples of client-side digest generation, see:
// example/digest-optimistic-locking/
MatchDigest uint64
}
// DelExArgs Redis `DELEX key [IFEQ|IFNE|IFDEQ|IFDNE] match-value` command.
// Compare-and-delete with flexible conditions.
//
// Returns the number of keys that were removed (0 or 1).
//
// NOTE DelExArgs is still experimental
// it's signature and behaviour may change
func (c cmdable) DelExArgs(ctx context.Context, key string, a DelExArgs) *IntCmd {
args := []interface{}{"delex", key}
if a.Mode != "" {
args = append(args, a.Mode)
// Add match value/digest based on mode
switch a.Mode {
case "ifeq", "IFEQ", "ifne", "IFNE":
if a.MatchValue != nil {
args = append(args, a.MatchValue)
}
case "ifdeq", "IFDEQ", "ifdne", "IFDNE":
if a.MatchDigest != 0 {
args = append(args, fmt.Sprintf("%016x", a.MatchDigest))
}
}
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// Digest returns the xxh3 hash (uint64) of the specified key's value.
//
// The digest is a 64-bit xxh3 hash that can be used for optimistic locking
// with SetIFDEQ, SetIFDNE, and DelExArgs commands.
//
// For examples of client-side digest generation and usage patterns, see:
// example/digest-optimistic-locking/
//
// Redis 8.4+. See https://redis.io/commands/digest/
//
// NOTE Digest is still experimental
// it's signature and behaviour may change
func (c cmdable) Digest(ctx context.Context, key string) *DigestCmd {
cmd := NewDigestCmd(ctx, "digest", key)
_ = c(ctx, cmd)
return cmd
}
// Get Redis `GET key` command. It returns redis.Nil error when key does not exist.
func (c cmdable) Get(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "get", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) GetRange(ctx context.Context, key string, start, end int64) *StringCmd {
cmd := NewStringCmd(ctx, "getrange", key, start, end)
_ = c(ctx, cmd)
return cmd
}
// GetSet returns the old value stored at key and sets it to the new value.
//
// Deprecated: Use SetArgs with Get option instead as of Redis 6.2.0.
func (c cmdable) GetSet(ctx context.Context, key string, value interface{}) *StringCmd {
cmd := NewStringCmd(ctx, "getset", key, value)
_ = c(ctx, cmd)
return cmd
}
// GetEx An expiration of zero removes the TTL associated with the key (i.e. GETEX key persist).
// Requires Redis >= 6.2.0.
func (c cmdable) GetEx(ctx context.Context, key string, expiration time.Duration) *StringCmd {
args := make([]interface{}, 0, 4)
args = append(args, "getex", key)
if expiration > 0 {
if usePrecise(expiration) {
args = append(args, "px", formatMs(ctx, expiration))
} else {
args = append(args, "ex", formatSec(ctx, expiration))
}
} else if expiration == 0 {
args = append(args, "persist")
}
cmd := NewStringCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// GetDel redis-server version >= 6.2.0.
func (c cmdable) GetDel(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "getdel", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) Incr(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "incr", key)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) IncrBy(ctx context.Context, key string, value int64) *IntCmd {
cmd := NewIntCmd(ctx, "incrby", key, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) IncrByFloat(ctx context.Context, key string, value float64) *FloatCmd {
cmd := NewFloatCmd(ctx, "incrbyfloat", key, value)
_ = c(ctx, cmd)
return cmd
}
type SetCondition string
const (
// NX only set the keys and their expiration if none exist
NX SetCondition = "NX"
// XX only set the keys and their expiration if all already exist
XX SetCondition = "XX"
)
type ExpirationMode string
const (
// EX sets expiration in seconds
EX ExpirationMode = "EX"
// PX sets expiration in milliseconds
PX ExpirationMode = "PX"
// EXAT sets expiration as Unix timestamp in seconds
EXAT ExpirationMode = "EXAT"
// PXAT sets expiration as Unix timestamp in milliseconds
PXAT ExpirationMode = "PXAT"
// KEEPTTL keeps the existing TTL
KEEPTTL ExpirationMode = "KEEPTTL"
)
type ExpirationOption struct {
Mode ExpirationMode
Value int64
}
func (c cmdable) LCS(ctx context.Context, q *LCSQuery) *LCSCmd {
cmd := NewLCSCmd(ctx, q)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) MGet(ctx context.Context, keys ...string) *SliceCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "mget"
for i, key := range keys {
args[1+i] = key
}
cmd := NewSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// MSet is like Set but accepts multiple values:
// - MSet("key1", "value1", "key2", "value2")
// - MSet([]string{"key1", "value1", "key2", "value2"})
// - MSet(map[string]interface{}{"key1": "value1", "key2": "value2"})
// - MSet(struct), For struct types, see HSet description.
func (c cmdable) MSet(ctx context.Context, values ...interface{}) *StatusCmd {
args := make([]interface{}, 1, 1+len(values))
args[0] = "mset"
args = appendArgs(args, values)
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// MSetNX is like SetNX but accepts multiple values:
// - MSetNX("key1", "value1", "key2", "value2")
// - MSetNX([]string{"key1", "value1", "key2", "value2"})
// - MSetNX(map[string]interface{}{"key1": "value1", "key2": "value2"})
// - MSetNX(struct), For struct types, see HSet description.
func (c cmdable) MSetNX(ctx context.Context, values ...interface{}) *BoolCmd {
args := make([]interface{}, 1, 1+len(values))
args[0] = "msetnx"
args = appendArgs(args, values)
cmd := NewBoolCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type MSetEXArgs struct {
Condition SetCondition
Expiration *ExpirationOption
}
// MSetEX sets the given keys to their respective values.
// This command is an extension of the MSETNX that adds expiration and XX options.
// Available since Redis 8.4
// Important: When this method is used with Cluster clients, all keys
// must be in the same hash slot, otherwise CROSSSLOT error will be returned.
// For more information, see https://redis.io/commands/msetex
func (c cmdable) MSetEX(ctx context.Context, args MSetEXArgs, values ...interface{}) *IntCmd {
expandedArgs := appendArgs([]interface{}{}, values)
numkeys := len(expandedArgs) / 2
cmdArgs := make([]interface{}, 0, 2+len(expandedArgs)+3)
cmdArgs = append(cmdArgs, "msetex", numkeys)
cmdArgs = append(cmdArgs, expandedArgs...)
if args.Condition != "" {
cmdArgs = append(cmdArgs, string(args.Condition))
}
if args.Expiration != nil {
switch args.Expiration.Mode {
case EX:
cmdArgs = append(cmdArgs, "ex", args.Expiration.Value)
case PX:
cmdArgs = append(cmdArgs, "px", args.Expiration.Value)
case EXAT:
cmdArgs = append(cmdArgs, "exat", args.Expiration.Value)
case PXAT:
cmdArgs = append(cmdArgs, "pxat", args.Expiration.Value)
case KEEPTTL:
cmdArgs = append(cmdArgs, "keepttl")
}
}
cmd := NewIntCmd(ctx, cmdArgs...)
_ = c(ctx, cmd)
return cmd
}
// Set Redis `SET key value [expiration]` command.
// Use expiration for `SETEx`-like behavior.
//
// Zero expiration means the key has no expiration time.
// KeepTTL is a Redis KEEPTTL option to keep existing TTL, it requires your redis-server version >= 6.0,
// otherwise you will receive an error: (error) ERR syntax error.
func (c cmdable) Set(ctx context.Context, key string, value interface{}, expiration time.Duration) *StatusCmd {
args := make([]interface{}, 3, 5)
args[0] = "set"
args[1] = key
args[2] = value
if expiration > 0 {
if usePrecise(expiration) {
args = append(args, "px", formatMs(ctx, expiration))
} else {
args = append(args, "ex", formatSec(ctx, expiration))
}
} else if expiration == KeepTTL {
args = append(args, "keepttl")
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// SetArgs provides arguments for the SetArgs function.
type SetArgs struct {
// Mode can be `NX`, `XX`, `IFEQ`, `IFNE`, `IFDEQ`, `IFDNE` or empty.
Mode string
// MatchValue is used with IFEQ/IFNE modes for compare-and-set operations.
// - IFEQ: only set if current value equals MatchValue
// - IFNE: only set if current value does not equal MatchValue
MatchValue interface{}
// MatchDigest is used with IFDEQ/IFDNE modes for digest-based compare-and-set.
// - IFDEQ: only set if current value's digest equals MatchDigest
// - IFDNE: only set if current value's digest does not equal MatchDigest
//
// The digest is a uint64 xxh3 hash value.
//
// For examples of client-side digest generation, see:
// example/digest-optimistic-locking/
MatchDigest uint64
// Zero `TTL` or `Expiration` means that the key has no expiration time.
TTL time.Duration
ExpireAt time.Time
// When Get is true, the command returns the old value stored at key, or nil when key did not exist.
Get bool
// KeepTTL is a Redis KEEPTTL option to keep existing TTL, it requires your redis-server version >= 6.0,
// otherwise you will receive an error: (error) ERR syntax error.
KeepTTL bool
}
// SetArgs supports all the options that the SET command supports.
// It is the alternative to the Set function when you want
// to have more control over the options.
func (c cmdable) SetArgs(ctx context.Context, key string, value interface{}, a SetArgs) *StatusCmd {
args := []interface{}{"set", key, value}
if a.KeepTTL {
args = append(args, "keepttl")
}
if !a.ExpireAt.IsZero() {
args = append(args, "exat", a.ExpireAt.Unix())
}
if a.TTL > 0 {
if usePrecise(a.TTL) {
args = append(args, "px", formatMs(ctx, a.TTL))
} else {
args = append(args, "ex", formatSec(ctx, a.TTL))
}
}
if a.Mode != "" {
args = append(args, a.Mode)
// Add match value/digest for CAS modes
switch a.Mode {
case "ifeq", "IFEQ", "ifne", "IFNE":
if a.MatchValue != nil {
args = append(args, a.MatchValue)
}
case "ifdeq", "IFDEQ", "ifdne", "IFDNE":
if a.MatchDigest != 0 {
args = append(args, fmt.Sprintf("%016x", a.MatchDigest))
}
}
}
if a.Get {
args = append(args, "get")
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// SetEx sets the value and expiration of a key.
//
// Deprecated: Use Set with expiration instead as of Redis 2.6.12.
func (c cmdable) SetEx(ctx context.Context, key string, value interface{}, expiration time.Duration) *StatusCmd {
cmd := NewStatusCmd(ctx, "setex", key, formatSec(ctx, expiration), value)
_ = c(ctx, cmd)
return cmd
}
// SetNX sets the value of a key only if the key does not exist.
//
// Deprecated: Use Set with NX option instead as of Redis 2.6.12.
//
// Zero expiration means the key has no expiration time.
// KeepTTL is a Redis KEEPTTL option to keep existing TTL, it requires your redis-server version >= 6.0,
// otherwise you will receive an error: (error) ERR syntax error.
func (c cmdable) SetNX(ctx context.Context, key string, value interface{}, expiration time.Duration) *BoolCmd {
var cmd *BoolCmd
switch expiration {
case 0:
// Use old `SETNX` to support old Redis versions.
cmd = NewBoolCmd(ctx, "setnx", key, value)
case KeepTTL:
cmd = NewBoolCmd(ctx, "set", key, value, "keepttl", "nx")
default:
if usePrecise(expiration) {
cmd = NewBoolCmd(ctx, "set", key, value, "px", formatMs(ctx, expiration), "nx")
} else {
cmd = NewBoolCmd(ctx, "set", key, value, "ex", formatSec(ctx, expiration), "nx")
}
}
_ = c(ctx, cmd)
return cmd
}
// SetXX Redis `SET key value [expiration] XX` command.
//
// Zero expiration means the key has no expiration time.
// KeepTTL is a Redis KEEPTTL option to keep existing TTL, it requires your redis-server version >= 6.0,
// otherwise you will receive an error: (error) ERR syntax error.
func (c cmdable) SetXX(ctx context.Context, key string, value interface{}, expiration time.Duration) *BoolCmd {
var cmd *BoolCmd
switch expiration {
case 0:
cmd = NewBoolCmd(ctx, "set", key, value, "xx")
case KeepTTL:
cmd = NewBoolCmd(ctx, "set", key, value, "keepttl", "xx")
default:
if usePrecise(expiration) {
cmd = NewBoolCmd(ctx, "set", key, value, "px", formatMs(ctx, expiration), "xx")
} else {
cmd = NewBoolCmd(ctx, "set", key, value, "ex", formatSec(ctx, expiration), "xx")
}
}
_ = c(ctx, cmd)
return cmd
}
// SetIFEQ Redis `SET key value [expiration] IFEQ match-value` command.
// Compare-and-set: only sets the value if the current value equals matchValue.
//
// Returns "OK" on success.
// Returns nil if the operation was aborted due to condition not matching.
// Zero expiration means the key has no expiration time.
//
// NOTE SetIFEQ is still experimental
// it's signature and behaviour may change
func (c cmdable) SetIFEQ(ctx context.Context, key string, value interface{}, matchValue interface{}, expiration time.Duration) *StatusCmd {
args := []interface{}{"set", key, value}
if expiration > 0 {
if usePrecise(expiration) {
args = append(args, "px", formatMs(ctx, expiration))
} else {
args = append(args, "ex", formatSec(ctx, expiration))
}
} else if expiration == KeepTTL {
args = append(args, "keepttl")
}
args = append(args, "ifeq", matchValue)
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// SetIFEQGet Redis `SET key value [expiration] IFEQ match-value GET` command.
// Compare-and-set with GET: only sets the value if the current value equals matchValue,
// and returns the previous value.
//
// Returns the previous value on success.
// Returns nil if the operation was aborted due to condition not matching.
// Zero expiration means the key has no expiration time.
//
// NOTE SetIFEQGet is still experimental
// it's signature and behaviour may change
func (c cmdable) SetIFEQGet(ctx context.Context, key string, value interface{}, matchValue interface{}, expiration time.Duration) *StringCmd {
args := []interface{}{"set", key, value}
if expiration > 0 {
if usePrecise(expiration) {
args = append(args, "px", formatMs(ctx, expiration))
} else {
args = append(args, "ex", formatSec(ctx, expiration))
}
} else if expiration == KeepTTL {
args = append(args, "keepttl")
}
args = append(args, "ifeq", matchValue, "get")
cmd := NewStringCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// SetIFNE Redis `SET key value [expiration] IFNE match-value` command.
// Compare-and-set: only sets the value if the current value does not equal matchValue.
//
// Returns "OK" on success.
// Returns nil if the operation was aborted due to condition not matching.
// Zero expiration means the key has no expiration time.
//
// NOTE SetIFNE is still experimental
// it's signature and behaviour may change
func (c cmdable) SetIFNE(ctx context.Context, key string, value interface{}, matchValue interface{}, expiration time.Duration) *StatusCmd {
args := []interface{}{"set", key, value}
if expiration > 0 {
if usePrecise(expiration) {
args = append(args, "px", formatMs(ctx, expiration))
} else {
args = append(args, "ex", formatSec(ctx, expiration))
}
} else if expiration == KeepTTL {
args = append(args, "keepttl")
}
args = append(args, "ifne", matchValue)
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// SetIFNEGet Redis `SET key value [expiration] IFNE match-value GET` command.
// Compare-and-set with GET: only sets the value if the current value does not equal matchValue,
// and returns the previous value.
//
// Returns the previous value on success.
// Returns nil if the operation was aborted due to condition not matching.
// Zero expiration means the key has no expiration time.
//
// NOTE SetIFNEGet is still experimental
// it's signature and behaviour may change
func (c cmdable) SetIFNEGet(ctx context.Context, key string, value interface{}, matchValue interface{}, expiration time.Duration) *StringCmd {
args := []interface{}{"set", key, value}
if expiration > 0 {
if usePrecise(expiration) {
args = append(args, "px", formatMs(ctx, expiration))
} else {
args = append(args, "ex", formatSec(ctx, expiration))
}
} else if expiration == KeepTTL {
args = append(args, "keepttl")
}
args = append(args, "ifne", matchValue, "get")
cmd := NewStringCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// SetIFDEQ sets the value only if the current value's digest equals matchDigest.
//
// This is a compare-and-set operation using xxh3 digest for optimistic locking.
// The matchDigest parameter is a uint64 xxh3 hash value.
//
// Returns "OK" on success.
// Returns redis.Nil if the digest doesn't match (value was modified).
// Zero expiration means the key has no expiration time.
//
// For examples of client-side digest generation and usage patterns, see:
// example/digest-optimistic-locking/
//
// Redis 8.4+. See https://redis.io/commands/set/
//
// NOTE SetIFNEQ is still experimental
// it's signature and behaviour may change
func (c cmdable) SetIFDEQ(ctx context.Context, key string, value interface{}, matchDigest uint64, expiration time.Duration) *StatusCmd {
args := []interface{}{"set", key, value}
if expiration > 0 {
if usePrecise(expiration) {
args = append(args, "px", formatMs(ctx, expiration))
} else {
args = append(args, "ex", formatSec(ctx, expiration))
}
} else if expiration == KeepTTL {
args = append(args, "keepttl")
}
args = append(args, "ifdeq", fmt.Sprintf("%016x", matchDigest))
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// SetIFDEQGet sets the value only if the current value's digest equals matchDigest,
// and returns the previous value.
//
// This is a compare-and-set operation using xxh3 digest for optimistic locking.
// The matchDigest parameter is a uint64 xxh3 hash value.
//
// Returns the previous value on success.
// Returns redis.Nil if the digest doesn't match (value was modified).
// Zero expiration means the key has no expiration time.
//
// For examples of client-side digest generation and usage patterns, see:
// example/digest-optimistic-locking/
//
// Redis 8.4+. See https://redis.io/commands/set/
//
// NOTE SetIFNEQGet is still experimental
// it's signature and behaviour may change
func (c cmdable) SetIFDEQGet(ctx context.Context, key string, value interface{}, matchDigest uint64, expiration time.Duration) *StringCmd {
args := []interface{}{"set", key, value}
if expiration > 0 {
if usePrecise(expiration) {
args = append(args, "px", formatMs(ctx, expiration))
} else {
args = append(args, "ex", formatSec(ctx, expiration))
}
} else if expiration == KeepTTL {
args = append(args, "keepttl")
}
args = append(args, "ifdeq", fmt.Sprintf("%016x", matchDigest), "get")
cmd := NewStringCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// SetIFDNE sets the value only if the current value's digest does NOT equal matchDigest.
//
// This is a compare-and-set operation using xxh3 digest for optimistic locking.
// The matchDigest parameter is a uint64 xxh3 hash value.
//
// Returns "OK" on success (digest didn't match, value was set).
// Returns redis.Nil if the digest matches (value was not modified).
// Zero expiration means the key has no expiration time.
//
// For examples of client-side digest generation and usage patterns, see:
// example/digest-optimistic-locking/
//
// Redis 8.4+. See https://redis.io/commands/set/
//
// NOTE SetIFDNE is still experimental
// it's signature and behaviour may change
func (c cmdable) SetIFDNE(ctx context.Context, key string, value interface{}, matchDigest uint64, expiration time.Duration) *StatusCmd {
args := []interface{}{"set", key, value}
if expiration > 0 {
if usePrecise(expiration) {
args = append(args, "px", formatMs(ctx, expiration))
} else {
args = append(args, "ex", formatSec(ctx, expiration))
}
} else if expiration == KeepTTL {
args = append(args, "keepttl")
}
args = append(args, "ifdne", fmt.Sprintf("%016x", matchDigest))
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// SetIFDNEGet sets the value only if the current value's digest does NOT equal matchDigest,
// and returns the previous value.
//
// This is a compare-and-set operation using xxh3 digest for optimistic locking.
// The matchDigest parameter is a uint64 xxh3 hash value.
//
// Returns the previous value on success (digest didn't match, value was set).
// Returns redis.Nil if the digest matches (value was not modified).
// Zero expiration means the key has no expiration time.
//
// For examples of client-side digest generation and usage patterns, see:
// example/digest-optimistic-locking/
//
// Redis 8.4+. See https://redis.io/commands/set/
//
// NOTE SetIFDNEGet is still experimental
// it's signature and behaviour may change
func (c cmdable) SetIFDNEGet(ctx context.Context, key string, value interface{}, matchDigest uint64, expiration time.Duration) *StringCmd {
args := []interface{}{"set", key, value}
if expiration > 0 {
if usePrecise(expiration) {
args = append(args, "px", formatMs(ctx, expiration))
} else {
args = append(args, "ex", formatSec(ctx, expiration))
}
} else if expiration == KeepTTL {
args = append(args, "keepttl")
}
args = append(args, "ifdne", fmt.Sprintf("%016x", matchDigest), "get")
cmd := NewStringCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) SetRange(ctx context.Context, key string, offset int64, value string) *IntCmd {
cmd := NewIntCmd(ctx, "setrange", key, offset, value)
_ = c(ctx, cmd)
return cmd
}
func (c cmdable) StrLen(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "strlen", key)
_ = c(ctx, cmd)
return cmd
}
package redis
import (
"context"
"github.com/redis/go-redis/v9/internal/proto"
"github.com/redis/go-redis/v9/internal/util"
)
type TimeseriesCmdable interface {
TSAdd(ctx context.Context, key string, timestamp interface{}, value float64) *IntCmd
TSAddWithArgs(ctx context.Context, key string, timestamp interface{}, value float64, options *TSOptions) *IntCmd
TSCreate(ctx context.Context, key string) *StatusCmd
TSCreateWithArgs(ctx context.Context, key string, options *TSOptions) *StatusCmd
TSAlter(ctx context.Context, key string, options *TSAlterOptions) *StatusCmd
TSCreateRule(ctx context.Context, sourceKey string, destKey string, aggregator Aggregator, bucketDuration int) *StatusCmd
TSCreateRuleWithArgs(ctx context.Context, sourceKey string, destKey string, aggregator Aggregator, bucketDuration int, options *TSCreateRuleOptions) *StatusCmd
TSIncrBy(ctx context.Context, Key string, timestamp float64) *IntCmd
TSIncrByWithArgs(ctx context.Context, key string, timestamp float64, options *TSIncrDecrOptions) *IntCmd
TSDecrBy(ctx context.Context, Key string, timestamp float64) *IntCmd
TSDecrByWithArgs(ctx context.Context, key string, timestamp float64, options *TSIncrDecrOptions) *IntCmd
TSDel(ctx context.Context, Key string, fromTimestamp int, toTimestamp int) *IntCmd
TSDeleteRule(ctx context.Context, sourceKey string, destKey string) *StatusCmd
TSGet(ctx context.Context, key string) *TSTimestampValueCmd
TSGetWithArgs(ctx context.Context, key string, options *TSGetOptions) *TSTimestampValueCmd
TSInfo(ctx context.Context, key string) *MapStringInterfaceCmd
TSInfoWithArgs(ctx context.Context, key string, options *TSInfoOptions) *MapStringInterfaceCmd
TSMAdd(ctx context.Context, ktvSlices [][]interface{}) *IntSliceCmd
TSQueryIndex(ctx context.Context, filterExpr []string) *StringSliceCmd
TSRevRange(ctx context.Context, key string, fromTimestamp int, toTimestamp int) *TSTimestampValueSliceCmd
TSRevRangeWithArgs(ctx context.Context, key string, fromTimestamp int, toTimestamp int, options *TSRevRangeOptions) *TSTimestampValueSliceCmd
TSRange(ctx context.Context, key string, fromTimestamp int, toTimestamp int) *TSTimestampValueSliceCmd
TSRangeWithArgs(ctx context.Context, key string, fromTimestamp int, toTimestamp int, options *TSRangeOptions) *TSTimestampValueSliceCmd
TSMRange(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string) *MapStringSliceInterfaceCmd
TSMRangeWithArgs(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string, options *TSMRangeOptions) *MapStringSliceInterfaceCmd
TSMRevRange(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string) *MapStringSliceInterfaceCmd
TSMRevRangeWithArgs(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string, options *TSMRevRangeOptions) *MapStringSliceInterfaceCmd
TSMGet(ctx context.Context, filters []string) *MapStringSliceInterfaceCmd
TSMGetWithArgs(ctx context.Context, filters []string, options *TSMGetOptions) *MapStringSliceInterfaceCmd
}
type TSOptions struct {
Retention int
ChunkSize int
Encoding string
DuplicatePolicy string
Labels map[string]string
IgnoreMaxTimeDiff int64
IgnoreMaxValDiff float64
}
type TSIncrDecrOptions struct {
Timestamp int64
Retention int
ChunkSize int
Uncompressed bool
DuplicatePolicy string
Labels map[string]string
IgnoreMaxTimeDiff int64
IgnoreMaxValDiff float64
}
type TSAlterOptions struct {
Retention int
ChunkSize int
DuplicatePolicy string
Labels map[string]string
IgnoreMaxTimeDiff int64
IgnoreMaxValDiff float64
}
type TSCreateRuleOptions struct {
alignTimestamp int64
}
type TSGetOptions struct {
Latest bool
}
type TSInfoOptions struct {
Debug bool
}
type Aggregator int
const (
Invalid = Aggregator(iota)
Avg
Sum
Min
Max
Range
Count
First
Last
StdP
StdS
VarP
VarS
Twa
CountNaN
CountAll
)
func (a Aggregator) String() string {
switch a {
case Invalid:
return ""
case Avg:
return "AVG"
case Sum:
return "SUM"
case Min:
return "MIN"
case Max:
return "MAX"
case Range:
return "RANGE"
case Count:
return "COUNT"
case First:
return "FIRST"
case Last:
return "LAST"
case StdP:
return "STD.P"
case StdS:
return "STD.S"
case VarP:
return "VAR.P"
case VarS:
return "VAR.S"
case Twa:
return "TWA"
case CountNaN:
return "COUNTNAN"
case CountAll:
return "COUNTALL"
default:
return ""
}
}
type TSRangeOptions struct {
Latest bool
FilterByTS []int
FilterByValue []int
Count int
Align interface{}
Aggregator Aggregator
BucketDuration int
BucketTimestamp interface{}
Empty bool
}
type TSRevRangeOptions struct {
Latest bool
FilterByTS []int
FilterByValue []int
Count int
Align interface{}
Aggregator Aggregator
BucketDuration int
BucketTimestamp interface{}
Empty bool
}
type TSMRangeOptions struct {
Latest bool
FilterByTS []int
FilterByValue []int
WithLabels bool
SelectedLabels []interface{}
Count int
Align interface{}
Aggregator Aggregator
BucketDuration int
BucketTimestamp interface{}
Empty bool
GroupByLabel interface{}
Reducer interface{}
}
type TSMRevRangeOptions struct {
Latest bool
FilterByTS []int
FilterByValue []int
WithLabels bool
SelectedLabels []interface{}
Count int
Align interface{}
Aggregator Aggregator
BucketDuration int
BucketTimestamp interface{}
Empty bool
GroupByLabel interface{}
Reducer interface{}
}
type TSMGetOptions struct {
Latest bool
WithLabels bool
SelectedLabels []interface{}
}
// TSAdd - Adds one or more observations to a t-digest sketch.
// For more information - https://redis.io/commands/ts.add/
func (c cmdable) TSAdd(ctx context.Context, key string, timestamp interface{}, value float64) *IntCmd {
args := []interface{}{"TS.ADD", key, timestamp, value}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSAddWithArgs - Adds one or more observations to a t-digest sketch.
// This function also allows for specifying additional options such as:
// Retention, ChunkSize, Encoding, DuplicatePolicy and Labels.
// For more information - https://redis.io/commands/ts.add/
func (c cmdable) TSAddWithArgs(ctx context.Context, key string, timestamp interface{}, value float64, options *TSOptions) *IntCmd {
args := []interface{}{"TS.ADD", key, timestamp, value}
if options != nil {
if options.Retention != 0 {
args = append(args, "RETENTION", options.Retention)
}
if options.ChunkSize != 0 {
args = append(args, "CHUNK_SIZE", options.ChunkSize)
}
if options.Encoding != "" {
args = append(args, "ENCODING", options.Encoding)
}
if options.DuplicatePolicy != "" {
args = append(args, "DUPLICATE_POLICY", options.DuplicatePolicy)
}
if options.Labels != nil {
args = append(args, "LABELS")
for label, value := range options.Labels {
args = append(args, label, value)
}
}
if options.IgnoreMaxTimeDiff != 0 || options.IgnoreMaxValDiff != 0 {
args = append(args, "IGNORE", options.IgnoreMaxTimeDiff, options.IgnoreMaxValDiff)
}
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSCreate - Creates a new time-series key.
// For more information - https://redis.io/commands/ts.create/
func (c cmdable) TSCreate(ctx context.Context, key string) *StatusCmd {
args := []interface{}{"TS.CREATE", key}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSCreateWithArgs - Creates a new time-series key with additional options.
// This function allows for specifying additional options such as:
// Retention, ChunkSize, Encoding, DuplicatePolicy and Labels.
// For more information - https://redis.io/commands/ts.create/
func (c cmdable) TSCreateWithArgs(ctx context.Context, key string, options *TSOptions) *StatusCmd {
args := []interface{}{"TS.CREATE", key}
if options != nil {
if options.Retention != 0 {
args = append(args, "RETENTION", options.Retention)
}
if options.ChunkSize != 0 {
args = append(args, "CHUNK_SIZE", options.ChunkSize)
}
if options.Encoding != "" {
args = append(args, "ENCODING", options.Encoding)
}
if options.DuplicatePolicy != "" {
args = append(args, "DUPLICATE_POLICY", options.DuplicatePolicy)
}
if options.Labels != nil {
args = append(args, "LABELS")
for label, value := range options.Labels {
args = append(args, label, value)
}
}
if options.IgnoreMaxTimeDiff != 0 || options.IgnoreMaxValDiff != 0 {
args = append(args, "IGNORE", options.IgnoreMaxTimeDiff, options.IgnoreMaxValDiff)
}
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSAlter - Alters an existing time-series key with additional options.
// This function allows for specifying additional options such as:
// Retention, ChunkSize and DuplicatePolicy.
// For more information - https://redis.io/commands/ts.alter/
func (c cmdable) TSAlter(ctx context.Context, key string, options *TSAlterOptions) *StatusCmd {
args := []interface{}{"TS.ALTER", key}
if options != nil {
if options.Retention != 0 {
args = append(args, "RETENTION", options.Retention)
}
if options.ChunkSize != 0 {
args = append(args, "CHUNK_SIZE", options.ChunkSize)
}
if options.DuplicatePolicy != "" {
args = append(args, "DUPLICATE_POLICY", options.DuplicatePolicy)
}
if options.Labels != nil {
args = append(args, "LABELS")
for label, value := range options.Labels {
args = append(args, label, value)
}
}
if options.IgnoreMaxTimeDiff != 0 || options.IgnoreMaxValDiff != 0 {
args = append(args, "IGNORE", options.IgnoreMaxTimeDiff, options.IgnoreMaxValDiff)
}
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSCreateRule - Creates a compaction rule from sourceKey to destKey.
// For more information - https://redis.io/commands/ts.createrule/
func (c cmdable) TSCreateRule(ctx context.Context, sourceKey string, destKey string, aggregator Aggregator, bucketDuration int) *StatusCmd {
args := []interface{}{"TS.CREATERULE", sourceKey, destKey, "AGGREGATION", aggregator.String(), bucketDuration}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSCreateRuleWithArgs - Creates a compaction rule from sourceKey to destKey with additional option.
// This function allows for specifying additional option such as:
// alignTimestamp.
// For more information - https://redis.io/commands/ts.createrule/
func (c cmdable) TSCreateRuleWithArgs(ctx context.Context, sourceKey string, destKey string, aggregator Aggregator, bucketDuration int, options *TSCreateRuleOptions) *StatusCmd {
args := []interface{}{"TS.CREATERULE", sourceKey, destKey, "AGGREGATION", aggregator.String(), bucketDuration}
if options != nil {
if options.alignTimestamp != 0 {
args = append(args, options.alignTimestamp)
}
}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSIncrBy - Increments the value of a time-series key by the specified timestamp.
// For more information - https://redis.io/commands/ts.incrby/
func (c cmdable) TSIncrBy(ctx context.Context, Key string, timestamp float64) *IntCmd {
args := []interface{}{"TS.INCRBY", Key, timestamp}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSIncrByWithArgs - Increments the value of a time-series key by the specified timestamp with additional options.
// This function allows for specifying additional options such as:
// Timestamp, Retention, ChunkSize, Uncompressed and Labels.
// For more information - https://redis.io/commands/ts.incrby/
func (c cmdable) TSIncrByWithArgs(ctx context.Context, key string, timestamp float64, options *TSIncrDecrOptions) *IntCmd {
args := []interface{}{"TS.INCRBY", key, timestamp}
if options != nil {
if options.Timestamp != 0 {
args = append(args, "TIMESTAMP", options.Timestamp)
}
if options.Retention != 0 {
args = append(args, "RETENTION", options.Retention)
}
if options.ChunkSize != 0 {
args = append(args, "CHUNK_SIZE", options.ChunkSize)
}
if options.Uncompressed {
args = append(args, "UNCOMPRESSED")
}
if options.DuplicatePolicy != "" {
args = append(args, "DUPLICATE_POLICY", options.DuplicatePolicy)
}
if options.Labels != nil {
args = append(args, "LABELS")
for label, value := range options.Labels {
args = append(args, label, value)
}
}
if options.IgnoreMaxTimeDiff != 0 || options.IgnoreMaxValDiff != 0 {
args = append(args, "IGNORE", options.IgnoreMaxTimeDiff, options.IgnoreMaxValDiff)
}
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSDecrBy - Decrements the value of a time-series key by the specified timestamp.
// For more information - https://redis.io/commands/ts.decrby/
func (c cmdable) TSDecrBy(ctx context.Context, Key string, timestamp float64) *IntCmd {
args := []interface{}{"TS.DECRBY", Key, timestamp}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSDecrByWithArgs - Decrements the value of a time-series key by the specified timestamp with additional options.
// This function allows for specifying additional options such as:
// Timestamp, Retention, ChunkSize, Uncompressed and Labels.
// For more information - https://redis.io/commands/ts.decrby/
func (c cmdable) TSDecrByWithArgs(ctx context.Context, key string, timestamp float64, options *TSIncrDecrOptions) *IntCmd {
args := []interface{}{"TS.DECRBY", key, timestamp}
if options != nil {
if options.Timestamp != 0 {
args = append(args, "TIMESTAMP", options.Timestamp)
}
if options.Retention != 0 {
args = append(args, "RETENTION", options.Retention)
}
if options.ChunkSize != 0 {
args = append(args, "CHUNK_SIZE", options.ChunkSize)
}
if options.Uncompressed {
args = append(args, "UNCOMPRESSED")
}
if options.DuplicatePolicy != "" {
args = append(args, "DUPLICATE_POLICY", options.DuplicatePolicy)
}
if options.Labels != nil {
args = append(args, "LABELS")
for label, value := range options.Labels {
args = append(args, label, value)
}
}
if options.IgnoreMaxTimeDiff != 0 || options.IgnoreMaxValDiff != 0 {
args = append(args, "IGNORE", options.IgnoreMaxTimeDiff, options.IgnoreMaxValDiff)
}
}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSDel - Deletes a range of samples from a time-series key.
// For more information - https://redis.io/commands/ts.del/
func (c cmdable) TSDel(ctx context.Context, Key string, fromTimestamp int, toTimestamp int) *IntCmd {
args := []interface{}{"TS.DEL", Key, fromTimestamp, toTimestamp}
cmd := NewIntCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSDeleteRule - Deletes a compaction rule from sourceKey to destKey.
// For more information - https://redis.io/commands/ts.deleterule/
func (c cmdable) TSDeleteRule(ctx context.Context, sourceKey string, destKey string) *StatusCmd {
args := []interface{}{"TS.DELETERULE", sourceKey, destKey}
cmd := NewStatusCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSGetWithArgs - Gets the last sample of a time-series key with additional option.
// This function allows for specifying additional option such as:
// Latest.
// For more information - https://redis.io/commands/ts.get/
func (c cmdable) TSGetWithArgs(ctx context.Context, key string, options *TSGetOptions) *TSTimestampValueCmd {
args := []interface{}{"TS.GET", key}
if options != nil {
if options.Latest {
args = append(args, "LATEST")
}
}
cmd := newTSTimestampValueCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSGet - Gets the last sample of a time-series key.
// For more information - https://redis.io/commands/ts.get/
func (c cmdable) TSGet(ctx context.Context, key string) *TSTimestampValueCmd {
args := []interface{}{"TS.GET", key}
cmd := newTSTimestampValueCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type TSTimestampValue struct {
Timestamp int64
Value float64
}
type TSTimestampValueCmd struct {
baseCmd
val TSTimestampValue
}
func newTSTimestampValueCmd(ctx context.Context, args ...interface{}) *TSTimestampValueCmd {
return &TSTimestampValueCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeTSTimestampValue,
},
}
}
func (cmd *TSTimestampValueCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *TSTimestampValueCmd) SetVal(val TSTimestampValue) {
cmd.val = val
}
func (cmd *TSTimestampValueCmd) Result() (TSTimestampValue, error) {
return cmd.val, cmd.err
}
func (cmd *TSTimestampValueCmd) Val() TSTimestampValue {
return cmd.val
}
func (cmd *TSTimestampValueCmd) readReply(rd *proto.Reader) (err error) {
n, err := rd.ReadMapLen()
if err != nil {
return err
}
cmd.val = TSTimestampValue{}
for i := 0; i < n; i++ {
timestamp, err := rd.ReadInt()
if err != nil {
return err
}
value, err := rd.ReadString()
if err != nil {
return err
}
cmd.val.Timestamp = timestamp
cmd.val.Value, err = util.ParseStringToFloat(value)
if err != nil {
return err
}
}
return nil
}
func (cmd *TSTimestampValueCmd) Clone() Cmder {
return &TSTimestampValueCmd{
baseCmd: cmd.cloneBaseCmd(),
val: cmd.val, // TSTimestampValue is a simple struct, can be copied directly
}
}
// TSInfo - Returns information about a time-series key.
// For more information - https://redis.io/commands/ts.info/
func (c cmdable) TSInfo(ctx context.Context, key string) *MapStringInterfaceCmd {
args := []interface{}{"TS.INFO", key}
cmd := NewMapStringInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSInfoWithArgs - Returns information about a time-series key with additional option.
// This function allows for specifying additional option such as:
// Debug.
// For more information - https://redis.io/commands/ts.info/
func (c cmdable) TSInfoWithArgs(ctx context.Context, key string, options *TSInfoOptions) *MapStringInterfaceCmd {
args := []interface{}{"TS.INFO", key}
if options != nil {
if options.Debug {
args = append(args, "DEBUG")
}
}
cmd := NewMapStringInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSMAdd - Adds multiple samples to multiple time-series keys.
// It accepts a slice of 'ktv' slices, each containing exactly three elements: key, timestamp, and value.
// This struct must be provided for this command to work.
// For more information - https://redis.io/commands/ts.madd/
func (c cmdable) TSMAdd(ctx context.Context, ktvSlices [][]interface{}) *IntSliceCmd {
args := []interface{}{"TS.MADD"}
for _, ktv := range ktvSlices {
args = append(args, ktv...)
}
cmd := NewIntSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSQueryIndex - Returns all the keys matching the filter expression.
// For more information - https://redis.io/commands/ts.queryindex/
func (c cmdable) TSQueryIndex(ctx context.Context, filterExpr []string) *StringSliceCmd {
args := []interface{}{"TS.QUERYINDEX"}
for _, f := range filterExpr {
args = append(args, f)
}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSRevRange - Returns a range of samples from a time-series key in reverse order.
// For more information - https://redis.io/commands/ts.revrange/
func (c cmdable) TSRevRange(ctx context.Context, key string, fromTimestamp int, toTimestamp int) *TSTimestampValueSliceCmd {
args := []interface{}{"TS.REVRANGE", key, fromTimestamp, toTimestamp}
cmd := newTSTimestampValueSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSRevRangeWithArgs - Returns a range of samples from a time-series key in reverse order with additional options.
// This function allows for specifying additional options such as:
// Latest, FilterByTS, FilterByValue, Count, Align, Aggregator,
// BucketDuration, BucketTimestamp and Empty.
// For more information - https://redis.io/commands/ts.revrange/
func (c cmdable) TSRevRangeWithArgs(ctx context.Context, key string, fromTimestamp int, toTimestamp int, options *TSRevRangeOptions) *TSTimestampValueSliceCmd {
args := []interface{}{"TS.REVRANGE", key, fromTimestamp, toTimestamp}
if options != nil {
if options.Latest {
args = append(args, "LATEST")
}
if options.FilterByTS != nil {
args = append(args, "FILTER_BY_TS")
for _, f := range options.FilterByTS {
args = append(args, f)
}
}
if options.FilterByValue != nil {
args = append(args, "FILTER_BY_VALUE")
for _, f := range options.FilterByValue {
args = append(args, f)
}
}
if options.Count != 0 {
args = append(args, "COUNT", options.Count)
}
if options.Align != nil {
args = append(args, "ALIGN", options.Align)
}
if options.Aggregator != 0 {
args = append(args, "AGGREGATION", options.Aggregator.String())
}
if options.BucketDuration != 0 {
args = append(args, options.BucketDuration)
}
if options.BucketTimestamp != nil {
args = append(args, "BUCKETTIMESTAMP", options.BucketTimestamp)
}
if options.Empty {
args = append(args, "EMPTY")
}
}
cmd := newTSTimestampValueSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSRange - Returns a range of samples from a time-series key.
// For more information - https://redis.io/commands/ts.range/
func (c cmdable) TSRange(ctx context.Context, key string, fromTimestamp int, toTimestamp int) *TSTimestampValueSliceCmd {
args := []interface{}{"TS.RANGE", key, fromTimestamp, toTimestamp}
cmd := newTSTimestampValueSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSRangeWithArgs - Returns a range of samples from a time-series key with additional options.
// This function allows for specifying additional options such as:
// Latest, FilterByTS, FilterByValue, Count, Align, Aggregator,
// BucketDuration, BucketTimestamp and Empty.
// For more information - https://redis.io/commands/ts.range/
func (c cmdable) TSRangeWithArgs(ctx context.Context, key string, fromTimestamp int, toTimestamp int, options *TSRangeOptions) *TSTimestampValueSliceCmd {
args := []interface{}{"TS.RANGE", key, fromTimestamp, toTimestamp}
if options != nil {
if options.Latest {
args = append(args, "LATEST")
}
if options.FilterByTS != nil {
args = append(args, "FILTER_BY_TS")
for _, f := range options.FilterByTS {
args = append(args, f)
}
}
if options.FilterByValue != nil {
args = append(args, "FILTER_BY_VALUE")
for _, f := range options.FilterByValue {
args = append(args, f)
}
}
if options.Count != 0 {
args = append(args, "COUNT", options.Count)
}
if options.Align != nil {
args = append(args, "ALIGN", options.Align)
}
if options.Aggregator != 0 {
args = append(args, "AGGREGATION", options.Aggregator.String())
}
if options.BucketDuration != 0 {
args = append(args, options.BucketDuration)
}
if options.BucketTimestamp != nil {
args = append(args, "BUCKETTIMESTAMP", options.BucketTimestamp)
}
if options.Empty {
args = append(args, "EMPTY")
}
}
cmd := newTSTimestampValueSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
type TSTimestampValueSliceCmd struct {
baseCmd
val []TSTimestampValue
}
func newTSTimestampValueSliceCmd(ctx context.Context, args ...interface{}) *TSTimestampValueSliceCmd {
return &TSTimestampValueSliceCmd{
baseCmd: baseCmd{
ctx: ctx,
args: args,
cmdType: CmdTypeTSTimestampValueSlice,
},
}
}
func (cmd *TSTimestampValueSliceCmd) String() string {
return cmdString(cmd, cmd.val)
}
func (cmd *TSTimestampValueSliceCmd) SetVal(val []TSTimestampValue) {
cmd.val = val
}
func (cmd *TSTimestampValueSliceCmd) Result() ([]TSTimestampValue, error) {
return cmd.val, cmd.err
}
func (cmd *TSTimestampValueSliceCmd) Val() []TSTimestampValue {
return cmd.val
}
func (cmd *TSTimestampValueSliceCmd) readReply(rd *proto.Reader) (err error) {
n, err := rd.ReadArrayLen()
if err != nil {
return err
}
cmd.val = make([]TSTimestampValue, n)
for i := 0; i < n; i++ {
_, _ = rd.ReadArrayLen()
timestamp, err := rd.ReadInt()
if err != nil {
return err
}
value, err := rd.ReadString()
if err != nil {
return err
}
cmd.val[i].Timestamp = timestamp
cmd.val[i].Value, err = util.ParseStringToFloat(value)
if err != nil {
return err
}
}
return nil
}
func (cmd *TSTimestampValueSliceCmd) Clone() Cmder {
var val []TSTimestampValue
if cmd.val != nil {
val = make([]TSTimestampValue, len(cmd.val))
copy(val, cmd.val)
}
return &TSTimestampValueSliceCmd{
baseCmd: cmd.cloneBaseCmd(),
val: val,
}
}
// TSMRange - Returns a range of samples from multiple time-series keys.
// For more information - https://redis.io/commands/ts.mrange/
func (c cmdable) TSMRange(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string) *MapStringSliceInterfaceCmd {
args := []interface{}{"TS.MRANGE", fromTimestamp, toTimestamp, "FILTER"}
for _, f := range filterExpr {
args = append(args, f)
}
cmd := NewMapStringSliceInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSMRangeWithArgs - Returns a range of samples from multiple time-series keys with additional options.
// This function allows for specifying additional options such as:
// Latest, FilterByTS, FilterByValue, WithLabels, SelectedLabels,
// Count, Align, Aggregator, BucketDuration, BucketTimestamp,
// Empty, GroupByLabel and Reducer.
// For more information - https://redis.io/commands/ts.mrange/
func (c cmdable) TSMRangeWithArgs(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string, options *TSMRangeOptions) *MapStringSliceInterfaceCmd {
args := []interface{}{"TS.MRANGE", fromTimestamp, toTimestamp}
if options != nil {
if options.Latest {
args = append(args, "LATEST")
}
if options.FilterByTS != nil {
args = append(args, "FILTER_BY_TS")
for _, f := range options.FilterByTS {
args = append(args, f)
}
}
if options.FilterByValue != nil {
args = append(args, "FILTER_BY_VALUE")
for _, f := range options.FilterByValue {
args = append(args, f)
}
}
if options.WithLabels {
args = append(args, "WITHLABELS")
}
if options.SelectedLabels != nil {
args = append(args, "SELECTED_LABELS")
args = append(args, options.SelectedLabels...)
}
if options.Count != 0 {
args = append(args, "COUNT", options.Count)
}
if options.Align != nil {
args = append(args, "ALIGN", options.Align)
}
if options.Aggregator != 0 {
args = append(args, "AGGREGATION", options.Aggregator.String())
}
if options.BucketDuration != 0 {
args = append(args, options.BucketDuration)
}
if options.BucketTimestamp != nil {
args = append(args, "BUCKETTIMESTAMP", options.BucketTimestamp)
}
if options.Empty {
args = append(args, "EMPTY")
}
}
args = append(args, "FILTER")
for _, f := range filterExpr {
args = append(args, f)
}
if options != nil {
if options.GroupByLabel != nil {
args = append(args, "GROUPBY", options.GroupByLabel)
}
if options.Reducer != nil {
args = append(args, "REDUCE", options.Reducer)
}
}
cmd := NewMapStringSliceInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSMRevRange - Returns a range of samples from multiple time-series keys in reverse order.
// For more information - https://redis.io/commands/ts.mrevrange/
func (c cmdable) TSMRevRange(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string) *MapStringSliceInterfaceCmd {
args := []interface{}{"TS.MREVRANGE", fromTimestamp, toTimestamp, "FILTER"}
for _, f := range filterExpr {
args = append(args, f)
}
cmd := NewMapStringSliceInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSMRevRangeWithArgs - Returns a range of samples from multiple time-series keys in reverse order with additional options.
// This function allows for specifying additional options such as:
// Latest, FilterByTS, FilterByValue, WithLabels, SelectedLabels,
// Count, Align, Aggregator, BucketDuration, BucketTimestamp,
// Empty, GroupByLabel and Reducer.
// For more information - https://redis.io/commands/ts.mrevrange/
func (c cmdable) TSMRevRangeWithArgs(ctx context.Context, fromTimestamp int, toTimestamp int, filterExpr []string, options *TSMRevRangeOptions) *MapStringSliceInterfaceCmd {
args := []interface{}{"TS.MREVRANGE", fromTimestamp, toTimestamp}
if options != nil {
if options.Latest {
args = append(args, "LATEST")
}
if options.FilterByTS != nil {
args = append(args, "FILTER_BY_TS")
for _, f := range options.FilterByTS {
args = append(args, f)
}
}
if options.FilterByValue != nil {
args = append(args, "FILTER_BY_VALUE")
for _, f := range options.FilterByValue {
args = append(args, f)
}
}
if options.WithLabels {
args = append(args, "WITHLABELS")
}
if options.SelectedLabels != nil {
args = append(args, "SELECTED_LABELS")
args = append(args, options.SelectedLabels...)
}
if options.Count != 0 {
args = append(args, "COUNT", options.Count)
}
if options.Align != nil {
args = append(args, "ALIGN", options.Align)
}
if options.Aggregator != 0 {
args = append(args, "AGGREGATION", options.Aggregator.String())
}
if options.BucketDuration != 0 {
args = append(args, options.BucketDuration)
}
if options.BucketTimestamp != nil {
args = append(args, "BUCKETTIMESTAMP", options.BucketTimestamp)
}
if options.Empty {
args = append(args, "EMPTY")
}
}
args = append(args, "FILTER")
for _, f := range filterExpr {
args = append(args, f)
}
if options != nil {
if options.GroupByLabel != nil {
args = append(args, "GROUPBY", options.GroupByLabel)
}
if options.Reducer != nil {
args = append(args, "REDUCE", options.Reducer)
}
}
cmd := NewMapStringSliceInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSMGet - Returns the last sample of multiple time-series keys.
// For more information - https://redis.io/commands/ts.mget/
func (c cmdable) TSMGet(ctx context.Context, filters []string) *MapStringSliceInterfaceCmd {
args := []interface{}{"TS.MGET", "FILTER"}
for _, f := range filters {
args = append(args, f)
}
cmd := NewMapStringSliceInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// TSMGetWithArgs - Returns the last sample of multiple time-series keys with additional options.
// This function allows for specifying additional options such as:
// Latest, WithLabels and SelectedLabels.
// For more information - https://redis.io/commands/ts.mget/
func (c cmdable) TSMGetWithArgs(ctx context.Context, filters []string, options *TSMGetOptions) *MapStringSliceInterfaceCmd {
args := []interface{}{"TS.MGET"}
if options != nil {
if options.Latest {
args = append(args, "LATEST")
}
if options.WithLabels {
args = append(args, "WITHLABELS")
}
if options.SelectedLabels != nil {
args = append(args, "SELECTED_LABELS")
args = append(args, options.SelectedLabels...)
}
}
args = append(args, "FILTER")
for _, f := range filters {
args = append(args, f)
}
cmd := NewMapStringSliceInterfaceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
package redis
import (
"context"
"github.com/redis/go-redis/v9/internal/pool"
"github.com/redis/go-redis/v9/internal/proto"
)
// TxFailedErr transaction redis failed.
const TxFailedErr = proto.RedisError("redis: transaction failed")
// Tx implements Redis transactions as described in
// https://redis.io/docs/latest/develop/using-commands/transactions. It's NOT safe for concurrent use
// by multiple goroutines, because Exec resets list of watched keys.
//
// If you don't need WATCH, use Pipeline instead.
type Tx struct {
baseClient
cmdable
statefulCmdable
}
func (c *Client) newTx() *Tx {
tx := Tx{
baseClient: baseClient{
opt: c.opt.clone(), // Clone options to avoid sharing mutable state between transaction and parent client
connPool: pool.NewStickyConnPool(c.connPool),
hooksMixin: c.hooksMixin.clone(),
pushProcessor: c.pushProcessor, // Copy push processor from parent client
},
}
tx.init()
return &tx
}
func (c *Tx) init() {
c.cmdable = c.Process
c.statefulCmdable = c.Process
c.initHooks(hooks{
dial: c.baseClient.dial,
process: c.baseClient.process,
pipeline: c.baseClient.processPipeline,
txPipeline: c.baseClient.processTxPipeline,
})
}
func (c *Tx) Process(ctx context.Context, cmd Cmder) error {
err := c.processHook(ctx, cmd)
cmd.SetErr(err)
return err
}
// Watch prepares a transaction and marks the keys to be watched
// for conditional execution if there are any keys.
//
// The transaction is automatically closed when fn exits.
func (c *Client) Watch(ctx context.Context, fn func(*Tx) error, keys ...string) error {
tx := c.newTx()
defer tx.Close(ctx)
if len(keys) > 0 {
if err := tx.Watch(ctx, keys...).Err(); err != nil {
return err
}
}
return fn(tx)
}
// Close closes the transaction, releasing any open resources.
func (c *Tx) Close(ctx context.Context) error {
_ = c.Unwatch(ctx).Err()
return c.baseClient.Close()
}
// Watch marks the keys to be watched for conditional execution
// of a transaction.
func (c *Tx) Watch(ctx context.Context, keys ...string) *StatusCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "watch"
for i, key := range keys {
args[1+i] = key
}
cmd := NewStatusCmd(ctx, args...)
_ = c.Process(ctx, cmd)
return cmd
}
// Unwatch flushes all the previously watched keys for a transaction.
func (c *Tx) Unwatch(ctx context.Context, keys ...string) *StatusCmd {
args := make([]interface{}, 1+len(keys))
args[0] = "unwatch"
for i, key := range keys {
args[1+i] = key
}
cmd := NewStatusCmd(ctx, args...)
_ = c.Process(ctx, cmd)
return cmd
}
// Pipeline creates a pipeline. Usually it is more convenient to use Pipelined.
func (c *Tx) Pipeline() Pipeliner {
pipe := Pipeline{
exec: func(ctx context.Context, cmds []Cmder) error {
return c.processPipelineHook(ctx, cmds)
},
}
pipe.init()
return &pipe
}
// Pipelined executes commands queued in the fn outside of the transaction.
// Use TxPipelined if you need transactional behavior.
func (c *Tx) Pipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.Pipeline().Pipelined(ctx, fn)
}
// TxPipelined executes commands queued in the fn in the transaction.
//
// When using WATCH, EXEC will execute commands only if the watched keys
// were not modified, allowing for a check-and-set mechanism.
//
// Exec always returns list of commands. If transaction fails
// TxFailedErr is returned. Otherwise Exec returns an error of the first
// failed command or nil.
func (c *Tx) TxPipelined(ctx context.Context, fn func(Pipeliner) error) ([]Cmder, error) {
return c.TxPipeline().Pipelined(ctx, fn)
}
// TxPipeline creates a pipeline. Usually it is more convenient to use TxPipelined.
func (c *Tx) TxPipeline() Pipeliner {
pipe := Pipeline{
exec: func(ctx context.Context, cmds []Cmder) error {
cmds = wrapMultiExec(ctx, cmds)
return c.processTxPipelineHook(ctx, cmds)
},
}
pipe.init()
return &pipe
}
func wrapMultiExec(ctx context.Context, cmds []Cmder) []Cmder {
if len(cmds) == 0 {
panic("not reached")
}
cmdsCopy := make([]Cmder, len(cmds)+2)
cmdsCopy[0] = NewStatusCmd(ctx, "multi")
copy(cmdsCopy[1:], cmds)
cmdsCopy[len(cmdsCopy)-1] = NewSliceCmd(ctx, "exec")
return cmdsCopy
}
package redis
import (
"context"
"crypto/tls"
"net"
"time"
"github.com/redis/go-redis/v9/auth"
"github.com/redis/go-redis/v9/maintnotifications"
"github.com/redis/go-redis/v9/push"
)
// UniversalOptions information is required by UniversalClient to establish
// connections.
type UniversalOptions struct {
// Either a single address or a seed list of host:port addresses
// of cluster/sentinel nodes.
Addrs []string
// ClientName will execute the `CLIENT SETNAME ClientName` command for each conn.
ClientName string
// Database to be selected after connecting to the server.
// Only single-node and failover clients.
DB int
// Common options.
Dialer func(ctx context.Context, network, addr string) (net.Conn, error)
OnConnect func(ctx context.Context, cn *Conn) error
Protocol int
Username string
Password string
// CredentialsProvider allows the username and password to be updated
// before reconnecting. It should return the current username and password.
CredentialsProvider func() (username string, password string)
// CredentialsProviderContext is an enhanced parameter of CredentialsProvider,
// done to maintain API compatibility. In the future,
// there might be a merge between CredentialsProviderContext and CredentialsProvider.
// There will be a conflict between them; if CredentialsProviderContext exists, we will ignore CredentialsProvider.
CredentialsProviderContext func(ctx context.Context) (username string, password string, err error)
// StreamingCredentialsProvider is used to retrieve the credentials
// for the connection from an external source. Those credentials may change
// during the connection lifetime. This is useful for managed identity
// scenarios where the credentials are retrieved from an external source.
//
// Currently, this is a placeholder for the future implementation.
StreamingCredentialsProvider auth.StreamingCredentialsProvider
SentinelUsername string
SentinelPassword string
MaxRetries int
MinRetryBackoff time.Duration
MaxRetryBackoff time.Duration
DialTimeout time.Duration
// DialerRetries is the maximum number of retry attempts when dialing fails.
//
// default: 5
DialerRetries int
// DialerRetryTimeout is the backoff duration between retry attempts.
//
// default: 100 milliseconds
DialerRetryTimeout time.Duration
ReadTimeout time.Duration
WriteTimeout time.Duration
ContextTimeoutEnabled bool
// ReadBufferSize is the size of the bufio.Reader buffer for each connection.
// Larger buffers can improve performance for commands that return large responses.
// Smaller buffers can improve memory usage for larger pools.
//
// default: 32KiB (32768 bytes)
ReadBufferSize int
// WriteBufferSize is the size of the bufio.Writer buffer for each connection.
// Larger buffers can improve performance for large pipelines and commands with many arguments.
// Smaller buffers can improve memory usage for larger pools.
//
// default: 32KiB (32768 bytes)
WriteBufferSize int
// PoolFIFO uses FIFO mode for each node connection pool GET/PUT (default LIFO).
PoolFIFO bool
PoolSize int
// MaxConcurrentDials is the maximum number of concurrent connection creation goroutines.
// If <= 0, defaults to PoolSize. If > PoolSize, it will be capped at PoolSize.
MaxConcurrentDials int
PoolTimeout time.Duration
MinIdleConns int
MaxIdleConns int
MaxActiveConns int
ConnMaxIdleTime time.Duration
ConnMaxLifetime time.Duration
ConnMaxLifetimeJitter time.Duration
TLSConfig *tls.Config
// Only cluster clients.
MaxRedirects int
ReadOnly bool
RouteByLatency bool
RouteRandomly bool
// MasterName is the sentinel master name.
// Only for failover clients.
MasterName string
// DisableIndentity - Disable set-lib on connect.
//
// default: false
//
// Deprecated: Use DisableIdentity instead.
DisableIndentity bool
// DisableIdentity is used to disable CLIENT SETINFO command on connect.
//
// default: false
DisableIdentity bool
IdentitySuffix string
// FailingTimeoutSeconds is the timeout in seconds for marking a cluster node as failing.
// When a node is marked as failing, it will be avoided for this duration.
// Only applies to cluster clients. Default is 15 seconds.
FailingTimeoutSeconds int
UnstableResp3 bool
// PushNotificationProcessor is the processor for handling push notifications.
// If nil, a default processor will be created for RESP3 connections.
PushNotificationProcessor push.NotificationProcessor
// IsClusterMode can be used when only one Addrs is provided (e.g. Elasticache supports setting up cluster mode with configuration endpoint).
IsClusterMode bool
// MaintNotificationsConfig provides configuration for maintnotifications upgrades.
MaintNotificationsConfig *maintnotifications.Config
}
// Cluster returns cluster options created from the universal options.
func (o *UniversalOptions) Cluster() *ClusterOptions {
if len(o.Addrs) == 0 {
o.Addrs = []string{"127.0.0.1:6379"}
}
return &ClusterOptions{
Addrs: o.Addrs,
ClientName: o.ClientName,
Dialer: o.Dialer,
OnConnect: o.OnConnect,
Protocol: o.Protocol,
Username: o.Username,
Password: o.Password,
CredentialsProvider: o.CredentialsProvider,
CredentialsProviderContext: o.CredentialsProviderContext,
StreamingCredentialsProvider: o.StreamingCredentialsProvider,
MaxRedirects: o.MaxRedirects,
ReadOnly: o.ReadOnly,
RouteByLatency: o.RouteByLatency,
RouteRandomly: o.RouteRandomly,
MaxRetries: o.MaxRetries,
MinRetryBackoff: o.MinRetryBackoff,
MaxRetryBackoff: o.MaxRetryBackoff,
DialTimeout: o.DialTimeout,
DialerRetries: o.DialerRetries,
DialerRetryTimeout: o.DialerRetryTimeout,
ReadTimeout: o.ReadTimeout,
WriteTimeout: o.WriteTimeout,
ContextTimeoutEnabled: o.ContextTimeoutEnabled,
ReadBufferSize: o.ReadBufferSize,
WriteBufferSize: o.WriteBufferSize,
PoolFIFO: o.PoolFIFO,
PoolSize: o.PoolSize,
MaxConcurrentDials: o.MaxConcurrentDials,
PoolTimeout: o.PoolTimeout,
MinIdleConns: o.MinIdleConns,
MaxIdleConns: o.MaxIdleConns,
MaxActiveConns: o.MaxActiveConns,
ConnMaxIdleTime: o.ConnMaxIdleTime,
ConnMaxLifetime: o.ConnMaxLifetime,
ConnMaxLifetimeJitter: o.ConnMaxLifetimeJitter,
TLSConfig: o.TLSConfig,
DisableIdentity: o.DisableIdentity,
DisableIndentity: o.DisableIndentity,
IdentitySuffix: o.IdentitySuffix,
FailingTimeoutSeconds: o.FailingTimeoutSeconds,
UnstableResp3: o.UnstableResp3,
PushNotificationProcessor: o.PushNotificationProcessor,
MaintNotificationsConfig: o.MaintNotificationsConfig,
}
}
// Failover returns failover options created from the universal options.
func (o *UniversalOptions) Failover() *FailoverOptions {
if len(o.Addrs) == 0 {
o.Addrs = []string{"127.0.0.1:26379"}
}
return &FailoverOptions{
SentinelAddrs: o.Addrs,
MasterName: o.MasterName,
ClientName: o.ClientName,
Dialer: o.Dialer,
OnConnect: o.OnConnect,
DB: o.DB,
Protocol: o.Protocol,
Username: o.Username,
Password: o.Password,
CredentialsProvider: o.CredentialsProvider,
CredentialsProviderContext: o.CredentialsProviderContext,
StreamingCredentialsProvider: o.StreamingCredentialsProvider,
SentinelUsername: o.SentinelUsername,
SentinelPassword: o.SentinelPassword,
RouteByLatency: o.RouteByLatency,
RouteRandomly: o.RouteRandomly,
MaxRetries: o.MaxRetries,
MinRetryBackoff: o.MinRetryBackoff,
MaxRetryBackoff: o.MaxRetryBackoff,
DialTimeout: o.DialTimeout,
DialerRetries: o.DialerRetries,
DialerRetryTimeout: o.DialerRetryTimeout,
ReadTimeout: o.ReadTimeout,
WriteTimeout: o.WriteTimeout,
ContextTimeoutEnabled: o.ContextTimeoutEnabled,
ReadBufferSize: o.ReadBufferSize,
WriteBufferSize: o.WriteBufferSize,
PoolFIFO: o.PoolFIFO,
PoolSize: o.PoolSize,
MaxConcurrentDials: o.MaxConcurrentDials,
PoolTimeout: o.PoolTimeout,
MinIdleConns: o.MinIdleConns,
MaxIdleConns: o.MaxIdleConns,
MaxActiveConns: o.MaxActiveConns,
ConnMaxIdleTime: o.ConnMaxIdleTime,
ConnMaxLifetime: o.ConnMaxLifetime,
ConnMaxLifetimeJitter: o.ConnMaxLifetimeJitter,
TLSConfig: o.TLSConfig,
ReplicaOnly: o.ReadOnly,
DisableIdentity: o.DisableIdentity,
DisableIndentity: o.DisableIndentity,
IdentitySuffix: o.IdentitySuffix,
UnstableResp3: o.UnstableResp3,
PushNotificationProcessor: o.PushNotificationProcessor,
// Note: MaintNotificationsConfig not supported for FailoverOptions
}
}
// Simple returns basic options created from the universal options.
func (o *UniversalOptions) Simple() *Options {
addr := "127.0.0.1:6379"
if len(o.Addrs) > 0 {
addr = o.Addrs[0]
}
return &Options{
Addr: addr,
ClientName: o.ClientName,
Dialer: o.Dialer,
OnConnect: o.OnConnect,
DB: o.DB,
Protocol: o.Protocol,
Username: o.Username,
Password: o.Password,
CredentialsProvider: o.CredentialsProvider,
CredentialsProviderContext: o.CredentialsProviderContext,
StreamingCredentialsProvider: o.StreamingCredentialsProvider,
MaxRetries: o.MaxRetries,
MinRetryBackoff: o.MinRetryBackoff,
MaxRetryBackoff: o.MaxRetryBackoff,
DialTimeout: o.DialTimeout,
DialerRetries: o.DialerRetries,
DialerRetryTimeout: o.DialerRetryTimeout,
ReadTimeout: o.ReadTimeout,
WriteTimeout: o.WriteTimeout,
ContextTimeoutEnabled: o.ContextTimeoutEnabled,
ReadBufferSize: o.ReadBufferSize,
WriteBufferSize: o.WriteBufferSize,
PoolFIFO: o.PoolFIFO,
PoolSize: o.PoolSize,
MaxConcurrentDials: o.MaxConcurrentDials,
PoolTimeout: o.PoolTimeout,
MinIdleConns: o.MinIdleConns,
MaxIdleConns: o.MaxIdleConns,
MaxActiveConns: o.MaxActiveConns,
ConnMaxIdleTime: o.ConnMaxIdleTime,
ConnMaxLifetime: o.ConnMaxLifetime,
ConnMaxLifetimeJitter: o.ConnMaxLifetimeJitter,
TLSConfig: o.TLSConfig,
DisableIdentity: o.DisableIdentity,
DisableIndentity: o.DisableIndentity,
IdentitySuffix: o.IdentitySuffix,
UnstableResp3: o.UnstableResp3,
PushNotificationProcessor: o.PushNotificationProcessor,
MaintNotificationsConfig: o.MaintNotificationsConfig,
}
}
// --------------------------------------------------------------------
// UniversalClient is an abstract client which - based on the provided options -
// represents either a ClusterClient, a FailoverClient, or a single-node Client.
// This can be useful for testing cluster-specific applications locally or having different
// clients in different environments.
type UniversalClient interface {
Cmdable
AddHook(Hook)
Watch(ctx context.Context, fn func(*Tx) error, keys ...string) error
Do(ctx context.Context, args ...interface{}) *Cmd
Process(ctx context.Context, cmd Cmder) error
Subscribe(ctx context.Context, channels ...string) *PubSub
PSubscribe(ctx context.Context, channels ...string) *PubSub
SSubscribe(ctx context.Context, channels ...string) *PubSub
Close() error
PoolStats() *PoolStats
}
var (
_ UniversalClient = (*Client)(nil)
_ UniversalClient = (*ClusterClient)(nil)
_ UniversalClient = (*Ring)(nil)
)
// NewUniversalClient returns a new multi client. The type of the returned client depends
// on the following conditions:
//
// 1. If the MasterName option is specified with RouteByLatency, RouteRandomly or IsClusterMode,
// a FailoverClusterClient is returned.
// 2. If the MasterName option is specified without RouteByLatency, RouteRandomly or IsClusterMode,
// a sentinel-backed FailoverClient is returned.
// 3. If the number of Addrs is two or more, or IsClusterMode option is specified,
// a ClusterClient is returned.
// 4. Otherwise, a single-node Client is returned.
func NewUniversalClient(opts *UniversalOptions) UniversalClient {
if opts == nil {
panic("redis: NewUniversalClient nil options")
}
switch {
case opts.MasterName != "" && (opts.RouteByLatency || opts.RouteRandomly || opts.IsClusterMode):
return NewFailoverClusterClient(opts.Failover())
case opts.MasterName != "":
return NewFailoverClient(opts.Failover())
case len(opts.Addrs) > 1 || opts.IsClusterMode:
return NewClusterClient(opts.Cluster())
default:
return NewClient(opts.Simple())
}
}
package redis
import (
"context"
"encoding/json"
"strconv"
)
// note: the APIs is experimental and may be subject to change.
type VectorSetCmdable interface {
VAdd(ctx context.Context, key, element string, val Vector) *BoolCmd
VAddWithArgs(ctx context.Context, key, element string, val Vector, addArgs *VAddArgs) *BoolCmd
VCard(ctx context.Context, key string) *IntCmd
VDim(ctx context.Context, key string) *IntCmd
VEmb(ctx context.Context, key, element string, raw bool) *SliceCmd
VGetAttr(ctx context.Context, key, element string) *StringCmd
VInfo(ctx context.Context, key string) *MapStringInterfaceCmd
VLinks(ctx context.Context, key, element string) *StringSliceCmd
VLinksWithScores(ctx context.Context, key, element string) *VectorScoreSliceCmd
VRandMember(ctx context.Context, key string) *StringCmd
VRandMemberCount(ctx context.Context, key string, count int) *StringSliceCmd
VRem(ctx context.Context, key, element string) *BoolCmd
VSetAttr(ctx context.Context, key, element string, attr interface{}) *BoolCmd
VClearAttributes(ctx context.Context, key, element string) *BoolCmd
VSim(ctx context.Context, key string, val Vector) *StringSliceCmd
VSimWithScores(ctx context.Context, key string, val Vector) *VectorScoreSliceCmd
VSimWithArgs(ctx context.Context, key string, val Vector, args *VSimArgs) *StringSliceCmd
VSimWithArgsWithScores(ctx context.Context, key string, val Vector, args *VSimArgs) *VectorScoreSliceCmd
VRange(ctx context.Context, key, start, end string, count int64) *StringSliceCmd
}
type Vector interface {
Value() []any
}
const (
vectorFormatFP32 string = "FP32"
vectorFormatValues string = "Values"
)
type VectorFP32 struct {
Val []byte
}
func (v *VectorFP32) Value() []any {
return []any{vectorFormatFP32, v.Val}
}
var _ Vector = (*VectorFP32)(nil)
type VectorValues struct {
Val []float64
}
func (v *VectorValues) Value() []any {
res := make([]any, 2+len(v.Val))
res[0] = vectorFormatValues
res[1] = len(v.Val)
for i, v := range v.Val {
res[2+i] = v
}
return res
}
var _ Vector = (*VectorValues)(nil)
type VectorRef struct {
Name string // the name of the referent vector
}
func (v *VectorRef) Value() []any {
return []any{"ele", v.Name}
}
var _ Vector = (*VectorRef)(nil)
type VectorScore struct {
Name string
Score float64
}
// `VADD key (FP32 | VALUES num) vector element`
// note: the API is experimental and may be subject to change.
func (c cmdable) VAdd(ctx context.Context, key, element string, val Vector) *BoolCmd {
return c.VAddWithArgs(ctx, key, element, val, &VAddArgs{})
}
type VAddArgs struct {
// the REDUCE option must be passed immediately after the key
Reduce int64
Cas bool
// The NoQuant, Q8 and Bin options are mutually exclusive.
NoQuant bool
Q8 bool
Bin bool
EF int64
SetAttr string
M int64
}
func (v VAddArgs) reduce() int64 {
return v.Reduce
}
func (v VAddArgs) appendArgs(args []any) []any {
if v.Cas {
args = append(args, "cas")
}
if v.NoQuant {
args = append(args, "noquant")
} else if v.Q8 {
args = append(args, "q8")
} else if v.Bin {
args = append(args, "bin")
}
if v.EF > 0 {
args = append(args, "ef", strconv.FormatInt(v.EF, 10))
}
if len(v.SetAttr) > 0 {
args = append(args, "setattr", v.SetAttr)
}
if v.M > 0 {
args = append(args, "m", strconv.FormatInt(v.M, 10))
}
return args
}
// `VADD key [REDUCE dim] (FP32 | VALUES num) vector element [CAS] [NOQUANT | Q8 | BIN] [EF build-exploration-factor] [SETATTR attributes] [M numlinks]`
// note: the API is experimental and may be subject to change.
func (c cmdable) VAddWithArgs(ctx context.Context, key, element string, val Vector, addArgs *VAddArgs) *BoolCmd {
if addArgs == nil {
addArgs = &VAddArgs{}
}
args := []any{"vadd", key}
if addArgs.reduce() > 0 {
args = append(args, "reduce", addArgs.reduce())
}
args = append(args, val.Value()...)
args = append(args, element)
args = addArgs.appendArgs(args)
cmd := NewBoolCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// `VCARD key`
// note: the API is experimental and may be subject to change.
func (c cmdable) VCard(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "vcard", key)
_ = c(ctx, cmd)
return cmd
}
// `VDIM key`
// note: the API is experimental and may be subject to change.
func (c cmdable) VDim(ctx context.Context, key string) *IntCmd {
cmd := NewIntCmd(ctx, "vdim", key)
_ = c(ctx, cmd)
return cmd
}
// `VEMB key element [RAW]`
// note: the API is experimental and may be subject to change.
func (c cmdable) VEmb(ctx context.Context, key, element string, raw bool) *SliceCmd {
args := []any{"vemb", key, element}
if raw {
args = append(args, "raw")
}
cmd := NewSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// `VGETATTR key element`
// note: the API is experimental and may be subject to change.
func (c cmdable) VGetAttr(ctx context.Context, key, element string) *StringCmd {
cmd := NewStringCmd(ctx, "vgetattr", key, element)
_ = c(ctx, cmd)
return cmd
}
// `VINFO key`
// note: the API is experimental and may be subject to change.
func (c cmdable) VInfo(ctx context.Context, key string) *MapStringInterfaceCmd {
cmd := NewMapStringInterfaceCmd(ctx, "vinfo", key)
_ = c(ctx, cmd)
return cmd
}
// `VLINKS key element`
// note: the API is experimental and may be subject to change.
func (c cmdable) VLinks(ctx context.Context, key, element string) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "vlinks", key, element)
_ = c(ctx, cmd)
return cmd
}
// `VLINKS key element WITHSCORES`
// note: the API is experimental and may be subject to change.
func (c cmdable) VLinksWithScores(ctx context.Context, key, element string) *VectorScoreSliceCmd {
cmd := NewVectorInfoSliceCmd(ctx, "vlinks", key, element, "withscores")
_ = c(ctx, cmd)
return cmd
}
// `VRANDMEMBER key`
// note: the API is experimental and may be subject to change.
func (c cmdable) VRandMember(ctx context.Context, key string) *StringCmd {
cmd := NewStringCmd(ctx, "vrandmember", key)
_ = c(ctx, cmd)
return cmd
}
// `VRANDMEMBER key [count]`
// note: the API is experimental and may be subject to change.
func (c cmdable) VRandMemberCount(ctx context.Context, key string, count int) *StringSliceCmd {
cmd := NewStringSliceCmd(ctx, "vrandmember", key, count)
_ = c(ctx, cmd)
return cmd
}
// `VREM key element`
// note: the API is experimental and may be subject to change.
func (c cmdable) VRem(ctx context.Context, key, element string) *BoolCmd {
cmd := NewBoolCmd(ctx, "vrem", key, element)
_ = c(ctx, cmd)
return cmd
}
// `VSETATTR key element "{ JSON obj }"`
// The `attr` must be something that can be marshaled to JSON (using encoding/JSON) unless
// the argument is a string or []byte when we assume that it can be passed directly as JSON.
//
// note: the API is experimental and may be subject to change.
func (c cmdable) VSetAttr(ctx context.Context, key, element string, attr interface{}) *BoolCmd {
var attrStr string
var err error
switch v := attr.(type) {
case string:
attrStr = v
case []byte:
attrStr = string(v)
default:
var bytes []byte
bytes, err = json.Marshal(v)
if err != nil {
// If marshalling fails, create the command and set the error; this command won't be executed.
cmd := NewBoolCmd(ctx, "vsetattr", key, element, "")
cmd.SetErr(err)
return cmd
}
attrStr = string(bytes)
}
cmd := NewBoolCmd(ctx, "vsetattr", key, element, attrStr)
_ = c(ctx, cmd)
return cmd
}
// `VClearAttributes` clear attributes on a vector set element.
// The implementation of `VClearAttributes` is execute command `VSETATTR key element ""`.
// note: the API is experimental and may be subject to change.
func (c cmdable) VClearAttributes(ctx context.Context, key, element string) *BoolCmd {
cmd := NewBoolCmd(ctx, "vsetattr", key, element, "")
_ = c(ctx, cmd)
return cmd
}
// `VSIM key (ELE | FP32 | VALUES num) (vector | element)`
// note: the API is experimental and may be subject to change.
func (c cmdable) VSim(ctx context.Context, key string, val Vector) *StringSliceCmd {
return c.VSimWithArgs(ctx, key, val, &VSimArgs{})
}
// `VSIM key (ELE | FP32 | VALUES num) (vector | element) WITHSCORES`
// note: the API is experimental and may be subject to change.
func (c cmdable) VSimWithScores(ctx context.Context, key string, val Vector) *VectorScoreSliceCmd {
return c.VSimWithArgsWithScores(ctx, key, val, &VSimArgs{})
}
type VSimArgs struct {
Count int64
EF int64
Filter string
FilterEF int64
Truth bool
NoThread bool
Epsilon float64
}
func (v VSimArgs) appendArgs(args []any) []any {
if v.Count > 0 {
args = append(args, "count", v.Count)
}
if v.EF > 0 {
args = append(args, "ef", v.EF)
}
if len(v.Filter) > 0 {
args = append(args, "filter", v.Filter)
}
if v.FilterEF > 0 {
args = append(args, "filter-ef", v.FilterEF)
}
if v.Truth {
args = append(args, "truth")
}
if v.NoThread {
args = append(args, "nothread")
}
if v.Epsilon > 0 {
args = append(args, "Epsilon", v.Epsilon)
}
return args
}
// `VSIM key (ELE | FP32 | VALUES num) (vector | element) [COUNT num] [EPSILON delta]
// [EF search-exploration-factor] [FILTER expression] [FILTER-EF max-filtering-effort] [TRUTH] [NOTHREAD]`
// note: the API is experimental and may be subject to change.
func (c cmdable) VSimWithArgs(ctx context.Context, key string, val Vector, simArgs *VSimArgs) *StringSliceCmd {
if simArgs == nil {
simArgs = &VSimArgs{}
}
args := []any{"vsim", key}
args = append(args, val.Value()...)
args = simArgs.appendArgs(args)
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// `VSIM key (ELE | FP32 | VALUES num) (vector | element) [WITHSCORES] [COUNT num] [EPSILON delta]
// [EF search-exploration-factor] [FILTER expression] [FILTER-EF max-filtering-effort] [TRUTH] [NOTHREAD]`
// note: the API is experimental and may be subject to change.
func (c cmdable) VSimWithArgsWithScores(ctx context.Context, key string, val Vector, simArgs *VSimArgs) *VectorScoreSliceCmd {
if simArgs == nil {
simArgs = &VSimArgs{}
}
args := []any{"vsim", key}
args = append(args, val.Value()...)
args = append(args, "withscores")
args = simArgs.appendArgs(args)
cmd := NewVectorInfoSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
// `VRANGE key start end count`
// a negative count means to return all the elements in the vector set.
// note: the API is experimental and may be subject to change.
func (c cmdable) VRange(ctx context.Context, key, start, end string, count int64) *StringSliceCmd {
args := []any{"vrange", key, start, end, count}
cmd := NewStringSliceCmd(ctx, args...)
_ = c(ctx, cmd)
return cmd
}
package redis
// Version is the current release version.
func Version() string {
return "9.18.0"
}