fuzz_early_setup: 23| 2|void fuzz_early_setup(void) { 24| | /* Set stderr to point to normal stderr by default */ 25| 2| fuzz.fake_stderr = stderr; 26| 2|} fuzz_common_setup: 28| 1|void fuzz_common_setup(void) { 29| 1| disallow_core(); 30| 1| fuzz.fuzzing = 1; 31| 1| fuzz.wrapfds = 1; 32| 1| fuzz.do_jmp = 1; 33| 1| fuzz.input = m_malloc(sizeof(buffer)); 34| 1| _dropbear_log = fuzz_dropbear_log; 35| 1| crypto_init(); 36| 1| fuzz_seed("start", 5); 37| | /* let any messages get flushed */ 38| 1| setlinebuf(stdout); 39| |#if DEBUG_TRACE 40| | if (debug_trace) 41| | { 42| | fprintf(stderr, "Dropbear fuzzer: -v specified, not disabling stderr output\n"); 43| | } 44| | else 45| |#endif 46| 1| if (getenv("DROPBEAR_KEEP_STDERR")) { ------------------ | Branch (46:9): [True: 0, False: 1] ------------------ 47| 0| fprintf(stderr, "Dropbear fuzzer: DROPBEAR_KEEP_STDERR, not disabling stderr output\n"); 48| 0| } 49| 1| else 50| 1| { 51| 1| fprintf(stderr, "Dropbear fuzzer: Disabling stderr output\n"); 52| 1| fuzz.fake_stderr = fopen("/dev/null", "w"); 53| 1| assert(fuzz.fake_stderr); 54| 1| } 55| 1|} fuzz_set_input: 57| 1.49k|int fuzz_set_input(const uint8_t *Data, size_t Size) { 58| | 59| 1.49k| fuzz.input->data = (unsigned char*)Data; 60| 1.49k| fuzz.input->size = Size; 61| 1.49k| fuzz.input->len = Size; 62| 1.49k| fuzz.input->pos = 0; 63| | 64| 1.49k| memset(&ses, 0x0, sizeof(ses)); 65| 1.49k| memset(&svr_ses, 0x0, sizeof(svr_ses)); 66| 1.49k| memset(&cli_ses, 0x0, sizeof(cli_ses)); 67| 1.49k| wrapfd_setup(fuzz.input); 68| | // printhex("input", fuzz.input->data, fuzz.input->len); 69| | 70| 1.49k| fuzz_seed(fuzz.input->data, MIN(fuzz.input->len, 16)); 71| | 72| 1.49k| return DROPBEAR_SUCCESS; ------------------ | | 102| 1.49k|#define DROPBEAR_SUCCESS 0 ------------------ 73| 1.49k|} fuzz_svr_setup: 89| 1|void fuzz_svr_setup(void) { 90| 1| fuzz_common_setup(); 91| | 92| 1| _dropbear_exit = svr_dropbear_exit; 93| | 94| 1| char *argv[] = { 95| 1| "dropbear", 96| 1| "-E", 97| 1| }; 98| | 99| 1| int argc = sizeof(argv) / sizeof(*argv); 100| 1| svr_getopts(argc, argv); 101| | 102| 1| load_fixed_hostkeys(); 103| 1|} fuzz_svr_hook_preloop: 105| 1.49k|void fuzz_svr_hook_preloop() { 106| 1.49k| if (fuzz.svr_postauth) { ------------------ | Branch (106:9): [True: 1.49k, False: 0] ------------------ 107| 1.49k| ses.authstate.authdone = 1; 108| 1.49k| fill_passwd("root"); 109| 1.49k| } 110| 1.49k|} fuzz_kex_fakealgos: 197| 9.44k|void fuzz_kex_fakealgos(void) { 198| 9.44k| ses.newkeys->recv.crypt_mode = &dropbear_mode_none; 199| 9.44k| ses.newkeys->recv.algo_mac = &dropbear_nohash; 200| 9.44k|} fuzz_get_socket_address: 203| 5.57k| char **remote_host, char **remote_port, int UNUSED(host_lookup)) { 204| 5.57k| if (local_host) { ------------------ | Branch (204:9): [True: 2.58k, False: 2.99k] ------------------ 205| 2.58k| *local_host = m_strdup("fuzzlocalhost"); 206| 2.58k| } 207| 5.57k| if (local_port) { ------------------ | Branch (207:9): [True: 2.58k, False: 2.99k] ------------------ 208| 2.58k| *local_port = m_strdup("1234"); 209| 2.58k| } 210| 5.57k| if (remote_host) { ------------------ | Branch (210:9): [True: 5.57k, False: 0] ------------------ 211| 5.57k| *remote_host = m_strdup("fuzzremotehost"); 212| 5.57k| } 213| 5.57k| if (remote_port) { ------------------ | Branch (213:9): [True: 4.08k, False: 1.49k] ------------------ 214| 4.08k| *remote_port = m_strdup("9876"); 215| 4.08k| } 216| 5.57k|} fuzz_fake_send_kexdh_reply: 219| 9.27k|void fuzz_fake_send_kexdh_reply(void) { 220| 9.27k| assert(!ses.dh_K); 221| 9.27k| m_mp_alloc_init_multi(&ses.dh_K, NULL); 222| 9.27k| mp_set_ul(ses.dh_K, 12345678uL); 223| 9.27k| finish_kexhashbuf(); 224| 9.27k|} fuzz_spawn_command: 227| 1.55k|int fuzz_spawn_command(int *ret_writefd, int *ret_readfd, int *ret_errfd, pid_t *ret_pid) { 228| 1.55k| *ret_writefd = wrapfd_new_dummy(); 229| 1.55k| *ret_readfd = wrapfd_new_dummy(); 230| 1.55k| if (ret_errfd) { ------------------ | Branch (230:9): [True: 1.55k, False: 0] ------------------ 231| 1.55k| *ret_errfd = wrapfd_new_dummy(); 232| 1.55k| } 233| 1.55k| if (*ret_writefd == -1 || *ret_readfd == -1 || (ret_errfd && *ret_errfd == -1)) { ------------------ | Branch (233:9): [True: 0, False: 1.55k] | Branch (233:31): [True: 0, False: 1.55k] | Branch (233:53): [True: 1.55k, False: 0] | Branch (233:66): [True: 0, False: 1.55k] ------------------ 234| 0| m_close(*ret_writefd); 235| 0| m_close(*ret_readfd); 236| 0| if (ret_errfd) { ------------------ | Branch (236:13): [True: 0, False: 0] ------------------ 237| 0| m_close(*ret_errfd); 238| 0| } 239| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 240| 1.55k| } else { 241| 1.55k| *ret_pid = 999; 242| 1.55k| return DROPBEAR_SUCCESS; ------------------ | | 102| 1.55k|#define DROPBEAR_SUCCESS 0 ------------------ 243| | 244| 1.55k| } 245| 1.55k|} fuzz_dropbear_listen: 257| 1.22k| int *UNUSED(socks), unsigned int UNUSED(sockcount), char **errstring, int *UNUSED(maxfd)) { 258| 1.22k| if (errstring) { ------------------ | Branch (258:9): [True: 1.22k, False: 0] ------------------ 259| 1.22k| *errstring = m_strdup("fuzzing can't listen (yet)"); 260| 1.22k| } 261| 1.22k| return -1; 262| 1.22k|} fuzz_run_server: 264| 1.49k|int fuzz_run_server(const uint8_t *Data, size_t Size, int skip_kexmaths, int postauth) { 265| 1.49k| static int once = 0; 266| 1.49k| if (!once) { ------------------ | Branch (266:9): [True: 1, False: 1.49k] ------------------ 267| 1| fuzz_svr_setup(); 268| 1| fuzz.skip_kexmaths = skip_kexmaths; 269| 1| once = 1; 270| 1| } 271| | 272| 1.49k| fuzz.svr_postauth = postauth; 273| | 274| 1.49k| if (fuzz_set_input(Data, Size) == DROPBEAR_FAILURE) { ------------------ | | 103| 1.49k|#define DROPBEAR_FAILURE -1 ------------------ | Branch (274:9): [True: 0, False: 1.49k] ------------------ 275| 0| return 0; 276| 0| } 277| | 278| 1.49k| uint32_t wrapseed; 279| 1.49k| genrandom((void*)&wrapseed, sizeof(wrapseed)); 280| 1.49k| wrapfd_setseed(wrapseed); 281| | 282| 1.49k| int fakesock = wrapfd_new_fuzzinput(); 283| | 284| 1.49k| m_malloc_set_epoch(1); 285| 1.49k| fuzz.do_jmp = 1; 286| 1.49k| if (setjmp(fuzz.jmp) == 0) { ------------------ | Branch (286:9): [True: 1.49k, False: 0] ------------------ 287| 1.49k| svr_session(fakesock, fakesock); 288| 0| m_malloc_free_epoch(1, 0); 289| 0| } else { 290| 0| fuzz.do_jmp = 0; 291| 0| m_malloc_free_epoch(1, 1); 292| 0| TRACE(("dropbear_exit longjmped")) 293| | /* dropbear_exit jumped here */ 294| 0| } 295| | 296| 0| return 0; 297| 1.49k|} fuzz_dump: 345| 96.2k|void fuzz_dump(const unsigned char* data, size_t len) { 346| 96.2k| if (fuzz.dumping) { ------------------ | Branch (346:9): [True: 0, False: 96.2k] ------------------ 347| 0| TRACE(("dump %zu", len)) 348| 0| assert(atomicio(vwrite, fuzz.recv_dumpfd, (void*)data, len) == len); 349| 0| } 350| 96.2k|} fuzz_getpwnam: 373| 1.50k|struct passwd* fuzz_getpwnam(const char *login) { 374| 1.50k| if (!fuzz.fuzzing) { ------------------ | Branch (374:9): [True: 0, False: 1.50k] ------------------ 375| 0| return getpwnam(login); 376| 0| } 377| 1.50k| if (strcmp(login, pwd_other.pw_name) == 0) { ------------------ | Branch (377:9): [True: 0, False: 1.50k] ------------------ 378| 0| return &pwd_other; 379| 0| } 380| 1.50k| if (strcmp(login, pwd_root.pw_name) == 0) { ------------------ | Branch (380:9): [True: 1.50k, False: 0] ------------------ 381| 1.50k| return &pwd_root; 382| 1.50k| } 383| 0| return NULL; 384| 1.50k|} fuzz-common.c:fuzz_dropbear_log: 84| 3.75k|static void fuzz_dropbear_log(int UNUSED(priority), const char* UNUSED(format), va_list UNUSED(param)) { 85| | /* No print */ 86| 3.75k|} fuzz-common.c:load_fixed_hostkeys: 153| 1|static void load_fixed_hostkeys(void) { 154| | 155| 1| buffer *b = buf_new(3000); 156| 1| enum signkey_type type; 157| | 158| 1| TRACE(("load fixed hostkeys")) 159| | 160| 1| svr_opts.hostkey = new_sign_key(); 161| | 162| 1| buf_setlen(b, 0); 163| 1| buf_putbytes(b, keyr, keyr_len); 164| 1| buf_setpos(b, 0); 165| 1| type = DROPBEAR_SIGNKEY_RSA; 166| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (166:9): [True: 0, False: 1] ------------------ 167| 0| dropbear_exit("failed fixed rsa hostkey"); 168| 0| } 169| | 170| 1| buf_setlen(b, 0); 171| 1| buf_putbytes(b, keyd, keyd_len); 172| 1| buf_setpos(b, 0); 173| 1| type = DROPBEAR_SIGNKEY_DSS; 174| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (174:9): [True: 0, False: 1] ------------------ 175| 0| dropbear_exit("failed fixed dss hostkey"); 176| 0| } 177| | 178| 1| buf_setlen(b, 0); 179| 1| buf_putbytes(b, keye, keye_len); 180| 1| buf_setpos(b, 0); 181| 1| type = DROPBEAR_SIGNKEY_ECDSA_NISTP256; 182| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (182:9): [True: 0, False: 1] ------------------ 183| 0| dropbear_exit("failed fixed ecdsa hostkey"); 184| 0| } 185| | 186| 1| buf_setlen(b, 0); 187| 1| buf_putbytes(b, keyed25519, keyed25519_len); 188| 1| buf_setpos(b, 0); 189| 1| type = DROPBEAR_SIGNKEY_ED25519; 190| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (190:9): [True: 0, False: 1] ------------------ 191| 0| dropbear_exit("failed fixed ed25519 hostkey"); 192| 0| } 193| | 194| 1| buf_free(b); 195| 1|} fuzz-sshpacketmutator.c:alloc_static_buffers: 126| 2|static void alloc_static_buffers() { 127| | 128| 2| int i; 129| 2| oup = buf_new(MAX_OUT_SIZE); 130| 2| alloc_packetA = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 215| 2|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ 131| 2| alloc_packetB = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 215| 2|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ 132| | 133| 1.00k| for (i = 0; i < MAX_FUZZ_PACKETS; i++) { ------------------ | | 20| 1.00k|#define MAX_FUZZ_PACKETS 500 ------------------ | Branch (133:17): [True: 1.00k, False: 2] ------------------ 134| 1.00k| packets1[i] = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 215| 1.00k|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ 135| 1.00k| } 136| 1.00k| for (i = 0; i < MAX_FUZZ_PACKETS; i++) { ------------------ | | 20| 1.00k|#define MAX_FUZZ_PACKETS 500 ------------------ | Branch (136:17): [True: 1.00k, False: 2] ------------------ 137| 1.00k| packets2[i] = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 215| 1.00k|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ 138| 1.00k| } 139| 2|} wrapfd_setup: 32| 1.49k|void wrapfd_setup(buffer *buf) { 33| 1.49k| TRACE(("wrapfd_setup")) 34| | 35| | // clean old ones 36| 1.49k| int i; 37| 18.6k| for (i = 0; i <= wrapfd_maxfd; i++) { ------------------ | Branch (37:14): [True: 17.1k, False: 1.49k] ------------------ 38| 17.1k| if (wrap_fds[i].mode != UNUSED) { ------------------ | Branch (38:7): [True: 460, False: 16.6k] ------------------ 39| 460| wrapfd_remove(i); 40| 460| } 41| 17.1k| } 42| 1.49k| wrapfd_maxfd = -1; 43| | 44| 1.49k| memset(rand_state, 0x0, sizeof(rand_state)); 45| 1.49k| wrapfd_setseed(50); 46| 1.49k| input_buf = buf; 47| 1.49k|} wrapfd_setseed: 49| 2.99k|void wrapfd_setseed(uint32_t seed) { 50| 2.99k| memcpy(rand_state, &seed, sizeof(seed)); 51| 2.99k| nrand48(rand_state); 52| 2.99k|} wrapfd_new_fuzzinput: 54| 1.49k|int wrapfd_new_fuzzinput() { 55| 1.49k| if (devnull_fd == -1) { ------------------ | Branch (55:6): [True: 1, False: 1.49k] ------------------ 56| 1| devnull_fd = open("/dev/null", O_RDONLY); 57| 1| assert(devnull_fd != -1); 58| 1| } 59| | 60| 1.49k| int fd = dup(devnull_fd); 61| 1.49k| assert(fd != -1); 62| 1.49k| assert(wrap_fds[fd].mode == UNUSED); 63| 1.49k| wrap_fds[fd].mode = COMMONBUF; 64| 1.49k| wrap_fds[fd].closein = 0; 65| 1.49k| wrap_fds[fd].closeout = 0; 66| 1.49k| wrapfd_maxfd = MAX(fd, wrapfd_maxfd); 67| | 68| 1.49k| return fd; 69| 1.49k|} wrapfd_new_dummy: 71| 4.67k|int wrapfd_new_dummy() { 72| 4.67k| if (devnull_fd == -1) { ------------------ | Branch (72:6): [True: 0, False: 4.67k] ------------------ 73| 0| devnull_fd = open("/dev/null", O_RDONLY); 74| 0| assert(devnull_fd != -1); 75| 0| } 76| | 77| 4.67k| int fd = dup(devnull_fd); 78| 4.67k| if (fd == -1) { ------------------ | Branch (78:6): [True: 0, False: 4.67k] ------------------ 79| 0| return -1; 80| 0| } 81| 4.67k| if (fd > IOWRAP_MAXFD) { ------------------ | | 9| 4.67k|#define IOWRAP_MAXFD (FD_SETSIZE-1) ------------------ | Branch (81:6): [True: 0, False: 4.67k] ------------------ 82| 0| close(fd); 83| 0| errno = EMFILE; 84| 0| return -1; 85| 0| } 86| 4.67k| assert(wrap_fds[fd].mode == UNUSED); 87| 4.67k| wrap_fds[fd].mode = DUMMY; 88| 4.67k| wrap_fds[fd].closein = 0; 89| 4.67k| wrap_fds[fd].closeout = 0; 90| 4.67k| wrapfd_maxfd = MAX(fd, wrapfd_maxfd); 91| | 92| 4.67k| return fd; 93| 4.67k|} wrapfd_close: 105| 5.70k|int wrapfd_close(int fd) { 106| 5.70k| if (fd >= 0 && fd <= IOWRAP_MAXFD && wrap_fds[fd].mode != UNUSED) { ------------------ | | 9| 11.4k|#define IOWRAP_MAXFD (FD_SETSIZE-1) ------------------ | Branch (106:6): [True: 5.70k, False: 0] | Branch (106:17): [True: 5.70k, False: 0] | Branch (106:39): [True: 5.70k, False: 0] ------------------ 107| 5.70k| wrapfd_remove(fd); 108| 5.70k| return 0; 109| 5.70k| } else { 110| 0| return close(fd); 111| 0| } 112| 5.70k|} wrapfd_read: 114| 567k|int wrapfd_read(int fd, void *out, size_t count) { 115| 567k| size_t maxread; 116| | 117| 567k| if (!fuzz.wrapfds) { ------------------ | Branch (117:6): [True: 0, False: 567k] ------------------ 118| 0| return read(fd, out, count); 119| 0| } 120| | 121| 567k| if (fd < 0 || fd > IOWRAP_MAXFD || wrap_fds[fd].mode == UNUSED) { ------------------ | | 9| 1.13M|#define IOWRAP_MAXFD (FD_SETSIZE-1) ------------------ | Branch (121:6): [True: 0, False: 567k] | Branch (121:16): [True: 0, False: 567k] | Branch (121:37): [True: 0, False: 567k] ------------------ 122| | /* XXX - assertion failure? */ 123| 0| TRACE(("Bad read descriptor %d\n", fd)) 124| 0| errno = EBADF; 125| 0| return -1; 126| 0| } 127| | 128| 567k| assert(count != 0); 129| | 130| 567k| if (wrap_fds[fd].closein || erand48(rand_state) < CHANCE_CLOSE) { ------------------ | Branch (130:6): [True: 0, False: 567k] | Branch (130:30): [True: 305, False: 566k] ------------------ 131| 305| wrap_fds[fd].closein = 1; 132| 305| errno = ECONNRESET; 133| 305| return -1; 134| 305| } 135| | 136| 566k| if (erand48(rand_state) < CHANCE_INTR) { ------------------ | Branch (136:6): [True: 697, False: 566k] ------------------ 137| 697| errno = EINTR; 138| 697| return -1; 139| 697| } 140| | 141| 566k| if (input_buf && wrap_fds[fd].mode == COMMONBUF) { ------------------ | Branch (141:6): [True: 566k, False: 0] | Branch (141:19): [True: 361k, False: 204k] ------------------ 142| 361k| maxread = MIN(input_buf->len - input_buf->pos, count); 143| | /* returns 0 if buf is EOF, as intended */ 144| 361k| if (maxread > 0) { ------------------ | Branch (144:7): [True: 360k, False: 1.03k] ------------------ 145| 360k| maxread = nrand48(rand_state) % maxread + 1; 146| 360k| } 147| 361k| memcpy(out, buf_getptr(input_buf, maxread), maxread); 148| 361k| buf_incrpos(input_buf, maxread); 149| 361k| return maxread; 150| 361k| } 151| | 152| | // return fixed output, of random length 153| 204k| maxread = MIN(MAX_RANDOM_IN, count); 154| 204k| maxread = nrand48(rand_state) % maxread + 1; 155| 204k| memset(out, 0xef, maxread); 156| 204k| return maxread; 157| 566k|} wrapfd_select: 196| 502k| fd_set *exceptfds, struct timeval *timeout) { 197| 502k| int i, nset, sel; 198| 502k| int ret = 0; 199| 502k| int fdlist[IOWRAP_MAXFD+1]; 200| | 201| 502k| if (!fuzz.wrapfds) { ------------------ | Branch (201:6): [True: 0, False: 502k] ------------------ 202| 0| return select(nfds, readfds, writefds, exceptfds, timeout); 203| 0| } 204| | 205| 502k| assert(nfds <= IOWRAP_MAXFD+1); 206| | 207| 502k| if (erand48(rand_state) < CHANCE_INTR) { ------------------ | Branch (207:6): [True: 657, False: 501k] ------------------ 208| 657| errno = EINTR; 209| 657| return -1; 210| 657| } 211| | 212| | /* read */ 213| 501k| if (readfds != NULL && erand48(rand_state) < CHANCE_READ1) { ------------------ | Branch (213:6): [True: 501k, False: 0] | Branch (213:25): [True: 477k, False: 24.2k] ------------------ 214| 9.47M| for (i = 0, nset = 0; i < nfds; i++) { ------------------ | Branch (214:25): [True: 8.99M, False: 477k] ------------------ 215| 8.99M| if (FD_ISSET(i, readfds)) { 216| 1.37M| assert(wrap_fds[i].mode != UNUSED); 217| 1.37M| fdlist[nset] = i; 218| 1.37M| nset++; 219| 1.37M| } 220| 8.99M| } 221| 477k| DROPBEAR_FD_ZERO(readfds); ------------------ | | 104| 477k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 222| | 223| 477k| if (nset > 0) { ------------------ | Branch (223:7): [True: 420k, False: 56.7k] ------------------ 224| | /* set one */ 225| 420k| sel = fdlist[nrand48(rand_state) % nset]; 226| 420k| FD_SET(sel, readfds); 227| 420k| ret++; 228| | 229| 420k| if (erand48(rand_state) < CHANCE_READ2) { ------------------ | Branch (229:8): [True: 208k, False: 212k] ------------------ 230| 208k| sel = fdlist[nrand48(rand_state) % nset]; 231| 208k| if (!FD_ISSET(sel, readfds)) { ------------------ | Branch (231:9): [True: 59.6k, False: 149k] ------------------ 232| 59.6k| FD_SET(sel, readfds); 233| 59.6k| ret++; 234| 59.6k| } 235| 208k| } 236| 420k| } 237| 477k| } 238| | 239| | /* write */ 240| 501k| if (writefds != NULL && erand48(rand_state) < CHANCE_WRITE1) { ------------------ | Branch (240:6): [True: 457k, False: 44.2k] | Branch (240:26): [True: 437k, False: 19.5k] ------------------ 241| 9.15M| for (i = 0, nset = 0; i < nfds; i++) { ------------------ | Branch (241:25): [True: 8.71M, False: 437k] ------------------ 242| 8.71M| if (FD_ISSET(i, writefds)) { 243| 184k| assert(wrap_fds[i].mode != UNUSED); 244| 184k| fdlist[nset] = i; 245| 184k| nset++; 246| 184k| } 247| 8.71M| } 248| 437k| DROPBEAR_FD_ZERO(writefds); ------------------ | | 104| 437k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 249| | 250| | /* set one */ 251| 437k| if (nset > 0) { ------------------ | Branch (251:7): [True: 184k, False: 253k] ------------------ 252| 184k| sel = fdlist[nrand48(rand_state) % nset]; 253| 184k| FD_SET(sel, writefds); 254| 184k| ret++; 255| | 256| 184k| if (erand48(rand_state) < CHANCE_WRITE2) { ------------------ | Branch (256:8): [True: 90.8k, False: 93.5k] ------------------ 257| 90.8k| sel = fdlist[nrand48(rand_state) % nset]; 258| 90.8k| if (!FD_ISSET(sel, writefds)) { ------------------ | Branch (258:9): [True: 0, False: 90.8k] ------------------ 259| 0| FD_SET(sel, writefds); 260| 0| ret++; 261| 0| } 262| 90.8k| } 263| 184k| } 264| 437k| } 265| 501k| return ret; 266| 501k|} fuzz_kill: 268| 185|int fuzz_kill(pid_t pid, int sig) { 269| 185| if (fuzz.fuzzing) { ------------------ | Branch (269:6): [True: 185, False: 0] ------------------ 270| 185| TRACE(("fuzz_kill ignoring pid %d signal %d", (pid), sig)) 271| 185| if (sig >= 0) { ------------------ | Branch (271:7): [True: 185, False: 0] ------------------ 272| 185| return 0; 273| 185| } else { 274| 0| errno = EINVAL; 275| 0| return -1; 276| 0| } 277| 185| } 278| 0| return kill(pid, sig); 279| 185|} fuzz-wrapfd.c:wrapfd_remove: 96| 6.16k|static void wrapfd_remove(int fd) { 97| 6.16k| TRACE(("wrapfd_remove %d", fd)) 98| 6.16k| assert(fd >= 0); 99| 6.16k| assert(fd <= IOWRAP_MAXFD); 100| 6.16k| assert(wrap_fds[fd].mode != UNUSED); 101| 6.16k| wrap_fds[fd].mode = UNUSED; 102| 6.16k| close(fd); 103| 6.16k|} LLVMFuzzerTestOneInput: 3| 1.49k|int LLVMFuzzerTestOneInput(const uint8_t *Data, size_t Size) { 4| 1.49k| return fuzz_run_server(Data, Size, 1, 1); 5| 1.49k|} rijndael_setup: 123| 3.55k|{ 124| 3.55k| int i; 125| 3.55k| ulong32 temp, *rk; 126| 3.55k|#ifndef ENCRYPT_ONLY 127| 3.55k| ulong32 *rrk; 128| 3.55k|#endif 129| 3.55k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 3.55k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.55k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 130| 3.55k| LTC_ARGCHK(skey != NULL); ------------------ | | 32| 3.55k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.55k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 131| | 132| 3.55k| if (keylen != 16 && keylen != 24 && keylen != 32) { ------------------ | Branch (132:9): [True: 1.24k, False: 2.31k] | Branch (132:25): [True: 1.24k, False: 0] | Branch (132:41): [True: 0, False: 1.24k] ------------------ 133| 0| return CRYPT_INVALID_KEYSIZE; 134| 0| } 135| | 136| 3.55k| if (num_rounds != 0 && num_rounds != (10 + ((keylen/8)-2)*2)) { ------------------ | Branch (136:9): [True: 0, False: 3.55k] | Branch (136:28): [True: 0, False: 0] ------------------ 137| 0| return CRYPT_INVALID_ROUNDS; 138| 0| } 139| | 140| 3.55k| skey->rijndael.Nr = 10 + ((keylen/8)-2)*2; 141| | 142| | /* setup the forward key */ 143| 3.55k| i = 0; 144| 3.55k| rk = skey->rijndael.eK; 145| 3.55k| LOAD32H(rk[0], key ); ------------------ | | 66| 3.55k|#define LOAD32H(x, y) \ | | 67| 3.55k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 3.55k|#define XMEMCPY memcpy | | ------------------ | | 68| 3.55k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 146| 3.55k| LOAD32H(rk[1], key + 4); ------------------ | | 66| 3.55k|#define LOAD32H(x, y) \ | | 67| 3.55k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 3.55k|#define XMEMCPY memcpy | | ------------------ | | 68| 3.55k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 147| 3.55k| LOAD32H(rk[2], key + 8); ------------------ | | 66| 3.55k|#define LOAD32H(x, y) \ | | 67| 3.55k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 3.55k|#define XMEMCPY memcpy | | ------------------ | | 68| 3.55k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 148| 3.55k| LOAD32H(rk[3], key + 12); ------------------ | | 66| 3.55k|#define LOAD32H(x, y) \ | | 67| 3.55k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 3.55k|#define XMEMCPY memcpy | | ------------------ | | 68| 3.55k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 149| 3.55k| if (keylen == 16) { ------------------ | Branch (149:9): [True: 2.31k, False: 1.24k] ------------------ 150| 23.1k| for (;;) { 151| 23.1k| temp = rk[3]; 152| 23.1k| rk[4] = rk[0] ^ setup_mix(temp) ^ rcon[i]; 153| 23.1k| rk[5] = rk[1] ^ rk[4]; 154| 23.1k| rk[6] = rk[2] ^ rk[5]; 155| 23.1k| rk[7] = rk[3] ^ rk[6]; 156| 23.1k| if (++i == 10) { ------------------ | Branch (156:17): [True: 2.31k, False: 20.8k] ------------------ 157| 2.31k| break; 158| 2.31k| } 159| 20.8k| rk += 4; 160| 20.8k| } 161| 2.31k| } else if (keylen == 24) { ------------------ | Branch (161:16): [True: 0, False: 1.24k] ------------------ 162| 0| LOAD32H(rk[4], key + 16); ------------------ | | 66| 0|#define LOAD32H(x, y) \ | | 67| 0|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 0|#define XMEMCPY memcpy | | ------------------ | | 68| 0| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 163| 0| LOAD32H(rk[5], key + 20); ------------------ | | 66| 0|#define LOAD32H(x, y) \ | | 67| 0|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 0|#define XMEMCPY memcpy | | ------------------ | | 68| 0| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 164| 0| for (;;) { 165| | #ifdef _MSC_VER 166| | temp = skey->rijndael.eK[rk - skey->rijndael.eK + 5]; 167| | #else 168| 0| temp = rk[5]; 169| 0| #endif 170| 0| rk[ 6] = rk[ 0] ^ setup_mix(temp) ^ rcon[i]; 171| 0| rk[ 7] = rk[ 1] ^ rk[ 6]; 172| 0| rk[ 8] = rk[ 2] ^ rk[ 7]; 173| 0| rk[ 9] = rk[ 3] ^ rk[ 8]; 174| 0| if (++i == 8) { ------------------ | Branch (174:17): [True: 0, False: 0] ------------------ 175| 0| break; 176| 0| } 177| 0| rk[10] = rk[ 4] ^ rk[ 9]; 178| 0| rk[11] = rk[ 5] ^ rk[10]; 179| 0| rk += 6; 180| 0| } 181| 1.24k| } else if (keylen == 32) { ------------------ | Branch (181:16): [True: 1.24k, False: 0] ------------------ 182| 1.24k| LOAD32H(rk[4], key + 16); ------------------ | | 66| 1.24k|#define LOAD32H(x, y) \ | | 67| 1.24k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 1.24k|#define XMEMCPY memcpy | | ------------------ | | 68| 1.24k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 183| 1.24k| LOAD32H(rk[5], key + 20); ------------------ | | 66| 1.24k|#define LOAD32H(x, y) \ | | 67| 1.24k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 1.24k|#define XMEMCPY memcpy | | ------------------ | | 68| 1.24k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 184| 1.24k| LOAD32H(rk[6], key + 24); ------------------ | | 66| 1.24k|#define LOAD32H(x, y) \ | | 67| 1.24k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 1.24k|#define XMEMCPY memcpy | | ------------------ | | 68| 1.24k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 185| 1.24k| LOAD32H(rk[7], key + 28); ------------------ | | 66| 1.24k|#define LOAD32H(x, y) \ | | 67| 1.24k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 1.24k|#define XMEMCPY memcpy | | ------------------ | | 68| 1.24k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 186| 8.68k| for (;;) { 187| | #ifdef _MSC_VER 188| | temp = skey->rijndael.eK[rk - skey->rijndael.eK + 7]; 189| | #else 190| 8.68k| temp = rk[7]; 191| 8.68k| #endif 192| 8.68k| rk[ 8] = rk[ 0] ^ setup_mix(temp) ^ rcon[i]; 193| 8.68k| rk[ 9] = rk[ 1] ^ rk[ 8]; 194| 8.68k| rk[10] = rk[ 2] ^ rk[ 9]; 195| 8.68k| rk[11] = rk[ 3] ^ rk[10]; 196| 8.68k| if (++i == 7) { ------------------ | Branch (196:17): [True: 1.24k, False: 7.44k] ------------------ 197| 1.24k| break; 198| 1.24k| } 199| 7.44k| temp = rk[11]; 200| 7.44k| rk[12] = rk[ 4] ^ setup_mix(RORc(temp, 8)); ------------------ | | 283| 7.44k|#define RORc(word,i) ({ \ | | 284| 7.44k| ulong32 __RORc_tmp = (word); \ | | 285| 7.44k| __asm__ ("rorl %2, %0" : \ | | 286| 7.44k| "=r" (__RORc_tmp) : \ | | 287| 7.44k| "0" (__RORc_tmp), \ | | 288| 7.44k| "I" (i)); \ | | 289| 7.44k| __RORc_tmp; \ | | 290| 7.44k| }) ------------------ 201| 7.44k| rk[13] = rk[ 5] ^ rk[12]; 202| 7.44k| rk[14] = rk[ 6] ^ rk[13]; 203| 7.44k| rk[15] = rk[ 7] ^ rk[14]; 204| 7.44k| rk += 8; 205| 7.44k| } 206| 1.24k| } else { 207| | /* this can't happen */ 208| | /* coverity[dead_error_line] */ 209| 0| return CRYPT_ERROR; 210| 0| } 211| | 212| 3.55k|#ifndef ENCRYPT_ONLY 213| | /* setup the inverse key now */ 214| 3.55k| rk = skey->rijndael.dK; 215| 3.55k| rrk = skey->rijndael.eK + (28 + keylen) - 4; 216| | 217| | /* apply the inverse MixColumn transform to all round keys but the first and the last: */ 218| | /* copy first */ 219| 3.55k| *rk++ = *rrk++; 220| 3.55k| *rk++ = *rrk++; 221| 3.55k| *rk++ = *rrk++; 222| 3.55k| *rk = *rrk; 223| 3.55k| rk -= 3; rrk -= 3; 224| | 225| 40.5k| for (i = 1; i < skey->rijndael.Nr; i++) { ------------------ | Branch (225:17): [True: 36.9k, False: 3.55k] ------------------ 226| 36.9k| rrk -= 4; 227| 36.9k| rk += 4; 228| 36.9k| #ifdef LTC_SMALL_CODE 229| 36.9k| temp = rrk[0]; 230| 36.9k| rk[0] = setup_mix2(temp); 231| 36.9k| temp = rrk[1]; 232| 36.9k| rk[1] = setup_mix2(temp); 233| 36.9k| temp = rrk[2]; 234| 36.9k| rk[2] = setup_mix2(temp); 235| 36.9k| temp = rrk[3]; 236| 36.9k| rk[3] = setup_mix2(temp); 237| | #else 238| | temp = rrk[0]; 239| | rk[0] = 240| | Tks0[byte(temp, 3)] ^ 241| | Tks1[byte(temp, 2)] ^ 242| | Tks2[byte(temp, 1)] ^ 243| | Tks3[byte(temp, 0)]; 244| | temp = rrk[1]; 245| | rk[1] = 246| | Tks0[byte(temp, 3)] ^ 247| | Tks1[byte(temp, 2)] ^ 248| | Tks2[byte(temp, 1)] ^ 249| | Tks3[byte(temp, 0)]; 250| | temp = rrk[2]; 251| | rk[2] = 252| | Tks0[byte(temp, 3)] ^ 253| | Tks1[byte(temp, 2)] ^ 254| | Tks2[byte(temp, 1)] ^ 255| | Tks3[byte(temp, 0)]; 256| | temp = rrk[3]; 257| | rk[3] = 258| | Tks0[byte(temp, 3)] ^ 259| | Tks1[byte(temp, 2)] ^ 260| | Tks2[byte(temp, 1)] ^ 261| | Tks3[byte(temp, 0)]; 262| | #endif 263| | 264| 36.9k| } 265| | 266| | /* copy last */ 267| 3.55k| rrk -= 4; 268| 3.55k| rk += 4; 269| 3.55k| *rk++ = *rrk++; 270| 3.55k| *rk++ = *rrk++; 271| 3.55k| *rk++ = *rrk++; 272| 3.55k| *rk = *rrk; 273| 3.55k|#endif /* ENCRYPT_ONLY */ 274| | 275| 3.55k| return CRYPT_OK; 276| 3.55k|} rijndael_ecb_encrypt: 290| 5.85M|{ 291| 5.85M| ulong32 s0, s1, s2, s3, t0, t1, t2, t3, *rk; 292| 5.85M| int Nr, r; 293| | 294| 5.85M| LTC_ARGCHK(pt != NULL); ------------------ | | 32| 5.85M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 5.85M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 295| 5.85M| LTC_ARGCHK(ct != NULL); ------------------ | | 32| 5.85M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 5.85M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 296| 5.85M| LTC_ARGCHK(skey != NULL); ------------------ | | 32| 5.85M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 5.85M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 297| | 298| 5.85M| Nr = skey->rijndael.Nr; 299| 5.85M| rk = skey->rijndael.eK; 300| | 301| | /* 302| | * map byte array block to cipher state 303| | * and add initial round key: 304| | */ 305| 5.85M| LOAD32H(s0, pt ); s0 ^= rk[0]; ------------------ | | 66| 5.85M|#define LOAD32H(x, y) \ | | 67| 5.85M|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 5.85M|#define XMEMCPY memcpy | | ------------------ | | 68| 5.85M| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 306| 5.85M| LOAD32H(s1, pt + 4); s1 ^= rk[1]; ------------------ | | 66| 5.85M|#define LOAD32H(x, y) \ | | 67| 5.85M|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 5.85M|#define XMEMCPY memcpy | | ------------------ | | 68| 5.85M| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 307| 5.85M| LOAD32H(s2, pt + 8); s2 ^= rk[2]; ------------------ | | 66| 5.85M|#define LOAD32H(x, y) \ | | 67| 5.85M|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 5.85M|#define XMEMCPY memcpy | | ------------------ | | 68| 5.85M| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 308| 5.85M| LOAD32H(s3, pt + 12); s3 ^= rk[3]; ------------------ | | 66| 5.85M|#define LOAD32H(x, y) \ | | 67| 5.85M|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 5.85M|#define XMEMCPY memcpy | | ------------------ | | 68| 5.85M| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 309| | 310| 5.85M|#ifdef LTC_SMALL_CODE 311| | 312| 57.5M| for (r = 0; ; r++) { 313| 57.5M| rk += 4; 314| 57.5M| t0 = 315| 57.5M| Te0(byte(s0, 3)) ^ ------------------ | | 306| 57.5M|#define Te0(x) TE0[x] ------------------ 316| 57.5M| Te1(byte(s1, 2)) ^ ------------------ | | 307| 57.5M|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 57.5M|#define RORc(word,i) ({ \ | | | | 284| 57.5M| ulong32 __RORc_tmp = (word); \ | | | | 285| 57.5M| __asm__ ("rorl %2, %0" : \ | | | | 286| 57.5M| "=r" (__RORc_tmp) : \ | | | | 287| 57.5M| "0" (__RORc_tmp), \ | | | | 288| 57.5M| "I" (i)); \ | | | | 289| 57.5M| __RORc_tmp; \ | | | | 290| 57.5M| }) | | ------------------ ------------------ 317| 57.5M| Te2(byte(s2, 1)) ^ ------------------ | | 308| 57.5M|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 57.5M|#define RORc(word,i) ({ \ | | | | 284| 57.5M| ulong32 __RORc_tmp = (word); \ | | | | 285| 57.5M| __asm__ ("rorl %2, %0" : \ | | | | 286| 57.5M| "=r" (__RORc_tmp) : \ | | | | 287| 57.5M| "0" (__RORc_tmp), \ | | | | 288| 57.5M| "I" (i)); \ | | | | 289| 57.5M| __RORc_tmp; \ | | | | 290| 57.5M| }) | | ------------------ ------------------ 318| 57.5M| Te3(byte(s3, 0)) ^ ------------------ | | 309| 57.5M|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 57.5M|#define RORc(word,i) ({ \ | | | | 284| 57.5M| ulong32 __RORc_tmp = (word); \ | | | | 285| 57.5M| __asm__ ("rorl %2, %0" : \ | | | | 286| 57.5M| "=r" (__RORc_tmp) : \ | | | | 287| 57.5M| "0" (__RORc_tmp), \ | | | | 288| 57.5M| "I" (i)); \ | | | | 289| 57.5M| __RORc_tmp; \ | | | | 290| 57.5M| }) | | ------------------ ------------------ 319| 57.5M| rk[0]; 320| 57.5M| t1 = 321| 57.5M| Te0(byte(s1, 3)) ^ ------------------ | | 306| 57.5M|#define Te0(x) TE0[x] ------------------ 322| 57.5M| Te1(byte(s2, 2)) ^ ------------------ | | 307| 57.5M|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 57.5M|#define RORc(word,i) ({ \ | | | | 284| 57.5M| ulong32 __RORc_tmp = (word); \ | | | | 285| 57.5M| __asm__ ("rorl %2, %0" : \ | | | | 286| 57.5M| "=r" (__RORc_tmp) : \ | | | | 287| 57.5M| "0" (__RORc_tmp), \ | | | | 288| 57.5M| "I" (i)); \ | | | | 289| 57.5M| __RORc_tmp; \ | | | | 290| 57.5M| }) | | ------------------ ------------------ 323| 57.5M| Te2(byte(s3, 1)) ^ ------------------ | | 308| 57.5M|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 57.5M|#define RORc(word,i) ({ \ | | | | 284| 57.5M| ulong32 __RORc_tmp = (word); \ | | | | 285| 57.5M| __asm__ ("rorl %2, %0" : \ | | | | 286| 57.5M| "=r" (__RORc_tmp) : \ | | | | 287| 57.5M| "0" (__RORc_tmp), \ | | | | 288| 57.5M| "I" (i)); \ | | | | 289| 57.5M| __RORc_tmp; \ | | | | 290| 57.5M| }) | | ------------------ ------------------ 324| 57.5M| Te3(byte(s0, 0)) ^ ------------------ | | 309| 57.5M|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 57.5M|#define RORc(word,i) ({ \ | | | | 284| 57.5M| ulong32 __RORc_tmp = (word); \ | | | | 285| 57.5M| __asm__ ("rorl %2, %0" : \ | | | | 286| 57.5M| "=r" (__RORc_tmp) : \ | | | | 287| 57.5M| "0" (__RORc_tmp), \ | | | | 288| 57.5M| "I" (i)); \ | | | | 289| 57.5M| __RORc_tmp; \ | | | | 290| 57.5M| }) | | ------------------ ------------------ 325| 57.5M| rk[1]; 326| 57.5M| t2 = 327| 57.5M| Te0(byte(s2, 3)) ^ ------------------ | | 306| 57.5M|#define Te0(x) TE0[x] ------------------ 328| 57.5M| Te1(byte(s3, 2)) ^ ------------------ | | 307| 57.5M|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 57.5M|#define RORc(word,i) ({ \ | | | | 284| 57.5M| ulong32 __RORc_tmp = (word); \ | | | | 285| 57.5M| __asm__ ("rorl %2, %0" : \ | | | | 286| 57.5M| "=r" (__RORc_tmp) : \ | | | | 287| 57.5M| "0" (__RORc_tmp), \ | | | | 288| 57.5M| "I" (i)); \ | | | | 289| 57.5M| __RORc_tmp; \ | | | | 290| 57.5M| }) | | ------------------ ------------------ 329| 57.5M| Te2(byte(s0, 1)) ^ ------------------ | | 308| 57.5M|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 57.5M|#define RORc(word,i) ({ \ | | | | 284| 57.5M| ulong32 __RORc_tmp = (word); \ | | | | 285| 57.5M| __asm__ ("rorl %2, %0" : \ | | | | 286| 57.5M| "=r" (__RORc_tmp) : \ | | | | 287| 57.5M| "0" (__RORc_tmp), \ | | | | 288| 57.5M| "I" (i)); \ | | | | 289| 57.5M| __RORc_tmp; \ | | | | 290| 57.5M| }) | | ------------------ ------------------ 330| 57.5M| Te3(byte(s1, 0)) ^ ------------------ | | 309| 57.5M|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 57.5M|#define RORc(word,i) ({ \ | | | | 284| 57.5M| ulong32 __RORc_tmp = (word); \ | | | | 285| 57.5M| __asm__ ("rorl %2, %0" : \ | | | | 286| 57.5M| "=r" (__RORc_tmp) : \ | | | | 287| 57.5M| "0" (__RORc_tmp), \ | | | | 288| 57.5M| "I" (i)); \ | | | | 289| 57.5M| __RORc_tmp; \ | | | | 290| 57.5M| }) | | ------------------ ------------------ 331| 57.5M| rk[2]; 332| 57.5M| t3 = 333| 57.5M| Te0(byte(s3, 3)) ^ ------------------ | | 306| 57.5M|#define Te0(x) TE0[x] ------------------ 334| 57.5M| Te1(byte(s0, 2)) ^ ------------------ | | 307| 57.5M|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 57.5M|#define RORc(word,i) ({ \ | | | | 284| 57.5M| ulong32 __RORc_tmp = (word); \ | | | | 285| 57.5M| __asm__ ("rorl %2, %0" : \ | | | | 286| 57.5M| "=r" (__RORc_tmp) : \ | | | | 287| 57.5M| "0" (__RORc_tmp), \ | | | | 288| 57.5M| "I" (i)); \ | | | | 289| 57.5M| __RORc_tmp; \ | | | | 290| 57.5M| }) | | ------------------ ------------------ 335| 57.5M| Te2(byte(s1, 1)) ^ ------------------ | | 308| 57.5M|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 57.5M|#define RORc(word,i) ({ \ | | | | 284| 57.5M| ulong32 __RORc_tmp = (word); \ | | | | 285| 57.5M| __asm__ ("rorl %2, %0" : \ | | | | 286| 57.5M| "=r" (__RORc_tmp) : \ | | | | 287| 57.5M| "0" (__RORc_tmp), \ | | | | 288| 57.5M| "I" (i)); \ | | | | 289| 57.5M| __RORc_tmp; \ | | | | 290| 57.5M| }) | | ------------------ ------------------ 336| 57.5M| Te3(byte(s2, 0)) ^ ------------------ | | 309| 57.5M|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 57.5M|#define RORc(word,i) ({ \ | | | | 284| 57.5M| ulong32 __RORc_tmp = (word); \ | | | | 285| 57.5M| __asm__ ("rorl %2, %0" : \ | | | | 286| 57.5M| "=r" (__RORc_tmp) : \ | | | | 287| 57.5M| "0" (__RORc_tmp), \ | | | | 288| 57.5M| "I" (i)); \ | | | | 289| 57.5M| __RORc_tmp; \ | | | | 290| 57.5M| }) | | ------------------ ------------------ 337| 57.5M| rk[3]; 338| 57.5M| if (r == Nr-2) { ------------------ | Branch (338:13): [True: 5.85M, False: 51.7M] ------------------ 339| 5.85M| break; 340| 5.85M| } 341| 51.7M| s0 = t0; s1 = t1; s2 = t2; s3 = t3; 342| 51.7M| } 343| 5.85M| rk += 4; 344| | 345| |#else 346| | 347| | /* 348| | * Nr - 1 full rounds: 349| | */ 350| | r = Nr >> 1; 351| | for (;;) { 352| | t0 = 353| | Te0(byte(s0, 3)) ^ 354| | Te1(byte(s1, 2)) ^ 355| | Te2(byte(s2, 1)) ^ 356| | Te3(byte(s3, 0)) ^ 357| | rk[4]; 358| | t1 = 359| | Te0(byte(s1, 3)) ^ 360| | Te1(byte(s2, 2)) ^ 361| | Te2(byte(s3, 1)) ^ 362| | Te3(byte(s0, 0)) ^ 363| | rk[5]; 364| | t2 = 365| | Te0(byte(s2, 3)) ^ 366| | Te1(byte(s3, 2)) ^ 367| | Te2(byte(s0, 1)) ^ 368| | Te3(byte(s1, 0)) ^ 369| | rk[6]; 370| | t3 = 371| | Te0(byte(s3, 3)) ^ 372| | Te1(byte(s0, 2)) ^ 373| | Te2(byte(s1, 1)) ^ 374| | Te3(byte(s2, 0)) ^ 375| | rk[7]; 376| | 377| | rk += 8; 378| | if (--r == 0) { 379| | break; 380| | } 381| | 382| | s0 = 383| | Te0(byte(t0, 3)) ^ 384| | Te1(byte(t1, 2)) ^ 385| | Te2(byte(t2, 1)) ^ 386| | Te3(byte(t3, 0)) ^ 387| | rk[0]; 388| | s1 = 389| | Te0(byte(t1, 3)) ^ 390| | Te1(byte(t2, 2)) ^ 391| | Te2(byte(t3, 1)) ^ 392| | Te3(byte(t0, 0)) ^ 393| | rk[1]; 394| | s2 = 395| | Te0(byte(t2, 3)) ^ 396| | Te1(byte(t3, 2)) ^ 397| | Te2(byte(t0, 1)) ^ 398| | Te3(byte(t1, 0)) ^ 399| | rk[2]; 400| | s3 = 401| | Te0(byte(t3, 3)) ^ 402| | Te1(byte(t0, 2)) ^ 403| | Te2(byte(t1, 1)) ^ 404| | Te3(byte(t2, 0)) ^ 405| | rk[3]; 406| | } 407| | 408| |#endif 409| | 410| | /* 411| | * apply last round and 412| | * map cipher state to byte array block: 413| | */ 414| 5.85M| s0 = 415| 5.85M| (Te4_3[byte(t0, 3)]) ^ ------------------ | | 319| 5.85M|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t0, 3)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 416| 5.85M| (Te4_2[byte(t1, 2)]) ^ ------------------ | | 318| 5.85M|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t1, 2)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 417| 5.85M| (Te4_1[byte(t2, 1)]) ^ ------------------ | | 317| 5.85M|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t2, 1)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 418| 5.85M| (Te4_0[byte(t3, 0)]) ^ ------------------ | | 316| 5.85M|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t3, 0)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 419| 5.85M| rk[0]; 420| 5.85M| STORE32H(s0, ct); ------------------ | | 62| 5.85M|#define STORE32H(x, y) \ | | 63| 5.85M|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 5.85M| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 5.85M|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 421| 5.85M| s1 = 422| 5.85M| (Te4_3[byte(t1, 3)]) ^ ------------------ | | 319| 5.85M|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t1, 3)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 423| 5.85M| (Te4_2[byte(t2, 2)]) ^ ------------------ | | 318| 5.85M|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t2, 2)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 424| 5.85M| (Te4_1[byte(t3, 1)]) ^ ------------------ | | 317| 5.85M|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t3, 1)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 425| 5.85M| (Te4_0[byte(t0, 0)]) ^ ------------------ | | 316| 5.85M|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t0, 0)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 426| 5.85M| rk[1]; 427| 5.85M| STORE32H(s1, ct+4); ------------------ | | 62| 5.85M|#define STORE32H(x, y) \ | | 63| 5.85M|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 5.85M| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 5.85M|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 428| 5.85M| s2 = 429| 5.85M| (Te4_3[byte(t2, 3)]) ^ ------------------ | | 319| 5.85M|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t2, 3)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 430| 5.85M| (Te4_2[byte(t3, 2)]) ^ ------------------ | | 318| 5.85M|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t3, 2)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 431| 5.85M| (Te4_1[byte(t0, 1)]) ^ ------------------ | | 317| 5.85M|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t0, 1)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 432| 5.85M| (Te4_0[byte(t1, 0)]) ^ ------------------ | | 316| 5.85M|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t1, 0)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 433| 5.85M| rk[2]; 434| 5.85M| STORE32H(s2, ct+8); ------------------ | | 62| 5.85M|#define STORE32H(x, y) \ | | 63| 5.85M|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 5.85M| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 5.85M|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 435| 5.85M| s3 = 436| 5.85M| (Te4_3[byte(t3, 3)]) ^ ------------------ | | 319| 5.85M|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t3, 3)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 437| 5.85M| (Te4_2[byte(t0, 2)]) ^ ------------------ | | 318| 5.85M|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t0, 2)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 438| 5.85M| (Te4_1[byte(t1, 1)]) ^ ------------------ | | 317| 5.85M|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t1, 1)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 439| 5.85M| (Te4_0[byte(t2, 0)]) ^ ------------------ | | 316| 5.85M|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t2, 0)]) ^ ------------------ | | 436| 5.85M| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 440| 5.85M| rk[3]; 441| 5.85M| STORE32H(s3, ct+12); ------------------ | | 62| 5.85M|#define STORE32H(x, y) \ | | 63| 5.85M|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 5.85M| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 5.85M|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 442| | 443| 5.85M| return CRYPT_OK; 444| 5.85M|} aes.c:setup_mix: 95| 39.2k|{ 96| 39.2k| return (Te4_3[byte(temp, 2)]) ^ ------------------ | | 319| 39.2k|#define Te4_3 0xFF000000 & Te4 ------------------ return (Te4_3[byte(temp, 2)]) ^ ------------------ | | 436| 39.2k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 97| 39.2k| (Te4_2[byte(temp, 1)]) ^ ------------------ | | 318| 39.2k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(temp, 1)]) ^ ------------------ | | 436| 39.2k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 98| 39.2k| (Te4_1[byte(temp, 0)]) ^ ------------------ | | 317| 39.2k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(temp, 0)]) ^ ------------------ | | 436| 39.2k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 99| 39.2k| (Te4_0[byte(temp, 3)]); ------------------ | | 316| 39.2k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(temp, 3)]); ------------------ | | 436| 39.2k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 100| 39.2k|} aes.c:setup_mix2: 105| 147k|{ 106| 147k| return Td0(255 & Te4[byte(temp, 3)]) ^ ------------------ | | 311| 147k|#define Td0(x) TD0[x] ------------------ 107| 147k| Td1(255 & Te4[byte(temp, 2)]) ^ ------------------ | | 312| 147k|#define Td1(x) RORc(TD0[x], 8) | | ------------------ | | | | 283| 147k|#define RORc(word,i) ({ \ | | | | 284| 147k| ulong32 __RORc_tmp = (word); \ | | | | 285| 147k| __asm__ ("rorl %2, %0" : \ | | | | 286| 147k| "=r" (__RORc_tmp) : \ | | | | 287| 147k| "0" (__RORc_tmp), \ | | | | 288| 147k| "I" (i)); \ | | | | 289| 147k| __RORc_tmp; \ | | | | 290| 147k| }) | | ------------------ ------------------ 108| 147k| Td2(255 & Te4[byte(temp, 1)]) ^ ------------------ | | 313| 147k|#define Td2(x) RORc(TD0[x], 16) | | ------------------ | | | | 283| 147k|#define RORc(word,i) ({ \ | | | | 284| 147k| ulong32 __RORc_tmp = (word); \ | | | | 285| 147k| __asm__ ("rorl %2, %0" : \ | | | | 286| 147k| "=r" (__RORc_tmp) : \ | | | | 287| 147k| "0" (__RORc_tmp), \ | | | | 288| 147k| "I" (i)); \ | | | | 289| 147k| __RORc_tmp; \ | | | | 290| 147k| }) | | ------------------ ------------------ 109| 147k| Td3(255 & Te4[byte(temp, 0)]); ------------------ | | 314| 147k|#define Td3(x) RORc(TD0[x], 24) | | ------------------ | | | | 283| 147k|#define RORc(word,i) ({ \ | | | | 284| 147k| ulong32 __RORc_tmp = (word); \ | | | | 285| 147k| __asm__ ("rorl %2, %0" : \ | | | | 286| 147k| "=r" (__RORc_tmp) : \ | | | | 287| 147k| "0" (__RORc_tmp), \ | | | | 288| 147k| "I" (i)); \ | | | | 289| 147k| __RORc_tmp; \ | | | | 290| 147k| }) | | ------------------ ------------------ 110| 147k|} sha1_init: 164| 17.9k|{ 165| 17.9k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 17.9k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.9k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 166| 17.9k| md->sha1.state[0] = 0x67452301UL; 167| 17.9k| md->sha1.state[1] = 0xefcdab89UL; 168| 17.9k| md->sha1.state[2] = 0x98badcfeUL; 169| 17.9k| md->sha1.state[3] = 0x10325476UL; 170| 17.9k| md->sha1.state[4] = 0xc3d2e1f0UL; 171| 17.9k| md->sha1.curlen = 0; 172| 17.9k| md->sha1.length = 0; 173| 17.9k| return CRYPT_OK; 174| 17.9k|} sha1_done: 192| 44.8k|{ 193| 44.8k| int i; 194| | 195| 44.8k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 44.8k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 44.8k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 196| 44.8k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 44.8k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 44.8k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 197| | 198| 44.8k| if (md->sha1.curlen >= sizeof(md->sha1.buf)) { ------------------ | Branch (198:9): [True: 0, False: 44.8k] ------------------ 199| 0| return CRYPT_INVALID_ARG; 200| 0| } 201| | 202| | /* increase the length of the message */ 203| 44.8k| md->sha1.length += md->sha1.curlen * 8; 204| | 205| | /* append the '1' bit */ 206| 44.8k| md->sha1.buf[md->sha1.curlen++] = (unsigned char)0x80; 207| | 208| | /* if the length is currently above 56 bytes we append zeros 209| | * then compress. Then we can fall back to padding zeros and length 210| | * encoding like normal. 211| | */ 212| 44.8k| if (md->sha1.curlen > 56) { ------------------ | Branch (212:9): [True: 291, False: 44.5k] ------------------ 213| 811| while (md->sha1.curlen < 64) { ------------------ | Branch (213:16): [True: 520, False: 291] ------------------ 214| 520| md->sha1.buf[md->sha1.curlen++] = (unsigned char)0; 215| 520| } 216| 291| sha1_compress(md, md->sha1.buf); 217| 291| md->sha1.curlen = 0; 218| 291| } 219| | 220| | /* pad upto 56 bytes of zeroes */ 221| 1.14M| while (md->sha1.curlen < 56) { ------------------ | Branch (221:12): [True: 1.10M, False: 44.8k] ------------------ 222| 1.10M| md->sha1.buf[md->sha1.curlen++] = (unsigned char)0; 223| 1.10M| } 224| | 225| | /* store length */ 226| 44.8k| STORE64H(md->sha1.length, md->sha1.buf+56); ------------------ | | 101| 44.8k|#define STORE64H(x, y) \ | | 102| 44.8k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 44.8k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 44.8k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 227| 44.8k| sha1_compress(md, md->sha1.buf); 228| | 229| | /* copy output */ 230| 269k| for (i = 0; i < 5; i++) { ------------------ | Branch (230:17): [True: 224k, False: 44.8k] ------------------ 231| 224k| STORE32H(md->sha1.state[i], out+(4*i)); ------------------ | | 62| 224k|#define STORE32H(x, y) \ | | 63| 224k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 224k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 224k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 232| 224k| } 233| |#ifdef LTC_CLEAN_STACK 234| | zeromem(md, sizeof(hash_state)); 235| |#endif 236| 44.8k| return CRYPT_OK; 237| 44.8k|} sha1.c:sha1_compress: 47| 724k|{ 48| 724k| ulong32 a,b,c,d,e,W[80],i; 49| 724k|#ifdef LTC_SMALL_CODE 50| 724k| ulong32 t; 51| 724k|#endif 52| | 53| | /* copy the state into 512-bits into W[0..15] */ 54| 12.3M| for (i = 0; i < 16; i++) { ------------------ | Branch (54:17): [True: 11.5M, False: 724k] ------------------ 55| 11.5M| LOAD32H(W[i], buf + (4*i)); ------------------ | | 66| 11.5M|#define LOAD32H(x, y) \ | | 67| 11.5M|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 11.5M|#define XMEMCPY memcpy | | ------------------ | | 68| 11.5M| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 56| 11.5M| } 57| | 58| | /* copy state */ 59| 724k| a = md->sha1.state[0]; 60| 724k| b = md->sha1.state[1]; 61| 724k| c = md->sha1.state[2]; 62| 724k| d = md->sha1.state[3]; 63| 724k| e = md->sha1.state[4]; 64| | 65| | /* expand it */ 66| 47.1M| for (i = 16; i < 80; i++) { ------------------ | Branch (66:18): [True: 46.3M, False: 724k] ------------------ 67| 46.3M| W[i] = ROL(W[i-3] ^ W[i-8] ^ W[i-14] ^ W[i-16], 1); 68| 46.3M| } 69| | 70| | /* compress */ 71| | /* round one */ 72| 724k| #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); 73| 724k| #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); 74| 724k| #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); 75| 724k| #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); 76| | 77| 724k|#ifdef LTC_SMALL_CODE 78| | 79| 15.2M| for (i = 0; i < 20; ) { ------------------ | Branch (79:17): [True: 14.4M, False: 724k] ------------------ 80| 14.4M| FF0(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; ------------------ | | 72| 14.4M| #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 14.4M|#define ROLc(word,i) ({ \ | | | | 276| 14.4M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 14.4M| __asm__ ("roll %2, %0" : \ | | | | 278| 14.4M| "=r" (__ROLc_tmp) : \ | | | | 279| 14.4M| "0" (__ROLc_tmp), \ | | | | 280| 14.4M| "I" (i)); \ | | | | 281| 14.4M| __ROLc_tmp; \ | | | | 282| 14.4M| }) | | ------------------ | | #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); | | ------------------ | | | | 37| 14.4M|#define F0(x,y,z) (z ^ (x & (y ^ z))) | | ------------------ | | #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 14.4M|#define ROLc(word,i) ({ \ | | | | 276| 14.4M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 14.4M| __asm__ ("roll %2, %0" : \ | | | | 278| 14.4M| "=r" (__ROLc_tmp) : \ | | | | 279| 14.4M| "0" (__ROLc_tmp), \ | | | | 280| 14.4M| "I" (i)); \ | | | | 281| 14.4M| __ROLc_tmp; \ | | | | 282| 14.4M| }) | | ------------------ ------------------ 81| 14.4M| } 82| | 83| 15.2M| for (; i < 40; ) { ------------------ | Branch (83:12): [True: 14.4M, False: 724k] ------------------ 84| 14.4M| FF1(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; ------------------ | | 73| 14.4M| #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 14.4M|#define ROLc(word,i) ({ \ | | | | 276| 14.4M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 14.4M| __asm__ ("roll %2, %0" : \ | | | | 278| 14.4M| "=r" (__ROLc_tmp) : \ | | | | 279| 14.4M| "0" (__ROLc_tmp), \ | | | | 280| 14.4M| "I" (i)); \ | | | | 281| 14.4M| __ROLc_tmp; \ | | | | 282| 14.4M| }) | | ------------------ | | #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); | | ------------------ | | | | 38| 14.4M|#define F1(x,y,z) (x ^ y ^ z) | | ------------------ | | #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 14.4M|#define ROLc(word,i) ({ \ | | | | 276| 14.4M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 14.4M| __asm__ ("roll %2, %0" : \ | | | | 278| 14.4M| "=r" (__ROLc_tmp) : \ | | | | 279| 14.4M| "0" (__ROLc_tmp), \ | | | | 280| 14.4M| "I" (i)); \ | | | | 281| 14.4M| __ROLc_tmp; \ | | | | 282| 14.4M| }) | | ------------------ ------------------ 85| 14.4M| } 86| | 87| 15.2M| for (; i < 60; ) { ------------------ | Branch (87:12): [True: 14.4M, False: 724k] ------------------ 88| 14.4M| FF2(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; ------------------ | | 74| 14.4M| #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); | | ------------------ | | | | 275| 14.4M|#define ROLc(word,i) ({ \ | | | | 276| 14.4M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 14.4M| __asm__ ("roll %2, %0" : \ | | | | 278| 14.4M| "=r" (__ROLc_tmp) : \ | | | | 279| 14.4M| "0" (__ROLc_tmp), \ | | | | 280| 14.4M| "I" (i)); \ | | | | 281| 14.4M| __ROLc_tmp; \ | | | | 282| 14.4M| }) | | ------------------ | | #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); | | ------------------ | | | | 39| 14.4M|#define F2(x,y,z) ((x & y) | (z & (x | y))) | | ------------------ | | #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); | | ------------------ | | | | 275| 14.4M|#define ROLc(word,i) ({ \ | | | | 276| 14.4M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 14.4M| __asm__ ("roll %2, %0" : \ | | | | 278| 14.4M| "=r" (__ROLc_tmp) : \ | | | | 279| 14.4M| "0" (__ROLc_tmp), \ | | | | 280| 14.4M| "I" (i)); \ | | | | 281| 14.4M| __ROLc_tmp; \ | | | | 282| 14.4M| }) | | ------------------ ------------------ 89| 14.4M| } 90| | 91| 15.2M| for (; i < 80; ) { ------------------ | Branch (91:12): [True: 14.4M, False: 724k] ------------------ 92| 14.4M| FF3(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; ------------------ | | 75| 14.4M| #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 14.4M|#define ROLc(word,i) ({ \ | | | | 276| 14.4M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 14.4M| __asm__ ("roll %2, %0" : \ | | | | 278| 14.4M| "=r" (__ROLc_tmp) : \ | | | | 279| 14.4M| "0" (__ROLc_tmp), \ | | | | 280| 14.4M| "I" (i)); \ | | | | 281| 14.4M| __ROLc_tmp; \ | | | | 282| 14.4M| }) | | ------------------ | | #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); | | ------------------ | | | | 40| 14.4M|#define F3(x,y,z) (x ^ y ^ z) | | ------------------ | | #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 14.4M|#define ROLc(word,i) ({ \ | | | | 276| 14.4M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 14.4M| __asm__ ("roll %2, %0" : \ | | | | 278| 14.4M| "=r" (__ROLc_tmp) : \ | | | | 279| 14.4M| "0" (__ROLc_tmp), \ | | | | 280| 14.4M| "I" (i)); \ | | | | 281| 14.4M| __ROLc_tmp; \ | | | | 282| 14.4M| }) | | ------------------ ------------------ 93| 14.4M| } 94| | 95| |#else 96| | 97| | for (i = 0; i < 20; ) { 98| | FF0(a,b,c,d,e,i++); 99| | FF0(e,a,b,c,d,i++); 100| | FF0(d,e,a,b,c,i++); 101| | FF0(c,d,e,a,b,i++); 102| | FF0(b,c,d,e,a,i++); 103| | } 104| | 105| | /* round two */ 106| | for (; i < 40; ) { 107| | FF1(a,b,c,d,e,i++); 108| | FF1(e,a,b,c,d,i++); 109| | FF1(d,e,a,b,c,i++); 110| | FF1(c,d,e,a,b,i++); 111| | FF1(b,c,d,e,a,i++); 112| | } 113| | 114| | /* round three */ 115| | for (; i < 60; ) { 116| | FF2(a,b,c,d,e,i++); 117| | FF2(e,a,b,c,d,i++); 118| | FF2(d,e,a,b,c,i++); 119| | FF2(c,d,e,a,b,i++); 120| | FF2(b,c,d,e,a,i++); 121| | } 122| | 123| | /* round four */ 124| | for (; i < 80; ) { 125| | FF3(a,b,c,d,e,i++); 126| | FF3(e,a,b,c,d,i++); 127| | FF3(d,e,a,b,c,i++); 128| | FF3(c,d,e,a,b,i++); 129| | FF3(b,c,d,e,a,i++); 130| | } 131| |#endif 132| | 133| 724k| #undef FF0 134| 724k| #undef FF1 135| 724k| #undef FF2 136| 724k| #undef FF3 137| | 138| | /* store */ 139| 724k| md->sha1.state[0] = md->sha1.state[0] + a; 140| 724k| md->sha1.state[1] = md->sha1.state[1] + b; 141| 724k| md->sha1.state[2] = md->sha1.state[2] + c; 142| 724k| md->sha1.state[3] = md->sha1.state[3] + d; 143| 724k| md->sha1.state[4] = md->sha1.state[4] + e; 144| | 145| 724k| return CRYPT_OK; 146| 724k|} sha256_init: 205| 292k|{ 206| 292k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 292k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 292k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 207| | 208| 292k| md->sha256.curlen = 0; 209| 292k| md->sha256.length = 0; 210| 292k| md->sha256.state[0] = 0x6A09E667UL; 211| 292k| md->sha256.state[1] = 0xBB67AE85UL; 212| 292k| md->sha256.state[2] = 0x3C6EF372UL; 213| 292k| md->sha256.state[3] = 0xA54FF53AUL; 214| 292k| md->sha256.state[4] = 0x510E527FUL; 215| 292k| md->sha256.state[5] = 0x9B05688CUL; 216| 292k| md->sha256.state[6] = 0x1F83D9ABUL; 217| 292k| md->sha256.state[7] = 0x5BE0CD19UL; 218| 292k| return CRYPT_OK; 219| 292k|} sha256_done: 237| 313k|{ 238| 313k| int i; 239| | 240| 313k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 313k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 313k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 241| 313k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 313k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 313k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 242| | 243| 313k| if (md->sha256.curlen >= sizeof(md->sha256.buf)) { ------------------ | Branch (243:9): [True: 0, False: 313k] ------------------ 244| 0| return CRYPT_INVALID_ARG; 245| 0| } 246| | 247| | 248| | /* increase the length of the message */ 249| 313k| md->sha256.length += md->sha256.curlen * 8; 250| | 251| | /* append the '1' bit */ 252| 313k| md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80; 253| | 254| | /* if the length is currently above 56 bytes we append zeros 255| | * then compress. Then we can fall back to padding zeros and length 256| | * encoding like normal. 257| | */ 258| 313k| if (md->sha256.curlen > 56) { ------------------ | Branch (258:9): [True: 1.15k, False: 312k] ------------------ 259| 3.55k| while (md->sha256.curlen < 64) { ------------------ | Branch (259:16): [True: 2.40k, False: 1.15k] ------------------ 260| 2.40k| md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; 261| 2.40k| } 262| 1.15k| sha256_compress(md, md->sha256.buf); 263| 1.15k| md->sha256.curlen = 0; 264| 1.15k| } 265| | 266| | /* pad upto 56 bytes of zeroes */ 267| 7.28M| while (md->sha256.curlen < 56) { ------------------ | Branch (267:12): [True: 6.97M, False: 313k] ------------------ 268| 6.97M| md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; 269| 6.97M| } 270| | 271| | /* store length */ 272| 313k| STORE64H(md->sha256.length, md->sha256.buf+56); ------------------ | | 101| 313k|#define STORE64H(x, y) \ | | 102| 313k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 313k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 313k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 273| 313k| sha256_compress(md, md->sha256.buf); 274| | 275| | /* copy output */ 276| 2.82M| for (i = 0; i < 8; i++) { ------------------ | Branch (276:17): [True: 2.50M, False: 313k] ------------------ 277| 2.50M| STORE32H(md->sha256.state[i], out+(4*i)); ------------------ | | 62| 2.50M|#define STORE32H(x, y) \ | | 63| 2.50M|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 2.50M| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 2.50M|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 278| 2.50M| } 279| |#ifdef LTC_CLEAN_STACK 280| | zeromem(md, sizeof(hash_state)); 281| |#endif 282| 313k| return CRYPT_OK; 283| 313k|} sha256.c:sha256_compress: 71| 1.25M|{ 72| 1.25M| ulong32 S[8], W[64], t0, t1; 73| 1.25M|#ifdef LTC_SMALL_CODE 74| 1.25M| ulong32 t; 75| 1.25M|#endif 76| 1.25M| int i; 77| | 78| | /* copy state into S */ 79| 11.3M| for (i = 0; i < 8; i++) { ------------------ | Branch (79:17): [True: 10.0M, False: 1.25M] ------------------ 80| 10.0M| S[i] = md->sha256.state[i]; 81| 10.0M| } 82| | 83| | /* copy the state into 512-bits into W[0..15] */ 84| 21.4M| for (i = 0; i < 16; i++) { ------------------ | Branch (84:17): [True: 20.1M, False: 1.25M] ------------------ 85| 20.1M| LOAD32H(W[i], buf + (4*i)); ------------------ | | 66| 20.1M|#define LOAD32H(x, y) \ | | 67| 20.1M|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 20.1M|#define XMEMCPY memcpy | | ------------------ | | 68| 20.1M| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 86| 20.1M| } 87| | 88| | /* fill W[16..63] */ 89| 61.7M| for (i = 16; i < 64; i++) { ------------------ | Branch (89:18): [True: 60.4M, False: 1.25M] ------------------ 90| 60.4M| W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 63| 60.4M|#define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) | | ------------------ | | | | 58| 60.4M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 60.4M|#define RORc(word,i) ({ \ | | | | | | 284| 60.4M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 60.4M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 60.4M| "=r" (__RORc_tmp) : \ | | | | | | 287| 60.4M| "0" (__RORc_tmp), \ | | | | | | 288| 60.4M| "I" (i)); \ | | | | | | 289| 60.4M| __RORc_tmp; \ | | | | | | 290| 60.4M| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) | | ------------------ | | | | 58| 60.4M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 60.4M|#define RORc(word,i) ({ \ | | | | | | 284| 60.4M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 60.4M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 60.4M| "=r" (__RORc_tmp) : \ | | | | | | 287| 60.4M| "0" (__RORc_tmp), \ | | | | | | 288| 60.4M| "I" (i)); \ | | | | | | 289| 60.4M| __RORc_tmp; \ | | | | | | 290| 60.4M| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) | | ------------------ | | | | 59| 60.4M|#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) | | ------------------ ------------------ W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 62| 60.4M|#define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) | | ------------------ | | | | 58| 60.4M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 60.4M|#define RORc(word,i) ({ \ | | | | | | 284| 60.4M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 60.4M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 60.4M| "=r" (__RORc_tmp) : \ | | | | | | 287| 60.4M| "0" (__RORc_tmp), \ | | | | | | 288| 60.4M| "I" (i)); \ | | | | | | 289| 60.4M| __RORc_tmp; \ | | | | | | 290| 60.4M| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) | | ------------------ | | | | 58| 60.4M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 60.4M|#define RORc(word,i) ({ \ | | | | | | 284| 60.4M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 60.4M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 60.4M| "=r" (__RORc_tmp) : \ | | | | | | 287| 60.4M| "0" (__RORc_tmp), \ | | | | | | 288| 60.4M| "I" (i)); \ | | | | | | 289| 60.4M| __RORc_tmp; \ | | | | | | 290| 60.4M| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) | | ------------------ | | | | 59| 60.4M|#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) | | ------------------ ------------------ 91| 60.4M| } 92| | 93| | /* Compress */ 94| 1.25M|#ifdef LTC_SMALL_CODE 95| 1.25M|#define RND(a,b,c,d,e,f,g,h,i) \ 96| 1.25M| t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ 97| 1.25M| t1 = Sigma0(a) + Maj(a, b, c); \ 98| 1.25M| d += t0; \ 99| 1.25M| h = t0 + t1; 100| | 101| 81.8M| for (i = 0; i < 64; ++i) { ------------------ | Branch (101:18): [True: 80.6M, False: 1.25M] ------------------ 102| 80.6M| RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i); ------------------ | | 96| 80.6M| t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ | | ------------------ | | | | 61| 80.6M|#define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) | | | | ------------------ | | | | | | 58| 80.6M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 80.6M|#define RORc(word,i) ({ \ | | | | | | | | 284| 80.6M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 80.6M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 80.6M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 80.6M| "0" (__RORc_tmp), \ | | | | | | | | 288| 80.6M| "I" (i)); \ | | | | | | | | 289| 80.6M| __RORc_tmp; \ | | | | | | | | 290| 80.6M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) | | | | ------------------ | | | | | | 58| 80.6M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 80.6M|#define RORc(word,i) ({ \ | | | | | | | | 284| 80.6M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 80.6M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 80.6M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 80.6M| "0" (__RORc_tmp), \ | | | | | | | | 288| 80.6M| "I" (i)); \ | | | | | | | | 289| 80.6M| __RORc_tmp; \ | | | | | | | | 290| 80.6M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) | | | | ------------------ | | | | | | 58| 80.6M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 80.6M|#define RORc(word,i) ({ \ | | | | | | | | 284| 80.6M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 80.6M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 80.6M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 80.6M| "0" (__RORc_tmp), \ | | | | | | | | 288| 80.6M| "I" (i)); \ | | | | | | | | 289| 80.6M| __RORc_tmp; \ | | | | | | | | 290| 80.6M| }) | | | | | | ------------------ | | | | ------------------ | | ------------------ | | t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ | | ------------------ | | | | 56| 80.6M|#define Ch(x,y,z) (z ^ (x & (y ^ z))) | | ------------------ | | 97| 80.6M| t1 = Sigma0(a) + Maj(a, b, c); \ | | ------------------ | | | | 60| 80.6M|#define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) | | | | ------------------ | | | | | | 58| 80.6M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 80.6M|#define RORc(word,i) ({ \ | | | | | | | | 284| 80.6M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 80.6M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 80.6M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 80.6M| "0" (__RORc_tmp), \ | | | | | | | | 288| 80.6M| "I" (i)); \ | | | | | | | | 289| 80.6M| __RORc_tmp; \ | | | | | | | | 290| 80.6M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) | | | | ------------------ | | | | | | 58| 80.6M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 80.6M|#define RORc(word,i) ({ \ | | | | | | | | 284| 80.6M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 80.6M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 80.6M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 80.6M| "0" (__RORc_tmp), \ | | | | | | | | 288| 80.6M| "I" (i)); \ | | | | | | | | 289| 80.6M| __RORc_tmp; \ | | | | | | | | 290| 80.6M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) | | | | ------------------ | | | | | | 58| 80.6M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 80.6M|#define RORc(word,i) ({ \ | | | | | | | | 284| 80.6M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 80.6M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 80.6M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 80.6M| "0" (__RORc_tmp), \ | | | | | | | | 288| 80.6M| "I" (i)); \ | | | | | | | | 289| 80.6M| __RORc_tmp; \ | | | | | | | | 290| 80.6M| }) | | | | | | ------------------ | | | | ------------------ | | ------------------ | | t1 = Sigma0(a) + Maj(a, b, c); \ | | ------------------ | | | | 57| 80.6M|#define Maj(x,y,z) (((x | y) & z) | (x & y)) | | ------------------ | | 98| 80.6M| d += t0; \ | | 99| 80.6M| h = t0 + t1; ------------------ 103| 80.6M| t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; 104| 80.6M| S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t; 105| 80.6M| } 106| |#else 107| |#define RND(a,b,c,d,e,f,g,h,i,ki) \ 108| | t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i]; \ 109| | t1 = Sigma0(a) + Maj(a, b, c); \ 110| | d += t0; \ 111| | h = t0 + t1; 112| | 113| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],0,0x428a2f98); 114| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],1,0x71374491); 115| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],2,0xb5c0fbcf); 116| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],3,0xe9b5dba5); 117| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],4,0x3956c25b); 118| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],5,0x59f111f1); 119| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],6,0x923f82a4); 120| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],7,0xab1c5ed5); 121| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],8,0xd807aa98); 122| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],9,0x12835b01); 123| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],10,0x243185be); 124| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],11,0x550c7dc3); 125| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],12,0x72be5d74); 126| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],13,0x80deb1fe); 127| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],14,0x9bdc06a7); 128| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],15,0xc19bf174); 129| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],16,0xe49b69c1); 130| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],17,0xefbe4786); 131| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],18,0x0fc19dc6); 132| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],19,0x240ca1cc); 133| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],20,0x2de92c6f); 134| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],21,0x4a7484aa); 135| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],22,0x5cb0a9dc); 136| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],23,0x76f988da); 137| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],24,0x983e5152); 138| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],25,0xa831c66d); 139| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],26,0xb00327c8); 140| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],27,0xbf597fc7); 141| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],28,0xc6e00bf3); 142| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],29,0xd5a79147); 143| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],30,0x06ca6351); 144| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],31,0x14292967); 145| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],32,0x27b70a85); 146| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],33,0x2e1b2138); 147| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],34,0x4d2c6dfc); 148| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],35,0x53380d13); 149| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],36,0x650a7354); 150| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],37,0x766a0abb); 151| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],38,0x81c2c92e); 152| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],39,0x92722c85); 153| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],40,0xa2bfe8a1); 154| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],41,0xa81a664b); 155| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],42,0xc24b8b70); 156| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],43,0xc76c51a3); 157| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],44,0xd192e819); 158| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],45,0xd6990624); 159| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],46,0xf40e3585); 160| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],47,0x106aa070); 161| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],48,0x19a4c116); 162| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],49,0x1e376c08); 163| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],50,0x2748774c); 164| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],51,0x34b0bcb5); 165| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],52,0x391c0cb3); 166| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],53,0x4ed8aa4a); 167| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],54,0x5b9cca4f); 168| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],55,0x682e6ff3); 169| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],56,0x748f82ee); 170| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],57,0x78a5636f); 171| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],58,0x84c87814); 172| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],59,0x8cc70208); 173| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],60,0x90befffa); 174| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],61,0xa4506ceb); 175| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7); 176| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2); 177| | 178| |#undef RND 179| | 180| |#endif 181| | 182| | /* feedback */ 183| 11.3M| for (i = 0; i < 8; i++) { ------------------ | Branch (183:17): [True: 10.0M, False: 1.25M] ------------------ 184| 10.0M| md->sha256.state[i] = md->sha256.state[i] + S[i]; 185| 10.0M| } 186| 1.25M| return CRYPT_OK; 187| 1.25M|} sha384_init: 42| 3.48k|{ 43| 3.48k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 3.48k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.48k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 44| | 45| 3.48k| md->sha512.curlen = 0; 46| 3.48k| md->sha512.length = 0; 47| 3.48k| md->sha512.state[0] = CONST64(0xcbbb9d5dc1059ed8); ------------------ | | 200| 3.48k| #define CONST64(n) n ## ULL ------------------ 48| 3.48k| md->sha512.state[1] = CONST64(0x629a292a367cd507); ------------------ | | 200| 3.48k| #define CONST64(n) n ## ULL ------------------ 49| 3.48k| md->sha512.state[2] = CONST64(0x9159015a3070dd17); ------------------ | | 200| 3.48k| #define CONST64(n) n ## ULL ------------------ 50| 3.48k| md->sha512.state[3] = CONST64(0x152fecd8f70e5939); ------------------ | | 200| 3.48k| #define CONST64(n) n ## ULL ------------------ 51| 3.48k| md->sha512.state[4] = CONST64(0x67332667ffc00b31); ------------------ | | 200| 3.48k| #define CONST64(n) n ## ULL ------------------ 52| 3.48k| md->sha512.state[5] = CONST64(0x8eb44a8768581511); ------------------ | | 200| 3.48k| #define CONST64(n) n ## ULL ------------------ 53| 3.48k| md->sha512.state[6] = CONST64(0xdb0c2e0d64f98fa7); ------------------ | | 200| 3.48k| #define CONST64(n) n ## ULL ------------------ 54| 3.48k| md->sha512.state[7] = CONST64(0x47b5481dbefa4fa4); ------------------ | | 200| 3.48k| #define CONST64(n) n ## ULL ------------------ 55| 3.48k| return CRYPT_OK; 56| 3.48k|} sha384_done: 65| 12.7k|{ 66| 12.7k| unsigned char buf[64]; 67| | 68| 12.7k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 12.7k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 12.7k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 69| 12.7k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 12.7k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 12.7k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 70| | 71| 12.7k| if (md->sha512.curlen >= sizeof(md->sha512.buf)) { ------------------ | Branch (71:9): [True: 0, False: 12.7k] ------------------ 72| 0| return CRYPT_INVALID_ARG; 73| 0| } 74| | 75| 12.7k| sha512_done(md, buf); 76| 12.7k| XMEMCPY(out, buf, 48); ------------------ | | 39| 12.7k|#define XMEMCPY memcpy ------------------ 77| |#ifdef LTC_CLEAN_STACK 78| | zeromem(buf, sizeof(buf)); 79| |#endif 80| 12.7k| return CRYPT_OK; 81| 12.7k|} sha512_init: 174| 1.55k|{ 175| 1.55k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 1.55k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.55k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 176| 1.55k| md->sha512.curlen = 0; 177| 1.55k| md->sha512.length = 0; 178| 1.55k| md->sha512.state[0] = CONST64(0x6a09e667f3bcc908); ------------------ | | 200| 1.55k| #define CONST64(n) n ## ULL ------------------ 179| 1.55k| md->sha512.state[1] = CONST64(0xbb67ae8584caa73b); ------------------ | | 200| 1.55k| #define CONST64(n) n ## ULL ------------------ 180| 1.55k| md->sha512.state[2] = CONST64(0x3c6ef372fe94f82b); ------------------ | | 200| 1.55k| #define CONST64(n) n ## ULL ------------------ 181| 1.55k| md->sha512.state[3] = CONST64(0xa54ff53a5f1d36f1); ------------------ | | 200| 1.55k| #define CONST64(n) n ## ULL ------------------ 182| 1.55k| md->sha512.state[4] = CONST64(0x510e527fade682d1); ------------------ | | 200| 1.55k| #define CONST64(n) n ## ULL ------------------ 183| 1.55k| md->sha512.state[5] = CONST64(0x9b05688c2b3e6c1f); ------------------ | | 200| 1.55k| #define CONST64(n) n ## ULL ------------------ 184| 1.55k| md->sha512.state[6] = CONST64(0x1f83d9abfb41bd6b); ------------------ | | 200| 1.55k| #define CONST64(n) n ## ULL ------------------ 185| 1.55k| md->sha512.state[7] = CONST64(0x5be0cd19137e2179); ------------------ | | 200| 1.55k| #define CONST64(n) n ## ULL ------------------ 186| 1.55k| return CRYPT_OK; 187| 1.55k|} sha512_done: 205| 17.2k|{ 206| 17.2k| int i; 207| | 208| 17.2k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 17.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 209| 17.2k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 17.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 210| | 211| 17.2k| if (md->sha512.curlen >= sizeof(md->sha512.buf)) { ------------------ | Branch (211:9): [True: 0, False: 17.2k] ------------------ 212| 0| return CRYPT_INVALID_ARG; 213| 0| } 214| | 215| | /* increase the length of the message */ 216| 17.2k| md->sha512.length += md->sha512.curlen * CONST64(8); ------------------ | | 200| 17.2k| #define CONST64(n) n ## ULL ------------------ 217| | 218| | /* append the '1' bit */ 219| 17.2k| md->sha512.buf[md->sha512.curlen++] = (unsigned char)0x80; 220| | 221| | /* if the length is currently above 112 bytes we append zeros 222| | * then compress. Then we can fall back to padding zeros and length 223| | * encoding like normal. 224| | */ 225| 17.2k| if (md->sha512.curlen > 112) { ------------------ | Branch (225:9): [True: 3.00k, False: 14.2k] ------------------ 226| 20.3k| while (md->sha512.curlen < 128) { ------------------ | Branch (226:16): [True: 17.3k, False: 3.00k] ------------------ 227| 17.3k| md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; 228| 17.3k| } 229| 3.00k| sha512_compress(md, md->sha512.buf); 230| 3.00k| md->sha512.curlen = 0; 231| 3.00k| } 232| | 233| | /* pad upto 120 bytes of zeroes 234| | * note: that from 112 to 120 is the 64 MSB of the length. We assume that you won't hash 235| | * > 2^64 bits of data... :-) 236| | */ 237| 1.05M| while (md->sha512.curlen < 120) { ------------------ | Branch (237:12): [True: 1.03M, False: 17.2k] ------------------ 238| 1.03M| md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; 239| 1.03M| } 240| | 241| | /* store length */ 242| 17.2k| STORE64H(md->sha512.length, md->sha512.buf+120); ------------------ | | 101| 17.2k|#define STORE64H(x, y) \ | | 102| 17.2k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 17.2k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 243| 17.2k| sha512_compress(md, md->sha512.buf); 244| | 245| | /* copy output */ 246| 154k| for (i = 0; i < 8; i++) { ------------------ | Branch (246:17): [True: 137k, False: 17.2k] ------------------ 247| 137k| STORE64H(md->sha512.state[i], out+(8*i)); ------------------ | | 101| 137k|#define STORE64H(x, y) \ | | 102| 137k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 137k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 137k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 248| 137k| } 249| |#ifdef LTC_CLEAN_STACK 250| | zeromem(md, sizeof(hash_state)); 251| |#endif 252| 17.2k| return CRYPT_OK; 253| 17.2k|} sha512.c:sha512_compress: 96| 40.5k|{ 97| 40.5k| ulong64 S[8], W[80], t0, t1; 98| 40.5k| int i; 99| | 100| | /* copy state into S */ 101| 364k| for (i = 0; i < 8; i++) { ------------------ | Branch (101:17): [True: 324k, False: 40.5k] ------------------ 102| 324k| S[i] = md->sha512.state[i]; 103| 324k| } 104| | 105| | /* copy the state into 1024-bits into W[0..15] */ 106| 689k| for (i = 0; i < 16; i++) { ------------------ | Branch (106:17): [True: 648k, False: 40.5k] ------------------ 107| 648k| LOAD64H(W[i], buf + (8*i)); ------------------ | | 105| 648k|#define LOAD64H(x, y) \ | | 106| 648k|do { XMEMCPY (&(x), (y), 8); \ | | ------------------ | | | | 39| 648k|#define XMEMCPY memcpy | | ------------------ | | 107| 648k| (x) = __builtin_bswap64 ((x)); } while(0) | | ------------------ | | | Branch (107:46): [Folded - Ignored] | | ------------------ ------------------ 108| 648k| } 109| | 110| | /* fill W[16..79] */ 111| 2.63M| for (i = 16; i < 80; i++) { ------------------ | Branch (111:18): [True: 2.59M, False: 40.5k] ------------------ 112| 2.59M| W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 88| 2.59M|#define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) | | ------------------ | | | | 83| 2.59M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 2.59M|#define ROR64c(word,i) ({ \ | | | | | | 385| 2.59M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 2.59M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 2.59M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 2.59M| "0" (__ROR64c_tmp), \ | | | | | | 389| 2.59M| "J" (i)); \ | | | | | | 390| 2.59M| __ROR64c_tmp; \ | | | | | | 391| 2.59M| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) | | ------------------ | | | | 83| 2.59M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 2.59M|#define ROR64c(word,i) ({ \ | | | | | | 385| 2.59M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 2.59M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 2.59M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 2.59M| "0" (__ROR64c_tmp), \ | | | | | | 389| 2.59M| "J" (i)); \ | | | | | | 390| 2.59M| __ROR64c_tmp; \ | | | | | | 391| 2.59M| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) | | ------------------ | | | | 84| 2.59M|#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) | | | | ------------------ | | | | | | 200| 2.59M| #define CONST64(n) n ## ULL | | | | ------------------ | | ------------------ ------------------ W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 87| 2.59M|#define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) | | ------------------ | | | | 83| 2.59M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 2.59M|#define ROR64c(word,i) ({ \ | | | | | | 385| 2.59M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 2.59M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 2.59M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 2.59M| "0" (__ROR64c_tmp), \ | | | | | | 389| 2.59M| "J" (i)); \ | | | | | | 390| 2.59M| __ROR64c_tmp; \ | | | | | | 391| 2.59M| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) | | ------------------ | | | | 83| 2.59M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 2.59M|#define ROR64c(word,i) ({ \ | | | | | | 385| 2.59M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 2.59M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 2.59M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 2.59M| "0" (__ROR64c_tmp), \ | | | | | | 389| 2.59M| "J" (i)); \ | | | | | | 390| 2.59M| __ROR64c_tmp; \ | | | | | | 391| 2.59M| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) | | ------------------ | | | | 84| 2.59M|#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) | | | | ------------------ | | | | | | 200| 2.59M| #define CONST64(n) n ## ULL | | | | ------------------ | | ------------------ ------------------ 113| 2.59M| } 114| | 115| | /* Compress */ 116| 40.5k|#ifdef LTC_SMALL_CODE 117| 3.28M| for (i = 0; i < 80; i++) { ------------------ | Branch (117:17): [True: 3.24M, False: 40.5k] ------------------ 118| 3.24M| t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i]; ------------------ | | 86| 3.24M|#define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) | | ------------------ | | | | 83| 3.24M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 3.24M|#define ROR64c(word,i) ({ \ | | | | | | 385| 3.24M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 3.24M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 3.24M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 3.24M| "0" (__ROR64c_tmp), \ | | | | | | 389| 3.24M| "J" (i)); \ | | | | | | 390| 3.24M| __ROR64c_tmp; \ | | | | | | 391| 3.24M| }) | | | | ------------------ | | ------------------ | | #define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) | | ------------------ | | | | 83| 3.24M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 3.24M|#define ROR64c(word,i) ({ \ | | | | | | 385| 3.24M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 3.24M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 3.24M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 3.24M| "0" (__ROR64c_tmp), \ | | | | | | 389| 3.24M| "J" (i)); \ | | | | | | 390| 3.24M| __ROR64c_tmp; \ | | | | | | 391| 3.24M| }) | | | | ------------------ | | ------------------ | | #define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) | | ------------------ | | | | 83| 3.24M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 3.24M|#define ROR64c(word,i) ({ \ | | | | | | 385| 3.24M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 3.24M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 3.24M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 3.24M| "0" (__ROR64c_tmp), \ | | | | | | 389| 3.24M| "J" (i)); \ | | | | | | 390| 3.24M| __ROR64c_tmp; \ | | | | | | 391| 3.24M| }) | | | | ------------------ | | ------------------ ------------------ t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i]; ------------------ | | 81| 3.24M|#define Ch(x,y,z) (z ^ (x & (y ^ z))) ------------------ 119| 3.24M| t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]); ------------------ | | 85| 3.24M|#define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) | | ------------------ | | | | 83| 3.24M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 3.24M|#define ROR64c(word,i) ({ \ | | | | | | 385| 3.24M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 3.24M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 3.24M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 3.24M| "0" (__ROR64c_tmp), \ | | | | | | 389| 3.24M| "J" (i)); \ | | | | | | 390| 3.24M| __ROR64c_tmp; \ | | | | | | 391| 3.24M| }) | | | | ------------------ | | ------------------ | | #define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) | | ------------------ | | | | 83| 3.24M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 3.24M|#define ROR64c(word,i) ({ \ | | | | | | 385| 3.24M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 3.24M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 3.24M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 3.24M| "0" (__ROR64c_tmp), \ | | | | | | 389| 3.24M| "J" (i)); \ | | | | | | 390| 3.24M| __ROR64c_tmp; \ | | | | | | 391| 3.24M| }) | | | | ------------------ | | ------------------ | | #define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) | | ------------------ | | | | 83| 3.24M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 3.24M|#define ROR64c(word,i) ({ \ | | | | | | 385| 3.24M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 3.24M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 3.24M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 3.24M| "0" (__ROR64c_tmp), \ | | | | | | 389| 3.24M| "J" (i)); \ | | | | | | 390| 3.24M| __ROR64c_tmp; \ | | | | | | 391| 3.24M| }) | | | | ------------------ | | ------------------ ------------------ t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]); ------------------ | | 82| 3.24M|#define Maj(x,y,z) (((x | y) & z) | (x & y)) ------------------ 120| 3.24M| S[7] = S[6]; 121| 3.24M| S[6] = S[5]; 122| 3.24M| S[5] = S[4]; 123| 3.24M| S[4] = S[3] + t0; 124| 3.24M| S[3] = S[2]; 125| 3.24M| S[2] = S[1]; 126| 3.24M| S[1] = S[0]; 127| 3.24M| S[0] = t0 + t1; 128| 3.24M| } 129| |#else 130| |#define RND(a,b,c,d,e,f,g,h,i) \ 131| | t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ 132| | t1 = Sigma0(a) + Maj(a, b, c); \ 133| | d += t0; \ 134| | h = t0 + t1; 135| | 136| | for (i = 0; i < 80; i += 8) { 137| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0); 138| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1); 139| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2); 140| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3); 141| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4); 142| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5); 143| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); 144| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); 145| | } 146| |#endif 147| | 148| | 149| | /* feedback */ 150| 364k| for (i = 0; i < 8; i++) { ------------------ | Branch (150:17): [True: 324k, False: 40.5k] ------------------ 151| 324k| md->sha512.state[i] = md->sha512.state[i] + S[i]; 152| 324k| } 153| | 154| 40.5k| return CRYPT_OK; 155| 40.5k|} sha1_process: 491| 80.8k|int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) \ 492| 80.8k|{ \ 493| 80.8k| unsigned long n; \ 494| 80.8k| int err; \ 495| 80.8k| LTC_ARGCHK(md != NULL); \ ------------------ | | 32| 80.8k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 80.8k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 496| 80.8k| LTC_ARGCHK(in != NULL); \ ------------------ | | 32| 80.8k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 80.8k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 497| 80.8k| if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ ------------------ | Branch (497:9): [True: 0, False: 80.8k] ------------------ 498| 0| return CRYPT_INVALID_ARG; \ 499| 0| } \ 500| 80.8k| if ((md-> state_var .length + inlen) < md-> state_var .length) { \ ------------------ | Branch (500:9): [True: 0, False: 80.8k] ------------------ 501| 0| return CRYPT_HASH_OVERFLOW; \ 502| 0| } \ 503| 829k| while (inlen > 0) { \ ------------------ | Branch (503:12): [True: 748k, False: 80.8k] ------------------ 504| 748k| if (md-> state_var .curlen == 0 && inlen >= block_size) { \ ------------------ | Branch (504:13): [True: 697k, False: 50.8k] | Branch (504:44): [True: 662k, False: 34.4k] ------------------ 505| 662k| if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) { \ ------------------ | Branch (505:16): [True: 0, False: 662k] ------------------ 506| 0| return err; \ 507| 0| } \ 508| 662k| md-> state_var .length += block_size * 8; \ 509| 662k| in += block_size; \ 510| 662k| inlen -= block_size; \ 511| 662k| } else { \ 512| 85.3k| n = MIN(inlen, (block_size - md-> state_var .curlen)); \ ------------------ | | 425| 85.3k| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 68.7k, False: 16.5k] | | ------------------ ------------------ 513| 85.3k| XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ ------------------ | | 39| 85.3k|#define XMEMCPY memcpy ------------------ 514| 85.3k| md-> state_var .curlen += n; \ 515| 85.3k| in += n; \ 516| 85.3k| inlen -= n; \ 517| 85.3k| if (md-> state_var .curlen == block_size) { \ ------------------ | Branch (517:16): [True: 16.5k, False: 68.7k] ------------------ 518| 16.5k| if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) { \ ------------------ | Branch (518:19): [True: 0, False: 16.5k] ------------------ 519| 0| return err; \ 520| 0| } \ 521| 16.5k| md-> state_var .length += 8*block_size; \ 522| 16.5k| md-> state_var .curlen = 0; \ 523| 16.5k| } \ 524| 85.3k| } \ 525| 748k| } \ 526| 80.8k| return CRYPT_OK; \ 527| 80.8k|} sha256_process: 491| 638k|int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) \ 492| 638k|{ \ 493| 638k| unsigned long n; \ 494| 638k| int err; \ 495| 638k| LTC_ARGCHK(md != NULL); \ ------------------ | | 32| 638k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 638k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 496| 638k| LTC_ARGCHK(in != NULL); \ ------------------ | | 32| 638k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 638k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 497| 638k| if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ ------------------ | Branch (497:9): [True: 0, False: 638k] ------------------ 498| 0| return CRYPT_INVALID_ARG; \ 499| 0| } \ 500| 638k| if ((md-> state_var .length + inlen) < md-> state_var .length) { \ ------------------ | Branch (500:9): [True: 0, False: 638k] ------------------ 501| 0| return CRYPT_HASH_OVERFLOW; \ 502| 0| } \ 503| 2.19M| while (inlen > 0) { \ ------------------ | Branch (503:12): [True: 1.55M, False: 638k] ------------------ 504| 1.55M| if (md-> state_var .curlen == 0 && inlen >= block_size) { \ ------------------ | Branch (504:13): [True: 1.23M, False: 315k] | Branch (504:44): [True: 911k, False: 326k] ------------------ 505| 911k| if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) { \ ------------------ | Branch (505:16): [True: 0, False: 911k] ------------------ 506| 0| return err; \ 507| 0| } \ 508| 911k| md-> state_var .length += block_size * 8; \ 509| 911k| in += block_size; \ 510| 911k| inlen -= block_size; \ 511| 911k| } else { \ 512| 641k| n = MIN(inlen, (block_size - md-> state_var .curlen)); \ ------------------ | | 425| 641k| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 607k, False: 34.1k] | | ------------------ ------------------ 513| 641k| XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ ------------------ | | 39| 641k|#define XMEMCPY memcpy ------------------ 514| 641k| md-> state_var .curlen += n; \ 515| 641k| in += n; \ 516| 641k| inlen -= n; \ 517| 641k| if (md-> state_var .curlen == block_size) { \ ------------------ | Branch (517:16): [True: 34.1k, False: 607k] ------------------ 518| 34.1k| if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) { \ ------------------ | Branch (518:19): [True: 0, False: 34.1k] ------------------ 519| 0| return err; \ 520| 0| } \ 521| 34.1k| md-> state_var .length += 8*block_size; \ 522| 34.1k| md-> state_var .curlen = 0; \ 523| 34.1k| } \ 524| 641k| } \ 525| 1.55M| } \ 526| 638k| return CRYPT_OK; \ 527| 638k|} sha512_process: 491| 33.4k|int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) \ 492| 33.4k|{ \ 493| 33.4k| unsigned long n; \ 494| 33.4k| int err; \ 495| 33.4k| LTC_ARGCHK(md != NULL); \ ------------------ | | 32| 33.4k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 33.4k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 496| 33.4k| LTC_ARGCHK(in != NULL); \ ------------------ | | 32| 33.4k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 33.4k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 497| 33.4k| if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ ------------------ | Branch (497:9): [True: 0, False: 33.4k] ------------------ 498| 0| return CRYPT_INVALID_ARG; \ 499| 0| } \ 500| 33.4k| if ((md-> state_var .length + inlen) < md-> state_var .length) { \ ------------------ | Branch (500:9): [True: 0, False: 33.4k] ------------------ 501| 0| return CRYPT_HASH_OVERFLOW; \ 502| 0| } \ 503| 87.2k| while (inlen > 0) { \ ------------------ | Branch (503:12): [True: 53.7k, False: 33.4k] ------------------ 504| 53.7k| if (md-> state_var .curlen == 0 && inlen >= block_size) { \ ------------------ | Branch (504:13): [True: 25.3k, False: 28.4k] | Branch (504:44): [True: 17.1k, False: 8.23k] ------------------ 505| 17.1k| if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) { \ ------------------ | Branch (505:16): [True: 0, False: 17.1k] ------------------ 506| 0| return err; \ 507| 0| } \ 508| 17.1k| md-> state_var .length += block_size * 8; \ 509| 17.1k| in += block_size; \ 510| 17.1k| inlen -= block_size; \ 511| 36.6k| } else { \ 512| 36.6k| n = MIN(inlen, (block_size - md-> state_var .curlen)); \ ------------------ | | 425| 36.6k| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 33.4k, False: 3.19k] | | ------------------ ------------------ 513| 36.6k| XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ ------------------ | | 39| 36.6k|#define XMEMCPY memcpy ------------------ 514| 36.6k| md-> state_var .curlen += n; \ 515| 36.6k| in += n; \ 516| 36.6k| inlen -= n; \ 517| 36.6k| if (md-> state_var .curlen == block_size) { \ ------------------ | Branch (517:16): [True: 3.19k, False: 33.4k] ------------------ 518| 3.19k| if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) { \ ------------------ | Branch (518:19): [True: 0, False: 3.19k] ------------------ 519| 0| return err; \ 520| 0| } \ 521| 3.19k| md-> state_var .length += 8*block_size; \ 522| 3.19k| md-> state_var .curlen = 0; \ 523| 3.19k| } \ 524| 36.6k| } \ 525| 53.7k| } \ 526| 33.4k| return CRYPT_OK; \ 527| 33.4k|} sha1.c:ROL: 258| 46.3M|{ 259| 46.3M| asm ("roll %%cl,%0" 260| 46.3M| :"=r" (word) 261| 46.3M| :"0" (word),"c" (i)); 262| 46.3M| return word; 263| 46.3M|} chacha_crypt.c:ROL: 258| 4.08G|{ 259| 4.08G| asm ("roll %%cl,%0" 260| 4.08G| :"=r" (word) 261| 4.08G| :"0" (word),"c" (i)); 262| 4.08G| return word; 263| 4.08G|} hmac_done: 28| 21.6k|{ 29| 21.6k| unsigned char buf[MAXBLOCKSIZE], isha[MAXBLOCKSIZE]; 30| 21.6k| unsigned long hashsize, i; 31| 21.6k| int hash, err; 32| | 33| 21.6k| LTC_ARGCHK(hmac != NULL); ------------------ | | 32| 21.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 21.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 34| 21.6k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 21.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 21.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 35| | 36| | /* test hash */ 37| 21.6k| hash = hmac->hash; 38| 21.6k| if((err = hash_is_valid(hash)) != CRYPT_OK) { ------------------ | Branch (38:8): [True: 0, False: 21.6k] ------------------ 39| 0| return err; 40| 0| } 41| | 42| | /* get the hash message digest size */ 43| 21.6k| hashsize = hash_descriptor[hash].hashsize; 44| | 45| 21.6k| if ((err = hash_descriptor[hash].done(&hmac->md, isha)) != CRYPT_OK) { ------------------ | Branch (45:9): [True: 0, False: 21.6k] ------------------ 46| 0| goto LBL_ERR; 47| 0| } 48| | 49| | /* Create the second HMAC vector vector for step (3) */ 50| 1.40M| for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) { ------------------ | | 18| 1.40M|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (50:14): [True: 1.38M, False: 21.6k] ------------------ 51| 1.38M| buf[i] = hmac->key[i] ^ 0x5C; 52| 1.38M| } 53| | 54| | /* Now calculate the "outer" hash for step (5), (6), and (7) */ 55| 21.6k| if ((err = hash_descriptor[hash].init(&hmac->md)) != CRYPT_OK) { ------------------ | Branch (55:9): [True: 0, False: 21.6k] ------------------ 56| 0| goto LBL_ERR; 57| 0| } 58| 21.6k| if ((err = hash_descriptor[hash].process(&hmac->md, buf, LTC_HMAC_BLOCKSIZE)) != CRYPT_OK) { ------------------ | | 18| 21.6k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (58:9): [True: 0, False: 21.6k] ------------------ 59| 0| goto LBL_ERR; 60| 0| } 61| 21.6k| if ((err = hash_descriptor[hash].process(&hmac->md, isha, hashsize)) != CRYPT_OK) { ------------------ | Branch (61:9): [True: 0, False: 21.6k] ------------------ 62| 0| goto LBL_ERR; 63| 0| } 64| 21.6k| if ((err = hash_descriptor[hash].done(&hmac->md, buf)) != CRYPT_OK) { ------------------ | Branch (64:9): [True: 0, False: 21.6k] ------------------ 65| 0| goto LBL_ERR; 66| 0| } 67| | 68| | /* copy to output */ 69| 642k| for (i = 0; i < hashsize && i < *outlen; i++) { ------------------ | Branch (69:17): [True: 621k, False: 21.6k] | Branch (69:33): [True: 621k, False: 0] ------------------ 70| 621k| out[i] = buf[i]; 71| 621k| } 72| 21.6k| *outlen = i; 73| | 74| 21.6k| err = CRYPT_OK; 75| 21.6k|LBL_ERR: 76| 21.6k| XFREE(hmac->key); ------------------ | | 17| 21.6k|#define XFREE m_free_direct ------------------ 77| |#ifdef LTC_CLEAN_STACK 78| | zeromem(isha, hashsize); 79| | zeromem(buf, hashsize); 80| | zeromem(hmac, sizeof(*hmac)); 81| |#endif 82| | 83| 21.6k| return err; 84| 21.6k|} hmac_init: 29| 21.6k|{ 30| 21.6k| unsigned char buf[MAXBLOCKSIZE]; 31| 21.6k| unsigned long hashsize; 32| 21.6k| unsigned long i, z; 33| 21.6k| int err; 34| | 35| 21.6k| LTC_ARGCHK(hmac != NULL); ------------------ | | 32| 21.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 21.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 36| 21.6k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 21.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 21.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 37| | 38| | /* valid hash? */ 39| 21.6k| if ((err = hash_is_valid(hash)) != CRYPT_OK) { ------------------ | Branch (39:9): [True: 0, False: 21.6k] ------------------ 40| 0| return err; 41| 0| } 42| 21.6k| hmac->hash = hash; 43| 21.6k| hashsize = hash_descriptor[hash].hashsize; 44| | 45| | /* valid key length? */ 46| 21.6k| if (keylen == 0) { ------------------ | Branch (46:9): [True: 0, False: 21.6k] ------------------ 47| 0| return CRYPT_INVALID_KEYSIZE; 48| 0| } 49| | 50| | /* allocate memory for key */ 51| 21.6k| hmac->key = XMALLOC(LTC_HMAC_BLOCKSIZE); ------------------ | | 16| 21.6k|#define XMALLOC m_malloc ------------------ hmac->key = XMALLOC(LTC_HMAC_BLOCKSIZE); ------------------ | | 18| 21.6k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ 52| 21.6k| if (hmac->key == NULL) { ------------------ | Branch (52:9): [True: 0, False: 21.6k] ------------------ 53| 0| return CRYPT_MEM; 54| 0| } 55| | 56| | /* (1) make sure we have a large enough key */ 57| 21.6k| if(keylen > LTC_HMAC_BLOCKSIZE) { ------------------ | | 18| 21.6k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (57:8): [True: 0, False: 21.6k] ------------------ 58| 0| z = LTC_HMAC_BLOCKSIZE; ------------------ | | 18| 0|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ 59| 0| if ((err = hash_memory(hash, key, keylen, hmac->key, &z)) != CRYPT_OK) { ------------------ | Branch (59:13): [True: 0, False: 0] ------------------ 60| 0| goto LBL_ERR; 61| 0| } 62| 0| keylen = hashsize; 63| 21.6k| } else { 64| 21.6k| XMEMCPY(hmac->key, key, (size_t)keylen); ------------------ | | 39| 21.6k|#define XMEMCPY memcpy ------------------ 65| 21.6k| } 66| | 67| 21.6k| if(keylen < LTC_HMAC_BLOCKSIZE) { ------------------ | | 18| 21.6k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (67:8): [True: 21.6k, False: 0] ------------------ 68| 21.6k| zeromem((hmac->key) + keylen, (size_t)(LTC_HMAC_BLOCKSIZE - keylen)); ------------------ | | 18| 21.6k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ 69| 21.6k| } 70| | 71| | /* Create the initialization vector for step (3) */ 72| 1.40M| for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) { ------------------ | | 18| 1.40M|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (72:14): [True: 1.38M, False: 21.6k] ------------------ 73| 1.38M| buf[i] = hmac->key[i] ^ 0x36; 74| 1.38M| } 75| | 76| | /* Pre-pend that to the hash data */ 77| 21.6k| if ((err = hash_descriptor[hash].init(&hmac->md)) != CRYPT_OK) { ------------------ | Branch (77:9): [True: 0, False: 21.6k] ------------------ 78| 0| goto LBL_ERR; 79| 0| } 80| | 81| 21.6k| if ((err = hash_descriptor[hash].process(&hmac->md, buf, LTC_HMAC_BLOCKSIZE)) != CRYPT_OK) { ------------------ | | 18| 21.6k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (81:9): [True: 0, False: 21.6k] ------------------ 82| 0| goto LBL_ERR; 83| 0| } 84| 21.6k| goto done; 85| 21.6k|LBL_ERR: 86| | /* free the key since we failed */ 87| 0| XFREE(hmac->key); ------------------ | | 17| 0|#define XFREE m_free_direct ------------------ 88| 21.6k|done: 89| |#ifdef LTC_CLEAN_STACK 90| | zeromem(buf, LTC_HMAC_BLOCKSIZE); 91| |#endif 92| | 93| 21.6k| return err; 94| 0|} hmac_process: 26| 43.3k|{ 27| 43.3k| int err; 28| 43.3k| LTC_ARGCHK(hmac != NULL); ------------------ | | 32| 43.3k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 43.3k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 29| 43.3k| LTC_ARGCHK(in != NULL); ------------------ | | 32| 43.3k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 43.3k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 30| 43.3k| if ((err = hash_is_valid(hmac->hash)) != CRYPT_OK) { ------------------ | Branch (30:9): [True: 0, False: 43.3k] ------------------ 31| 0| return err; 32| 0| } 33| 43.3k| return hash_descriptor[hmac->hash].process(&hmac->md, in, inlen); 34| 43.3k|} poly1305_init: 90| 214k|{ 91| 214k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 214k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 214k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 92| 214k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 214k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 214k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 93| 214k| LTC_ARGCHK(keylen == 32); ------------------ | | 32| 214k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 214k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 94| | 95| | /* r &= 0xffffffc0ffffffc0ffffffc0fffffff */ 96| 214k| LOAD32L(st->r[0], key + 0); st->r[0] = (st->r[0] ) & 0x3ffffff; ------------------ | | 167| 214k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 214k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 97| 214k| LOAD32L(st->r[1], key + 3); st->r[1] = (st->r[1] >> 2) & 0x3ffff03; ------------------ | | 167| 214k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 214k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 98| 214k| LOAD32L(st->r[2], key + 6); st->r[2] = (st->r[2] >> 4) & 0x3ffc0ff; ------------------ | | 167| 214k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 214k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 99| 214k| LOAD32L(st->r[3], key + 9); st->r[3] = (st->r[3] >> 6) & 0x3f03fff; ------------------ | | 167| 214k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 214k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 100| 214k| LOAD32L(st->r[4], key + 12); st->r[4] = (st->r[4] >> 8) & 0x00fffff; ------------------ | | 167| 214k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 214k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 101| | 102| | /* h = 0 */ 103| 214k| st->h[0] = 0; 104| 214k| st->h[1] = 0; 105| 214k| st->h[2] = 0; 106| 214k| st->h[3] = 0; 107| 214k| st->h[4] = 0; 108| | 109| | /* save pad for later */ 110| 214k| LOAD32L(st->pad[0], key + 16); ------------------ | | 167| 214k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 214k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 111| 214k| LOAD32L(st->pad[1], key + 20); ------------------ | | 167| 214k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 214k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 112| 214k| LOAD32L(st->pad[2], key + 24); ------------------ | | 167| 214k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 214k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 113| 214k| LOAD32L(st->pad[3], key + 28); ------------------ | | 167| 214k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 214k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 114| | 115| 214k| st->leftover = 0; 116| 214k| st->final = 0; 117| 214k| return CRYPT_OK; 118| 214k|} poly1305_process: 128| 214k|{ 129| 214k| unsigned long i; 130| | 131| 214k| if (inlen == 0) return CRYPT_OK; /* nothing to do */ ------------------ | Branch (131:8): [True: 0, False: 214k] ------------------ 132| 214k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 214k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 214k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 133| 214k| LTC_ARGCHK(in != NULL); ------------------ | | 32| 214k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 214k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 134| | 135| | /* handle leftover */ 136| 214k| if (st->leftover) { ------------------ | Branch (136:8): [True: 0, False: 214k] ------------------ 137| 0| unsigned long want = (16 - st->leftover); 138| 0| if (want > inlen) want = inlen; ------------------ | Branch (138:11): [True: 0, False: 0] ------------------ 139| 0| for (i = 0; i < want; i++) st->buffer[st->leftover + i] = in[i]; ------------------ | Branch (139:19): [True: 0, False: 0] ------------------ 140| 0| inlen -= want; 141| 0| in += want; 142| 0| st->leftover += want; 143| 0| if (st->leftover < 16) return CRYPT_OK; ------------------ | Branch (143:11): [True: 0, False: 0] ------------------ 144| 0| _poly1305_block(st, st->buffer, 16); 145| 0| st->leftover = 0; 146| 0| } 147| | 148| | /* process full blocks */ 149| 214k| if (inlen >= 16) { ------------------ | Branch (149:8): [True: 214k, False: 0] ------------------ 150| 214k| unsigned long want = (inlen & ~(16 - 1)); 151| 214k| _poly1305_block(st, in, want); 152| 214k| in += want; 153| 214k| inlen -= want; 154| 214k| } 155| | 156| | /* store leftover */ 157| 214k| if (inlen) { ------------------ | Branch (157:8): [True: 214k, False: 0] ------------------ 158| 1.88M| for (i = 0; i < inlen; i++) st->buffer[st->leftover + i] = in[i]; ------------------ | Branch (158:19): [True: 1.66M, False: 214k] ------------------ 159| 214k| st->leftover += inlen; 160| 214k| } 161| 214k| return CRYPT_OK; 162| 214k|} poly1305_done: 172| 214k|{ 173| 214k| ulong32 h0,h1,h2,h3,h4,c; 174| 214k| ulong32 g0,g1,g2,g3,g4; 175| 214k| ulong64 f; 176| 214k| ulong32 mask; 177| | 178| 214k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 214k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 214k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 179| 214k| LTC_ARGCHK(mac != NULL); ------------------ | | 32| 214k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 214k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 180| 214k| LTC_ARGCHK(maclen != NULL); ------------------ | | 32| 214k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 214k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 181| 214k| LTC_ARGCHK(*maclen >= 16); ------------------ | | 32| 214k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 214k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 182| | 183| | /* process the remaining block */ 184| 214k| if (st->leftover) { ------------------ | Branch (184:8): [True: 214k, False: 0] ------------------ 185| 214k| unsigned long i = st->leftover; 186| 214k| st->buffer[i++] = 1; 187| 1.76M| for (; i < 16; i++) st->buffer[i] = 0; ------------------ | Branch (187:14): [True: 1.54M, False: 214k] ------------------ 188| 214k| st->final = 1; 189| 214k| _poly1305_block(st, st->buffer, 16); 190| 214k| } 191| | 192| | /* fully carry h */ 193| 214k| h0 = st->h[0]; 194| 214k| h1 = st->h[1]; 195| 214k| h2 = st->h[2]; 196| 214k| h3 = st->h[3]; 197| 214k| h4 = st->h[4]; 198| | 199| 214k| c = h1 >> 26; h1 = h1 & 0x3ffffff; 200| 214k| h2 += c; c = h2 >> 26; h2 = h2 & 0x3ffffff; 201| 214k| h3 += c; c = h3 >> 26; h3 = h3 & 0x3ffffff; 202| 214k| h4 += c; c = h4 >> 26; h4 = h4 & 0x3ffffff; 203| 214k| h0 += c * 5; c = h0 >> 26; h0 = h0 & 0x3ffffff; 204| 214k| h1 += c; 205| | 206| | /* compute h + -p */ 207| 214k| g0 = h0 + 5; c = g0 >> 26; g0 &= 0x3ffffff; 208| 214k| g1 = h1 + c; c = g1 >> 26; g1 &= 0x3ffffff; 209| 214k| g2 = h2 + c; c = g2 >> 26; g2 &= 0x3ffffff; 210| 214k| g3 = h3 + c; c = g3 >> 26; g3 &= 0x3ffffff; 211| 214k| g4 = h4 + c - (1UL << 26); 212| | 213| | /* select h if h < p, or h + -p if h >= p */ 214| 214k| mask = (g4 >> 31) - 1; 215| 214k| g0 &= mask; 216| 214k| g1 &= mask; 217| 214k| g2 &= mask; 218| 214k| g3 &= mask; 219| 214k| g4 &= mask; 220| 214k| mask = ~mask; 221| 214k| h0 = (h0 & mask) | g0; 222| 214k| h1 = (h1 & mask) | g1; 223| 214k| h2 = (h2 & mask) | g2; 224| 214k| h3 = (h3 & mask) | g3; 225| 214k| h4 = (h4 & mask) | g4; 226| | 227| | /* h = h % (2^128) */ 228| 214k| h0 = ((h0 ) | (h1 << 26)) & 0xffffffff; 229| 214k| h1 = ((h1 >> 6) | (h2 << 20)) & 0xffffffff; 230| 214k| h2 = ((h2 >> 12) | (h3 << 14)) & 0xffffffff; 231| 214k| h3 = ((h3 >> 18) | (h4 << 8)) & 0xffffffff; 232| | 233| | /* mac = (h + pad) % (2^128) */ 234| 214k| f = (ulong64)h0 + st->pad[0] ; h0 = (ulong32)f; 235| 214k| f = (ulong64)h1 + st->pad[1] + (f >> 32); h1 = (ulong32)f; 236| 214k| f = (ulong64)h2 + st->pad[2] + (f >> 32); h2 = (ulong32)f; 237| 214k| f = (ulong64)h3 + st->pad[3] + (f >> 32); h3 = (ulong32)f; 238| | 239| 214k| STORE32L(h0, mac + 0); ------------------ | | 164| 214k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 214k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 240| 214k| STORE32L(h1, mac + 4); ------------------ | | 164| 214k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 214k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 241| 214k| STORE32L(h2, mac + 8); ------------------ | | 164| 214k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 214k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 242| 214k| STORE32L(h3, mac + 12); ------------------ | | 164| 214k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 214k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 243| | 244| | /* zero out the state */ 245| 214k| st->h[0] = 0; 246| 214k| st->h[1] = 0; 247| 214k| st->h[2] = 0; 248| 214k| st->h[3] = 0; 249| 214k| st->h[4] = 0; 250| 214k| st->r[0] = 0; 251| 214k| st->r[1] = 0; 252| 214k| st->r[2] = 0; 253| 214k| st->r[3] = 0; 254| 214k| st->r[4] = 0; 255| 214k| st->pad[0] = 0; 256| 214k| st->pad[1] = 0; 257| 214k| st->pad[2] = 0; 258| 214k| st->pad[3] = 0; 259| | 260| 214k| *maclen = 16; 261| 214k| return CRYPT_OK; 262| 214k|} poly1305.c:_poly1305_block: 21| 429k|{ 22| 429k| const unsigned long hibit = (st->final) ? 0 : (1UL << 24); /* 1 << 128 */ ------------------ | Branch (22:32): [True: 214k, False: 214k] ------------------ 23| 429k| ulong32 r0,r1,r2,r3,r4; 24| 429k| ulong32 s1,s2,s3,s4; 25| 429k| ulong32 h0,h1,h2,h3,h4; 26| 429k| ulong32 tmp; 27| 429k| ulong64 d0,d1,d2,d3,d4; 28| 429k| ulong32 c; 29| | 30| 429k| r0 = st->r[0]; 31| 429k| r1 = st->r[1]; 32| 429k| r2 = st->r[2]; 33| 429k| r3 = st->r[3]; 34| 429k| r4 = st->r[4]; 35| | 36| 429k| s1 = r1 * 5; 37| 429k| s2 = r2 * 5; 38| 429k| s3 = r3 * 5; 39| 429k| s4 = r4 * 5; 40| | 41| 429k| h0 = st->h[0]; 42| 429k| h1 = st->h[1]; 43| 429k| h2 = st->h[2]; 44| 429k| h3 = st->h[3]; 45| 429k| h4 = st->h[4]; 46| | 47| 49.5M| while (inlen >= 16) { ------------------ | Branch (47:11): [True: 49.1M, False: 429k] ------------------ 48| | /* h += in[i] */ 49| 49.1M| LOAD32L(tmp, in+ 0); h0 += (tmp ) & 0x3ffffff; ------------------ | | 167| 49.1M| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 49.1M|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 50| 49.1M| LOAD32L(tmp, in+ 3); h1 += (tmp >> 2) & 0x3ffffff; ------------------ | | 167| 49.1M| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 49.1M|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 51| 49.1M| LOAD32L(tmp, in+ 6); h2 += (tmp >> 4) & 0x3ffffff; ------------------ | | 167| 49.1M| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 49.1M|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 52| 49.1M| LOAD32L(tmp, in+ 9); h3 += (tmp >> 6) & 0x3ffffff; ------------------ | | 167| 49.1M| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 49.1M|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 53| 49.1M| LOAD32L(tmp, in+12); h4 += (tmp >> 8) | hibit; ------------------ | | 167| 49.1M| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 49.1M|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 54| | 55| | /* h *= r */ 56| 49.1M| d0 = ((ulong64)h0 * r0) + ((ulong64)h1 * s4) + ((ulong64)h2 * s3) + ((ulong64)h3 * s2) + ((ulong64)h4 * s1); 57| 49.1M| d1 = ((ulong64)h0 * r1) + ((ulong64)h1 * r0) + ((ulong64)h2 * s4) + ((ulong64)h3 * s3) + ((ulong64)h4 * s2); 58| 49.1M| d2 = ((ulong64)h0 * r2) + ((ulong64)h1 * r1) + ((ulong64)h2 * r0) + ((ulong64)h3 * s4) + ((ulong64)h4 * s3); 59| 49.1M| d3 = ((ulong64)h0 * r3) + ((ulong64)h1 * r2) + ((ulong64)h2 * r1) + ((ulong64)h3 * r0) + ((ulong64)h4 * s4); 60| 49.1M| d4 = ((ulong64)h0 * r4) + ((ulong64)h1 * r3) + ((ulong64)h2 * r2) + ((ulong64)h3 * r1) + ((ulong64)h4 * r0); 61| | 62| | /* (partial) h %= p */ 63| 49.1M| c = (ulong32)(d0 >> 26); h0 = (ulong32)d0 & 0x3ffffff; 64| 49.1M| d1 += c; c = (ulong32)(d1 >> 26); h1 = (ulong32)d1 & 0x3ffffff; 65| 49.1M| d2 += c; c = (ulong32)(d2 >> 26); h2 = (ulong32)d2 & 0x3ffffff; 66| 49.1M| d3 += c; c = (ulong32)(d3 >> 26); h3 = (ulong32)d3 & 0x3ffffff; 67| 49.1M| d4 += c; c = (ulong32)(d4 >> 26); h4 = (ulong32)d4 & 0x3ffffff; 68| 49.1M| h0 += c * 5; c = (h0 >> 26); h0 = h0 & 0x3ffffff; 69| 49.1M| h1 += c; 70| | 71| 49.1M| in += 16; 72| 49.1M| inlen -= 16; 73| 49.1M| } 74| | 75| 429k| st->h[0] = h0; 76| 429k| st->h[1] = h1; 77| 429k| st->h[2] = h2; 78| 429k| st->h[3] = h3; 79| 429k| st->h[4] = h4; 80| 429k|} cipher_is_valid: 22| 25.2k|{ 23| 25.2k| LTC_MUTEX_LOCK(<c_cipher_mutex); 24| 25.2k| if (idx < 0 || idx >= TAB_SIZE || cipher_descriptor[idx].name == NULL) { ------------------ | | 14| 50.4k|#define TAB_SIZE 5 ------------------ | Branch (24:8): [True: 0, False: 25.2k] | Branch (24:19): [True: 0, False: 25.2k] | Branch (24:38): [True: 0, False: 25.2k] ------------------ 25| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 26| 0| return CRYPT_INVALID_CIPHER; 27| 0| } 28| 25.2k| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 29| 25.2k| return CRYPT_OK; 30| 25.2k|} find_cipher: 22| 6.72k|{ 23| 6.72k| int x; 24| 6.72k| LTC_ARGCHK(name != NULL); ------------------ | | 32| 6.72k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 6.72k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 25| 6.72k| LTC_MUTEX_LOCK(<c_cipher_mutex); 26| 6.72k| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 6.72k|#define TAB_SIZE 5 ------------------ | Branch (26:16): [True: 6.72k, False: 0] ------------------ 27| 6.72k| if (cipher_descriptor[x].name != NULL && !XSTRCMP(cipher_descriptor[x].name, name)) { ------------------ | | 54| 6.72k|#define XSTRCMP strcmp ------------------ | Branch (27:12): [True: 6.72k, False: 0] | Branch (27:49): [True: 6.72k, False: 0] ------------------ 28| 6.72k| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 29| 6.72k| return x; 30| 6.72k| } 31| 6.72k| } 32| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 33| 0| return -1; 34| 6.72k|} find_hash: 22| 3.55k|{ 23| 3.55k| int x; 24| 3.55k| LTC_ARGCHK(name != NULL); ------------------ | | 32| 3.55k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.55k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 25| 3.55k| LTC_MUTEX_LOCK(<c_hash_mutex); 26| 6.93k| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 6.93k|#define TAB_SIZE 5 ------------------ | Branch (26:16): [True: 6.93k, False: 0] ------------------ 27| 6.93k| if (hash_descriptor[x].name != NULL && XSTRCMP(hash_descriptor[x].name, name) == 0) { ------------------ | | 54| 6.93k|#define XSTRCMP strcmp ------------------ | Branch (27:12): [True: 6.93k, False: 0] | Branch (27:47): [True: 3.55k, False: 3.38k] ------------------ 28| 3.55k| LTC_MUTEX_UNLOCK(<c_hash_mutex); 29| 3.55k| return x; 30| 3.55k| } 31| 6.93k| } 32| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 33| 0| return -1; 34| 3.55k|} hash_is_valid: 22| 86.7k|{ 23| 86.7k| LTC_MUTEX_LOCK(<c_hash_mutex); 24| 86.7k| if (idx < 0 || idx >= TAB_SIZE || hash_descriptor[idx].name == NULL) { ------------------ | | 14| 173k|#define TAB_SIZE 5 ------------------ | Branch (24:8): [True: 0, False: 86.7k] | Branch (24:19): [True: 0, False: 86.7k] | Branch (24:38): [True: 0, False: 86.7k] ------------------ 25| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 26| 0| return CRYPT_INVALID_HASH; 27| 0| } 28| 86.7k| LTC_MUTEX_UNLOCK(<c_hash_mutex); 29| 86.7k| return CRYPT_OK; 30| 86.7k|} register_cipher: 22| 1|{ 23| 1| int x; 24| | 25| 1| LTC_ARGCHK(cipher != NULL); ------------------ | | 32| 1|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 26| | 27| | /* is it already registered? */ 28| 1| LTC_MUTEX_LOCK(<c_cipher_mutex); 29| 6| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 6|#define TAB_SIZE 5 ------------------ | Branch (29:16): [True: 5, False: 1] ------------------ 30| 5| if (cipher_descriptor[x].name != NULL && cipher_descriptor[x].ID == cipher->ID) { ------------------ | Branch (30:12): [True: 0, False: 5] | Branch (30:49): [True: 0, False: 0] ------------------ 31| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 32| 0| return x; 33| 0| } 34| 5| } 35| | 36| | /* find a blank spot */ 37| 1| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 1|#define TAB_SIZE 5 ------------------ | Branch (37:16): [True: 1, False: 0] ------------------ 38| 1| if (cipher_descriptor[x].name == NULL) { ------------------ | Branch (38:12): [True: 1, False: 0] ------------------ 39| 1| XMEMCPY(&cipher_descriptor[x], cipher, sizeof(struct ltc_cipher_descriptor)); ------------------ | | 39| 1|#define XMEMCPY memcpy ------------------ 40| 1| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 41| 1| return x; 42| 1| } 43| 1| } 44| | 45| | /* no spot */ 46| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 47| 0| return -1; 48| 1|} register_hash: 22| 4|{ 23| 4| int x; 24| | 25| 4| LTC_ARGCHK(hash != NULL); ------------------ | | 32| 4|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 4] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 26| | 27| | /* is it already registered? */ 28| 4| LTC_MUTEX_LOCK(<c_hash_mutex); 29| 24| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 24|#define TAB_SIZE 5 ------------------ | Branch (29:16): [True: 20, False: 4] ------------------ 30| 20| if (XMEMCMP(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)) == 0) { ------------------ | | 45| 20|#define XMEMCMP memcmp ------------------ | Branch (30:12): [True: 0, False: 20] ------------------ 31| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 32| 0| return x; 33| 0| } 34| 20| } 35| | 36| | /* find a blank spot */ 37| 10| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 10|#define TAB_SIZE 5 ------------------ | Branch (37:16): [True: 10, False: 0] ------------------ 38| 10| if (hash_descriptor[x].name == NULL) { ------------------ | Branch (38:12): [True: 4, False: 6] ------------------ 39| 4| XMEMCPY(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)); ------------------ | | 39| 4|#define XMEMCPY memcpy ------------------ 40| 4| LTC_MUTEX_UNLOCK(<c_hash_mutex); 41| 4| return x; 42| 4| } 43| 10| } 44| | 45| | /* no spot */ 46| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 47| 0| return -1; 48| 4|} register_prng: 22| 1|{ 23| 1| int x; 24| | 25| 1| LTC_ARGCHK(prng != NULL); ------------------ | | 32| 1|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 26| | 27| | /* is it already registered? */ 28| 1| LTC_MUTEX_LOCK(<c_prng_mutex); 29| 6| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 6|#define TAB_SIZE 5 ------------------ | Branch (29:16): [True: 5, False: 1] ------------------ 30| 5| if (XMEMCMP(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)) == 0) { ------------------ | | 45| 5|#define XMEMCMP memcmp ------------------ | Branch (30:12): [True: 0, False: 5] ------------------ 31| 0| LTC_MUTEX_UNLOCK(<c_prng_mutex); 32| 0| return x; 33| 0| } 34| 5| } 35| | 36| | /* find a blank spot */ 37| 1| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 1|#define TAB_SIZE 5 ------------------ | Branch (37:16): [True: 1, False: 0] ------------------ 38| 1| if (prng_descriptor[x].name == NULL) { ------------------ | Branch (38:12): [True: 1, False: 0] ------------------ 39| 1| XMEMCPY(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)); ------------------ | | 39| 1|#define XMEMCPY memcpy ------------------ 40| 1| LTC_MUTEX_UNLOCK(<c_prng_mutex); 41| 1| return x; 42| 1| } 43| 1| } 44| | 45| | /* no spot */ 46| 0| LTC_MUTEX_UNLOCK(<c_prng_mutex); 47| 0| return -1; 48| 1|} zeromem: 23| 21.6k|{ 24| 21.6k| m_burn((void*)out, outlen); 25| 21.6k|} ctr_encrypt: 87| 21.6k|{ 88| 21.6k| int err, fr; 89| | 90| 21.6k| LTC_ARGCHK(pt != NULL); ------------------ | | 32| 21.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 21.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 91| 21.6k| LTC_ARGCHK(ct != NULL); ------------------ | | 32| 21.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 21.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 92| 21.6k| LTC_ARGCHK(ctr != NULL); ------------------ | | 32| 21.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 21.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 93| | 94| 21.6k| if ((err = cipher_is_valid(ctr->cipher)) != CRYPT_OK) { ------------------ | Branch (94:8): [True: 0, False: 21.6k] ------------------ 95| 0| return err; 96| 0| } 97| | 98| | /* is blocklen/padlen valid? */ 99| 21.6k| if ((ctr->blocklen < 1) || (ctr->blocklen > (int)sizeof(ctr->ctr)) || ------------------ | Branch (99:8): [True: 0, False: 21.6k] | Branch (99:31): [True: 0, False: 21.6k] ------------------ 100| 21.6k| (ctr->padlen < 0) || (ctr->padlen > (int)sizeof(ctr->pad))) { ------------------ | Branch (100:8): [True: 0, False: 21.6k] | Branch (100:31): [True: 0, False: 21.6k] ------------------ 101| 0| return CRYPT_INVALID_ARG; 102| 0| } 103| | 104| 21.6k|#ifdef LTC_FAST 105| 21.6k| if (ctr->blocklen % sizeof(LTC_FAST_TYPE)) { ------------------ | Branch (105:8): [True: 0, False: 21.6k] ------------------ 106| 0| return CRYPT_INVALID_ARG; 107| 0| } 108| 21.6k|#endif 109| | 110| | /* handle acceleration only if pad is empty, accelerator is present and length is >= a block size */ 111| 21.6k| if ((cipher_descriptor[ctr->cipher].accel_ctr_encrypt != NULL) && (len >= (unsigned long)ctr->blocklen)) { ------------------ | Branch (111:8): [True: 0, False: 21.6k] | Branch (111:70): [True: 0, False: 0] ------------------ 112| 0| if (ctr->padlen < ctr->blocklen) { ------------------ | Branch (112:10): [True: 0, False: 0] ------------------ 113| 0| fr = ctr->blocklen - ctr->padlen; 114| 0| if ((err = _ctr_encrypt(pt, ct, fr, ctr)) != CRYPT_OK) { ------------------ | Branch (114:12): [True: 0, False: 0] ------------------ 115| 0| return err; 116| 0| } 117| 0| pt += fr; 118| 0| ct += fr; 119| 0| len -= fr; 120| 0| } 121| | 122| 0| if (len >= (unsigned long)ctr->blocklen) { ------------------ | Branch (122:10): [True: 0, False: 0] ------------------ 123| 0| if ((err = cipher_descriptor[ctr->cipher].accel_ctr_encrypt(pt, ct, len/ctr->blocklen, ctr->ctr, ctr->mode, &ctr->key)) != CRYPT_OK) { ------------------ | Branch (123:12): [True: 0, False: 0] ------------------ 124| 0| return err; 125| 0| } 126| 0| pt += (len / ctr->blocklen) * ctr->blocklen; 127| 0| ct += (len / ctr->blocklen) * ctr->blocklen; 128| 0| len %= ctr->blocklen; 129| 0| } 130| 0| } 131| | 132| 21.6k| return _ctr_encrypt(pt, ct, len, ctr); 133| 21.6k|} ctr_encrypt.c:_ctr_encrypt: 28| 21.6k|{ 29| 21.6k| int x, err; 30| | 31| 5.87M| while (len) { ------------------ | Branch (31:11): [True: 5.85M, False: 21.6k] ------------------ 32| | /* is the pad empty? */ 33| 5.85M| if (ctr->padlen == ctr->blocklen) { ------------------ | Branch (33:11): [True: 5.84M, False: 3.37k] ------------------ 34| | /* increment counter */ 35| 5.84M| if (ctr->mode == CTR_COUNTER_LITTLE_ENDIAN) { ------------------ | | 859| 5.84M|#define CTR_COUNTER_LITTLE_ENDIAN 0x0000 ------------------ | Branch (35:14): [True: 0, False: 5.84M] ------------------ 36| | /* little-endian */ 37| 0| for (x = 0; x < ctr->ctrlen; x++) { ------------------ | Branch (37:25): [True: 0, False: 0] ------------------ 38| 0| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 39| 0| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (39:20): [True: 0, False: 0] ------------------ 40| 0| break; 41| 0| } 42| 0| } 43| 5.84M| } else { 44| | /* big-endian */ 45| 5.87M| for (x = ctr->blocklen-1; x >= ctr->ctrlen; x--) { ------------------ | Branch (45:39): [True: 5.87M, False: 0] ------------------ 46| 5.87M| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 47| 5.87M| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (47:20): [True: 5.84M, False: 22.9k] ------------------ 48| 5.84M| break; 49| 5.84M| } 50| 5.87M| } 51| 5.84M| } 52| | 53| | /* encrypt it */ 54| 5.84M| if ((err = cipher_descriptor[ctr->cipher].ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key)) != CRYPT_OK) { ------------------ | Branch (54:14): [True: 0, False: 5.84M] ------------------ 55| 0| return err; 56| 0| } 57| 5.84M| ctr->padlen = 0; 58| 5.84M| } 59| 5.85M|#ifdef LTC_FAST 60| 5.85M| if ((ctr->padlen == 0) && (len >= (unsigned long)ctr->blocklen)) { ------------------ | Branch (60:11): [True: 5.85M, False: 0] | Branch (60:33): [True: 5.85M, False: 0] ------------------ 61| 17.5M| for (x = 0; x < ctr->blocklen; x += sizeof(LTC_FAST_TYPE)) { ------------------ | Branch (61:22): [True: 11.7M, False: 5.85M] ------------------ 62| 11.7M| *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ct + x)) = *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)pt + x)) ^ ------------------ | | 244| 11.7M| #define LTC_FAST_TYPE_PTR_CAST(x) ((LTC_FAST_TYPE*)(void*)(x)) ------------------ *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ct + x)) = *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)pt + x)) ^ ------------------ | | 244| 11.7M| #define LTC_FAST_TYPE_PTR_CAST(x) ((LTC_FAST_TYPE*)(void*)(x)) ------------------ 63| 11.7M| *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ctr->pad + x)); ------------------ | | 244| 11.7M| #define LTC_FAST_TYPE_PTR_CAST(x) ((LTC_FAST_TYPE*)(void*)(x)) ------------------ 64| 11.7M| } 65| 5.85M| pt += ctr->blocklen; 66| 5.85M| ct += ctr->blocklen; 67| 5.85M| len -= ctr->blocklen; 68| 5.85M| ctr->padlen = ctr->blocklen; 69| 5.85M| continue; 70| 5.85M| } 71| 0|#endif 72| 0| *ct++ = *pt++ ^ ctr->pad[ctr->padlen++]; 73| 0| --len; 74| 0| } 75| 21.6k| return CRYPT_OK; 76| 21.6k|} ctr_start: 35| 3.55k|{ 36| 3.55k| int x, err; 37| | 38| 3.55k| LTC_ARGCHK(IV != NULL); ------------------ | | 32| 3.55k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.55k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 39| 3.55k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 3.55k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.55k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 40| 3.55k| LTC_ARGCHK(ctr != NULL); ------------------ | | 32| 3.55k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.55k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 41| | 42| | /* bad param? */ 43| 3.55k| if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { ------------------ | Branch (43:8): [True: 0, False: 3.55k] ------------------ 44| 0| return err; 45| 0| } 46| | 47| | /* ctrlen == counter width */ 48| 3.55k| ctr->ctrlen = (ctr_mode & 255) ? (ctr_mode & 255) : cipher_descriptor[cipher].block_length; ------------------ | Branch (48:20): [True: 0, False: 3.55k] ------------------ 49| 3.55k| if (ctr->ctrlen > cipher_descriptor[cipher].block_length) { ------------------ | Branch (49:8): [True: 0, False: 3.55k] ------------------ 50| 0| return CRYPT_INVALID_ARG; 51| 0| } 52| | 53| 3.55k| if ((ctr_mode & 0x1000) == CTR_COUNTER_BIG_ENDIAN) { ------------------ | | 860| 3.55k|#define CTR_COUNTER_BIG_ENDIAN 0x1000 ------------------ | Branch (53:8): [True: 3.55k, False: 0] ------------------ 54| 3.55k| ctr->ctrlen = cipher_descriptor[cipher].block_length - ctr->ctrlen; 55| 3.55k| } 56| | 57| | /* setup cipher */ 58| 3.55k| if ((err = cipher_descriptor[cipher].setup(key, keylen, num_rounds, &ctr->key)) != CRYPT_OK) { ------------------ | Branch (58:8): [True: 0, False: 3.55k] ------------------ 59| 0| return err; 60| 0| } 61| | 62| | /* copy ctr */ 63| 3.55k| ctr->blocklen = cipher_descriptor[cipher].block_length; 64| 3.55k| ctr->cipher = cipher; 65| 3.55k| ctr->padlen = 0; 66| 3.55k| ctr->mode = ctr_mode & 0x1000; 67| 60.4k| for (x = 0; x < ctr->blocklen; x++) { ------------------ | Branch (67:16): [True: 56.9k, False: 3.55k] ------------------ 68| 56.9k| ctr->ctr[x] = IV[x]; 69| 56.9k| } 70| | 71| 3.55k| if (ctr_mode & LTC_CTR_RFC3686) { ------------------ | | 861| 3.55k|#define LTC_CTR_RFC3686 0x2000 ------------------ | Branch (71:8): [True: 0, False: 3.55k] ------------------ 72| | /* increment the IV as per RFC 3686 */ 73| 0| if (ctr->mode == CTR_COUNTER_LITTLE_ENDIAN) { ------------------ | | 859| 0|#define CTR_COUNTER_LITTLE_ENDIAN 0x0000 ------------------ | Branch (73:11): [True: 0, False: 0] ------------------ 74| | /* little-endian */ 75| 0| for (x = 0; x < ctr->ctrlen; x++) { ------------------ | Branch (75:22): [True: 0, False: 0] ------------------ 76| 0| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 77| 0| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (77:18): [True: 0, False: 0] ------------------ 78| 0| break; 79| 0| } 80| 0| } 81| 0| } else { 82| | /* big-endian */ 83| 0| for (x = ctr->blocklen-1; x >= ctr->ctrlen; x--) { ------------------ | Branch (83:36): [True: 0, False: 0] ------------------ 84| 0| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 85| 0| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (85:18): [True: 0, False: 0] ------------------ 86| 0| break; 87| 0| } 88| 0| } 89| 0| } 90| 0| } 91| | 92| 3.55k| return cipher_descriptor[ctr->cipher].ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key); 93| 3.55k|} chacha_crypt: 55| 643k|{ 56| 643k| unsigned char buf[64]; 57| 643k| unsigned long i, j; 58| | 59| 643k| if (inlen == 0) return CRYPT_OK; /* nothing to do */ ------------------ | Branch (59:8): [True: 0, False: 643k] ------------------ 60| | 61| 643k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 643k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 643k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 62| 643k| LTC_ARGCHK(in != NULL); ------------------ | | 32| 643k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 643k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 63| 643k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 643k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 643k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 64| 643k| LTC_ARGCHK(st->ivlen != 0); ------------------ | | 32| 643k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 643k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 65| | 66| 643k| if (st->ksleft > 0) { ------------------ | Branch (66:8): [True: 0, False: 643k] ------------------ 67| 0| j = MIN(st->ksleft, inlen); ------------------ | | 425| 0| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 0, False: 0] | | ------------------ ------------------ 68| 0| for (i = 0; i < j; ++i, st->ksleft--) out[i] = in[i] ^ st->kstream[64 - st->ksleft]; ------------------ | Branch (68:19): [True: 0, False: 0] ------------------ 69| 0| inlen -= j; 70| 0| if (inlen == 0) return CRYPT_OK; ------------------ | Branch (70:11): [True: 0, False: 0] ------------------ 71| 0| out += j; 72| 0| in += j; 73| 0| } 74| 12.7M| for (;;) { 75| 12.7M| _chacha_block(buf, st->input, st->rounds); 76| 12.7M| if (st->ivlen == 8) { ------------------ | Branch (76:10): [True: 12.7M, False: 0] ------------------ 77| | /* IV-64bit, increment 64bit counter */ 78| 12.7M| if (0 == ++st->input[12] && 0 == ++st->input[13]) return CRYPT_OVERFLOW; ------------------ | Branch (78:12): [True: 0, False: 12.7M] | Branch (78:36): [True: 0, False: 0] ------------------ 79| 12.7M| } 80| 0| else { 81| | /* IV-96bit, increment 32bit counter */ 82| 0| if (0 == ++st->input[12]) return CRYPT_OVERFLOW; ------------------ | Branch (82:12): [True: 0, False: 0] ------------------ 83| 0| } 84| 12.7M| if (inlen <= 64) { ------------------ | Branch (84:10): [True: 643k, False: 12.1M] ------------------ 85| 16.4M| for (i = 0; i < inlen; ++i) out[i] = in[i] ^ buf[i]; ------------------ | Branch (85:20): [True: 15.7M, False: 643k] ------------------ 86| 643k| st->ksleft = 64 - inlen; 87| 26.0M| for (i = inlen; i < 64; ++i) st->kstream[i] = buf[i]; ------------------ | Branch (87:24): [True: 25.4M, False: 643k] ------------------ 88| 643k| return CRYPT_OK; 89| 643k| } 90| 788M| for (i = 0; i < 64; ++i) out[i] = in[i] ^ buf[i]; ------------------ | Branch (90:18): [True: 776M, False: 12.1M] ------------------ 91| 12.1M| inlen -= 64; 92| 12.1M| out += 64; 93| 12.1M| in += 64; 94| 12.1M| } 95| 643k|} chacha_crypt.c:_chacha_block: 26| 12.7M|{ 27| 12.7M| ulong32 x[16]; 28| 12.7M| int i; 29| 12.7M| XMEMCPY(x, input, sizeof(x)); ------------------ | | 39| 12.7M|#define XMEMCPY memcpy ------------------ 30| 140M| for (i = rounds; i > 0; i -= 2) { ------------------ | Branch (30:21): [True: 127M, False: 12.7M] ------------------ 31| 127M| QUARTERROUND(0, 4, 8,12) ------------------ | | 20| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 32| 127M| QUARTERROUND(1, 5, 9,13) ------------------ | | 20| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 33| 127M| QUARTERROUND(2, 6,10,14) ------------------ | | 20| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 34| 127M| QUARTERROUND(3, 7,11,15) ------------------ | | 20| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 35| 127M| QUARTERROUND(0, 5,10,15) ------------------ | | 20| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 36| 127M| QUARTERROUND(1, 6,11,12) ------------------ | | 20| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 37| 127M| QUARTERROUND(2, 7, 8,13) ------------------ | | 20| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 38| 127M| QUARTERROUND(3, 4, 9,14) ------------------ | | 20| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 127M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 127M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 39| 127M| } 40| 217M| for (i = 0; i < 16; ++i) { ------------------ | Branch (40:16): [True: 204M, False: 12.7M] ------------------ 41| 204M| x[i] += input[i]; 42| 204M| STORE32L(x[i], output + 4 * i); ------------------ | | 164| 204M| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 204M|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 43| 204M| } 44| 12.7M|} chacha_ivctr64: 28| 643k|{ 29| 643k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 643k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 643k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 30| 643k| LTC_ARGCHK(iv != NULL); ------------------ | | 32| 643k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 643k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 31| | /* 64bit IV + 64bit counter */ 32| 643k| LTC_ARGCHK(ivlen == 8); ------------------ | | 32| 643k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 643k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 33| | 34| 643k| st->input[12] = (ulong32)(counter & 0xFFFFFFFF); 35| 643k| st->input[13] = (ulong32)(counter >> 32); 36| 643k| LOAD32L(st->input[14], iv + 0); ------------------ | | 167| 643k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 643k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 37| 643k| LOAD32L(st->input[15], iv + 4); ------------------ | | 167| 643k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 643k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 38| 643k| st->ksleft = 0; 39| 643k| st->ivlen = ivlen; 40| 643k| return CRYPT_OK; 41| 643k|} chacha_keystream: 27| 214k|{ 28| 214k| if (outlen == 0) return CRYPT_OK; /* nothing to do */ ------------------ | Branch (28:8): [True: 0, False: 214k] ------------------ 29| 214k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 214k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 214k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 30| 214k| XMEMSET(out, 0, outlen); ------------------ | | 36| 214k|#define XMEMSET memset ------------------ 31| 214k| return chacha_crypt(st, out, outlen, out); 32| 214k|} chacha_setup: 31| 11.4k|{ 32| 11.4k| const char *constants; 33| | 34| 11.4k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 11.4k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 11.4k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 35| 11.4k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 11.4k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 11.4k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 36| 11.4k| LTC_ARGCHK(keylen == 32 || keylen == 16); ------------------ | | 32| 11.4k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:34): [True: 11.4k, False: 0] | | | Branch (32:34): [True: 0, False: 0] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 37| | 38| 11.4k| if (rounds == 0) rounds = 20; ------------------ | Branch (38:8): [True: 0, False: 11.4k] ------------------ 39| | 40| 11.4k| LOAD32L(st->input[4], key + 0); ------------------ | | 167| 11.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 11.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 41| 11.4k| LOAD32L(st->input[5], key + 4); ------------------ | | 167| 11.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 11.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 42| 11.4k| LOAD32L(st->input[6], key + 8); ------------------ | | 167| 11.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 11.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 43| 11.4k| LOAD32L(st->input[7], key + 12); ------------------ | | 167| 11.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 11.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 44| 11.4k| if (keylen == 32) { /* 256bit */ ------------------ | Branch (44:8): [True: 11.4k, False: 0] ------------------ 45| 11.4k| key += 16; 46| 11.4k| constants = sigma; 47| 11.4k| } else { /* 128bit */ 48| 0| constants = tau; 49| 0| } 50| 11.4k| LOAD32L(st->input[8], key + 0); ------------------ | | 167| 11.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 11.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 51| 11.4k| LOAD32L(st->input[9], key + 4); ------------------ | | 167| 11.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 11.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 52| 11.4k| LOAD32L(st->input[10], key + 8); ------------------ | | 167| 11.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 11.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 53| 11.4k| LOAD32L(st->input[11], key + 12); ------------------ | | 167| 11.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 11.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 54| 11.4k| LOAD32L(st->input[0], constants + 0); ------------------ | | 167| 11.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 11.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 55| 11.4k| LOAD32L(st->input[1], constants + 4); ------------------ | | 167| 11.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 11.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 56| 11.4k| LOAD32L(st->input[2], constants + 8); ------------------ | | 167| 11.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 11.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 57| 11.4k| LOAD32L(st->input[3], constants + 12); ------------------ | | 167| 11.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 11.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 58| 11.4k| st->rounds = rounds; /* e.g. 20 for chacha20 */ 59| 11.4k| st->ivlen = 0; /* will be set later by chacha_ivctr(32|64) */ 60| 11.4k| return CRYPT_OK; 61| 11.4k|} mp_add: 8| 3|{ 9| 3| mp_sign sa, sb; 10| 3| mp_err err; 11| | 12| | /* get sign of both inputs */ 13| 3| sa = a->sign; 14| 3| sb = b->sign; 15| | 16| | /* handle two cases, not four */ 17| 3| if (sa == sb) { ------------------ | Branch (17:8): [True: 3, False: 0] ------------------ 18| | /* both positive or both negative */ 19| | /* add their magnitudes, copy the sign */ 20| 3| c->sign = sa; 21| 3| err = s_mp_add(a, b, c); 22| 3| } else { 23| | /* one positive, the other negative */ 24| | /* subtract the one with the greater magnitude from */ 25| | /* the one of the lesser magnitude. The result gets */ 26| | /* the sign of the one with the greater magnitude. */ 27| 0| if (mp_cmp_mag(a, b) == MP_LT) { ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ | Branch (27:11): [True: 0, False: 0] ------------------ 28| 0| c->sign = sb; 29| 0| err = s_mp_sub(b, a, c); 30| 0| } else { 31| 0| c->sign = sa; 32| 0| err = s_mp_sub(a, b, c); 33| 0| } 34| 0| } 35| 3| return err; 36| 3|} mp_add_d: 8| 128|{ 9| 128| mp_err err; 10| 128| int ix, oldused; 11| 128| mp_digit *tmpa, *tmpc; 12| | 13| | /* grow c as required */ 14| 128| if (c->alloc < (a->used + 1)) { ------------------ | Branch (14:8): [True: 0, False: 128] ------------------ 15| 0| if ((err = mp_grow(c, a->used + 1)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (15:11): [True: 0, False: 0] ------------------ 16| 0| return err; 17| 0| } 18| 0| } 19| | 20| | /* if a is negative and |a| >= b, call c = |a| - b */ 21| 128| if ((a->sign == MP_NEG) && ((a->used > 1) || (a->dp[0] >= b))) { ------------------ | | 152| 128|#define MP_NEG 1 /* negative */ ------------------ | Branch (21:8): [True: 0, False: 128] | Branch (21:32): [True: 0, False: 0] | Branch (21:49): [True: 0, False: 0] ------------------ 22| 0| mp_int a_ = *a; 23| | /* temporarily fix sign of a */ 24| 0| a_.sign = MP_ZPOS; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ 25| | 26| | /* c = |a| - b */ 27| 0| err = mp_sub_d(&a_, b, c); 28| | 29| | /* fix sign */ 30| 0| c->sign = MP_NEG; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ 31| | 32| | /* clamp */ 33| 0| mp_clamp(c); 34| | 35| 0| return err; 36| 0| } 37| | 38| | /* old number of used digits in c */ 39| 128| oldused = c->used; 40| | 41| | /* source alias */ 42| 128| tmpa = a->dp; 43| | 44| | /* destination alias */ 45| 128| tmpc = c->dp; 46| | 47| | /* if a is positive */ 48| 128| if (a->sign == MP_ZPOS) { ------------------ | | 151| 128|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (48:8): [True: 128, False: 0] ------------------ 49| | /* add digits, mu is carry */ 50| 128| mp_digit mu = b; 51| 466| for (ix = 0; ix < a->used; ix++) { ------------------ | Branch (51:20): [True: 338, False: 128] ------------------ 52| 338| *tmpc = *tmpa++ + mu; 53| 338| mu = *tmpc >> MP_DIGIT_BIT; ------------------ | | 82| 338|# define MP_DIGIT_BIT 60 ------------------ 54| 338| *tmpc++ &= MP_MASK; ------------------ | | 106| 338|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 338|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 55| 338| } 56| | /* set final carry */ 57| 128| ix++; 58| 128| *tmpc++ = mu; 59| | 60| | /* setup size */ 61| 128| c->used = a->used + 1; 62| 128| } else { 63| | /* a was negative and |a| < b */ 64| 0| c->used = 1; 65| | 66| | /* the result is a single digit */ 67| 0| if (a->used == 1) { ------------------ | Branch (67:11): [True: 0, False: 0] ------------------ 68| 0| *tmpc++ = b - a->dp[0]; 69| 0| } else { 70| 0| *tmpc++ = b; 71| 0| } 72| | 73| | /* setup count so the clearing of oldused 74| | * can fall through correctly 75| | */ 76| 0| ix = 1; 77| 0| } 78| | 79| | /* sign always positive */ 80| 128| c->sign = MP_ZPOS; ------------------ | | 151| 128|#define MP_ZPOS 0 /* positive integer */ ------------------ 81| | 82| | /* now zero to oldused */ 83| 128| MP_ZERO_DIGITS(tmpc, oldused - ix); ------------------ | | 89| 128|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 128|do { \ | | 91| 128| int zd_ = (digits); \ | | 92| 128| mp_digit* zm_ = (mem); \ | | 93| 128| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 128] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 128|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 84| 128| mp_clamp(c); 85| | 86| 128| return MP_OKAY; ------------------ | | 161| 128|#define MP_OKAY 0 /* no error */ ------------------ 87| 128|} mp_clamp: 14| 56.7k|{ 15| | /* decrease used while the most significant digit is 16| | * zero. 17| | */ 18| 86.6k| while ((a->used > 0) && (a->dp[a->used - 1] == 0u)) { ------------------ | Branch (18:11): [True: 74.1k, False: 12.4k] | Branch (18:28): [True: 29.8k, False: 44.2k] ------------------ 19| 29.8k| --(a->used); 20| 29.8k| } 21| | 22| | /* reset the sign flag if used == 0 */ 23| 56.7k| if (a->used == 0) { ------------------ | Branch (23:8): [True: 12.4k, False: 44.2k] ------------------ 24| 12.4k| a->sign = MP_ZPOS; ------------------ | | 151| 12.4k|#define MP_ZPOS 0 /* positive integer */ ------------------ 25| 12.4k| } 26| 56.7k|} mp_clear: 8| 27.8k|{ 9| | /* only do anything if a hasn't been freed previously */ 10| 27.8k| if (a->dp != NULL) { ------------------ | Branch (10:8): [True: 21.5k, False: 6.34k] ------------------ 11| | /* free ram */ 12| 21.5k| MP_FREE_DIGITS(a->dp, a->alloc); ------------------ | | 58| 21.5k|# define MP_FREE_DIGITS(mem, digits) \ | | 59| 21.5k|do { \ | | 60| 21.5k| int fd_ = (digits); \ | | 61| 21.5k| void* fm_ = (mem); \ | | 62| 21.5k| if (fm_ != NULL) { \ | | ------------------ | | | Branch (62:8): [True: 21.5k, False: 0] | | ------------------ | | 63| 21.5k| size_t fs_ = sizeof (mp_digit) * (size_t)fd_; \ | | 64| 21.5k| MP_ZERO_BUFFER(fm_, fs_); \ | | ------------------ | | | | 81| 21.5k|# define MP_ZERO_BUFFER(mem, size) \ | | | | 82| 21.5k|do { \ | | | | 83| 21.5k| size_t zs_ = (size); \ | | | | 84| 21.5k| char* zm_ = (char*)(mem); \ | | | | 85| 3.30M| while (zs_-- > 0u) { \ | | | | ------------------ | | | | | Branch (85:11): [True: 3.28M, False: 21.5k] | | | | ------------------ | | | | 86| 3.28M| *zm_++ = '\0'; \ | | | | 87| 3.28M| } \ | | | | 88| 21.5k|} while (0) | | | | ------------------ | | | | | Branch (88:10): [Folded - Ignored] | | | | ------------------ | | ------------------ | | 65| 21.5k| MP_FREE(fm_, fs_); \ | | ------------------ | | | | 1324| 21.5k|#define MP_FREE m_free_ltm | | ------------------ | | 66| 21.5k| } \ | | 67| 21.5k|} while (0) | | ------------------ | | | Branch (67:10): [Folded - Ignored] | | ------------------ ------------------ 13| | 14| | /* reset members to make debugging easier */ 15| 21.5k| a->dp = NULL; 16| 21.5k| a->alloc = a->used = 0; 17| 21.5k| a->sign = MP_ZPOS; ------------------ | | 151| 21.5k|#define MP_ZPOS 0 /* positive integer */ ------------------ 18| 21.5k| } 19| 27.8k|} mp_clear_multi: 9| 1|{ 10| 1| mp_int *next_mp = mp; 11| 1| va_list args; 12| 1| va_start(args, mp); 13| 5| while (next_mp != NULL) { ------------------ | Branch (13:11): [True: 4, False: 1] ------------------ 14| 4| mp_clear(next_mp); 15| 4| next_mp = va_arg(args, mp_int *); 16| 4| } 17| 1| va_end(args); 18| 1|} mp_cmp: 8| 5|{ 9| | /* compare based on sign */ 10| 5| if (a->sign != b->sign) { ------------------ | Branch (10:8): [True: 0, False: 5] ------------------ 11| 0| if (a->sign == MP_NEG) { ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ | Branch (11:11): [True: 0, False: 0] ------------------ 12| 0| return MP_LT; ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ 13| 0| } else { 14| 0| return MP_GT; ------------------ | | 156| 0|#define MP_GT 1 /* greater than */ ------------------ 15| 0| } 16| 0| } 17| | 18| | /* compare digits */ 19| 5| if (a->sign == MP_NEG) { ------------------ | | 152| 5|#define MP_NEG 1 /* negative */ ------------------ | Branch (19:8): [True: 0, False: 5] ------------------ 20| | /* if negative compare opposite direction */ 21| 0| return mp_cmp_mag(b, a); 22| 5| } else { 23| 5| return mp_cmp_mag(a, b); 24| 5| } 25| 5|} mp_cmp_d: 8| 4|{ 9| | /* compare based on sign */ 10| 4| if (a->sign == MP_NEG) { ------------------ | | 152| 4|#define MP_NEG 1 /* negative */ ------------------ | Branch (10:8): [True: 0, False: 4] ------------------ 11| 0| return MP_LT; ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ 12| 0| } 13| | 14| | /* compare based on magnitude */ 15| 4| if (a->used > 1) { ------------------ | Branch (15:8): [True: 4, False: 0] ------------------ 16| 4| return MP_GT; ------------------ | | 156| 4|#define MP_GT 1 /* greater than */ ------------------ 17| 4| } 18| | 19| | /* compare the only digit of a to b */ 20| 0| if (a->dp[0] > b) { ------------------ | Branch (20:8): [True: 0, False: 0] ------------------ 21| 0| return MP_GT; ------------------ | | 156| 0|#define MP_GT 1 /* greater than */ ------------------ 22| 0| } else if (a->dp[0] < b) { ------------------ | Branch (22:15): [True: 0, False: 0] ------------------ 23| 0| return MP_LT; ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ 24| 0| } else { 25| 0| return MP_EQ; ------------------ | | 155| 0|#define MP_EQ 0 /* equal to */ ------------------ 26| 0| } 27| 0|} mp_cmp_mag: 8| 28|{ 9| 28| int n; 10| 28| const mp_digit *tmpa, *tmpb; 11| | 12| | /* compare based on # of non-zero digits */ 13| 28| if (a->used > b->used) { ------------------ | Branch (13:8): [True: 2, False: 26] ------------------ 14| 2| return MP_GT; ------------------ | | 156| 2|#define MP_GT 1 /* greater than */ ------------------ 15| 2| } 16| | 17| 26| if (a->used < b->used) { ------------------ | Branch (17:8): [True: 0, False: 26] ------------------ 18| 0| return MP_LT; ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ 19| 0| } 20| | 21| | /* alias for a */ 22| 26| tmpa = a->dp + (a->used - 1); 23| | 24| | /* alias for b */ 25| 26| tmpb = b->dp + (a->used - 1); 26| | 27| | /* compare based on digits */ 28| 43| for (n = 0; n < a->used; ++n, --tmpa, --tmpb) { ------------------ | Branch (28:16): [True: 42, False: 1] ------------------ 29| 42| if (*tmpa > *tmpb) { ------------------ | Branch (29:11): [True: 11, False: 31] ------------------ 30| 11| return MP_GT; ------------------ | | 156| 11|#define MP_GT 1 /* greater than */ ------------------ 31| 11| } 32| | 33| 31| if (*tmpa < *tmpb) { ------------------ | Branch (33:11): [True: 14, False: 17] ------------------ 34| 14| return MP_LT; ------------------ | | 154| 14|#define MP_LT -1 /* less than */ ------------------ 35| 14| } 36| 31| } 37| 1| return MP_EQ; ------------------ | | 155| 1|#define MP_EQ 0 /* equal to */ ------------------ 38| 26|} mp_copy: 8| 37.1k|{ 9| 37.1k| int n; 10| 37.1k| mp_digit *tmpa, *tmpb; 11| 37.1k| mp_err err; 12| | 13| | /* if dst == src do nothing */ 14| 37.1k| if (a == b) { ------------------ | Branch (14:8): [True: 27.8k, False: 9.28k] ------------------ 15| 27.8k| return MP_OKAY; ------------------ | | 161| 27.8k|#define MP_OKAY 0 /* no error */ ------------------ 16| 27.8k| } 17| | 18| | /* grow dest */ 19| 9.28k| if (b->alloc < a->used) { ------------------ | Branch (19:8): [True: 0, False: 9.28k] ------------------ 20| 0| if ((err = mp_grow(b, a->used)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (20:11): [True: 0, False: 0] ------------------ 21| 0| return err; 22| 0| } 23| 0| } 24| | 25| | /* zero b and copy the parameters over */ 26| | /* pointer aliases */ 27| | 28| | /* source */ 29| 9.28k| tmpa = a->dp; 30| | 31| | /* destination */ 32| 9.28k| tmpb = b->dp; 33| | 34| | /* copy all the digits */ 35| 18.5k| for (n = 0; n < a->used; n++) { ------------------ | Branch (35:16): [True: 9.30k, False: 9.28k] ------------------ 36| 9.30k| *tmpb++ = *tmpa++; 37| 9.30k| } 38| | 39| | /* clear high digits */ 40| 9.28k| MP_ZERO_DIGITS(tmpb, b->used - n); ------------------ | | 89| 9.28k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 9.28k|do { \ | | 91| 9.28k| int zd_ = (digits); \ | | 92| 9.28k| mp_digit* zm_ = (mem); \ | | 93| 9.28k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 9.28k] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 9.28k|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 41| | 42| | /* copy used count and sign */ 43| 9.28k| b->used = a->used; 44| 9.28k| b->sign = a->sign; 45| 9.28k| return MP_OKAY; ------------------ | | 161| 9.28k|#define MP_OKAY 0 /* no error */ ------------------ 46| 9.28k|} mp_count_bits: 8| 18.5k|{ 9| 18.5k| int r; 10| 18.5k| mp_digit q; 11| | 12| | /* shortcut */ 13| 18.5k| if (MP_IS_ZERO(a)) { ------------------ | | 163| 18.5k|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 18.5k] | | ------------------ ------------------ 14| 0| return 0; 15| 0| } 16| | 17| | /* get number of digits and add that */ 18| 18.5k| r = (a->used - 1) * MP_DIGIT_BIT; ------------------ | | 82| 18.5k|# define MP_DIGIT_BIT 60 ------------------ 19| | 20| | /* take the last digit and count the bits in it */ 21| 18.5k| q = a->dp[a->used - 1]; 22| 463k| while (q > 0u) { ------------------ | Branch (22:11): [True: 445k, False: 18.5k] ------------------ 23| 445k| ++r; 24| 445k| q >>= 1u; 25| 445k| } 26| 18.5k| return r; 27| 18.5k|} mp_div: 87| 2|{ 88| 2| mp_int q, x, y, t1, t2; 89| 2| int n, t, i, norm; 90| 2| mp_sign neg; 91| 2| mp_err err; 92| | 93| | /* is divisor zero ? */ 94| 2| if (MP_IS_ZERO(b)) { ------------------ | | 163| 2|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 2] | | ------------------ ------------------ 95| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 96| 0| } 97| | 98| | /* if a < b then q=0, r = a */ 99| 2| if (mp_cmp_mag(a, b) == MP_LT) { ------------------ | | 154| 2|#define MP_LT -1 /* less than */ ------------------ | Branch (99:8): [True: 0, False: 2] ------------------ 100| 0| if (d != NULL) { ------------------ | Branch (100:11): [True: 0, False: 0] ------------------ 101| 0| err = mp_copy(a, d); 102| 0| } else { 103| 0| err = MP_OKAY; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ 104| 0| } 105| 0| if (c != NULL) { ------------------ | Branch (105:11): [True: 0, False: 0] ------------------ 106| 0| mp_zero(c); 107| 0| } 108| 0| return err; 109| 0| } 110| | 111| 2| if ((err = mp_init_size(&q, a->used + 2)) != MP_OKAY) { ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (111:8): [True: 0, False: 2] ------------------ 112| 0| return err; 113| 0| } 114| 2| q.used = a->used + 2; 115| | 116| 2| if ((err = mp_init(&t1)) != MP_OKAY) goto LBL_Q; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (116:8): [True: 0, False: 2] ------------------ 117| | 118| 2| if ((err = mp_init(&t2)) != MP_OKAY) goto LBL_T1; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (118:8): [True: 0, False: 2] ------------------ 119| | 120| 2| if ((err = mp_init_copy(&x, a)) != MP_OKAY) goto LBL_T2; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (120:8): [True: 0, False: 2] ------------------ 121| | 122| 2| if ((err = mp_init_copy(&y, b)) != MP_OKAY) goto LBL_X; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (122:8): [True: 0, False: 2] ------------------ 123| | 124| | /* fix the sign */ 125| 2| neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 151| 2|#define MP_ZPOS 0 /* positive integer */ ------------------ neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 152| 2|#define MP_NEG 1 /* negative */ ------------------ | Branch (125:10): [True: 2, False: 0] ------------------ 126| 2| x.sign = y.sign = MP_ZPOS; ------------------ | | 151| 2|#define MP_ZPOS 0 /* positive integer */ ------------------ 127| | 128| | /* normalize both x and y, ensure that y >= b/2, [b == 2**MP_DIGIT_BIT] */ 129| 2| norm = mp_count_bits(&y) % MP_DIGIT_BIT; ------------------ | | 82| 2|# define MP_DIGIT_BIT 60 ------------------ 130| 2| if (norm < (MP_DIGIT_BIT - 1)) { ------------------ | | 82| 2|# define MP_DIGIT_BIT 60 ------------------ | Branch (130:8): [True: 2, False: 0] ------------------ 131| 2| norm = (MP_DIGIT_BIT - 1) - norm; ------------------ | | 82| 2|# define MP_DIGIT_BIT 60 ------------------ 132| 2| if ((err = mp_mul_2d(&x, norm, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (132:11): [True: 0, False: 2] ------------------ 133| 2| if ((err = mp_mul_2d(&y, norm, &y)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (133:11): [True: 0, False: 2] ------------------ 134| 2| } else { 135| 0| norm = 0; 136| 0| } 137| | 138| | /* note hac does 0 based, so if used==5 then its 0,1,2,3,4, e.g. use 4 */ 139| 2| n = x.used - 1; 140| 2| t = y.used - 1; 141| | 142| | /* while (x >= y*b**n-t) do { q[n-t] += 1; x -= y*b**{n-t} } */ 143| | /* y = y*b**{n-t} */ 144| 2| if ((err = mp_lshd(&y, n - t)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (144:8): [True: 0, False: 2] ------------------ 145| | 146| 2| while (mp_cmp(&x, &y) != MP_LT) { ------------------ | | 154| 2|#define MP_LT -1 /* less than */ ------------------ | Branch (146:11): [True: 0, False: 2] ------------------ 147| 0| ++(q.dp[n - t]); 148| 0| if ((err = mp_sub(&x, &y, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (148:11): [True: 0, False: 0] ------------------ 149| 0| } 150| | 151| | /* reset y by shifting it back down */ 152| 2| mp_rshd(&y, n - t); 153| | 154| | /* step 3. for i from n down to (t + 1) */ 155| 12| for (i = n; i >= (t + 1); i--) { ------------------ | Branch (155:16): [True: 10, False: 2] ------------------ 156| 10| if (i > x.used) { ------------------ | Branch (156:11): [True: 0, False: 10] ------------------ 157| 0| continue; 158| 0| } 159| | 160| | /* step 3.1 if xi == yt then set q{i-t-1} to b-1, 161| | * otherwise set q{i-t-1} to (xi*b + x{i-1})/yt */ 162| 10| if (x.dp[i] == y.dp[t]) { ------------------ | Branch (162:11): [True: 0, False: 10] ------------------ 163| 0| q.dp[(i - t) - 1] = ((mp_digit)1 << (mp_digit)MP_DIGIT_BIT) - (mp_digit)1; ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ 164| 10| } else { 165| 10| mp_word tmp; 166| 10| tmp = (mp_word)x.dp[i] << (mp_word)MP_DIGIT_BIT; ------------------ | | 82| 10|# define MP_DIGIT_BIT 60 ------------------ 167| 10| tmp |= (mp_word)x.dp[i - 1]; 168| 10| tmp /= (mp_word)y.dp[t]; 169| 10| if (tmp > (mp_word)MP_MASK) { ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (169:14): [True: 0, False: 10] ------------------ 170| 0| tmp = MP_MASK; ------------------ | | 106| 0|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 0|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 171| 0| } 172| 10| q.dp[(i - t) - 1] = (mp_digit)(tmp & (mp_word)MP_MASK); ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 173| 10| } 174| | 175| | /* while (q{i-t-1} * (yt * b + y{t-1})) > 176| | xi * b**2 + xi-1 * b + xi-2 177| | 178| | do q{i-t-1} -= 1; 179| | */ 180| 10| q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] + 1uL) & (mp_digit)MP_MASK; ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 181| 10| do { 182| 10| q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] - 1uL) & (mp_digit)MP_MASK; ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 183| | 184| | /* find left hand */ 185| 10| mp_zero(&t1); 186| 10| t1.dp[0] = ((t - 1) < 0) ? 0u : y.dp[t - 1]; ------------------ | Branch (186:21): [True: 0, False: 10] ------------------ 187| 10| t1.dp[1] = y.dp[t]; 188| 10| t1.used = 2; 189| 10| if ((err = mp_mul_d(&t1, q.dp[(i - t) - 1], &t1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ | Branch (189:14): [True: 0, False: 10] ------------------ 190| | 191| | /* find right hand */ 192| 10| t2.dp[0] = ((i - 2) < 0) ? 0u : x.dp[i - 2]; ------------------ | Branch (192:21): [True: 0, False: 10] ------------------ 193| 10| t2.dp[1] = x.dp[i - 1]; /* i >= 1 always holds */ 194| 10| t2.dp[2] = x.dp[i]; 195| 10| t2.used = 3; 196| 10| } while (mp_cmp_mag(&t1, &t2) == MP_GT); ------------------ | | 156| 10|#define MP_GT 1 /* greater than */ ------------------ | Branch (196:16): [True: 0, False: 10] ------------------ 197| | 198| | /* step 3.3 x = x - q{i-t-1} * y * b**{i-t-1} */ 199| 10| if ((err = mp_mul_d(&y, q.dp[(i - t) - 1], &t1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ | Branch (199:11): [True: 0, False: 10] ------------------ 200| | 201| 10| if ((err = mp_lshd(&t1, (i - t) - 1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ | Branch (201:11): [True: 0, False: 10] ------------------ 202| | 203| 10| if ((err = mp_sub(&x, &t1, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ | Branch (203:11): [True: 0, False: 10] ------------------ 204| | 205| | /* if x < 0 then { x = x + y*b**{i-t-1}; q{i-t-1} -= 1; } */ 206| 10| if (x.sign == MP_NEG) { ------------------ | | 152| 10|#define MP_NEG 1 /* negative */ ------------------ | Branch (206:11): [True: 0, False: 10] ------------------ 207| 0| if ((err = mp_copy(&y, &t1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (207:14): [True: 0, False: 0] ------------------ 208| 0| if ((err = mp_lshd(&t1, (i - t) - 1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (208:14): [True: 0, False: 0] ------------------ 209| 0| if ((err = mp_add(&x, &t1, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (209:14): [True: 0, False: 0] ------------------ 210| | 211| 0| q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] - 1uL) & MP_MASK; ------------------ | | 106| 0|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 0|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 212| 0| } 213| 10| } 214| | 215| | /* now q is the quotient and x is the remainder 216| | * [which we have to normalize] 217| | */ 218| | 219| | /* get sign before writing to c */ 220| 2| x.sign = (x.used == 0) ? MP_ZPOS : a->sign; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (220:13): [True: 0, False: 2] ------------------ 221| | 222| 2| if (c != NULL) { ------------------ | Branch (222:8): [True: 0, False: 2] ------------------ 223| 0| mp_clamp(&q); 224| 0| mp_exch(&q, c); 225| 0| c->sign = neg; 226| 0| } 227| | 228| 2| if (d != NULL) { ------------------ | Branch (228:8): [True: 2, False: 0] ------------------ 229| 2| if ((err = mp_div_2d(&x, norm, &x, NULL)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (229:11): [True: 0, False: 2] ------------------ 230| 2| mp_exch(&x, d); 231| 2| } 232| | 233| 2| err = MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 234| | 235| 2|LBL_Y: 236| 2| mp_clear(&y); 237| 2|LBL_X: 238| 2| mp_clear(&x); 239| 2|LBL_T2: 240| 2| mp_clear(&t2); 241| 2|LBL_T1: 242| 2| mp_clear(&t1); 243| 2|LBL_Q: 244| 2| mp_clear(&q); 245| 2| return err; 246| 2|} mp_div_2d: 8| 27.8k|{ 9| 27.8k| mp_digit D, r, rr; 10| 27.8k| int x; 11| 27.8k| mp_err err; 12| | 13| | /* if the shift count is <= 0 then we do no work */ 14| 27.8k| if (b <= 0) { ------------------ | Branch (14:8): [True: 0, False: 27.8k] ------------------ 15| 0| err = mp_copy(a, c); 16| 0| if (d != NULL) { ------------------ | Branch (16:11): [True: 0, False: 0] ------------------ 17| 0| mp_zero(d); 18| 0| } 19| 0| return err; 20| 0| } 21| | 22| | /* copy */ 23| 27.8k| if ((err = mp_copy(a, c)) != MP_OKAY) { ------------------ | | 161| 27.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (23:8): [True: 0, False: 27.8k] ------------------ 24| 0| return err; 25| 0| } 26| | /* 'a' should not be used after here - it might be the same as d */ 27| | 28| | /* get the remainder */ 29| 27.8k| if (d != NULL) { ------------------ | Branch (29:8): [True: 0, False: 27.8k] ------------------ 30| 0| if ((err = mp_mod_2d(a, b, d)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (30:11): [True: 0, False: 0] ------------------ 31| 0| return err; 32| 0| } 33| 0| } 34| | 35| | /* shift by as many digits in the bit count */ 36| 27.8k| if (b >= MP_DIGIT_BIT) { ------------------ | | 82| 27.8k|# define MP_DIGIT_BIT 60 ------------------ | Branch (36:8): [True: 0, False: 27.8k] ------------------ 37| 0| mp_rshd(c, b / MP_DIGIT_BIT); ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ 38| 0| } 39| | 40| | /* shift any bit count < MP_DIGIT_BIT */ 41| 27.8k| D = (mp_digit)(b % MP_DIGIT_BIT); ------------------ | | 82| 27.8k|# define MP_DIGIT_BIT 60 ------------------ 42| 27.8k| if (D != 0u) { ------------------ | Branch (42:8): [True: 27.8k, False: 0] ------------------ 43| 27.8k| mp_digit *tmpc, mask, shift; 44| | 45| | /* mask */ 46| 27.8k| mask = ((mp_digit)1 << D) - 1uL; 47| | 48| | /* shift for lsb */ 49| 27.8k| shift = (mp_digit)MP_DIGIT_BIT - D; ------------------ | | 82| 27.8k|# define MP_DIGIT_BIT 60 ------------------ 50| | 51| | /* alias */ 52| 27.8k| tmpc = c->dp + (c->used - 1); 53| | 54| | /* carry */ 55| 27.8k| r = 0; 56| 55.6k| for (x = c->used - 1; x >= 0; x--) { ------------------ | Branch (56:29): [True: 27.8k, False: 27.8k] ------------------ 57| | /* get the lower bits of this word in a temp */ 58| 27.8k| rr = *tmpc & mask; 59| | 60| | /* shift the current word and mix in the carry bits from the previous word */ 61| 27.8k| *tmpc = (*tmpc >> D) | (r << shift); 62| 27.8k| --tmpc; 63| | 64| | /* set the carry to the carry bits of the current word found above */ 65| 27.8k| r = rr; 66| 27.8k| } 67| 27.8k| } 68| 27.8k| mp_clamp(c); 69| 27.8k| return MP_OKAY; ------------------ | | 161| 27.8k|#define MP_OKAY 0 /* no error */ ------------------ 70| 27.8k|} mp_exch: 10| 4|{ 11| 4| mp_int t; 12| | 13| 4| t = *a; 14| 4| *a = *b; 15| 4| *b = t; 16| 4|} mp_from_ubin: 8| 2.87k|{ 9| 2.87k| mp_err err; 10| | 11| | /* make sure there are at least two digits */ 12| 2.87k| if (a->alloc < 2) { ------------------ | Branch (12:8): [True: 0, False: 2.87k] ------------------ 13| 0| if ((err = mp_grow(a, 2)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (13:11): [True: 0, False: 0] ------------------ 14| 0| return err; 15| 0| } 16| 0| } 17| | 18| | /* zero the int */ 19| 2.87k| mp_zero(a); 20| | 21| | /* read the bytes in */ 22| 28.6k| while (size-- > 0u) { ------------------ | Branch (22:11): [True: 25.7k, False: 2.87k] ------------------ 23| 25.7k| if ((err = mp_mul_2d(a, 8, a)) != MP_OKAY) { ------------------ | | 161| 25.7k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (23:11): [True: 0, False: 25.7k] ------------------ 24| 0| return err; 25| 0| } 26| | 27| 25.7k|#ifndef MP_8BIT 28| 25.7k| a->dp[0] |= *buf++; 29| 25.7k| a->used += 1; 30| |#else 31| | a->dp[0] = (*buf & MP_MASK); 32| | a->dp[1] |= ((*buf++ >> 7) & 1u); 33| | a->used += 2; 34| |#endif 35| 25.7k| } 36| 2.87k| mp_clamp(a); 37| 2.87k| return MP_OKAY; ------------------ | | 161| 2.87k|#define MP_OKAY 0 /* no error */ ------------------ 38| 2.87k|} mp_grow: 8| 1.54k|{ 9| 1.54k| int i; 10| 1.54k| mp_digit *tmp; 11| | 12| | /* if the alloc size is smaller alloc more ram */ 13| 1.54k| if (a->alloc < size) { ------------------ | Branch (13:8): [True: 1.54k, False: 0] ------------------ 14| | /* reallocate the array a->dp 15| | * 16| | * We store the return in a temporary variable 17| | * in case the operation failed we don't want 18| | * to overwrite the dp member of a. 19| | */ 20| 1.54k| tmp = (mp_digit *) MP_REALLOC(a->dp, ------------------ | | 1325| 1.54k|#define MP_REALLOC m_realloc_ltm ------------------ 21| 1.54k| (size_t)a->alloc * sizeof(mp_digit), 22| 1.54k| (size_t)size * sizeof(mp_digit)); 23| 1.54k| if (tmp == NULL) { ------------------ | Branch (23:11): [True: 0, False: 1.54k] ------------------ 24| | /* reallocation failed but "a" is still valid [can be freed] */ 25| 0| return MP_MEM; ------------------ | | 163| 0|#define MP_MEM -2 /* out of mem */ ------------------ 26| 0| } 27| | 28| | /* reallocation succeeded so set a->dp */ 29| 1.54k| a->dp = tmp; 30| | 31| | /* zero excess digits */ 32| 1.54k| i = a->alloc; 33| 1.54k| a->alloc = size; 34| 1.54k| MP_ZERO_DIGITS(a->dp + i, a->alloc - i); ------------------ | | 89| 1.54k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 1.54k|do { \ | | 91| 1.54k| int zd_ = (digits); \ | | 92| 1.54k| mp_digit* zm_ = (mem); \ | | 93| 3.09k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 1.55k, False: 1.54k] | | ------------------ | | 94| 1.55k| *zm_++ = 0; \ | | 95| 1.55k| } \ | | 96| 1.54k|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 35| 1.54k| } 36| 1.54k| return MP_OKAY; ------------------ | | 161| 1.54k|#define MP_OKAY 0 /* no error */ ------------------ 37| 1.54k|} mp_init: 8| 12.2k|{ 9| | /* allocate memory required and clear it */ 10| 12.2k| a->dp = (mp_digit *) MP_CALLOC((size_t)MP_PREC, sizeof(mp_digit)); ------------------ | | 1326| 12.2k|#define MP_CALLOC m_calloc ------------------ a->dp = (mp_digit *) MP_CALLOC((size_t)MP_PREC, sizeof(mp_digit)); ------------------ | | 177| 12.2k|# define MP_PREC PRIVATE_MP_PREC | | ------------------ | | | | 193| 12.2k|# define PRIVATE_MP_PREC 32 /* default digits of precision */ | | ------------------ ------------------ 11| 12.2k| if (a->dp == NULL) { ------------------ | Branch (11:8): [True: 0, False: 12.2k] ------------------ 12| 0| return MP_MEM; ------------------ | | 163| 0|#define MP_MEM -2 /* out of mem */ ------------------ 13| 0| } 14| | 15| | /* set the used to zero, allocated digits to the default precision 16| | * and sign to positive */ 17| 12.2k| a->used = 0; 18| 12.2k| a->alloc = MP_PREC; ------------------ | | 177| 12.2k|# define MP_PREC PRIVATE_MP_PREC | | ------------------ | | | | 193| 12.2k|# define PRIVATE_MP_PREC 32 /* default digits of precision */ | | ------------------ ------------------ 19| 12.2k| a->sign = MP_ZPOS; ------------------ | | 151| 12.2k|#define MP_ZPOS 0 /* positive integer */ ------------------ 20| | 21| 12.2k| return MP_OKAY; ------------------ | | 161| 12.2k|#define MP_OKAY 0 /* no error */ ------------------ 22| 12.2k|} mp_init_copy: 8| 9.28k|{ 9| 9.28k| mp_err err; 10| | 11| 9.28k| if ((err = mp_init_size(a, b->used)) != MP_OKAY) { ------------------ | | 161| 9.28k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (11:8): [True: 0, False: 9.28k] ------------------ 12| 0| return err; 13| 0| } 14| | 15| 9.28k| if ((err = mp_copy(b, a)) != MP_OKAY) { ------------------ | | 161| 9.28k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (15:8): [True: 0, False: 9.28k] ------------------ 16| 0| mp_clear(a); 17| 0| } 18| | 19| 9.28k| return err; 20| 9.28k|} mp_init_size: 8| 9.28k|{ 9| 9.28k| size = MP_MAX(MP_MIN_PREC, size); ------------------ | | 157| 9.28k|#define MP_MAX(x, y) (((x) > (y)) ? (x) : (y)) | | ------------------ | | | Branch (157:23): [True: 9.27k, False: 8] | | ------------------ ------------------ 10| | 11| | /* alloc mem */ 12| 9.28k| a->dp = (mp_digit *) MP_CALLOC((size_t)size, sizeof(mp_digit)); ------------------ | | 1326| 9.28k|#define MP_CALLOC m_calloc ------------------ 13| 9.28k| if (a->dp == NULL) { ------------------ | Branch (13:8): [True: 0, False: 9.28k] ------------------ 14| 0| return MP_MEM; ------------------ | | 163| 0|#define MP_MEM -2 /* out of mem */ ------------------ 15| 0| } 16| | 17| | /* set the members */ 18| 9.28k| a->used = 0; 19| 9.28k| a->alloc = size; 20| 9.28k| a->sign = MP_ZPOS; ------------------ | | 151| 9.28k|#define MP_ZPOS 0 /* positive integer */ ------------------ 21| | 22| 9.28k| return MP_OKAY; ------------------ | | 161| 9.28k|#define MP_OKAY 0 /* no error */ ------------------ 23| 9.28k|} mp_lshd: 8| 12|{ 9| 12| int x; 10| 12| mp_err err; 11| 12| mp_digit *top, *bottom; 12| | 13| | /* if its less than zero return */ 14| 12| if (b <= 0) { ------------------ | Branch (14:8): [True: 2, False: 10] ------------------ 15| 2| return MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 16| 2| } 17| | /* no need to shift 0 around */ 18| 10| if (MP_IS_ZERO(a)) { ------------------ | | 163| 10|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 10] | | ------------------ ------------------ 19| 0| return MP_OKAY; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ 20| 0| } 21| | 22| | /* grow to fit the new digits */ 23| 10| if (a->alloc < (a->used + b)) { ------------------ | Branch (23:8): [True: 2, False: 8] ------------------ 24| 2| if ((err = mp_grow(a, a->used + b)) != MP_OKAY) { ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (24:11): [True: 0, False: 2] ------------------ 25| 0| return err; 26| 0| } 27| 2| } 28| | 29| | /* increment the used by the shift amount then copy upwards */ 30| 10| a->used += b; 31| | 32| | /* top */ 33| 10| top = a->dp + a->used - 1; 34| | 35| | /* base */ 36| 10| bottom = (a->dp + a->used - 1) - b; 37| | 38| | /* much like mp_rshd this is implemented using a sliding window 39| | * except the window goes the otherway around. Copying from 40| | * the bottom to the top. see bn_mp_rshd.c for more info. 41| | */ 42| 68| for (x = a->used - 1; x >= b; x--) { ------------------ | Branch (42:26): [True: 58, False: 10] ------------------ 43| 58| *top-- = *bottom--; 44| 58| } 45| | 46| | /* zero the lower digits */ 47| 10| MP_ZERO_DIGITS(a->dp, b); ------------------ | | 89| 10|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 10|do { \ | | 91| 10| int zd_ = (digits); \ | | 92| 10| mp_digit* zm_ = (mem); \ | | 93| 40| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 30, False: 10] | | ------------------ | | 94| 30| *zm_++ = 0; \ | | 95| 30| } \ | | 96| 10|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 48| | 49| 10| return MP_OKAY; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ 50| 10|} mp_mod: 8| 2|{ 9| 2| mp_int t; 10| 2| mp_err err; 11| | 12| 2| if ((err = mp_init_size(&t, b->used)) != MP_OKAY) { ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (12:8): [True: 0, False: 2] ------------------ 13| 0| return err; 14| 0| } 15| | 16| 2| if ((err = mp_div(a, b, NULL, &t)) != MP_OKAY) { ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (16:8): [True: 0, False: 2] ------------------ 17| 0| goto LBL_ERR; 18| 0| } 19| | 20| 2| if (MP_IS_ZERO(&t) || (t.sign == b->sign)) { ------------------ | | 163| 4|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 2] | | ------------------ ------------------ | Branch (20:26): [True: 2, False: 0] ------------------ 21| 2| err = MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 22| 2| mp_exch(&t, c); 23| 2| } else { 24| 0| err = mp_add(b, &t, c); 25| 0| } 26| | 27| 2|LBL_ERR: 28| 2| mp_clear(&t); 29| 2| return err; 30| 2|} mp_mul: 8| 1|{ 9| 1| mp_err err; 10| 1| int min_len = MP_MIN(a->used, b->used), ------------------ | | 156| 1|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 0, False: 1] | | ------------------ ------------------ 11| 1| max_len = MP_MAX(a->used, b->used), ------------------ | | 157| 1|#define MP_MAX(x, y) (((x) > (y)) ? (x) : (y)) | | ------------------ | | | Branch (157:23): [True: 0, False: 1] | | ------------------ ------------------ 12| 1| digs = a->used + b->used + 1; 13| 1| mp_sign neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 151| 1|#define MP_ZPOS 0 /* positive integer */ ------------------ mp_sign neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ | Branch (13:18): [True: 1, False: 0] ------------------ 14| | 15| 1| if (MP_HAS(S_MP_BALANCE_MUL) && ------------------ | | 150| 2|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 1|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 1|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 16| | /* Check sizes. The smaller one needs to be larger than the Karatsuba cut-off. 17| | * The bigger one needs to be at least about one MP_KARATSUBA_MUL_CUTOFF bigger 18| | * to make some sense, but it depends on architecture, OS, position of the 19| | * stars... so YMMV. 20| | * Using it to cut the input into slices small enough for fast_s_mp_mul_digs 21| | * was actually slower on the author's machine, but YMMV. 22| | */ 23| 1| (min_len >= MP_KARATSUBA_MUL_CUTOFF) && ------------------ | | 121| 1|# define MP_KARATSUBA_MUL_CUTOFF KARATSUBA_MUL_CUTOFF ------------------ | Branch (23:8): [True: 0, False: 1] ------------------ 24| 1| ((max_len / 2) >= MP_KARATSUBA_MUL_CUTOFF) && ------------------ | | 121| 0|# define MP_KARATSUBA_MUL_CUTOFF KARATSUBA_MUL_CUTOFF ------------------ | Branch (24:8): [True: 0, False: 0] ------------------ 25| | /* Not much effect was observed below a ratio of 1:2, but again: YMMV. */ 26| 1| (max_len >= (2 * min_len))) { ------------------ | Branch (26:8): [True: 0, False: 0] ------------------ 27| 0| err = s_mp_balance_mul(a,b,c); 28| 1| } else if (MP_HAS(S_MP_TOOM_MUL) && ------------------ | | 150| 2|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 1|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 1|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 29| 1| (min_len >= MP_TOOM_MUL_CUTOFF)) { ------------------ | | 123| 0|# define MP_TOOM_MUL_CUTOFF TOOM_MUL_CUTOFF ------------------ | Branch (29:15): [True: 0, False: 0] ------------------ 30| 0| err = s_mp_toom_mul(a, b, c); 31| 1| } else if (MP_HAS(S_MP_KARATSUBA_MUL) && ------------------ | | 150| 2|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 1|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 1|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 32| 1| (min_len >= MP_KARATSUBA_MUL_CUTOFF)) { ------------------ | | 121| 0|# define MP_KARATSUBA_MUL_CUTOFF KARATSUBA_MUL_CUTOFF ------------------ | Branch (32:15): [True: 0, False: 0] ------------------ 33| 0| err = s_mp_karatsuba_mul(a, b, c); 34| 1| } else if (MP_HAS(S_MP_MUL_DIGS_FAST) && ------------------ | | 150| 2|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 1|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 1|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 35| | /* can we use the fast multiplier? 36| | * 37| | * The fast multiplier can be used if the output will 38| | * have less than MP_WARRAY digits and the number of 39| | * digits won't affect carry propagation 40| | */ 41| 1| (digs < MP_WARRAY) && ------------------ | | 172| 1|#define MP_WARRAY PRIVATE_MP_WARRAY | | ------------------ | | | | 203| 1|#define PRIVATE_MP_WARRAY (int)(1uLL << (((CHAR_BIT * sizeof(private_mp_word)) - (2 * MP_DIGIT_BIT)) + 1)) | | | | ------------------ | | | | | | 82| 1|# define MP_DIGIT_BIT 60 | | | | ------------------ | | ------------------ ------------------ | Branch (41:15): [True: 1, False: 0] ------------------ 42| 1| (min_len <= MP_MAXFAST)) { ------------------ | | 168| 1|#define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 167| 1|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) | | ------------------ | | #define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 82| 1|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (42:15): [True: 1, False: 0] ------------------ 43| 1| err = s_mp_mul_digs_fast(a, b, c, digs); 44| 1| } else if (MP_HAS(S_MP_MUL_DIGS)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 45| 0| err = s_mp_mul_digs(a, b, c, digs); 46| 0| } else { 47| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 48| 0| } 49| 1| c->sign = (c->used > 0) ? neg : MP_ZPOS; ------------------ | | 151| 1|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (49:14): [True: 1, False: 0] ------------------ 50| 1| return err; 51| 1|} mp_mul_2d: 8| 25.7k|{ 9| 25.7k| mp_digit d; 10| 25.7k| mp_err err; 11| | 12| | /* copy */ 13| 25.7k| if (a != c) { ------------------ | Branch (13:8): [True: 0, False: 25.7k] ------------------ 14| 0| if ((err = mp_copy(a, c)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (14:11): [True: 0, False: 0] ------------------ 15| 0| return err; 16| 0| } 17| 0| } 18| | 19| 25.7k| if (c->alloc < (c->used + (b / MP_DIGIT_BIT) + 1)) { ------------------ | | 82| 25.7k|# define MP_DIGIT_BIT 60 ------------------ | Branch (19:8): [True: 1.54k, False: 24.2k] ------------------ 20| 1.54k| if ((err = mp_grow(c, c->used + (b / MP_DIGIT_BIT) + 1)) != MP_OKAY) { ------------------ | | 82| 1.54k|# define MP_DIGIT_BIT 60 ------------------ if ((err = mp_grow(c, c->used + (b / MP_DIGIT_BIT) + 1)) != MP_OKAY) { ------------------ | | 161| 1.54k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (20:11): [True: 0, False: 1.54k] ------------------ 21| 0| return err; 22| 0| } 23| 1.54k| } 24| | 25| | /* shift by as many digits in the bit count */ 26| 25.7k| if (b >= MP_DIGIT_BIT) { ------------------ | | 82| 25.7k|# define MP_DIGIT_BIT 60 ------------------ | Branch (26:8): [True: 0, False: 25.7k] ------------------ 27| 0| if ((err = mp_lshd(c, b / MP_DIGIT_BIT)) != MP_OKAY) { ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ if ((err = mp_lshd(c, b / MP_DIGIT_BIT)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (27:11): [True: 0, False: 0] ------------------ 28| 0| return err; 29| 0| } 30| 0| } 31| | 32| | /* shift any bit count < MP_DIGIT_BIT */ 33| 25.7k| d = (mp_digit)(b % MP_DIGIT_BIT); ------------------ | | 82| 25.7k|# define MP_DIGIT_BIT 60 ------------------ 34| 25.7k| if (d != 0u) { ------------------ | Branch (34:8): [True: 25.7k, False: 0] ------------------ 35| 25.7k| mp_digit *tmpc, shift, mask, r, rr; 36| 25.7k| int x; 37| | 38| | /* bitmask for carries */ 39| 25.7k| mask = ((mp_digit)1 << d) - (mp_digit)1; 40| | 41| | /* shift for msbs */ 42| 25.7k| shift = (mp_digit)MP_DIGIT_BIT - d; ------------------ | | 82| 25.7k|# define MP_DIGIT_BIT 60 ------------------ 43| | 44| | /* alias */ 45| 25.7k| tmpc = c->dp; 46| | 47| | /* carry */ 48| 25.7k| r = 0; 49| 1.01M| for (x = 0; x < c->used; x++) { ------------------ | Branch (49:19): [True: 989k, False: 25.7k] ------------------ 50| | /* get the higher bits of the current word */ 51| 989k| rr = (*tmpc >> shift) & mask; 52| | 53| | /* shift the current word and OR in the carry */ 54| 989k| *tmpc = ((*tmpc << d) | r) & MP_MASK; ------------------ | | 106| 989k|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 989k|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 55| 989k| ++tmpc; 56| | 57| | /* set the carry to the carry bits of the current word */ 58| 989k| r = rr; 59| 989k| } 60| | 61| | /* set final carry */ 62| 25.7k| if (r != 0u) { ------------------ | Branch (62:11): [True: 2, False: 25.7k] ------------------ 63| 2| c->dp[(c->used)++] = r; 64| 2| } 65| 25.7k| } 66| 25.7k| mp_clamp(c); 67| 25.7k| return MP_OKAY; ------------------ | | 161| 25.7k|#define MP_OKAY 0 /* no error */ ------------------ 68| 25.7k|} mp_mul_d: 8| 148|{ 9| 148| mp_digit u, *tmpa, *tmpc; 10| 148| mp_word r; 11| 148| mp_err err; 12| 148| int ix, olduse; 13| | 14| | /* make sure c is big enough to hold a*b */ 15| 148| if (c->alloc < (a->used + 1)) { ------------------ | Branch (15:8): [True: 0, False: 148] ------------------ 16| 0| if ((err = mp_grow(c, a->used + 1)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (16:11): [True: 0, False: 0] ------------------ 17| 0| return err; 18| 0| } 19| 0| } 20| | 21| | /* get the original destinations used count */ 22| 148| olduse = c->used; 23| | 24| | /* set the sign */ 25| 148| c->sign = a->sign; 26| | 27| | /* alias for a->dp [source] */ 28| 148| tmpa = a->dp; 29| | 30| | /* alias for c->dp [dest] */ 31| 148| tmpc = c->dp; 32| | 33| | /* zero carry */ 34| 148| u = 0; 35| | 36| | /* compute columns */ 37| 548| for (ix = 0; ix < a->used; ix++) { ------------------ | Branch (37:17): [True: 400, False: 148] ------------------ 38| | /* compute product and carry sum for this term */ 39| 400| r = (mp_word)u + ((mp_word)*tmpa++ * (mp_word)b); 40| | 41| | /* mask off higher bits to get a single digit */ 42| 400| *tmpc++ = (mp_digit)(r & (mp_word)MP_MASK); ------------------ | | 106| 400|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 400|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 43| | 44| | /* send carry into next iteration */ 45| 400| u = (mp_digit)(r >> (mp_word)MP_DIGIT_BIT); ------------------ | | 82| 400|# define MP_DIGIT_BIT 60 ------------------ 46| 400| } 47| | 48| | /* store final carry [if any] and increment ix offset */ 49| 148| *tmpc++ = u; 50| 148| ++ix; 51| | 52| | /* now zero digits above the top */ 53| 148| MP_ZERO_DIGITS(tmpc, olduse - ix); ------------------ | | 89| 148|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 148|do { \ | | 91| 148| int zd_ = (digits); \ | | 92| 148| mp_digit* zm_ = (mem); \ | | 93| 148| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 148] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 148|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 54| | 55| | /* set used count */ 56| 148| c->used = a->used + 1; 57| 148| mp_clamp(c); 58| | 59| 148| return MP_OKAY; ------------------ | | 161| 148|#define MP_OKAY 0 /* no error */ ------------------ 60| 148|} mp_rand_source: 10| 1|{ 11| | /* Dropbear, don't reset to platform if source==NULL */ 12| 1| s_mp_rand_source = source; 13| 1|} mp_read_radix: 10| 2|{ 11| 2| mp_err err; 12| 2| int y; 13| 2| mp_sign neg; 14| 2| unsigned pos; 15| 2| char ch; 16| | 17| | /* zero the digit bignum */ 18| 2| mp_zero(a); 19| | 20| | /* make sure the radix is ok */ 21| 2| if ((radix < 2) || (radix > 64)) { ------------------ | Branch (21:8): [True: 0, False: 2] | Branch (21:23): [True: 0, False: 2] ------------------ 22| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 23| 0| } 24| | 25| | /* if the leading digit is a 26| | * minus set the sign to negative. 27| | */ 28| 2| if (*str == '-') { ------------------ | Branch (28:8): [True: 0, False: 2] ------------------ 29| 0| ++str; 30| 0| neg = MP_NEG; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ 31| 2| } else { 32| 2| neg = MP_ZPOS; ------------------ | | 151| 2|#define MP_ZPOS 0 /* positive integer */ ------------------ 33| 2| } 34| | 35| | /* set the integer to the default of zero */ 36| 2| mp_zero(a); 37| | 38| | /* process each digit of the string */ 39| 130| while (*str != '\0') { ------------------ | Branch (39:11): [True: 128, False: 2] ------------------ 40| | /* if the radix <= 36 the conversion is case insensitive 41| | * this allows numbers like 1AB and 1ab to represent the same value 42| | * [e.g. in hex] 43| | */ 44| 128| ch = (radix <= 36) ? (char)MP_TOUPPER((int)*str) : *str; ------------------ | | 6| 128|#define MP_TOUPPER(c) ((((c) >= 'a') && ((c) <= 'z')) ? (((c) + 'A') - 'a') : (c)) | | ------------------ | | | Branch (6:25): [True: 0, False: 128] | | | Branch (6:41): [True: 0, False: 0] | | ------------------ ------------------ | Branch (44:12): [True: 128, False: 0] ------------------ 45| 128| pos = (unsigned)(ch - '('); 46| 128| if (mp_s_rmap_reverse_sz < pos) { ------------------ | Branch (46:11): [True: 0, False: 128] ------------------ 47| 0| break; 48| 0| } 49| 128| y = (int)mp_s_rmap_reverse[pos]; 50| | 51| | /* if the char was found in the map 52| | * and is less than the given radix add it 53| | * to the number, otherwise exit the loop. 54| | */ 55| 128| if ((y == 0xff) || (y >= radix)) { ------------------ | Branch (55:11): [True: 0, False: 128] | Branch (55:26): [True: 0, False: 128] ------------------ 56| 0| break; 57| 0| } 58| 128| if ((err = mp_mul_d(a, (mp_digit)radix, a)) != MP_OKAY) { ------------------ | | 161| 128|#define MP_OKAY 0 /* no error */ ------------------ | Branch (58:11): [True: 0, False: 128] ------------------ 59| 0| return err; 60| 0| } 61| 128| if ((err = mp_add_d(a, (mp_digit)y, a)) != MP_OKAY) { ------------------ | | 161| 128|#define MP_OKAY 0 /* no error */ ------------------ | Branch (61:11): [True: 0, False: 128] ------------------ 62| 0| return err; 63| 0| } 64| 128| ++str; 65| 128| } 66| | 67| | /* if an illegal character was found, fail. */ 68| 2| if (!((*str == '\0') || (*str == '\r') || (*str == '\n'))) { ------------------ | Branch (68:10): [True: 2, False: 0] | Branch (68:28): [True: 0, False: 0] | Branch (68:46): [True: 0, False: 0] ------------------ 69| 0| mp_zero(a); 70| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 71| 0| } 72| | 73| | /* set the sign only if a != 0 */ 74| 2| if (!MP_IS_ZERO(a)) { ------------------ | | 163| 2|#define MP_IS_ZERO(a) ((a)->used == 0) ------------------ | Branch (74:8): [True: 2, False: 0] ------------------ 75| 2| a->sign = neg; 76| 2| } 77| 2| return MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 78| 2|} mp_rshd: 8| 2|{ 9| 2| int x; 10| 2| mp_digit *bottom, *top; 11| | 12| | /* if b <= 0 then ignore it */ 13| 2| if (b <= 0) { ------------------ | Branch (13:8): [True: 0, False: 2] ------------------ 14| 0| return; 15| 0| } 16| | 17| | /* if b > used then simply zero it and return */ 18| 2| if (a->used <= b) { ------------------ | Branch (18:8): [True: 0, False: 2] ------------------ 19| 0| mp_zero(a); 20| 0| return; 21| 0| } 22| | 23| | /* shift the digits down */ 24| | 25| | /* bottom */ 26| 2| bottom = a->dp; 27| | 28| | /* top [offset into digits] */ 29| 2| top = a->dp + b; 30| | 31| | /* this is implemented as a sliding window where 32| | * the window is b-digits long and digits from 33| | * the top of the window are copied to the bottom 34| | * 35| | * e.g. 36| | 37| | b-2 | b-1 | b0 | b1 | b2 | ... | bb | ----> 38| | /\ | ----> 39| | \-------------------/ ----> 40| | */ 41| 12| for (x = 0; x < (a->used - b); x++) { ------------------ | Branch (41:16): [True: 10, False: 2] ------------------ 42| 10| *bottom++ = *top++; 43| 10| } 44| | 45| | /* zero the top digits */ 46| 2| MP_ZERO_DIGITS(bottom, a->used - x); ------------------ | | 89| 2|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 2|do { \ | | 91| 2| int zd_ = (digits); \ | | 92| 2| mp_digit* zm_ = (mem); \ | | 93| 12| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 10, False: 2] | | ------------------ | | 94| 10| *zm_++ = 0; \ | | 95| 10| } \ | | 96| 2|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 47| | 48| | /* remove excess digits */ 49| 2| a->used -= b; 50| 2|} mp_set: 8| 1|{ 9| 1| a->dp[0] = b & MP_MASK; ------------------ | | 106| 1|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 1|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 10| 1| a->sign = MP_ZPOS; ------------------ | | 151| 1|#define MP_ZPOS 0 /* positive integer */ ------------------ 11| 1| a->used = (a->dp[0] != 0u) ? 1 : 0; ------------------ | Branch (11:15): [True: 1, False: 0] ------------------ 12| 1| MP_ZERO_DIGITS(a->dp + a->used, a->alloc - a->used); ------------------ | | 89| 1|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 1|do { \ | | 91| 1| int zd_ = (digits); \ | | 92| 1| mp_digit* zm_ = (mem); \ | | 93| 32| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 31, False: 1] | | ------------------ | | 94| 31| *zm_++ = 0; \ | | 95| 31| } \ | | 96| 1|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 13| 1|} mp_sqr: 8| 2|{ 9| 2| mp_err err; 10| 2| if (MP_HAS(S_MP_TOOM_SQR) && /* use Toom-Cook? */ ------------------ | | 150| 4|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 2|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 2|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 11| 2| (a->used >= MP_TOOM_SQR_CUTOFF)) { ------------------ | | 124| 0|# define MP_TOOM_SQR_CUTOFF TOOM_SQR_CUTOFF ------------------ | Branch (11:8): [True: 0, False: 0] ------------------ 12| 0| err = s_mp_toom_sqr(a, b); 13| 2| } else if (MP_HAS(S_MP_KARATSUBA_SQR) && /* Karatsuba? */ ------------------ | | 150| 4|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 2|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 2|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 14| 2| (a->used >= MP_KARATSUBA_SQR_CUTOFF)) { ------------------ | | 122| 0|# define MP_KARATSUBA_SQR_CUTOFF KARATSUBA_SQR_CUTOFF ------------------ | Branch (14:15): [True: 0, False: 0] ------------------ 15| 0| err = s_mp_karatsuba_sqr(a, b); 16| 2| } else if (MP_HAS(S_MP_SQR_FAST) && /* can we use the fast comba multiplier? */ ------------------ | | 150| 4|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 2|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 2|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 17| 2| (((a->used * 2) + 1) < MP_WARRAY) && ------------------ | | 172| 2|#define MP_WARRAY PRIVATE_MP_WARRAY | | ------------------ | | | | 203| 2|#define PRIVATE_MP_WARRAY (int)(1uLL << (((CHAR_BIT * sizeof(private_mp_word)) - (2 * MP_DIGIT_BIT)) + 1)) | | | | ------------------ | | | | | | 82| 2|# define MP_DIGIT_BIT 60 | | | | ------------------ | | ------------------ ------------------ | Branch (17:15): [True: 2, False: 0] ------------------ 18| 2| (a->used < (MP_MAXFAST / 2))) { ------------------ | | 168| 2|#define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 167| 2|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) | | ------------------ | | #define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 82| 2|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (18:15): [True: 2, False: 0] ------------------ 19| 2| err = s_mp_sqr_fast(a, b); 20| 2| } else if (MP_HAS(S_MP_SQR)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 21| 0| err = s_mp_sqr(a, b); 22| 0| } else { 23| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 24| 0| } 25| 2| b->sign = MP_ZPOS; ------------------ | | 151| 2|#define MP_ZPOS 0 /* positive integer */ ------------------ 26| 2| return err; 27| 2|} mp_sub: 8| 11|{ 9| 11| mp_sign sa = a->sign, sb = b->sign; 10| 11| mp_err err; 11| | 12| 11| if (sa != sb) { ------------------ | Branch (12:8): [True: 0, False: 11] ------------------ 13| | /* subtract a negative from a positive, OR */ 14| | /* subtract a positive from a negative. */ 15| | /* In either case, ADD their magnitudes, */ 16| | /* and use the sign of the first number. */ 17| 0| c->sign = sa; 18| 0| err = s_mp_add(a, b, c); 19| 11| } else { 20| | /* subtract a positive from a positive, OR */ 21| | /* subtract a negative from a negative. */ 22| | /* First, take the difference between their */ 23| | /* magnitudes, then... */ 24| 11| if (mp_cmp_mag(a, b) != MP_LT) { ------------------ | | 154| 11|#define MP_LT -1 /* less than */ ------------------ | Branch (24:11): [True: 11, False: 0] ------------------ 25| | /* Copy the sign from the first */ 26| 11| c->sign = sa; 27| | /* The first has a larger or equal magnitude */ 28| 11| err = s_mp_sub(a, b, c); 29| 11| } else { 30| | /* The result has the *opposite* sign from */ 31| | /* the first number. */ 32| 0| c->sign = (sa == MP_ZPOS) ? MP_NEG : MP_ZPOS; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ c->sign = (sa == MP_ZPOS) ? MP_NEG : MP_ZPOS; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ c->sign = (sa == MP_ZPOS) ? MP_NEG : MP_ZPOS; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (32:20): [True: 0, False: 0] ------------------ 33| | /* The second has a larger magnitude */ 34| 0| err = s_mp_sub(b, a, c); 35| 0| } 36| 11| } 37| 11| return err; 38| 11|} mp_to_ubin: 8| 9.27k|{ 9| 9.27k| size_t x, count; 10| 9.27k| mp_err err; 11| 9.27k| mp_int t; 12| | 13| 9.27k| count = mp_ubin_size(a); 14| 9.27k| if (count > maxlen) { ------------------ | Branch (14:8): [True: 0, False: 9.27k] ------------------ 15| 0| return MP_BUF; ------------------ | | 167| 0|#define MP_BUF -5 /* buffer overflow, supplied buffer too small */ ------------------ 16| 0| } 17| | 18| 9.27k| if ((err = mp_init_copy(&t, a)) != MP_OKAY) { ------------------ | | 161| 9.27k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (18:8): [True: 0, False: 9.27k] ------------------ 19| 0| return err; 20| 0| } 21| | 22| 37.1k| for (x = count; x --> 0u;) { ------------------ | Branch (22:20): [True: 27.8k, False: 9.27k] ------------------ 23| 27.8k|#ifndef MP_8BIT 24| 27.8k| buf[x] = (unsigned char)(t.dp[0] & 255u); 25| |#else 26| | buf[x] = (unsigned char)(t.dp[0] | ((t.dp[1] & 1u) << 7)); 27| |#endif 28| 27.8k| if ((err = mp_div_2d(&t, 8, &t, NULL)) != MP_OKAY) { ------------------ | | 161| 27.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (28:11): [True: 0, False: 27.8k] ------------------ 29| 0| goto LBL_ERR; 30| 0| } 31| 27.8k| } 32| | 33| 9.27k| if (written != NULL) { ------------------ | Branch (33:8): [True: 9.27k, False: 0] ------------------ 34| 9.27k| *written = count; 35| 9.27k| } 36| | 37| 9.27k|LBL_ERR: 38| 9.27k| mp_clear(&t); 39| 9.27k| return err; 40| 9.27k|} mp_ubin_size: 8| 9.27k|{ 9| 9.27k| size_t size = (size_t)mp_count_bits(a); 10| 9.27k| return (size / 8u) + (((size & 7u) != 0u) ? 1u : 0u); ------------------ | Branch (10:26): [True: 0, False: 9.27k] ------------------ 11| 9.27k|} mp_zero: 8| 2.98k|{ 9| 2.98k| a->sign = MP_ZPOS; ------------------ | | 151| 2.98k|#define MP_ZPOS 0 /* positive integer */ ------------------ 10| 2.98k| a->used = 0; 11| 2.98k| MP_ZERO_DIGITS(a->dp, a->alloc); ------------------ | | 89| 2.98k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 2.98k|do { \ | | 91| 2.98k| int zd_ = (digits); \ | | 92| 2.98k| mp_digit* zm_ = (mem); \ | | 93| 98.5k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 95.5k, False: 2.98k] | | ------------------ | | 94| 95.5k| *zm_++ = 0; \ | | 95| 95.5k| } \ | | 96| 2.98k|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 12| 2.98k|} s_mp_add: 8| 3|{ 9| 3| const mp_int *x; 10| 3| mp_err err; 11| 3| int olduse, min, max; 12| | 13| | /* find sizes, we let |a| <= |b| which means we have to sort 14| | * them. "x" will point to the input with the most digits 15| | */ 16| 3| if (a->used > b->used) { ------------------ | Branch (16:8): [True: 3, False: 0] ------------------ 17| 3| min = b->used; 18| 3| max = a->used; 19| 3| x = a; 20| 3| } else { 21| 0| min = a->used; 22| 0| max = b->used; 23| 0| x = b; 24| 0| } 25| | 26| | /* init result */ 27| 3| if (c->alloc < (max + 1)) { ------------------ | Branch (27:8): [True: 0, False: 3] ------------------ 28| 0| if ((err = mp_grow(c, max + 1)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (28:11): [True: 0, False: 0] ------------------ 29| 0| return err; 30| 0| } 31| 0| } 32| | 33| | /* get old used digit count and set new one */ 34| 3| olduse = c->used; 35| 3| c->used = max + 1; 36| | 37| 3| { 38| 3| mp_digit u, *tmpa, *tmpb, *tmpc; 39| 3| int i; 40| | 41| | /* alias for digit pointers */ 42| | 43| | /* first input */ 44| 3| tmpa = a->dp; 45| | 46| | /* second input */ 47| 3| tmpb = b->dp; 48| | 49| | /* destination */ 50| 3| tmpc = c->dp; 51| | 52| | /* zero the carry */ 53| 3| u = 0; 54| 18| for (i = 0; i < min; i++) { ------------------ | Branch (54:19): [True: 15, False: 3] ------------------ 55| | /* Compute the sum at one digit, T[i] = A[i] + B[i] + U */ 56| 15| *tmpc = *tmpa++ + *tmpb++ + u; 57| | 58| | /* U = carry bit of T[i] */ 59| 15| u = *tmpc >> (mp_digit)MP_DIGIT_BIT; ------------------ | | 82| 15|# define MP_DIGIT_BIT 60 ------------------ 60| | 61| | /* take away carry bit from T[i] */ 62| 15| *tmpc++ &= MP_MASK; ------------------ | | 106| 15|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 15|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 63| 15| } 64| | 65| | /* now copy higher words if any, that is in A+B 66| | * if A or B has more digits add those in 67| | */ 68| 3| if (min != max) { ------------------ | Branch (68:11): [True: 3, False: 0] ------------------ 69| 15| for (; i < max; i++) { ------------------ | Branch (69:17): [True: 12, False: 3] ------------------ 70| | /* T[i] = X[i] + U */ 71| 12| *tmpc = x->dp[i] + u; 72| | 73| | /* U = carry bit of T[i] */ 74| 12| u = *tmpc >> (mp_digit)MP_DIGIT_BIT; ------------------ | | 82| 12|# define MP_DIGIT_BIT 60 ------------------ 75| | 76| | /* take away carry bit from T[i] */ 77| 12| *tmpc++ &= MP_MASK; ------------------ | | 106| 12|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 12|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 78| 12| } 79| 3| } 80| | 81| | /* add carry */ 82| 3| *tmpc++ = u; 83| | 84| | /* clear digits above oldused */ 85| 3| MP_ZERO_DIGITS(tmpc, olduse - c->used); ------------------ | | 89| 3|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 3|do { \ | | 91| 3| int zd_ = (digits); \ | | 92| 3| mp_digit* zm_ = (mem); \ | | 93| 3| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 3] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 3|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 86| 3| } 87| | 88| 3| mp_clamp(c); 89| 3| return MP_OKAY; ------------------ | | 161| 3|#define MP_OKAY 0 /* no error */ ------------------ 90| 3|} s_mp_mul_digs_fast: 23| 1|{ 24| 1| int olduse, pa, ix, iz; 25| 1| mp_err err; 26| 1| mp_digit W[MP_WARRAY]; 27| 1| mp_word _W; 28| | 29| | /* grow the destination as required */ 30| 1| if (c->alloc < digs) { ------------------ | Branch (30:8): [True: 1, False: 0] ------------------ 31| 1| if ((err = mp_grow(c, digs)) != MP_OKAY) { ------------------ | | 161| 1|#define MP_OKAY 0 /* no error */ ------------------ | Branch (31:11): [True: 0, False: 1] ------------------ 32| 0| return err; 33| 0| } 34| 1| } 35| | 36| | /* number of output digits to produce */ 37| 1| pa = MP_MIN(digs, a->used + b->used); ------------------ | | 156| 1|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 0, False: 1] | | ------------------ ------------------ 38| | 39| | /* clear the carry */ 40| 1| _W = 0; 41| 11| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (41:17): [True: 10, False: 1] ------------------ 42| 10| int tx, ty; 43| 10| int iy; 44| 10| mp_digit *tmpx, *tmpy; 45| | 46| | /* get offsets into the two bignums */ 47| 10| ty = MP_MIN(b->used-1, ix); ------------------ | | 156| 10|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 5, False: 5] | | ------------------ ------------------ 48| 10| tx = ix - ty; 49| | 50| | /* setup temp aliases */ 51| 10| tmpx = a->dp + tx; 52| 10| tmpy = b->dp + ty; 53| | 54| | /* this is the number of times the loop will iterrate, essentially 55| | while (tx++ < a->used && ty-- >= 0) { ... } 56| | */ 57| 10| iy = MP_MIN(a->used-tx, ty+1); ------------------ | | 156| 10|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 5, False: 5] | | ------------------ ------------------ 58| | 59| | /* execute loop */ 60| 35| for (iz = 0; iz < iy; ++iz) { ------------------ | Branch (60:20): [True: 25, False: 10] ------------------ 61| 25| _W += (mp_word)*tmpx++ * (mp_word)*tmpy--; 62| | 63| 25| } 64| | 65| | /* store term */ 66| 10| W[ix] = (mp_digit)_W & MP_MASK; ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 67| | 68| | /* make next carry */ 69| 10| _W = _W >> (mp_word)MP_DIGIT_BIT; ------------------ | | 82| 10|# define MP_DIGIT_BIT 60 ------------------ 70| 10| } 71| | 72| | /* setup dest */ 73| 1| olduse = c->used; 74| 1| c->used = pa; 75| | 76| 1| { 77| 1| mp_digit *tmpc; 78| 1| tmpc = c->dp; 79| 11| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (79:20): [True: 10, False: 1] ------------------ 80| | /* now extract the previous digit [below the carry] */ 81| 10| *tmpc++ = W[ix]; 82| 10| } 83| | 84| | /* clear unused digits [that existed in the old copy of c] */ 85| 1| MP_ZERO_DIGITS(tmpc, olduse - ix); ------------------ | | 89| 1|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 1|do { \ | | 91| 1| int zd_ = (digits); \ | | 92| 1| mp_digit* zm_ = (mem); \ | | 93| 1| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 1] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 1|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 86| 1| } 87| 1| mp_clamp(c); 88| 1| return MP_OKAY; ------------------ | | 161| 1|#define MP_OKAY 0 /* no error */ ------------------ 89| 1|} s_mp_sqr_fast: 17| 2|{ 18| 2| int olduse, pa, ix, iz; 19| 2| mp_digit W[MP_WARRAY], *tmpx; 20| 2| mp_word W1; 21| 2| mp_err err; 22| | 23| | /* grow the destination as required */ 24| 2| pa = a->used + a->used; 25| 2| if (b->alloc < pa) { ------------------ | Branch (25:8): [True: 0, False: 2] ------------------ 26| 0| if ((err = mp_grow(b, pa)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (26:11): [True: 0, False: 0] ------------------ 27| 0| return err; 28| 0| } 29| 0| } 30| | 31| | /* number of output digits to produce */ 32| 2| W1 = 0; 33| 22| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (33:17): [True: 20, False: 2] ------------------ 34| 20| int tx, ty, iy; 35| 20| mp_word _W; 36| 20| mp_digit *tmpy; 37| | 38| | /* clear counter */ 39| 20| _W = 0; 40| | 41| | /* get offsets into the two bignums */ 42| 20| ty = MP_MIN(a->used-1, ix); ------------------ | | 156| 20|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 10, False: 10] | | ------------------ ------------------ 43| 20| tx = ix - ty; 44| | 45| | /* setup temp aliases */ 46| 20| tmpx = a->dp + tx; 47| 20| tmpy = a->dp + ty; 48| | 49| | /* this is the number of times the loop will iterrate, essentially 50| | while (tx++ < a->used && ty-- >= 0) { ... } 51| | */ 52| 20| iy = MP_MIN(a->used-tx, ty+1); ------------------ | | 156| 20|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 10, False: 10] | | ------------------ ------------------ 53| | 54| | /* now for squaring tx can never equal ty 55| | * we halve the distance since they approach at a rate of 2x 56| | * and we have to round because odd cases need to be executed 57| | */ 58| 20| iy = MP_MIN(iy, ((ty-tx)+1)>>1); ------------------ | | 156| 20|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 0, False: 20] | | ------------------ ------------------ 59| | 60| | /* execute loop */ 61| 40| for (iz = 0; iz < iy; iz++) { ------------------ | Branch (61:20): [True: 20, False: 20] ------------------ 62| 20| _W += (mp_word)*tmpx++ * (mp_word)*tmpy--; 63| 20| } 64| | 65| | /* double the inner product and add carry */ 66| 20| _W = _W + _W + W1; 67| | 68| | /* even columns have the square term in them */ 69| 20| if (((unsigned)ix & 1u) == 0u) { ------------------ | Branch (69:11): [True: 10, False: 10] ------------------ 70| 10| _W += (mp_word)a->dp[ix>>1] * (mp_word)a->dp[ix>>1]; 71| 10| } 72| | 73| | /* store it */ 74| 20| W[ix] = (mp_digit)_W & MP_MASK; ------------------ | | 106| 20|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 20|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 75| | 76| | /* make next carry */ 77| 20| W1 = _W >> (mp_word)MP_DIGIT_BIT; ------------------ | | 82| 20|# define MP_DIGIT_BIT 60 ------------------ 78| 20| } 79| | 80| | /* setup dest */ 81| 2| olduse = b->used; 82| 2| b->used = a->used+a->used; 83| | 84| 2| { 85| 2| mp_digit *tmpb; 86| 2| tmpb = b->dp; 87| 22| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (87:20): [True: 20, False: 2] ------------------ 88| 20| *tmpb++ = W[ix] & MP_MASK; ------------------ | | 106| 20|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 20|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 89| 20| } 90| | 91| | /* clear unused digits [that existed in the old copy of c] */ 92| 2| MP_ZERO_DIGITS(tmpb, olduse - ix); ------------------ | | 89| 2|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 2|do { \ | | 91| 2| int zd_ = (digits); \ | | 92| 2| mp_digit* zm_ = (mem); \ | | 93| 2| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 2] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 2|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 93| 2| } 94| 2| mp_clamp(b); 95| 2| return MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 96| 2|} s_mp_sub: 8| 11|{ 9| 11| int olduse, min, max; 10| 11| mp_err err; 11| | 12| | /* find sizes */ 13| 11| min = b->used; 14| 11| max = a->used; 15| | 16| | /* init result */ 17| 11| if (c->alloc < max) { ------------------ | Branch (17:8): [True: 0, False: 11] ------------------ 18| 0| if ((err = mp_grow(c, max)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (18:11): [True: 0, False: 0] ------------------ 19| 0| return err; 20| 0| } 21| 0| } 22| 11| olduse = c->used; 23| 11| c->used = max; 24| | 25| 11| { 26| 11| mp_digit u, *tmpa, *tmpb, *tmpc; 27| 11| int i; 28| | 29| | /* alias for digit pointers */ 30| 11| tmpa = a->dp; 31| 11| tmpb = b->dp; 32| 11| tmpc = c->dp; 33| | 34| | /* set carry to zero */ 35| 11| u = 0; 36| 100| for (i = 0; i < min; i++) { ------------------ | Branch (36:19): [True: 89, False: 11] ------------------ 37| | /* T[i] = A[i] - B[i] - U */ 38| 89| *tmpc = (*tmpa++ - *tmpb++) - u; 39| | 40| | /* U = carry bit of T[i] 41| | * Note this saves performing an AND operation since 42| | * if a carry does occur it will propagate all the way to the 43| | * MSB. As a result a single shift is enough to get the carry 44| | */ 45| 89| u = *tmpc >> (MP_SIZEOF_BITS(mp_digit) - 1u); ------------------ | | 167| 89|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ 46| | 47| | /* Clear carry from T[i] */ 48| 89| *tmpc++ &= MP_MASK; ------------------ | | 106| 89|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 89|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 49| 89| } 50| | 51| | /* now copy higher words if any, e.g. if A has more digits than B */ 52| 11| for (; i < max; i++) { ------------------ | Branch (52:14): [True: 0, False: 11] ------------------ 53| | /* T[i] = A[i] - U */ 54| 0| *tmpc = *tmpa++ - u; 55| | 56| | /* U = carry bit of T[i] */ 57| 0| u = *tmpc >> (MP_SIZEOF_BITS(mp_digit) - 1u); ------------------ | | 167| 0|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ 58| | 59| | /* Clear carry from T[i] */ 60| 0| *tmpc++ &= MP_MASK; ------------------ | | 106| 0|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 0|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 61| 0| } 62| | 63| | /* clear digits above used (since we may not have grown result above) */ 64| 11| MP_ZERO_DIGITS(tmpc, olduse - c->used); ------------------ | | 89| 11|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 11|do { \ | | 91| 11| int zd_ = (digits); \ | | 92| 11| mp_digit* zm_ = (mem); \ | | 93| 11| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 11] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 11|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 65| 11| } 66| | 67| 11| mp_clamp(c); 68| 11| return MP_OKAY; ------------------ | | 161| 11|#define MP_OKAY 0 /* no error */ ------------------ 69| 11|} mp_set_ul: 253| 9.27k| { \ 254| 9.27k| int i = 0; \ 255| 18.5k| while (b != 0u) { \ ------------------ | Branch (255:16): [True: 9.27k, False: 9.27k] ------------------ 256| 9.27k| a->dp[i++] = ((mp_digit)b & MP_MASK); \ ------------------ | | 106| 9.27k|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 9.27k|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 257| 9.27k| if (MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) { break; } \ ------------------ | | 167| 9.27k|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ if (MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) { break; } \ ------------------ | | 82| 9.27k|# define MP_DIGIT_BIT 60 ------------------ | Branch (257:17): [Folded - Ignored] ------------------ 258| 9.27k| b >>= ((MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) ? 0 : MP_DIGIT_BIT); \ ------------------ | | 167| 9.27k|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ b >>= ((MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) ? 0 : MP_DIGIT_BIT); \ ------------------ | | 82| 9.27k|# define MP_DIGIT_BIT 60 ------------------ b >>= ((MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) ? 0 : MP_DIGIT_BIT); \ ------------------ | | 82| 9.27k|# define MP_DIGIT_BIT 60 ------------------ | Branch (258:20): [Folded - Ignored] ------------------ 259| 9.27k| } \ 260| 9.27k| a->used = i; \ 261| 9.27k| a->sign = MP_ZPOS; \ ------------------ | | 151| 9.27k|#define MP_ZPOS 0 /* positive integer */ ------------------ 262| 9.27k| MP_ZERO_DIGITS(a->dp + a->used, a->alloc - a->used); \ ------------------ | | 89| 9.27k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 9.27k|do { \ | | 91| 9.27k| int zd_ = (digits); \ | | 92| 9.27k| mp_digit* zm_ = (mem); \ | | 93| 296k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 287k, False: 9.27k] | | ------------------ | | 94| 287k| *zm_++ = 0; \ | | 95| 287k| } \ | | 96| 9.27k|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 263| 9.27k| } m_mp_init: 31| 2.96k|void m_mp_init(mp_int *mp) { 32| | 33| 2.96k| if (mp_init(mp) != MP_OKAY) { ------------------ | | 161| 2.96k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (33:6): [True: 0, False: 2.96k] ------------------ 34| 0| dropbear_exit("Mem alloc error"); 35| 0| } 36| 2.96k|} m_mp_alloc_init_multi: 56| 9.28k|{ 57| 9.28k| mp_int** cur_arg = mp; 58| 9.28k| va_list args; 59| | 60| 9.28k| va_start(args, mp); /* init args to next argument from caller */ 61| 18.5k| while (cur_arg != NULL) { ------------------ | Branch (61:9): [True: 9.29k, False: 9.28k] ------------------ 62| 9.29k| *cur_arg = m_malloc(sizeof(mp_int)); 63| 9.29k| if (mp_init(*cur_arg) != MP_OKAY) { ------------------ | | 161| 9.29k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (63:7): [True: 0, False: 9.29k] ------------------ 64| 0| dropbear_exit("Mem alloc error"); 65| 0| } 66| 9.29k| cur_arg = va_arg(args, mp_int**); 67| 9.29k| } 68| 9.28k| va_end(args); 69| 9.28k|} hash_process_mp: 96| 9.27k| hash_state *hs, const mp_int *mp) { 97| 9.27k| buffer * buf; 98| | 99| 9.27k| buf = buf_new(512 + 20); /* max buffer is a 4096 bit key, 100| | plus header + some leeway*/ 101| 9.27k| buf_putmpint(buf, mp); 102| 9.27k| hash_desc->process(hs, buf->data, buf->len); 103| 9.27k| buf_burn_free(buf); 104| 9.27k|} buf_new: 41| 344k|buffer* buf_new(unsigned int size) { 42| 344k| buffer* buf; 43| 344k| if (size > BUF_MAX_SIZE) { ------------------ | | 35| 344k|#define BUF_MAX_SIZE 1000000000 ------------------ | Branch (43:6): [True: 0, False: 344k] ------------------ 44| 0| dropbear_exit("buf->size too big"); 45| 0| } 46| | 47| 344k| buf = (buffer*)m_malloc(sizeof(buffer)+size); 48| 344k| buf->data = (unsigned char*)buf + sizeof(buffer); 49| 344k| buf->size = size; 50| 344k| return buf; 51| 344k|} buf_free: 54| 309k|void buf_free(buffer* buf) { 55| 309k| m_free(buf); ------------------ | | 24| 309k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 56| 309k|} buf_burn_free: 59| 32.6k|void buf_burn_free(buffer* buf) { 60| 32.6k| m_burn(buf->data, buf->size); 61| 32.6k| m_free(buf); ------------------ | | 24| 32.6k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 62| 32.6k|} buf_resize: 67| 10.4k|buffer* buf_resize(buffer *buf, unsigned int newsize) { 68| 10.4k| if (newsize > BUF_MAX_SIZE) { ------------------ | | 35| 10.4k|#define BUF_MAX_SIZE 1000000000 ------------------ | Branch (68:6): [True: 0, False: 10.4k] ------------------ 69| 0| dropbear_exit("buf->size too big"); 70| 0| } 71| | 72| 10.4k| buf = m_realloc(buf, sizeof(buffer)+newsize); 73| 10.4k| buf->data = (unsigned char*)buf + sizeof(buffer); 74| 10.4k| buf->size = newsize; 75| 10.4k| buf->len = MIN(newsize, buf->len); 76| 10.4k| buf->pos = MIN(newsize, buf->pos); 77| 10.4k| return buf; 78| 10.4k|} buf_newcopy: 82| 11.5k|buffer* buf_newcopy(const buffer* buf) { 83| | 84| 11.5k| buffer* ret; 85| | 86| 11.5k| ret = buf_new(buf->len); 87| 11.5k| ret->len = buf->len; 88| 11.5k| if (buf->len > 0) { ------------------ | Branch (88:6): [True: 11.5k, False: 0] ------------------ 89| 11.5k| memcpy(ret->data, buf->data, buf->len); 90| 11.5k| } 91| 11.5k| return ret; 92| 11.5k|} buf_setlen: 95| 595k|void buf_setlen(buffer* buf, unsigned int len) { 96| 595k| if (len > buf->size) { ------------------ | Branch (96:6): [True: 0, False: 595k] ------------------ 97| 0| dropbear_exit("Bad buf_setlen"); 98| 0| } 99| 595k| buf->len = len; 100| 595k| buf->pos = MIN(buf->pos, buf->len); 101| 595k|} buf_incrlen: 104| 924k|void buf_incrlen(buffer* buf, unsigned int incr) { 105| 924k| if (incr > BUF_MAX_INCR || buf->len + incr > buf->size) { ------------------ | | 34| 1.84M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (105:6): [True: 0, False: 924k] | Branch (105:29): [True: 0, False: 924k] ------------------ 106| 0| dropbear_exit("Bad buf_incrlen"); 107| 0| } 108| 924k| buf->len += incr; 109| 924k|} buf_setpos: 111| 2.57M|void buf_setpos(buffer* buf, unsigned int pos) { 112| | 113| 2.57M| if (pos > buf->len) { ------------------ | Branch (113:6): [True: 0, False: 2.57M] ------------------ 114| 0| dropbear_exit("Bad buf_setpos"); 115| 0| } 116| 2.57M| buf->pos = pos; 117| 2.57M|} buf_incrwritepos: 120| 2.27M|void buf_incrwritepos(buffer* buf, unsigned int incr) { 121| 2.27M| if (incr > BUF_MAX_INCR || buf->pos + incr > buf->size) { ------------------ | | 34| 4.54M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (121:6): [True: 0, False: 2.27M] | Branch (121:29): [True: 0, False: 2.27M] ------------------ 122| 0| dropbear_exit("Bad buf_incrwritepos"); 123| 0| } 124| 2.27M| buf->pos += incr; 125| 2.27M| if (buf->pos > buf->len) { ------------------ | Branch (125:6): [True: 1.64M, False: 625k] ------------------ 126| 1.64M| buf->len = buf->pos; 127| 1.64M| } 128| 2.27M|} buf_incrpos: 131| 1.18M|void buf_incrpos(buffer* buf, unsigned int incr) { 132| 1.18M| if (incr > BUF_MAX_INCR ------------------ | | 34| 2.37M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (132:6): [True: 2, False: 1.18M] ------------------ 133| 1.18M| || (buf->pos + incr) > buf->len) { ------------------ | Branch (133:6): [True: 10, False: 1.18M] ------------------ 134| 12| dropbear_exit("Bad buf_incrpos"); 135| 12| } 136| 1.18M| buf->pos += incr; 137| 1.18M|} buf_decrpos: 140| 4|void buf_decrpos(buffer* buf, unsigned int decr) { 141| 4| if (decr > buf->pos) { ------------------ | Branch (141:6): [True: 0, False: 4] ------------------ 142| 0| dropbear_exit("Bad buf_decrpos"); 143| 0| } 144| 4| buf->pos -= decr; 145| 4|} buf_getbyte: 148| 364k|unsigned char buf_getbyte(buffer* buf) { 149| | 150| | /* This check is really just ==, but the >= allows us to check for the 151| | * bad case of pos > len, which should _never_ happen. */ 152| 364k| if (buf->pos >= buf->len) { ------------------ | Branch (152:6): [True: 0, False: 364k] ------------------ 153| 0| dropbear_exit("Bad buf_getbyte"); 154| 0| } 155| 364k| return buf->data[buf->pos++]; 156| 364k|} buf_getbool: 159| 19.0k|unsigned char buf_getbool(buffer* buf) { 160| | 161| 19.0k| unsigned char b; 162| 19.0k| b = buf_getbyte(buf); 163| 19.0k| if (b != 0) ------------------ | Branch (163:6): [True: 7.88k, False: 11.1k] ------------------ 164| 7.88k| b = 1; 165| 19.0k| return b; 166| 19.0k|} buf_putbyte: 169| 703k|void buf_putbyte(buffer* buf, unsigned char val) { 170| | 171| 703k| if (buf->pos >= buf->len) { ------------------ | Branch (171:6): [True: 462k, False: 240k] ------------------ 172| 462k| buf_incrlen(buf, 1); 173| 462k| } 174| 703k| buf->data[buf->pos] = val; 175| 703k| buf->pos++; 176| 703k|} buf_getptr: 180| 4.27M|unsigned char* buf_getptr(const buffer* buf, unsigned int len) { 181| | 182| 4.27M| if (len > BUF_MAX_INCR || buf->pos + len > buf->len) { ------------------ | | 34| 8.55M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (182:6): [True: 0, False: 4.27M] | Branch (182:28): [True: 83, False: 4.27M] ------------------ 183| 83| dropbear_exit("Bad buf_getptr"); 184| 83| } 185| 4.27M| return &buf->data[buf->pos]; 186| 4.27M|} buf_getwriteptr: 190| 2.55M|unsigned char* buf_getwriteptr(const buffer* buf, unsigned int len) { 191| | 192| 2.55M| if (len > BUF_MAX_INCR || buf->pos + len > buf->size) { ------------------ | | 34| 5.11M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (192:6): [True: 0, False: 2.55M] | Branch (192:28): [True: 0, False: 2.55M] ------------------ 193| 0| dropbear_exit("Bad buf_getwriteptr"); 194| 0| } 195| 2.55M| return &buf->data[buf->pos]; 196| 2.55M|} buf_getstring: 201| 105k|char* buf_getstring(buffer* buf, unsigned int *retlen) { 202| | 203| 105k| unsigned int len; 204| 105k| char* ret; 205| 105k| void* src = NULL; 206| 105k| len = buf_getint(buf); 207| 105k| if (len > MAX_STRING_LEN) { ------------------ | | 228| 105k|#define MAX_STRING_LEN (MAX(MAX_CMD_LEN, 2400)) /* Sun SSH needs 2400 for algos, ------------------ | Branch (207:6): [True: 24, False: 105k] ------------------ 208| 24| dropbear_exit("String too long"); 209| 24| } 210| | 211| 105k| if (retlen != NULL) { ------------------ | Branch (211:6): [True: 105k, False: 445] ------------------ 212| 105k| *retlen = len; 213| 105k| } 214| 105k| src = buf_getptr(buf, len); 215| 105k| ret = m_malloc(len+1); 216| 105k| memcpy(ret, src, len); 217| 105k| buf_incrpos(buf, len); 218| 105k| ret[len] = '\0'; 219| | 220| 105k| return ret; 221| 105k|} buf_getstringbuf: 246| 6.36k|buffer * buf_getstringbuf(buffer *buf) { 247| 6.36k| return buf_getstringbuf_int(buf, 0); 248| 6.36k|} buf_eatstring: 257| 18.9k|void buf_eatstring(buffer *buf) { 258| | 259| 18.9k| buf_incrpos( buf, buf_getint(buf) ); 260| 18.9k|} buf_getint: 263| 223k|unsigned int buf_getint(buffer* buf) { 264| 223k| unsigned int ret; 265| | 266| 223k| LOAD32H(ret, buf_getptr(buf, 4)); ------------------ | | 66| 223k|#define LOAD32H(x, y) \ | | 67| 223k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 223k|#define XMEMCPY memcpy | | ------------------ | | 68| 223k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 267| 223k| buf_incrpos(buf, 4); 268| 223k| return ret; 269| 223k|} buf_putint: 272| 1.21M|void buf_putint(buffer* buf, int unsigned val) { 273| | 274| 1.21M| STORE32H(val, buf_getwriteptr(buf, 4)); ------------------ | | 62| 1.21M|#define STORE32H(x, y) \ | | 63| 1.21M|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 1.21M| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 1.21M|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 275| 1.21M| buf_incrwritepos(buf, 4); 276| | 277| 1.21M|} buf_putstring: 280| 60.1k|void buf_putstring(buffer* buf, const char* str, unsigned int len) { 281| | 282| 60.1k| buf_putint(buf, len); 283| 60.1k| buf_putbytes(buf, (const unsigned char*)str, len); 284| | 285| 60.1k|} buf_putbytes: 294| 368k|void buf_putbytes(buffer *buf, const unsigned char *bytes, unsigned int len) { 295| 368k| memcpy(buf_getwriteptr(buf, len), bytes, len); 296| 368k| buf_incrwritepos(buf, len); 297| 368k|} buf_putmpint: 302| 9.27k|void buf_putmpint(buffer* buf, const mp_int * mp) { 303| 9.27k| size_t written; 304| 9.27k| unsigned int len, pad = 0; 305| 9.27k| TRACE2(("enter buf_putmpint")) 306| | 307| 9.27k| dropbear_assert(mp != NULL); ------------------ | | 83| 9.27k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 9.27k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 308| | 309| 9.27k| if (mp_isneg(mp)) { ------------------ | | 295| 9.27k|#define mp_isneg(a) (((a)->sign != MP_ZPOS) ? MP_YES : MP_NO) | | ------------------ | | | | 151| 9.27k|#define MP_ZPOS 0 /* positive integer */ | | ------------------ | | #define mp_isneg(a) (((a)->sign != MP_ZPOS) ? MP_YES : MP_NO) | | ------------------ | | | | 158| 0|#define MP_YES 1 | | ------------------ | | #define mp_isneg(a) (((a)->sign != MP_ZPOS) ? MP_YES : MP_NO) | | ------------------ | | | | 159| 9.27k|#define MP_NO 0 | | ------------------ | | | Branch (295:22): [True: 0, False: 9.27k] | | | Branch (295:23): [True: 0, False: 9.27k] | | ------------------ ------------------ 310| 0| dropbear_exit("negative bignum"); 311| 0| } 312| | 313| | /* zero check */ 314| 9.27k| if (mp_iszero(mp)) { ------------------ | | 292| 9.27k|#define mp_iszero(a) (((a)->used == 0) ? MP_YES : MP_NO) | | ------------------ | | | | 158| 0|#define MP_YES 1 | | ------------------ | | #define mp_iszero(a) (((a)->used == 0) ? MP_YES : MP_NO) | | ------------------ | | | | 159| 9.27k|#define MP_NO 0 | | ------------------ | | | Branch (292:22): [True: 0, False: 9.27k] | | | Branch (292:23): [True: 0, False: 9.27k] | | ------------------ ------------------ 315| 0| len = 0; 316| 9.27k| } else { 317| | /* SSH spec requires padding for mpints with the MSB set, this code 318| | * implements it */ 319| 9.27k| len = mp_count_bits(mp); 320| | /* if the top bit of MSB is set, we need to pad */ 321| 9.27k| pad = (len%8 == 0) ? 1 : 0; ------------------ | Branch (321:9): [True: 9.27k, False: 0] ------------------ 322| 9.27k| len = len / 8 + 1; /* don't worry about rounding, we need it for 323| | padding anyway when len%8 == 0 */ 324| | 325| 9.27k| } 326| | 327| | /* store the length */ 328| 9.27k| buf_putint(buf, len); 329| | 330| | /* store the actual value */ 331| 9.27k| if (len > 0) { ------------------ | Branch (331:6): [True: 9.27k, False: 0] ------------------ 332| 9.27k| if (pad) { ------------------ | Branch (332:7): [True: 9.27k, False: 0] ------------------ 333| 9.27k| buf_putbyte(buf, 0x00); 334| 9.27k| } 335| 9.27k| if (mp_to_ubin(mp, buf_getwriteptr(buf, len-pad), len-pad, &written) != MP_OKAY) { ------------------ | | 161| 9.27k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (335:7): [True: 0, False: 9.27k] ------------------ 336| 0| dropbear_exit("mpint error"); 337| 0| } 338| 9.27k| buf_incrwritepos(buf, written); 339| 9.27k| } 340| | 341| 9.27k| TRACE2(("leave buf_putmpint")) 342| 9.27k|} buf_getmpint: 347| 2.97k|int buf_getmpint(buffer* buf, mp_int* mp) { 348| | 349| 2.97k| unsigned int len; 350| 2.97k| len = buf_getint(buf); 351| | 352| 2.97k| if (len == 0) { ------------------ | Branch (352:6): [True: 98, False: 2.87k] ------------------ 353| 98| mp_zero(mp); 354| 98| return DROPBEAR_SUCCESS; ------------------ | | 102| 98|#define DROPBEAR_SUCCESS 0 ------------------ 355| 98| } 356| | 357| 2.87k| if (len > BUF_MAX_MPINT) { ------------------ | | 38| 2.87k|#define BUF_MAX_MPINT (8240 / 8) ------------------ | Branch (357:6): [True: 1, False: 2.87k] ------------------ 358| 1| return DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 359| 1| } 360| | 361| | /* check for negative */ 362| 2.87k| if (*buf_getptr(buf, 1) & (1 << (CHAR_BIT-1))) { ------------------ | Branch (362:6): [True: 1, False: 2.87k] ------------------ 363| 1| return DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 364| 1| } 365| | 366| 2.87k| if (mp_from_ubin(mp, buf_getptr(buf, len), len) != MP_OKAY) { ------------------ | | 161| 2.87k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (366:6): [True: 0, False: 2.87k] ------------------ 367| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 368| 0| } 369| | 370| 2.87k| buf_incrpos(buf, len); 371| 2.87k| return DROPBEAR_SUCCESS; ------------------ | | 102| 2.87k|#define DROPBEAR_SUCCESS 0 ------------------ 372| 2.87k|} buffer.c:buf_getstringbuf_int: 224| 6.36k|static buffer * buf_getstringbuf_int(buffer *buf, int incllen) { 225| 6.36k| buffer *ret = NULL; 226| 6.36k| unsigned int len = buf_getint(buf); 227| 6.36k| int extra = 0; 228| 6.36k| if (len > MAX_STRING_LEN) { ------------------ | | 228| 6.36k|#define MAX_STRING_LEN (MAX(MAX_CMD_LEN, 2400)) /* Sun SSH needs 2400 for algos, ------------------ | Branch (228:6): [True: 1, False: 6.36k] ------------------ 229| 1| dropbear_exit("String too long"); 230| 1| } 231| 6.36k| if (incllen) { ------------------ | Branch (231:6): [True: 0, False: 6.36k] ------------------ 232| 0| extra = 4; 233| 0| } 234| 6.36k| ret = buf_new(len+extra); 235| 6.36k| if (incllen) { ------------------ | Branch (235:6): [True: 0, False: 6.36k] ------------------ 236| 0| buf_putint(ret, len); 237| 0| } 238| 6.36k| memcpy(buf_getwriteptr(ret, len), buf_getptr(buf, len), len); 239| 6.36k| buf_incrpos(buf, len); 240| 6.36k| buf_incrlen(ret, len); 241| 6.36k| buf_setpos(ret, 0); 242| 6.36k| return ret; 243| 6.36k|} chachapoly.c:dropbear_chachapoly_start: 48| 5.72k| int UNUSED(num_rounds), dropbear_chachapoly_state *state) { 49| 5.72k| int err; 50| | 51| 5.72k| TRACE2(("enter dropbear_chachapoly_start")) 52| | 53| 5.72k| if (keylen != CHACHA20_KEY_LEN*2) { ------------------ | | 33| 5.72k|#define CHACHA20_KEY_LEN 32 ------------------ | Branch (53:6): [True: 0, False: 5.72k] ------------------ 54| 0| return CRYPT_ERROR; 55| 0| } 56| | 57| 5.72k| if ((err = chacha_setup(&state->chacha, key, ------------------ | Branch (57:6): [True: 0, False: 5.72k] ------------------ 58| 5.72k| CHACHA20_KEY_LEN, 20)) != CRYPT_OK) { ------------------ | | 33| 5.72k|#define CHACHA20_KEY_LEN 32 ------------------ 59| 0| return err; 60| 0| } 61| | 62| 5.72k| if ((err = chacha_setup(&state->header, key + CHACHA20_KEY_LEN, ------------------ | | 33| 5.72k|#define CHACHA20_KEY_LEN 32 ------------------ | Branch (62:6): [True: 0, False: 5.72k] ------------------ 63| 5.72k| CHACHA20_KEY_LEN, 20) != CRYPT_OK)) { ------------------ | | 33| 5.72k|#define CHACHA20_KEY_LEN 32 ------------------ 64| 0| return err; 65| 0| } 66| | 67| 5.72k| TRACE2(("leave dropbear_chachapoly_start")) 68| 5.72k| return CRYPT_OK; 69| 5.72k|} chachapoly.c:dropbear_chachapoly_crypt: 74| 214k| dropbear_chachapoly_state *state, int direction) { 75| 214k| poly1305_state poly; 76| 214k| unsigned char seqbuf[8], key[POLY1305_KEY_LEN], tag[POLY1305_TAG_LEN]; 77| 214k| int err; 78| | 79| 214k| TRACE2(("enter dropbear_chachapoly_crypt")) 80| | 81| 214k| if (len < 4 || taglen != POLY1305_TAG_LEN) { ------------------ | | 36| 214k|#define POLY1305_TAG_LEN 16 ------------------ | Branch (81:6): [True: 0, False: 214k] | Branch (81:17): [True: 0, False: 214k] ------------------ 82| 0| return CRYPT_ERROR; 83| 0| } 84| | 85| 214k| STORE64H((uint64_t)seq, seqbuf); ------------------ | | 101| 214k|#define STORE64H(x, y) \ | | 102| 214k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 214k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 214k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 86| 214k| chacha_ivctr64(&state->chacha, seqbuf, sizeof(seqbuf), 0); 87| 214k| if ((err = chacha_keystream(&state->chacha, key, sizeof(key))) != CRYPT_OK) { ------------------ | Branch (87:6): [True: 0, False: 214k] ------------------ 88| 0| return err; 89| 0| } 90| | 91| 214k| poly1305_init(&poly, key, sizeof(key)); 92| 214k| if (direction == LTC_DECRYPT) { ------------------ | | 70| 214k|#define LTC_DECRYPT 1 ------------------ | Branch (92:6): [True: 0, False: 214k] ------------------ 93| 0| poly1305_process(&poly, in, len); 94| 0| poly1305_done(&poly, tag, &taglen); 95| 0| if (constant_time_memcmp(in + len, tag, taglen) != 0) { ------------------ | Branch (95:7): [True: 0, False: 0] ------------------ 96| 0| return CRYPT_ERROR; 97| 0| } 98| 0| } 99| | 100| 214k| chacha_ivctr64(&state->header, seqbuf, sizeof(seqbuf), 0); 101| 214k| if ((err = chacha_crypt(&state->header, in, 4, out)) != CRYPT_OK) { ------------------ | Branch (101:6): [True: 0, False: 214k] ------------------ 102| 0| return err; 103| 0| } 104| | 105| 214k| chacha_ivctr64(&state->chacha, seqbuf, sizeof(seqbuf), 1); 106| 214k| if ((err = chacha_crypt(&state->chacha, in + 4, len - 4, out + 4)) != CRYPT_OK) { ------------------ | Branch (106:6): [True: 0, False: 214k] ------------------ 107| 0| return err; 108| 0| } 109| | 110| 214k| if (direction == LTC_ENCRYPT) { ------------------ | | 68| 214k|#define LTC_ENCRYPT 0 ------------------ | Branch (110:6): [True: 214k, False: 0] ------------------ 111| 214k| poly1305_process(&poly, out, len); 112| 214k| poly1305_done(&poly, out + len, &taglen); 113| 214k| } 114| | 115| 214k| TRACE2(("leave dropbear_chachapoly_crypt")) 116| 214k| return CRYPT_OK; 117| 214k|} cbuf_new: 31| 4.11k|circbuffer * cbuf_new(unsigned int size) { 32| | 33| 4.11k| circbuffer *cbuf = NULL; 34| | 35| 4.11k| if (size > MAX_CBUF_SIZE) { ------------------ | | 29| 4.11k|#define MAX_CBUF_SIZE 100000000 ------------------ | Branch (35:6): [True: 0, False: 4.11k] ------------------ 36| 0| dropbear_exit("Bad cbuf size"); 37| 0| } 38| | 39| 4.11k| cbuf = (circbuffer*)m_malloc(sizeof(circbuffer)); 40| | /* data is malloced on first write */ 41| 4.11k| cbuf->data = NULL; 42| 4.11k| cbuf->used = 0; 43| 4.11k| cbuf->readpos = 0; 44| 4.11k| cbuf->writepos = 0; 45| 4.11k| cbuf->size = size; 46| | 47| 4.11k| return cbuf; 48| 4.11k|} cbuf_free: 50| 4.11k|void cbuf_free(circbuffer * cbuf) { 51| | 52| 4.11k| if (cbuf->data) { ------------------ | Branch (52:6): [True: 0, False: 4.11k] ------------------ 53| 0| m_burn(cbuf->data, cbuf->size); 54| 0| m_free(cbuf->data); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 55| 0| } 56| 4.11k| m_free(cbuf); ------------------ | | 24| 4.11k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 57| 4.11k|} cbuf_getused: 59| 980k|unsigned int cbuf_getused(const circbuffer * cbuf) { 60| | 61| 980k| return cbuf->used; 62| | 63| 980k|} cbuf_getavail: 65| 33|unsigned int cbuf_getavail(const circbuffer * cbuf) { 66| | 67| 33| return cbuf->size - cbuf->used; 68| | 69| 33|} cbuf_readptrs: 91| 15| unsigned char **p2, unsigned int *len2) { 92| 15| *p1 = &cbuf->data[cbuf->readpos]; 93| 15| *len1 = MIN(cbuf->used, cbuf->size - cbuf->readpos); 94| | 95| 15| if (*len1 < cbuf->used) { ------------------ | Branch (95:6): [True: 0, False: 15] ------------------ 96| 0| *p2 = cbuf->data; 97| 0| *len2 = cbuf->used - *len1; 98| 15| } else { 99| 15| *p2 = NULL; 100| 15| *len2 = 0; 101| 15| } 102| 15|} buf_put_algolist_all: 315| 77.2k|void buf_put_algolist_all(buffer * buf, const algo_type localalgos[], int useall) { 316| 77.2k| unsigned int i, len; 317| 77.2k| unsigned int donefirst = 0; 318| 77.2k| unsigned int startpos; 319| | 320| 77.2k| startpos = buf->pos; 321| | /* Placeholder for length */ 322| 77.2k| buf_putint(buf, 0); 323| 367k| for (i = 0; localalgos[i].name != NULL; i++) { ------------------ | Branch (323:14): [True: 289k, False: 77.2k] ------------------ 324| 289k| if (localalgos[i].usable || useall) { ------------------ | Branch (324:7): [True: 280k, False: 9.65k] | Branch (324:31): [True: 0, False: 9.65k] ------------------ 325| 280k| if (donefirst) { ------------------ | Branch (325:8): [True: 202k, False: 77.2k] ------------------ 326| 202k| buf_putbyte(buf, ','); 327| 202k| } 328| 280k| donefirst = 1; 329| 280k| len = strlen(localalgos[i].name); 330| 280k| buf_putbytes(buf, (const unsigned char *) localalgos[i].name, len); 331| 280k| } 332| 289k| } 333| | /* Fill out the length */ 334| 77.2k| len = buf->pos - startpos - 4; 335| 77.2k| buf_setpos(buf, startpos); 336| 77.2k| buf_putint(buf, len); 337| 77.2k| TRACE(("algolist add %d '%.*s'", len, len, buf_getptr(buf, len))) 338| 77.2k| buf_incrwritepos(buf, len); 339| 77.2k|} buf_put_algolist: 341| 77.2k|void buf_put_algolist(buffer * buf, const algo_type localalgos[]) { 342| 77.2k| buf_put_algolist_all(buf, localalgos, 0); 343| 77.2k|} buf_has_algo: 387| 11.0k|int buf_has_algo(buffer *buf, const char *algo) { 388| 11.0k| unsigned char* algolist = NULL; 389| 11.0k| unsigned int orig_pos = buf->pos; 390| 11.0k| unsigned int len, remotecount, i; 391| 11.0k| const char *remotenames[MAX_PROPOSED_ALGO]; 392| 11.0k| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 11.0k|#define DROPBEAR_FAILURE -1 ------------------ 393| | 394| 11.0k| algolist = buf_getstring(buf, &len); 395| 11.0k| remotecount = MAX_PROPOSED_ALGO; ------------------ | | 209| 11.0k|#define MAX_PROPOSED_ALGO 50 ------------------ 396| 11.0k| get_algolist(algolist, len, remotenames, &remotecount); 397| 59.0k| for (i = 0; i < remotecount; i++) ------------------ | Branch (397:14): [True: 48.1k, False: 10.8k] ------------------ 398| 48.1k| { 399| 48.1k| if (strcmp(remotenames[i], algo) == 0) { ------------------ | Branch (399:7): [True: 129, False: 48.0k] ------------------ 400| 129| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 129|#define DROPBEAR_SUCCESS 0 ------------------ 401| 129| break; 402| 129| } 403| 48.1k| } 404| 11.0k| if (algolist) { ------------------ | Branch (404:6): [True: 11.0k, False: 2] ------------------ 405| 11.0k| m_free(algolist); ------------------ | | 24| 11.0k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 406| 11.0k| } 407| 11.0k| buf_setpos(buf, orig_pos); 408| 11.0k| return ret; 409| 11.0k|} buf_match_algo: 427| 76.0k| int kexguess2, int *goodguess) { 428| 76.0k| char * algolist = NULL; 429| 76.0k| const char *remotenames[MAX_PROPOSED_ALGO], *localnames[MAX_PROPOSED_ALGO]; 430| 76.0k| unsigned int len; 431| 76.0k| unsigned int remotecount, localcount, clicount, servcount, i, j; 432| 76.0k| algo_type * ret = NULL; 433| 76.0k| const char **clinames, **servnames; 434| | 435| 76.0k| if (goodguess) { ------------------ | Branch (435:6): [True: 19.1k, False: 56.9k] ------------------ 436| 19.1k| *goodguess = 0; 437| 19.1k| } 438| | 439| | /* get the comma-separated list from the buffer ie "algo1,algo2,algo3" */ 440| 76.0k| algolist = buf_getstring(buf, &len); 441| 76.0k| DEBUG3(("buf_match_algo: %s", algolist)) 442| 76.0k| remotecount = MAX_PROPOSED_ALGO; ------------------ | | 209| 76.0k|#define MAX_PROPOSED_ALGO 50 ------------------ 443| 76.0k| get_algolist(algolist, len, remotenames, &remotecount); 444| | 445| 362k| for (i = 0; localalgos[i].name != NULL; i++) { ------------------ | Branch (445:14): [True: 285k, False: 76.0k] ------------------ 446| 285k| if (localalgos[i].usable) { ------------------ | Branch (446:7): [True: 276k, False: 9.58k] ------------------ 447| 276k| localnames[i] = localalgos[i].name; 448| 276k| } else { 449| 9.58k| localnames[i] = NULL; 450| 9.58k| } 451| 285k| } 452| 76.0k| localcount = i; 453| | 454| 76.0k| if (IS_DROPBEAR_SERVER) { ------------------ | | 319| 76.0k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 76.0k, False: 54] | | ------------------ ------------------ 455| 76.0k| clinames = remotenames; 456| 76.0k| clicount = remotecount; 457| 76.0k| servnames = localnames; 458| 76.0k| servcount = localcount; 459| 76.0k| } else { 460| 54| clinames = localnames; 461| 54| clicount = localcount; 462| 54| servnames = remotenames; 463| 54| servcount = remotecount; 464| 54| } 465| | 466| | /* iterate and find the first match */ 467| 120k| for (i = 0; i < clicount; i++) { ------------------ | Branch (467:14): [True: 108k, False: 12.0k] ------------------ 468| 444k| for (j = 0; j < servcount; j++) { ------------------ | Branch (468:15): [True: 400k, False: 44.1k] ------------------ 469| 400k| if (!(servnames[j] && clinames[i])) { ------------------ | Branch (469:10): [True: 378k, False: 21.6k] | Branch (469:26): [True: 378k, False: 0] ------------------ 470| | /* unusable algos are NULL */ 471| 21.6k| continue; 472| 21.6k| } 473| 378k| if (strcmp(servnames[j], clinames[i]) == 0) { ------------------ | Branch (473:8): [True: 63.9k, False: 314k] ------------------ 474| | /* set if it was a good guess */ 475| 63.9k| if (goodguess != NULL) { ------------------ | Branch (475:9): [True: 19.0k, False: 44.8k] ------------------ 476| 19.0k| if (kexguess2) { ------------------ | Branch (476:10): [True: 236, False: 18.8k] ------------------ 477| 236| if (i == 0) { ------------------ | Branch (477:11): [True: 145, False: 91] ------------------ 478| 145| *goodguess = 1; 479| 145| } 480| 18.8k| } else { 481| 18.8k| if (i == 0 && j == 0) { ------------------ | Branch (481:11): [True: 14.3k, False: 4.51k] | Branch (481:21): [True: 6.72k, False: 7.61k] ------------------ 482| 6.72k| *goodguess = 1; 483| 6.72k| } 484| 18.8k| } 485| 19.0k| } 486| | /* set the algo to return */ 487| 63.9k| if (IS_DROPBEAR_SERVER) { ------------------ | | 319| 63.9k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 63.9k, False: 0] | | ------------------ ------------------ 488| 63.9k| ret = &localalgos[j]; 489| 63.9k| } else { 490| 0| ret = &localalgos[i]; 491| 0| } 492| 63.9k| goto out; 493| 63.9k| } 494| 378k| } 495| 108k| } 496| | 497| 76.0k|out: 498| 76.0k| m_free(algolist); ------------------ | | 24| 76.0k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 499| 76.0k| return ret; 500| 76.0k|} common-algo.c:void_start: 50| 9.27k| int UNUSED(keylen), int UNUSED(num_rounds), void* UNUSED(cipher_state)) { 51| 9.27k| return CRYPT_OK; 52| 9.27k|} common-algo.c:void_cipher: 41| 108k| unsigned long len, void* UNUSED(cipher_state)) { 42| 108k| if (in != out) { ------------------ | Branch (42:6): [True: 0, False: 108k] ------------------ 43| 0| memmove(out, in, len); 44| 0| } 45| 108k| return CRYPT_OK; 46| 108k|} common-algo.c:dropbear_big_endian_ctr_start: 91| 3.55k| int num_rounds, symmetric_CTR *ctr) { 92| 3.55k| return ctr_start(cipher, IV, key, keylen, num_rounds, CTR_COUNTER_BIG_ENDIAN, ctr); ------------------ | | 860| 3.55k|#define CTR_COUNTER_BIG_ENDIAN 0x1000 ------------------ 93| 3.55k|} common-algo.c:get_algolist: 350| 87.0k| const char* *ret_list, unsigned int *ret_count) { 351| 87.0k| unsigned int max_count = *ret_count; 352| 87.0k| unsigned int i; 353| | 354| 87.0k| if (*ret_count == 0) { ------------------ | Branch (354:6): [True: 0, False: 87.0k] ------------------ 355| 0| return; 356| 0| } 357| 87.0k| if (algolist_len > MAX_PROPOSED_ALGO*(MAX_NAME_LEN+1)) { ------------------ | | 209| 87.0k|#define MAX_PROPOSED_ALGO 50 ------------------ if (algolist_len > MAX_PROPOSED_ALGO*(MAX_NAME_LEN+1)) { ------------------ | | 205| 87.0k|#define MAX_NAME_LEN 64 /* maximum length of a protocol name, isn't ------------------ | Branch (357:6): [True: 5, False: 87.0k] ------------------ 358| 5| *ret_count = 0; 359| 5| } 360| | 361| | /* ret_list will contain a list of the strings parsed out. 362| | We will have at least one string (even if it's just "") */ 363| 87.0k| ret_list[0] = algolist; 364| 87.0k| *ret_count = 1; 365| 1.77M| for (i = 0; i < algolist_len; i++) { ------------------ | Branch (365:14): [True: 1.68M, False: 86.6k] ------------------ 366| 1.68M| if (algolist[i] == '\0') { ------------------ | Branch (366:7): [True: 335, False: 1.68M] ------------------ 367| | /* someone is trying something strange */ 368| 335| *ret_count = 0; 369| 335| return; 370| 335| } 371| | 372| 1.68M| if (algolist[i] == ',') { ------------------ | Branch (372:7): [True: 115k, False: 1.57M] ------------------ 373| 115k| if (*ret_count >= max_count) { ------------------ | Branch (373:8): [True: 0, False: 115k] ------------------ 374| 0| dropbear_exit("Too many remote algorithms"); 375| 0| *ret_count = 0; 376| 0| return; 377| 0| } 378| 115k| algolist[i] = '\0'; 379| 115k| ret_list[*ret_count] = &algolist[i+1]; 380| 115k| (*ret_count)++; 381| 115k| } 382| 1.68M| } 383| 87.0k|} chaninitialise: 70| 1.49k|void chaninitialise(const struct ChanType *chantypes[]) { 71| | 72| | /* may as well create space for a single channel */ 73| 1.49k| ses.channels = (struct Channel**)m_malloc(sizeof(struct Channel*)); 74| 1.49k| ses.chansize = 1; 75| 1.49k| ses.channels[0] = NULL; 76| 1.49k| ses.chancount = 0; 77| | 78| 1.49k| ses.chantypes = chantypes; 79| | 80| 1.49k|#if DROPBEAR_LISTENERS 81| 1.49k| listeners_initialise(); 82| 1.49k|#endif 83| | 84| 1.49k|} chancleanup: 87| 1.49k|void chancleanup() { 88| | 89| 1.49k| unsigned int i; 90| | 91| 1.49k| TRACE(("enter chancleanup")) 92| 5.94k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (92:14): [True: 4.45k, False: 1.49k] ------------------ 93| 4.45k| if (ses.channels[i] != NULL) { ------------------ | Branch (93:7): [True: 3.13k, False: 1.31k] ------------------ 94| 3.13k| TRACE(("channel %d closing", i)) 95| 3.13k| remove_channel(ses.channels[i]); 96| 3.13k| } 97| 4.45k| } 98| 1.49k| m_free(ses.channels); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 99| 1.49k| TRACE(("leave chancleanup")) 100| 1.49k|} getchannel: 194| 7.95k|struct Channel* getchannel() { 195| 7.95k| return getchannel_msg(NULL); 196| 7.95k|} channelio: 199| 456k|void channelio(const fd_set *readfds, const fd_set *writefds) { 200| | 201| | /* Listeners such as TCP, X11, agent-auth */ 202| 456k| struct Channel *channel; 203| 456k| unsigned int i; 204| | 205| | /* foreach channel */ 206| 3.11M| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (206:14): [True: 2.65M, False: 456k] ------------------ 207| | /* Close checking only needs to occur for channels that had IO events */ 208| 2.65M| int do_check_close = 0; 209| | 210| 2.65M| channel = ses.channels[i]; 211| 2.65M| if (channel == NULL) { ------------------ | Branch (211:7): [True: 481k, False: 2.17M] ------------------ 212| | /* only process in-use channels */ 213| 481k| continue; 214| 481k| } 215| | 216| | /* read data and send it over the wire */ 217| 2.17M| if (channel->readfd >= 0 && FD_ISSET(channel->readfd, readfds)) { ------------------ | Branch (217:7): [True: 816k, False: 1.36M] ------------------ 218| 106k| TRACE(("send normal readfd")) 219| 106k| send_msg_channel_data(channel, 0); 220| 106k| do_check_close = 1; 221| 106k| } 222| | 223| | /* read stderr data and send it over the wire */ 224| 2.17M| if (ERRFD_IS_READ(channel) && channel->errfd >= 0 ------------------ | | 59| 4.35M|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (59:32): [True: 2.17M, False: 0] | | ------------------ ------------------ | Branch (224:33): [True: 783k, False: 1.39M] ------------------ 225| 2.17M| && FD_ISSET(channel->errfd, readfds)) { 226| 99.8k| TRACE(("send normal errfd")) 227| 99.8k| send_msg_channel_data(channel, 1); 228| 99.8k| do_check_close = 1; 229| 99.8k| } 230| | 231| | /* write to program/pipe stdin */ 232| 2.17M| if (channel->writefd >= 0 && FD_ISSET(channel->writefd, writefds)) { ------------------ | Branch (232:7): [True: 980k, False: 1.19M] ------------------ 233| 0| writechannel(channel, channel->writefd, channel->writebuf, NULL, NULL); 234| 0| do_check_close = 1; 235| 0| } 236| | 237| | /* stderr for client mode */ 238| 2.17M| if (ERRFD_IS_WRITE(channel) ------------------ | | 60| 4.35M|#define ERRFD_IS_WRITE(channel) (!ERRFD_IS_READ(channel)) | | ------------------ | | | | 59| 2.17M|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (60:33): [True: 0, False: 2.17M] | | ------------------ ------------------ 239| 2.17M| && channel->errfd >= 0 && FD_ISSET(channel->errfd, writefds)) { ------------------ | Branch (239:8): [True: 0, False: 0] ------------------ 240| 0| writechannel(channel, channel->errfd, channel->extrabuf, NULL, NULL); 241| 0| do_check_close = 1; 242| 0| } 243| | 244| 2.17M| if (ses.channel_signal_pending) { ------------------ | Branch (244:7): [True: 0, False: 2.17M] ------------------ 245| | /* SIGCHLD can change channel state for server sessions */ 246| 0| do_check_close = 1; 247| 0| } 248| | 249| | /* handle any channel closing etc */ 250| 2.17M| if (do_check_close) { ------------------ | Branch (250:7): [True: 183k, False: 1.99M] ------------------ 251| 183k| check_close(channel); 252| 183k| } 253| 2.17M| } 254| | 255| 456k|#if DROPBEAR_LISTENERS 256| 456k| handle_listeners(readfds); 257| 456k|#endif 258| 456k|} channel_connect_done: 347| 97|void channel_connect_done(int result, int sock, void* user_data, const char* errstring) { 348| 97| struct Channel *channel = user_data; 349| | 350| 97| TRACE(("enter channel_connect_done")) 351| | 352| 97| if (result == DROPBEAR_SUCCESS) ------------------ | | 102| 97|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (352:6): [True: 0, False: 97] ------------------ 353| 0| { 354| 0| channel->readfd = channel->writefd = sock; 355| 0| channel->bidir_fd = 1; 356| 0| channel->conn_pending = NULL; 357| 0| send_msg_channel_open_confirmation(channel, channel->recvwindow, 358| 0| channel->recvmaxpacket); 359| 0| TRACE(("leave channel_connect_done: success")) 360| 0| } 361| 97| else 362| 97| { 363| 97| send_msg_channel_open_failure(channel->remotechan, 364| 97| SSH_OPEN_CONNECT_FAILED, errstring, ""); ------------------ | | 34| 97|#define SSH_OPEN_CONNECT_FAILED 2 ------------------ 365| 97| remove_channel(channel); 366| 97| TRACE(("leave check_in_progress: fail. internal errstring: %s", errstring)) 367| 97| } 368| 97|} setchannelfds: 541| 458k|void setchannelfds(fd_set *readfds, fd_set *writefds, int allow_reads) { 542| | 543| 458k| unsigned int i; 544| 458k| struct Channel * channel; 545| | 546| 3.11M| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (546:14): [True: 2.65M, False: 458k] ------------------ 547| | 548| 2.65M| channel = ses.channels[i]; 549| 2.65M| if (channel == NULL) { ------------------ | Branch (549:7): [True: 483k, False: 2.17M] ------------------ 550| 483k| continue; 551| 483k| } 552| | 553| | /* Stuff to put over the wire. 554| | Avoid queueing data to send if we're in the middle of a 555| | key re-exchange (!dataallowed), but still read from the 556| | FD if there's the possibility of "~."" to kill an 557| | interactive session (the read_mangler) */ 558| 2.17M| if (channel->transwindow > 0 ------------------ | Branch (558:7): [True: 2.09M, False: 76.3k] ------------------ 559| 2.17M| && ((ses.dataallowed && allow_reads) || channel->read_mangler)) { ------------------ | Branch (559:11): [True: 2.09M, False: 6.82k] | Branch (559:30): [True: 1.48M, False: 603k] | Branch (559:46): [True: 0, False: 610k] ------------------ 560| | 561| 1.48M| if (channel->readfd >= 0) { ------------------ | Branch (561:8): [True: 510k, False: 978k] ------------------ 562| 510k| FD_SET(channel->readfd, readfds); 563| 510k| } 564| | 565| 1.48M| if (ERRFD_IS_READ(channel) && channel->errfd >= 0) { ------------------ | | 59| 2.97M|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (59:32): [True: 1.48M, False: 0] | | ------------------ ------------------ | Branch (565:34): [True: 488k, False: 1.00M] ------------------ 566| 488k| FD_SET(channel->errfd, readfds); 567| 488k| } 568| 1.48M| } 569| | 570| | /* Stuff from the wire */ 571| 2.17M| if (channel->writefd >= 0 && cbuf_getused(channel->writebuf) > 0) { ------------------ | Branch (571:7): [True: 980k, False: 1.19M] | Branch (571:32): [True: 0, False: 980k] ------------------ 572| 0| FD_SET(channel->writefd, writefds); 573| 0| } 574| | 575| 2.17M| if (ERRFD_IS_WRITE(channel) && channel->errfd >= 0 ------------------ | | 60| 4.35M|#define ERRFD_IS_WRITE(channel) (!ERRFD_IS_READ(channel)) | | ------------------ | | | | 59| 2.17M|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (60:33): [True: 0, False: 2.17M] | | ------------------ ------------------ | Branch (575:34): [True: 0, False: 0] ------------------ 576| 2.17M| && cbuf_getused(channel->extrabuf) > 0) { ------------------ | Branch (576:8): [True: 0, False: 0] ------------------ 577| 0| FD_SET(channel->errfd, writefds); 578| 0| } 579| | 580| 2.17M| } /* foreach channel */ 581| | 582| 458k|#if DROPBEAR_LISTENERS 583| 458k| set_listener_fds(readfds); 584| 458k|#endif 585| | 586| 458k|} recv_msg_channel_eof: 591| 1.45k|void recv_msg_channel_eof() { 592| | 593| 1.45k| struct Channel * channel; 594| | 595| 1.45k| TRACE(("enter recv_msg_channel_eof")) 596| | 597| 1.45k| channel = getchannel_msg("EOF"); 598| | 599| 1.45k| channel->recv_eof = 1; 600| | 601| 1.45k| check_close(channel); 602| 1.45k| TRACE(("leave recv_msg_channel_eof")) 603| 1.45k|} recv_msg_channel_close: 607| 1.01k|void recv_msg_channel_close() { 608| | 609| 1.01k| struct Channel * channel; 610| | 611| 1.01k| TRACE(("enter recv_msg_channel_close")) 612| | 613| 1.01k| channel = getchannel_msg("Close"); 614| | 615| 1.01k| channel->recv_eof = 1; 616| 1.01k| channel->recv_close = 1; 617| | 618| 1.01k| check_close(channel); 619| 1.01k| TRACE(("leave recv_msg_channel_close")) 620| 1.01k|} recv_msg_channel_request: 668| 7.35k|void recv_msg_channel_request() { 669| | 670| 7.35k| struct Channel *channel; 671| | 672| 7.35k| channel = getchannel(); 673| | 674| 7.35k| TRACE(("enter recv_msg_channel_request %p", (void*)channel)) 675| | 676| 7.35k| if (channel->type->reqhandler) { ------------------ | Branch (676:6): [True: 7.34k, False: 10] ------------------ 677| 7.34k| channel->type->reqhandler(channel); 678| 7.34k| } else { 679| 10| int wantreply; 680| 10| buf_eatstring(ses.payload); 681| 10| wantreply = buf_getbool(ses.payload); 682| 10| if (wantreply) { ------------------ | Branch (682:7): [True: 0, False: 10] ------------------ 683| 0| send_msg_channel_failure(channel); 684| 0| } 685| 10| } 686| | 687| 7.35k| TRACE(("leave recv_msg_channel_request")) 688| | 689| 7.35k|} recv_msg_channel_data: 775| 79|void recv_msg_channel_data() { 776| | 777| 79| struct Channel *channel; 778| | 779| 79| channel = getchannel(); 780| | 781| 79| common_recv_msg_channel_data(channel, channel->writefd, channel->writebuf); 782| 79|} common_recv_msg_channel_data: 787| 78| circbuffer * cbuf) { 788| | 789| 78| unsigned int datalen; 790| 78| unsigned int maxdata; 791| 78| unsigned int buflen; 792| 78| unsigned int len; 793| 78| unsigned int consumed; 794| 78| int res; 795| | 796| 78| TRACE(("enter recv_msg_channel_data")) 797| | 798| 78| if (channel->recv_eof) { ------------------ | Branch (798:6): [True: 0, False: 78] ------------------ 799| 0| dropbear_exit("Received data after eof"); 800| 0| } 801| | 802| 78| if (fd < 0 || !cbuf) { ------------------ | Branch (802:6): [True: 60, False: 18] | Branch (802:16): [True: 0, False: 18] ------------------ 803| | /* If we have encountered failed write, the far side might still 804| | * be sending data without having yet received our close notification. 805| | * We just drop the data. */ 806| 60| return; 807| 60| } 808| | 809| 18| datalen = buf_getint(ses.payload); 810| 18| TRACE(("length %d", datalen)) 811| | 812| 18| maxdata = cbuf_getavail(cbuf); 813| | 814| | /* Whilst the spec says we "MAY ignore data past the end" this could 815| | * lead to corrupted file transfers etc (chunks missed etc). It's better to 816| | * just die horribly */ 817| 18| if (datalen > maxdata) { ------------------ | Branch (817:6): [True: 2, False: 16] ------------------ 818| 2| dropbear_exit("Oversized packet"); 819| 2| } 820| | 821| 16| dropbear_assert(channel->recvwindow >= datalen); ------------------ | | 83| 16|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 16] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 822| 16| channel->recvwindow -= datalen; 823| 16| dropbear_assert(channel->recvwindow <= opts.recv_window); ------------------ | | 83| 16|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 16] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 824| | 825| | /* Attempt to write the data immediately without having to put it in the circular buffer */ 826| 16| consumed = datalen; 827| 16| res = writechannel(channel, fd, cbuf, buf_getptr(ses.payload, datalen), &consumed); 828| | 829| 16| datalen -= consumed; 830| 16| buf_incrpos(ses.payload, consumed); 831| | 832| | 833| | /* We may have to run throught twice, if the buffer wraps around. Can't 834| | * just "leave it for next time" like with writechannel, since this 835| | * is payload data. 836| | * If the writechannel() failed then remaining data is discarded */ 837| 16| if (res == DROPBEAR_SUCCESS) { ------------------ | | 102| 16|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (837:6): [True: 0, False: 16] ------------------ 838| 0| len = datalen; 839| 0| while (len > 0) { ------------------ | Branch (839:10): [True: 0, False: 0] ------------------ 840| 0| buflen = cbuf_writelen(cbuf); 841| 0| buflen = MIN(buflen, len); 842| | 843| 0| memcpy(cbuf_writeptr(cbuf, buflen), 844| 0| buf_getptr(ses.payload, buflen), buflen); 845| 0| cbuf_incrwrite(cbuf, buflen); 846| 0| buf_incrpos(ses.payload, buflen); 847| 0| len -= buflen; 848| 0| } 849| 0| } 850| | 851| 16| TRACE(("leave recv_msg_channel_data")) 852| 16|} recv_msg_channel_window_adjust: 857| 526|void recv_msg_channel_window_adjust() { 858| | 859| 526| struct Channel * channel; 860| 526| unsigned int incr; 861| | 862| 526| channel = getchannel(); 863| | 864| 526| incr = buf_getint(ses.payload); 865| 526| TRACE(("received window increment %d", incr)) 866| 526| incr = MIN(incr, TRANS_MAX_WIN_INCR); 867| | 868| 526| channel->transwindow += incr; 869| 526| channel->transwindow = MIN(channel->transwindow, TRANS_MAX_WINDOW); 870| | 871| 526|} recv_msg_channel_open: 889| 5.01k|void recv_msg_channel_open() { 890| | 891| 5.01k| char *type; 892| 5.01k| unsigned int typelen; 893| 5.01k| unsigned int remotechan, transwindow, transmaxpacket; 894| 5.01k| struct Channel *channel; 895| 5.01k| const struct ChanType **cp; 896| 5.01k| const struct ChanType *chantype; 897| 5.01k| unsigned int errtype = SSH_OPEN_UNKNOWN_CHANNEL_TYPE; ------------------ | | 35| 5.01k|#define SSH_OPEN_UNKNOWN_CHANNEL_TYPE 3 ------------------ 898| 5.01k| int ret; 899| | 900| | 901| 5.01k| TRACE(("enter recv_msg_channel_open")) 902| | 903| | /* get the packet contents */ 904| 5.01k| type = buf_getstring(ses.payload, &typelen); 905| | 906| 5.01k| remotechan = buf_getint(ses.payload); 907| 5.01k| transwindow = buf_getint(ses.payload); 908| 5.01k| transwindow = MIN(transwindow, TRANS_MAX_WINDOW); 909| 5.01k| transmaxpacket = buf_getint(ses.payload); 910| 5.01k| transmaxpacket = MIN(transmaxpacket, TRANS_MAX_PAYLOAD_LEN); 911| | 912| | /* figure what type of packet it is */ 913| 5.01k| if (typelen > MAX_NAME_LEN) { ------------------ | | 205| 5.01k|#define MAX_NAME_LEN 64 /* maximum length of a protocol name, isn't ------------------ | Branch (913:6): [True: 70, False: 4.94k] ------------------ 914| 70| goto failure; 915| 70| } 916| | 917| | /* Get the channel type. Client and server style invokation will set up a 918| | * different list for ses.chantypes at startup. We just iterate through 919| | * this list and find the matching name */ 920| 4.94k| for (cp = &ses.chantypes[0], chantype = (*cp); 921| 6.93k| chantype != NULL; ------------------ | Branch (921:4): [True: 6.10k, False: 835] ------------------ 922| 6.10k| cp++, chantype = (*cp)) { 923| 6.10k| if (strcmp(type, chantype->name) == 0) { ------------------ | Branch (923:7): [True: 4.11k, False: 1.98k] ------------------ 924| 4.11k| break; 925| 4.11k| } 926| 6.10k| } 927| | 928| 4.94k| if (chantype == NULL) { ------------------ | Branch (928:6): [True: 833, False: 4.11k] ------------------ 929| 833| TRACE(("No matching type for '%s'", type)) 930| 833| goto failure; 931| 833| } 932| | 933| 4.11k| TRACE(("matched type '%s'", type)) 934| | 935| | /* create the channel */ 936| 4.11k| channel = newchannel(remotechan, chantype, transwindow, transmaxpacket); 937| | 938| 4.11k| if (channel == NULL) { ------------------ | Branch (938:6): [True: 0, False: 4.11k] ------------------ 939| 0| TRACE(("newchannel returned NULL")) 940| 0| errtype = SSH_OPEN_RESOURCE_SHORTAGE; ------------------ | | 36| 0|#define SSH_OPEN_RESOURCE_SHORTAGE 4 ------------------ 941| 0| goto failure; 942| 0| } 943| | 944| 4.11k| if (channel->type->inithandler) { ------------------ | Branch (944:6): [True: 4.11k, False: 2] ------------------ 945| 4.11k| ret = channel->type->inithandler(channel); 946| 4.11k| if (ret == SSH_OPEN_IN_PROGRESS) { ------------------ | | 39| 4.11k|#define SSH_OPEN_IN_PROGRESS 99 ------------------ | Branch (946:7): [True: 98, False: 4.01k] ------------------ 947| | /* We'll send the confirmation later */ 948| 98| goto cleanup; 949| 98| } 950| 4.01k| if (ret > 0) { ------------------ | Branch (950:7): [True: 219, False: 3.79k] ------------------ 951| 219| errtype = ret; 952| 219| remove_channel(channel); 953| 219| TRACE(("inithandler returned failure %d", ret)) 954| 219| goto failure; 955| 219| } 956| 4.01k| } 957| | 958| 3.79k| update_channel_prio(); 959| | 960| | /* success */ 961| 3.79k| send_msg_channel_open_confirmation(channel, channel->recvwindow, 962| 3.79k| channel->recvmaxpacket); 963| 3.79k| goto cleanup; 964| | 965| 1.12k|failure: 966| 1.12k| TRACE(("recv_msg_channel_open failure")) 967| 1.12k| send_msg_channel_open_failure(remotechan, errtype, "", ""); 968| | 969| 5.00k|cleanup: 970| 5.00k| m_free(type); ------------------ | | 24| 5.00k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 971| | 972| 5.00k| TRACE(("leave recv_msg_channel_open")) 973| 5.00k|} send_msg_channel_failure: 976| 4.75k|void send_msg_channel_failure(const struct Channel *channel) { 977| | 978| 4.75k| TRACE(("enter send_msg_channel_failure")) 979| | 980| 4.75k| if (channel->sent_close) { ------------------ | Branch (980:6): [True: 257, False: 4.49k] ------------------ 981| 257| TRACE(("Skipping sending msg_channel_failure for closed channel")) 982| 257| return; 983| 257| } 984| 4.49k| CHECKCLEARTOWRITE(); 985| | 986| 4.49k| buf_putbyte(ses.writepayload, SSH_MSG_CHANNEL_FAILURE); ------------------ | | 76| 4.49k|#define SSH_MSG_CHANNEL_FAILURE 100 ------------------ 987| 4.49k| buf_putint(ses.writepayload, channel->remotechan); 988| | 989| 4.49k| encrypt_packet(); 990| 4.49k| TRACE(("leave send_msg_channel_failure")) 991| 4.49k|} send_msg_channel_success: 994| 1.40k|void send_msg_channel_success(const struct Channel *channel) { 995| | 996| 1.40k| TRACE(("enter send_msg_channel_success")) 997| 1.40k| if (channel->sent_close) { ------------------ | Branch (997:6): [True: 384, False: 1.01k] ------------------ 998| 384| TRACE(("Skipping sending msg_channel_success for closed channel")) 999| 384| return; 1000| 384| } 1001| 1.01k| CHECKCLEARTOWRITE(); 1002| | 1003| 1.01k| buf_putbyte(ses.writepayload, SSH_MSG_CHANNEL_SUCCESS); ------------------ | | 75| 1.01k|#define SSH_MSG_CHANNEL_SUCCESS 99 ------------------ 1004| 1.01k| buf_putint(ses.writepayload, channel->remotechan); 1005| | 1006| 1.01k| encrypt_packet(); 1007| 1.01k| TRACE(("leave send_msg_channel_success")) 1008| 1.01k|} send_msg_request_failure: 1192| 757|void send_msg_request_failure() { 1193| 757| CHECKCLEARTOWRITE(); 1194| 757| buf_putbyte(ses.writepayload, SSH_MSG_REQUEST_FAILURE); ------------------ | | 65| 757|#define SSH_MSG_REQUEST_FAILURE 82 ------------------ 1195| 757| encrypt_packet(); 1196| 757|} common-channel.c:getchannel_msg: 179| 10.4k|static struct Channel* getchannel_msg(const char* kind) { 180| | 181| 10.4k| unsigned int chan; 182| | 183| 10.4k| chan = buf_getint(ses.payload); 184| 10.4k| if (chan >= ses.chansize || ses.channels[chan] == NULL) { ------------------ | Branch (184:6): [True: 18, False: 10.4k] | Branch (184:30): [True: 2, False: 10.4k] ------------------ 185| 20| if (kind) { ------------------ | Branch (185:7): [True: 7, False: 13] ------------------ 186| 7| dropbear_exit("%s for unknown channel %d", kind, chan); 187| 13| } else { 188| 13| dropbear_exit("Unknown channel %d", chan); 189| 13| } 190| 20| } 191| 10.4k| return ses.channels[chan]; 192| 10.4k|} common-channel.c:check_close: 276| 185k|static void check_close(struct Channel *channel) { 277| 185k| int close_allowed = 0; 278| | 279| 185k| TRACE2(("check_close: writefd %d, readfd %d, errfd %d, sent_close %d, recv_close %d", 280| 185k| channel->writefd, channel->readfd, 281| 185k| channel->errfd, channel->sent_close, channel->recv_close)) 282| 185k| TRACE2(("writebuf size %d extrabuf size %d", 283| 185k| channel->writebuf ? cbuf_getused(channel->writebuf) : 0, 284| 185k| channel->extrabuf ? cbuf_getused(channel->extrabuf) : 0)) 285| | 286| | /* if a type-specific check_close is defined we will only exit 287| | once that has been triggered. this is only used for a server "session" 288| | channel, to ensure that the shell has exited (and the exit status 289| | retrieved) before we close things up. */ 290| 185k| if (!channel->type->check_close ------------------ | Branch (290:6): [True: 0, False: 185k] ------------------ 291| 185k| || channel->sent_close ------------------ | Branch (291:6): [True: 892, False: 184k] ------------------ 292| 185k| || channel->type->check_close(channel)) { ------------------ | Branch (292:6): [True: 710, False: 184k] ------------------ 293| 1.60k| close_allowed = 1; 294| 1.60k| } 295| | 296| | /* In flushing mode we close FDs as soon as pipes are empty. 297| | This is used to drain out FDs when the process exits, in the case 298| | where the FD doesn't have EOF - "sleep 10&echo hello" case */ 299| 185k| if (channel->flushing) { ------------------ | Branch (299:6): [True: 0, False: 185k] ------------------ 300| 0| if (channel->readfd >= 0 && !fd_read_pending(channel->readfd)) { ------------------ | Branch (300:7): [True: 0, False: 0] | Branch (300:31): [True: 0, False: 0] ------------------ 301| 0| close_chan_fd(channel, channel->readfd, SHUT_RD); 302| 0| } 303| 0| if (ERRFD_IS_READ(channel) ------------------ | | 59| 0|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (59:32): [True: 0, False: 0] | | ------------------ ------------------ 304| 0| && channel->errfd >= 0 && !fd_read_pending(channel->errfd)) { ------------------ | Branch (304:7): [True: 0, False: 0] | Branch (304:30): [True: 0, False: 0] ------------------ 305| 0| close_chan_fd(channel, channel->errfd, SHUT_RD); 306| 0| } 307| 0| } 308| | 309| 185k| if (channel->recv_close && !write_pending(channel) && close_allowed) { ------------------ | Branch (309:6): [True: 3.27k, False: 182k] | Branch (309:29): [True: 3.27k, False: 0] | Branch (309:56): [True: 663, False: 2.61k] ------------------ 310| 663| if (!channel->sent_close) { ------------------ | Branch (310:7): [True: 67, False: 596] ------------------ 311| 67| TRACE(("Sending MSG_CHANNEL_CLOSE in response to same.")) 312| 67| send_msg_channel_close(channel); 313| 67| } 314| 663| remove_channel(channel); 315| 663| return; 316| 663| } 317| | 318| 185k| if ((channel->recv_eof && !write_pending(channel)) ------------------ | Branch (318:7): [True: 7.31k, False: 177k] | Branch (318:28): [True: 7.31k, False: 0] ------------------ 319| | /* have a server "session" and child has exited */ 320| 185k| || (channel->type->check_close && close_allowed)) { ------------------ | Branch (320:7): [True: 177k, False: 0] | Branch (320:37): [True: 0, False: 177k] ------------------ 321| 7.31k| close_chan_fd(channel, channel->writefd, SHUT_WR); 322| 7.31k| } 323| | 324| | /* If we're not going to send any more data, send EOF */ 325| 185k| if (!channel->sent_eof ------------------ | Branch (325:6): [True: 184k, False: 627] ------------------ 326| 185k| && channel->readfd == FD_CLOSED ------------------ | | 57| 369k|#define FD_CLOSED (-1) ------------------ | Branch (326:7): [True: 18.0k, False: 166k] ------------------ 327| 185k| && (ERRFD_IS_WRITE(channel) || channel->errfd == FD_CLOSED)) { ------------------ | | 60| 36.1k|#define ERRFD_IS_WRITE(channel) (!ERRFD_IS_READ(channel)) | | ------------------ | | | | 59| 18.0k|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (60:33): [True: 0, False: 18.0k] | | ------------------ ------------------ && (ERRFD_IS_WRITE(channel) || channel->errfd == FD_CLOSED)) { ------------------ | | 57| 18.0k|#define FD_CLOSED (-1) ------------------ | Branch (327:35): [True: 702, False: 17.3k] ------------------ 328| 702| send_msg_channel_eof(channel); 329| 702| } 330| | 331| | /* And if we can't receive any more data from them either, close up */ 332| 185k| if (channel->readfd == FD_CLOSED ------------------ | | 57| 370k|#define FD_CLOSED (-1) ------------------ | Branch (332:6): [True: 18.6k, False: 166k] ------------------ 333| 185k| && channel->writefd == FD_CLOSED ------------------ | | 57| 203k|#define FD_CLOSED (-1) ------------------ | Branch (333:7): [True: 3.62k, False: 15.0k] ------------------ 334| 185k| && (ERRFD_IS_WRITE(channel) || channel->errfd == FD_CLOSED) ------------------ | | 60| 7.24k|#define ERRFD_IS_WRITE(channel) (!ERRFD_IS_READ(channel)) | | ------------------ | | | | 59| 3.62k|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (60:33): [True: 0, False: 3.62k] | | ------------------ ------------------ && (ERRFD_IS_WRITE(channel) || channel->errfd == FD_CLOSED) ------------------ | | 57| 3.62k|#define FD_CLOSED (-1) ------------------ | Branch (334:35): [True: 1.22k, False: 2.40k] ------------------ 335| 185k| && !channel->sent_close ------------------ | Branch (335:7): [True: 985, False: 237] ------------------ 336| 185k| && close_allowed ------------------ | Branch (336:7): [True: 643, False: 342] ------------------ 337| 185k| && !write_pending(channel)) { ------------------ | Branch (337:7): [True: 643, False: 0] ------------------ 338| 643| TRACE(("sending close, readfd is closed")) 339| 643| send_msg_channel_close(channel); 340| 643| } 341| 185k|} common-channel.c:close_chan_fd: 1048| 9.75k|static void close_chan_fd(struct Channel *channel, int fd, int how) { 1049| | 1050| 9.75k| int closein = 0, closeout = 0; 1051| | 1052| 9.75k| if (channel->bidir_fd) { ------------------ | Branch (1052:6): [True: 0, False: 9.75k] ------------------ 1053| 0| TRACE(("SHUTDOWN(%d, %d)", fd, how)) 1054| 0| shutdown(fd, how); 1055| 0| if (how == 0) { ------------------ | Branch (1055:7): [True: 0, False: 0] ------------------ 1056| 0| closeout = 1; 1057| 0| } else { 1058| 0| closein = 1; 1059| 0| } 1060| 9.75k| } else { 1061| 9.75k| TRACE(("CLOSE some fd %d", fd)) 1062| 9.75k| m_close(fd); 1063| 9.75k| closein = closeout = 1; 1064| 9.75k| } 1065| | 1066| 9.75k| if (closeout && (fd == channel->readfd)) { ------------------ | Branch (1066:6): [True: 9.75k, False: 0] | Branch (1066:18): [True: 5.90k, False: 3.85k] ------------------ 1067| 5.90k| channel->readfd = FD_CLOSED; ------------------ | | 57| 5.90k|#define FD_CLOSED (-1) ------------------ 1068| 5.90k| } 1069| 9.75k| if (closeout && ERRFD_IS_READ(channel) && (fd == channel->errfd)) { ------------------ | | 59| 19.5k|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (59:32): [True: 9.75k, False: 0] | | ------------------ ------------------ | Branch (1069:6): [True: 9.75k, False: 0] | Branch (1069:44): [True: 3.07k, False: 6.68k] ------------------ 1070| 3.07k| channel->errfd = FD_CLOSED; ------------------ | | 57| 3.07k|#define FD_CLOSED (-1) ------------------ 1071| 3.07k| } 1072| | 1073| 9.75k| if (closein && fd == channel->writefd) { ------------------ | Branch (1073:6): [True: 9.75k, False: 0] | Branch (1073:17): [True: 9.46k, False: 297] ------------------ 1074| 9.46k| channel->writefd = FD_CLOSED; ------------------ | | 57| 9.46k|#define FD_CLOSED (-1) ------------------ 1075| 9.46k| } 1076| 9.75k| if (closein && ERRFD_IS_WRITE(channel) && (fd == channel->errfd)) { ------------------ | | 60| 19.5k|#define ERRFD_IS_WRITE(channel) (!ERRFD_IS_READ(channel)) | | ------------------ | | | | 59| 9.75k|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (60:33): [True: 0, False: 9.75k] | | ------------------ ------------------ | Branch (1076:6): [True: 9.75k, False: 0] | Branch (1076:44): [True: 0, False: 0] ------------------ 1077| 0| channel->errfd = FD_CLOSED; ------------------ | | 57| 0|#define FD_CLOSED (-1) ------------------ 1078| 0| } 1079| | 1080| | /* if we called shutdown on it and all references are gone, then we 1081| | * need to close() it to stop it lingering */ 1082| 9.75k| if (channel->bidir_fd && channel->readfd == FD_CLOSED ------------------ | | 57| 9.75k|#define FD_CLOSED (-1) ------------------ | Branch (1082:6): [True: 0, False: 9.75k] | Branch (1082:27): [True: 0, False: 0] ------------------ 1083| 9.75k| && channel->writefd == FD_CLOSED && channel->errfd == FD_CLOSED) { ------------------ | | 57| 9.75k|#define FD_CLOSED (-1) ------------------ && channel->writefd == FD_CLOSED && channel->errfd == FD_CLOSED) { ------------------ | | 57| 0|#define FD_CLOSED (-1) ------------------ | Branch (1083:6): [True: 0, False: 0] | Branch (1083:39): [True: 0, False: 0] ------------------ 1084| 0| TRACE(("CLOSE (finally) of %d", fd)) 1085| 0| m_close(fd); 1086| 0| } 1087| 9.75k|} common-channel.c:write_pending: 263| 11.2k|static unsigned int write_pending(const struct Channel * channel) { 264| | 265| 11.2k| if (channel->writefd >= 0 && cbuf_getused(channel->writebuf) > 0) { ------------------ | Branch (265:6): [True: 634, False: 10.6k] | Branch (265:31): [True: 0, False: 634] ------------------ 266| 0| return 1; 267| 11.2k| } else if (channel->errfd >= 0 && channel->extrabuf && ------------------ | Branch (267:13): [True: 8.52k, False: 2.70k] | Branch (267:36): [True: 0, False: 8.52k] ------------------ 268| 11.2k| cbuf_getused(channel->extrabuf) > 0) { ------------------ | Branch (268:4): [True: 0, False: 0] ------------------ 269| 0| return 1; 270| 0| } 271| 11.2k| return 0; 272| 11.2k|} common-channel.c:send_msg_channel_close: 372| 710|static void send_msg_channel_close(struct Channel *channel) { 373| | 374| 710| TRACE(("enter send_msg_channel_close %p", (void*)channel)) 375| 710| if (channel->type->closehandler) { ------------------ | Branch (375:6): [True: 710, False: 0] ------------------ 376| 710| channel->type->closehandler(channel); 377| 710| } 378| | 379| 710| CHECKCLEARTOWRITE(); 380| | 381| 710| buf_putbyte(ses.writepayload, SSH_MSG_CHANNEL_CLOSE); ------------------ | | 73| 710|#define SSH_MSG_CHANNEL_CLOSE 97 ------------------ 382| 710| buf_putint(ses.writepayload, channel->remotechan); 383| | 384| 710| encrypt_packet(); 385| | 386| 710| channel->sent_eof = 1; 387| 710| channel->sent_close = 1; 388| 710| close_chan_fd(channel, channel->readfd, SHUT_RD); 389| 710| close_chan_fd(channel, channel->errfd, SHUT_RDWR); 390| 710| close_chan_fd(channel, channel->writefd, SHUT_WR); 391| 710| TRACE(("leave send_msg_channel_close")) 392| 710|} common-channel.c:send_msg_channel_eof: 395| 702|static void send_msg_channel_eof(struct Channel *channel) { 396| | 397| 702| TRACE(("enter send_msg_channel_eof")) 398| 702| CHECKCLEARTOWRITE(); 399| | 400| 702| buf_putbyte(ses.writepayload, SSH_MSG_CHANNEL_EOF); ------------------ | | 72| 702|#define SSH_MSG_CHANNEL_EOF 96 ------------------ 401| 702| buf_putint(ses.writepayload, channel->remotechan); 402| | 403| 702| encrypt_packet(); 404| | 405| 702| channel->sent_eof = 1; 406| | 407| 702| TRACE(("leave send_msg_channel_eof")) 408| 702|} common-channel.c:writechannel: 513| 15| const unsigned char *moredata, unsigned int *morelen) { 514| 15| int ret = DROPBEAR_SUCCESS; ------------------ | | 102| 15|#define DROPBEAR_SUCCESS 0 ------------------ 515| 15| TRACE(("enter writechannel fd %d", fd)) 516| 15|#ifdef HAVE_WRITEV 517| 15| ret = writechannel_writev(channel, fd, cbuf, moredata, morelen); 518| |#else 519| | ret = writechannel_fallback(channel, fd, cbuf, moredata, morelen); 520| |#endif 521| | 522| | /* Window adjust handling */ 523| 15| if (channel->recvdonelen >= RECV_WINDOWEXTEND) { ------------------ | | 221| 15|#define RECV_WINDOWEXTEND (opts.recv_window / 3) /* We send a "window extend" every ------------------ | Branch (523:6): [True: 0, False: 15] ------------------ 524| 0| send_msg_channel_window_adjust(channel, channel->recvdonelen); 525| 0| channel->recvwindow += channel->recvdonelen; 526| 0| channel->recvdonelen = 0; 527| 0| } 528| | 529| 15| dropbear_assert(channel->recvwindow <= opts.recv_window); ------------------ | | 83| 15|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 15] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 530| 15| dropbear_assert(channel->recvwindow <= cbuf_getavail(channel->writebuf)); ------------------ | | 83| 15|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 15] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 531| 15| dropbear_assert(channel->extrabuf == NULL || ------------------ | | 83| 15|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:39): [True: 15, False: 0] | | | Branch (83:39): [True: 0, False: 0] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 532| 15| channel->recvwindow <= cbuf_getavail(channel->extrabuf)); 533| | 534| 15| TRACE(("leave writechannel")) 535| 15| return ret; 536| 15|} common-channel.c:writechannel_writev: 442| 15| const unsigned char *moredata, unsigned int *morelen) { 443| | 444| 15| struct iovec iov[3]; 445| 15| unsigned char *circ_p1, *circ_p2; 446| 15| unsigned int circ_len1, circ_len2; 447| 15| int io_count = 0; 448| | 449| 15| ssize_t written; 450| | 451| 15| cbuf_readptrs(cbuf, &circ_p1, &circ_len1, &circ_p2, &circ_len2); 452| | 453| 15| if (circ_len1 > 0) { ------------------ | Branch (453:6): [True: 0, False: 15] ------------------ 454| 0| TRACE(("circ1 %d", circ_len1)) 455| 0| iov[io_count].iov_base = circ_p1; 456| 0| iov[io_count].iov_len = circ_len1; 457| 0| io_count++; 458| 0| } 459| | 460| 15| if (circ_len2 > 0) { ------------------ | Branch (460:6): [True: 0, False: 15] ------------------ 461| 0| TRACE(("circ2 %d", circ_len2)) 462| 0| iov[io_count].iov_base = circ_p2; 463| 0| iov[io_count].iov_len = circ_len2; 464| 0| io_count++; 465| 0| } 466| | 467| 15| if (morelen) { ------------------ | Branch (467:6): [True: 15, False: 0] ------------------ 468| 15| assert(moredata); 469| 15| TRACE(("more %d", *morelen)) 470| 15| iov[io_count].iov_base = (void*)moredata; 471| 15| iov[io_count].iov_len = *morelen; 472| 15| io_count++; 473| 15| } 474| | 475| 15| if (io_count == 0) { ------------------ | Branch (475:6): [True: 0, False: 15] ------------------ 476| | /* writechannel may sometimes be called twice in a main loop iteration. 477| | From common_recv_msg_channel_data() then channelio(). 478| | The second call may not have any data to write, so we just return. */ 479| 0| TRACE(("leave writechannel, no data")) 480| 0| return DROPBEAR_SUCCESS; ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ 481| 0| } 482| | 483| 15| if (morelen) { ------------------ | Branch (483:6): [True: 15, False: 0] ------------------ 484| | /* Default return value, none consumed */ 485| 15| *morelen = 0; 486| 15| } 487| | 488| 15| written = writev(fd, iov, io_count); 489| | 490| 15| if (written < 0) { ------------------ | Branch (490:6): [True: 15, False: 0] ------------------ 491| 15| if (errno != EINTR && errno != EAGAIN) { ------------------ | Branch (491:7): [True: 15, False: 0] | Branch (491:25): [True: 15, False: 0] ------------------ 492| 15| TRACE(("channel IO write error fd %d %s", fd, strerror(errno))) 493| 15| close_chan_fd(channel, fd, SHUT_WR); 494| 15| return DROPBEAR_FAILURE; ------------------ | | 103| 15|#define DROPBEAR_FAILURE -1 ------------------ 495| 15| } 496| 15| } else { 497| 0| int cbuf_written = MIN(circ_len1+circ_len2, (unsigned int)written); 498| 0| cbuf_incrread(cbuf, cbuf_written); 499| 0| if (morelen) { ------------------ | Branch (499:7): [True: 0, False: 0] ------------------ 500| 0| *morelen = written - cbuf_written; 501| 0| } 502| 0| channel->recvdonelen += written; 503| 0| } 504| 0| return DROPBEAR_SUCCESS; ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ 505| 15|} common-channel.c:remove_channel: 624| 4.11k|static void remove_channel(struct Channel * channel) { 625| | 626| 4.11k| TRACE(("enter remove_channel")) 627| 4.11k| TRACE(("channel index is %d", channel->index)) 628| | 629| 4.11k| cbuf_free(channel->writebuf); 630| 4.11k| channel->writebuf = NULL; 631| | 632| 4.11k| if (channel->extrabuf) { ------------------ | Branch (632:6): [True: 0, False: 4.11k] ------------------ 633| 0| cbuf_free(channel->extrabuf); 634| 0| channel->extrabuf = NULL; 635| 0| } 636| | 637| | 638| 4.11k| if (IS_DROPBEAR_SERVER || (channel->writefd != STDOUT_FILENO)) { ------------------ | | 319| 8.22k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 4.11k, False: 0] | | ------------------ ------------------ | Branch (638:28): [True: 0, False: 0] ------------------ 639| | /* close the FDs in case they haven't been done 640| | * yet (they might have been shutdown etc) */ 641| 4.11k| TRACE(("CLOSE writefd %d", channel->writefd)) 642| 4.11k| m_close(channel->writefd); 643| 4.11k| TRACE(("CLOSE readfd %d", channel->readfd)) 644| 4.11k| m_close(channel->readfd); 645| 4.11k| TRACE(("CLOSE errfd %d", channel->errfd)) 646| 4.11k| m_close(channel->errfd); 647| 4.11k| } 648| | 649| 4.11k| if (channel->type->cleanup) { ------------------ | Branch (649:6): [True: 3.78k, False: 323] ------------------ 650| 3.78k| channel->type->cleanup(channel); 651| 3.78k| } 652| | 653| 4.11k| if (channel->conn_pending) { ------------------ | Branch (653:6): [True: 98, False: 4.01k] ------------------ 654| 98| cancel_connect(channel->conn_pending); 655| 98| } 656| | 657| 4.11k| ses.channels[channel->index] = NULL; 658| 4.11k| m_free(channel); ------------------ | | 24| 4.11k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 659| 4.11k| ses.chancount--; 660| | 661| 4.11k| update_channel_prio(); 662| | 663| 4.11k| TRACE(("leave remove_channel")) 664| 4.11k|} common-channel.c:send_msg_channel_data: 696| 206k|static void send_msg_channel_data(struct Channel *channel, int isextended) { 697| | 698| 206k| int len; 699| 206k| size_t maxlen, size_pos; 700| 206k| int fd; 701| | 702| 206k| CHECKCLEARTOWRITE(); 703| | 704| 206k| TRACE(("enter send_msg_channel_data")) 705| 206k| dropbear_assert(!channel->sent_close); ------------------ | | 83| 206k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 1, False: 206k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 706| | 707| 206k| if (isextended) { ------------------ | Branch (707:6): [True: 99.8k, False: 106k] ------------------ 708| 99.8k| fd = channel->errfd; 709| 106k| } else { 710| 106k| fd = channel->readfd; 711| 106k| } 712| 206k| TRACE(("enter send_msg_channel_data isextended %d fd %d", isextended, fd)) 713| 206k| dropbear_assert(fd >= 0); ------------------ | | 83| 206k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 206k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 714| | 715| 206k| maxlen = MIN(channel->transwindow, channel->transmaxpacket); 716| | /* -(1+4+4) is SSH_MSG_CHANNEL_DATA, channel number, string length, and 717| | * exttype if is extended */ 718| 206k| maxlen = MIN(maxlen, 719| 206k| ses.writepayload->size - 1 - 4 - 4 - (isextended ? 4 : 0)); 720| 206k| TRACE(("maxlen %zd", maxlen)) 721| 206k| if (maxlen == 0) { ------------------ | Branch (721:6): [True: 1.50k, False: 205k] ------------------ 722| 1.50k| TRACE(("leave send_msg_channel_data: no window")) 723| 1.50k| return; 724| 1.50k| } 725| | 726| 205k| buf_putbyte(ses.writepayload, 727| 205k| isextended ? SSH_MSG_CHANNEL_EXTENDED_DATA : SSH_MSG_CHANNEL_DATA); ------------------ | | 71| 99.1k|#define SSH_MSG_CHANNEL_EXTENDED_DATA 95 ------------------ isextended ? SSH_MSG_CHANNEL_EXTENDED_DATA : SSH_MSG_CHANNEL_DATA); ------------------ | | 70| 311k|#define SSH_MSG_CHANNEL_DATA 94 ------------------ | Branch (727:4): [True: 99.1k, False: 106k] ------------------ 728| 205k| buf_putint(ses.writepayload, channel->remotechan); 729| 205k| if (isextended) { ------------------ | Branch (729:6): [True: 99.1k, False: 106k] ------------------ 730| 99.1k| buf_putint(ses.writepayload, SSH_EXTENDED_DATA_STDERR); ------------------ | | 79| 99.1k|#define SSH_EXTENDED_DATA_STDERR 1 ------------------ 731| 99.1k| } 732| | /* a dummy size first ...*/ 733| 205k| size_pos = ses.writepayload->pos; 734| 205k| buf_putint(ses.writepayload, 0); 735| | 736| | /* read the data */ 737| 205k| len = read(fd, buf_getwriteptr(ses.writepayload, maxlen), maxlen); ------------------ | | 55| 205k|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ 738| | 739| 205k| if (len <= 0) { ------------------ | Branch (739:6): [True: 626, False: 204k] ------------------ 740| 626| if (len == 0 || errno != EINTR) { ------------------ | Branch (740:7): [True: 0, False: 626] | Branch (740:19): [True: 297, False: 329] ------------------ 741| | /* This will also get hit in the case of EAGAIN. The only 742| | time we expect to receive EAGAIN is when we're flushing a FD, 743| | in which case it can be treated the same as EOF */ 744| 297| close_chan_fd(channel, fd, SHUT_RD); 745| 297| } 746| 626| buf_setpos(ses.writepayload, 0); 747| 626| buf_setlen(ses.writepayload, 0); 748| 626| TRACE(("leave send_msg_channel_data: len %d read err %d or EOF for fd %d", 749| 626| len, errno, fd)) 750| 626| return; 751| 626| } 752| | 753| 204k| if (channel->read_mangler) { ------------------ | Branch (753:6): [True: 0, False: 204k] ------------------ 754| 0| channel->read_mangler(channel, buf_getwriteptr(ses.writepayload, len), &len); 755| 0| if (len == 0) { ------------------ | Branch (755:7): [True: 0, False: 0] ------------------ 756| 0| buf_setpos(ses.writepayload, 0); 757| 0| buf_setlen(ses.writepayload, 0); 758| 0| return; 759| 0| } 760| 0| } 761| | 762| 204k| TRACE(("send_msg_channel_data: len %d fd %d", len, fd)) 763| 204k| buf_incrwritepos(ses.writepayload, len); 764| | /* ... real size here */ 765| 204k| buf_setpos(ses.writepayload, size_pos); 766| 204k| buf_putint(ses.writepayload, len); 767| | 768| 204k| channel->transwindow -= len; 769| | 770| 204k| encrypt_packet(); 771| 204k| TRACE(("leave send_msg_channel_data")) 772| 204k|} common-channel.c:newchannel: 108| 4.11k| unsigned int transwindow, unsigned int transmaxpacket) { 109| | 110| 4.11k| struct Channel * newchan; 111| 4.11k| unsigned int i, j; 112| | 113| 4.11k| TRACE(("enter newchannel")) 114| | 115| | /* first see if we can use existing channels */ 116| 56.8k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (116:14): [True: 55.8k, False: 985] ------------------ 117| 55.8k| if (ses.channels[i] == NULL) { ------------------ | Branch (117:7): [True: 3.12k, False: 52.7k] ------------------ 118| 3.12k| break; 119| 3.12k| } 120| 55.8k| } 121| | 122| | /* otherwise extend the list */ 123| 4.11k| if (i == ses.chansize) { ------------------ | Branch (123:6): [True: 985, False: 3.12k] ------------------ 124| 985| if (ses.chansize >= MAX_CHANNELS) { ------------------ | | 225| 985|#define MAX_CHANNELS 1000 /* simple mem restriction, includes each tcp/x11 ------------------ | Branch (124:7): [True: 0, False: 985] ------------------ 125| 0| TRACE(("leave newchannel: max chans reached")) 126| 0| return NULL; 127| 0| } 128| | 129| | /* extend the channels */ 130| 985| ses.channels = (struct Channel**)m_realloc(ses.channels, 131| 985| (ses.chansize+CHAN_EXTEND_SIZE)*sizeof(struct Channel*)); ------------------ | | 41| 985|#define CHAN_EXTEND_SIZE 3 /* how many extra slots to add when we need more */ ------------------ 132| | 133| 985| ses.chansize += CHAN_EXTEND_SIZE; ------------------ | | 41| 985|#define CHAN_EXTEND_SIZE 3 /* how many extra slots to add when we need more */ ------------------ 134| | 135| | /* set the new channels to null */ 136| 3.94k| for (j = i; j < ses.chansize; j++) { ------------------ | Branch (136:15): [True: 2.95k, False: 985] ------------------ 137| 2.95k| ses.channels[j] = NULL; 138| 2.95k| } 139| | 140| 985| } 141| | 142| 4.11k| newchan = (struct Channel*)m_malloc(sizeof(struct Channel)); 143| 4.11k| newchan->type = type; 144| 4.11k| newchan->index = i; 145| 4.11k| newchan->sent_close = newchan->recv_close = 0; 146| 4.11k| newchan->sent_eof = newchan->recv_eof = 0; 147| | 148| 4.11k| newchan->remotechan = remotechan; 149| 4.11k| newchan->transwindow = transwindow; 150| 4.11k| newchan->transmaxpacket = transmaxpacket; 151| | 152| 4.11k| newchan->typedata = NULL; 153| 4.11k| newchan->writefd = FD_UNINIT; ------------------ | | 56| 4.11k|#define FD_UNINIT (-2) ------------------ 154| 4.11k| newchan->readfd = FD_UNINIT; ------------------ | | 56| 4.11k|#define FD_UNINIT (-2) ------------------ 155| 4.11k| newchan->errfd = FD_CLOSED; /* this isn't always set to start with */ ------------------ | | 57| 4.11k|#define FD_CLOSED (-1) ------------------ 156| 4.11k| newchan->await_open = 0; 157| | 158| 4.11k| newchan->writebuf = cbuf_new(opts.recv_window); 159| 4.11k| newchan->recvwindow = opts.recv_window; 160| | 161| 4.11k| newchan->extrabuf = NULL; /* The user code can set it up */ 162| 4.11k| newchan->recvdonelen = 0; 163| 4.11k| newchan->recvmaxpacket = RECV_MAX_CHANNEL_DATA_LEN; ------------------ | | 67| 4.11k|#define RECV_MAX_CHANNEL_DATA_LEN (RECV_MAX_PAYLOAD_LEN-(1+4+4)) | | ------------------ | | | | 492| 4.11k|#define RECV_MAX_PAYLOAD_LEN 32768 | | ------------------ ------------------ 164| | 165| 4.11k| newchan->prio = DROPBEAR_PRIO_NORMAL; 166| | 167| 4.11k| ses.channels[i] = newchan; 168| 4.11k| ses.chancount++; 169| | 170| 4.11k| TRACE(("leave newchannel")) 171| | 172| 4.11k| return newchan; 173| 4.11k|} common-channel.c:send_msg_channel_open_failure: 1013| 1.21k| int reason, const char *text, const char *lang) { 1014| | 1015| 1.21k| TRACE(("enter send_msg_channel_open_failure")) 1016| 1.21k| CHECKCLEARTOWRITE(); 1017| | 1018| 1.21k| buf_putbyte(ses.writepayload, SSH_MSG_CHANNEL_OPEN_FAILURE); ------------------ | | 68| 1.21k|#define SSH_MSG_CHANNEL_OPEN_FAILURE 92 ------------------ 1019| 1.21k| buf_putint(ses.writepayload, remotechan); 1020| 1.21k| buf_putint(ses.writepayload, reason); 1021| 1.21k| buf_putstring(ses.writepayload, text, strlen(text)); 1022| 1.21k| buf_putstring(ses.writepayload, lang, strlen(lang)); 1023| | 1024| 1.21k| encrypt_packet(); 1025| 1.21k| TRACE(("leave send_msg_channel_open_failure")) 1026| 1.21k|} common-channel.c:send_msg_channel_open_confirmation: 1032| 3.78k| unsigned int recvmaxpacket) { 1033| | 1034| 3.78k| TRACE(("enter send_msg_channel_open_confirmation")) 1035| 3.78k| CHECKCLEARTOWRITE(); 1036| | 1037| 3.78k| buf_putbyte(ses.writepayload, SSH_MSG_CHANNEL_OPEN_CONFIRMATION); ------------------ | | 67| 3.78k|#define SSH_MSG_CHANNEL_OPEN_CONFIRMATION 91 ------------------ 1038| 3.78k| buf_putint(ses.writepayload, channel->remotechan); 1039| 3.78k| buf_putint(ses.writepayload, channel->index); 1040| 3.78k| buf_putint(ses.writepayload, recvwindow); 1041| 3.78k| buf_putint(ses.writepayload, recvmaxpacket); 1042| | 1043| 3.78k| encrypt_packet(); 1044| 3.78k| TRACE(("leave send_msg_channel_open_confirmation")) 1045| 3.78k|} send_msg_kexinit: 55| 9.65k|void send_msg_kexinit() { 56| | 57| 9.65k| CHECKCLEARTOWRITE(); 58| 9.65k| buf_putbyte(ses.writepayload, SSH_MSG_KEXINIT); ------------------ | | 36| 9.65k|#define SSH_MSG_KEXINIT 20 ------------------ 59| | 60| | /* cookie */ 61| 9.65k| genrandom(buf_getwriteptr(ses.writepayload, 16), 16); 62| 9.65k| buf_incrwritepos(ses.writepayload, 16); 63| | 64| | /* kex algos */ 65| 9.65k| buf_put_algolist(ses.writepayload, sshkex); 66| | 67| | /* server_host_key_algorithms */ 68| 9.65k| buf_put_algolist(ses.writepayload, sigalgs); 69| | 70| | /* encryption_algorithms_client_to_server */ 71| 9.65k| buf_put_algolist(ses.writepayload, sshciphers); 72| | 73| | /* encryption_algorithms_server_to_client */ 74| 9.65k| buf_put_algolist(ses.writepayload, sshciphers); 75| | 76| | /* mac_algorithms_client_to_server */ 77| 9.65k| buf_put_algolist(ses.writepayload, sshhashes); 78| | 79| | /* mac_algorithms_server_to_client */ 80| 9.65k| buf_put_algolist(ses.writepayload, sshhashes); 81| | 82| | 83| | /* compression_algorithms_client_to_server */ 84| 9.65k| buf_put_algolist(ses.writepayload, ses.compress_algos); 85| | 86| | /* compression_algorithms_server_to_client */ 87| 9.65k| buf_put_algolist(ses.writepayload, ses.compress_algos); 88| | 89| | /* languages_client_to_server */ 90| 9.65k| buf_putstring(ses.writepayload, "", 0); 91| | 92| | /* languages_server_to_client */ 93| 9.65k| buf_putstring(ses.writepayload, "", 0); 94| | 95| | /* first_kex_packet_follows */ 96| 9.65k| buf_putbyte(ses.writepayload, (ses.send_kex_first_guess != NULL)); 97| | 98| | /* reserved unit32 */ 99| 9.65k| buf_putint(ses.writepayload, 0); 100| | 101| | /* set up transmitted kex packet buffer for hashing. 102| | * This is freed after the end of the kex */ 103| 9.65k| ses.transkexinit = buf_newcopy(ses.writepayload); 104| | 105| 9.65k| encrypt_packet(); 106| 9.65k| ses.dataallowed = 0; /* don't send other packets during kex */ 107| | 108| 9.65k| ses.kexstate.sentkexinit = 1; 109| | 110| 9.65k| ses.newkeys = (struct key_context*)m_malloc(sizeof(struct key_context)); 111| | 112| 9.65k| if (ses.send_kex_first_guess) { ------------------ | Branch (112:6): [True: 0, False: 9.65k] ------------------ 113| 0| ses.newkeys->algo_kex = first_usable_algo(sshkex)->data; 114| 0| ses.newkeys->algo_signature = first_usable_algo(sigalgs)->val; 115| 0| ses.newkeys->algo_hostkey = signkey_type_from_signature(ses.newkeys->algo_signature); 116| 0| ses.send_kex_first_guess(); 117| 0| } 118| | 119| 9.65k| TRACE(("DATAALLOWED=0")) 120| 9.65k| TRACE(("-> KEXINIT")) 121| | 122| 9.65k|} send_msg_newkeys: 166| 9.27k|void send_msg_newkeys() { 167| | 168| 9.27k| TRACE(("enter send_msg_newkeys")) 169| | 170| | /* generate the kexinit request */ 171| 9.27k| CHECKCLEARTOWRITE(); 172| 9.27k| buf_putbyte(ses.writepayload, SSH_MSG_NEWKEYS); ------------------ | | 37| 9.27k|#define SSH_MSG_NEWKEYS 21 ------------------ 173| 9.27k| encrypt_packet(); 174| | 175| | 176| | /* set up our state */ 177| 9.27k| ses.kexstate.sentnewkeys = 1; 178| 9.27k| if (ses.kexstate.donefirstkex) { ------------------ | Branch (178:6): [True: 7.96k, False: 1.31k] ------------------ 179| 7.96k| ses.kexstate.donesecondkex = 1; 180| 7.96k| } 181| 9.27k| ses.kexstate.donefirstkex = 1; 182| 9.27k| ses.dataallowed = 1; /* we can send other packets again now */ 183| 9.27k| gen_new_keys(); 184| 9.27k| switch_keys(); 185| | 186| 9.27k| TRACE(("leave send_msg_newkeys")) 187| 9.27k|} recv_msg_newkeys: 190| 9.07k|void recv_msg_newkeys() { 191| | 192| 9.07k| TRACE(("enter recv_msg_newkeys")) 193| | 194| 9.07k| ses.kexstate.recvnewkeys = 1; 195| 9.07k| switch_keys(); 196| | 197| 9.07k| TRACE(("leave recv_msg_newkeys")) 198| 9.07k|} kexfirstinitialise: 202| 1.49k|void kexfirstinitialise() { 203| 1.49k|#ifdef DISABLE_ZLIB 204| 1.49k| ses.compress_algos = ssh_nocompress; 205| |#else 206| | switch (opts.compress_mode) 207| | { 208| | case DROPBEAR_COMPRESS_DELAYED: 209| | ses.compress_algos = ssh_delaycompress; 210| | break; 211| | 212| | case DROPBEAR_COMPRESS_ON: 213| | ses.compress_algos = ssh_compress; 214| | break; 215| | 216| | case DROPBEAR_COMPRESS_OFF: 217| | ses.compress_algos = ssh_nocompress; 218| | break; 219| | } 220| |#endif 221| 1.49k| kexinitialise(); 222| 1.49k|} recv_msg_kexinit: 474| 9.58k|void recv_msg_kexinit() { 475| | 476| 9.58k| unsigned int kexhashbuf_len = 0; 477| 9.58k| unsigned int remote_ident_len = 0; 478| 9.58k| unsigned int local_ident_len = 0; 479| | 480| 9.58k| TRACE(("<- KEXINIT")) 481| 9.58k| TRACE(("enter recv_msg_kexinit")) 482| | 483| 9.58k| if (!ses.kexstate.sentkexinit) { ------------------ | Branch (483:6): [True: 8.16k, False: 1.42k] ------------------ 484| | /* we need to send a kex packet */ 485| 8.16k| send_msg_kexinit(); 486| 8.16k| TRACE(("continue recv_msg_kexinit: sent kexinit")) 487| 8.16k| } 488| | 489| | /* "Once a party has sent a SSH_MSG_KEXINIT message ... 490| | further SSH_MSG_KEXINIT messages MUST NOT be sent" */ 491| 9.58k| if (ses.kexstate.recvkexinit) { ------------------ | Branch (491:6): [True: 0, False: 9.58k] ------------------ 492| 0| dropbear_exit("Unexpected KEXINIT"); 493| 0| } 494| | 495| | /* start the kex hash */ 496| 9.58k| local_ident_len = strlen(LOCAL_IDENT); ------------------ | | 10| 9.58k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION | | ------------------ | | | | 7| 9.58k|#define DROPBEAR_VERSION "2022.83" | | ------------------ ------------------ 497| 9.58k| remote_ident_len = strlen(ses.remoteident); 498| | 499| 9.58k| kexhashbuf_len = local_ident_len + remote_ident_len 500| 9.58k| + ses.transkexinit->len + ses.payload->len 501| 9.58k| + KEXHASHBUF_MAX_INTS; ------------------ | | 240| 9.58k|#define KEXHASHBUF_MAX_INTS (1700 + 130 + 130 + 130) ------------------ 502| | 503| 9.58k| ses.kexhashbuf = buf_new(kexhashbuf_len); 504| | 505| 9.58k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 320| 9.58k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 9.58k] | | ------------------ ------------------ 506| | 507| | /* read the peer's choice of algos */ 508| 0| read_kex_algos(); 509| | 510| | /* V_C, the client's version string (CR and NL excluded) */ 511| 0| buf_putstring(ses.kexhashbuf, LOCAL_IDENT, local_ident_len); ------------------ | | 10| 0|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION | | ------------------ | | | | 7| 0|#define DROPBEAR_VERSION "2022.83" | | ------------------ ------------------ 512| | /* V_S, the server's version string (CR and NL excluded) */ 513| 0| buf_putstring(ses.kexhashbuf, ses.remoteident, remote_ident_len); 514| | 515| | /* I_C, the payload of the client's SSH_MSG_KEXINIT */ 516| 0| buf_putstring(ses.kexhashbuf, 517| 0| (const char*)ses.transkexinit->data, ses.transkexinit->len); 518| | /* I_S, the payload of the server's SSH_MSG_KEXINIT */ 519| 0| buf_setpos(ses.payload, ses.payload_beginning); 520| 0| buf_putstring(ses.kexhashbuf, 521| 0| (const char*)buf_getptr(ses.payload, ses.payload->len-ses.payload->pos), 522| 0| ses.payload->len-ses.payload->pos); 523| 0| ses.requirenext = SSH_MSG_KEXDH_REPLY; ------------------ | | 39| 0|#define SSH_MSG_KEXDH_REPLY 31 ------------------ 524| 9.58k| } else { 525| | /* SERVER */ 526| | 527| | /* read the peer's choice of algos */ 528| 9.58k| read_kex_algos(); 529| | /* V_C, the client's version string (CR and NL excluded) */ 530| 9.58k| buf_putstring(ses.kexhashbuf, ses.remoteident, remote_ident_len); 531| | /* V_S, the server's version string (CR and NL excluded) */ 532| 9.58k| buf_putstring(ses.kexhashbuf, LOCAL_IDENT, local_ident_len); ------------------ | | 10| 9.58k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION | | ------------------ | | | | 7| 9.58k|#define DROPBEAR_VERSION "2022.83" | | ------------------ ------------------ 533| | 534| | /* I_C, the payload of the client's SSH_MSG_KEXINIT */ 535| 9.58k| buf_setpos(ses.payload, ses.payload_beginning); 536| 9.58k| buf_putstring(ses.kexhashbuf, 537| 9.58k| (const char*)buf_getptr(ses.payload, ses.payload->len-ses.payload->pos), 538| 9.58k| ses.payload->len-ses.payload->pos); 539| | 540| | /* I_S, the payload of the server's SSH_MSG_KEXINIT */ 541| 9.58k| buf_putstring(ses.kexhashbuf, 542| 9.58k| (const char*)ses.transkexinit->data, ses.transkexinit->len); 543| | 544| 9.58k| ses.requirenext = SSH_MSG_KEXDH_INIT; ------------------ | | 38| 9.58k|#define SSH_MSG_KEXDH_INIT 30 ------------------ 545| 9.58k| } 546| | 547| 9.58k| buf_free(ses.transkexinit); 548| 9.58k| ses.transkexinit = NULL; 549| | /* the rest of ses.kexhashbuf will be done after DH exchange */ 550| | 551| 9.58k| ses.kexstate.recvkexinit = 1; 552| | 553| 9.58k| TRACE(("leave recv_msg_kexinit")) 554| 9.58k|} finish_kexhashbuf: 786| 9.27k|void finish_kexhashbuf(void) { 787| 9.27k| hash_state hs; 788| 9.27k| const struct ltc_hash_descriptor *hash_desc = ses.newkeys->algo_kex->hash_desc; 789| | 790| 9.27k| hash_desc->init(&hs); 791| 9.27k| buf_setpos(ses.kexhashbuf, 0); 792| 9.27k| hash_desc->process(&hs, buf_getptr(ses.kexhashbuf, ses.kexhashbuf->len), 793| 9.27k| ses.kexhashbuf->len); 794| 9.27k| ses.hash = buf_new(hash_desc->hashsize); 795| 9.27k| hash_desc->done(&hs, buf_getwriteptr(ses.hash, hash_desc->hashsize)); 796| 9.27k| buf_setlen(ses.hash, hash_desc->hashsize); 797| | 798| |#if defined(DEBUG_KEXHASH) && DEBUG_TRACE 799| | if (!debug_trace) { 800| | printhex("kexhashbuf", ses.kexhashbuf->data, ses.kexhashbuf->len); 801| | printhex("kexhash", ses.hash->data, ses.hash->len); 802| | } 803| |#endif 804| | 805| 9.27k| buf_burn_free(ses.kexhashbuf); 806| 9.27k| m_burn(&hs, sizeof(hash_state)); 807| 9.27k| ses.kexhashbuf = NULL; 808| | 809| | /* first time around, we set the session_id to H */ 810| 9.27k| if (ses.session_id == NULL) { ------------------ | Branch (810:6): [True: 1.31k, False: 7.96k] ------------------ 811| | /* create the session_id, this never needs freeing */ 812| 1.31k| ses.session_id = buf_newcopy(ses.hash); 813| 1.31k| } 814| 9.27k|} common-kex.c:switch_keys: 124| 18.3k|static void switch_keys() { 125| 18.3k| TRACE2(("enter switch_keys")) 126| 18.3k| if (!(ses.kexstate.sentkexinit && ses.kexstate.recvkexinit)) { ------------------ | Branch (126:8): [True: 18.3k, False: 8] | Branch (126:36): [True: 18.3k, False: 0] ------------------ 127| 8| dropbear_exit("Unexpected newkeys message"); 128| 8| } 129| | 130| 18.3k| if (!ses.keys) { ------------------ | Branch (130:6): [True: 0, False: 18.3k] ------------------ 131| 0| ses.keys = m_malloc(sizeof(*ses.newkeys)); 132| 0| } 133| 18.3k| if (ses.kexstate.recvnewkeys && ses.newkeys->recv.valid) { ------------------ | Branch (133:6): [True: 9.06k, False: 9.27k] | Branch (133:34): [True: 9.06k, False: 0] ------------------ 134| 9.06k| TRACE(("switch_keys recv")) 135| |#ifndef DISABLE_ZLIB 136| | gen_new_zstream_recv(); 137| |#endif 138| 9.06k| ses.keys->recv = ses.newkeys->recv; 139| 9.06k| m_burn(&ses.newkeys->recv, sizeof(ses.newkeys->recv)); 140| 9.06k| ses.newkeys->recv.valid = 0; 141| 9.06k| } 142| 18.3k| if (ses.kexstate.sentnewkeys && ses.newkeys->trans.valid) { ------------------ | Branch (142:6): [True: 18.3k, False: 0] | Branch (142:34): [True: 9.27k, False: 9.06k] ------------------ 143| 9.27k| TRACE(("switch_keys trans")) 144| |#ifndef DISABLE_ZLIB 145| | gen_new_zstream_trans(); 146| |#endif 147| 9.27k| ses.keys->trans = ses.newkeys->trans; 148| 9.27k| m_burn(&ses.newkeys->trans, sizeof(ses.newkeys->trans)); 149| 9.27k| ses.newkeys->trans.valid = 0; 150| 9.27k| } 151| 18.3k| if (ses.kexstate.sentnewkeys && ses.kexstate.recvnewkeys) ------------------ | Branch (151:6): [True: 18.3k, False: 0] | Branch (151:34): [True: 9.06k, False: 9.27k] ------------------ 152| 9.06k| { 153| 9.06k| TRACE(("switch_keys done")) 154| 9.06k| ses.keys->algo_kex = ses.newkeys->algo_kex; 155| 9.06k| ses.keys->algo_hostkey = ses.newkeys->algo_hostkey; 156| 9.06k| ses.keys->algo_signature = ses.newkeys->algo_signature; 157| 9.06k| ses.keys->allow_compress = 0; 158| 9.06k| m_free(ses.newkeys); ------------------ | | 24| 9.06k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 159| 9.06k| ses.newkeys = NULL; 160| 9.06k| kexinitialise(); 161| 9.06k| } 162| 18.3k| TRACE2(("leave switch_keys")) 163| 18.3k|} common-kex.c:kexinitialise: 225| 10.5k|static void kexinitialise() { 226| | 227| 10.5k| TRACE(("kexinitialise()")) 228| | 229| | /* sent/recv'd MSG_KEXINIT */ 230| 10.5k| ses.kexstate.sentkexinit = 0; 231| 10.5k| ses.kexstate.recvkexinit = 0; 232| | 233| | /* sent/recv'd MSG_NEWKEYS */ 234| 10.5k| ses.kexstate.recvnewkeys = 0; 235| 10.5k| ses.kexstate.sentnewkeys = 0; 236| | 237| | /* first_packet_follows */ 238| 10.5k| ses.kexstate.them_firstfollows = 0; 239| | 240| 10.5k| ses.kexstate.datatrans = 0; 241| 10.5k| ses.kexstate.datarecv = 0; 242| | 243| 10.5k| ses.kexstate.our_first_follows_matches = 0; 244| | 245| 10.5k| ses.kexstate.lastkextime = monotonic_now(); 246| | 247| 10.5k|} common-kex.c:gen_new_keys: 288| 9.27k|static void gen_new_keys() { 289| | 290| 9.27k| unsigned char C2S_IV[MAX_IV_LEN]; 291| 9.27k| unsigned char C2S_key[MAX_KEY_LEN]; 292| 9.27k| unsigned char S2C_IV[MAX_IV_LEN]; 293| 9.27k| unsigned char S2C_key[MAX_KEY_LEN]; 294| | /* unsigned char key[MAX_KEY_LEN]; */ 295| 9.27k| unsigned char *trans_IV, *trans_key, *recv_IV, *recv_key; 296| | 297| 9.27k| hash_state hs; 298| 9.27k| const struct ltc_hash_descriptor *hash_desc = ses.newkeys->algo_kex->hash_desc; 299| 9.27k| char mactransletter, macrecvletter; /* Client or server specific */ 300| | 301| 9.27k| TRACE(("enter gen_new_keys")) 302| | /* the dh_K and hash are the start of all hashes, we make use of that */ 303| | 304| 9.27k| hash_desc->init(&hs); 305| 9.27k| hash_process_mp(hash_desc, &hs, ses.dh_K); 306| 9.27k| mp_clear(ses.dh_K); 307| 9.27k| m_free(ses.dh_K); ------------------ | | 24| 9.27k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 308| 9.27k| hash_desc->process(&hs, ses.hash->data, ses.hash->len); 309| 9.27k| buf_burn_free(ses.hash); 310| 9.27k| ses.hash = NULL; 311| | 312| 9.27k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 320| 9.27k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 9.27k] | | ------------------ ------------------ 313| 0| trans_IV = C2S_IV; 314| 0| recv_IV = S2C_IV; 315| 0| trans_key = C2S_key; 316| 0| recv_key = S2C_key; 317| 0| mactransletter = 'E'; 318| 0| macrecvletter = 'F'; 319| 9.27k| } else { 320| 9.27k| trans_IV = S2C_IV; 321| 9.27k| recv_IV = C2S_IV; 322| 9.27k| trans_key = S2C_key; 323| 9.27k| recv_key = C2S_key; 324| 9.27k| mactransletter = 'F'; 325| 9.27k| macrecvletter = 'E'; 326| 9.27k| } 327| | 328| 9.27k| hashkeys(C2S_IV, sizeof(C2S_IV), &hs, 'A'); 329| 9.27k| hashkeys(S2C_IV, sizeof(S2C_IV), &hs, 'B'); 330| 9.27k| hashkeys(C2S_key, sizeof(C2S_key), &hs, 'C'); 331| 9.27k| hashkeys(S2C_key, sizeof(S2C_key), &hs, 'D'); 332| | 333| 9.27k| if (ses.newkeys->recv.algo_crypt->cipherdesc != NULL) { ------------------ | Branch (333:6): [True: 9.27k, False: 0] ------------------ 334| 9.27k| int recv_cipher = -1; 335| 9.27k| if (ses.newkeys->recv.algo_crypt->cipherdesc->name != NULL) { ------------------ | Branch (335:7): [True: 3.16k, False: 6.11k] ------------------ 336| 3.16k| recv_cipher = find_cipher(ses.newkeys->recv.algo_crypt->cipherdesc->name); 337| 3.16k| if (recv_cipher < 0) { ------------------ | Branch (337:8): [True: 0, False: 3.16k] ------------------ 338| 0| dropbear_exit("Crypto error"); 339| 0| } 340| 3.16k| } 341| 9.27k| if (ses.newkeys->recv.crypt_mode->start(recv_cipher, ------------------ | Branch (341:7): [True: 0, False: 9.27k] ------------------ 342| 9.27k| recv_IV, recv_key, 343| 9.27k| ses.newkeys->recv.algo_crypt->keysize, 0, 344| 9.27k| &ses.newkeys->recv.cipher_state) != CRYPT_OK) { 345| 0| dropbear_exit("Crypto error"); 346| 0| } 347| 9.27k| } 348| | 349| 9.27k| if (ses.newkeys->trans.algo_crypt->cipherdesc != NULL) { ------------------ | Branch (349:6): [True: 9.27k, False: 0] ------------------ 350| 9.27k| int trans_cipher = -1; 351| 9.27k| if (ses.newkeys->trans.algo_crypt->cipherdesc->name != NULL) { ------------------ | Branch (351:7): [True: 3.55k, False: 5.72k] ------------------ 352| 3.55k| trans_cipher = find_cipher(ses.newkeys->trans.algo_crypt->cipherdesc->name); 353| 3.55k| if (trans_cipher < 0) { ------------------ | Branch (353:8): [True: 0, False: 3.55k] ------------------ 354| 0| dropbear_exit("Crypto error"); 355| 0| } 356| 3.55k| } 357| 9.27k| if (ses.newkeys->trans.crypt_mode->start(trans_cipher, ------------------ | Branch (357:7): [True: 0, False: 9.27k] ------------------ 358| 9.27k| trans_IV, trans_key, 359| 9.27k| ses.newkeys->trans.algo_crypt->keysize, 0, 360| 9.27k| &ses.newkeys->trans.cipher_state) != CRYPT_OK) { 361| 0| dropbear_exit("Crypto error"); 362| 0| } 363| 9.27k| } 364| | 365| 9.27k| if (ses.newkeys->trans.algo_mac->hash_desc != NULL) { ------------------ | Branch (365:6): [True: 3.55k, False: 5.72k] ------------------ 366| 3.55k| hashkeys(ses.newkeys->trans.mackey, 367| 3.55k| ses.newkeys->trans.algo_mac->keysize, &hs, mactransletter); 368| 3.55k| ses.newkeys->trans.hash_index = find_hash(ses.newkeys->trans.algo_mac->hash_desc->name); 369| 3.55k| } 370| | 371| 9.27k| if (ses.newkeys->recv.algo_mac->hash_desc != NULL) { ------------------ | Branch (371:6): [True: 0, False: 9.27k] ------------------ 372| 0| hashkeys(ses.newkeys->recv.mackey, 373| 0| ses.newkeys->recv.algo_mac->keysize, &hs, macrecvletter); 374| 0| ses.newkeys->recv.hash_index = find_hash(ses.newkeys->recv.algo_mac->hash_desc->name); 375| 0| } 376| | 377| | /* Ready to switch over */ 378| 9.27k| ses.newkeys->trans.valid = 1; 379| 9.27k| ses.newkeys->recv.valid = 1; 380| | 381| 9.27k| m_burn(C2S_IV, sizeof(C2S_IV)); 382| 9.27k| m_burn(C2S_key, sizeof(C2S_key)); 383| 9.27k| m_burn(S2C_IV, sizeof(S2C_IV)); 384| 9.27k| m_burn(S2C_key, sizeof(S2C_key)); 385| 9.27k| m_burn(&hs, sizeof(hash_state)); 386| | 387| 9.27k| TRACE(("leave gen_new_keys")) 388| 9.27k|} common-kex.c:hashkeys: 256| 40.6k| const hash_state * hs, const unsigned char X) { 257| | 258| 40.6k| const struct ltc_hash_descriptor *hash_desc = ses.newkeys->algo_kex->hash_desc; 259| 40.6k| hash_state hs2; 260| 40.6k| unsigned int offset; 261| 40.6k| unsigned char tmpout[MAX_HASH_SIZE]; 262| | 263| 40.6k| memcpy(&hs2, hs, sizeof(hash_state)); 264| 40.6k| hash_desc->process(&hs2, &X, 1); 265| 40.6k| hash_desc->process(&hs2, ses.session_id->data, ses.session_id->len); 266| 40.6k| hash_desc->done(&hs2, tmpout); 267| 40.6k| memcpy(out, tmpout, MIN(hash_desc->hashsize, outlen)); 268| 40.6k| for (offset = hash_desc->hashsize; 269| 69.6k| offset < outlen; ------------------ | Branch (269:4): [True: 28.9k, False: 40.6k] ------------------ 270| 40.6k| offset += hash_desc->hashsize) 271| 28.9k| { 272| | /* need to extend */ 273| 28.9k| memcpy(&hs2, hs, sizeof(hash_state)); 274| 28.9k| hash_desc->process(&hs2, out, offset); 275| 28.9k| hash_desc->done(&hs2, tmpout); 276| 28.9k| memcpy(&out[offset], tmpout, MIN(outlen - offset, hash_desc->hashsize)); 277| 28.9k| } 278| 40.6k| m_burn(&hs2, sizeof(hash_state)); 279| 40.6k|} common-kex.c:read_kex_algos: 818| 9.58k|static void read_kex_algos() { 819| | 820| | /* for asymmetry */ 821| 9.58k| algo_type * c2s_hash_algo = NULL; 822| 9.58k| algo_type * s2c_hash_algo = NULL; 823| 9.58k| algo_type * c2s_cipher_algo = NULL; 824| 9.58k| algo_type * s2c_cipher_algo = NULL; 825| 9.58k| algo_type * c2s_comp_algo = NULL; 826| 9.58k| algo_type * s2c_comp_algo = NULL; 827| | /* the generic one */ 828| 9.58k| algo_type * algo = NULL; 829| | 830| | /* which algo couldn't match */ 831| 9.58k| char * erralgo = NULL; 832| | 833| 9.58k| int goodguess = 0; 834| 9.58k| int allgood = 1; /* we AND this with each goodguess and see if its still 835| | true after */ 836| 9.58k| int kexguess2 = 0; 837| | 838| 9.58k| buf_incrpos(ses.payload, 16); /* start after the cookie */ 839| | 840| 9.58k| memset(ses.newkeys, 0x0, sizeof(*ses.newkeys)); 841| | 842| | /* kex_algorithms */ 843| 9.58k|#if DROPBEAR_KEXGUESS2 844| 9.58k| if (buf_has_algo(ses.payload, KEXGUESS2_ALGO_NAME) == DROPBEAR_SUCCESS) { ------------------ | | 128| 9.58k|#define KEXGUESS2_ALGO_NAME "kexguess2@matt.ucc.asn.au" ------------------ if (buf_has_algo(ses.payload, KEXGUESS2_ALGO_NAME) == DROPBEAR_SUCCESS) { ------------------ | | 102| 9.58k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (844:6): [True: 121, False: 9.46k] ------------------ 845| 121| kexguess2 = 1; 846| 121| } 847| 9.58k|#endif 848| | 849| 9.58k|#if DROPBEAR_EXT_INFO 850| | /* Determine if SSH_MSG_EXT_INFO messages should be sent. 851| | Should be done for the first key exchange. Only required on server side 852| | for server-sig-algs */ 853| 9.58k| if (IS_DROPBEAR_SERVER) { ------------------ | | 319| 9.58k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 9.58k, False: 8] | | ------------------ ------------------ 854| 9.58k| if (!ses.kexstate.donefirstkex) { ------------------ | Branch (854:7): [True: 1.42k, False: 8.15k] ------------------ 855| 1.42k| if (buf_has_algo(ses.payload, SSH_EXT_INFO_C) == DROPBEAR_SUCCESS) { ------------------ | | 100| 1.42k|#define SSH_EXT_INFO_C "ext-info-c" ------------------ if (buf_has_algo(ses.payload, SSH_EXT_INFO_C) == DROPBEAR_SUCCESS) { ------------------ | | 102| 1.42k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (855:8): [True: 8, False: 1.41k] ------------------ 856| 8| ses.allow_ext_info = 1; 857| 8| } 858| 1.42k| } 859| 9.58k| } 860| 9.58k|#endif 861| | 862| 9.58k| algo = buf_match_algo(ses.payload, sshkex, kexguess2, &goodguess); 863| 9.58k| allgood &= goodguess; 864| 9.58k| if (algo == NULL || algo->data == NULL) { ------------------ | Branch (864:6): [True: 38, False: 9.55k] | Branch (864:22): [True: 5, False: 9.54k] ------------------ 865| | /* kexguess2, ext-info-c, ext-info-s should not match negotiation */ 866| 35| erralgo = "kex"; 867| 35| goto error; 868| 35| } 869| 9.55k| TRACE(("kexguess2 %d", kexguess2)) 870| 9.55k| DEBUG3(("kex algo %s", algo->name)) 871| 9.55k| ses.newkeys->algo_kex = algo->data; 872| | 873| | /* server_host_key_algorithms */ 874| 9.55k| algo = buf_match_algo(ses.payload, sigalgs, kexguess2, &goodguess); 875| 9.55k| allgood &= goodguess; 876| 9.55k| if (algo == NULL) { ------------------ | Branch (876:6): [True: 3, False: 9.55k] ------------------ 877| 3| erralgo = "hostkey"; 878| 3| goto error; 879| 3| } 880| 9.55k| DEBUG2(("hostkey algo %s", algo->name)) 881| 9.55k| ses.newkeys->algo_signature = algo->val; 882| 9.55k| ses.newkeys->algo_hostkey = signkey_type_from_signature(ses.newkeys->algo_signature); 883| | 884| | /* encryption_algorithms_client_to_server */ 885| 9.55k| c2s_cipher_algo = buf_match_algo(ses.payload, sshciphers, 0, NULL); 886| 9.55k| if (c2s_cipher_algo == NULL) { ------------------ | Branch (886:6): [True: 14, False: 9.53k] ------------------ 887| 14| erralgo = "enc c->s"; 888| 14| goto error; 889| 14| } 890| 9.53k| DEBUG2(("enc c2s is %s", c2s_cipher_algo->name)) 891| | 892| | /* encryption_algorithms_server_to_client */ 893| 9.53k| s2c_cipher_algo = buf_match_algo(ses.payload, sshciphers, 0, NULL); 894| 9.53k| if (s2c_cipher_algo == NULL) { ------------------ | Branch (894:6): [True: 5, False: 9.53k] ------------------ 895| 5| erralgo = "enc s->c"; 896| 5| goto error; 897| 5| } 898| 9.53k| DEBUG2(("enc s2c is %s", s2c_cipher_algo->name)) 899| | 900| | /* mac_algorithms_client_to_server */ 901| 9.53k| c2s_hash_algo = buf_match_algo(ses.payload, sshhashes, 0, NULL); 902| 9.53k|#if DROPBEAR_AEAD_MODE 903| 9.53k| if (((struct dropbear_cipher_mode*)c2s_cipher_algo->mode)->aead_crypt != NULL) { ------------------ | Branch (903:6): [True: 6.18k, False: 3.34k] ------------------ 904| 6.18k| c2s_hash_algo = NULL; 905| 6.18k| } else 906| 3.34k|#endif 907| 3.34k| if (c2s_hash_algo == NULL) { ------------------ | Branch (907:6): [True: 6, False: 3.34k] ------------------ 908| 6| erralgo = "mac c->s"; 909| 6| goto error; 910| 6| } 911| 9.52k| DEBUG2(("hmac c2s is %s", c2s_hash_algo ? c2s_hash_algo->name : "")) 912| | 913| | /* mac_algorithms_server_to_client */ 914| 9.52k| s2c_hash_algo = buf_match_algo(ses.payload, sshhashes, 0, NULL); 915| 9.52k|#if DROPBEAR_AEAD_MODE 916| 9.52k| if (((struct dropbear_cipher_mode*)s2c_cipher_algo->mode)->aead_crypt != NULL) { ------------------ | Branch (916:6): [True: 5.77k, False: 3.75k] ------------------ 917| 5.77k| s2c_hash_algo = NULL; 918| 5.77k| } else 919| 3.75k|#endif 920| 3.75k| if (s2c_hash_algo == NULL) { ------------------ | Branch (920:6): [True: 4, False: 3.74k] ------------------ 921| 4| erralgo = "mac s->c"; 922| 4| goto error; 923| 4| } 924| 9.52k| DEBUG2(("hmac s2c is %s", s2c_hash_algo ? s2c_hash_algo->name : "")) 925| | 926| | /* compression_algorithms_client_to_server */ 927| 9.52k| c2s_comp_algo = buf_match_algo(ses.payload, ses.compress_algos, 0, NULL); 928| 9.52k| if (c2s_comp_algo == NULL) { ------------------ | Branch (928:6): [True: 2, False: 9.52k] ------------------ 929| 2| erralgo = "comp c->s"; 930| 2| goto error; 931| 2| } 932| 9.52k| DEBUG2(("comp c2s is %s", c2s_comp_algo->name)) 933| | 934| | /* compression_algorithms_server_to_client */ 935| 9.52k| s2c_comp_algo = buf_match_algo(ses.payload, ses.compress_algos, 0, NULL); 936| 9.52k| if (s2c_comp_algo == NULL) { ------------------ | Branch (936:6): [True: 5, False: 9.51k] ------------------ 937| 5| erralgo = "comp s->c"; 938| 5| goto error; 939| 5| } 940| 9.51k| DEBUG2(("comp s2c is %s", s2c_comp_algo->name)) 941| | 942| | /* languages_client_to_server */ 943| 9.51k| buf_eatstring(ses.payload); 944| | 945| | /* languages_server_to_client */ 946| 9.51k| buf_eatstring(ses.payload); 947| | 948| | /* their first_kex_packet_follows */ 949| 9.51k| if (buf_getbool(ses.payload)) { ------------------ | Branch (949:6): [True: 961, False: 8.55k] ------------------ 950| 961| TRACE(("them kex firstfollows. allgood %d", allgood)) 951| 961| ses.kexstate.them_firstfollows = 1; 952| | /* if the guess wasn't good, we ignore the packet sent */ 953| 961| if (!allgood) { ------------------ | Branch (953:7): [True: 154, False: 807] ------------------ 954| 154| ses.ignorenext = 1; 955| 154| } 956| 961| } 957| | 958| | /* Handle the asymmetry */ 959| 9.51k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 320| 9.51k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 9.51k] | | ------------------ ------------------ 960| 0| ses.newkeys->recv.algo_crypt = 961| 0| (struct dropbear_cipher*)s2c_cipher_algo->data; 962| 0| ses.newkeys->trans.algo_crypt = 963| 0| (struct dropbear_cipher*)c2s_cipher_algo->data; 964| 0| ses.newkeys->recv.crypt_mode = 965| 0| (struct dropbear_cipher_mode*)s2c_cipher_algo->mode; 966| 0| ses.newkeys->trans.crypt_mode = 967| 0| (struct dropbear_cipher_mode*)c2s_cipher_algo->mode; 968| 0| ses.newkeys->recv.algo_mac = 969| 0|#if DROPBEAR_AEAD_MODE 970| 0| s2c_hash_algo == NULL ? ses.newkeys->recv.crypt_mode->aead_mac : ------------------ | Branch (970:4): [True: 0, False: 0] ------------------ 971| 0|#endif 972| 0| (struct dropbear_hash*)s2c_hash_algo->data; 973| 0| ses.newkeys->trans.algo_mac = 974| 0|#if DROPBEAR_AEAD_MODE 975| 0| c2s_hash_algo == NULL ? ses.newkeys->trans.crypt_mode->aead_mac : ------------------ | Branch (975:4): [True: 0, False: 0] ------------------ 976| 0|#endif 977| 0| (struct dropbear_hash*)c2s_hash_algo->data; 978| 0| ses.newkeys->recv.algo_comp = s2c_comp_algo->val; 979| 0| ses.newkeys->trans.algo_comp = c2s_comp_algo->val; 980| 9.51k| } else { 981| | /* SERVER */ 982| 9.51k| ses.newkeys->recv.algo_crypt = 983| 9.51k| (struct dropbear_cipher*)c2s_cipher_algo->data; 984| 9.51k| ses.newkeys->trans.algo_crypt = 985| 9.51k| (struct dropbear_cipher*)s2c_cipher_algo->data; 986| 9.51k| ses.newkeys->recv.crypt_mode = 987| 9.51k| (struct dropbear_cipher_mode*)c2s_cipher_algo->mode; 988| 9.51k| ses.newkeys->trans.crypt_mode = 989| 9.51k| (struct dropbear_cipher_mode*)s2c_cipher_algo->mode; 990| 9.51k| ses.newkeys->recv.algo_mac = 991| 9.51k|#if DROPBEAR_AEAD_MODE 992| 9.51k| c2s_hash_algo == NULL ? ses.newkeys->recv.crypt_mode->aead_mac : ------------------ | Branch (992:4): [True: 6.16k, False: 3.34k] ------------------ 993| 9.51k|#endif 994| 9.51k| (struct dropbear_hash*)c2s_hash_algo->data; 995| 9.51k| ses.newkeys->trans.algo_mac = 996| 9.51k|#if DROPBEAR_AEAD_MODE 997| 9.51k| s2c_hash_algo == NULL ? ses.newkeys->trans.crypt_mode->aead_mac : ------------------ | Branch (997:4): [True: 5.76k, False: 3.75k] ------------------ 998| 9.51k|#endif 999| 9.51k| (struct dropbear_hash*)s2c_hash_algo->data; 1000| 9.51k| ses.newkeys->recv.algo_comp = c2s_comp_algo->val; 1001| 9.51k| ses.newkeys->trans.algo_comp = s2c_comp_algo->val; 1002| 9.51k| } 1003| | 1004| 9.51k|#if DROPBEAR_FUZZ 1005| 9.51k| if (fuzz.fuzzing) { ------------------ | Branch (1005:6): [True: 9.44k, False: 69] ------------------ 1006| 9.44k| fuzz_kex_fakealgos(); 1007| 9.44k| } 1008| 9.51k|#endif 1009| | 1010| | /* reserved for future extensions */ 1011| 9.51k| buf_getint(ses.payload); 1012| | 1013| 9.51k| if (ses.send_kex_first_guess && allgood) { ------------------ | Branch (1013:6): [True: 0, False: 9.51k] | Branch (1013:34): [True: 0, False: 0] ------------------ 1014| 0| TRACE(("our_first_follows_matches 1")) 1015| 0| ses.kexstate.our_first_follows_matches = 1; 1016| 0| } 1017| 9.51k| return; 1018| | 1019| 74|error: 1020| 74| dropbear_exit("No matching algo %s", erralgo); 1021| 9.52k|} common_session_init: 47| 1.49k|void common_session_init(int sock_in, int sock_out) { 48| 1.49k| time_t now; 49| | 50| |#if DEBUG_TRACE 51| | debug_start_net(); 52| |#endif 53| | 54| 1.49k| TRACE(("enter session_init")) 55| | 56| 1.49k| ses.sock_in = sock_in; 57| 1.49k| ses.sock_out = sock_out; 58| 1.49k| ses.maxfd = MAX(sock_in, sock_out); 59| | 60| 1.49k| if (sock_in >= 0) { ------------------ | Branch (60:6): [True: 1.49k, False: 0] ------------------ 61| 1.49k| setnonblocking(sock_in); 62| 1.49k| } 63| 1.49k| if (sock_out >= 0) { ------------------ | Branch (63:6): [True: 1.49k, False: 0] ------------------ 64| 1.49k| setnonblocking(sock_out); 65| 1.49k| } 66| | 67| 1.49k| ses.socket_prio = DROPBEAR_PRIO_NORMAL; 68| | /* Sets it to lowdelay */ 69| 1.49k| update_channel_prio(); 70| | 71| |#if !DROPBEAR_SVR_MULTIUSER 72| | /* A sanity check to prevent an accidental configuration option 73| | leaving multiuser systems exposed */ 74| | errno = 0; 75| | getuid(); 76| | if (errno != ENOSYS) { 77| | dropbear_exit("Non-multiuser Dropbear requires a non-multiuser kernel"); 78| | } 79| |#endif 80| | 81| 1.49k| now = monotonic_now(); 82| 1.49k| ses.connect_time = now; 83| 1.49k| ses.last_packet_time_keepalive_recv = now; 84| 1.49k| ses.last_packet_time_idle = now; 85| 1.49k| ses.last_packet_time_any_sent = 0; 86| 1.49k| ses.last_packet_time_keepalive_sent = 0; 87| | 88| 1.49k|#if DROPBEAR_FUZZ 89| 1.49k| if (!fuzz.fuzzing) ------------------ | Branch (89:6): [True: 0, False: 1.49k] ------------------ 90| 0|#endif 91| 0| { 92| 0| if (pipe(ses.signal_pipe) < 0) { ------------------ | Branch (92:6): [True: 0, False: 0] ------------------ 93| 0| dropbear_exit("Signal pipe failed"); 94| 0| } 95| 0| setnonblocking(ses.signal_pipe[0]); 96| 0| setnonblocking(ses.signal_pipe[1]); 97| 0| ses.maxfd = MAX(ses.maxfd, ses.signal_pipe[0]); 98| 0| ses.maxfd = MAX(ses.maxfd, ses.signal_pipe[1]); 99| 0| } 100| | 101| 1.49k| ses.writepayload = buf_new(TRANS_MAX_PAYLOAD_LEN); ------------------ | | 497| 1.49k|#define TRANS_MAX_PAYLOAD_LEN 16384 ------------------ 102| 1.49k| ses.transseq = 0; 103| | 104| 1.49k| ses.readbuf = NULL; 105| 1.49k| ses.payload = NULL; 106| 1.49k| ses.recvseq = 0; 107| | 108| 1.49k| initqueue(&ses.writequeue); 109| | 110| 1.49k| ses.requirenext = SSH_MSG_KEXINIT; ------------------ | | 36| 1.49k|#define SSH_MSG_KEXINIT 20 ------------------ 111| 1.49k| ses.dataallowed = 1; /* we can send data until we actually 112| | send the SSH_MSG_KEXINIT */ 113| 1.49k| ses.ignorenext = 0; 114| 1.49k| ses.lastpacket = 0; 115| 1.49k| ses.reply_queue_head = NULL; 116| 1.49k| ses.reply_queue_tail = NULL; 117| | 118| | /* set all the algos to none */ 119| 1.49k| ses.keys = (struct key_context*)m_malloc(sizeof(struct key_context)); 120| 1.49k| ses.newkeys = NULL; 121| 1.49k| ses.keys->recv.algo_crypt = &dropbear_nocipher; 122| 1.49k| ses.keys->trans.algo_crypt = &dropbear_nocipher; 123| 1.49k| ses.keys->recv.crypt_mode = &dropbear_mode_none; 124| 1.49k| ses.keys->trans.crypt_mode = &dropbear_mode_none; 125| | 126| 1.49k| ses.keys->recv.algo_mac = &dropbear_nohash; 127| 1.49k| ses.keys->trans.algo_mac = &dropbear_nohash; 128| | 129| 1.49k| ses.keys->algo_kex = NULL; 130| 1.49k| ses.keys->algo_hostkey = -1; 131| 1.49k| ses.keys->recv.algo_comp = DROPBEAR_COMP_NONE; 132| 1.49k| ses.keys->trans.algo_comp = DROPBEAR_COMP_NONE; 133| | 134| |#ifndef DISABLE_ZLIB 135| | ses.keys->recv.zstream = NULL; 136| | ses.keys->trans.zstream = NULL; 137| |#endif 138| | 139| | /* key exchange buffers */ 140| 1.49k| ses.session_id = NULL; 141| 1.49k| ses.kexhashbuf = NULL; 142| 1.49k| ses.transkexinit = NULL; 143| 1.49k| ses.dh_K = NULL; 144| 1.49k| ses.remoteident = NULL; 145| | 146| 1.49k| ses.chantypes = NULL; 147| | 148| 1.49k| ses.allowprivport = 0; 149| | 150| |#if DROPBEAR_PLUGIN 151| | ses.plugin_session = NULL; 152| |#endif 153| | 154| 1.49k| TRACE(("leave session_init")) 155| 1.49k|} session_loop: 157| 1.49k|void session_loop(void(*loophandler)(void)) { 158| | 159| 1.49k| fd_set readfd, writefd; 160| 1.49k| struct timeval timeout; 161| 1.49k| int val; 162| | 163| | /* main loop, select()s for all sockets in use */ 164| 458k| for(;;) { 165| 458k| const int writequeue_has_space = (ses.writequeue_len <= 2*TRANS_MAX_PAYLOAD_LEN); ------------------ | | 497| 458k|#define TRANS_MAX_PAYLOAD_LEN 16384 ------------------ 166| | 167| 458k| timeout.tv_sec = select_timeout(); 168| 458k| timeout.tv_usec = 0; 169| 458k| DROPBEAR_FD_ZERO(&writefd); ------------------ | | 104| 458k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 170| 458k| DROPBEAR_FD_ZERO(&readfd); ------------------ | | 104| 458k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 171| | 172| 458k| dropbear_assert(ses.payload == NULL); ------------------ | | 83| 458k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 458k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 173| | 174| | /* We get woken up when signal handlers write to this pipe. 175| | SIGCHLD in svr-chansession is the only one currently. */ 176| 458k|#if DROPBEAR_FUZZ 177| 458k| if (!fuzz.fuzzing) ------------------ | Branch (177:7): [True: 0, False: 458k] ------------------ 178| 0|#endif 179| 0| { 180| 0| FD_SET(ses.signal_pipe[0], &readfd); 181| 0| } 182| | 183| | /* set up for channels which can be read/written */ 184| 458k| setchannelfds(&readfd, &writefd, writequeue_has_space); 185| | 186| | /* Pending connections to test */ 187| 458k| set_connect_fds(&writefd); 188| | 189| | /* We delay reading from the input socket during initial setup until 190| | after we have written out our initial KEXINIT packet (empty writequeue). 191| | This means our initial packet can be in-flight while we're doing a blocking 192| | read for the remote ident. 193| | We also avoid reading from the socket if the writequeue is full, that avoids 194| | replies backing up */ 195| 458k| if (ses.sock_in != -1 ------------------ | Branch (195:7): [True: 458k, False: 0] ------------------ 196| 458k| && (ses.remoteident || isempty(&ses.writequeue)) ------------------ | Branch (196:8): [True: 453k, False: 4.49k] | Branch (196:27): [True: 1.50k, False: 2.99k] ------------------ 197| 458k| && writequeue_has_space) { ------------------ | Branch (197:7): [True: 399k, False: 55.9k] ------------------ 198| 399k| FD_SET(ses.sock_in, &readfd); 199| 399k| } 200| | 201| | /* Ordering is important, this test must occur after any other function 202| | might have queued packets (such as connection handlers) */ 203| 458k| if (ses.sock_out != -1 && !isempty(&ses.writequeue)) { ------------------ | Branch (203:7): [True: 458k, False: 0] | Branch (203:29): [True: 192k, False: 265k] ------------------ 204| 192k| FD_SET(ses.sock_out, &writefd); 205| 192k| } 206| | 207| 458k| val = select(ses.maxfd+1, &readfd, &writefd, NULL, &timeout); ------------------ | | 53| 458k| wrapfd_select(nfds, readfds, writefds, exceptfds, timeout) ------------------ 208| | 209| 458k| if (ses.exitflag) { ------------------ | Branch (209:7): [True: 0, False: 458k] ------------------ 210| 0| dropbear_exit("Terminated by signal"); 211| 0| } 212| | 213| 458k| if (val < 0 && errno != EINTR) { ------------------ | Branch (213:7): [True: 615, False: 457k] | Branch (213:18): [True: 0, False: 615] ------------------ 214| 0| dropbear_exit("Error in select"); 215| 0| } 216| | 217| 458k| if (val <= 0) { ------------------ | Branch (217:7): [True: 15.7k, False: 442k] ------------------ 218| | /* If we were interrupted or the select timed out, we still 219| | * want to iterate over channels etc for reading, to handle 220| | * server processes exiting etc. 221| | * We don't want to read/write FDs. */ 222| 15.7k| DROPBEAR_FD_ZERO(&writefd); ------------------ | | 104| 15.7k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 223| 15.7k| DROPBEAR_FD_ZERO(&readfd); ------------------ | | 104| 15.7k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 224| 15.7k| } 225| | 226| | /* We'll just empty out the pipe if required. We don't do 227| | any thing with the data, since the pipe's purpose is purely to 228| | wake up the select() above. */ 229| 458k| ses.channel_signal_pending = 0; 230| 458k| if (FD_ISSET(ses.signal_pipe[0], &readfd)) { 231| 0| char x; 232| 0| TRACE(("signal pipe set")) 233| 0| while (read(ses.signal_pipe[0], &x, 1) > 0) {} ------------------ | | 55| 0|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ | Branch (233:11): [True: 0, False: 0] ------------------ 234| 0| ses.channel_signal_pending = 1; 235| 0| } 236| | 237| | /* check for auth timeout, rekeying required etc */ 238| 458k| checktimeouts(); 239| | 240| | /* process session socket's incoming data */ 241| 458k| if (ses.sock_in != -1) { ------------------ | Branch (241:7): [True: 458k, False: 0] ------------------ 242| 458k| if (FD_ISSET(ses.sock_in, &readfd)) { 243| 275k| if (!ses.remoteident) { ------------------ | Branch (243:9): [True: 1.49k, False: 273k] ------------------ 244| | /* blocking read of the version string */ 245| 1.49k| read_session_identification(); 246| 273k| } else { 247| 273k| read_packet(); 248| 273k| } 249| 275k| } 250| | 251| | /* Process the decrypted packet. After this, the read buffer 252| | * will be ready for a new packet */ 253| 458k| if (ses.payload != NULL) { ------------------ | Branch (253:8): [True: 52.0k, False: 406k] ------------------ 254| 52.0k| process_packet(); 255| 52.0k| } 256| 458k| } 257| | 258| | /* if required, flush out any queued reply packets that 259| | were being held up during a KEX */ 260| 458k| maybe_flush_reply_queue(); 261| | 262| 458k| handle_connect_fds(&writefd); 263| | 264| | /* loop handler prior to channelio, in case the server loophandler closes 265| | channels on process exit */ 266| 458k| loophandler(); 267| | 268| | /* process pipes etc for the channels, ses.dataallowed == 0 269| | * during rekeying ) */ 270| 458k| channelio(&readfd, &writefd); 271| | 272| | /* process session socket's outgoing data */ 273| 458k| if (ses.sock_out != -1) { ------------------ | Branch (273:7): [True: 456k, False: 1.49k] ------------------ 274| 456k| if (!isempty(&ses.writequeue)) { ------------------ | Branch (274:8): [True: 234k, False: 221k] ------------------ 275| 234k| write_packet(); 276| 234k| } 277| 456k| } 278| | 279| 458k| } /* for(;;) */ 280| | 281| | /* Not reached */ 282| 1.49k|} session_cleanup: 293| 1.49k|void session_cleanup() { 294| | 295| 1.49k| TRACE(("enter session_cleanup")) 296| | 297| | /* we can't cleanup if we don't know the session state */ 298| 1.49k| if (!ses.init_done) { ------------------ | Branch (298:6): [True: 0, False: 1.49k] ------------------ 299| 0| TRACE(("leave session_cleanup: !ses.init_done")) 300| 0| return; 301| 0| } 302| | 303| | /* BEWARE of changing order of functions here. */ 304| | 305| | /* Must be before extra_session_cleanup() */ 306| 1.49k| chancleanup(); 307| | 308| 1.49k| if (ses.extra_session_cleanup) { ------------------ | Branch (308:6): [True: 1.49k, False: 0] ------------------ 309| 1.49k| ses.extra_session_cleanup(); 310| 1.49k| } 311| | 312| | /* After these are freed most functions will fail */ 313| 1.49k|#if DROPBEAR_CLEANUP 314| | /* listeners call cleanup functions, this should occur before 315| | other session state is freed. */ 316| 1.49k| remove_all_listeners(); 317| | 318| 1.49k| remove_connect_pending(); 319| | 320| 8.54k| while (!isempty(&ses.writequeue)) { ------------------ | Branch (320:9): [True: 7.04k, False: 1.49k] ------------------ 321| 7.04k| buf_free(dequeue(&ses.writequeue)); 322| 7.04k| } 323| | 324| 1.49k| m_free(ses.newkeys); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 325| |#ifndef DISABLE_ZLIB 326| | if (ses.keys->recv.zstream != NULL) { 327| | if (inflateEnd(ses.keys->recv.zstream) == Z_STREAM_ERROR) { 328| | dropbear_exit("Crypto error"); 329| | } 330| | m_free(ses.keys->recv.zstream); 331| | } 332| |#endif 333| | 334| 1.49k| m_free(ses.remoteident); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 335| 1.49k| m_free(ses.authstate.pw_dir); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 336| 1.49k| m_free(ses.authstate.pw_name); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 337| 1.49k| m_free(ses.authstate.pw_shell); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 338| 1.49k| m_free(ses.authstate.pw_passwd); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 339| 1.49k| m_free(ses.authstate.username); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 340| 1.49k|#endif 341| | 342| 1.49k| cleanup_buf(&ses.session_id); 343| 1.49k| cleanup_buf(&ses.hash); 344| 1.49k| cleanup_buf(&ses.payload); 345| 1.49k| cleanup_buf(&ses.readbuf); 346| 1.49k| cleanup_buf(&ses.writepayload); 347| 1.49k| cleanup_buf(&ses.kexhashbuf); 348| 1.49k| cleanup_buf(&ses.transkexinit); 349| 1.49k| if (ses.dh_K) { ------------------ | Branch (349:6): [True: 0, False: 1.49k] ------------------ 350| 0| mp_clear(ses.dh_K); 351| 0| } 352| 1.49k| m_free(ses.dh_K); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 353| | 354| 1.49k| m_burn(ses.keys, sizeof(struct key_context)); 355| 1.49k| m_free(ses.keys); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 356| | 357| 1.49k| TRACE(("leave session_cleanup")) 358| 1.49k|} send_session_identification: 360| 1.49k|void send_session_identification() { 361| 1.49k| buffer *writebuf = buf_new(strlen(LOCAL_IDENT "\r\n") + 1); ------------------ | | 10| 1.49k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION ------------------ 362| 1.49k| buf_putbytes(writebuf, (const unsigned char *) LOCAL_IDENT "\r\n", strlen(LOCAL_IDENT "\r\n")); ------------------ | | 10| 1.49k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION ------------------ buf_putbytes(writebuf, (const unsigned char *) LOCAL_IDENT "\r\n", strlen(LOCAL_IDENT "\r\n")); ------------------ | | 10| 1.49k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION ------------------ 363| 1.49k| writebuf_enqueue(writebuf); 364| 1.49k|} ignore_recv_response: 489| 348|void ignore_recv_response() { 490| | /* Do nothing */ 491| 348| TRACE(("Ignored msg_request_response")) 492| 348|} fill_passwd: 630| 1.49k|void fill_passwd(const char* username) { 631| 1.49k| struct passwd *pw = NULL; 632| 1.49k| if (ses.authstate.pw_name) ------------------ | Branch (632:6): [True: 0, False: 1.49k] ------------------ 633| 0| m_free(ses.authstate.pw_name); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 634| 1.49k| if (ses.authstate.pw_dir) ------------------ | Branch (634:6): [True: 0, False: 1.49k] ------------------ 635| 0| m_free(ses.authstate.pw_dir); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 636| 1.49k| if (ses.authstate.pw_shell) ------------------ | Branch (636:6): [True: 0, False: 1.49k] ------------------ 637| 0| m_free(ses.authstate.pw_shell); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 638| 1.49k| if (ses.authstate.pw_passwd) ------------------ | Branch (638:6): [True: 0, False: 1.49k] ------------------ 639| 0| m_free(ses.authstate.pw_passwd); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 640| | 641| 1.49k| pw = getpwnam(username); ------------------ | | 108| 1.49k|#define getpwnam(x) fuzz_getpwnam(x) ------------------ 642| 1.49k| if (!pw) { ------------------ | Branch (642:6): [True: 0, False: 1.49k] ------------------ 643| 0| return; 644| 0| } 645| 1.49k| ses.authstate.pw_uid = pw->pw_uid; 646| 1.49k| ses.authstate.pw_gid = pw->pw_gid; 647| 1.49k| ses.authstate.pw_name = m_strdup(pw->pw_name); 648| 1.49k| ses.authstate.pw_dir = m_strdup(pw->pw_dir); 649| 1.49k| ses.authstate.pw_shell = m_strdup(pw->pw_shell); 650| 1.49k| { 651| 1.49k| char *passwd_crypt = pw->pw_passwd; 652| 1.49k|#ifdef HAVE_SHADOW_H 653| | /* get the shadow password if possible */ 654| 1.49k| struct spwd *spasswd = getspnam(ses.authstate.pw_name); 655| 1.49k| if (spasswd && spasswd->sp_pwdp) { ------------------ | Branch (655:7): [True: 1.49k, False: 0] | Branch (655:18): [True: 1.49k, False: 0] ------------------ 656| 1.49k| passwd_crypt = spasswd->sp_pwdp; 657| 1.49k| } 658| 1.49k|#endif 659| 1.49k| if (!passwd_crypt) { ------------------ | Branch (659:7): [True: 0, False: 1.49k] ------------------ 660| | /* android supposedly returns NULL */ 661| 0| passwd_crypt = "!!"; 662| 0| } 663| 1.49k| ses.authstate.pw_passwd = m_strdup(passwd_crypt); 664| 1.49k| } 665| 1.49k|} update_channel_prio: 668| 10.9k|void update_channel_prio() { 669| 10.9k| enum dropbear_prio new_prio; 670| 10.9k| int any = 0; 671| 10.9k| unsigned int i; 672| | 673| 10.9k| TRACE(("update_channel_prio")) 674| | 675| 10.9k| if (ses.sock_out < 0) { ------------------ | Branch (675:6): [True: 1.93k, False: 9.01k] ------------------ 676| 1.93k| TRACE(("leave update_channel_prio: no socket")) 677| 1.93k| return; 678| 1.93k| } 679| | 680| 9.01k| new_prio = DROPBEAR_PRIO_NORMAL; 681| 38.9k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (681:14): [True: 35.4k, False: 3.49k] ------------------ 682| 35.4k| struct Channel *channel = ses.channels[i]; 683| 35.4k| if (!channel) { ------------------ | Branch (683:7): [True: 23.7k, False: 11.7k] ------------------ 684| 23.7k| continue; 685| 23.7k| } 686| 11.7k| any = 1; 687| 11.7k| if (channel->prio == DROPBEAR_PRIO_LOWDELAY) { ------------------ | Branch (687:7): [True: 5.51k, False: 6.18k] ------------------ 688| 5.51k| new_prio = DROPBEAR_PRIO_LOWDELAY; 689| 5.51k| break; 690| 5.51k| } 691| 11.7k| } 692| | 693| 9.01k| if (any == 0) { ------------------ | Branch (693:6): [True: 2.27k, False: 6.73k] ------------------ 694| | /* lowdelay during setup */ 695| 2.27k| TRACE(("update_channel_prio: not any")) 696| 2.27k| new_prio = DROPBEAR_PRIO_LOWDELAY; 697| 2.27k| } 698| | 699| 9.01k| if (new_prio != ses.socket_prio) { ------------------ | Branch (699:6): [True: 3.17k, False: 5.84k] ------------------ 700| 3.17k| TRACE(("Dropbear priority transitioning %d -> %d", ses.socket_prio, new_prio)) 701| 3.17k| set_sock_priority(ses.sock_out, new_prio); 702| 3.17k| ses.socket_prio = new_prio; 703| 3.17k| } 704| 9.01k|} common-session.c:cleanup_buf: 284| 10.4k|static void cleanup_buf(buffer **buf) { 285| 10.4k| if (!*buf) { ------------------ | Branch (285:6): [True: 5.64k, False: 4.82k] ------------------ 286| 5.64k| return; 287| 5.64k| } 288| 4.82k| buf_burn_free(*buf); 289| 4.82k| *buf = NULL; 290| 4.82k|} common-session.c:read_session_identification: 366| 1.49k|static void read_session_identification() { 367| | /* max length of 255 chars */ 368| 1.49k| char linebuf[256]; 369| 1.49k| int len = 0; 370| 1.49k| char done = 0; 371| 1.49k| int i; 372| | 373| | /* Servers may send other lines of data before sending the 374| | * version string, client must be able to process such lines. 375| | * If they send more than 50 lines, something is wrong */ 376| 1.49k| for (i = IS_DROPBEAR_CLIENT ? 50 : 1; i > 0; i--) { ------------------ | | 320| 1.49k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 1.49k] | | ------------------ ------------------ | Branch (376:40): [True: 1.49k, False: 4] ------------------ 377| 1.49k| len = ident_readln(ses.sock_in, linebuf, sizeof(linebuf)); 378| | 379| 1.49k| if (len < 0 && errno != EINTR) { ------------------ | Branch (379:7): [True: 5, False: 1.49k] | Branch (379:18): [True: 1, False: 4] ------------------ 380| | /* It failed */ 381| 1| break; 382| 1| } 383| | 384| 1.49k| if (len >= 4 && memcmp(linebuf, "SSH-", 4) == 0) { ------------------ | Branch (384:7): [True: 1.49k, False: 4] | Branch (384:19): [True: 1.49k, False: 0] ------------------ 385| | /* start of line matches */ 386| 1.49k| done = 1; 387| 1.49k| break; 388| 1.49k| } 389| 1.49k| } 390| | 391| 1.49k| if (!done) { ------------------ | Branch (391:6): [True: 5, False: 1.49k] ------------------ 392| 5| TRACE(("error reading remote ident: %s\n", strerror(errno))) 393| 5| ses.remoteclosed(); 394| 1.49k| } else { 395| | /* linebuf is already null terminated */ 396| 1.49k| ses.remoteident = m_malloc(len); 397| 1.49k| memcpy(ses.remoteident, linebuf, len); 398| 1.49k| } 399| | 400| | /* Shall assume that 2.x will be backwards compatible. */ 401| 1.49k| if (strncmp(ses.remoteident, "SSH-2.", 6) != 0 ------------------ | Branch (401:6): [True: 0, False: 1.49k] ------------------ 402| 1.49k| && strncmp(ses.remoteident, "SSH-1.99-", 9) != 0) { ------------------ | Branch (402:7): [True: 0, False: 0] ------------------ 403| 0| dropbear_exit("Incompatible remote version '%s'", ses.remoteident); 404| 0| } 405| | 406| 1.49k| DEBUG1(("remoteident: %s", ses.remoteident)) 407| | 408| 1.49k|} common-session.c:ident_readln: 412| 1.49k|static int ident_readln(int fd, char* buf, int count) { 413| | 414| 1.49k| char in; 415| 1.49k| int pos = 0; 416| 1.49k| int num = 0; 417| 1.49k| fd_set fds; 418| 1.49k| struct timeval timeout; 419| | 420| 1.49k| TRACE(("enter ident_readln")) 421| | 422| 1.49k| if (count < 1) { ------------------ | Branch (422:6): [True: 0, False: 1.49k] ------------------ 423| 0| return -1; 424| 0| } 425| | 426| 1.49k| DROPBEAR_FD_ZERO(&fds); ------------------ | | 104| 1.49k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 427| | 428| | /* select since it's a non-blocking fd */ 429| | 430| | /* leave space to null-terminate */ 431| 44.2k| while (pos < count-1) { ------------------ | Branch (431:9): [True: 44.2k, False: 0] ------------------ 432| | 433| 44.2k| FD_SET(fd, &fds); 434| | 435| 44.2k| timeout.tv_sec = 1; 436| 44.2k| timeout.tv_usec = 0; 437| 44.2k| if (select(fd+1, &fds, NULL, NULL, &timeout) < 0) { ------------------ | | 53| 44.2k| wrapfd_select(nfds, readfds, writefds, exceptfds, timeout) ------------------ | Branch (437:7): [True: 42, False: 44.2k] ------------------ 438| 42| if (errno == EINTR) { ------------------ | Branch (438:8): [True: 42, False: 0] ------------------ 439| 42| continue; 440| 42| } 441| 0| TRACE(("leave ident_readln: select error")) 442| 0| return -1; 443| 42| } 444| | 445| 44.2k| checktimeouts(); 446| | 447| | /* Have to go one byte at a time, since we don't want to read past 448| | * the end, and have to somehow shove bytes back into the normal 449| | * packet reader */ 450| 44.2k| if (FD_ISSET(fd, &fds)) { 451| 44.2k| num = read(fd, &in, 1); ------------------ | | 55| 44.2k|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ 452| | /* a "\n" is a newline, "\r" we want to read in and keep going 453| | * so that it won't be read as part of the next line */ 454| 44.2k| if (num < 0) { ------------------ | Branch (454:8): [True: 62, False: 44.1k] ------------------ 455| | /* error */ 456| 62| if (errno == EINTR) { ------------------ | Branch (456:9): [True: 62, False: 0] ------------------ 457| 62| continue; /* not a real error */ 458| 62| } 459| 0| TRACE(("leave ident_readln: read error")) 460| 0| return -1; 461| 62| } 462| 44.1k| if (num == 0) { ------------------ | Branch (462:8): [True: 5, False: 44.1k] ------------------ 463| | /* EOF */ 464| 5| TRACE(("leave ident_readln: EOF")) 465| 5| return -1; 466| 5| } 467| | 468| 44.1k|#if DROPBEAR_FUZZ 469| 44.1k| fuzz_dump(&in, 1); 470| 44.1k|#endif 471| | 472| 44.1k| if (in == '\n') { ------------------ | Branch (472:8): [True: 1.49k, False: 42.6k] ------------------ 473| | /* end of ident string */ 474| 1.49k| break; 475| 1.49k| } 476| | /* we don't want to include '\r's */ 477| 42.6k| if (in != '\r') { ------------------ | Branch (477:8): [True: 31.0k, False: 11.6k] ------------------ 478| 31.0k| buf[pos] = in; 479| 31.0k| pos++; 480| 31.0k| } 481| 42.6k| } 482| 44.2k| } 483| | 484| 1.49k| buf[pos] = '\0'; 485| 1.49k| TRACE(("leave ident_readln: return %d", pos+1)) 486| 1.49k| return pos+1; 487| 1.49k|} common-session.c:checktimeouts: 533| 502k|static void checktimeouts() { 534| | 535| 502k| time_t now; 536| 502k| now = monotonic_now(); 537| | 538| 502k| if (IS_DROPBEAR_SERVER && ses.connect_time != 0 ------------------ | | 319| 1.00M|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 502k, False: 0] | | ------------------ ------------------ | Branch (538:28): [True: 502k, False: 0] ------------------ 539| 502k| && elapsed(now, ses.connect_time) >= AUTH_TIMEOUT) { ------------------ | | 31| 502k|#define AUTH_TIMEOUT 300 /* we choose 5 minutes */ ------------------ | Branch (539:6): [True: 0, False: 502k] ------------------ 540| 0| dropbear_close("Timeout before auth"); 541| 0| } 542| | 543| | /* we can't rekey if we haven't done remote ident exchange yet */ 544| 502k| if (ses.remoteident == NULL) { ------------------ | Branch (544:6): [True: 48.7k, False: 453k] ------------------ 545| 48.7k| return; 546| 48.7k| } 547| | 548| 453k| if (!ses.kexstate.sentkexinit ------------------ | Branch (548:6): [True: 346k, False: 106k] ------------------ 549| 453k| && (elapsed(now, ses.kexstate.lastkextime) >= KEX_REKEY_TIMEOUT ------------------ | | 24| 693k|#define KEX_REKEY_TIMEOUT (3600 * 8) ------------------ | Branch (549:8): [True: 0, False: 346k] ------------------ 550| 346k| || ses.kexstate.datarecv+ses.kexstate.datatrans >= KEX_REKEY_DATA)) { ------------------ | | 27| 346k|#define KEX_REKEY_DATA (1<<30) /* 2^30 == 1GB, this value must be < INT_MAX */ ------------------ | Branch (550:7): [True: 0, False: 346k] ------------------ 551| 0| TRACE(("rekeying after timeout or max data reached")) 552| 0| send_msg_kexinit(); 553| 0| } 554| | 555| 453k| if (opts.keepalive_secs > 0 && ses.authstate.authdone) { ------------------ | Branch (555:6): [True: 0, False: 453k] | Branch (555:33): [True: 0, False: 0] ------------------ 556| | /* Avoid sending keepalives prior to auth - those are 557| | not valid pre-auth packet types */ 558| | 559| | /* Send keepalives if we've been idle */ 560| 0| if (elapsed(now, ses.last_packet_time_any_sent) >= opts.keepalive_secs) { ------------------ | Branch (560:7): [True: 0, False: 0] ------------------ 561| 0| send_msg_keepalive(); 562| 0| } 563| | 564| | /* Also send an explicit keepalive message to trigger a response 565| | if the remote end hasn't sent us anything */ 566| 0| if (elapsed(now, ses.last_packet_time_keepalive_recv) >= opts.keepalive_secs ------------------ | Branch (566:7): [True: 0, False: 0] ------------------ 567| 0| && elapsed(now, ses.last_packet_time_keepalive_sent) >= opts.keepalive_secs) { ------------------ | Branch (567:7): [True: 0, False: 0] ------------------ 568| 0| send_msg_keepalive(); 569| 0| } 570| | 571| 0| if (elapsed(now, ses.last_packet_time_keepalive_recv) ------------------ | Branch (571:7): [True: 0, False: 0] ------------------ 572| 0| >= opts.keepalive_secs * DEFAULT_KEEPALIVE_LIMIT) { ------------------ | | 510| 0|#define DEFAULT_KEEPALIVE_LIMIT 3 ------------------ 573| 0| dropbear_exit("Keepalive timeout"); 574| 0| } 575| 0| } 576| | 577| 453k| if (opts.idle_timeout_secs > 0 ------------------ | Branch (577:6): [True: 0, False: 453k] ------------------ 578| 453k| && elapsed(now, ses.last_packet_time_idle) >= opts.idle_timeout_secs) { ------------------ | Branch (578:7): [True: 0, False: 0] ------------------ 579| 0| dropbear_close("Idle timeout"); 580| 0| } 581| 453k|} common-session.c:elapsed: 523| 1.52M|static long elapsed(time_t now, time_t prev) { 524| 1.52M| time_t del = now - prev; 525| 1.52M| if (del > LONG_MAX) { ------------------ | Branch (525:6): [True: 0, False: 1.52M] ------------------ 526| 0| return LONG_MAX; 527| 0| } 528| 1.52M| return (long)del; 529| 1.52M|} common-session.c:select_timeout: 594| 458k|static long select_timeout() { 595| | /* determine the minimum timeout that might be required, so 596| | as to avoid waking when unneccessary */ 597| 458k| long timeout = KEX_REKEY_TIMEOUT; ------------------ | | 24| 458k|#define KEX_REKEY_TIMEOUT (3600 * 8) ------------------ 598| 458k| time_t now = monotonic_now(); 599| | 600| 458k| if (!ses.kexstate.sentkexinit) { ------------------ | Branch (600:6): [True: 346k, False: 111k] ------------------ 601| 346k| update_timeout(KEX_REKEY_TIMEOUT, now, ses.kexstate.lastkextime, &timeout); ------------------ | | 24| 346k|#define KEX_REKEY_TIMEOUT (3600 * 8) ------------------ 602| 346k| } 603| | 604| 458k| if (ses.authstate.authdone != 1 && IS_DROPBEAR_SERVER) { ------------------ | | 319| 0|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 0, False: 0] | | ------------------ ------------------ | Branch (604:6): [True: 0, False: 458k] ------------------ 605| | /* AUTH_TIMEOUT is only relevant before authdone */ 606| 0| update_timeout(AUTH_TIMEOUT, now, ses.connect_time, &timeout); ------------------ | | 31| 0|#define AUTH_TIMEOUT 300 /* we choose 5 minutes */ ------------------ 607| 0| } 608| | 609| 458k| if (ses.authstate.authdone) { ------------------ | Branch (609:6): [True: 458k, False: 0] ------------------ 610| 458k| update_timeout(opts.keepalive_secs, now, 611| 458k| MAX(ses.last_packet_time_keepalive_recv, ses.last_packet_time_keepalive_sent), 612| 458k| &timeout); 613| 458k| } 614| | 615| 458k| update_timeout(opts.idle_timeout_secs, now, ses.last_packet_time_idle, 616| 458k| &timeout); 617| | 618| | /* clamp negative timeouts to zero - event has already triggered */ 619| 458k| return MAX(timeout, 0); 620| 458k|} common-session.c:update_timeout: 583| 1.26M|static void update_timeout(long limit, time_t now, time_t last_event, long * timeout) { 584| 1.26M| TRACE2(("update_timeout limit %ld, now %llu, last %llu, timeout %ld", 585| 1.26M| limit, 586| 1.26M| (unsigned long long)now, 587| 1.26M| (unsigned long long)last_event, *timeout)) 588| 1.26M| if (last_event > 0 && limit > 0) { ------------------ | Branch (588:6): [True: 1.26M, False: 0] | Branch (588:24): [True: 346k, False: 916k] ------------------ 589| 346k| *timeout = MIN(*timeout, elapsed(now, last_event) + limit); 590| 346k| TRACE2(("new timeout %ld", *timeout)) 591| 346k| } 592| 1.26M|} strlcpy: 93| 32|size_t strlcpy(char *dst, const char *src, size_t size) { 94| | 95| 32| size_t i; 96| | 97| | /* this is undefined, though size==0 -> return 0 */ 98| 32| if (size < 1) { ------------------ | Branch (98:6): [True: 0, False: 32] ------------------ 99| 0| return 0; 100| 0| } 101| | 102| 344| for (i = 0; i < size-1; i++) { ------------------ | Branch (102:14): [True: 344, False: 0] ------------------ 103| 344| if (src[i] == '\0') { ------------------ | Branch (103:7): [True: 32, False: 312] ------------------ 104| 32| break; 105| 312| } else { 106| 312| dst[i] = src[i]; 107| 312| } 108| 344| } 109| | 110| 32| dst[i] = '\0'; 111| 32| return strlen(src); 112| | 113| 32|} crypto_init: 21| 1|void crypto_init() { 22| | 23| 1| const struct ltc_cipher_descriptor *regciphers[] = { 24| 1|#if DROPBEAR_AES 25| 1| &aes_desc, 26| 1|#endif 27| |#if DROPBEAR_3DES 28| | &des3_desc, 29| |#endif 30| 1| NULL 31| 1| }; 32| | 33| 1| const struct ltc_hash_descriptor *reghashes[] = { 34| 1|#if DROPBEAR_SHA1_HMAC 35| 1| &sha1_desc, 36| 1|#endif 37| 1|#if DROPBEAR_SHA256 38| 1| &sha256_desc, 39| 1|#endif 40| 1|#if DROPBEAR_SHA384 41| 1| &sha384_desc, 42| 1|#endif 43| 1|#if DROPBEAR_SHA512 44| 1| &sha512_desc, 45| 1|#endif 46| 1| NULL 47| 1| }; 48| 1| int i; 49| | 50| 2| for (i = 0; regciphers[i] != NULL; i++) { ------------------ | Branch (50:14): [True: 1, False: 1] ------------------ 51| 1| if (register_cipher(regciphers[i]) == -1) { ------------------ | Branch (51:7): [True: 0, False: 1] ------------------ 52| 0| dropbear_exit("Error registering crypto"); 53| 0| } 54| 1| } 55| | 56| 5| for (i = 0; reghashes[i] != NULL; i++) { ------------------ | Branch (56:14): [True: 4, False: 1] ------------------ 57| 4| if (register_hash(reghashes[i]) == -1) { ------------------ | Branch (57:7): [True: 0, False: 4] ------------------ 58| 0| dropbear_exit("Error registering crypto"); 59| 0| } 60| 4| } 61| | 62| 1|#if DROPBEAR_LTC_PRNG 63| 1| dropbear_ltc_prng = register_prng(&dropbear_prng_desc); 64| 1| if (dropbear_ltc_prng == -1) { ------------------ | Branch (64:6): [True: 0, False: 1] ------------------ 65| 0| dropbear_exit("Error registering crypto"); 66| 0| } 67| 1|#endif 68| | 69| 1| mp_rand_source(dropbear_rand_source); 70| | 71| 1|#if DROPBEAR_ECC 72| 1| ltc_mp = ltm_desc; 73| 1| dropbear_ecc_fill_dp(); 74| 1|#endif 75| 1|} m_burn: 5| 422k|void m_burn(void *data, unsigned int len) { 6| | 7| |#if defined(HAVE_MEMSET_S) 8| | memset_s(data, len, 0x0, len); 9| |#elif defined(HAVE_EXPLICIT_BZERO) 10| 422k| explicit_bzero(data, len); 11| |#else 12| | /* This must be volatile to avoid compiler optimisation */ 13| | volatile void *p = data; 14| | memset((void*)p, 0x0, len); 15| |#endif 16| 422k|} m_calloc: 5| 21.5k|void * m_calloc(size_t nmemb, size_t size) { 6| 21.5k| if (SIZE_T_MAX / nmemb < size) { ------------------ | | 166| 21.5k|#define SIZE_T_MAX ULONG_MAX ------------------ | Branch (6:9): [True: 0, False: 21.5k] ------------------ 7| 0| dropbear_exit("m_calloc failed"); 8| 0| } 9| 21.5k| return m_malloc(nmemb*size); 10| 21.5k|} m_strdup: 12| 22.4k|void * m_strdup(const char * str) { 13| 22.4k| char* ret; 14| 22.4k| unsigned int len; 15| 22.4k| len = strlen(str); 16| | 17| 22.4k| ret = m_malloc(len+1); 18| 22.4k| if (ret == NULL) { ------------------ | Branch (18:9): [True: 0, False: 22.4k] ------------------ 19| 0| dropbear_exit("m_strdup failed"); 20| 0| } 21| 22.4k| memcpy(ret, str, len+1); 22| 22.4k| return ret; 23| 22.4k|} m_malloc_set_epoch: 76| 1.49k|void m_malloc_set_epoch(unsigned int epoch) { 77| 1.49k| current_epoch = epoch; 78| 1.49k|} m_malloc_free_epoch: 80| 1.49k|void m_malloc_free_epoch(unsigned int epoch, int dofree) { 81| 1.49k| struct dbmalloc_header* header; 82| 1.49k| struct dbmalloc_header* nextheader = NULL; 83| 1.49k| struct dbmalloc_header* oldstaple = staple; 84| 1.49k| staple = NULL; 85| | /* free allocations from this epoch, create a new staple-anchored list from 86| | the remainder */ 87| 1.55M| for (header = oldstaple; header; header = nextheader) ------------------ | Branch (87:30): [True: 1.55M, False: 1.49k] ------------------ 88| 1.55M| { 89| 1.55M| nextheader = header->next; 90| 1.55M| if (header->epoch == epoch) { ------------------ | Branch (90:13): [True: 355, False: 1.55M] ------------------ 91| 355| if (dofree) { ------------------ | Branch (91:17): [True: 355, False: 0] ------------------ 92| 355| free(header); 93| 355| } 94| 1.55M| } else { 95| 1.55M| header->prev = NULL; 96| 1.55M| header->next = NULL; 97| 1.55M| put_alloc(header); 98| 1.55M| } 99| 1.55M| } 100| 1.49k|} m_malloc: 131| 805k|void * m_malloc(size_t size) { 132| 805k| char* mem = NULL; 133| 805k| struct dbmalloc_header* header = NULL; 134| | 135| 805k| if (size == 0 || size > 1e9) { ------------------ | Branch (135:9): [True: 0, False: 805k] | Branch (135:22): [True: 0, False: 805k] ------------------ 136| 0| dropbear_exit("m_malloc failed"); 137| 0| } 138| | 139| 805k| size = size + sizeof(struct dbmalloc_header); 140| | 141| 805k| mem = calloc(1, size); 142| 805k| if (mem == NULL) { ------------------ | Branch (142:9): [True: 0, False: 805k] ------------------ 143| 0| dropbear_exit("m_malloc failed"); 144| 0| } 145| 805k| header = (struct dbmalloc_header*)mem; 146| 805k| put_alloc(header); 147| 805k| header->epoch = current_epoch; 148| 805k| return &mem[sizeof(struct dbmalloc_header)]; 149| 805k|} m_realloc: 151| 13.5k|void * m_realloc(void* ptr, size_t size) { 152| 13.5k| char* mem = NULL; 153| 13.5k| struct dbmalloc_header* header = NULL; 154| 13.5k| if (size == 0 || size > 1e9) { ------------------ | Branch (154:9): [True: 0, False: 13.5k] | Branch (154:22): [True: 0, False: 13.5k] ------------------ 155| 0| dropbear_exit("m_realloc failed"); 156| 0| } 157| | 158| 13.5k| header = get_header(ptr); 159| 13.5k| remove_alloc(header); 160| | 161| 13.5k| size = size + sizeof(struct dbmalloc_header); 162| 13.5k| mem = realloc(header, size); 163| 13.5k| if (mem == NULL) { ------------------ | Branch (163:9): [True: 0, False: 13.5k] ------------------ 164| 0| dropbear_exit("m_realloc failed"); 165| 0| } 166| | 167| 13.5k| header = (struct dbmalloc_header*)mem; 168| 13.5k| put_alloc(header); 169| 13.5k| return &mem[sizeof(struct dbmalloc_header)]; 170| 13.5k|} m_free_direct: 172| 819k|void m_free_direct(void* ptr) { 173| 819k| struct dbmalloc_header* header = NULL; 174| 819k| if (!ptr) { ------------------ | Branch (174:9): [True: 16.7k, False: 802k] ------------------ 175| 16.7k| return; 176| 16.7k| } 177| 802k| header = get_header(ptr); 178| 802k| remove_alloc(header); 179| 802k| free(header); 180| 802k|} m_realloc_ltm: 184| 1.54k|void * m_realloc_ltm(void* ptr, size_t oldsize, size_t newsize) { 185| 1.54k| (void)oldsize; 186| 1.54k| return m_realloc(ptr, newsize); 187| 1.54k|} m_free_ltm: 189| 21.5k|void m_free_ltm(void *mem, size_t size) { 190| 21.5k| (void)size; 191| 21.5k| m_free_direct(mem); 192| 21.5k|} dbmalloc.c:put_alloc: 102| 2.37M|static void put_alloc(struct dbmalloc_header *header) { 103| 2.37M| assert(header->next == NULL); 104| 2.37M| assert(header->prev == NULL); 105| 2.37M| if (staple) { ------------------ | Branch (105:9): [True: 2.37M, False: 1.49k] ------------------ 106| 2.37M| staple->prev = header; 107| 2.37M| } 108| 2.37M| header->next = staple; 109| 2.37M| staple = header; 110| 2.37M|} dbmalloc.c:get_header: 126| 816k|static struct dbmalloc_header* get_header(void* ptr) { 127| 816k| char* bptr = ptr; 128| 816k| return (struct dbmalloc_header*)&bptr[-sizeof(struct dbmalloc_header)]; 129| 816k|} dbmalloc.c:remove_alloc: 112| 816k|static void remove_alloc(struct dbmalloc_header *header) { 113| 816k| if (header->prev) { ------------------ | Branch (113:9): [True: 581k, False: 234k] ------------------ 114| 581k| header->prev->next = header->next; 115| 581k| } 116| 816k| if (header->next) { ------------------ | Branch (116:9): [True: 816k, False: 0] ------------------ 117| 816k| header->next->prev = header->prev; 118| 816k| } 119| 816k| if (staple == header) { ------------------ | Branch (119:9): [True: 234k, False: 581k] ------------------ 120| 234k| staple = header->next; 121| 234k| } 122| 816k| header->prev = NULL; 123| 816k| header->next = NULL; 124| 816k|} fuzz_seed: 153| 1.49k|void fuzz_seed(const unsigned char* dat, unsigned int len) { 154| 1.49k| hash_state hs; 155| 1.49k| sha256_init(&hs); 156| 1.49k| sha256_process(&hs, "fuzzfuzzfuzz", strlen("fuzzfuzzfuzz")); 157| 1.49k| sha256_process(&hs, dat, len); 158| 1.49k| sha256_done(&hs, hashpool); 159| 1.49k| counter = 0; 160| 1.49k| donerandinit = 1; 161| 1.49k|} genrandom: 316| 251k|void genrandom(unsigned char* buf, unsigned int len) { 317| | 318| 251k| hash_state hs; 319| 251k| unsigned char hash[SHA256_HASH_SIZE]; 320| 251k| unsigned int copylen; 321| | 322| 251k| if (!donerandinit) { ------------------ | Branch (322:6): [True: 0, False: 251k] ------------------ 323| 0| dropbear_exit("seedrandom not done"); 324| 0| } 325| | 326| 503k| while (len > 0) { ------------------ | Branch (326:9): [True: 251k, False: 251k] ------------------ 327| 251k| sha256_init(&hs); 328| 251k| sha256_process(&hs, (void*)hashpool, sizeof(hashpool)); 329| 251k| sha256_process(&hs, (void*)&counter, sizeof(counter)); 330| 251k| sha256_done(&hs, hash); 331| | 332| 251k| counter++; 333| 251k| if (counter > MAX_COUNTER) { ------------------ | | 35| 251k|#define MAX_COUNTER (1<<30) ------------------ | Branch (333:7): [True: 0, False: 251k] ------------------ 334| 0| seedrandom(); 335| 0| } 336| | 337| 251k| copylen = MIN(len, SHA256_HASH_SIZE); 338| 251k| memcpy(buf, hash, copylen); 339| 251k| len -= copylen; 340| 251k| buf += copylen; 341| 251k| } 342| 251k| m_burn(hash, sizeof(hash)); 343| 251k|} dropbear_close: 95| 1.03k|void dropbear_close(const char* format, ...) { 96| | 97| 1.03k| va_list param; 98| | 99| 1.03k| va_start(param, format); 100| 1.03k| _dropbear_exit(EXIT_SUCCESS, format, param); 101| 0| va_end(param); 102| | 103| 0|} dropbear_exit: 105| 458|void dropbear_exit(const char* format, ...) { 106| | 107| 458| va_list param; 108| | 109| 458| va_start(param, format); 110| 458| _dropbear_exit(EXIT_FAILURE, format, param); 111| 0| va_end(param); 112| 0|} fail_assert: 132| 1|void fail_assert(const char* expr, const char* file, int line) { 133| 1| dropbear_exit("Failed assertion (%s:%d): `%s'", file, line, expr); 134| 1|} dropbear_log: 148| 3.75k|void dropbear_log(int priority, const char* format, ...) { 149| | 150| 3.75k| va_list param; 151| | 152| 3.75k| va_start(param, format); 153| 3.75k| _dropbear_log(priority, format, param); 154| 3.75k| va_end(param); 155| 3.75k|} spawn_command: 275| 1.55k| int *ret_writefd, int *ret_readfd, int *ret_errfd, pid_t *ret_pid) { 276| 1.55k| int infds[2]; 277| 1.55k| int outfds[2]; 278| 1.55k| int errfds[2]; 279| 1.55k| pid_t pid; 280| | 281| 1.55k| const int FDIN = 0; 282| 1.55k| const int FDOUT = 1; 283| | 284| 1.55k|#if DROPBEAR_FUZZ 285| 1.55k| if (fuzz.fuzzing) { ------------------ | Branch (285:6): [True: 1.55k, False: 0] ------------------ 286| 1.55k| return fuzz_spawn_command(ret_writefd, ret_readfd, ret_errfd, ret_pid); 287| 1.55k| } 288| 0|#endif 289| | 290| | /* redirect stdin/stdout/stderr */ 291| 0| if (pipe(infds) != 0) { ------------------ | Branch (291:6): [True: 0, False: 0] ------------------ 292| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 293| 0| } 294| 0| if (pipe(outfds) != 0) { ------------------ | Branch (294:6): [True: 0, False: 0] ------------------ 295| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 296| 0| } 297| 0| if (ret_errfd && pipe(errfds) != 0) { ------------------ | Branch (297:6): [True: 0, False: 0] | Branch (297:19): [True: 0, False: 0] ------------------ 298| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 299| 0| } 300| | 301| |#if DROPBEAR_VFORK 302| | pid = vfork(); 303| |#else 304| 0| pid = fork(); 305| 0|#endif 306| | 307| 0| if (pid < 0) { ------------------ | Branch (307:6): [True: 0, False: 0] ------------------ 308| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 309| 0| } 310| | 311| 0| if (!pid) { ------------------ | Branch (311:6): [True: 0, False: 0] ------------------ 312| | /* child */ 313| | 314| 0| TRACE(("back to normal sigchld")) 315| | /* Revert to normal sigchld handling */ 316| 0| if (signal(SIGCHLD, SIG_DFL) == SIG_ERR) { ------------------ | Branch (316:7): [True: 0, False: 0] ------------------ 317| 0| dropbear_exit("signal() error"); 318| 0| } 319| | 320| | /* redirect stdin/stdout */ 321| | 322| 0| if ((dup2(infds[FDIN], STDIN_FILENO) < 0) || ------------------ | Branch (322:7): [True: 0, False: 0] ------------------ 323| 0| (dup2(outfds[FDOUT], STDOUT_FILENO) < 0) || ------------------ | Branch (323:4): [True: 0, False: 0] ------------------ 324| 0| (ret_errfd && dup2(errfds[FDOUT], STDERR_FILENO) < 0)) { ------------------ | Branch (324:5): [True: 0, False: 0] | Branch (324:18): [True: 0, False: 0] ------------------ 325| 0| TRACE(("leave noptycommand: error redirecting FDs")) 326| 0| dropbear_exit("Child dup2() failure"); 327| 0| } 328| | 329| 0| close(infds[FDOUT]); ------------------ | | 56| 0|#define close(fd) wrapfd_close(fd) ------------------ 330| 0| close(infds[FDIN]); ------------------ | | 56| 0|#define close(fd) wrapfd_close(fd) ------------------ 331| 0| close(outfds[FDIN]); ------------------ | | 56| 0|#define close(fd) wrapfd_close(fd) ------------------ 332| 0| close(outfds[FDOUT]); ------------------ | | 56| 0|#define close(fd) wrapfd_close(fd) ------------------ 333| 0| if (ret_errfd) ------------------ | Branch (333:7): [True: 0, False: 0] ------------------ 334| 0| { 335| 0| close(errfds[FDIN]); ------------------ | | 56| 0|#define close(fd) wrapfd_close(fd) ------------------ 336| 0| close(errfds[FDOUT]); ------------------ | | 56| 0|#define close(fd) wrapfd_close(fd) ------------------ 337| 0| } 338| | 339| 0| exec_fn(exec_data); 340| | /* not reached */ 341| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 342| 0| } else { 343| | /* parent */ 344| 0| close(infds[FDIN]); ------------------ | | 56| 0|#define close(fd) wrapfd_close(fd) ------------------ 345| 0| close(outfds[FDOUT]); ------------------ | | 56| 0|#define close(fd) wrapfd_close(fd) ------------------ 346| | 347| 0| setnonblocking(outfds[FDIN]); 348| 0| setnonblocking(infds[FDOUT]); 349| | 350| 0| if (ret_errfd) { ------------------ | Branch (350:7): [True: 0, False: 0] ------------------ 351| 0| close(errfds[FDOUT]); ------------------ | | 56| 0|#define close(fd) wrapfd_close(fd) ------------------ 352| 0| setnonblocking(errfds[FDIN]); 353| 0| } 354| | 355| 0| if (ret_pid) { ------------------ | Branch (355:7): [True: 0, False: 0] ------------------ 356| 0| *ret_pid = pid; 357| 0| } 358| | 359| 0| *ret_writefd = infds[FDOUT]; 360| 0| *ret_readfd = outfds[FDIN]; 361| 0| if (ret_errfd) { ------------------ | Branch (361:7): [True: 0, False: 0] ------------------ 362| 0| *ret_errfd = errfds[FDIN]; 363| 0| } 364| 0| return DROPBEAR_SUCCESS; ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ 365| 0| } 366| 0|} m_close: 560| 23.1k|void m_close(int fd) { 561| 23.1k| int val; 562| | 563| 23.1k| if (fd < 0) { ------------------ | Branch (563:6): [True: 17.4k, False: 5.70k] ------------------ 564| 17.4k| return; 565| 17.4k| } 566| | 567| 5.70k| do { 568| 5.70k| val = close(fd); ------------------ | | 56| 5.70k|#define close(fd) wrapfd_close(fd) ------------------ 569| 5.70k| } while (val < 0 && errno == EINTR); ------------------ | Branch (569:11): [True: 0, False: 5.70k] | Branch (569:22): [True: 0, False: 0] ------------------ 570| | 571| 5.70k| if (val < 0 && errno != EBADF) { ------------------ | Branch (571:6): [True: 0, False: 5.70k] | Branch (571:17): [True: 0, False: 0] ------------------ 572| | /* Linux says EIO can happen */ 573| 0| dropbear_exit("Error closing fd %d, %s", fd, strerror(errno)); 574| 0| } 575| 5.70k|} setnonblocking: 577| 2.99k|void setnonblocking(int fd) { 578| | 579| 2.99k| TRACE(("setnonblocking: %d", fd)) 580| | 581| 2.99k|#if DROPBEAR_FUZZ 582| 2.99k| if (fuzz.fuzzing) { ------------------ | Branch (582:6): [True: 2.99k, False: 0] ------------------ 583| 2.99k| return; 584| 2.99k| } 585| 0|#endif 586| | 587| 0| if (fcntl(fd, F_SETFL, O_NONBLOCK) < 0) { ------------------ | Branch (587:6): [True: 0, False: 0] ------------------ 588| 0| if (errno == ENODEV) { ------------------ | Branch (588:7): [True: 0, False: 0] ------------------ 589| | /* Some devices (like /dev/null redirected in) 590| | * can't be set to non-blocking */ 591| 0| TRACE(("ignoring ENODEV for setnonblocking")) 592| 0| } else { 593| 0| { 594| 0| dropbear_exit("Couldn't set nonblocking"); 595| 0| } 596| 0| } 597| 0| } 598| 0| TRACE(("leave setnonblocking")) 599| 0|} disallow_core: 601| 1|void disallow_core() { 602| 1| struct rlimit lim = {0}; 603| 1| if (getrlimit(RLIMIT_CORE, &lim) < 0) { ------------------ | Branch (603:6): [True: 0, False: 1] ------------------ 604| 0| TRACE(("getrlimit(RLIMIT_CORE) failed")); 605| 0| } 606| 1| lim.rlim_cur = 0; 607| 1| if (setrlimit(RLIMIT_CORE, &lim) < 0) { ------------------ | Branch (607:6): [True: 0, False: 1] ------------------ 608| 0| TRACE(("setrlimit(RLIMIT_CORE) failed")); 609| 0| } 610| 1|} expand_homedir_path: 638| 66|char * expand_homedir_path(const char *inpath) { 639| 66| struct passwd *pw = NULL; 640| 66| if (strncmp(inpath, "~/", 2) == 0) { ------------------ | Branch (640:6): [True: 0, False: 66] ------------------ 641| 0| char *homedir = getenv("HOME"); 642| | 643| 0| if (!homedir) { ------------------ | Branch (643:7): [True: 0, False: 0] ------------------ 644| 0| pw = getpwuid(getuid()); ------------------ | | 109| 0|#define getpwuid(x) fuzz_getpwuid(x) ------------------ 645| 0| if (pw) { ------------------ | Branch (645:8): [True: 0, False: 0] ------------------ 646| 0| homedir = pw->pw_dir; 647| 0| } 648| 0| } 649| | 650| 0| if (homedir) { ------------------ | Branch (650:7): [True: 0, False: 0] ------------------ 651| 0| int len = strlen(inpath)-2 + strlen(homedir) + 2; 652| 0| char *buf = m_malloc(len); 653| 0| snprintf(buf, len, "%s/%s", homedir, inpath+2); 654| 0| return buf; 655| 0| } 656| 0| } 657| | 658| | /* Fallback */ 659| 66| return m_strdup(inpath); 660| 66|} gettime_wrapper: 675| 1.26M|void gettime_wrapper(struct timespec *now) { 676| 1.26M| struct timeval tv; 677| 1.26M|#if DROPBEAR_FUZZ 678| 1.26M| if (fuzz.fuzzing) { ------------------ | Branch (678:6): [True: 1.26M, False: 0] ------------------ 679| | /* time stands still when fuzzing */ 680| 1.26M| now->tv_sec = 5; 681| 1.26M| now->tv_nsec = 0; 682| 1.26M| } 683| 1.26M|#endif 684| | 685| 1.26M|#if defined(HAVE_CLOCK_GETTIME) && defined(CLOCK_MONOTONIC) 686| | /* POSIX monotonic clock. Newer Linux, BSD, MacOSX >10.12 */ 687| 1.26M| if (clock_gettime(CLOCK_MONOTONIC, now) == 0) { ------------------ | Branch (687:6): [True: 1.26M, False: 0] ------------------ 688| 1.26M| return; 689| 1.26M| } 690| 0|#endif 691| | 692| 0|#if defined(__linux__) && defined(SYS_clock_gettime) 693| 0| { 694| | /* Old linux toolchain - kernel might support it but not the build headers */ 695| | /* Also glibc <2.17 requires -lrt which we neglect to add */ 696| 0| static int linux_monotonic_failed = 0; 697| 0| if (!linux_monotonic_failed) { ------------------ | Branch (697:6): [True: 0, False: 0] ------------------ 698| | /* CLOCK_MONOTONIC isn't in some headers */ 699| 0| int clock_source_monotonic = 1; 700| 0| if (syscall(SYS_clock_gettime, clock_source_monotonic, now) == 0) { ------------------ | Branch (700:7): [True: 0, False: 0] ------------------ 701| 0| return; 702| 0| } else { 703| | /* Don't try again */ 704| 0| linux_monotonic_failed = 1; 705| 0| } 706| 0| } 707| 0| } 708| 0|#endif /* linux fallback clock_gettime */ 709| | 710| |#if defined(HAVE_MACH_ABSOLUTE_TIME) 711| | { 712| | /* OS X pre 10.12, see https://developer.apple.com/library/mac/qa/qa1398/_index.html */ 713| | static mach_timebase_info_data_t timebase_info; 714| | uint64_t scaled_time; 715| | if (timebase_info.denom == 0) { 716| | mach_timebase_info(&timebase_info); 717| | } 718| | scaled_time = mach_absolute_time() * timebase_info.numer / timebase_info.denom; 719| | now->tv_sec = scaled_time / 1000000000; 720| | now->tv_nsec = scaled_time % 1000000000; 721| | } 722| |#endif /* osx mach_absolute_time */ 723| | 724| | /* Fallback for everything else - this will sometimes go backwards */ 725| 0| gettimeofday(&tv, NULL); 726| 0| now->tv_sec = tv.tv_sec; 727| 0| now->tv_nsec = 1000*(long)tv.tv_usec; 728| 0|} monotonic_now: 731| 1.26M|time_t monotonic_now() { 732| 1.26M| struct timespec ts; 733| 1.26M| gettime_wrapper(&ts); 734| 1.26M| return ts.tv_sec; 735| 1.26M|} buf_get_dss_pub_key: 46| 1|int buf_get_dss_pub_key(buffer* buf, dropbear_dss_key *key) { 47| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 48| | 49| 1| TRACE(("enter buf_get_dss_pub_key")) 50| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 51| 1| m_mp_alloc_init_multi(&key->p, &key->q, &key->g, &key->y, NULL); 52| 1| key->x = NULL; 53| | 54| 1| buf_incrpos(buf, 4+SSH_SIGNKEY_DSS_LEN); /* int + "ssh-dss" */ ------------------ | | 111| 1|#define SSH_SIGNKEY_DSS_LEN 7 ------------------ 55| 1| if (buf_getmpint(buf, key->p) == DROPBEAR_FAILURE ------------------ | | 103| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (55:6): [True: 0, False: 1] ------------------ 56| 1| || buf_getmpint(buf, key->q) == DROPBEAR_FAILURE ------------------ | | 103| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (56:6): [True: 0, False: 1] ------------------ 57| 1| || buf_getmpint(buf, key->g) == DROPBEAR_FAILURE ------------------ | | 103| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (57:6): [True: 0, False: 1] ------------------ 58| 1| || buf_getmpint(buf, key->y) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (58:6): [True: 0, False: 1] ------------------ 59| 0| TRACE(("leave buf_get_dss_pub_key: failed reading mpints")) 60| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 61| 0| goto out; 62| 0| } 63| | 64| 1| if (mp_count_bits(key->p) != DSS_P_BITS) { ------------------ | | 44| 1|#define DSS_P_BITS 1024 ------------------ | Branch (64:6): [True: 0, False: 1] ------------------ 65| 0| dropbear_log(LOG_WARNING, "Bad DSS p"); 66| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 67| 0| goto out; 68| 0| } 69| | 70| 1| if (mp_count_bits(key->q) != DSS_Q_BITS) { ------------------ | | 45| 1|#define DSS_Q_BITS 160 ------------------ | Branch (70:6): [True: 0, False: 1] ------------------ 71| 0| dropbear_log(LOG_WARNING, "Bad DSS q"); 72| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 73| 0| goto out; 74| 0| } 75| | 76| | /* test 1 < g < p */ 77| 1| if (mp_cmp_d(key->g, 1) != MP_GT) { ------------------ | | 156| 1|#define MP_GT 1 /* greater than */ ------------------ | Branch (77:6): [True: 0, False: 1] ------------------ 78| 0| dropbear_log(LOG_WARNING, "Bad DSS g"); 79| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 80| 0| goto out; 81| 0| } 82| 1| if (mp_cmp(key->g, key->p) != MP_LT) { ------------------ | | 154| 1|#define MP_LT -1 /* less than */ ------------------ | Branch (82:6): [True: 0, False: 1] ------------------ 83| 0| dropbear_log(LOG_WARNING, "Bad DSS g"); 84| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 85| 0| goto out; 86| 0| } 87| | 88| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 89| 1| TRACE(("leave buf_get_dss_pub_key: success")) 90| 1|out: 91| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (91:6): [True: 0, False: 1] ------------------ 92| 0| m_mp_free_multi(&key->p, &key->q, &key->g, &key->y, NULL); 93| 0| } 94| 1| return ret; 95| 1|} buf_get_dss_priv_key: 100| 1|int buf_get_dss_priv_key(buffer* buf, dropbear_dss_key *key) { 101| | 102| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 103| | 104| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 105| | 106| 1| ret = buf_get_dss_pub_key(buf, key); 107| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (107:6): [True: 0, False: 1] ------------------ 108| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 109| 0| } 110| | 111| 1| m_mp_alloc_init_multi(&key->x, NULL); 112| 1| ret = buf_getmpint(buf, key->x); 113| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (113:6): [True: 0, False: 1] ------------------ 114| 0| m_mp_free_multi(&key->x, NULL); 115| 0| } 116| | 117| 1| return ret; 118| 1|} dss_key_free: 122| 1|void dss_key_free(dropbear_dss_key *key) { 123| | 124| 1| TRACE2(("enter dsa_key_free")) 125| 1| if (key == NULL) { ------------------ | Branch (125:6): [True: 1, False: 0] ------------------ 126| 1| TRACE2(("enter dsa_key_free: key == NULL")) 127| 1| return; 128| 1| } 129| 0| m_mp_free_multi(&key->p, &key->q, &key->g, &key->y, &key->x, NULL); 130| 0| m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 131| 0| TRACE2(("leave dsa_key_free")) 132| 0|} dropbear_ecc_fill_dp: 47| 1|void dropbear_ecc_fill_dp() { 48| 1| struct dropbear_ecc_curve **curve; 49| | /* libtomcrypt guarantees they're ordered by size */ 50| 1| const ltc_ecc_set_type *dp = ltc_ecc_sets; 51| 4| for (curve = dropbear_ecc_curves; *curve; curve++) { ------------------ | Branch (51:36): [True: 3, False: 1] ------------------ 52| 10| for (;dp->size > 0; dp++) { ------------------ | Branch (52:9): [True: 10, False: 0] ------------------ 53| 10| if (dp->size == (*curve)->ltc_size) { ------------------ | Branch (53:8): [True: 3, False: 7] ------------------ 54| 3| (*curve)->dp = dp; 55| 3| break; 56| 3| } 57| 10| } 58| 3| if (!(*curve)->dp) { ------------------ | Branch (58:7): [True: 0, False: 3] ------------------ 59| 0| dropbear_exit("Missing ECC params %s", (*curve)->name); 60| 0| } 61| 3| } 62| 1|} new_ecc_key: 75| 1|ecc_key * new_ecc_key(void) { 76| 1| ecc_key *key = m_malloc(sizeof(*key)); 77| 1| m_mp_alloc_init_multi((mp_int**)&key->pubkey.x, (mp_int**)&key->pubkey.y, 78| 1| (mp_int**)&key->pubkey.z, (mp_int**)&key->k, NULL); 79| 1| return key; 80| 1|} buf_get_ecc_raw_pubkey: 147| 1|ecc_key * buf_get_ecc_raw_pubkey(buffer *buf, const struct dropbear_ecc_curve *curve) { 148| 1| ecc_key *key = NULL; 149| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 150| 1| const unsigned int size = curve->dp->size; 151| 1| unsigned char first; 152| | 153| 1| TRACE(("enter buf_get_ecc_raw_pubkey")) 154| | 155| 1| buf_setpos(buf, 0); 156| 1| first = buf_getbyte(buf); 157| 1| if (first == 2 || first == 3) { ------------------ | Branch (157:6): [True: 0, False: 1] | Branch (157:20): [True: 0, False: 1] ------------------ 158| 0| dropbear_log(LOG_WARNING, "Dropbear doesn't support ECC point compression"); 159| 0| return NULL; 160| 0| } 161| 1| if (first != 4 || buf->len != 1+2*size) { ------------------ | Branch (161:6): [True: 0, False: 1] | Branch (161:20): [True: 0, False: 1] ------------------ 162| 0| TRACE(("leave, wrong size")) 163| 0| return NULL; 164| 0| } 165| | 166| 1| key = new_ecc_key(); 167| 1| key->dp = curve->dp; 168| | 169| 1| if (mp_from_ubin(key->pubkey.x, buf_getptr(buf, size), size) != MP_OKAY) { ------------------ | | 161| 1|#define MP_OKAY 0 /* no error */ ------------------ | Branch (169:6): [True: 0, False: 1] ------------------ 170| 0| TRACE(("failed to read x")) 171| 0| goto out; 172| 0| } 173| 1| buf_incrpos(buf, size); 174| | 175| 1| if (mp_from_ubin(key->pubkey.y, buf_getptr(buf, size), size) != MP_OKAY) { ------------------ | | 161| 1|#define MP_OKAY 0 /* no error */ ------------------ | Branch (175:6): [True: 0, False: 1] ------------------ 176| 0| TRACE(("failed to read y")) 177| 0| goto out; 178| 0| } 179| 1| buf_incrpos(buf, size); 180| | 181| 1| mp_set(key->pubkey.z, 1); 182| | 183| 1| if (ecc_is_point(key) != CRYPT_OK) { ------------------ | Branch (183:6): [True: 0, False: 1] ------------------ 184| 0| TRACE(("failed, not a point")) 185| 0| goto out; 186| 0| } 187| | 188| | /* SEC1 3.2.3.1 Check that Q != 0 */ 189| 1| if (mp_cmp_d(key->pubkey.x, 0) == LTC_MP_EQ) { ------------------ | | 13| 1|#define LTC_MP_EQ 0 ------------------ | Branch (189:6): [True: 0, False: 1] ------------------ 190| 0| TRACE(("failed, x == 0")) 191| 0| goto out; 192| 0| } 193| 1| if (mp_cmp_d(key->pubkey.y, 0) == LTC_MP_EQ) { ------------------ | | 13| 1|#define LTC_MP_EQ 0 ------------------ | Branch (193:6): [True: 0, False: 1] ------------------ 194| 0| TRACE(("failed, y == 0")) 195| 0| goto out; 196| 0| } 197| | 198| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 199| | 200| 1| out: 201| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (201:6): [True: 0, False: 1] ------------------ 202| 0| if (key) { ------------------ | Branch (202:7): [True: 0, False: 0] ------------------ 203| 0| ecc_free(key); 204| 0| m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 205| 0| key = NULL; 206| 0| } 207| 0| } 208| | 209| 1| return key; 210| | 211| 1|} ecc.c:ecc_is_point: 85| 1|{ 86| 1| mp_int *prime, *b, *t1, *t2; 87| 1| int err; 88| | 89| 1| m_mp_alloc_init_multi(&prime, &b, &t1, &t2, NULL); 90| | 91| | /* load prime and b */ 92| 1| if ((err = mp_read_radix(prime, key->dp->prime, 16)) != CRYPT_OK) { goto error; } ------------------ | Branch (92:6): [True: 0, False: 1] ------------------ 93| 1| if ((err = mp_read_radix(b, key->dp->B, 16)) != CRYPT_OK) { goto error; } ------------------ | Branch (93:6): [True: 0, False: 1] ------------------ 94| | 95| | /* compute y^2 */ 96| 1| if ((err = mp_sqr(key->pubkey.y, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (96:6): [True: 0, False: 1] ------------------ 97| | 98| | /* compute x^3 */ 99| 1| if ((err = mp_sqr(key->pubkey.x, t2)) != CRYPT_OK) { goto error; } ------------------ | Branch (99:6): [True: 0, False: 1] ------------------ 100| 1| if ((err = mp_mod(t2, prime, t2)) != CRYPT_OK) { goto error; } ------------------ | Branch (100:6): [True: 0, False: 1] ------------------ 101| 1| if ((err = mp_mul(key->pubkey.x, t2, t2)) != CRYPT_OK) { goto error; } ------------------ | Branch (101:6): [True: 0, False: 1] ------------------ 102| | 103| | /* compute y^2 - x^3 */ 104| 1| if ((err = mp_sub(t1, t2, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (104:6): [True: 0, False: 1] ------------------ 105| | 106| | /* compute y^2 - x^3 + 3x */ 107| 1| if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (107:6): [True: 0, False: 1] ------------------ 108| 1| if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (108:6): [True: 0, False: 1] ------------------ 109| 1| if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (109:6): [True: 0, False: 1] ------------------ 110| 1| if ((err = mp_mod(t1, prime, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (110:6): [True: 0, False: 1] ------------------ 111| 1| while (mp_cmp_d(t1, 0) == LTC_MP_LT) { ------------------ | | 12| 1|#define LTC_MP_LT -1 ------------------ | Branch (111:9): [True: 0, False: 1] ------------------ 112| 0| if ((err = mp_add(t1, prime, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (112:7): [True: 0, False: 0] ------------------ 113| 0| } 114| 1| while (mp_cmp(t1, prime) != LTC_MP_LT) { ------------------ | | 12| 1|#define LTC_MP_LT -1 ------------------ | Branch (114:9): [True: 0, False: 1] ------------------ 115| 0| if ((err = mp_sub(t1, prime, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (115:7): [True: 0, False: 0] ------------------ 116| 0| } 117| | 118| | /* compare to b */ 119| 1| if (mp_cmp(t1, b) != LTC_MP_EQ) { ------------------ | | 13| 1|#define LTC_MP_EQ 0 ------------------ | Branch (119:6): [True: 0, False: 1] ------------------ 120| 0| err = CRYPT_INVALID_PACKET; 121| 1| } else { 122| 1| err = CRYPT_OK; 123| 1| } 124| | 125| 1| error: 126| 1| mp_clear_multi(prime, b, t1, t2, NULL); 127| 1| m_free(prime); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 128| 1| m_free(b); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 129| 1| m_free(t1); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 130| 1| m_free(t2); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 131| 1| return err; 132| 1|} signkey_is_ecdsa: 11| 4|{ 12| 4| return type == DROPBEAR_SIGNKEY_ECDSA_NISTP256 ------------------ | Branch (12:9): [True: 1, False: 3] ------------------ 13| 4| || type == DROPBEAR_SIGNKEY_ECDSA_NISTP384 ------------------ | Branch (13:6): [True: 0, False: 3] ------------------ 14| 4| || type == DROPBEAR_SIGNKEY_ECDSA_NISTP521; ------------------ | Branch (14:6): [True: 0, False: 3] ------------------ 15| 4|} buf_get_ecdsa_pub_key: 77| 1|ecc_key *buf_get_ecdsa_pub_key(buffer* buf) { 78| 1| unsigned char *key_ident = NULL, *identifier = NULL; 79| 1| unsigned int key_ident_len, identifier_len; 80| 1| buffer *q_buf = NULL; 81| 1| struct dropbear_ecc_curve **curve; 82| 1| ecc_key *new_key = NULL; 83| | 84| | /* string "ecdsa-sha2-[identifier]" or "sk-ecdsa-sha2-nistp256@openssh.com" */ 85| 1| key_ident = (unsigned char*)buf_getstring(buf, &key_ident_len); 86| | /* string "[identifier]" */ 87| 1| identifier = (unsigned char*)buf_getstring(buf, &identifier_len); 88| | 89| 1| if (strcmp (key_ident, "sk-ecdsa-sha2-nistp256@openssh.com") == 0) { ------------------ | Branch (89:6): [True: 0, False: 1] ------------------ 90| 0| if (strcmp (identifier, "nistp256") != 0) { ------------------ | Branch (90:7): [True: 0, False: 0] ------------------ 91| 0| TRACE(("mismatching identifiers")) 92| 0| goto out; 93| 0| } 94| 1| } else { 95| 1| if (key_ident_len != identifier_len + strlen ("ecdsa-sha2-")) { ------------------ | Branch (95:7): [True: 0, False: 1] ------------------ 96| 0| TRACE(("Bad identifier lengths")) 97| 0| goto out; 98| 0| } 99| 1| if (memcmp(&key_ident[strlen ("ecdsa-sha2-")], identifier, identifier_len) != 0) { ------------------ | Branch (99:7): [True: 0, False: 1] ------------------ 100| 0| TRACE(("mismatching identifiers")) 101| 0| goto out; 102| 0| } 103| 1| } 104| | 105| 1| for (curve = dropbear_ecc_curves; *curve; curve++) { ------------------ | Branch (105:36): [True: 1, False: 0] ------------------ 106| 1| if (memcmp(identifier, (char*)(*curve)->name, strlen((char*)(*curve)->name)) == 0) { ------------------ | Branch (106:7): [True: 1, False: 0] ------------------ 107| 1| break; 108| 1| } 109| 1| } 110| 1| if (!*curve) { ------------------ | Branch (110:6): [True: 0, False: 1] ------------------ 111| 0| TRACE(("couldn't match ecc curve")) 112| 0| goto out; 113| 0| } 114| | 115| | /* string Q */ 116| 1| q_buf = buf_getstringbuf(buf); 117| 1| new_key = buf_get_ecc_raw_pubkey(q_buf, *curve); 118| | 119| 1|out: 120| 1| m_free(key_ident); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 121| 1| m_free(identifier); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 122| 1| if (q_buf) { ------------------ | Branch (122:6): [True: 1, False: 0] ------------------ 123| 1| buf_free(q_buf); 124| 1| q_buf = NULL; 125| 1| } 126| 1| TRACE(("leave buf_get_ecdsa_pub_key")) 127| 1| return new_key; 128| 1|} buf_get_ecdsa_priv_key: 130| 1|ecc_key *buf_get_ecdsa_priv_key(buffer *buf) { 131| 1| ecc_key *new_key = NULL; 132| 1| TRACE(("enter buf_get_ecdsa_priv_key")) 133| 1| new_key = buf_get_ecdsa_pub_key(buf); 134| 1| if (!new_key) { ------------------ | Branch (134:6): [True: 0, False: 1] ------------------ 135| 0| return NULL; 136| 0| } 137| | 138| 1| if (buf_getmpint(buf, new_key->k) != DROPBEAR_SUCCESS) { ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (138:6): [True: 0, False: 1] ------------------ 139| 0| ecc_free(new_key); 140| 0| m_free(new_key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 141| 0| return NULL; 142| 0| } 143| | 144| 1| return new_key; 145| 1|} buf_get_ed25519_priv_key: 78| 1|int buf_get_ed25519_priv_key(buffer *buf, dropbear_ed25519_key *key) { 79| | 80| 1| unsigned int len; 81| | 82| 1| TRACE(("enter buf_get_ed25519_priv_key")) 83| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 84| | 85| 1| buf_incrpos(buf, 4+SSH_SIGNKEY_ED25519_LEN); /* int + "ssh-ed25519" */ ------------------ | | 115| 1|#define SSH_SIGNKEY_ED25519_LEN 11 ------------------ 86| | 87| 1| len = buf_getint(buf); 88| 1| if (len != CURVE25519_LEN*2 || buf->len - buf->pos < len) { ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ | Branch (88:6): [True: 0, False: 1] | Branch (88:33): [True: 0, False: 1] ------------------ 89| 0| TRACE(("leave buf_get_ed25519_priv_key: failure")) 90| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 91| 0| } 92| | 93| 1| memcpy(key->priv, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ memcpy(key->priv, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 94| 1| buf_incrpos(buf, CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 95| 1| memcpy(key->pub, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ memcpy(key->pub, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 96| 1| buf_incrpos(buf, CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 97| | 98| 1| TRACE(("leave buf_get_ed25519_priv_key: success")) 99| 1| return DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 100| 1|} ed25519_key_free: 103| 1|void ed25519_key_free(dropbear_ed25519_key *key) { 104| | 105| 1| TRACE2(("enter ed25519_key_free")) 106| | 107| 1| if (key == NULL) { ------------------ | Branch (107:6): [True: 1, False: 0] ------------------ 108| 1| TRACE2(("leave ed25519_key_free: key == NULL")) 109| 1| return; 110| 1| } 111| 0| m_burn(key->priv, CURVE25519_LEN); ------------------ | | 34| 0|#define CURVE25519_LEN 32 ------------------ 112| 0| m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 113| | 114| 0| TRACE2(("leave ed25519_key_free")) 115| 0|} list_append: 5| 98|void list_append(m_list *list, void *item) { 6| 98| m_list_elem *elem; 7| | 8| 98| elem = m_malloc(sizeof(*elem)); 9| 98| elem->item = item; 10| 98| elem->list = list; 11| 98| elem->next = NULL; 12| 98| if (!list->first) { ------------------ | Branch (12:6): [True: 98, False: 0] ------------------ 13| 98| list->first = elem; 14| 98| elem->prev = NULL; 15| 98| } else { 16| 0| elem->prev = list->last; 17| 0| list->last->next = elem; 18| 0| } 19| 98| list->last = elem; 20| 98|} list_remove: 28| 98|void * list_remove(m_list_elem *elem) { 29| 98| void *item = elem->item; 30| 98| m_list *list = elem->list; 31| 98| if (list->first == elem) ------------------ | Branch (31:6): [True: 98, False: 0] ------------------ 32| 98| { 33| 98| list->first = elem->next; 34| 98| } 35| 98| if (list->last == elem) ------------------ | Branch (35:6): [True: 98, False: 0] ------------------ 36| 98| { 37| 98| list->last = elem->prev; 38| 98| } 39| 98| if (elem->prev) ------------------ | Branch (39:6): [True: 0, False: 98] ------------------ 40| 0| { 41| 0| elem->prev->next = elem->next; 42| 0| } 43| 98| if (elem->next) ------------------ | Branch (43:6): [True: 0, False: 98] ------------------ 44| 0| { 45| 0| elem->next->prev = elem->prev; 46| 0| } 47| 98| m_free(elem); ------------------ | | 24| 98|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 48| 98| return item; 49| 98|} listeners_initialise: 30| 1.49k|void listeners_initialise() { 31| | 32| | /* just one slot to start with */ 33| 1.49k| ses.listeners = (struct Listener**)m_malloc(sizeof(struct Listener*)); 34| 1.49k| ses.listensize = 1; 35| 1.49k| ses.listeners[0] = NULL; 36| | 37| 1.49k|} set_listener_fds: 39| 458k|void set_listener_fds(fd_set * readfds) { 40| | 41| 458k| unsigned int i, j; 42| 458k| struct Listener *listener; 43| | 44| | /* check each in turn */ 45| 916k| for (i = 0; i < ses.listensize; i++) { ------------------ | Branch (45:14): [True: 458k, False: 458k] ------------------ 46| 458k| listener = ses.listeners[i]; 47| 458k| if (listener != NULL) { ------------------ | Branch (47:7): [True: 0, False: 458k] ------------------ 48| 0| for (j = 0; j < listener->nsocks; j++) { ------------------ | Branch (48:16): [True: 0, False: 0] ------------------ 49| 0| FD_SET(listener->socks[j], readfds); 50| 0| } 51| 0| } 52| 458k| } 53| 458k|} handle_listeners: 56| 456k|void handle_listeners(const fd_set * readfds) { 57| | 58| 456k| unsigned int i, j; 59| 456k| struct Listener *listener; 60| 456k| int sock; 61| | 62| | /* check each in turn */ 63| 913k| for (i = 0; i < ses.listensize; i++) { ------------------ | Branch (63:14): [True: 456k, False: 456k] ------------------ 64| 456k| listener = ses.listeners[i]; 65| 456k| if (listener != NULL) { ------------------ | Branch (65:7): [True: 0, False: 456k] ------------------ 66| 0| for (j = 0; j < listener->nsocks; j++) { ------------------ | Branch (66:16): [True: 0, False: 0] ------------------ 67| 0| sock = listener->socks[j]; 68| 0| if (FD_ISSET(sock, readfds)) { 69| 0| listener->acceptor(listener, sock); 70| 0| } 71| 0| } 72| 0| } 73| 456k| } 74| 456k|} /* Woo brace matching */ get_listener: 136| 68| int (*match)(const void*, const void*)) { 137| | 138| 68| unsigned int i; 139| 68| struct Listener* listener; 140| | 141| 136| for (i = 0, listener = ses.listeners[i]; i < ses.listensize; i++) { ------------------ | Branch (141:43): [True: 68, False: 68] ------------------ 142| 68| if (listener && listener->type == type ------------------ | Branch (142:7): [True: 0, False: 68] | Branch (142:19): [True: 0, False: 0] ------------------ 143| 68| && match(typedata, listener->typedata)) { ------------------ | Branch (143:8): [True: 0, False: 0] ------------------ 144| 0| return listener; 145| 0| } 146| 68| } 147| | 148| 68| return NULL; 149| 68|} remove_all_listeners: 166| 1.49k|void remove_all_listeners(void) { 167| 1.49k| unsigned int i; 168| 2.99k| for (i = 0; i < ses.listensize; i++) { ------------------ | Branch (168:14): [True: 1.49k, False: 1.49k] ------------------ 169| 1.49k| if (ses.listeners[i]) { ------------------ | Branch (169:7): [True: 0, False: 1.49k] ------------------ 170| 0| remove_listener(ses.listeners[i]); 171| 0| } 172| 1.49k| } 173| 1.49k| m_free(ses.listeners); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 174| 1.49k|} login_logout: 219| 8|{ 220| 8| li->type = LTYPE_LOGOUT; ------------------ | | 119| 8|#define LTYPE_LOGOUT 8 ------------------ 221| 8| return login_write(li); 222| 8|} login_alloc_entry: 237| 8|{ 238| 8| struct logininfo *newli; 239| | 240| 8| newli = (struct logininfo *) m_malloc (sizeof(*newli)); 241| 8| (void)login_init_entry(newli, pid, username, hostname, line); 242| 8| return newli; 243| 8|} login_free_entry: 249| 8|{ 250| 8| m_free(li); ------------------ | | 24| 8|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 251| 8|} login_init_entry: 265| 8|{ 266| 8| struct passwd *pw; 267| | 268| 8| memset(li, 0, sizeof(*li)); 269| | 270| 8| li->pid = pid; 271| | 272| | /* set the line information */ 273| 8| if (line) ------------------ | Branch (273:6): [True: 8, False: 0] ------------------ 274| 8| line_fullname(li->line, line, sizeof(li->line)); 275| | 276| 8| if (username) { ------------------ | Branch (276:6): [True: 0, False: 8] ------------------ 277| 0| strlcpy(li->username, username, sizeof(li->username)); 278| 0| pw = getpwnam(li->username); ------------------ | | 108| 0|#define getpwnam(x) fuzz_getpwnam(x) ------------------ 279| 0| if (pw == NULL) ------------------ | Branch (279:7): [True: 0, False: 0] ------------------ 280| 0| dropbear_exit("login_init_entry: Cannot find user \"%s\"", 281| 0| li->username); 282| 0| li->uid = pw->pw_uid; 283| 0| } 284| | 285| 8| if (hostname) ------------------ | Branch (285:6): [True: 8, False: 0] ------------------ 286| 8| strlcpy(li->hostname, hostname, sizeof(li->hostname)); 287| | 288| 8| return 1; 289| 8|} login_set_current_time: 299| 8|{ 300| 8| struct timeval tv; 301| | 302| 8| gettimeofday(&tv, NULL); 303| | 304| 8| li->tv_sec = tv.tv_sec; 305| 8| li->tv_usec = tv.tv_usec; 306| 8|} login_write: 314| 8|{ 315| 8|#ifndef HAVE_CYGWIN 316| 8| if ((int)geteuid() != 0) { ------------------ | Branch (316:6): [True: 0, False: 8] ------------------ 317| 0| return 1; 318| 0| } 319| 8|#endif 320| | 321| | /* set the timestamp */ 322| 8| login_set_current_time(li); 323| 8|#ifdef USE_LOGIN 324| 8| syslogin_write_entry(li); 325| 8|#endif 326| 8|#ifdef USE_LASTLOG 327| 8| if (li->type == LTYPE_LOGIN) { ------------------ | | 118| 8|#define LTYPE_LOGIN 7 ------------------ | Branch (327:6): [True: 0, False: 8] ------------------ 328| 0| lastlog_write_entry(li); 329| 0| } 330| 8|#endif 331| |#ifdef USE_UTMP 332| | utmp_write_entry(li); 333| |#endif 334| |#ifdef USE_WTMP 335| | wtmp_write_entry(li); 336| |#endif 337| |#ifdef USE_UTMPX 338| | utmpx_write_entry(li); 339| |#endif 340| |#ifdef USE_WTMPX 341| | wtmpx_write_entry(li); 342| |#endif 343| 8| return 0; 344| 8|} line_fullname: 391| 8|{ 392| 8| memset(dst, '\0', dstsize); 393| 8| if ((strncmp(src, "/dev/", 5) == 0) || (dstsize < (strlen(src) + 5))) { ------------------ | Branch (393:6): [True: 8, False: 0] | Branch (393:41): [True: 0, False: 0] ------------------ 394| 8| strlcpy(dst, src, dstsize); 395| 8| } else { 396| 0| strlcpy(dst, "/dev/", dstsize); 397| 0| strlcat(dst, src, dstsize); 398| 0| } 399| 8| return dst; 400| 8|} line_stripname: 405| 8|{ 406| 8| memset(dst, '\0', dstsize); 407| 8| if (strncmp(src, "/dev/", 5) == 0) ------------------ | Branch (407:6): [True: 8, False: 0] ------------------ 408| 8| strlcpy(dst, src + 5, dstsize); 409| 0| else 410| 0| strlcpy(dst, src, dstsize); 411| 8| return dst; 412| 8|} syslogin_write_entry: 1243| 8|{ 1244| 8| switch (li->type) { 1245| 0| case LTYPE_LOGIN: ------------------ | | 118| 0|#define LTYPE_LOGIN 7 ------------------ | Branch (1245:2): [True: 0, False: 8] ------------------ 1246| 0| return syslogin_perform_login(li); 1247| 8| case LTYPE_LOGOUT: ------------------ | | 119| 8|#define LTYPE_LOGOUT 8 ------------------ | Branch (1247:2): [True: 8, False: 0] ------------------ 1248| 8| return syslogin_perform_logout(li); 1249| 0| default: ------------------ | Branch (1249:2): [True: 0, False: 8] ------------------ 1250| 0| dropbear_log(LOG_WARNING, "syslogin_write_entry: Invalid type field"); 1251| 0| return 0; 1252| 8| } 1253| 8|} loginrec.c:syslogin_perform_logout: 1220| 8|{ 1221| 8|# ifdef HAVE_LOGOUT 1222| 8| char line[8]; 1223| | 1224| 8| (void)line_stripname(line, li->line, sizeof(line)); 1225| | 1226| 8| if (!logout(line)) { ------------------ | Branch (1226:6): [True: 8, False: 0] ------------------ 1227| 8| dropbear_log(LOG_WARNING, "syslogin_perform_logout: logout(%s) returned an error: %s", line, strerror(errno)); 1228| 8|# ifdef HAVE_LOGWTMP 1229| 8| } else { 1230| 0| logwtmp(line, "", ""); 1231| 0|# endif 1232| 0| } 1233| | /* FIXME: (ATL - if the need arises) What to do if we have 1234| | * login, but no logout? what if logout but no logwtmp? All 1235| | * routines are in libutil so they should all be there, 1236| | * but... */ 1237| 8|# endif 1238| 8| return 1; 1239| 8|} cancel_connect: 52| 98|void cancel_connect(struct dropbear_progress_connection *c) { 53| 98| c->cb = cancel_callback; 54| 98| c->cb_data = NULL; 55| 98|} connect_remote: 180| 98|{ 181| 98| struct dropbear_progress_connection *c = NULL; 182| 98| int err; 183| 98| struct addrinfo hints; 184| | 185| 98| c = m_malloc(sizeof(*c)); 186| 98| c->remotehost = m_strdup(remotehost); 187| 98| c->remoteport = m_strdup(remoteport); 188| 98| c->sock = -1; 189| 98| c->cb = cb; 190| 98| c->cb_data = cb_data; 191| 98| c->prio = prio; 192| | 193| 98| list_append(&ses.conn_pending, c); 194| | 195| 98|#if DROPBEAR_FUZZ 196| 98| if (fuzz.fuzzing) { ------------------ | Branch (196:6): [True: 98, False: 0] ------------------ 197| 98| c->errstring = m_strdup("fuzzing connect_remote always fails"); 198| 98| return c; 199| 98| } 200| 0|#endif 201| | 202| 0| memset(&hints, 0, sizeof(hints)); 203| 0| hints.ai_socktype = SOCK_STREAM; 204| 0| hints.ai_family = AF_UNSPEC; 205| | 206| 0| err = getaddrinfo(remotehost, remoteport, &hints, &c->res); 207| 0| if (err) { ------------------ | Branch (207:6): [True: 0, False: 0] ------------------ 208| 0| int len; 209| 0| len = 100 + strlen(gai_strerror(err)); 210| 0| c->errstring = (char*)m_malloc(len); 211| 0| snprintf(c->errstring, len, "Error resolving '%s' port '%s'. %s", 212| 0| remotehost, remoteport, gai_strerror(err)); 213| 0| TRACE(("Error resolving: %s", gai_strerror(err))) 214| 0| } else { 215| 0| c->res_iter = c->res; 216| 0| } 217| | 218| 0| if (bind_address) { ------------------ | Branch (218:6): [True: 0, False: 0] ------------------ 219| 0| c->bind_address = m_strdup(bind_address); 220| 0| } 221| 0| if (bind_port) { ------------------ | Branch (221:6): [True: 0, False: 0] ------------------ 222| 0| c->bind_port = m_strdup(bind_port); 223| 0| } 224| | 225| 0| return c; 226| 98|} remove_connect_pending: 228| 1.49k|void remove_connect_pending() { 229| 1.49k| while (ses.conn_pending.first) { ------------------ | Branch (229:9): [True: 1, False: 1.49k] ------------------ 230| 1| struct dropbear_progress_connection *c = ses.conn_pending.first->item; 231| 1| remove_connect(c, ses.conn_pending.first); 232| 1| } 233| 1.49k|} set_connect_fds: 236| 458k|void set_connect_fds(fd_set *writefd) { 237| 458k| m_list_elem *iter; 238| 458k| iter = ses.conn_pending.first; 239| 458k| while (iter) { ------------------ | Branch (239:9): [True: 97, False: 458k] ------------------ 240| 97| m_list_elem *next_iter = iter->next; 241| 97| struct dropbear_progress_connection *c = iter->item; 242| | /* Set one going */ 243| 97| while (c->res_iter && c->sock < 0) { ------------------ | Branch (243:10): [True: 0, False: 97] | Branch (243:25): [True: 0, False: 0] ------------------ 244| 0| connect_try_next(c); 245| 0| } 246| 97| if (c->sock >= 0) { ------------------ | Branch (246:7): [True: 0, False: 97] ------------------ 247| 0| FD_SET(c->sock, writefd); 248| 97| } else { 249| | /* Final failure */ 250| 97| if (!c->errstring) { ------------------ | Branch (250:8): [True: 0, False: 97] ------------------ 251| 0| c->errstring = m_strdup("unexpected failure"); 252| 0| } 253| 97| c->cb(DROPBEAR_FAILURE, -1, c->cb_data, c->errstring); ------------------ | | 103| 97|#define DROPBEAR_FAILURE -1 ------------------ 254| 97| remove_connect(c, iter); 255| 97| } 256| 97| iter = next_iter; 257| 97| } 258| 458k|} handle_connect_fds: 260| 456k|void handle_connect_fds(const fd_set *writefd) { 261| 456k| m_list_elem *iter; 262| 456k| for (iter = ses.conn_pending.first; iter; iter = iter->next) { ------------------ | Branch (262:38): [True: 98, False: 456k] ------------------ 263| 98| int val; 264| 98| socklen_t vallen = sizeof(val); 265| 98| struct dropbear_progress_connection *c = iter->item; 266| | 267| 98| if (c->sock < 0 || !FD_ISSET(c->sock, writefd)) { ------------------ | Branch (267:7): [True: 98, False: 0] | Branch (267:22): [True: 0, False: 0] ------------------ 268| 98| continue; 269| 98| } 270| | 271| 0| TRACE(("handling %s port %s socket %d", c->remotehost, c->remoteport, c->sock)); 272| | 273| 0| if (getsockopt(c->sock, SOL_SOCKET, SO_ERROR, &val, &vallen) != 0) { ------------------ | Branch (273:7): [True: 0, False: 0] ------------------ 274| 0| TRACE(("handle_connect_fds getsockopt(%d) SO_ERROR failed: %s", c->sock, strerror(errno))) 275| | /* This isn't expected to happen - Unix has surprises though, continue gracefully. */ 276| 0| m_close(c->sock); 277| 0| c->sock = -1; 278| 0| } else if (val != 0) { ------------------ | Branch (278:14): [True: 0, False: 0] ------------------ 279| | /* Connect failed */ 280| 0| TRACE(("connect to %s port %s failed.", c->remotehost, c->remoteport)) 281| 0| m_close(c->sock); 282| 0| c->sock = -1; 283| | 284| 0| m_free(c->errstring); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 285| 0| c->errstring = m_strdup(strerror(val)); 286| 0| } else { 287| | /* New connection has been established */ 288| 0| c->cb(DROPBEAR_SUCCESS, c->sock, c->cb_data, NULL); ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ 289| 0| remove_connect(c, iter); 290| 0| TRACE(("leave handle_connect_fds - success")) 291| | /* Must return here - remove_connect() invalidates iter */ 292| 0| return; 293| 0| } 294| 0| } 295| 456k|} packet_queue_to_iovec: 301| 234k|void packet_queue_to_iovec(const struct Queue *queue, struct iovec *iov, unsigned int *iov_count) { 302| 234k| struct Link *l; 303| 234k| unsigned int i; 304| 234k| int len; 305| 234k| buffer *writebuf; 306| | 307| |#ifndef IOV_MAX 308| | #if defined(__CYGWIN__) && !defined(UIO_MAXIOV) 309| | #define IOV_MAX 1024 310| | #elif defined(__sgi) 311| | #define IOV_MAX 512 312| | #else 313| | #define IOV_MAX UIO_MAXIOV 314| | #endif 315| |#endif 316| | 317| 234k| *iov_count = MIN(MIN(queue->count, IOV_MAX), *iov_count); 318| | 319| 2.77M| for (l = queue->head, i = 0; i < *iov_count; l = l->link, i++) ------------------ | Branch (319:31): [True: 2.53M, False: 234k] ------------------ 320| 2.53M| { 321| 2.53M| writebuf = (buffer*)l->item; 322| 2.53M| len = writebuf->len - writebuf->pos; 323| 2.53M| dropbear_assert(len > 0); ------------------ | | 83| 2.53M|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 2.53M] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 324| 2.53M| TRACE2(("write_packet writev #%d len %d/%d", i, 325| 2.53M| len, writebuf->len)) 326| 2.53M| iov[i].iov_base = buf_getptr(writebuf, len); 327| 2.53M| iov[i].iov_len = len; 328| 2.53M| } 329| 234k|} packet_queue_consume: 331| 234k|void packet_queue_consume(struct Queue *queue, ssize_t written) { 332| 234k| buffer *writebuf; 333| 234k| int len; 334| 469k| while (written > 0) { ------------------ | Branch (334:9): [True: 234k, False: 234k] ------------------ 335| 234k| writebuf = (buffer*)examine(queue); 336| 234k| len = writebuf->len - writebuf->pos; 337| 234k| if (len > written) { ------------------ | Branch (337:7): [True: 0, False: 234k] ------------------ 338| | /* partial buffer write */ 339| 0| buf_incrpos(writebuf, written); 340| 0| written = 0; 341| 234k| } else { 342| 234k| written -= len; 343| 234k| dequeue(queue); 344| 234k| buf_free(writebuf); 345| 234k| } 346| 234k| } 347| 234k|} set_sock_priority: 367| 3.17k|void set_sock_priority(int sock, enum dropbear_prio prio) { 368| | 369| 3.17k| int rc; 370| 3.17k| int val; 371| | 372| 3.17k|#if DROPBEAR_FUZZ 373| 3.17k| if (fuzz.fuzzing) { ------------------ | Branch (373:6): [True: 3.17k, False: 0] ------------------ 374| 3.17k| TRACE(("fuzzing skips set_sock_prio")) 375| 3.17k| return; 376| 3.17k| } 377| 0|#endif 378| | /* Don't log ENOTSOCK errors so that this can harmlessly be called 379| | * on a client '-J' proxy pipe */ 380| | 381| 0| if (opts.disable_ip_tos == 0) { ------------------ | Branch (381:6): [True: 0, False: 0] ------------------ 382| 0|#ifdef IP_TOS 383| | /* Set the DSCP field for outbound IP packet priority. 384| | rfc4594 has some guidance to meanings. 385| | 386| | We set AF21 as "Low-Latency" class for interactive (tty session, 387| | also handshake/setup packets). Other traffic is left at the default. 388| | 389| | OpenSSH at present uses AF21/CS1, rationale 390| | https://cvsweb.openbsd.org/src/usr.bin/ssh/readconf.c#rev1.284 391| | 392| | Old Dropbear/OpenSSH and Debian/Ubuntu OpenSSH (at Jan 2022) use 393| | IPTOS_LOWDELAY/IPTOS_THROUGHPUT 394| | 395| | DSCP constants are from Linux headers, applicable to other platforms 396| | such as macos. 397| | */ 398| 0| if (prio == DROPBEAR_PRIO_LOWDELAY) { ------------------ | Branch (398:6): [True: 0, False: 0] ------------------ 399| 0| val = 0x48; /* IPTOS_DSCP_AF21 */ 400| 0| } else { 401| 0| val = 0; /* default */ 402| 0| } 403| 0|#if defined(IPPROTO_IPV6) && defined(IPV6_TCLASS) 404| 0| rc = setsockopt(sock, IPPROTO_IPV6, IPV6_TCLASS, (void*)&val, sizeof(val)); 405| 0| if (rc < 0 && errno != ENOTSOCK) { ------------------ | Branch (405:6): [True: 0, False: 0] | Branch (405:16): [True: 0, False: 0] ------------------ 406| 0| TRACE(("Couldn't set IPV6_TCLASS (%s)", strerror(errno))); 407| 0| } 408| 0|#endif 409| 0| rc = setsockopt(sock, IPPROTO_IP, IP_TOS, (void*)&val, sizeof(val)); 410| 0| if (rc < 0 && errno != ENOTSOCK) { ------------------ | Branch (410:6): [True: 0, False: 0] | Branch (410:16): [True: 0, False: 0] ------------------ 411| 0| TRACE(("Couldn't set IP_TOS (%s)", strerror(errno))); 412| 0| } 413| 0|#endif /* IP_TOS */ 414| 0| } 415| | 416| 0|#ifdef HAVE_LINUX_PKT_SCHED_H 417| | /* Set scheduling priority within the local Linux network stack */ 418| 0| if (prio == DROPBEAR_PRIO_LOWDELAY) { ------------------ | Branch (418:6): [True: 0, False: 0] ------------------ 419| 0| val = TC_PRIO_INTERACTIVE; 420| 0| } else { 421| 0| val = 0; 422| 0| } 423| | /* linux specific, sets QoS class. see tc-prio(8) */ 424| 0| rc = setsockopt(sock, SOL_SOCKET, SO_PRIORITY, (void*) &val, sizeof(val)); 425| 0| if (rc < 0 && errno != ENOTSOCK) { ------------------ | Branch (425:6): [True: 0, False: 0] | Branch (425:16): [True: 0, False: 0] ------------------ 426| 0| TRACE(("Couldn't set SO_PRIORITY (%s)", strerror(errno))) 427| 0| } 428| 0|#endif 429| | 430| 0|} dropbear_listen: 470| 1.22k| int *socks, unsigned int sockcount, char **errstring, int *maxfd) { 471| | 472| 1.22k| struct addrinfo hints, *res = NULL, *res0 = NULL; 473| 1.22k| int err; 474| 1.22k| unsigned int nsock; 475| 1.22k| struct linger linger; 476| 1.22k| int val; 477| 1.22k| int sock; 478| 1.22k| uint16_t *allocated_lport_p = NULL; 479| 1.22k| int allocated_lport = 0; 480| | 481| 1.22k| TRACE(("enter dropbear_listen")) 482| | 483| 1.22k|#if DROPBEAR_FUZZ 484| 1.22k| if (fuzz.fuzzing) { ------------------ | Branch (484:6): [True: 1.22k, False: 0] ------------------ 485| 1.22k| return fuzz_dropbear_listen(address, port, socks, sockcount, errstring, maxfd); 486| 1.22k| } 487| 0|#endif 488| | 489| 0| memset(&hints, 0, sizeof(hints)); 490| 0| hints.ai_family = AF_UNSPEC; /* TODO: let them flag v4 only etc */ 491| 0| hints.ai_socktype = SOCK_STREAM; 492| | 493| | /* for calling getaddrinfo: 494| | address == NULL and !AI_PASSIVE: local loopback 495| | address == NULL and AI_PASSIVE: all interfaces 496| | address != NULL: whatever the address says */ 497| 0| if (!address) { ------------------ | Branch (497:6): [True: 0, False: 0] ------------------ 498| 0| TRACE(("dropbear_listen: local loopback")) 499| 0| } else { 500| 0| if (address[0] == '\0') { ------------------ | Branch (500:7): [True: 0, False: 0] ------------------ 501| 0| TRACE(("dropbear_listen: all interfaces")) 502| 0| address = NULL; 503| 0| } 504| 0| hints.ai_flags = AI_PASSIVE; 505| 0| } 506| 0| err = getaddrinfo(address, port, &hints, &res0); 507| | 508| 0| if (err) { ------------------ | Branch (508:6): [True: 0, False: 0] ------------------ 509| 0| if (errstring != NULL && *errstring == NULL) { ------------------ | Branch (509:7): [True: 0, False: 0] | Branch (509:28): [True: 0, False: 0] ------------------ 510| 0| int len; 511| 0| len = 20 + strlen(gai_strerror(err)); 512| 0| *errstring = (char*)m_malloc(len); 513| 0| snprintf(*errstring, len, "Error resolving: %s", gai_strerror(err)); 514| 0| } 515| 0| if (res0) { ------------------ | Branch (515:7): [True: 0, False: 0] ------------------ 516| 0| freeaddrinfo(res0); 517| 0| res0 = NULL; 518| 0| } 519| 0| TRACE(("leave dropbear_listen: failed resolving")) 520| 0| return -1; 521| 0| } 522| | 523| | /* When listening on server-assigned-port 0 524| | * the assigned ports may differ for address families (v4/v6) 525| | * causing problems for tcpip-forward. 526| | * Caller can do a get_socket_address to discover assigned-port 527| | * hence, use same port for all address families */ 528| 0| allocated_lport = 0; 529| 0| nsock = 0; 530| 0| for (res = res0; res != NULL && nsock < sockcount; ------------------ | Branch (530:19): [True: 0, False: 0] | Branch (530:34): [True: 0, False: 0] ------------------ 531| 0| res = res->ai_next) { 532| 0| if (allocated_lport > 0) { ------------------ | Branch (532:7): [True: 0, False: 0] ------------------ 533| 0| if (AF_INET == res->ai_family) { ------------------ | Branch (533:8): [True: 0, False: 0] ------------------ 534| 0| allocated_lport_p = &((struct sockaddr_in *)res->ai_addr)->sin_port; 535| 0| } else if (AF_INET6 == res->ai_family) { ------------------ | Branch (535:15): [True: 0, False: 0] ------------------ 536| 0| allocated_lport_p = &((struct sockaddr_in6 *)res->ai_addr)->sin6_port; 537| 0| } 538| 0| *allocated_lport_p = htons(allocated_lport); 539| 0| } 540| | 541| | /* Get a socket */ 542| 0| socks[nsock] = socket(res->ai_family, res->ai_socktype, res->ai_protocol); 543| 0| sock = socks[nsock]; /* For clarity */ 544| 0| if (sock < 0) { ------------------ | Branch (544:7): [True: 0, False: 0] ------------------ 545| 0| err = errno; 546| 0| TRACE(("socket() failed")) 547| 0| continue; 548| 0| } 549| | 550| | /* Various useful socket options */ 551| 0| val = 1; 552| | /* set to reuse, quick timeout */ 553| 0| setsockopt(sock, SOL_SOCKET, SO_REUSEADDR, (void*) &val, sizeof(val)); 554| 0| linger.l_onoff = 1; 555| 0| linger.l_linger = 5; 556| 0| setsockopt(sock, SOL_SOCKET, SO_LINGER, (void*)&linger, sizeof(linger)); 557| | 558| 0|#if defined(IPPROTO_IPV6) && defined(IPV6_V6ONLY) 559| 0| if (res->ai_family == AF_INET6) { ------------------ | Branch (559:7): [True: 0, False: 0] ------------------ 560| 0| int on = 1; 561| 0| if (setsockopt(sock, IPPROTO_IPV6, IPV6_V6ONLY, ------------------ | Branch (561:8): [True: 0, False: 0] ------------------ 562| 0| &on, sizeof(on)) == -1) { 563| 0| dropbear_log(LOG_WARNING, "Couldn't set IPV6_V6ONLY"); 564| 0| } 565| 0| } 566| 0|#endif 567| 0| set_sock_nodelay(sock); 568| | 569| 0| if (bind(sock, res->ai_addr, res->ai_addrlen) < 0) { ------------------ | Branch (569:7): [True: 0, False: 0] ------------------ 570| 0| err = errno; 571| 0| close(sock); ------------------ | | 56| 0|#define close(fd) wrapfd_close(fd) ------------------ 572| 0| TRACE(("bind(%s) failed", port)) 573| 0| continue; 574| 0| } 575| | 576| 0| if (listen(sock, DROPBEAR_LISTEN_BACKLOG) < 0) { ------------------ | | 349| 0|#define DROPBEAR_LISTEN_BACKLOG MAX_CHANNELS | | ------------------ | | | | 225| 0|#define MAX_CHANNELS 1000 /* simple mem restriction, includes each tcp/x11 | | ------------------ ------------------ | Branch (576:7): [True: 0, False: 0] ------------------ 577| 0| err = errno; 578| 0| close(sock); ------------------ | | 56| 0|#define close(fd) wrapfd_close(fd) ------------------ 579| 0| TRACE(("listen() failed")) 580| 0| continue; 581| 0| } 582| | 583| 0| if (0 == allocated_lport) { ------------------ | Branch (583:7): [True: 0, False: 0] ------------------ 584| 0| allocated_lport = get_sock_port(sock); 585| 0| } 586| | 587| 0| *maxfd = MAX(*maxfd, sock); 588| 0| nsock++; 589| 0| } 590| | 591| 0| if (res0) { ------------------ | Branch (591:6): [True: 0, False: 0] ------------------ 592| 0| freeaddrinfo(res0); 593| 0| res0 = NULL; 594| 0| } 595| | 596| 0| if (nsock == 0) { ------------------ | Branch (596:6): [True: 0, False: 0] ------------------ 597| 0| if (errstring != NULL && *errstring == NULL) { ------------------ | Branch (597:7): [True: 0, False: 0] | Branch (597:28): [True: 0, False: 0] ------------------ 598| 0| int len; 599| 0| len = 20 + strlen(strerror(err)); 600| 0| *errstring = (char*)m_malloc(len); 601| 0| snprintf(*errstring, len, "Error listening: %s", strerror(err)); 602| 0| } 603| 0| TRACE(("leave dropbear_listen: failure, %s", strerror(err))) 604| 0| return -1; 605| 0| } 606| | 607| 0| TRACE(("leave dropbear_listen: success, %d socks bound", nsock)) 608| 0| return nsock; 609| 0|} get_socket_address: 613| 5.57k|{ 614| 5.57k| struct sockaddr_storage addr; 615| 5.57k| socklen_t addrlen; 616| | 617| 5.57k|#if DROPBEAR_FUZZ 618| 5.57k| if (fuzz.fuzzing) { ------------------ | Branch (618:6): [True: 5.57k, False: 0] ------------------ 619| 5.57k| fuzz_get_socket_address(fd, local_host, local_port, remote_host, remote_port, host_lookup); 620| 5.57k| return; 621| 5.57k| } 622| 0|#endif 623| | 624| 0| if (local_host || local_port) { ------------------ | Branch (624:6): [True: 0, False: 0] | Branch (624:20): [True: 0, False: 0] ------------------ 625| 0| addrlen = sizeof(addr); 626| 0| if (getsockname(fd, (struct sockaddr*)&addr, &addrlen) < 0) { ------------------ | Branch (626:7): [True: 0, False: 0] ------------------ 627| 0| dropbear_exit("Failed socket address: %s", strerror(errno)); 628| 0| } 629| 0| getaddrstring(&addr, local_host, local_port, host_lookup); 630| 0| } 631| 0| if (remote_host || remote_port) { ------------------ | Branch (631:6): [True: 0, False: 0] | Branch (631:21): [True: 0, False: 0] ------------------ 632| 0| addrlen = sizeof(addr); 633| 0| if (getpeername(fd, (struct sockaddr*)&addr, &addrlen) < 0) { ------------------ | Branch (633:7): [True: 0, False: 0] ------------------ 634| 0| dropbear_exit("Failed socket address: %s", strerror(errno)); 635| 0| } 636| 0| getaddrstring(&addr, remote_host, remote_port, host_lookup); 637| 0| } 638| 0|} netio.c:remove_connect: 29| 98|static void remove_connect(struct dropbear_progress_connection *c, m_list_elem *iter) { 30| 98| if (c->res) { ------------------ | Branch (30:6): [True: 0, False: 98] ------------------ 31| 0| freeaddrinfo(c->res); 32| 0| } 33| 98| m_free(c->remotehost); ------------------ | | 24| 98|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 34| 98| m_free(c->remoteport); ------------------ | | 24| 98|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 35| 98| m_free(c->errstring); ------------------ | | 24| 98|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 36| 98| m_free(c->bind_address); ------------------ | | 24| 98|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 37| 98| m_free(c->bind_port); ------------------ | | 24| 98|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 38| 98| m_free(c); ------------------ | | 24| 98|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 39| | 40| 98| if (iter) { ------------------ | Branch (40:6): [True: 98, False: 0] ------------------ 41| 98| list_remove(iter); 42| 98| } 43| 98|} write_packet: 58| 234k|void write_packet() { 59| | 60| 234k| ssize_t written; 61| 234k|#if defined(HAVE_WRITEV) && (defined(IOV_MAX) || defined(UIO_MAXIOV)) 62| | /* 50 is somewhat arbitrary */ 63| 234k| unsigned int iov_count = 50; 64| 234k| struct iovec iov[50]; 65| |#else 66| | int len; 67| | buffer* writebuf; 68| |#endif 69| | 70| 234k| TRACE2(("enter write_packet")) 71| 234k| dropbear_assert(!isempty(&ses.writequeue)); ------------------ | | 83| 234k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 234k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 72| | 73| 234k|#if defined(HAVE_WRITEV) && (defined(IOV_MAX) || defined(UIO_MAXIOV)) 74| | 75| 234k| packet_queue_to_iovec(&ses.writequeue, iov, &iov_count); 76| | /* This may return EAGAIN. The main loop sometimes 77| | calls write_packet() without bothering to test with select() since 78| | it's likely to be necessary */ 79| 234k|#if DROPBEAR_FUZZ 80| 234k| if (fuzz.fuzzing) { ------------------ | Branch (80:6): [True: 234k, False: 0] ------------------ 81| | /* pretend to write one packet at a time */ 82| | /* TODO(fuzz): randomise amount written based on the fuzz input */ 83| 234k| written = iov[0].iov_len; 84| 234k| } 85| 0| else 86| 0|#endif 87| 0| { 88| 0| written = writev(ses.sock_out, iov, iov_count); 89| 0| if (written < 0) { ------------------ | Branch (89:6): [True: 0, False: 0] ------------------ 90| 0| if (errno == EINTR || errno == EAGAIN) { ------------------ | Branch (90:7): [True: 0, False: 0] | Branch (90:25): [True: 0, False: 0] ------------------ 91| 0| TRACE2(("leave write_packet: EINTR")) 92| 0| return; 93| 0| } else { 94| 0| dropbear_exit("Error writing: %s", strerror(errno)); 95| 0| } 96| 0| } 97| 0| } 98| | 99| 234k| packet_queue_consume(&ses.writequeue, written); 100| 234k| ses.writequeue_len -= written; 101| | 102| 234k| if (written == 0) { ------------------ | Branch (102:6): [True: 0, False: 234k] ------------------ 103| 0| ses.remoteclosed(); 104| 0| } 105| | 106| |#else /* No writev () */ 107| |#if DROPBEAR_FUZZ 108| | _Static_assert(0, "No fuzzing code for no-writev writes"); 109| |#endif 110| | /* Get the next buffer in the queue of encrypted packets to write*/ 111| | writebuf = (buffer*)examine(&ses.writequeue); 112| | 113| | len = writebuf->len - writebuf->pos; 114| | dropbear_assert(len > 0); 115| | /* Try to write as much as possible */ 116| | written = write(ses.sock_out, buf_getptr(writebuf, len), len); 117| | 118| | if (written < 0) { 119| | if (errno == EINTR || errno == EAGAIN) { 120| | TRACE2(("leave writepacket: EINTR")) 121| | return; 122| | } else { 123| | dropbear_exit("Error writing: %s", strerror(errno)); 124| | } 125| | } 126| | 127| | if (written == 0) { 128| | ses.remoteclosed(); 129| | } 130| | 131| | ses.writequeue_len -= written; 132| | 133| | if (written == len) { 134| | /* We've finished with the packet, free it */ 135| | dequeue(&ses.writequeue); 136| | buf_free(writebuf); 137| | writebuf = NULL; 138| | } else { 139| | /* More packet left to write, leave it in the queue for later */ 140| | buf_incrpos(writebuf, written); 141| | } 142| |#endif /* writev */ 143| | 144| 234k| TRACE2(("leave write_packet")) 145| 234k|} read_packet: 150| 273k|void read_packet() { 151| | 152| 273k| int len; 153| 273k| unsigned int maxlen; 154| 273k| unsigned char blocksize; 155| | 156| 273k| TRACE2(("enter read_packet")) 157| 273k| blocksize = ses.keys->recv.algo_crypt->blocksize; 158| | 159| 273k| if (ses.readbuf == NULL || ses.readbuf->len < blocksize) { ------------------ | Branch (159:6): [True: 53.2k, False: 220k] | Branch (159:29): [True: 96.0k, False: 124k] ------------------ 160| 149k| int ret; 161| | /* In the first blocksize of a packet */ 162| | 163| | /* Read the first blocksize of the packet, so we can decrypt it and 164| | * find the length of the whole packet */ 165| 149k| ret = read_packet_init(); 166| | 167| 149k| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 149k|#define DROPBEAR_FAILURE -1 ------------------ | Branch (167:7): [True: 96.0k, False: 53.2k] ------------------ 168| | /* didn't read enough to determine the length */ 169| 96.0k| TRACE2(("leave read_packet: packetinit done")) 170| 96.0k| return; 171| 96.0k| } 172| 149k| } 173| | 174| | /* Attempt to read the remainder of the packet, note that there 175| | * mightn't be any available (EAGAIN) */ 176| 177k| maxlen = ses.readbuf->len - ses.readbuf->pos; 177| 177k| if (maxlen == 0) { ------------------ | Branch (177:6): [True: 8.51k, False: 169k] ------------------ 178| | /* Occurs when the packet is only a single block long and has all 179| | * been read in read_packet_init(). Usually means that MAC is disabled 180| | */ 181| 8.51k| len = 0; 182| 169k| } else { 183| 169k| len = read(ses.sock_in, buf_getptr(ses.readbuf, maxlen), maxlen); ------------------ | | 55| 169k|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ 184| | 185| 169k| if (len == 0) { ------------------ | Branch (185:7): [True: 129, False: 169k] ------------------ 186| 129| ses.remoteclosed(); 187| 129| } 188| | 189| 169k| if (len < 0) { ------------------ | Branch (189:7): [True: 215, False: 169k] ------------------ 190| 215| if (errno == EINTR || errno == EAGAIN) { ------------------ | Branch (190:8): [True: 212, False: 3] | Branch (190:26): [True: 0, False: 3] ------------------ 191| 212| TRACE2(("leave read_packet: EINTR or EAGAIN")) 192| 212| return; 193| 212| } else { 194| 3| dropbear_exit("Error reading: %s", strerror(errno)); 195| 3| } 196| 215| } 197| | 198| 169k| buf_incrpos(ses.readbuf, len); 199| 169k| } 200| | 201| 177k| if ((unsigned int)len == maxlen) { ------------------ | Branch (201:6): [True: 52.0k, False: 125k] ------------------ 202| | /* The whole packet has been read */ 203| 52.0k| decrypt_packet(); 204| | /* The main select() loop process_packet() to 205| | * handle the packet contents... */ 206| 52.0k| } 207| 177k| TRACE2(("leave read_packet")) 208| 177k|} decrypt_packet: 298| 52.0k|void decrypt_packet() { 299| | 300| 52.0k| unsigned char blocksize; 301| 52.0k| unsigned char macsize; 302| 52.0k| unsigned int padlen; 303| 52.0k| unsigned int len; 304| | 305| 52.0k| TRACE2(("enter decrypt_packet")) 306| 52.0k| blocksize = ses.keys->recv.algo_crypt->blocksize; 307| 52.0k| macsize = ses.keys->recv.algo_mac->hashsize; 308| | 309| 52.0k| ses.kexstate.datarecv += ses.readbuf->len; 310| | 311| 52.0k|#if DROPBEAR_AEAD_MODE 312| 52.0k| if (ses.keys->recv.crypt_mode->aead_crypt) { ------------------ | Branch (312:6): [True: 0, False: 52.0k] ------------------ 313| | /* first blocksize is not decrypted yet */ 314| 0| buf_setpos(ses.readbuf, 0); 315| | 316| | /* decrypt it in-place */ 317| 0| len = ses.readbuf->len - macsize - ses.readbuf->pos; 318| 0| if (ses.keys->recv.crypt_mode->aead_crypt(ses.recvseq, ------------------ | Branch (318:7): [True: 0, False: 0] ------------------ 319| 0| buf_getptr(ses.readbuf, len + macsize), 320| 0| buf_getwriteptr(ses.readbuf, len), 321| 0| len, macsize, 322| 0| &ses.keys->recv.cipher_state, LTC_DECRYPT) != CRYPT_OK) { ------------------ | | 70| 0|#define LTC_DECRYPT 1 ------------------ 323| 0| dropbear_exit("Error decrypting"); 324| 0| } 325| 0| buf_incrpos(ses.readbuf, len); 326| 0| } else 327| 52.0k|#endif 328| 52.0k| { 329| | /* we've already decrypted the first blocksize in read_packet_init */ 330| 52.0k| buf_setpos(ses.readbuf, blocksize); 331| | 332| | /* decrypt it in-place */ 333| 52.0k| len = ses.readbuf->len - macsize - ses.readbuf->pos; 334| 52.0k| if (ses.keys->recv.crypt_mode->decrypt( ------------------ | Branch (334:7): [True: 0, False: 52.0k] ------------------ 335| 52.0k| buf_getptr(ses.readbuf, len), 336| 52.0k| buf_getwriteptr(ses.readbuf, len), 337| 52.0k| len, 338| 52.0k| &ses.keys->recv.cipher_state) != CRYPT_OK) { 339| 0| dropbear_exit("Error decrypting"); 340| 0| } 341| 52.0k| buf_incrpos(ses.readbuf, len); 342| | 343| | /* check the hmac */ 344| 52.0k| if (checkmac() != DROPBEAR_SUCCESS) { ------------------ | | 102| 52.0k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (344:7): [True: 0, False: 52.0k] ------------------ 345| 0| dropbear_exit("Integrity error"); 346| 0| } 347| | 348| 52.0k| } 349| | 350| 52.0k|#if DROPBEAR_FUZZ 351| 52.0k| fuzz_dump(ses.readbuf->data, ses.readbuf->len); 352| 52.0k|#endif 353| | 354| | /* get padding length */ 355| 52.0k| buf_setpos(ses.readbuf, PACKET_PADDING_OFF); ------------------ | | 48| 52.0k|#define PACKET_PADDING_OFF 4 ------------------ 356| 52.0k| padlen = buf_getbyte(ses.readbuf); 357| | 358| | /* payload length */ 359| | /* - 4 - 1 is for LEN and PADLEN values */ 360| 52.0k| len = ses.readbuf->len - padlen - 4 - 1 - macsize; 361| 52.0k| if ((len > RECV_MAX_PAYLOAD_LEN+ZLIB_COMPRESS_EXPANSION) || (len < 1)) { ------------------ | | 492| 52.0k|#define RECV_MAX_PAYLOAD_LEN 32768 ------------------ if ((len > RECV_MAX_PAYLOAD_LEN+ZLIB_COMPRESS_EXPANSION) || (len < 1)) { ------------------ | | 50| 52.0k|#define ZLIB_COMPRESS_EXPANSION (((RECV_MAX_PAYLOAD_LEN/16384)+1)*5 + 6) | | ------------------ | | | | 492| 52.0k|#define RECV_MAX_PAYLOAD_LEN 32768 | | ------------------ ------------------ | Branch (361:6): [True: 7, False: 52.0k] | Branch (361:62): [True: 0, False: 52.0k] ------------------ 362| 7| dropbear_exit("Bad packet size %u", len); 363| 7| } 364| | 365| 52.0k| buf_setpos(ses.readbuf, PACKET_PAYLOAD_OFF); ------------------ | | 49| 52.0k|#define PACKET_PAYLOAD_OFF 5 ------------------ 366| | 367| |#ifndef DISABLE_ZLIB 368| | if (is_compress_recv()) { 369| | /* decompress */ 370| | ses.payload = buf_decompress(ses.readbuf, len); 371| | buf_setpos(ses.payload, 0); 372| | ses.payload_beginning = 0; 373| | buf_free(ses.readbuf); 374| | } else 375| |#endif 376| 52.0k| { 377| 52.0k| ses.payload = ses.readbuf; 378| 52.0k| ses.payload_beginning = ses.payload->pos; 379| 52.0k| buf_setlen(ses.payload, ses.payload->pos + len); 380| 52.0k| } 381| 52.0k| ses.readbuf = NULL; 382| | 383| 52.0k| ses.recvseq++; 384| | 385| 52.0k| TRACE2(("leave decrypt_packet")) 386| 52.0k|} maybe_flush_reply_queue: 495| 456k|void maybe_flush_reply_queue() { 496| 456k| struct packetlist *tmp_item = NULL, *curr_item = NULL; 497| 456k| if (!ses.dataallowed) ------------------ | Branch (497:6): [True: 65.0k, False: 391k] ------------------ 498| 65.0k| { 499| 65.0k| TRACE(("maybe_empty_reply_queue - no data allowed")) 500| 65.0k| return; 501| 65.0k| } 502| | 503| 392k| for (curr_item = ses.reply_queue_head; curr_item; ) { ------------------ | Branch (503:41): [True: 462, False: 391k] ------------------ 504| 462| CHECKCLEARTOWRITE(); 505| 462| buf_putbytes(ses.writepayload, 506| 462| curr_item->payload->data, curr_item->payload->len); 507| | 508| 462| buf_free(curr_item->payload); 509| 462| tmp_item = curr_item; 510| 462| curr_item = curr_item->next; 511| 462| m_free(tmp_item); ------------------ | | 24| 462|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 512| 462| encrypt_packet(); 513| 462| } 514| 391k| ses.reply_queue_head = ses.reply_queue_tail = NULL; 515| 391k|} encrypt_packet: 519| 241k|void encrypt_packet() { 520| | 521| 241k| unsigned char padlen; 522| 241k| unsigned char blocksize, mac_size; 523| 241k| buffer * writebuf; /* the packet which will go on the wire. This is 524| | encrypted in-place. */ 525| 241k| unsigned char packet_type; 526| 241k| unsigned int len, encrypt_buf_size; 527| 241k| unsigned char mac_bytes[MAX_MAC_LEN]; 528| | 529| 241k| time_t now; 530| | 531| 241k| TRACE2(("enter encrypt_packet()")) 532| | 533| 241k| buf_setpos(ses.writepayload, 0); 534| 241k| packet_type = buf_getbyte(ses.writepayload); 535| 241k| buf_setpos(ses.writepayload, 0); 536| | 537| 241k| TRACE2(("encrypt_packet type is %d", packet_type)) 538| | 539| 241k| if ((!ses.dataallowed && !packet_is_okay_kex(packet_type))) { ------------------ | Branch (539:7): [True: 11.3k, False: 229k] | Branch (539:27): [True: 542, False: 10.8k] ------------------ 540| | /* During key exchange only particular packets are allowed. 541| | Since this packet_type isn't OK we just enqueue it to send 542| | after the KEX, see maybe_flush_reply_queue */ 543| 542| enqueue_reply_packet(); 544| 542| return; 545| 542| } 546| | 547| 240k| blocksize = ses.keys->trans.algo_crypt->blocksize; 548| 240k| mac_size = ses.keys->trans.algo_mac->hashsize; 549| | 550| | /* Encrypted packet len is payload+5. We need to then make sure 551| | * there is enough space for padding or MIN_PACKET_LEN. 552| | * Add extra 3 since we need at least 4 bytes of padding */ 553| 240k| encrypt_buf_size = (ses.writepayload->len+4+1) 554| 240k| + MAX(MIN_PACKET_LEN, blocksize) + 3 555| | /* add space for the MAC at the end */ 556| 240k| + mac_size 557| |#ifndef DISABLE_ZLIB 558| | /* some extra in case 'compression' makes it larger */ 559| | + ZLIB_COMPRESS_EXPANSION 560| |#endif 561| | /* and an extra cleartext (stripped before transmission) byte for the 562| | * packet type */ 563| 240k| + 1; 564| | 565| 240k| writebuf = buf_new(encrypt_buf_size); 566| 240k| buf_setlen(writebuf, PACKET_PAYLOAD_OFF); ------------------ | | 49| 240k|#define PACKET_PAYLOAD_OFF 5 ------------------ 567| 240k| buf_setpos(writebuf, PACKET_PAYLOAD_OFF); ------------------ | | 49| 240k|#define PACKET_PAYLOAD_OFF 5 ------------------ 568| | 569| |#ifndef DISABLE_ZLIB 570| | /* compression */ 571| | if (is_compress_trans()) { 572| | buf_compress(writebuf, ses.writepayload, ses.writepayload->len); 573| | } else 574| |#endif 575| 240k| { 576| 240k| memcpy(buf_getwriteptr(writebuf, ses.writepayload->len), 577| 240k| buf_getptr(ses.writepayload, ses.writepayload->len), 578| 240k| ses.writepayload->len); 579| 240k| buf_incrwritepos(writebuf, ses.writepayload->len); 580| 240k| } 581| | 582| | /* finished with payload */ 583| 240k| buf_setpos(ses.writepayload, 0); 584| 240k| buf_setlen(ses.writepayload, 0); 585| | 586| | /* length of padding - packet length excluding the packetlength uint32 587| | * field in aead mode must be a multiple of blocksize, with a minimum of 588| | * 4 bytes of padding */ 589| 240k| len = writebuf->len; 590| 240k|#if DROPBEAR_AEAD_MODE 591| 240k| if (ses.keys->trans.crypt_mode->aead_crypt) { ------------------ | Branch (591:6): [True: 214k, False: 25.9k] ------------------ 592| 214k| len -= 4; 593| 214k| } 594| 240k|#endif 595| 240k| padlen = blocksize - len % blocksize; 596| 240k| if (padlen < 4) { ------------------ | Branch (596:6): [True: 82.8k, False: 157k] ------------------ 597| 82.8k| padlen += blocksize; 598| 82.8k| } 599| | /* check for min packet length */ 600| 240k| if (writebuf->len + padlen < MIN_PACKET_LEN) { ------------------ | | 213| 240k|#define MIN_PACKET_LEN 16 ------------------ | Branch (600:6): [True: 5.75k, False: 234k] ------------------ 601| 5.75k| padlen += blocksize; 602| 5.75k| } 603| | 604| 240k| buf_setpos(writebuf, 0); 605| | /* packet length excluding the packetlength uint32 */ 606| 240k| buf_putint(writebuf, writebuf->len + padlen - 4); 607| | 608| | /* padding len */ 609| 240k| buf_putbyte(writebuf, padlen); 610| | /* actual padding */ 611| 240k| buf_setpos(writebuf, writebuf->len); 612| 240k| buf_incrlen(writebuf, padlen); 613| 240k| genrandom(buf_getptr(writebuf, padlen), padlen); 614| | 615| 240k|#if DROPBEAR_AEAD_MODE 616| 240k| if (ses.keys->trans.crypt_mode->aead_crypt) { ------------------ | Branch (616:6): [True: 214k, False: 25.9k] ------------------ 617| | /* do the actual encryption, in-place */ 618| 214k| buf_setpos(writebuf, 0); 619| | /* encrypt it in-place*/ 620| 214k| len = writebuf->len; 621| 214k| buf_incrlen(writebuf, mac_size); 622| 214k| if (ses.keys->trans.crypt_mode->aead_crypt(ses.transseq, ------------------ | Branch (622:7): [True: 0, False: 214k] ------------------ 623| 214k| buf_getptr(writebuf, len), 624| 214k| buf_getwriteptr(writebuf, len + mac_size), 625| 214k| len, mac_size, 626| 214k| &ses.keys->trans.cipher_state, LTC_ENCRYPT) != CRYPT_OK) { ------------------ | | 68| 214k|#define LTC_ENCRYPT 0 ------------------ 627| 0| dropbear_exit("Error encrypting"); 628| 0| } 629| 214k| buf_incrpos(writebuf, len + mac_size); 630| 214k| } else 631| 25.9k|#endif 632| 25.9k| { 633| 25.9k| make_mac(ses.transseq, &ses.keys->trans, writebuf, writebuf->len, mac_bytes); 634| | 635| | /* do the actual encryption, in-place */ 636| 25.9k| buf_setpos(writebuf, 0); 637| | /* encrypt it in-place*/ 638| 25.9k| len = writebuf->len; 639| 25.9k| if (ses.keys->trans.crypt_mode->encrypt( ------------------ | Branch (639:7): [True: 0, False: 25.9k] ------------------ 640| 25.9k| buf_getptr(writebuf, len), 641| 25.9k| buf_getwriteptr(writebuf, len), 642| 25.9k| len, 643| 25.9k| &ses.keys->trans.cipher_state) != CRYPT_OK) { 644| 0| dropbear_exit("Error encrypting"); 645| 0| } 646| 25.9k| buf_incrpos(writebuf, len); 647| | 648| | /* stick the MAC on it */ 649| 25.9k| buf_putbytes(writebuf, mac_bytes, mac_size); 650| 25.9k| } 651| | 652| | /* Update counts */ 653| 240k| ses.kexstate.datatrans += writebuf->len; 654| | 655| 240k| writebuf_enqueue(writebuf); 656| | 657| | /* Update counts */ 658| 240k| ses.transseq++; 659| | 660| 240k| now = monotonic_now(); 661| 240k| ses.last_packet_time_any_sent = now; 662| | /* idle timeout shouldn't be affected by responses to keepalives. 663| | send_msg_keepalive() itself also does tricks with 664| | ses.last_packet_idle_time - read that if modifying this code */ 665| 240k| if (packet_type != SSH_MSG_REQUEST_FAILURE ------------------ | | 65| 480k|#define SSH_MSG_REQUEST_FAILURE 82 ------------------ | Branch (665:6): [True: 239k, False: 757] ------------------ 666| 240k| && packet_type != SSH_MSG_UNIMPLEMENTED ------------------ | | 31| 480k|#define SSH_MSG_UNIMPLEMENTED 3 ------------------ | Branch (666:6): [True: 236k, False: 3.69k] ------------------ 667| 240k| && packet_type != SSH_MSG_IGNORE) { ------------------ | | 30| 236k|#define SSH_MSG_IGNORE 2 ------------------ | Branch (667:6): [True: 236k, False: 0] ------------------ 668| 236k| ses.last_packet_time_idle = now; 669| | 670| 236k| } 671| | 672| 240k| TRACE2(("leave encrypt_packet()")) 673| 240k|} writebuf_enqueue: 675| 241k|void writebuf_enqueue(buffer * writebuf) { 676| | /* enqueue the packet for sending. It will get freed after transmission. */ 677| 241k| buf_setpos(writebuf, 0); 678| 241k| enqueue(&ses.writequeue, (void*)writebuf); 679| 241k| ses.writequeue_len += writebuf->len; 680| 241k|} packet.c:read_packet_init: 214| 149k|static int read_packet_init() { 215| | 216| 149k| unsigned int maxlen; 217| 149k| int slen; 218| 149k| unsigned int len, plen; 219| 149k| unsigned int blocksize; 220| 149k| unsigned int macsize; 221| | 222| | 223| 149k| blocksize = ses.keys->recv.algo_crypt->blocksize; 224| 149k| macsize = ses.keys->recv.algo_mac->hashsize; 225| | 226| 149k| if (ses.readbuf == NULL) { ------------------ | Branch (226:6): [True: 53.2k, False: 96.0k] ------------------ 227| | /* start of a new packet */ 228| 53.2k| ses.readbuf = buf_new(INIT_READBUF); ------------------ | | 51| 53.2k|#define INIT_READBUF 128 ------------------ 229| 53.2k| } 230| | 231| 149k| maxlen = blocksize - ses.readbuf->pos; 232| | 233| | /* read the rest of the packet if possible */ 234| 149k| slen = read(ses.sock_in, buf_getwriteptr(ses.readbuf, maxlen), ------------------ | | 55| 149k|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ 235| 149k| maxlen); 236| 149k| if (slen == 0) { ------------------ | Branch (236:6): [True: 900, False: 148k] ------------------ 237| 900| ses.remoteclosed(); 238| 900| } 239| 149k| if (slen < 0) { ------------------ | Branch (239:6): [True: 99, False: 149k] ------------------ 240| 99| if (errno == EINTR || errno == EAGAIN) { ------------------ | Branch (240:7): [True: 94, False: 5] | Branch (240:25): [True: 0, False: 5] ------------------ 241| 94| TRACE2(("leave read_packet_init: EINTR")) 242| 94| return DROPBEAR_FAILURE; ------------------ | | 103| 94|#define DROPBEAR_FAILURE -1 ------------------ 243| 94| } 244| 5| dropbear_exit("Error reading: %s", strerror(errno)); 245| 99| } 246| | 247| 149k| buf_incrwritepos(ses.readbuf, slen); 248| | 249| 149k| if ((unsigned int)slen != maxlen) { ------------------ | Branch (249:6): [True: 95.9k, False: 53.2k] ------------------ 250| | /* don't have enough bytes to determine length, get next time */ 251| 95.9k| return DROPBEAR_FAILURE; ------------------ | | 103| 95.9k|#define DROPBEAR_FAILURE -1 ------------------ 252| 95.9k| } 253| | 254| | /* now we have the first block, need to get packet length, so we decrypt 255| | * the first block (only need first 4 bytes) */ 256| 53.2k| buf_setpos(ses.readbuf, 0); 257| 53.2k|#if DROPBEAR_AEAD_MODE 258| 53.2k| if (ses.keys->recv.crypt_mode->aead_crypt) { ------------------ | Branch (258:6): [True: 0, False: 53.2k] ------------------ 259| 0| if (ses.keys->recv.crypt_mode->aead_getlength(ses.recvseq, ------------------ | Branch (259:7): [True: 0, False: 0] ------------------ 260| 0| buf_getptr(ses.readbuf, blocksize), &plen, 261| 0| blocksize, 262| 0| &ses.keys->recv.cipher_state) != CRYPT_OK) { 263| 0| dropbear_exit("Error decrypting"); 264| 0| } 265| 0| len = plen + 4 + macsize; 266| 0| } else 267| 53.2k|#endif 268| 53.2k| { 269| 53.2k| if (ses.keys->recv.crypt_mode->decrypt(buf_getptr(ses.readbuf, blocksize), ------------------ | Branch (269:7): [True: 0, False: 53.2k] ------------------ 270| 53.2k| buf_getwriteptr(ses.readbuf, blocksize), 271| 53.2k| blocksize, 272| 53.2k| &ses.keys->recv.cipher_state) != CRYPT_OK) { 273| 0| dropbear_exit("Error decrypting"); 274| 0| } 275| 53.2k| plen = buf_getint(ses.readbuf) + 4; 276| 53.2k| len = plen + macsize; 277| 53.2k| } 278| | 279| 53.2k| TRACE2(("packet size is %u, block %u mac %u", len, blocksize, macsize)) 280| | 281| | 282| | /* check packet length */ 283| 53.2k| if ((len > RECV_MAX_PACKET_LEN) || ------------------ | | 215| 53.2k|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ | Branch (283:6): [True: 985, False: 52.2k] ------------------ 284| 53.2k| (plen < blocksize) || ------------------ | Branch (284:3): [True: 21, False: 52.2k] ------------------ 285| 53.2k| (plen % blocksize != 0)) { ------------------ | Branch (285:3): [True: 34, False: 52.1k] ------------------ 286| 140| dropbear_exit("Integrity error (bad packet size %u)", len); 287| 140| } 288| | 289| 53.0k| if (len > ses.readbuf->size) { ------------------ | Branch (289:6): [True: 10.4k, False: 42.6k] ------------------ 290| 10.4k| ses.readbuf = buf_resize(ses.readbuf, len); 291| 10.4k| } 292| 53.0k| buf_setlen(ses.readbuf, len); 293| 53.0k| buf_setpos(ses.readbuf, blocksize); 294| 53.0k| return DROPBEAR_SUCCESS; ------------------ | | 102| 53.0k|#define DROPBEAR_SUCCESS 0 ------------------ 295| 53.2k|} packet.c:checkmac: 390| 52.0k|static int checkmac() { 391| | 392| 52.0k| unsigned char mac_bytes[MAX_MAC_LEN]; 393| 52.0k| unsigned int mac_size, contents_len; 394| | 395| 52.0k| mac_size = ses.keys->recv.algo_mac->hashsize; 396| 52.0k| contents_len = ses.readbuf->len - mac_size; 397| | 398| 52.0k| buf_setpos(ses.readbuf, 0); 399| 52.0k| make_mac(ses.recvseq, &ses.keys->recv, ses.readbuf, contents_len, mac_bytes); 400| | 401| 52.0k|#if DROPBEAR_FUZZ 402| 52.0k| if (fuzz.fuzzing) { ------------------ | Branch (402:6): [True: 52.0k, False: 0] ------------------ 403| | /* fail 1 in 2000 times to test error path. */ 404| 52.0k| unsigned int value = 0; 405| 52.0k| if (mac_size > sizeof(value)) { ------------------ | Branch (405:7): [True: 0, False: 52.0k] ------------------ 406| 0| memcpy(&value, mac_bytes, sizeof(value)); 407| 0| } 408| 52.0k| if (value % 2000 == 99) { ------------------ | Branch (408:7): [True: 0, False: 52.0k] ------------------ 409| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 410| 0| } 411| 52.0k| return DROPBEAR_SUCCESS; ------------------ | | 102| 52.0k|#define DROPBEAR_SUCCESS 0 ------------------ 412| 52.0k| } 413| 0|#endif 414| | 415| | /* compare the hash */ 416| 0| buf_setpos(ses.readbuf, contents_len); 417| 0| if (constant_time_memcmp(mac_bytes, buf_getptr(ses.readbuf, mac_size), mac_size) != 0) { ------------------ | Branch (417:6): [True: 0, False: 0] ------------------ 418| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 419| 0| } else { 420| 0| return DROPBEAR_SUCCESS; ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ 421| 0| } 422| 0|} packet.c:packet_is_okay_kex: 464| 11.3k|static int packet_is_okay_kex(unsigned char type) { 465| 11.3k| if (type >= SSH_MSG_USERAUTH_REQUEST) { ------------------ | | 42| 11.3k|#define SSH_MSG_USERAUTH_REQUEST 50 ------------------ | Branch (465:6): [True: 542, False: 10.8k] ------------------ 466| 542| return 0; 467| 542| } 468| 10.8k| if (type == SSH_MSG_SERVICE_REQUEST || type == SSH_MSG_SERVICE_ACCEPT) { ------------------ | | 33| 21.6k|#define SSH_MSG_SERVICE_REQUEST 5 ------------------ if (type == SSH_MSG_SERVICE_REQUEST || type == SSH_MSG_SERVICE_ACCEPT) { ------------------ | | 34| 10.8k|#define SSH_MSG_SERVICE_ACCEPT 6 ------------------ | Branch (468:6): [True: 0, False: 10.8k] | Branch (468:41): [True: 0, False: 10.8k] ------------------ 469| 0| return 0; 470| 0| } 471| 10.8k| if (type == SSH_MSG_KEXINIT) { ------------------ | | 36| 10.8k|#define SSH_MSG_KEXINIT 20 ------------------ | Branch (471:6): [True: 0, False: 10.8k] ------------------ 472| | /* XXX should this die horribly if !dataallowed ?? */ 473| 0| return 0; 474| 0| } 475| 10.8k| return 1; 476| 10.8k|} packet.c:enqueue_reply_packet: 478| 542|static void enqueue_reply_packet() { 479| 542| struct packetlist * new_item = NULL; 480| 542| new_item = m_malloc(sizeof(struct packetlist)); 481| 542| new_item->next = NULL; 482| | 483| 542| new_item->payload = buf_newcopy(ses.writepayload); 484| 542| buf_setpos(ses.writepayload, 0); 485| 542| buf_setlen(ses.writepayload, 0); 486| | 487| 542| if (ses.reply_queue_tail) { ------------------ | Branch (487:6): [True: 308, False: 234] ------------------ 488| 308| ses.reply_queue_tail->next = new_item; 489| 308| } else { 490| 234| ses.reply_queue_head = new_item; 491| 234| } 492| 542| ses.reply_queue_tail = new_item; 493| 542|} packet.c:make_mac: 687| 78.0k| unsigned char *output_mac) { 688| 78.0k| unsigned char seqbuf[4]; 689| 78.0k| unsigned long bufsize; 690| 78.0k| hmac_state hmac; 691| | 692| 78.0k| if (key_state->algo_mac->hashsize > 0) { ------------------ | Branch (692:6): [True: 21.6k, False: 56.3k] ------------------ 693| | /* calculate the mac */ 694| 21.6k| if (hmac_init(&hmac, ------------------ | Branch (694:7): [True: 0, False: 21.6k] ------------------ 695| 21.6k| key_state->hash_index, 696| 21.6k| key_state->mackey, 697| 21.6k| key_state->algo_mac->keysize) != CRYPT_OK) { 698| 0| dropbear_exit("HMAC error"); 699| 0| } 700| | 701| | /* sequence number */ 702| 21.6k| STORE32H(seqno, seqbuf); ------------------ | | 62| 21.6k|#define STORE32H(x, y) \ | | 63| 21.6k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 21.6k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 21.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 703| 21.6k| if (hmac_process(&hmac, seqbuf, 4) != CRYPT_OK) { ------------------ | Branch (703:7): [True: 0, False: 21.6k] ------------------ 704| 0| dropbear_exit("HMAC error"); 705| 0| } 706| | 707| | /* the actual contents */ 708| 21.6k| buf_setpos(clear_buf, 0); 709| 21.6k| if (hmac_process(&hmac, ------------------ | Branch (709:7): [True: 0, False: 21.6k] ------------------ 710| 21.6k| buf_getptr(clear_buf, clear_len), 711| 21.6k| clear_len) != CRYPT_OK) { 712| 0| dropbear_exit("HMAC error"); 713| 0| } 714| | 715| 21.6k| bufsize = MAX_MAC_LEN; ------------------ | | 134| 21.6k|#define MAX_MAC_LEN 32 ------------------ 716| 21.6k| if (hmac_done(&hmac, output_mac, &bufsize) != CRYPT_OK) { ------------------ | Branch (716:7): [True: 0, False: 21.6k] ------------------ 717| 0| dropbear_exit("HMAC error"); 718| 0| } 719| 21.6k| } 720| 78.0k| TRACE2(("leave writemac")) 721| 78.0k|} process_packet: 43| 52.0k|void process_packet() { 44| | 45| 52.0k| unsigned char type; 46| 52.0k| unsigned int i; 47| 52.0k| time_t now; 48| | 49| 52.0k| TRACE2(("enter process_packet")) 50| | 51| 52.0k| type = buf_getbyte(ses.payload); 52| 52.0k| TRACE(("process_packet: packet type = %d, len %d", type, ses.payload->len)) 53| | 54| 52.0k| now = monotonic_now(); 55| 52.0k| ses.last_packet_time_keepalive_recv = now; 56| | 57| | /* These packets we can receive at any time */ 58| 52.0k| switch(type) { ------------------ | Branch (58:9): [True: 51.1k, False: 867] ------------------ 59| | 60| 289| case SSH_MSG_IGNORE: ------------------ | | 30| 289|#define SSH_MSG_IGNORE 2 ------------------ | Branch (60:3): [True: 289, False: 51.7k] ------------------ 61| 289| goto out; 62| 397| case SSH_MSG_DEBUG: ------------------ | | 32| 397|#define SSH_MSG_DEBUG 4 ------------------ | Branch (62:3): [True: 397, False: 51.6k] ------------------ 63| 397| goto out; 64| | 65| 178| case SSH_MSG_UNIMPLEMENTED: ------------------ | | 31| 178|#define SSH_MSG_UNIMPLEMENTED 3 ------------------ | Branch (65:3): [True: 178, False: 51.8k] ------------------ 66| | /* debugging XXX */ 67| 178| TRACE(("SSH_MSG_UNIMPLEMENTED")) 68| 178| goto out; 69| | 70| 3| case SSH_MSG_DISCONNECT: ------------------ | | 29| 3|#define SSH_MSG_DISCONNECT 1 ------------------ | Branch (70:3): [True: 3, False: 52.0k] ------------------ 71| | /* TODO cleanup? */ 72| 3| dropbear_close("Disconnect received"); 73| 52.0k| } 74| | 75| | /* Ignore these packet types so that keepalives don't interfere with 76| | idle detection. This is slightly incorrect since a tcp forwarded 77| | global request with failure won't trigger the idle timeout, 78| | but that's probably acceptable */ 79| 51.1k| if (!(type == SSH_MSG_GLOBAL_REQUEST ------------------ | | 63| 102k|#define SSH_MSG_GLOBAL_REQUEST 80 ------------------ | Branch (79:8): [True: 2.22k, False: 48.9k] ------------------ 80| 51.1k| || type == SSH_MSG_REQUEST_FAILURE ------------------ | | 65| 100k|#define SSH_MSG_REQUEST_FAILURE 82 ------------------ | Branch (80:6): [True: 85, False: 48.8k] ------------------ 81| 51.1k| || type == SSH_MSG_CHANNEL_FAILURE)) { ------------------ | | 76| 48.8k|#define SSH_MSG_CHANNEL_FAILURE 100 ------------------ | Branch (81:6): [True: 72, False: 48.7k] ------------------ 82| 48.7k| ses.last_packet_time_idle = now; 83| 48.7k| } 84| | 85| | /* This applies for KEX, where the spec says the next packet MUST be 86| | * NEWKEYS */ 87| 51.1k| if (ses.requirenext != 0) { ------------------ | Branch (87:6): [True: 22.3k, False: 28.8k] ------------------ 88| 22.3k| if (ses.requirenext == type) ------------------ | Branch (88:7): [True: 19.9k, False: 2.35k] ------------------ 89| 19.9k| { 90| | /* Got what we expected */ 91| 19.9k| TRACE(("got expected packet %d during kexinit", type)) 92| 19.9k| } 93| 2.35k| else 94| 2.35k| { 95| | /* RFC4253 7.1 - various messages are allowed at this point. 96| | The only ones we know about have already been handled though, 97| | so just return "unimplemented" */ 98| 2.35k| if (type >= 1 && type <= 49 ------------------ | Branch (98:8): [True: 2.34k, False: 12] | Branch (98:21): [True: 2.33k, False: 9] ------------------ 99| 2.35k| && type != SSH_MSG_SERVICE_REQUEST ------------------ | | 33| 4.69k|#define SSH_MSG_SERVICE_REQUEST 5 ------------------ | Branch (99:8): [True: 2.33k, False: 0] ------------------ 100| 2.35k| && type != SSH_MSG_SERVICE_ACCEPT ------------------ | | 34| 4.69k|#define SSH_MSG_SERVICE_ACCEPT 6 ------------------ | Branch (100:8): [True: 2.33k, False: 0] ------------------ 101| 2.35k| && type != SSH_MSG_KEXINIT) ------------------ | | 36| 2.33k|#define SSH_MSG_KEXINIT 20 ------------------ | Branch (101:8): [True: 2.33k, False: 1] ------------------ 102| 2.33k| { 103| 2.33k| TRACE(("unknown allowed packet during kexinit")) 104| 2.33k| recv_unimplemented(); 105| 2.33k| goto out; 106| 2.33k| } 107| 22| else 108| 22| { 109| 22| TRACE(("disallowed packet during kexinit")) 110| 22| dropbear_exit("Unexpected packet type %d, expected %d", type, 111| 22| ses.requirenext); 112| 22| } 113| 2.35k| } 114| 22.3k| } 115| | 116| | /* Check if we should ignore this packet. Used currently only for 117| | * KEX code, with first_kex_packet_follows */ 118| 48.8k| if (ses.ignorenext) { ------------------ | Branch (118:6): [True: 132, False: 48.6k] ------------------ 119| 132| TRACE(("Ignoring packet, type = %d", type)) 120| 132| ses.ignorenext = 0; 121| 132| goto out; 122| 132| } 123| | 124| | /* Only clear the flag after we have checked ignorenext */ 125| 48.6k| if (ses.requirenext != 0 && ses.requirenext == type) ------------------ | Branch (125:6): [True: 19.8k, False: 28.8k] | Branch (125:30): [True: 19.8k, False: 0] ------------------ 126| 19.8k| { 127| 19.8k| ses.requirenext = 0; 128| 19.8k| } 129| | 130| | 131| | /* Kindly the protocol authors gave all the preauth packets type values 132| | * less-than-or-equal-to 60 ( == MAX_UNAUTH_PACKET_TYPE ). 133| | * NOTE: if the protocol changes and new types are added, revisit this 134| | * assumption */ 135| 48.6k| if ( !ses.authstate.authdone && type > MAX_UNAUTH_PACKET_TYPE ) { ------------------ | | 38| 0|#define MAX_UNAUTH_PACKET_TYPE SSH_MSG_USERAUTH_PK_OK | | ------------------ | | | | 52| 0|#define SSH_MSG_USERAUTH_PK_OK 60 | | ------------------ ------------------ | Branch (135:7): [True: 0, False: 48.6k] | Branch (135:34): [True: 0, False: 0] ------------------ 136| 0| dropbear_exit("Received message %d before userauth", type); 137| 0| } 138| | 139| 366k| for (i = 0; ; i++) { 140| 366k| if (ses.packettypes[i].type == 0) { ------------------ | Branch (140:7): [True: 1.36k, False: 364k] ------------------ 141| | /* end of list */ 142| 1.36k| break; 143| 1.36k| } 144| | 145| 364k| if (ses.packettypes[i].type == type) { ------------------ | Branch (145:7): [True: 47.3k, False: 317k] ------------------ 146| 47.3k| ses.packettypes[i].handler(); 147| 47.3k| goto out; 148| 47.3k| } 149| 364k| } 150| | 151| | 152| | /* TODO do something more here? */ 153| 1.36k| TRACE(("preauth unknown packet")) 154| 1.36k| recv_unimplemented(); 155| | 156| 51.7k|out: 157| 51.7k| ses.lastpacket = type; 158| 51.7k| buf_free(ses.payload); 159| 51.7k| ses.payload = NULL; 160| | 161| 51.7k| TRACE2(("leave process_packet")) 162| 51.7k|} process-packet.c:recv_unimplemented: 170| 3.69k|static void recv_unimplemented() { 171| | 172| 3.69k| CHECKCLEARTOWRITE(); 173| | 174| 3.69k| buf_putbyte(ses.writepayload, SSH_MSG_UNIMPLEMENTED); ------------------ | | 31| 3.69k|#define SSH_MSG_UNIMPLEMENTED 3 ------------------ 175| | /* the decryption routine increments the sequence number, we must 176| | * decrement */ 177| 3.69k| buf_putint(ses.writepayload, ses.recvseq - 1); 178| | 179| 3.69k| encrypt_packet(); 180| 3.69k|} initqueue: 29| 1.49k|void initqueue(struct Queue* queue) { 30| | 31| 1.49k| queue->head = NULL; 32| 1.49k| queue->tail = NULL; 33| 1.49k| queue->count = 0; 34| 1.49k|} isempty: 36| 1.63M|int isempty(const struct Queue* queue) { 37| | 38| 1.63M| return (queue->head == NULL); 39| 1.63M|} dequeue: 41| 241k|void* dequeue(struct Queue* queue) { 42| | 43| 241k| void* ret; 44| 241k| struct Link* oldhead; 45| 241k| dropbear_assert(!isempty(queue)); ------------------ | | 83| 241k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 241k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 46| | 47| 241k| ret = queue->head->item; 48| 241k| oldhead = queue->head; 49| | 50| 241k| if (oldhead->link != NULL) { ------------------ | Branch (50:6): [True: 197k, False: 44.5k] ------------------ 51| 197k| queue->head = oldhead->link; 52| 197k| } else { 53| 44.5k| queue->head = NULL; 54| 44.5k| queue->tail = NULL; 55| 44.5k| TRACE(("empty queue dequeing")) 56| 44.5k| } 57| | 58| 241k| m_free(oldhead); ------------------ | | 24| 241k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 59| 241k| queue->count--; 60| 241k| return ret; 61| 241k|} examine: 63| 234k|void *examine(const struct Queue* queue) { 64| | 65| 234k| dropbear_assert(!isempty(queue)); ------------------ | | 83| 234k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 234k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 66| 234k| return queue->head->item; 67| 234k|} enqueue: 69| 241k|void enqueue(struct Queue* queue, void* item) { 70| | 71| 241k| struct Link* newlink; 72| | 73| 241k| newlink = (struct Link*)m_malloc(sizeof(struct Link)); 74| | 75| 241k| newlink->item = item; 76| 241k| newlink->link = NULL; 77| | 78| 241k| if (queue->tail != NULL) { ------------------ | Branch (78:6): [True: 197k, False: 44.5k] ------------------ 79| 197k| queue->tail->link = newlink; 80| 197k| } 81| 241k| queue->tail = newlink; 82| | 83| 241k| if (queue->head == NULL) { ------------------ | Branch (83:6): [True: 44.5k, False: 197k] ------------------ 84| 44.5k| queue->head = newlink; 85| 44.5k| } 86| 241k| queue->count++; 87| 241k|} buf_get_rsa_pub_key: 53| 1|int buf_get_rsa_pub_key(buffer* buf, dropbear_rsa_key *key) { 54| | 55| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 56| 1| TRACE(("enter buf_get_rsa_pub_key")) 57| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 58| 1| m_mp_alloc_init_multi(&key->e, &key->n, NULL); 59| 1| key->d = NULL; 60| 1| key->p = NULL; 61| 1| key->q = NULL; 62| | 63| 1| buf_incrpos(buf, 4+SSH_SIGNKEY_RSA_LEN); /* int + "ssh-rsa" */ ------------------ | | 113| 1|#define SSH_SIGNKEY_RSA_LEN 7 ------------------ 64| | 65| 1| if (buf_getmpint(buf, key->e) == DROPBEAR_FAILURE ------------------ | | 103| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (65:6): [True: 0, False: 1] ------------------ 66| 1| || buf_getmpint(buf, key->n) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (66:6): [True: 0, False: 1] ------------------ 67| 0| TRACE(("leave buf_get_rsa_pub_key: failure")) 68| 0| goto out; 69| 0| } 70| | 71| 1| if (mp_count_bits(key->n) < MIN_RSA_KEYLEN) { ------------------ | | 65| 1|#define MIN_RSA_KEYLEN 1024 ------------------ | Branch (71:6): [True: 0, False: 1] ------------------ 72| 0| dropbear_log(LOG_WARNING, "RSA key too short"); 73| 0| goto out; 74| 0| } 75| | 76| | /* 64 bit is limit used by openssl, so we won't block any keys in the wild */ 77| 1| if (mp_count_bits(key->e) > 64) { ------------------ | Branch (77:6): [True: 0, False: 1] ------------------ 78| 0| dropbear_log(LOG_WARNING, "RSA key bad e"); 79| 0| goto out; 80| 0| } 81| | 82| 1| TRACE(("leave buf_get_rsa_pub_key: success")) 83| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 84| 1|out: 85| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (85:6): [True: 0, False: 1] ------------------ 86| 0| m_mp_free_multi(&key->e, &key->n, NULL); 87| 0| } 88| 1| return ret; 89| 1|} buf_get_rsa_priv_key: 94| 1|int buf_get_rsa_priv_key(buffer* buf, dropbear_rsa_key *key) { 95| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 96| | 97| 1| TRACE(("enter buf_get_rsa_priv_key")) 98| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 99| | 100| 1| if (buf_get_rsa_pub_key(buf, key) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (100:6): [True: 0, False: 1] ------------------ 101| 0| TRACE(("leave buf_get_rsa_priv_key: pub: ret == DROPBEAR_FAILURE")) 102| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 103| 0| } 104| | 105| 1| key->d = NULL; 106| 1| key->p = NULL; 107| 1| key->q = NULL; 108| | 109| 1| m_mp_alloc_init_multi(&key->d, NULL); 110| 1| if (buf_getmpint(buf, key->d) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (110:6): [True: 0, False: 1] ------------------ 111| 0| TRACE(("leave buf_get_rsa_priv_key: d: ret == DROPBEAR_FAILURE")) 112| 0| goto out; 113| 0| } 114| | 115| 1| if (buf->pos == buf->len) { ------------------ | Branch (115:6): [True: 0, False: 1] ------------------ 116| | /* old Dropbear private keys didn't keep p and q, so we will ignore them*/ 117| 1| } else { 118| 1| m_mp_alloc_init_multi(&key->p, &key->q, NULL); 119| | 120| 1| if (buf_getmpint(buf, key->p) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (120:7): [True: 0, False: 1] ------------------ 121| 0| TRACE(("leave buf_get_rsa_priv_key: p: ret == DROPBEAR_FAILURE")) 122| 0| goto out; 123| 0| } 124| | 125| 1| if (buf_getmpint(buf, key->q) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (125:7): [True: 0, False: 1] ------------------ 126| 0| TRACE(("leave buf_get_rsa_priv_key: q: ret == DROPBEAR_FAILURE")) 127| 0| goto out; 128| 0| } 129| 1| } 130| | 131| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 132| 1|out: 133| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (133:6): [True: 0, False: 1] ------------------ 134| 0| m_mp_free_multi(&key->d, &key->p, &key->q, NULL); 135| 0| } 136| 1| TRACE(("leave buf_get_rsa_priv_key")) 137| 1| return ret; 138| 1|} rsa_key_free: 142| 1|void rsa_key_free(dropbear_rsa_key *key) { 143| | 144| 1| TRACE2(("enter rsa_key_free")) 145| | 146| 1| if (key == NULL) { ------------------ | Branch (146:6): [True: 1, False: 0] ------------------ 147| 1| TRACE2(("leave rsa_key_free: key == NULL")) 148| 1| return; 149| 1| } 150| 0| m_mp_free_multi(&key->d, &key->e, &key->p, &key->q, &key->n, NULL); 151| 0| m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 152| 0| TRACE2(("leave rsa_key_free")) 153| 0|} new_sign_key: 62| 1|sign_key * new_sign_key() { 63| | 64| 1| sign_key * ret; 65| | 66| 1| ret = (sign_key*)m_malloc(sizeof(sign_key)); 67| 1| ret->type = DROPBEAR_SIGNKEY_NONE; 68| 1| ret->source = SIGNKEY_SOURCE_INVALID; 69| 1| return ret; 70| 1|} signkey_type_from_name: 86| 4|enum signkey_type signkey_type_from_name(const char* name, unsigned int namelen) { 87| 4| int i; 88| 13| for (i = 0; i < DROPBEAR_SIGNKEY_NUM_NAMED; i++) { ------------------ | Branch (88:14): [True: 13, False: 0] ------------------ 89| 13| const char *fixed_name = signkey_names[i]; 90| 13| if (namelen == strlen(fixed_name) ------------------ | Branch (90:7): [True: 5, False: 8] ------------------ 91| 13| && memcmp(fixed_name, name, namelen) == 0) { ------------------ | Branch (91:7): [True: 4, False: 1] ------------------ 92| | 93| 4|#if DROPBEAR_ECDSA 94| | /* Some of the ECDSA key sizes are defined even if they're not compiled in */ 95| 4| if (0 ------------------ | Branch (95:8): [Folded - Ignored] ------------------ 96| |#if !DROPBEAR_ECC_256 97| | || i == DROPBEAR_SIGNKEY_ECDSA_NISTP256 98| |#endif 99| |#if !DROPBEAR_ECC_384 100| | || i == DROPBEAR_SIGNKEY_ECDSA_NISTP384 101| |#endif 102| |#if !DROPBEAR_ECC_521 103| | || i == DROPBEAR_SIGNKEY_ECDSA_NISTP521 104| |#endif 105| 4| ) { 106| 0| TRACE(("attempt to use ecdsa type %d not compiled in", i)) 107| 0| return DROPBEAR_SIGNKEY_NONE; 108| 0| } 109| 4|#endif 110| | 111| 4| return (enum signkey_type)i; 112| 4| } 113| 13| } 114| | 115| 0| TRACE(("signkey_type_from_name unexpected key type.")) 116| | 117| 0| return DROPBEAR_SIGNKEY_NONE; 118| 4|} signkey_type_from_signature: 173| 9.54k|enum signkey_type signkey_type_from_signature(enum signature_type sigtype) { 174| 9.54k|#if DROPBEAR_RSA 175| 9.54k|#if DROPBEAR_RSA_SHA256 176| 9.54k| if (sigtype == DROPBEAR_SIGNATURE_RSA_SHA256) { ------------------ | Branch (176:6): [True: 99, False: 9.44k] ------------------ 177| 99| return DROPBEAR_SIGNKEY_RSA; 178| 99| } 179| 9.44k|#endif 180| 9.44k|#if DROPBEAR_RSA_SHA1 181| 9.44k| if (sigtype == DROPBEAR_SIGNATURE_RSA_SHA1) { ------------------ | Branch (181:6): [True: 139, False: 9.30k] ------------------ 182| 139| return DROPBEAR_SIGNKEY_RSA; 183| 139| } 184| 9.30k|#endif 185| 9.30k|#endif /* DROPBEAR_RSA */ 186| 9.30k| assert((int)sigtype < (int)DROPBEAR_SIGNKEY_NUM_NAMED); 187| 9.30k| return (enum signkey_type)sigtype; 188| 9.30k|} signkey_key_ptr: 193| 1|signkey_key_ptr(sign_key *key, enum signkey_type type) { 194| 1| switch (type) { 195| 0|#if DROPBEAR_ED25519 196| 0| case DROPBEAR_SIGNKEY_ED25519: ------------------ | Branch (196:3): [True: 0, False: 1] ------------------ 197| 0|#if DROPBEAR_SK_ED25519 198| 0| case DROPBEAR_SIGNKEY_SK_ED25519: ------------------ | Branch (198:3): [True: 0, False: 1] ------------------ 199| 0|#endif 200| 0| return (void**)&key->ed25519key; 201| 0|#endif 202| 0|#if DROPBEAR_ECDSA 203| 0|#if DROPBEAR_ECC_256 204| 1| case DROPBEAR_SIGNKEY_ECDSA_NISTP256: ------------------ | Branch (204:3): [True: 1, False: 0] ------------------ 205| 1|#if DROPBEAR_SK_ECDSA 206| 1| case DROPBEAR_SIGNKEY_SK_ECDSA_NISTP256: ------------------ | Branch (206:3): [True: 0, False: 1] ------------------ 207| 1|#endif 208| 1| return (void**)&key->ecckey256; 209| 0|#endif 210| 0|#if DROPBEAR_ECC_384 211| 0| case DROPBEAR_SIGNKEY_ECDSA_NISTP384: ------------------ | Branch (211:3): [True: 0, False: 1] ------------------ 212| 0| return (void**)&key->ecckey384; 213| 0|#endif 214| 0|#if DROPBEAR_ECC_521 215| 0| case DROPBEAR_SIGNKEY_ECDSA_NISTP521: ------------------ | Branch (215:3): [True: 0, False: 1] ------------------ 216| 0| return (void**)&key->ecckey521; 217| 0|#endif 218| 0|#endif /* DROPBEAR_ECDSA */ 219| 0|#if DROPBEAR_RSA 220| 0| case DROPBEAR_SIGNKEY_RSA: ------------------ | Branch (220:3): [True: 0, False: 1] ------------------ 221| 0| return (void**)&key->rsakey; 222| 0|#endif 223| 0|#if DROPBEAR_DSS 224| 0| case DROPBEAR_SIGNKEY_DSS: ------------------ | Branch (224:3): [True: 0, False: 1] ------------------ 225| 0| return (void**)&key->dsskey; 226| 0|#endif 227| 0| default: ------------------ | Branch (227:3): [True: 0, False: 1] ------------------ 228| 0| return NULL; 229| 1| } 230| 1|} buf_get_priv_key: 339| 4|int buf_get_priv_key(buffer *buf, sign_key *key, enum signkey_type *type) { 340| | 341| 4| char *ident; 342| 4| unsigned int len; 343| 4| enum signkey_type keytype; 344| 4| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 4|#define DROPBEAR_FAILURE -1 ------------------ 345| | 346| 4| TRACE2(("enter buf_get_priv_key")) 347| | 348| 4| ident = buf_getstring(buf, &len); 349| 4| keytype = signkey_type_from_name(ident, len); 350| 4| m_free(ident); ------------------ | | 24| 4|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 351| | 352| 4| if (*type != DROPBEAR_SIGNKEY_ANY && *type != keytype) { ------------------ | Branch (352:6): [True: 4, False: 0] | Branch (352:39): [True: 0, False: 4] ------------------ 353| 0| TRACE(("wrong key type: %d %d", *type, keytype)) 354| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 355| 0| } 356| | 357| 4| *type = keytype; 358| | 359| | /* Rewind the buffer back before "ssh-rsa" etc */ 360| 4| buf_decrpos(buf, len + 4); 361| | 362| 4|#if DROPBEAR_DSS 363| 4| if (keytype == DROPBEAR_SIGNKEY_DSS) { ------------------ | Branch (363:6): [True: 1, False: 3] ------------------ 364| 1| dss_key_free(key->dsskey); 365| 1| key->dsskey = m_malloc(sizeof(*key->dsskey)); 366| 1| ret = buf_get_dss_priv_key(buf, key->dsskey); 367| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (367:7): [True: 0, False: 1] ------------------ 368| 0| dss_key_free(key->dsskey); 369| 0| key->dsskey = NULL; 370| 0| } 371| 1| } 372| 4|#endif 373| 4|#if DROPBEAR_RSA 374| 4| if (keytype == DROPBEAR_SIGNKEY_RSA) { ------------------ | Branch (374:6): [True: 1, False: 3] ------------------ 375| 1| rsa_key_free(key->rsakey); 376| 1| key->rsakey = m_malloc(sizeof(*key->rsakey)); 377| 1| ret = buf_get_rsa_priv_key(buf, key->rsakey); 378| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (378:7): [True: 0, False: 1] ------------------ 379| 0| rsa_key_free(key->rsakey); 380| 0| key->rsakey = NULL; 381| 0| } 382| 1| } 383| 4|#endif 384| 4|#if DROPBEAR_ECDSA 385| 4| if (signkey_is_ecdsa(keytype)) { ------------------ | Branch (385:6): [True: 1, False: 3] ------------------ 386| 1| ecc_key **eck = (ecc_key**)signkey_key_ptr(key, keytype); 387| 1| if (eck) { ------------------ | Branch (387:7): [True: 1, False: 0] ------------------ 388| 1| if (*eck) { ------------------ | Branch (388:8): [True: 0, False: 1] ------------------ 389| 0| ecc_free(*eck); 390| 0| m_free(*eck); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 391| 0| *eck = NULL; 392| 0| } 393| 1| *eck = buf_get_ecdsa_priv_key(buf); 394| 1| if (*eck) { ------------------ | Branch (394:8): [True: 1, False: 0] ------------------ 395| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 396| 1| } 397| 1| } 398| 1| } 399| 4|#endif 400| 4|#if DROPBEAR_ED25519 401| 4| if (keytype == DROPBEAR_SIGNKEY_ED25519) { ------------------ | Branch (401:6): [True: 1, False: 3] ------------------ 402| 1| ed25519_key_free(key->ed25519key); 403| 1| key->ed25519key = m_malloc(sizeof(*key->ed25519key)); 404| 1| ret = buf_get_ed25519_priv_key(buf, key->ed25519key); 405| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (405:7): [True: 0, False: 1] ------------------ 406| 0| m_free(key->ed25519key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 407| 0| key->ed25519key = NULL; 408| 0| } 409| 1| } 410| 4|#endif 411| | 412| 4| TRACE2(("leave buf_get_priv_key")) 413| | 414| 4| return ret; 415| | 416| 4|} pty_allocate: 50| 8|{ 51| 8|#if defined(HAVE_OPENPTY) 52| | /* exists in recent (4.4) BSDs and OSF/1 */ 53| 8| char *name; 54| 8| int i; 55| | 56| 8| i = openpty(ptyfd, ttyfd, NULL, NULL, NULL); 57| 8| if (i < 0) { ------------------ | Branch (57:6): [True: 0, False: 8] ------------------ 58| 0| dropbear_log(LOG_WARNING, 59| 0| "pty_allocate: openpty: %.100s", strerror(errno)); 60| 0| return 0; 61| 0| } 62| 8| name = ttyname(*ttyfd); 63| 8| if (!name) { ------------------ | Branch (63:6): [True: 0, False: 8] ------------------ 64| 0| dropbear_exit("ttyname fails for openpty device"); 65| 0| } 66| | 67| 8| strlcpy(namebuf, name, namebuflen); /* possible truncation */ 68| 8| return 1; 69| |#else /* HAVE_OPENPTY */ 70| |#ifdef HAVE__GETPTY 71| | /* 72| | * _getpty(3) exists in SGI Irix 4.x, 5.x & 6.x -- it generates more 73| | * pty's automagically when needed 74| | */ 75| | char *slave; 76| | 77| | slave = _getpty(ptyfd, O_RDWR, 0622, 0); 78| | if (slave == NULL) { 79| | dropbear_log(LOG_WARNING, 80| | "pty_allocate: _getpty: %.100s", strerror(errno)); 81| | return 0; 82| | } 83| | strlcpy(namebuf, slave, namebuflen); 84| | /* Open the slave side. */ 85| | *ttyfd = open(namebuf, O_RDWR | O_NOCTTY); 86| | if (*ttyfd < 0) { 87| | dropbear_log(LOG_WARNING, 88| | "pty_allocate error: ttyftd open error"); 89| | close(*ptyfd); 90| | return 0; 91| | } 92| | return 1; 93| |#else /* HAVE__GETPTY */ 94| |#if defined(USE_DEV_PTMX) 95| | /* 96| | * This code is used e.g. on Solaris 2.x. (Note that Solaris 2.3 97| | * also has bsd-style ptys, but they simply do not work.) 98| | * 99| | * Linux systems may have the /dev/ptmx device, but this code won't work. 100| | */ 101| | int ptm; 102| | char *pts; 103| | 104| | ptm = open("/dev/ptmx", O_RDWR | O_NOCTTY); 105| | if (ptm < 0) { 106| | dropbear_log(LOG_WARNING, 107| | "pty_allocate: /dev/ptmx: %.100s", strerror(errno)); 108| | return 0; 109| | } 110| | if (grantpt(ptm) < 0) { 111| | dropbear_log(LOG_WARNING, 112| | "grantpt: %.100s", strerror(errno)); 113| | return 0; 114| | } 115| | if (unlockpt(ptm) < 0) { 116| | dropbear_log(LOG_WARNING, 117| | "unlockpt: %.100s", strerror(errno)); 118| | return 0; 119| | } 120| | pts = ptsname(ptm); 121| | if (pts == NULL) { 122| | dropbear_log(LOG_WARNING, 123| | "Slave pty side name could not be obtained."); 124| | } 125| | strlcpy(namebuf, pts, namebuflen); 126| | *ptyfd = ptm; 127| | 128| | /* Open the slave side. */ 129| | *ttyfd = open(namebuf, O_RDWR | O_NOCTTY); 130| | if (*ttyfd < 0) { 131| | dropbear_log(LOG_ERR, 132| | "error opening pts %.100s: %.100s", namebuf, strerror(errno)); 133| | close(*ptyfd); 134| | return 0; 135| | } 136| |#if !defined(HAVE_CYGWIN) && defined(I_PUSH) 137| | /* 138| | * Push the appropriate streams modules, as described in Solaris pts(7). 139| | * HP-UX pts(7) doesn't have ttcompat module. 140| | */ 141| | if (ioctl(*ttyfd, I_PUSH, "ptem") < 0) { 142| | dropbear_log(LOG_WARNING, 143| | "ioctl I_PUSH ptem: %.100s", strerror(errno)); 144| | } 145| | if (ioctl(*ttyfd, I_PUSH, "ldterm") < 0) { 146| | dropbear_log(LOG_WARNING, 147| | "ioctl I_PUSH ldterm: %.100s", strerror(errno)); 148| | } 149| |#ifndef __hpux 150| | if (ioctl(*ttyfd, I_PUSH, "ttcompat") < 0) { 151| | dropbear_log(LOG_WARNING, 152| | "ioctl I_PUSH ttcompat: %.100s", strerror(errno)); 153| | } 154| |#endif 155| |#endif 156| | return 1; 157| |#else /* USE_DEV_PTMX */ 158| |#ifdef HAVE_DEV_PTS_AND_PTC 159| | /* AIX-style pty code. */ 160| | const char *name; 161| | 162| | *ptyfd = open("/dev/ptc", O_RDWR | O_NOCTTY); 163| | if (*ptyfd < 0) { 164| | dropbear_log(LOG_ERR, 165| | "Could not open /dev/ptc: %.100s", strerror(errno)); 166| | return 0; 167| | } 168| | name = ttyname(*ptyfd); 169| | if (!name) { 170| | dropbear_exit("ttyname fails for /dev/ptc device"); 171| | } 172| | strlcpy(namebuf, name, namebuflen); 173| | *ttyfd = open(name, O_RDWR | O_NOCTTY); 174| | if (*ttyfd < 0) { 175| | dropbear_log(LOG_ERR, 176| | "Could not open pty slave side %.100s: %.100s", 177| | name, strerror(errno)); 178| | close(*ptyfd); 179| | return 0; 180| | } 181| | return 1; 182| |#else /* HAVE_DEV_PTS_AND_PTC */ 183| | 184| | /* BSD-style pty code. */ 185| | char buf[64]; 186| | int i; 187| | const char *ptymajors = "pqrstuvwxyzabcdefghijklmnoABCDEFGHIJKLMNOPQRSTUVWXYZ"; 188| | const char *ptyminors = "0123456789abcdef"; 189| | int num_minors = strlen(ptyminors); 190| | int num_ptys = strlen(ptymajors) * num_minors; 191| | struct termios tio; 192| | 193| | for (i = 0; i < num_ptys; i++) { 194| | snprintf(buf, sizeof buf, "/dev/pty%c%c", ptymajors[i / num_minors], 195| | ptyminors[i % num_minors]); 196| | snprintf(namebuf, namebuflen, "/dev/tty%c%c", 197| | ptymajors[i / num_minors], ptyminors[i % num_minors]); 198| | 199| | *ptyfd = open(buf, O_RDWR | O_NOCTTY); 200| | if (*ptyfd < 0) { 201| | /* Try SCO style naming */ 202| | snprintf(buf, sizeof buf, "/dev/ptyp%d", i); 203| | snprintf(namebuf, namebuflen, "/dev/ttyp%d", i); 204| | *ptyfd = open(buf, O_RDWR | O_NOCTTY); 205| | if (*ptyfd < 0) { 206| | continue; 207| | } 208| | } 209| | 210| | /* Open the slave side. */ 211| | *ttyfd = open(namebuf, O_RDWR | O_NOCTTY); 212| | if (*ttyfd < 0) { 213| | dropbear_log(LOG_ERR, 214| | "pty_allocate: %.100s: %.100s", namebuf, strerror(errno)); 215| | close(*ptyfd); 216| | return 0; 217| | } 218| | /* set tty modes to a sane state for broken clients */ 219| | if (tcgetattr(*ptyfd, &tio) < 0) { 220| | dropbear_log(LOG_WARNING, 221| | "ptyallocate: tty modes failed: %.100s", strerror(errno)); 222| | } else { 223| | tio.c_lflag |= (ECHO | ISIG | ICANON); 224| | tio.c_oflag |= (OPOST | ONLCR); 225| | tio.c_iflag |= ICRNL; 226| | 227| | /* Set the new modes for the terminal. */ 228| | if (tcsetattr(*ptyfd, TCSANOW, &tio) < 0) { 229| | dropbear_log(LOG_WARNING, 230| | "Setting tty modes for pty failed: %.100s", 231| | strerror(errno)); 232| | } 233| | } 234| | 235| | return 1; 236| | } 237| | dropbear_log(LOG_WARNING, "Failed to open any /dev/pty?? devices"); 238| | return 0; 239| |#endif /* HAVE_DEV_PTS_AND_PTC */ 240| |#endif /* USE_DEV_PTMX */ 241| |#endif /* HAVE__GETPTY */ 242| |#endif /* HAVE_OPENPTY */ 243| 8|} pty_release: 249| 8|{ 250| 8| if (chown(tty_name, (uid_t) 0, (gid_t) 0) < 0 ------------------ | Branch (250:6): [True: 0, False: 8] ------------------ 251| 8| && (errno != ENOENT)) { ------------------ | Branch (251:7): [True: 0, False: 0] ------------------ 252| 0| dropbear_log(LOG_ERR, 253| 0| "chown %.100s 0 0 failed: %.100s", tty_name, strerror(errno)); 254| 0| } 255| 8| if (chmod(tty_name, (mode_t) 0666) < 0 ------------------ | Branch (255:6): [True: 0, False: 8] ------------------ 256| 8| && (errno != ENOENT)) { ------------------ | Branch (256:7): [True: 0, False: 0] ------------------ 257| 0| dropbear_log(LOG_ERR, 258| 0| "chmod %.100s 0666 failed: %.100s", tty_name, strerror(errno)); 259| 0| } 260| 8|} pty_change_window_size: 345| 1|{ 346| 1| struct winsize w; 347| | 348| 1| w.ws_row = row; 349| 1| w.ws_col = col; 350| 1| w.ws_xpixel = xpixel; 351| 1| w.ws_ypixel = ypixel; 352| 1| (void) ioctl(ptyfd, TIOCSWINSZ, &w); 353| 1|} pty_setowner: 357| 8|{ 358| 8| struct group *grp; 359| 8| gid_t gid; 360| 8| mode_t mode; 361| 8| struct stat st; 362| | 363| | /* Determine the group to make the owner of the tty. */ 364| 8| grp = getgrnam("tty"); 365| 8| if (grp) { ------------------ | Branch (365:6): [True: 8, False: 0] ------------------ 366| 8| gid = grp->gr_gid; 367| 8| mode = S_IRUSR | S_IWUSR | S_IWGRP; 368| 8| } else { 369| 0| gid = pw->pw_gid; 370| 0| mode = S_IRUSR | S_IWUSR | S_IWGRP | S_IWOTH; 371| 0| } 372| | 373| | /* 374| | * Change owner and mode of the tty as required. 375| | * Warn but continue if filesystem is read-only and the uids match/ 376| | * tty is owned by root. 377| | */ 378| 8| if (stat(tty_name, &st)) { ------------------ | Branch (378:6): [True: 0, False: 8] ------------------ 379| 0| dropbear_exit("pty_setowner: stat(%.101s) failed: %.100s", 380| 0| tty_name, strerror(errno)); 381| 0| } 382| | 383| | /* Allow either "tty" gid or user's own gid. On Linux with openpty() 384| | * this varies depending on the devpts mount options */ 385| 8| if (st.st_uid != pw->pw_uid || !(st.st_gid == gid || st.st_gid == pw->pw_gid)) { ------------------ | Branch (385:6): [True: 0, False: 8] | Branch (385:35): [True: 8, False: 0] | Branch (385:55): [True: 0, False: 0] ------------------ 386| 0| if (chown(tty_name, pw->pw_uid, gid) < 0) { ------------------ | Branch (386:7): [True: 0, False: 0] ------------------ 387| 0| if (errno == EROFS && ------------------ | Branch (387:8): [True: 0, False: 0] ------------------ 388| 0| (st.st_uid == pw->pw_uid || st.st_uid == 0)) { ------------------ | Branch (388:9): [True: 0, False: 0] | Branch (388:36): [True: 0, False: 0] ------------------ 389| 0| dropbear_log(LOG_ERR, 390| 0| "chown(%.100s, %u, %u) failed: %.100s", 391| 0| tty_name, (unsigned int)pw->pw_uid, (unsigned int)gid, 392| 0| strerror(errno)); 393| 0| } else { 394| 0| dropbear_exit("chown(%.100s, %u, %u) failed: %.100s", 395| 0| tty_name, (unsigned int)pw->pw_uid, (unsigned int)gid, 396| 0| strerror(errno)); 397| 0| } 398| 0| } 399| 0| } 400| | 401| 8| if ((st.st_mode & (S_IRWXU|S_IRWXG|S_IRWXO)) != mode) { ------------------ | Branch (401:6): [True: 0, False: 8] ------------------ 402| 0| if (chmod(tty_name, mode) < 0) { ------------------ | Branch (402:7): [True: 0, False: 0] ------------------ 403| 0| if (errno == EROFS && ------------------ | Branch (403:8): [True: 0, False: 0] ------------------ 404| 0| (st.st_mode & (S_IRGRP | S_IROTH)) == 0) { ------------------ | Branch (404:8): [True: 0, False: 0] ------------------ 405| 0| dropbear_log(LOG_ERR, 406| 0| "chmod(%.100s, 0%o) failed: %.100s", 407| 0| tty_name, mode, strerror(errno)); 408| 0| } else { 409| 0| dropbear_exit("chmod(%.100s, 0%o) failed: %.100s", 410| 0| tty_name, mode, strerror(errno)); 411| 0| } 412| 0| } 413| 0| } 414| 8|} svr_agentcleanup: 140| 3.78k|void svr_agentcleanup(struct ChanSess * chansess) { 141| | 142| 3.78k| char *path = NULL; 143| 3.78k| uid_t uid; 144| 3.78k| gid_t gid; 145| 3.78k| int len; 146| | 147| 3.78k| if (chansess->agentlistener != NULL) { ------------------ | Branch (147:6): [True: 0, False: 3.78k] ------------------ 148| 0| remove_listener(chansess->agentlistener); 149| 0| chansess->agentlistener = NULL; 150| 0| } 151| | 152| 3.78k| if (chansess->agentfile != NULL && chansess->agentdir != NULL) { ------------------ | Branch (152:6): [True: 0, False: 3.78k] | Branch (152:37): [True: 0, False: 0] ------------------ 153| | 154| 0|#if DROPBEAR_SVR_MULTIUSER 155| | /* Remove the dir as the user. That way they can't cause problems except 156| | * for themselves */ 157| 0| uid = getuid(); 158| 0| gid = getgid(); 159| 0| if ((setegid(ses.authstate.pw_gid)) < 0 || ------------------ | Branch (159:7): [True: 0, False: 0] ------------------ 160| 0| (seteuid(ses.authstate.pw_uid)) < 0) { ------------------ | Branch (160:4): [True: 0, False: 0] ------------------ 161| 0| dropbear_exit("Failed to set euid"); 162| 0| } 163| 0|#endif 164| | 165| | /* 2 for "/" and "\0" */ 166| 0| len = strlen(chansess->agentdir) + strlen(chansess->agentfile) + 2; 167| | 168| 0| path = m_malloc(len); 169| 0| snprintf(path, len, "%s/%s", chansess->agentdir, chansess->agentfile); 170| 0| unlink(path); 171| 0| m_free(path); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 172| | 173| 0| rmdir(chansess->agentdir); 174| | 175| 0|#if DROPBEAR_SVR_MULTIUSER 176| 0| if ((seteuid(uid)) < 0 || ------------------ | Branch (176:7): [True: 0, False: 0] ------------------ 177| 0| (setegid(gid)) < 0) { ------------------ | Branch (177:4): [True: 0, False: 0] ------------------ 178| 0| dropbear_exit("Failed to revert euid"); 179| 0| } 180| 0|#endif 181| | 182| 0| m_free(chansess->agentfile); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 183| 0| m_free(chansess->agentdir); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 184| 0| } 185| | 186| 3.78k|} svr_authinitialise: 42| 1.49k|void svr_authinitialise() { 43| 1.49k| memset(&ses.authstate, 0, sizeof(ses.authstate)); 44| 1.49k|#if DROPBEAR_SVR_PUBKEY_AUTH 45| 1.49k| ses.authstate.authtypes |= AUTH_TYPE_PUBKEY; ------------------ | | 88| 1.49k|#define AUTH_TYPE_PUBKEY (1 << 1) ------------------ 46| 1.49k|#endif 47| 1.49k|#if DROPBEAR_SVR_PASSWORD_AUTH || DROPBEAR_SVR_PAM_AUTH 48| 1.49k| if (!svr_opts.noauthpass) { ------------------ | Branch (48:6): [True: 1.49k, False: 0] ------------------ 49| 1.49k| ses.authstate.authtypes |= AUTH_TYPE_PASSWORD; ------------------ | | 89| 1.49k|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ 50| 1.49k| } 51| 1.49k|#endif 52| 1.49k|} recv_msg_userauth_request: 73| 634|void recv_msg_userauth_request() { 74| | 75| 634| char *username = NULL, *servicename = NULL, *methodname = NULL; 76| 634| unsigned int userlen, servicelen, methodlen; 77| 634| int valid_user = 0; 78| | 79| 634| TRACE(("enter recv_msg_userauth_request")) 80| | 81| | /* for compensating failure delay */ 82| 634| gettime_wrapper(&ses.authstate.auth_starttime); 83| | 84| | /* ignore packets if auth is already done */ 85| 634| if (ses.authstate.authdone == 1) { ------------------ | Branch (85:6): [True: 634, False: 0] ------------------ 86| 634| TRACE(("leave recv_msg_userauth_request: authdone already")) 87| 634| return; 88| 634| } 89| | 90| | /* send the banner if it exists, it will only exist once */ 91| 0| if (svr_opts.banner) { ------------------ | Branch (91:6): [True: 0, False: 0] ------------------ 92| 0| send_msg_userauth_banner(svr_opts.banner); 93| 0| buf_free(svr_opts.banner); 94| 0| svr_opts.banner = NULL; 95| 0| } 96| | 97| 0| username = buf_getstring(ses.payload, &userlen); 98| 0| servicename = buf_getstring(ses.payload, &servicelen); 99| 0| methodname = buf_getstring(ses.payload, &methodlen); 100| | 101| | /* only handle 'ssh-connection' currently */ 102| 0| if (servicelen != SSH_SERVICE_CONNECTION_LEN ------------------ | | 107| 0|#define SSH_SERVICE_CONNECTION_LEN 14 ------------------ | Branch (102:6): [True: 0, False: 0] ------------------ 103| 0| && (strncmp(servicename, SSH_SERVICE_CONNECTION, ------------------ | | 106| 0|#define SSH_SERVICE_CONNECTION "ssh-connection" ------------------ | Branch (103:7): [True: 0, False: 0] ------------------ 104| 0| SSH_SERVICE_CONNECTION_LEN) != 0)) { ------------------ | | 107| 0|#define SSH_SERVICE_CONNECTION_LEN 14 ------------------ 105| | 106| | /* TODO - disconnect here */ 107| 0| m_free(username); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 108| 0| m_free(servicename); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 109| 0| m_free(methodname); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 110| 0| dropbear_exit("unknown service in auth"); 111| 0| } 112| | 113| | /* check username is good before continuing. 114| | * the 'incrfail' varies depending on the auth method to 115| | * avoid giving away which users exist on the system through 116| | * the time delay. */ 117| 0| if (checkusername(username, userlen) == DROPBEAR_SUCCESS) { ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (117:6): [True: 0, False: 0] ------------------ 118| 0| valid_user = 1; 119| 0| } 120| | 121| | /* user wants to know what methods are supported */ 122| 0| if (methodlen == AUTH_METHOD_NONE_LEN && ------------------ | | 93| 0|#define AUTH_METHOD_NONE_LEN 4 ------------------ | Branch (122:6): [True: 0, False: 0] ------------------ 123| 0| strncmp(methodname, AUTH_METHOD_NONE, ------------------ | | 92| 0|#define AUTH_METHOD_NONE "none" ------------------ | Branch (123:4): [True: 0, False: 0] ------------------ 124| 0| AUTH_METHOD_NONE_LEN) == 0) { ------------------ | | 93| 0|#define AUTH_METHOD_NONE_LEN 4 ------------------ 125| 0| TRACE(("recv_msg_userauth_request: 'none' request")) 126| 0| if (valid_user ------------------ | Branch (126:7): [True: 0, False: 0] ------------------ 127| 0| && svr_opts.allowblankpass ------------------ | Branch (127:8): [True: 0, False: 0] ------------------ 128| 0| && !svr_opts.noauthpass ------------------ | Branch (128:8): [True: 0, False: 0] ------------------ 129| 0| && !(svr_opts.norootpass && ses.authstate.pw_uid == 0) ------------------ | Branch (129:10): [True: 0, False: 0] | Branch (129:33): [True: 0, False: 0] ------------------ 130| 0| && ses.authstate.pw_passwd[0] == '\0') ------------------ | Branch (130:8): [True: 0, False: 0] ------------------ 131| 0| { 132| 0| dropbear_log(LOG_NOTICE, 133| 0| "Auth succeeded with blank password for '%s' from %s", 134| 0| ses.authstate.pw_name, 135| 0| svr_ses.addrstring); 136| 0| send_msg_userauth_success(); 137| 0| goto out; 138| 0| } 139| 0| else 140| 0| { 141| | /* 'none' has no failure delay */ 142| 0| send_msg_userauth_failure(0, 0); 143| 0| goto out; 144| 0| } 145| 0| } 146| | 147| 0|#if DROPBEAR_SVR_PASSWORD_AUTH 148| 0| if (!svr_opts.noauthpass && ------------------ | Branch (148:6): [True: 0, False: 0] ------------------ 149| 0| !(svr_opts.norootpass && ses.authstate.pw_uid == 0) ) { ------------------ | Branch (149:6): [True: 0, False: 0] | Branch (149:29): [True: 0, False: 0] ------------------ 150| | /* user wants to try password auth */ 151| 0| if (methodlen == AUTH_METHOD_PASSWORD_LEN && ------------------ | | 97| 0|#define AUTH_METHOD_PASSWORD_LEN 8 ------------------ | Branch (151:7): [True: 0, False: 0] ------------------ 152| 0| strncmp(methodname, AUTH_METHOD_PASSWORD, ------------------ | | 96| 0|#define AUTH_METHOD_PASSWORD "password" ------------------ | Branch (152:5): [True: 0, False: 0] ------------------ 153| 0| AUTH_METHOD_PASSWORD_LEN) == 0) { ------------------ | | 97| 0|#define AUTH_METHOD_PASSWORD_LEN 8 ------------------ 154| 0| svr_auth_password(valid_user); 155| 0| goto out; 156| 0| } 157| 0| } 158| 0|#endif 159| | 160| |#if DROPBEAR_SVR_PAM_AUTH 161| | if (!svr_opts.noauthpass && 162| | !(svr_opts.norootpass && ses.authstate.pw_uid == 0) ) { 163| | /* user wants to try password auth */ 164| | if (methodlen == AUTH_METHOD_PASSWORD_LEN && 165| | strncmp(methodname, AUTH_METHOD_PASSWORD, 166| | AUTH_METHOD_PASSWORD_LEN) == 0) { 167| | svr_auth_pam(valid_user); 168| | goto out; 169| | } 170| | } 171| |#endif 172| | 173| 0|#if DROPBEAR_SVR_PUBKEY_AUTH 174| | /* user wants to try pubkey auth */ 175| 0| if (methodlen == AUTH_METHOD_PUBKEY_LEN && ------------------ | | 95| 0|#define AUTH_METHOD_PUBKEY_LEN 9 ------------------ | Branch (175:6): [True: 0, False: 0] ------------------ 176| 0| strncmp(methodname, AUTH_METHOD_PUBKEY, ------------------ | | 94| 0|#define AUTH_METHOD_PUBKEY "publickey" ------------------ | Branch (176:4): [True: 0, False: 0] ------------------ 177| 0| AUTH_METHOD_PUBKEY_LEN) == 0) { ------------------ | | 95| 0|#define AUTH_METHOD_PUBKEY_LEN 9 ------------------ 178| 0| svr_auth_pubkey(valid_user); 179| 0| goto out; 180| 0| } 181| 0|#endif 182| | 183| | /* nothing matched, we just fail with a delay */ 184| 0| send_msg_userauth_failure(0, 1); 185| | 186| 0|out: 187| | 188| 0| m_free(username); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 189| 0| m_free(servicename); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 190| 0| m_free(methodname); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 191| 0|} svr_pubkey_allows_tcpfwd: 65| 2.55k|int svr_pubkey_allows_tcpfwd() { 66| 2.55k| if (ses.authstate.pubkey_options ------------------ | Branch (66:6): [True: 0, False: 2.55k] ------------------ 67| 2.55k| && ses.authstate.pubkey_options->no_port_forwarding_flag) { ------------------ | Branch (67:6): [True: 0, False: 0] ------------------ 68| 0| return 0; 69| 0| } 70| 2.55k| return 1; 71| 2.55k|} svr_pubkey_allows_pty: 84| 167|int svr_pubkey_allows_pty() { 85| 167| if (ses.authstate.pubkey_options ------------------ | Branch (85:6): [True: 0, False: 167] ------------------ 86| 167| && ses.authstate.pubkey_options->no_pty_flag) { ------------------ | Branch (86:6): [True: 0, False: 0] ------------------ 87| 0| return 0; 88| 0| } 89| 167| return 1; 90| 167|} svr_pubkey_allows_local_tcpfwd: 94| 98|int svr_pubkey_allows_local_tcpfwd(const char *host, unsigned int port) { 95| 98| if (ses.authstate.pubkey_options ------------------ | Branch (95:6): [True: 0, False: 98] ------------------ 96| 98| && ses.authstate.pubkey_options->permit_open_destinations) { ------------------ | Branch (96:6): [True: 0, False: 0] ------------------ 97| 0| m_list_elem *iter = ses.authstate.pubkey_options->permit_open_destinations->first; 98| 0| while (iter) { ------------------ | Branch (98:10): [True: 0, False: 0] ------------------ 99| 0| struct PermitTCPFwdEntry *entry = (struct PermitTCPFwdEntry*)iter->item; 100| 0| if (strcmp(entry->host, host) == 0) { ------------------ | Branch (100:8): [True: 0, False: 0] ------------------ 101| 0| if ((entry->port == PUBKEY_OPTIONS_ANY_PORT) || (entry->port == port)) { ------------------ | | 101| 0|#define PUBKEY_OPTIONS_ANY_PORT UINT_MAX ------------------ | Branch (101:9): [True: 0, False: 0] | Branch (101:53): [True: 0, False: 0] ------------------ 102| 0| return 1; 103| 0| } 104| 0| } 105| | 106| 0| iter = iter->next; 107| 0| } 108| | 109| 0| return 0; 110| 0| } 111| | 112| 98| return 1; 113| 98|} svr_pubkey_set_forced_command: 117| 2.58k|void svr_pubkey_set_forced_command(struct ChanSess *chansess) { 118| 2.58k| if (ses.authstate.pubkey_options && ses.authstate.pubkey_options->forced_command) { ------------------ | Branch (118:6): [True: 0, False: 2.58k] | Branch (118:38): [True: 0, False: 0] ------------------ 119| 0| TRACE(("Forced command '%s'", ses.authstate.pubkey_options->forced_command)) 120| 0| if (chansess->cmd) { ------------------ | Branch (120:7): [True: 0, False: 0] ------------------ 121| | /* original_command takes ownership */ 122| 0| chansess->original_command = chansess->cmd; 123| 0| chansess->cmd = NULL; 124| 0| } else { 125| 0| chansess->original_command = m_strdup(""); 126| 0| } 127| 0| chansess->cmd = m_strdup(ses.authstate.pubkey_options->forced_command); 128| |#if LOG_COMMANDS 129| | dropbear_log(LOG_INFO, "Command forced to '%s'", chansess->original_command); 130| |#endif 131| 0| } 132| 2.58k|} svr_pubkey_options_cleanup: 135| 1.49k|void svr_pubkey_options_cleanup() { 136| 1.49k| if (ses.authstate.pubkey_options) { ------------------ | Branch (136:6): [True: 0, False: 1.49k] ------------------ 137| 0| if (ses.authstate.pubkey_options->forced_command) { ------------------ | Branch (137:7): [True: 0, False: 0] ------------------ 138| 0| m_free(ses.authstate.pubkey_options->forced_command); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 139| 0| } 140| 0| if (ses.authstate.pubkey_options->permit_open_destinations) { ------------------ | Branch (140:7): [True: 0, False: 0] ------------------ 141| 0| m_list_elem *iter = ses.authstate.pubkey_options->permit_open_destinations->first; 142| 0| while (iter) { ------------------ | Branch (142:11): [True: 0, False: 0] ------------------ 143| 0| struct PermitTCPFwdEntry *entry = (struct PermitTCPFwdEntry*)list_remove(iter); 144| 0| m_free(entry->host); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 145| 0| m_free(entry); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 146| 0| iter = ses.authstate.pubkey_options->permit_open_destinations->first; 147| 0| } 148| 0| m_free(ses.authstate.pubkey_options->permit_open_destinations); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 149| 0| } 150| 0| m_free(ses.authstate.pubkey_options); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 151| 0| } 152| 1.49k| if (ses.authstate.pubkey_info) { ------------------ | Branch (152:6): [True: 0, False: 1.49k] ------------------ 153| 0| m_free(ses.authstate.pubkey_info); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 154| 0| } 155| 1.49k|} svr_chansess_checksignal: 95| 456k|void svr_chansess_checksignal(void) { 96| 456k| int status; 97| 456k| pid_t pid; 98| | 99| 456k| if (!ses.channel_signal_pending) { ------------------ | Branch (99:6): [True: 456k, False: 0] ------------------ 100| 456k| return; 101| 456k| } 102| | 103| 0| while ((pid = waitpid(-1, &status, WNOHANG)) > 0) { ------------------ | Branch (103:9): [True: 0, False: 0] ------------------ 104| 0| unsigned int i; 105| 0| struct exitinfo *ex = NULL; 106| 0| TRACE(("svr_chansess_checksignal : pid %d", pid)) 107| | 108| 0| ex = NULL; 109| | /* find the corresponding chansess */ 110| 0| for (i = 0; i < svr_ses.childpidsize; i++) { ------------------ | Branch (110:15): [True: 0, False: 0] ------------------ 111| 0| if (svr_ses.childpids[i].pid == pid) { ------------------ | Branch (111:8): [True: 0, False: 0] ------------------ 112| 0| TRACE(("found match session")); 113| 0| ex = &svr_ses.childpids[i].chansess->exit; 114| 0| break; 115| 0| } 116| 0| } 117| | 118| | /* If the pid wasn't matched, then we might have hit the race mentioned 119| | * above. So we just store the info for the parent to deal with */ 120| 0| if (ex == NULL) { ------------------ | Branch (120:7): [True: 0, False: 0] ------------------ 121| 0| TRACE(("using lastexit")); 122| 0| ex = &svr_ses.lastexit; 123| 0| } 124| | 125| 0| ex->exitpid = pid; 126| 0| if (WIFEXITED(status)) { 127| 0| ex->exitstatus = WEXITSTATUS(status); 128| 0| } 129| 0| if (WIFSIGNALED(status)) { 130| 0| ex->exitsignal = WTERMSIG(status); 131| 0|#if !defined(AIX) && defined(WCOREDUMP) 132| 0| ex->exitcore = WCOREDUMP(status); 133| |#else 134| | ex->exitcore = 0; 135| |#endif 136| 0| } else { 137| | /* we use this to determine how pid exited */ 138| 0| ex->exitsignal = -1; 139| 0| } 140| 0| } 141| 0|} svr_chansessinitialise: 1077| 1.49k|void svr_chansessinitialise() { 1078| | 1079| 1.49k| struct sigaction sa_chld; 1080| | 1081| | /* single child process intially */ 1082| 1.49k| svr_ses.childpids = (struct ChildPid*)m_malloc(sizeof(struct ChildPid)); 1083| 1.49k| svr_ses.childpids[0].pid = -1; /* unused */ 1084| 1.49k| svr_ses.childpids[0].chansess = NULL; 1085| 1.49k| svr_ses.childpidsize = 1; 1086| 1.49k| svr_ses.lastexit.exitpid = -1; /* Nothing has exited yet */ 1087| 1.49k| sa_chld.sa_handler = sesssigchild_handler; 1088| 1.49k| sa_chld.sa_flags = SA_NOCLDSTOP; 1089| 1.49k| sigemptyset(&sa_chld.sa_mask); 1090| 1.49k| if (sigaction(SIGCHLD, &sa_chld, NULL) < 0) { ------------------ | Branch (1090:6): [True: 0, False: 1.49k] ------------------ 1091| 0| dropbear_exit("signal() error"); 1092| 0| } 1093| | 1094| 1.49k|} svr-chansession.c:sesscheckclose: 77| 184k|static int sesscheckclose(struct Channel *channel) { 78| 184k| struct ChanSess *chansess = (struct ChanSess*)channel->typedata; 79| 184k| TRACE(("sesscheckclose, pid %d, exitpid %d", chansess->pid, chansess->exit.exitpid)) 80| | 81| 184k| if (chansess->exit.exitpid != -1) { ------------------ | Branch (81:6): [True: 0, False: 184k] ------------------ 82| 0| channel->flushing = 1; 83| 0| } 84| 184k| return chansess->pid == 0 || chansess->exit.exitpid != -1; ------------------ | Branch (84:9): [True: 710, False: 184k] | Branch (84:31): [True: 0, False: 184k] ------------------ 85| 184k|} svr-chansession.c:newchansess: 241| 3.78k|static int newchansess(struct Channel *channel) { 242| | 243| 3.78k| struct ChanSess *chansess; 244| | 245| 3.78k| TRACE(("new chansess %p", (void*)channel)) 246| | 247| 3.78k| dropbear_assert(channel->typedata == NULL); ------------------ | | 83| 3.78k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 3.78k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 248| | 249| 3.78k| chansess = (struct ChanSess*)m_malloc(sizeof(struct ChanSess)); 250| 3.78k| chansess->cmd = NULL; 251| 3.78k| chansess->connection_string = NULL; 252| 3.78k| chansess->client_string = NULL; 253| 3.78k| chansess->pid = 0; 254| | 255| | /* pty details */ 256| 3.78k| chansess->master = -1; 257| 3.78k| chansess->slave = -1; 258| 3.78k| chansess->tty = NULL; 259| 3.78k| chansess->term = NULL; 260| | 261| 3.78k| chansess->exit.exitpid = -1; 262| | 263| 3.78k| channel->typedata = chansess; 264| | 265| |#if DROPBEAR_X11FWD 266| | chansess->x11listener = NULL; 267| | chansess->x11authprot = NULL; 268| | chansess->x11authcookie = NULL; 269| |#endif 270| | 271| 3.78k|#if DROPBEAR_SVR_AGENTFWD 272| 3.78k| chansess->agentlistener = NULL; 273| 3.78k| chansess->agentfile = NULL; 274| 3.78k| chansess->agentdir = NULL; 275| 3.78k|#endif 276| | 277| | /* Will drop to DROPBEAR_PRIO_NORMAL if a non-tty command starts */ 278| 3.78k| channel->prio = DROPBEAR_PRIO_LOWDELAY; 279| | 280| 3.78k| return 0; 281| | 282| 3.78k|} svr-chansession.c:closechansess: 293| 710|static void closechansess(const struct Channel *channel) { 294| 710| struct ChanSess *chansess; 295| | 296| 710| TRACE(("enter closechansess")) 297| | 298| 710| chansess = (struct ChanSess*)channel->typedata; 299| | 300| 710| if (chansess == NULL) { ------------------ | Branch (300:6): [True: 0, False: 710] ------------------ 301| 0| TRACE(("leave closechansess: chansess == NULL")) 302| 0| return; 303| 0| } 304| | 305| 710| send_exitsignalstatus(channel); 306| 710| TRACE(("leave closechansess")) 307| 710|} svr-chansession.c:send_exitsignalstatus: 170| 710|static void send_exitsignalstatus(const struct Channel *channel) { 171| | 172| 710| struct ChanSess *chansess = (struct ChanSess*)channel->typedata; 173| | 174| 710| if (chansess->exit.exitpid >= 0) { ------------------ | Branch (174:6): [True: 0, False: 710] ------------------ 175| 0| if (chansess->exit.exitsignal > 0) { ------------------ | Branch (175:7): [True: 0, False: 0] ------------------ 176| 0| send_msg_chansess_exitsignal(channel, chansess); 177| 0| } else { 178| 0| send_msg_chansess_exitstatus(channel, chansess); 179| 0| } 180| 0| } 181| 710|} svr-chansession.c:cleanupchansess: 310| 3.78k|static void cleanupchansess(const struct Channel *channel) { 311| | 312| 3.78k| struct ChanSess *chansess; 313| 3.78k| unsigned int i; 314| 3.78k| struct logininfo *li; 315| | 316| 3.78k| TRACE(("enter closechansess")) 317| | 318| 3.78k| chansess = (struct ChanSess*)channel->typedata; 319| | 320| 3.78k| if (chansess == NULL) { ------------------ | Branch (320:6): [True: 0, False: 3.78k] ------------------ 321| 0| TRACE(("leave closechansess: chansess == NULL")) 322| 0| return; 323| 0| } 324| | 325| 3.78k| m_free(chansess->cmd); ------------------ | | 24| 3.78k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 326| 3.78k| m_free(chansess->term); ------------------ | | 24| 3.78k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 327| 3.78k| m_free(chansess->original_command); ------------------ | | 24| 3.78k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 328| | 329| 3.78k| if (chansess->tty) { ------------------ | Branch (329:6): [True: 8, False: 3.78k] ------------------ 330| | /* write the utmp/wtmp login record */ 331| 8| li = chansess_login_alloc(chansess); 332| 8| login_logout(li); 333| 8| login_free_entry(li); 334| | 335| 8| pty_release(chansess->tty); 336| 8| m_free(chansess->tty); ------------------ | | 24| 8|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 337| 8| } 338| | 339| |#if DROPBEAR_X11FWD 340| | x11cleanup(chansess); 341| |#endif 342| | 343| 3.78k|#if DROPBEAR_SVR_AGENTFWD 344| 3.78k| svr_agentcleanup(chansess); 345| 3.78k|#endif 346| | 347| | /* clear child pid entries */ 348| 12.9k| for (i = 0; i < svr_ses.childpidsize; i++) { ------------------ | Branch (348:14): [True: 9.14k, False: 3.78k] ------------------ 349| 9.14k| if (svr_ses.childpids[i].chansess == chansess) { ------------------ | Branch (349:7): [True: 1.55k, False: 7.59k] ------------------ 350| 1.55k| dropbear_assert(svr_ses.childpids[i].pid > 0); ------------------ | | 83| 1.55k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1.55k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 351| 1.55k| TRACE(("closing pid %d", svr_ses.childpids[i].pid)) 352| 1.55k| TRACE(("exitpid is %d", chansess->exit.exitpid)) 353| 1.55k| svr_ses.childpids[i].pid = -1; 354| 1.55k| svr_ses.childpids[i].chansess = NULL; 355| 1.55k| } 356| 9.14k| } 357| | 358| 3.78k| m_free(chansess); ------------------ | | 24| 3.78k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 359| | 360| 3.78k| TRACE(("leave closechansess")) 361| 3.78k|} svr-chansession.c:chansess_login_alloc: 285| 8|chansess_login_alloc(const struct ChanSess *chansess) { 286| 8| struct logininfo * li; 287| 8| li = login_alloc_entry(chansess->pid, ses.authstate.username, 288| 8| svr_ses.remotehost, chansess->tty); 289| 8| return li; 290| 8|} svr-chansession.c:chansessionrequest: 365| 7.34k|static void chansessionrequest(struct Channel *channel) { 366| | 367| 7.34k| char * type = NULL; 368| 7.34k| unsigned int typelen; 369| 7.34k| unsigned char wantreply; 370| 7.34k| int ret = 1; 371| 7.34k| struct ChanSess *chansess; 372| | 373| 7.34k| TRACE(("enter chansessionrequest")) 374| | 375| 7.34k| type = buf_getstring(ses.payload, &typelen); 376| 7.34k| wantreply = buf_getbool(ses.payload); 377| | 378| 7.34k| if (typelen > MAX_NAME_LEN) { ------------------ | | 205| 7.34k|#define MAX_NAME_LEN 64 /* maximum length of a protocol name, isn't ------------------ | Branch (378:6): [True: 70, False: 7.27k] ------------------ 379| 70| TRACE(("leave chansessionrequest: type too long")) /* XXX send error?*/ 380| 70| goto out; 381| 70| } 382| | 383| 7.27k| chansess = (struct ChanSess*)channel->typedata; 384| 7.27k| dropbear_assert(chansess != NULL); ------------------ | | 83| 7.27k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 7.27k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 385| 7.27k| TRACE(("type is %s", type)) 386| | 387| 7.27k| if (strcmp(type, "window-change") == 0) { ------------------ | Branch (387:6): [True: 63, False: 7.20k] ------------------ 388| 63| ret = sessionwinchange(chansess); 389| 7.20k| } else if (strcmp(type, "shell") == 0) { ------------------ | Branch (389:13): [True: 4.71k, False: 2.49k] ------------------ 390| 4.71k| ret = sessioncommand(channel, chansess, 0, 0); 391| 4.71k| } else if (strcmp(type, "pty-req") == 0) { ------------------ | Branch (391:13): [True: 167, False: 2.32k] ------------------ 392| 167| ret = sessionpty(chansess); 393| 2.32k| } else if (strcmp(type, "exec") == 0) { ------------------ | Branch (393:13): [True: 175, False: 2.15k] ------------------ 394| 175| ret = sessioncommand(channel, chansess, 1, 0); 395| 2.15k| } else if (strcmp(type, "subsystem") == 0) { ------------------ | Branch (395:13): [True: 290, False: 1.86k] ------------------ 396| 290| ret = sessioncommand(channel, chansess, 1, 1); 397| |#if DROPBEAR_X11FWD 398| | } else if (strcmp(type, "x11-req") == 0) { 399| | ret = x11req(chansess); 400| |#endif 401| 290|#if DROPBEAR_SVR_AGENTFWD 402| 1.86k| } else if (strcmp(type, "auth-agent-req@openssh.com") == 0) { ------------------ | Branch (402:13): [True: 0, False: 1.86k] ------------------ 403| 0| ret = svr_agentreq(chansess); 404| 0|#endif 405| 1.86k| } else if (strcmp(type, "signal") == 0) { ------------------ | Branch (405:13): [True: 506, False: 1.35k] ------------------ 406| 506| ret = sessionsignal(chansess); 407| 1.35k| } else { 408| | /* etc, todo "env", "subsystem" */ 409| 1.35k| } 410| | 411| 7.31k|out: 412| | 413| 7.31k| if (wantreply) { ------------------ | Branch (413:6): [True: 6.15k, False: 1.16k] ------------------ 414| 6.15k| if (ret == DROPBEAR_SUCCESS) { ------------------ | | 102| 6.15k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (414:7): [True: 1.40k, False: 4.75k] ------------------ 415| 1.40k| send_msg_channel_success(channel); 416| 4.75k| } else { 417| 4.75k| send_msg_channel_failure(channel); 418| 4.75k| } 419| 6.15k| } 420| | 421| 7.31k| m_free(type); ------------------ | | 24| 7.31k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 422| 7.31k| TRACE(("leave chansessionrequest")) 423| 7.31k|} svr-chansession.c:sessionwinchange: 467| 71|static int sessionwinchange(const struct ChanSess *chansess) { 468| | 469| 71| int termc, termr, termw, termh; 470| | 471| 71| if (chansess->master < 0) { ------------------ | Branch (471:6): [True: 63, False: 8] ------------------ 472| | /* haven't got a pty yet */ 473| 63| return DROPBEAR_FAILURE; ------------------ | | 103| 63|#define DROPBEAR_FAILURE -1 ------------------ 474| 63| } 475| | 476| 8| termc = buf_getint(ses.payload); 477| 8| termr = buf_getint(ses.payload); 478| 8| termw = buf_getint(ses.payload); 479| 8| termh = buf_getint(ses.payload); 480| | 481| 8| pty_change_window_size(chansess->master, termr, termc, termw, termh); 482| | 483| 8| return DROPBEAR_SUCCESS; ------------------ | | 102| 8|#define DROPBEAR_SUCCESS 0 ------------------ 484| 71|} svr-chansession.c:sessioncommand: 658| 5.18k| int iscmd, int issubsys) { 659| | 660| 5.18k| unsigned int cmdlen = 0; 661| 5.18k| int ret; 662| | 663| 5.18k| TRACE(("enter sessioncommand %d", channel->index)) 664| | 665| 5.18k| if (chansess->pid != 0) { ------------------ | Branch (665:6): [True: 2.36k, False: 2.81k] ------------------ 666| | /* Note that only one command can _succeed_. The client might try 667| | * one command (which fails), then try another. Ie fallback 668| | * from sftp to scp */ 669| 2.36k| TRACE(("leave sessioncommand, already have a command")) 670| 2.36k| return DROPBEAR_FAILURE; ------------------ | | 103| 2.36k|#define DROPBEAR_FAILURE -1 ------------------ 671| 2.36k| } 672| | 673| 2.81k| if (iscmd) { ------------------ | Branch (673:6): [True: 405, False: 2.40k] ------------------ 674| | /* "exec" */ 675| 405| if (chansess->cmd == NULL) { ------------------ | Branch (675:7): [True: 405, False: 0] ------------------ 676| 405| chansess->cmd = buf_getstring(ses.payload, &cmdlen); 677| | 678| 405| if (cmdlen > MAX_CMD_LEN) { ------------------ | | 75| 405|#define MAX_CMD_LEN 9000 /* max length of a command */ ------------------ | Branch (678:8): [True: 0, False: 405] ------------------ 679| 0| m_free(chansess->cmd); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 680| | /* TODO - send error - too long ? */ 681| 0| TRACE(("leave sessioncommand, command too long %d", cmdlen)) 682| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 683| 0| } 684| 405| } 685| 405| if (issubsys) { ------------------ | Branch (685:7): [True: 290, False: 115] ------------------ 686| 290|#if DROPBEAR_SFTPSERVER 687| 290| if ((cmdlen == 4) && strncmp(chansess->cmd, "sftp", 4) == 0) { ------------------ | Branch (687:8): [True: 130, False: 160] | Branch (687:25): [True: 65, False: 65] ------------------ 688| 65| char *expand_path = expand_homedir_path(SFTPSERVER_PATH); ------------------ | | 463| 65|#define SFTPSERVER_PATH "/usr/libexec/sftp-server" ------------------ 689| 65| m_free(chansess->cmd); ------------------ | | 24| 65|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 690| 65| chansess->cmd = m_strdup(expand_path); 691| 65| m_free(expand_path); ------------------ | | 24| 65|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 692| 65| } else 693| 225|#endif 694| 225| { 695| 225| m_free(chansess->cmd); ------------------ | | 24| 225|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 696| 225| TRACE(("leave sessioncommand, unknown subsystem")) 697| 225| return DROPBEAR_FAILURE; ------------------ | | 103| 225|#define DROPBEAR_FAILURE -1 ------------------ 698| 225| } 699| 290| } 700| 405| } 701| | 702| | 703| | /* take global command into account */ 704| 2.58k| if (svr_opts.forced_command) { ------------------ | Branch (704:6): [True: 0, False: 2.58k] ------------------ 705| 0| if (chansess->cmd) { ------------------ | Branch (705:7): [True: 0, False: 0] ------------------ 706| 0| chansess->original_command = chansess->cmd; 707| 0| } else { 708| 0| chansess->original_command = m_strdup(""); 709| 0| } 710| 0| chansess->cmd = m_strdup(svr_opts.forced_command); 711| 2.58k| } else { 712| | /* take public key option 'command' into account */ 713| 2.58k| svr_pubkey_set_forced_command(chansess); 714| 2.58k| } 715| | 716| | 717| |#if LOG_COMMANDS 718| | if (chansess->cmd) { 719| | dropbear_log(LOG_INFO, "User %s executing '%s'", 720| | ses.authstate.pw_name, chansess->cmd); 721| | } else { 722| | dropbear_log(LOG_INFO, "User %s executing login shell", 723| | ses.authstate.pw_name); 724| | } 725| |#endif 726| | 727| | /* uClinux will vfork(), so there'll be a race as 728| | connection_string is freed below. */ 729| 2.58k|#if !DROPBEAR_VFORK 730| 2.58k| make_connection_string(chansess); 731| 2.58k|#endif 732| | 733| 2.58k| if (chansess->term == NULL) { ------------------ | Branch (733:6): [True: 1.55k, False: 1.03k] ------------------ 734| | /* no pty */ 735| 1.55k| ret = noptycommand(channel, chansess); 736| 1.55k| if (ret == DROPBEAR_SUCCESS) { ------------------ | | 102| 1.55k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (736:7): [True: 1.55k, False: 0] ------------------ 737| 1.55k| channel->prio = DROPBEAR_PRIO_NORMAL; 738| 1.55k| update_channel_prio(); 739| 1.55k| } 740| 1.55k| } else { 741| | /* want pty */ 742| 1.03k| ret = ptycommand(channel, chansess); 743| 1.03k| } 744| | 745| 2.58k|#if !DROPBEAR_VFORK 746| 2.58k| m_free(chansess->connection_string); ------------------ | | 24| 2.58k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 747| 2.58k| m_free(chansess->client_string); ------------------ | | 24| 2.58k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 748| 2.58k|#endif 749| | 750| 2.58k| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 2.58k|#define DROPBEAR_FAILURE -1 ------------------ | Branch (750:6): [True: 1.03k, False: 1.55k] ------------------ 751| 1.03k| m_free(chansess->cmd); ------------------ | | 24| 1.03k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 752| 1.03k| } 753| 2.58k| TRACE(("leave sessioncommand, ret %d", ret)) 754| 2.58k| return ret; 755| 2.81k|} svr-chansession.c:make_connection_string: 630| 2.58k|static void make_connection_string(struct ChanSess *chansess) { 631| 2.58k| char *local_ip, *local_port, *remote_ip, *remote_port; 632| 2.58k| size_t len; 633| 2.58k| get_socket_address(ses.sock_in, &local_ip, &local_port, &remote_ip, &remote_port, 0); 634| | 635| | /* "remoteip remoteport localip localport" */ 636| 2.58k| len = strlen(local_ip) + strlen(remote_ip) + 20; 637| 2.58k| chansess->connection_string = m_malloc(len); 638| 2.58k| snprintf(chansess->connection_string, len, "%s %s %s %s", remote_ip, remote_port, local_ip, local_port); 639| | 640| | /* deprecated but bash only loads .bashrc if SSH_CLIENT is set */ 641| | /* "remoteip remoteport localport" */ 642| 2.58k| len = strlen(remote_ip) + 20; 643| 2.58k| chansess->client_string = m_malloc(len); 644| 2.58k| snprintf(chansess->client_string, len, "%s %s %s", remote_ip, remote_port, local_port); 645| | 646| 2.58k| m_free(local_ip); ------------------ | | 24| 2.58k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 647| 2.58k| m_free(local_port); ------------------ | | 24| 2.58k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 648| 2.58k| m_free(remote_ip); ------------------ | | 24| 2.58k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 649| 2.58k| m_free(remote_port); ------------------ | | 24| 2.58k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 650| 2.58k|} svr-chansession.c:noptycommand: 760| 1.55k|static int noptycommand(struct Channel *channel, struct ChanSess *chansess) { 761| 1.55k| int ret; 762| | 763| 1.55k| TRACE(("enter noptycommand")) 764| 1.55k| ret = spawn_command(execchild, chansess, 765| 1.55k| &channel->writefd, &channel->readfd, &channel->errfd, 766| 1.55k| &chansess->pid); 767| | 768| 1.55k| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1.55k|#define DROPBEAR_FAILURE -1 ------------------ | Branch (768:6): [True: 0, False: 1.55k] ------------------ 769| 0| return ret; 770| 0| } 771| | 772| 1.55k| ses.maxfd = MAX(ses.maxfd, channel->writefd); 773| 1.55k| ses.maxfd = MAX(ses.maxfd, channel->readfd); 774| 1.55k| ses.maxfd = MAX(ses.maxfd, channel->errfd); 775| 1.55k| channel->bidir_fd = 0; 776| | 777| 1.55k| addchildpid(chansess, chansess->pid); 778| | 779| 1.55k| if (svr_ses.lastexit.exitpid != -1) { ------------------ | Branch (779:6): [True: 0, False: 1.55k] ------------------ 780| 0| unsigned int i; 781| 0| TRACE(("parent side: lastexitpid is %d", svr_ses.lastexit.exitpid)) 782| | /* The child probably exited and the signal handler triggered 783| | * possibly before we got around to adding the childpid. So we fill 784| | * out its data manually */ 785| 0| for (i = 0; i < svr_ses.childpidsize; i++) { ------------------ | Branch (785:15): [True: 0, False: 0] ------------------ 786| 0| if (svr_ses.childpids[i].pid == svr_ses.lastexit.exitpid) { ------------------ | Branch (786:8): [True: 0, False: 0] ------------------ 787| 0| TRACE(("found match for lastexitpid")) 788| 0| svr_ses.childpids[i].chansess->exit = svr_ses.lastexit; 789| 0| svr_ses.lastexit.exitpid = -1; 790| 0| break; 791| 0| } 792| 0| } 793| 0| } 794| | 795| 1.55k| TRACE(("leave noptycommand")) 796| 1.55k| return DROPBEAR_SUCCESS; ------------------ | | 102| 1.55k|#define DROPBEAR_SUCCESS 0 ------------------ 797| 1.55k|} svr-chansession.c:addchildpid: 924| 1.55k|static void addchildpid(struct ChanSess *chansess, pid_t pid) { 925| | 926| 1.55k| unsigned int i; 927| 2.97k| for (i = 0; i < svr_ses.childpidsize; i++) { ------------------ | Branch (927:14): [True: 2.39k, False: 574] ------------------ 928| 2.39k| if (svr_ses.childpids[i].pid == -1) { ------------------ | Branch (928:7): [True: 984, False: 1.41k] ------------------ 929| 984| break; 930| 984| } 931| 2.39k| } 932| | 933| | /* need to increase size */ 934| 1.55k| if (i == svr_ses.childpidsize) { ------------------ | Branch (934:6): [True: 574, False: 984] ------------------ 935| 574| svr_ses.childpids = (struct ChildPid*)m_realloc(svr_ses.childpids, 936| 574| sizeof(struct ChildPid) * (svr_ses.childpidsize+1)); 937| 574| svr_ses.childpidsize++; 938| 574| } 939| | 940| 1.55k| TRACE(("addchildpid %d pid %d for chansess %p", i, pid, chansess)) 941| 1.55k| svr_ses.childpids[i].pid = pid; 942| 1.55k| svr_ses.childpids[i].chansess = chansess; 943| | 944| 1.55k|} svr-chansession.c:ptycommand: 802| 1.03k|static int ptycommand(struct Channel *channel, struct ChanSess *chansess) { 803| | 804| 1.03k| pid_t pid; 805| 1.03k| struct logininfo *li = NULL; 806| 1.03k|#if DO_MOTD 807| 1.03k| buffer * motdbuf = NULL; 808| 1.03k| int len; 809| 1.03k| struct stat sb; 810| 1.03k| char *hushpath = NULL; 811| 1.03k|#endif 812| | 813| 1.03k| TRACE(("enter ptycommand")) 814| | 815| | /* we need to have a pty allocated */ 816| 1.03k| if (chansess->master == -1 || chansess->tty == NULL) { ------------------ | Branch (816:6): [True: 1.03k, False: 0] | Branch (816:32): [True: 0, False: 0] ------------------ 817| 1.03k| dropbear_log(LOG_WARNING, "No pty was allocated, couldn't execute"); 818| 1.03k| return DROPBEAR_FAILURE; ------------------ | | 103| 1.03k|#define DROPBEAR_FAILURE -1 ------------------ 819| 1.03k| } 820| | 821| |#if DROPBEAR_VFORK 822| | pid = vfork(); 823| |#else 824| 0| pid = fork(); 825| 0|#endif 826| 0| if (pid < 0) ------------------ | Branch (826:6): [True: 0, False: 0] ------------------ 827| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 828| | 829| 0| if (pid == 0) { ------------------ | Branch (829:6): [True: 0, False: 0] ------------------ 830| | /* child */ 831| | 832| 0| TRACE(("back to normal sigchld")) 833| | /* Revert to normal sigchld handling */ 834| 0| if (signal(SIGCHLD, SIG_DFL) == SIG_ERR) { ------------------ | Branch (834:7): [True: 0, False: 0] ------------------ 835| 0| dropbear_exit("signal() error"); 836| 0| } 837| | 838| | /* redirect stdin/stdout/stderr */ 839| 0| close(chansess->master); ------------------ | | 56| 0|#define close(fd) wrapfd_close(fd) ------------------ 840| | 841| 0| pty_make_controlling_tty(&chansess->slave, chansess->tty); 842| | 843| 0| if ((dup2(chansess->slave, STDIN_FILENO) < 0) || ------------------ | Branch (843:7): [True: 0, False: 0] ------------------ 844| 0| (dup2(chansess->slave, STDOUT_FILENO) < 0)) { ------------------ | Branch (844:4): [True: 0, False: 0] ------------------ 845| 0| TRACE(("leave ptycommand: error redirecting filedesc")) 846| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 847| 0| } 848| | 849| | /* write the utmp/wtmp login record - must be after changing the 850| | * terminal used for stdout with the dup2 above, otherwise 851| | * the wtmp login will not be recorded */ 852| 0| li = chansess_login_alloc(chansess); 853| 0| login_login(li); 854| 0| login_free_entry(li); 855| | 856| | /* Can now dup2 stderr. Messages from login_login() have gone 857| | to the parent stderr */ 858| 0| if (dup2(chansess->slave, STDERR_FILENO) < 0) { ------------------ | Branch (858:7): [True: 0, False: 0] ------------------ 859| 0| TRACE(("leave ptycommand: error redirecting filedesc")) 860| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 861| 0| } 862| | 863| 0| close(chansess->slave); ------------------ | | 56| 0|#define close(fd) wrapfd_close(fd) ------------------ 864| | 865| 0|#if DO_MOTD 866| 0| if (svr_opts.domotd && !chansess->cmd) { ------------------ | Branch (866:7): [True: 0, False: 0] | Branch (866:26): [True: 0, False: 0] ------------------ 867| | /* don't show the motd if ~/.hushlogin exists */ 868| | 869| | /* 12 == strlen("/.hushlogin\0") */ 870| 0| len = strlen(ses.authstate.pw_dir) + 12; 871| | 872| 0| hushpath = m_malloc(len); 873| 0| snprintf(hushpath, len, "%s/.hushlogin", ses.authstate.pw_dir); 874| | 875| 0| if (stat(hushpath, &sb) < 0) { ------------------ | Branch (875:8): [True: 0, False: 0] ------------------ 876| 0| char *expand_path = NULL; 877| | /* more than a screenful is stupid IMHO */ 878| 0| motdbuf = buf_new(80 * 25); 879| 0| expand_path = expand_homedir_path(MOTD_FILENAME); ------------------ | | 329| 0|#define MOTD_FILENAME "/etc/motd" ------------------ 880| 0| if (buf_readfile(motdbuf, expand_path) == DROPBEAR_SUCCESS) { ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (880:9): [True: 0, False: 0] ------------------ 881| 0| buf_setpos(motdbuf, 0); 882| 0| while (motdbuf->pos != motdbuf->len) { ------------------ | Branch (882:13): [True: 0, False: 0] ------------------ 883| 0| len = motdbuf->len - motdbuf->pos; 884| 0| len = write(STDOUT_FILENO, ------------------ | | 54| 0|#define write(fd, buf, count) wrapfd_write(fd, buf, count) ------------------ 885| 0| buf_getptr(motdbuf, len), len); 886| 0| buf_incrpos(motdbuf, len); 887| 0| } 888| 0| } 889| 0| m_free(expand_path); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 890| 0| buf_free(motdbuf); 891| | 892| 0| } 893| 0| m_free(hushpath); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 894| 0| } 895| 0|#endif /* DO_MOTD */ 896| | 897| 0| execchild(chansess); 898| | /* not reached */ 899| | 900| 0| } else { 901| | /* parent */ 902| 0| TRACE(("continue ptycommand: parent")) 903| 0| chansess->pid = pid; 904| | 905| | /* add a child pid */ 906| 0| addchildpid(chansess, pid); 907| | 908| 0| close(chansess->slave); ------------------ | | 56| 0|#define close(fd) wrapfd_close(fd) ------------------ 909| 0| channel->writefd = chansess->master; 910| 0| channel->readfd = chansess->master; 911| | /* don't need to set stderr here */ 912| 0| ses.maxfd = MAX(ses.maxfd, chansess->master); 913| 0| channel->bidir_fd = 1; 914| | 915| 0| setnonblocking(chansess->master); 916| | 917| 0| } 918| | 919| 0| TRACE(("leave ptycommand")) 920| 0| return DROPBEAR_SUCCESS; ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ 921| 0|} svr-chansession.c:sessionpty: 580| 167|static int sessionpty(struct ChanSess * chansess) { 581| | 582| 167| unsigned int termlen; 583| 167| char namebuf[65]; 584| 167| struct passwd * pw = NULL; 585| | 586| 167| TRACE(("enter sessionpty")) 587| | 588| 167| if (!svr_pubkey_allows_pty()) { ------------------ | Branch (588:6): [True: 0, False: 167] ------------------ 589| 0| TRACE(("leave sessionpty : pty forbidden by public key option")) 590| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 591| 0| } 592| | 593| 167| chansess->term = buf_getstring(ses.payload, &termlen); 594| 167| if (termlen > MAX_TERM_LEN) { ------------------ | | 76| 167|#define MAX_TERM_LEN 200 /* max length of TERM name */ ------------------ | Branch (594:6): [True: 154, False: 13] ------------------ 595| | /* TODO send disconnect ? */ 596| 154| TRACE(("leave sessionpty: term len too long")) 597| 154| return DROPBEAR_FAILURE; ------------------ | | 103| 154|#define DROPBEAR_FAILURE -1 ------------------ 598| 154| } 599| | 600| | /* allocate the pty */ 601| 13| if (chansess->master != -1) { ------------------ | Branch (601:6): [True: 0, False: 13] ------------------ 602| 0| dropbear_exit("Multiple pty requests"); 603| 0| } 604| 13| if (pty_allocate(&chansess->master, &chansess->slave, namebuf, 64) == 0) { ------------------ | Branch (604:6): [True: 0, False: 13] ------------------ 605| 0| TRACE(("leave sessionpty: failed to allocate pty")) 606| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 607| 0| } 608| | 609| 13| chansess->tty = m_strdup(namebuf); 610| 13| if (!chansess->tty) { ------------------ | Branch (610:6): [True: 0, False: 13] ------------------ 611| 0| dropbear_exit("Out of memory"); /* TODO disconnect */ 612| 0| } 613| | 614| 13| pw = getpwnam(ses.authstate.pw_name); ------------------ | | 108| 13|#define getpwnam(x) fuzz_getpwnam(x) ------------------ 615| 13| if (!pw) ------------------ | Branch (615:6): [True: 0, False: 13] ------------------ 616| 0| dropbear_exit("getpwnam failed after succeeding previously"); 617| 13| pty_setowner(pw, chansess->tty); 618| | 619| | /* Set up the rows/col counts */ 620| 13| sessionwinchange(chansess); 621| | 622| | /* Read the terminal modes */ 623| 13| get_termmodes(chansess); 624| | 625| 13| TRACE(("leave sessionpty")) 626| 13| return DROPBEAR_SUCCESS; ------------------ | | 102| 13|#define DROPBEAR_SUCCESS 0 ------------------ 627| 13|} svr-chansession.c:get_termmodes: 486| 1|static void get_termmodes(const struct ChanSess *chansess) { 487| | 488| 1| struct termios termio; 489| 1| unsigned char opcode; 490| 1| unsigned int value; 491| 1| const struct TermCode * termcode; 492| 1| unsigned int len; 493| | 494| 1| TRACE(("enter get_termmodes")) 495| | 496| | /* Term modes */ 497| | /* We'll ignore errors and continue if we can't set modes. 498| | * We're ignoring baud rates since they seem evil */ 499| 1| if (tcgetattr(chansess->master, &termio) == -1) { ------------------ | Branch (499:6): [True: 0, False: 1] ------------------ 500| 0| return; 501| 0| } 502| | 503| 1| len = buf_getint(ses.payload); 504| 1| TRACE(("term mode str %d p->l %d p->p %d", 505| 1| len, ses.payload->len , ses.payload->pos)); 506| 1| if (len != ses.payload->len - ses.payload->pos) { ------------------ | Branch (506:6): [True: 1, False: 0] ------------------ 507| 1| dropbear_exit("Bad term mode string"); 508| 1| } 509| | 510| 0| if (len == 0) { ------------------ | Branch (510:6): [True: 0, False: 0] ------------------ 511| 0| TRACE(("leave get_termmodes: empty terminal modes string")) 512| 0| return; 513| 0| } 514| | 515| 0| while (((opcode = buf_getbyte(ses.payload)) != 0x00) && opcode <= 159) { ------------------ | Branch (515:9): [True: 0, False: 0] | Branch (515:58): [True: 0, False: 0] ------------------ 516| | 517| | /* must be before checking type, so that value is consumed even if 518| | * we don't use it */ 519| 0| value = buf_getint(ses.payload); 520| | 521| | /* handle types of code */ 522| 0| if (opcode > MAX_TERMCODE) { ------------------ | | 35| 0|#define MAX_TERMCODE 93 ------------------ | Branch (522:7): [True: 0, False: 0] ------------------ 523| 0| continue; 524| 0| } 525| 0| termcode = &termcodes[(unsigned int)opcode]; 526| | 527| | 528| 0| switch (termcode->type) { ------------------ | Branch (528:11): [True: 0, False: 0] ------------------ 529| | 530| 0| case TERMCODE_NONE: ------------------ | | 28| 0|#define TERMCODE_NONE 0 ------------------ | Branch (530:4): [True: 0, False: 0] ------------------ 531| 0| break; 532| | 533| 0| case TERMCODE_CONTROLCHAR: ------------------ | | 33| 0|#define TERMCODE_CONTROLCHAR 5 ------------------ | Branch (533:4): [True: 0, False: 0] ------------------ 534| 0| termio.c_cc[termcode->mapcode] = value; 535| 0| break; 536| | 537| 0| case TERMCODE_INPUT: ------------------ | | 30| 0|#define TERMCODE_INPUT 2 ------------------ | Branch (537:4): [True: 0, False: 0] ------------------ 538| 0| if (value) { ------------------ | Branch (538:9): [True: 0, False: 0] ------------------ 539| 0| termio.c_iflag |= termcode->mapcode; 540| 0| } else { 541| 0| termio.c_iflag &= ~(termcode->mapcode); 542| 0| } 543| 0| break; 544| | 545| 0| case TERMCODE_OUTPUT: ------------------ | | 31| 0|#define TERMCODE_OUTPUT 3 ------------------ | Branch (545:4): [True: 0, False: 0] ------------------ 546| 0| if (value) { ------------------ | Branch (546:9): [True: 0, False: 0] ------------------ 547| 0| termio.c_oflag |= termcode->mapcode; 548| 0| } else { 549| 0| termio.c_oflag &= ~(termcode->mapcode); 550| 0| } 551| 0| break; 552| | 553| 0| case TERMCODE_LOCAL: ------------------ | | 32| 0|#define TERMCODE_LOCAL 4 ------------------ | Branch (553:4): [True: 0, False: 0] ------------------ 554| 0| if (value) { ------------------ | Branch (554:9): [True: 0, False: 0] ------------------ 555| 0| termio.c_lflag |= termcode->mapcode; 556| 0| } else { 557| 0| termio.c_lflag &= ~(termcode->mapcode); 558| 0| } 559| 0| break; 560| | 561| 0| case TERMCODE_CONTROL: ------------------ | | 29| 0|#define TERMCODE_CONTROL 1 ------------------ | Branch (561:4): [True: 0, False: 0] ------------------ 562| 0| if (value) { ------------------ | Branch (562:9): [True: 0, False: 0] ------------------ 563| 0| termio.c_cflag |= termcode->mapcode; 564| 0| } else { 565| 0| termio.c_cflag &= ~(termcode->mapcode); 566| 0| } 567| 0| break; 568| | 569| 0| } 570| 0| } 571| 0| if (tcsetattr(chansess->master, TCSANOW, &termio) < 0) { ------------------ | Branch (571:6): [True: 0, False: 0] ------------------ 572| 0| dropbear_log(LOG_INFO, "Error setting terminal attributes"); 573| 0| } 574| 0| TRACE(("leave get_termmodes")) 575| 0|} svr-chansession.c:sessionsignal: 427| 506|static int sessionsignal(const struct ChanSess *chansess) { 428| 506| TRACE(("sessionsignal")) 429| | 430| 506| int sig = 0; 431| 506| char* signame = NULL; 432| 506| int i; 433| | 434| 506| if (chansess->pid == 0) { ------------------ | Branch (434:6): [True: 100, False: 406] ------------------ 435| 100| TRACE(("sessionsignal: done no pid")) 436| | /* haven't got a process pid yet */ 437| 100| return DROPBEAR_FAILURE; ------------------ | | 103| 100|#define DROPBEAR_FAILURE -1 ------------------ 438| 100| } 439| | 440| 406| signame = buf_getstring(ses.payload, NULL); 441| | 442| 4.00k| for (i = 0; signames[i].name != NULL; i++) { ------------------ | Branch (442:14): [True: 3.78k, False: 221] ------------------ 443| 3.78k| if (strcmp(signames[i].name, signame) == 0) { ------------------ | Branch (443:7): [True: 185, False: 3.60k] ------------------ 444| 185| sig = signames[i].signal; 445| 185| break; 446| 185| } 447| 3.78k| } 448| | 449| 406| m_free(signame); ------------------ | | 24| 406|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 450| | 451| 406| TRACE(("sessionsignal: pid %d signal %d", (int)chansess->pid, sig)) 452| 406| if (sig == 0) { ------------------ | Branch (452:6): [True: 220, False: 186] ------------------ 453| | /* failed */ 454| 220| return DROPBEAR_FAILURE; ------------------ | | 103| 220|#define DROPBEAR_FAILURE -1 ------------------ 455| 220| } 456| | 457| 186| if (kill(chansess->pid, sig) < 0) { ------------------ | | 57| 186|#define kill(pid, sig) fuzz_kill(pid, sig) ------------------ | Branch (457:6): [True: 0, False: 186] ------------------ 458| 0| TRACE(("sessionsignal: kill() errored")) 459| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 460| 0| } 461| | 462| 186| return DROPBEAR_SUCCESS; ------------------ | | 102| 186|#define DROPBEAR_SUCCESS 0 ------------------ 463| 186|} recv_msg_kexdh_init: 49| 9.32k|void recv_msg_kexdh_init() { 50| 9.32k| DEF_MP_INT(dh_e); ------------------ | | 80| 9.32k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 51| 9.32k| buffer *ecdh_qs = NULL; 52| | 53| 9.32k| TRACE(("enter recv_msg_kexdh_init")) 54| 9.32k| if (!ses.kexstate.recvkexinit) { ------------------ | Branch (54:6): [True: 5, False: 9.32k] ------------------ 55| 5| dropbear_exit("Premature kexdh_init message received"); 56| 5| } 57| | 58| 9.32k| switch (ses.newkeys->algo_kex->mode) { ------------------ | Branch (58:10): [True: 0, False: 9.32k] ------------------ 59| 0|#if DROPBEAR_NORMAL_DH 60| 2.96k| case DROPBEAR_KEX_NORMAL_DH: ------------------ | Branch (60:3): [True: 2.96k, False: 6.36k] ------------------ 61| 2.96k| m_mp_init(&dh_e); 62| 2.96k| if (buf_getmpint(ses.payload, &dh_e) != DROPBEAR_SUCCESS) { ------------------ | | 102| 2.96k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (62:8): [True: 2, False: 2.96k] ------------------ 63| 2| dropbear_exit("Bad kex value"); 64| 2| } 65| 2.96k| break; 66| 2.96k|#endif 67| 2.96k|#if DROPBEAR_ECDH 68| 2.96k| case DROPBEAR_KEX_ECDH: ------------------ | Branch (68:3): [True: 2.52k, False: 6.80k] ------------------ 69| 2.52k|#endif 70| 2.52k|#if DROPBEAR_CURVE25519 71| 6.36k| case DROPBEAR_KEX_CURVE25519: ------------------ | Branch (71:3): [True: 3.83k, False: 5.48k] ------------------ 72| 6.36k|#endif 73| 6.36k|#if DROPBEAR_ECDH || DROPBEAR_CURVE25519 74| 6.36k| ecdh_qs = buf_getstringbuf(ses.payload); 75| 6.36k| break; 76| 9.32k|#endif 77| 9.32k| } 78| 9.31k| if (ses.payload->pos != ses.payload->len) { ------------------ | Branch (78:6): [True: 39, False: 9.27k] ------------------ 79| 39| dropbear_exit("Bad kex value"); 80| 39| } 81| | 82| 9.27k| send_msg_kexdh_reply(&dh_e, ecdh_qs); 83| | 84| 9.27k| mp_clear(&dh_e); 85| 9.27k| if (ecdh_qs) { ------------------ | Branch (85:6): [True: 6.34k, False: 2.93k] ------------------ 86| 6.34k| buf_free(ecdh_qs); 87| 6.34k| ecdh_qs = NULL; 88| 6.34k| } 89| | 90| 9.27k| send_msg_newkeys(); 91| | 92| 9.27k|#if DROPBEAR_EXT_INFO 93| | /* Only send it following the first newkeys */ 94| 9.27k| if (!ses.kexstate.donesecondkex && ses.allow_ext_info) { ------------------ | Branch (94:6): [True: 1.31k, False: 7.96k] | Branch (94:37): [True: 8, False: 1.30k] ------------------ 95| 8| send_msg_ext_info(); 96| 8| } 97| 9.27k|#endif 98| | 99| 9.27k| ses.requirenext = SSH_MSG_NEWKEYS; ------------------ | | 37| 9.27k|#define SSH_MSG_NEWKEYS 21 ------------------ 100| 9.27k| TRACE(("leave recv_msg_kexdh_init")) 101| 9.27k|} svr-kex.c:send_msg_kexdh_reply: 189| 9.27k|static void send_msg_kexdh_reply(mp_int *dh_e, buffer *ecdh_qs) { 190| 9.27k| TRACE(("enter send_msg_kexdh_reply")) 191| | 192| | /* we can start creating the kexdh_reply packet */ 193| 9.27k| CHECKCLEARTOWRITE(); 194| | 195| 9.27k|#if DROPBEAR_DELAY_HOSTKEY 196| 9.27k| if (svr_opts.delay_hostkey) ------------------ | Branch (196:6): [True: 0, False: 9.27k] ------------------ 197| 0| { 198| 0| svr_ensure_hostkey(); 199| 0| } 200| 9.27k|#endif 201| | 202| 9.27k|#if DROPBEAR_FUZZ 203| 9.27k| if (fuzz.fuzzing && fuzz.skip_kexmaths) { ------------------ | Branch (203:6): [True: 9.27k, False: 0] | Branch (203:22): [True: 9.27k, False: 0] ------------------ 204| 9.27k| fuzz_fake_send_kexdh_reply(); 205| 9.27k| return; 206| 9.27k| } 207| 0|#endif 208| | 209| 0| buf_putbyte(ses.writepayload, SSH_MSG_KEXDH_REPLY); ------------------ | | 39| 0|#define SSH_MSG_KEXDH_REPLY 31 ------------------ 210| 0| buf_put_pub_key(ses.writepayload, svr_opts.hostkey, 211| 0| ses.newkeys->algo_hostkey); 212| | 213| 0| switch (ses.newkeys->algo_kex->mode) { ------------------ | Branch (213:10): [True: 0, False: 0] ------------------ 214| 0|#if DROPBEAR_NORMAL_DH 215| 0| case DROPBEAR_KEX_NORMAL_DH: ------------------ | Branch (215:3): [True: 0, False: 0] ------------------ 216| 0| { 217| 0| struct kex_dh_param * dh_param = gen_kexdh_param(); 218| 0| kexdh_comb_key(dh_param, dh_e, svr_opts.hostkey); 219| | 220| | /* put f */ 221| 0| buf_putmpint(ses.writepayload, &dh_param->pub); 222| 0| free_kexdh_param(dh_param); 223| 0| } 224| 0| break; 225| 0|#endif 226| 0|#if DROPBEAR_ECDH 227| 0| case DROPBEAR_KEX_ECDH: ------------------ | Branch (227:3): [True: 0, False: 0] ------------------ 228| 0| { 229| 0| struct kex_ecdh_param *ecdh_param = gen_kexecdh_param(); 230| 0| kexecdh_comb_key(ecdh_param, ecdh_qs, svr_opts.hostkey); 231| | 232| 0| buf_put_ecc_raw_pubkey_string(ses.writepayload, &ecdh_param->key); 233| 0| free_kexecdh_param(ecdh_param); 234| 0| } 235| 0| break; 236| 0|#endif 237| 0|#if DROPBEAR_CURVE25519 238| 0| case DROPBEAR_KEX_CURVE25519: ------------------ | Branch (238:3): [True: 0, False: 0] ------------------ 239| 0| { 240| 0| struct kex_curve25519_param *param = gen_kexcurve25519_param(); 241| 0| kexcurve25519_comb_key(param, ecdh_qs, svr_opts.hostkey); 242| | 243| 0| buf_putstring(ses.writepayload, param->pub, CURVE25519_LEN); ------------------ | | 106| 0|#define CURVE25519_LEN 32 ------------------ 244| 0| free_kexcurve25519_param(param); 245| 0| } 246| 0| break; 247| 0|#endif 248| 0| } 249| | 250| | /* calc the signature */ 251| 0| buf_put_sign(ses.writepayload, svr_opts.hostkey, 252| 0| ses.newkeys->algo_signature, ses.hash); 253| | 254| | /* the SSH_MSG_KEXDH_REPLY is done */ 255| 0| encrypt_packet(); 256| | 257| 0| TRACE(("leave send_msg_kexdh_reply")) 258| 0|} svr-kex.c:send_msg_ext_info: 262| 8|static void send_msg_ext_info(void) { 263| 8| TRACE(("enter send_msg_ext_info")) 264| | 265| 8| buf_putbyte(ses.writepayload, SSH_MSG_EXT_INFO); ------------------ | | 35| 8|#define SSH_MSG_EXT_INFO 7 ------------------ 266| | /* nr-extensions */ 267| 8| buf_putint(ses.writepayload, 1); 268| | 269| 8| buf_putstring(ses.writepayload, SSH_SERVER_SIG_ALGS, strlen(SSH_SERVER_SIG_ALGS)); ------------------ | | 101| 8|#define SSH_SERVER_SIG_ALGS "server-sig-algs" ------------------ buf_putstring(ses.writepayload, SSH_SERVER_SIG_ALGS, strlen(SSH_SERVER_SIG_ALGS)); ------------------ | | 101| 8|#define SSH_SERVER_SIG_ALGS "server-sig-algs" ------------------ 270| 8| buf_put_algolist_all(ses.writepayload, sigalgs, 1); 271| | 272| 8| encrypt_packet(); 273| | 274| 8| TRACE(("leave send_msg_ext_info")) 275| 8|} svr_getopts: 134| 1|void svr_getopts(int argc, char ** argv) { 135| | 136| 1| unsigned int i, j; 137| 1| char ** next = NULL; 138| 1| int nextisport = 0; 139| 1| char* recv_window_arg = NULL; 140| 1| char* keepalive_arg = NULL; 141| 1| char* idle_timeout_arg = NULL; 142| 1| char* maxauthtries_arg = NULL; 143| 1| char* reexec_fd_arg = NULL; 144| 1| char* keyfile = NULL; 145| 1| char c; 146| |#if DROPBEAR_PLUGIN 147| | char* pubkey_plugin = NULL; 148| |#endif 149| | 150| | 151| | /* see printhelp() for options */ 152| 1| svr_opts.bannerfile = NULL; 153| 1| svr_opts.banner = NULL; 154| 1| svr_opts.forced_command = NULL; 155| 1| svr_opts.forkbg = 1; 156| 1| svr_opts.norootlogin = 0; 157| 1|#ifdef HAVE_GETGROUPLIST 158| 1| svr_opts.restrict_group = NULL; 159| 1| svr_opts.restrict_group_gid = 0; 160| 1|#endif 161| 1| svr_opts.noauthpass = 0; 162| 1| svr_opts.norootpass = 0; 163| 1| svr_opts.allowblankpass = 0; 164| 1| svr_opts.multiauthmethod = 0; 165| 1| svr_opts.maxauthtries = MAX_AUTH_TRIES; ------------------ | | 428| 1|#define MAX_AUTH_TRIES 10 ------------------ 166| 1| svr_opts.inetdmode = 0; 167| 1| svr_opts.portcount = 0; 168| 1| svr_opts.hostkey = NULL; 169| 1| svr_opts.delay_hostkey = 0; 170| 1| svr_opts.pidfile = expand_homedir_path(DROPBEAR_PIDFILE); ------------------ | | 444| 1|#define DROPBEAR_PIDFILE "/var/run/dropbear.pid" ------------------ 171| 1|#if DROPBEAR_SVR_LOCALTCPFWD 172| 1| svr_opts.nolocaltcp = 0; 173| 1|#endif 174| 1|#if DROPBEAR_SVR_REMOTETCPFWD 175| 1| svr_opts.noremotetcp = 0; 176| 1|#endif 177| |#if DROPBEAR_PLUGIN 178| | svr_opts.pubkey_plugin = NULL; 179| | svr_opts.pubkey_plugin_options = NULL; 180| |#endif 181| 1| svr_opts.pass_on_env = 0; 182| 1| svr_opts.reexec_childpipe = -1; 183| | 184| |#ifndef DISABLE_ZLIB 185| | opts.compress_mode = DROPBEAR_COMPRESS_DELAYED; 186| |#endif 187| | 188| | /* not yet 189| | opts.ipv4 = 1; 190| | opts.ipv6 = 1; 191| | */ 192| 1|#if DO_MOTD 193| 1| svr_opts.domotd = 1; 194| 1|#endif 195| 1|#ifndef DISABLE_SYSLOG 196| 1| opts.usingsyslog = 1; 197| 1|#endif 198| 1| opts.recv_window = DEFAULT_RECV_WINDOW; ------------------ | | 487| 1|#define DEFAULT_RECV_WINDOW 24576 ------------------ 199| 1| opts.keepalive_secs = DEFAULT_KEEPALIVE; ------------------ | | 503| 1|#define DEFAULT_KEEPALIVE 0 ------------------ 200| 1| opts.idle_timeout_secs = DEFAULT_IDLE_TIMEOUT; ------------------ | | 516| 1|#define DEFAULT_IDLE_TIMEOUT 0 ------------------ 201| | 202| 1|#if DROPBEAR_SVR_REMOTETCPFWD 203| 1| opts.listen_fwd_all = 0; 204| 1|#endif 205| 1| opts.disable_ip_tos = 0; 206| | 207| 2| for (i = 1; i < (unsigned int)argc; i++) { ------------------ | Branch (207:14): [True: 1, False: 1] ------------------ 208| 1| if (argv[i][0] != '-' || argv[i][1] == '\0') ------------------ | Branch (208:7): [True: 0, False: 1] | Branch (208:28): [True: 0, False: 1] ------------------ 209| 0| dropbear_exit("Invalid argument: %s", argv[i]); 210| | 211| 2| for (j = 1; (c = argv[i][j]) != '\0' && !next && !nextisport; j++) { ------------------ | Branch (211:15): [True: 1, False: 1] | Branch (211:43): [True: 1, False: 0] | Branch (211:52): [True: 1, False: 0] ------------------ 212| 1| switch (c) { 213| 0| case 'b': ------------------ | Branch (213:5): [True: 0, False: 1] ------------------ 214| 0| next = &svr_opts.bannerfile; 215| 0| break; 216| 0| case 'c': ------------------ | Branch (216:5): [True: 0, False: 1] ------------------ 217| 0| next = &svr_opts.forced_command; 218| 0| break; 219| 0| case 'd': ------------------ | Branch (219:5): [True: 0, False: 1] ------------------ 220| 0| case 'r': ------------------ | Branch (220:5): [True: 0, False: 1] ------------------ 221| 0| next = &keyfile; 222| 0| break; 223| 0| case 'R': ------------------ | Branch (223:5): [True: 0, False: 1] ------------------ 224| 0| svr_opts.delay_hostkey = 1; 225| 0| break; 226| 0| case 'F': ------------------ | Branch (226:5): [True: 0, False: 1] ------------------ 227| 0| svr_opts.forkbg = 0; 228| 0| break; 229| 0|#ifndef DISABLE_SYSLOG 230| 1| case 'E': ------------------ | Branch (230:5): [True: 1, False: 0] ------------------ 231| 1| opts.usingsyslog = 0; 232| 1| break; 233| 0|#endif 234| 0| case 'e': ------------------ | Branch (234:5): [True: 0, False: 1] ------------------ 235| 0| svr_opts.pass_on_env = 1; 236| 0| break; 237| | 238| 0|#if DROPBEAR_SVR_LOCALTCPFWD 239| 0| case 'j': ------------------ | Branch (239:5): [True: 0, False: 1] ------------------ 240| 0| svr_opts.nolocaltcp = 1; 241| 0| break; 242| 0|#endif 243| 0|#if DROPBEAR_SVR_REMOTETCPFWD 244| 0| case 'k': ------------------ | Branch (244:5): [True: 0, False: 1] ------------------ 245| 0| svr_opts.noremotetcp = 1; 246| 0| break; 247| 0| case 'a': ------------------ | Branch (247:5): [True: 0, False: 1] ------------------ 248| 0| opts.listen_fwd_all = 1; 249| 0| break; 250| 0|#endif 251| 0|#if INETD_MODE 252| 0| case 'i': ------------------ | Branch (252:5): [True: 0, False: 1] ------------------ 253| 0| svr_opts.inetdmode = 1; 254| 0| break; 255| 0|#endif 256| 0|#if DROPBEAR_DO_REEXEC && NON_INETD_MODE 257| | /* For internal use by re-exec */ 258| 0| case '2': ------------------ | Branch (258:5): [True: 0, False: 1] ------------------ 259| 0| next = &reexec_fd_arg; 260| 0| break; 261| 0|#endif 262| 0| case 'p': ------------------ | Branch (262:5): [True: 0, False: 1] ------------------ 263| 0| nextisport = 1; 264| 0| break; 265| 0| case 'P': ------------------ | Branch (265:5): [True: 0, False: 1] ------------------ 266| 0| next = &svr_opts.pidfile; 267| 0| break; 268| 0|#if DO_MOTD 269| | /* motd is displayed by default, -m turns it off */ 270| 0| case 'm': ------------------ | Branch (270:5): [True: 0, False: 1] ------------------ 271| 0| svr_opts.domotd = 0; 272| 0| break; 273| 0|#endif 274| 0| case 'w': ------------------ | Branch (274:5): [True: 0, False: 1] ------------------ 275| 0| svr_opts.norootlogin = 1; 276| 0| break; 277| 0|#ifdef HAVE_GETGROUPLIST 278| 0| case 'G': ------------------ | Branch (278:5): [True: 0, False: 1] ------------------ 279| 0| next = &svr_opts.restrict_group; 280| 0| break; 281| 0|#endif 282| 0| case 'W': ------------------ | Branch (282:5): [True: 0, False: 1] ------------------ 283| 0| next = &recv_window_arg; 284| 0| break; 285| 0| case 'K': ------------------ | Branch (285:5): [True: 0, False: 1] ------------------ 286| 0| next = &keepalive_arg; 287| 0| break; 288| 0| case 'I': ------------------ | Branch (288:5): [True: 0, False: 1] ------------------ 289| 0| next = &idle_timeout_arg; 290| 0| break; 291| 0| case 'T': ------------------ | Branch (291:5): [True: 0, False: 1] ------------------ 292| 0| next = &maxauthtries_arg; 293| 0| break; 294| 0|#if DROPBEAR_SVR_PASSWORD_AUTH || DROPBEAR_SVR_PAM_AUTH 295| 0| case 's': ------------------ | Branch (295:5): [True: 0, False: 1] ------------------ 296| 0| svr_opts.noauthpass = 1; 297| 0| break; 298| 0| case 'g': ------------------ | Branch (298:5): [True: 0, False: 1] ------------------ 299| 0| svr_opts.norootpass = 1; 300| 0| break; 301| 0| case 'B': ------------------ | Branch (301:5): [True: 0, False: 1] ------------------ 302| 0| svr_opts.allowblankpass = 1; 303| 0| break; 304| 0| case 't': ------------------ | Branch (304:5): [True: 0, False: 1] ------------------ 305| 0| svr_opts.multiauthmethod = 1; 306| 0| break; 307| 0|#endif 308| 0| case 'h': ------------------ | Branch (308:5): [True: 0, False: 1] ------------------ 309| 0| printhelp(argv[0]); 310| 0| exit(EXIT_SUCCESS); 311| 0| break; 312| 0| case 'u': ------------------ | Branch (312:5): [True: 0, False: 1] ------------------ 313| | /* backwards compatibility with old urandom option */ 314| 0| break; 315| |#if DROPBEAR_PLUGIN 316| | case 'A': 317| | next = &pubkey_plugin; 318| | break; 319| |#endif 320| |#if DEBUG_TRACE 321| | case 'v': 322| | debug_trace++; 323| | break; 324| |#endif 325| 0| case 'V': ------------------ | Branch (325:5): [True: 0, False: 1] ------------------ 326| 0| print_version(); 327| 0| exit(EXIT_SUCCESS); 328| 0| break; 329| 0| case 'z': ------------------ | Branch (329:5): [True: 0, False: 1] ------------------ 330| 0| opts.disable_ip_tos = 1; 331| 0| break; 332| 0| default: ------------------ | Branch (332:5): [True: 0, False: 1] ------------------ 333| 0| fprintf(stderr, "Invalid option -%c\n", c); ------------------ | | 100| 0|#define stderr (fuzz.fake_stderr) ------------------ 334| 0| printhelp(argv[0]); 335| 0| exit(EXIT_FAILURE); 336| 0| break; 337| 1| } 338| 1| } 339| | 340| 1| if (!next && !nextisport) ------------------ | Branch (340:7): [True: 1, False: 0] | Branch (340:16): [True: 1, False: 0] ------------------ 341| 1| continue; 342| | 343| 0| if (c == '\0') { ------------------ | Branch (343:7): [True: 0, False: 0] ------------------ 344| 0| i++; 345| 0| j = 0; 346| 0| if (!argv[i]) { ------------------ | Branch (346:8): [True: 0, False: 0] ------------------ 347| 0| dropbear_exit("Missing argument"); 348| 0| } 349| 0| } 350| | 351| 0| if (nextisport) { ------------------ | Branch (351:7): [True: 0, False: 0] ------------------ 352| 0| addportandaddress(&argv[i][j]); 353| 0| nextisport = 0; 354| 0| } else if (next) { ------------------ | Branch (354:14): [True: 0, False: 0] ------------------ 355| 0| *next = &argv[i][j]; 356| 0| if (*next == NULL) { ------------------ | Branch (356:8): [True: 0, False: 0] ------------------ 357| 0| dropbear_exit("Invalid null argument"); 358| 0| } 359| 0| next = NULL; 360| | 361| 0| if (keyfile) { ------------------ | Branch (361:8): [True: 0, False: 0] ------------------ 362| 0| addhostkey(keyfile); 363| 0| keyfile = NULL; 364| 0| } 365| 0| } 366| 0| } 367| | 368| | /* Set up listening ports */ 369| 1| if (svr_opts.portcount == 0) { ------------------ | Branch (369:6): [True: 1, False: 0] ------------------ 370| 1| svr_opts.ports[0] = m_strdup(DROPBEAR_DEFPORT); ------------------ | | 23| 1|#define DROPBEAR_DEFPORT "22" ------------------ 371| 1| svr_opts.addresses[0] = m_strdup(DROPBEAR_DEFADDRESS); ------------------ | | 28| 1|#define DROPBEAR_DEFADDRESS "" ------------------ 372| 1| svr_opts.portcount = 1; 373| 1| } 374| | 375| 1| if (svr_opts.bannerfile) { ------------------ | Branch (375:6): [True: 0, False: 1] ------------------ 376| 0| struct stat buf; 377| 0| if (stat(svr_opts.bannerfile, &buf) != 0) { ------------------ | Branch (377:7): [True: 0, False: 0] ------------------ 378| 0| dropbear_exit("Error opening banner file '%s'", 379| 0| svr_opts.bannerfile); 380| 0| } 381| | 382| 0| if (buf.st_size > MAX_BANNER_SIZE) { ------------------ | | 68| 0|#define MAX_BANNER_SIZE 2050 /* this is 25*80 chars, any more is foolish */ ------------------ | Branch (382:7): [True: 0, False: 0] ------------------ 383| 0| dropbear_exit("Banner file too large, max is %d bytes", 384| 0| MAX_BANNER_SIZE); ------------------ | | 68| 0|#define MAX_BANNER_SIZE 2050 /* this is 25*80 chars, any more is foolish */ ------------------ 385| 0| } 386| | 387| 0| svr_opts.banner = buf_new(buf.st_size); 388| 0| if (buf_readfile(svr_opts.banner, svr_opts.bannerfile)!=DROPBEAR_SUCCESS) { ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (388:7): [True: 0, False: 0] ------------------ 389| 0| dropbear_exit("Error reading banner file '%s'", 390| 0| svr_opts.bannerfile); 391| 0| } 392| 0| buf_setpos(svr_opts.banner, 0); 393| 0| } 394| | 395| 1|#ifdef HAVE_GETGROUPLIST 396| 1| if (svr_opts.restrict_group) { ------------------ | Branch (396:6): [True: 0, False: 1] ------------------ 397| 0| struct group *restrictedgroup = getgrnam(svr_opts.restrict_group); 398| | 399| 0| if (restrictedgroup){ ------------------ | Branch (399:7): [True: 0, False: 0] ------------------ 400| 0| svr_opts.restrict_group_gid = restrictedgroup->gr_gid; 401| 0| } else { 402| 0| dropbear_exit("Cannot restrict logins to group '%s' as the group does not exist", svr_opts.restrict_group); 403| 0| } 404| 0| } 405| 1|#endif 406| | 407| 1| if (recv_window_arg) { ------------------ | Branch (407:6): [True: 0, False: 1] ------------------ 408| 0| parse_recv_window(recv_window_arg); 409| 0| } 410| | 411| 1| if (maxauthtries_arg) { ------------------ | Branch (411:6): [True: 0, False: 1] ------------------ 412| 0| unsigned int val = 0; 413| 0| if (m_str_to_uint(maxauthtries_arg, &val) == DROPBEAR_FAILURE ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (413:7): [True: 0, False: 0] ------------------ 414| 0| || val == 0) { ------------------ | Branch (414:7): [True: 0, False: 0] ------------------ 415| 0| dropbear_exit("Bad maxauthtries '%s'", maxauthtries_arg); 416| 0| } 417| 0| svr_opts.maxauthtries = val; 418| 0| } 419| | 420| | 421| 1| if (keepalive_arg) { ------------------ | Branch (421:6): [True: 0, False: 1] ------------------ 422| 0| unsigned int val; 423| 0| if (m_str_to_uint(keepalive_arg, &val) == DROPBEAR_FAILURE) { ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (423:7): [True: 0, False: 0] ------------------ 424| 0| dropbear_exit("Bad keepalive '%s'", keepalive_arg); 425| 0| } 426| 0| opts.keepalive_secs = val; 427| 0| } 428| | 429| 1| if (idle_timeout_arg) { ------------------ | Branch (429:6): [True: 0, False: 1] ------------------ 430| 0| unsigned int val; 431| 0| if (m_str_to_uint(idle_timeout_arg, &val) == DROPBEAR_FAILURE) { ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (431:7): [True: 0, False: 0] ------------------ 432| 0| dropbear_exit("Bad idle_timeout '%s'", idle_timeout_arg); 433| 0| } 434| 0| opts.idle_timeout_secs = val; 435| 0| } 436| | 437| 1| if (svr_opts.forced_command) { ------------------ | Branch (437:6): [True: 0, False: 1] ------------------ 438| 0| dropbear_log(LOG_INFO, "Forced command set to '%s'", svr_opts.forced_command); 439| 0| } 440| | 441| 1| if (reexec_fd_arg) { ------------------ | Branch (441:6): [True: 0, False: 1] ------------------ 442| 0| if (m_str_to_uint(reexec_fd_arg, &svr_opts.reexec_childpipe) == DROPBEAR_FAILURE ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (442:7): [True: 0, False: 0] ------------------ 443| 0| || svr_opts.reexec_childpipe < 0) { ------------------ | Branch (443:7): [True: 0, False: 0] ------------------ 444| 0| dropbear_exit("Bad -2"); 445| 0| } 446| 0| } 447| | 448| 1|#if INETD_MODE 449| 1| if (svr_opts.inetdmode && ( ------------------ | Branch (449:6): [True: 0, False: 1] | Branch (449:28): [True: 0, False: 0] ------------------ 450| 0| opts.usingsyslog == 0 451| |#if DEBUG_TRACE 452| | || debug_trace 453| |#endif 454| 0| )) { 455| | /* log output goes to stderr which would get sent over the inetd network socket */ 456| 0| dropbear_exit("Dropbear inetd mode is incompatible with debug -v or non-syslog"); 457| 0| } 458| 1|#endif 459| | 460| 1| if (svr_opts.multiauthmethod && svr_opts.noauthpass) { ------------------ | Branch (460:6): [True: 0, False: 1] | Branch (460:34): [True: 0, False: 0] ------------------ 461| 0| dropbear_exit("-t and -s are incompatible"); 462| 0| } 463| | 464| |#if DROPBEAR_PLUGIN 465| | if (pubkey_plugin) { 466| | svr_opts.pubkey_plugin = m_strdup(pubkey_plugin); 467| | char *args = strchr(svr_opts.pubkey_plugin, ','); 468| | if (args) { 469| | *args='\0'; 470| | ++args; 471| | } 472| | svr_opts.pubkey_plugin_options = args; 473| | } 474| |#endif 475| 1|} recv_msg_service_request: 37| 672|void recv_msg_service_request() { 38| | 39| 672| char * name; 40| 672| unsigned int len; 41| | 42| 672| TRACE(("enter recv_msg_service_request")) 43| | 44| 672| name = buf_getstring(ses.payload, &len); 45| | 46| | /* ssh-userauth */ 47| 672| if (len == SSH_SERVICE_USERAUTH_LEN && ------------------ | | 105| 1.34k|#define SSH_SERVICE_USERAUTH_LEN 12 ------------------ | Branch (47:6): [True: 96, False: 576] ------------------ 48| 672| strncmp(SSH_SERVICE_USERAUTH, name, len) == 0) { ------------------ | | 104| 96|#define SSH_SERVICE_USERAUTH "ssh-userauth" ------------------ | Branch (48:4): [True: 96, False: 0] ------------------ 49| | 50| 96| send_msg_service_accept(name, len); 51| 96| m_free(name); ------------------ | | 24| 96|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 52| 96| TRACE(("leave recv_msg_service_request: done ssh-userauth")) 53| 96| return; 54| 96| } 55| | 56| | /* ssh-connection */ 57| 576| if (len == SSH_SERVICE_CONNECTION_LEN && ------------------ | | 107| 1.15k|#define SSH_SERVICE_CONNECTION_LEN 14 ------------------ | Branch (57:6): [True: 567, False: 9] ------------------ 58| 576| (strncmp(SSH_SERVICE_CONNECTION, name, len) == 0)) { ------------------ | | 106| 567|#define SSH_SERVICE_CONNECTION "ssh-connection" ------------------ | Branch (58:4): [True: 566, False: 1] ------------------ 59| 566| if (ses.authstate.authdone != 1) { ------------------ | Branch (59:7): [True: 0, False: 566] ------------------ 60| 0| dropbear_exit("Request for connection before auth"); 61| 0| } 62| | 63| 566| send_msg_service_accept(name, len); 64| 566| m_free(name); ------------------ | | 24| 566|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 65| 566| TRACE(("leave recv_msg_service_request: done ssh-connection")) 66| 566| return; 67| 566| } 68| | 69| 10| m_free(name); ------------------ | | 24| 10|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 70| | /* TODO this should be a MSG_DISCONNECT */ 71| 10| dropbear_exit("Unrecognised SSH_MSG_SERVICE_REQUEST"); 72| | 73| | 74| 576|} svr-service.c:send_msg_service_accept: 76| 662|static void send_msg_service_accept(const char *name, int len) { 77| | 78| 662| TRACE(("accepting service %s", name)) 79| | 80| 662| CHECKCLEARTOWRITE(); 81| | 82| 662| buf_putbyte(ses.writepayload, SSH_MSG_SERVICE_ACCEPT); ------------------ | | 34| 662|#define SSH_MSG_SERVICE_ACCEPT 6 ------------------ 83| 662| buf_putstring(ses.writepayload, name, len); 84| | 85| 662| encrypt_packet(); 86| | 87| 662|} svr_session: 105| 1.49k|void svr_session(int sock, int childpipe) { 106| 1.49k| char *host, *port; 107| 1.49k| size_t len; 108| | 109| 1.49k| common_session_init(sock, sock); 110| | 111| | /* Initialise server specific parts of the session */ 112| 1.49k| svr_ses.childpipe = childpipe; 113| |#if DROPBEAR_VFORK 114| | svr_ses.server_pid = getpid(); 115| |#endif 116| | 117| | /* for logging the remote address */ 118| 1.49k| get_socket_address(ses.sock_in, NULL, NULL, &host, &port, 0); 119| 1.49k| len = strlen(host) + strlen(port) + 2; 120| 1.49k| svr_ses.addrstring = m_malloc(len); 121| 1.49k| snprintf(svr_ses.addrstring, len, "%s:%s", host, port); 122| 1.49k| m_free(host); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 123| 1.49k| m_free(port); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 124| | 125| |#if DROPBEAR_PLUGIN 126| | /* Initializes the PLUGIN Plugin */ 127| | svr_ses.plugin_handle = NULL; 128| | svr_ses.plugin_instance = NULL; 129| | if (svr_opts.pubkey_plugin) { 130| |#if DEBUG_TRACE 131| | const int verbose = debug_trace; 132| |#else 133| | const int verbose = 0; 134| |#endif 135| | PubkeyExtPlugin_newFn pluginConstructor; 136| | 137| | /* RTLD_NOW: fails if not all the symbols are resolved now. Better fail now than at run-time */ 138| | svr_ses.plugin_handle = dlopen(svr_opts.pubkey_plugin, RTLD_NOW); 139| | if (svr_ses.plugin_handle == NULL) { 140| | dropbear_exit("failed to load external pubkey plugin '%s': %s", svr_opts.pubkey_plugin, dlerror()); 141| | } 142| | pluginConstructor = (PubkeyExtPlugin_newFn)dlsym(svr_ses.plugin_handle, DROPBEAR_PUBKEY_PLUGIN_FNNAME_NEW); 143| | if (!pluginConstructor) { 144| | dropbear_exit("plugin constructor method not found in external pubkey plugin"); 145| | } 146| | 147| | /* Create an instance of the plugin */ 148| | svr_ses.plugin_instance = pluginConstructor(verbose, svr_opts.pubkey_plugin_options, svr_ses.addrstring); 149| | if (svr_ses.plugin_instance == NULL) { 150| | dropbear_exit("external plugin initialization failed"); 151| | } 152| | /* Check if the plugin is compatible */ 153| | if ( (svr_ses.plugin_instance->api_version[0] != DROPBEAR_PLUGIN_VERSION_MAJOR) || 154| | (svr_ses.plugin_instance->api_version[1] < DROPBEAR_PLUGIN_VERSION_MINOR) ) { 155| | dropbear_exit("plugin version check failed: " 156| | "Dropbear=%d.%d, plugin=%d.%d", 157| | DROPBEAR_PLUGIN_VERSION_MAJOR, DROPBEAR_PLUGIN_VERSION_MINOR, 158| | svr_ses.plugin_instance->api_version[0], svr_ses.plugin_instance->api_version[1]); 159| | } 160| | if (svr_ses.plugin_instance->api_version[1] > DROPBEAR_PLUGIN_VERSION_MINOR) { 161| | dropbear_log(LOG_WARNING, "plugin API newer than dropbear API: " 162| | "Dropbear=%d.%d, plugin=%d.%d", 163| | DROPBEAR_PLUGIN_VERSION_MAJOR, DROPBEAR_PLUGIN_VERSION_MINOR, 164| | svr_ses.plugin_instance->api_version[0], svr_ses.plugin_instance->api_version[1]); 165| | } 166| | dropbear_log(LOG_INFO, "successfully loaded and initialized pubkey plugin '%s'", svr_opts.pubkey_plugin); 167| | } 168| |#endif 169| | 170| 1.49k| svr_authinitialise(); 171| 1.49k| chaninitialise(svr_chantypes); 172| 1.49k| svr_chansessinitialise(); 173| 1.49k| svr_algos_initialise(); 174| | 175| 1.49k| get_socket_address(ses.sock_in, NULL, NULL, 176| 1.49k| &svr_ses.remotehost, NULL, 1); 177| | 178| | /* set up messages etc */ 179| 1.49k| ses.remoteclosed = svr_remoteclosed; 180| 1.49k| ses.extra_session_cleanup = svr_session_cleanup; 181| | 182| | /* packet handlers */ 183| 1.49k| ses.packettypes = svr_packettypes; 184| | 185| 1.49k| ses.isserver = 1; 186| | 187| | /* We're ready to go now */ 188| 1.49k| ses.init_done = 1; 189| | 190| | /* exchange identification, version etc */ 191| 1.49k| send_session_identification(); 192| | 193| 1.49k| kexfirstinitialise(); /* initialise the kex state */ 194| | 195| | /* start off with key exchange */ 196| 1.49k| send_msg_kexinit(); 197| | 198| 1.49k|#if DROPBEAR_FUZZ 199| 1.49k| if (fuzz.fuzzing) { ------------------ | Branch (199:9): [True: 1.49k, False: 0] ------------------ 200| 1.49k| fuzz_svr_hook_preloop(); 201| 1.49k| } 202| 1.49k|#endif 203| | 204| | /* Run the main for-loop. */ 205| 1.49k| session_loop(svr_chansess_checksignal); 206| | 207| | /* Not reached */ 208| | 209| 1.49k|} svr_dropbear_exit: 212| 1.49k|void svr_dropbear_exit(int exitcode, const char* format, va_list param) { 213| 1.49k| char exitmsg[150]; 214| 1.49k| char fullmsg[300]; 215| 1.49k| char fromaddr[60]; 216| 1.49k| int i; 217| 1.49k| int add_delay = 0; 218| | 219| |#if DROPBEAR_PLUGIN 220| | if ((ses.plugin_session != NULL)) { 221| | svr_ses.plugin_instance->delete_session(ses.plugin_session); 222| | } 223| | ses.plugin_session = NULL; 224| | svr_opts.pubkey_plugin_options = NULL; 225| | m_free(svr_opts.pubkey_plugin); 226| |#endif 227| | 228| | /* Render the formatted exit message */ 229| 1.49k| vsnprintf(exitmsg, sizeof(exitmsg), format, param); 230| | 231| | /* svr_ses.addrstring may not be set for some early exits, or for 232| | the listener process */ 233| 1.49k| fromaddr[0] = '\0'; 234| 1.49k| if (svr_ses.addrstring) { ------------------ | Branch (234:6): [True: 1.49k, False: 0] ------------------ 235| 1.49k| snprintf(fromaddr, sizeof(fromaddr), " from <%s>", svr_ses.addrstring); 236| 1.49k| } 237| | 238| | /* Add the prefix depending on session/auth state */ 239| 1.49k| if (!ses.init_done) { ------------------ | Branch (239:6): [True: 0, False: 1.49k] ------------------ 240| | /* before session init */ 241| 0| snprintf(fullmsg, sizeof(fullmsg), "Early exit%s: %s", fromaddr, exitmsg); 242| 1.49k| } else if (ses.authstate.authdone) { ------------------ | Branch (242:13): [True: 1.49k, False: 0] ------------------ 243| | /* user has authenticated */ 244| 1.49k| snprintf(fullmsg, sizeof(fullmsg), 245| 1.49k| "Exit (%s)%s: %s", 246| 1.49k| ses.authstate.pw_name, fromaddr, exitmsg); 247| 1.49k| } else if (ses.authstate.pw_name) { ------------------ | Branch (247:13): [True: 0, False: 0] ------------------ 248| | /* we have a potential user */ 249| 0| snprintf(fullmsg, sizeof(fullmsg), 250| 0| "Exit before auth%s: (user '%s', %u fails): %s", 251| 0| fromaddr, ses.authstate.pw_name, ses.authstate.failcount, exitmsg); 252| 0| add_delay = 1; 253| 0| } else { 254| | /* before userauth */ 255| 0| snprintf(fullmsg, sizeof(fullmsg), "Exit before auth%s: %s", fromaddr, exitmsg); 256| 0| add_delay = 1; 257| 0| } 258| | 259| 1.49k| dropbear_log(LOG_INFO, "%s", fullmsg); 260| | 261| | /* To make it harder for attackers, introduce a delay to keep an 262| | * unauthenticated session open a bit longer, thus blocking a connection 263| | * slot until after the delay. Without this, while there is a limit on 264| | * the amount of attempts an attacker can make at the same time 265| | * (MAX_UNAUTH_PER_IP), the time taken by dropbear to handle one attempt 266| | * is still short and thus for each of the allowed parallel attempts 267| | * many attempts can be chained one after the other. The attempt rate is 268| | * then: 269| | * "MAX_UNAUTH_PER_IP / ". 270| | * With the delay, this rate becomes: 271| | * "MAX_UNAUTH_PER_IP / UNAUTH_CLOSE_DELAY". 272| | */ 273| 1.49k| if ((add_delay != 0) && (UNAUTH_CLOSE_DELAY > 0)) { ------------------ | | 436| 0|#define UNAUTH_CLOSE_DELAY 0 ------------------ | Branch (273:6): [True: 0, False: 1.49k] | Branch (273:26): [Folded - Ignored] ------------------ 274| 0| TRACE(("svr_dropbear_exit: start delay of %d seconds", UNAUTH_CLOSE_DELAY)); 275| 0| sleep(UNAUTH_CLOSE_DELAY); ------------------ | | 436| 0|#define UNAUTH_CLOSE_DELAY 0 ------------------ 276| 0| TRACE(("svr_dropbear_exit: end delay of %d seconds", UNAUTH_CLOSE_DELAY)); 277| 0| } 278| | 279| |#if DROPBEAR_VFORK 280| | /* For uclinux only the main server process should cleanup - we don't want 281| | * forked children doing that */ 282| | if (svr_ses.server_pid == getpid()) 283| |#endif 284| 1.49k| { 285| | /* must be after we've done with username etc */ 286| 1.49k| session_cleanup(); 287| 1.49k| } 288| | 289| 1.49k|#if DROPBEAR_FUZZ 290| | /* longjmp before cleaning up svr_opts */ 291| 1.49k| if (fuzz.do_jmp) { ------------------ | Branch (291:9): [True: 1.49k, False: 0] ------------------ 292| 1.49k| longjmp(fuzz.jmp, 1); 293| 1.49k| } 294| 0|#endif 295| | 296| 0| if (svr_opts.hostkey) { ------------------ | Branch (296:6): [True: 0, False: 0] ------------------ 297| 0| sign_key_free(svr_opts.hostkey); 298| 0| svr_opts.hostkey = NULL; 299| 0| } 300| 0| for (i = 0; i < DROPBEAR_MAX_PORTS; i++) { ------------------ | | 80| 0|#define DROPBEAR_MAX_PORTS 10 /* max number of ports which can be specified, ------------------ | Branch (300:14): [True: 0, False: 0] ------------------ 301| 0| m_free(svr_opts.addresses[i]); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 302| 0| m_free(svr_opts.ports[i]); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 303| 0| } 304| | 305| | 306| 0| exit(exitcode); 307| | 308| 1.49k|} svr-session.c:svr_session_cleanup: 83| 1.49k|svr_session_cleanup(void) { 84| | /* free potential public key options */ 85| 1.49k| svr_pubkey_options_cleanup(); 86| | 87| 1.49k| m_free(svr_ses.addrstring); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 88| 1.49k| m_free(svr_ses.remotehost); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 89| 1.49k| m_free(svr_ses.childpids); ------------------ | | 24| 1.49k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 90| 1.49k| svr_ses.childpidsize = 0; 91| | 92| |#if DROPBEAR_PLUGIN 93| | if (svr_ses.plugin_handle != NULL) { 94| | if (svr_ses.plugin_instance) { 95| | svr_ses.plugin_instance->delete_plugin(svr_ses.plugin_instance); 96| | svr_ses.plugin_instance = NULL; 97| | } 98| | 99| | dlclose(svr_ses.plugin_handle); 100| | svr_ses.plugin_handle = NULL; 101| | } 102| |#endif 103| 1.49k|} svr-session.c:svr_remoteclosed: 348| 1.03k|static void svr_remoteclosed() { 349| | 350| 1.03k| m_close(ses.sock_in); 351| 1.03k| if (ses.sock_in != ses.sock_out) { ------------------ | Branch (351:6): [True: 0, False: 1.03k] ------------------ 352| 0| m_close(ses.sock_out); 353| 0| } 354| 1.03k| ses.sock_in = -1; 355| 1.03k| ses.sock_out = -1; 356| 1.03k| dropbear_close("Exited normally"); 357| | 358| 1.03k|} svr-session.c:svr_algos_initialise: 360| 1.49k|static void svr_algos_initialise(void) { 361| 1.49k| algo_type *algo; 362| 14.9k| for (algo = sshkex; algo->name; algo++) { ------------------ | Branch (362:22): [True: 13.4k, False: 1.49k] ------------------ 363| |#if DROPBEAR_DH_GROUP1 && DROPBEAR_DH_GROUP1_CLIENTONLY 364| | if (strcmp(algo->name, "diffie-hellman-group1-sha1") == 0) { 365| | algo->usable = 0; 366| | } 367| |#endif 368| 13.4k|#if DROPBEAR_EXT_INFO 369| 13.4k| if (strcmp(algo->name, SSH_EXT_INFO_C) == 0) { ------------------ | | 100| 13.4k|#define SSH_EXT_INFO_C "ext-info-c" ------------------ | Branch (369:7): [True: 1.49k, False: 11.9k] ------------------ 370| 1.49k| algo->usable = 0; 371| 1.49k| } 372| 13.4k|#endif 373| 13.4k| } 374| 1.49k|} recv_msg_global_request_remotetcp: 73| 2.22k|void recv_msg_global_request_remotetcp() { 74| | 75| 2.22k| char* reqname = NULL; 76| 2.22k| unsigned int namelen; 77| 2.22k| unsigned int wantreply = 0; 78| 2.22k| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 2.22k|#define DROPBEAR_FAILURE -1 ------------------ 79| | 80| 2.22k| TRACE(("enter recv_msg_global_request_remotetcp")) 81| | 82| 2.22k| if (svr_opts.noremotetcp || !svr_pubkey_allows_tcpfwd()) { ------------------ | Branch (82:6): [True: 0, False: 2.22k] | Branch (82:30): [True: 0, False: 2.22k] ------------------ 83| 0| TRACE(("leave recv_msg_global_request_remotetcp: remote tcp forwarding disabled")) 84| 0| goto out; 85| 0| } 86| | 87| 2.22k| reqname = buf_getstring(ses.payload, &namelen); 88| 2.22k| wantreply = buf_getbool(ses.payload); 89| | 90| 2.22k| if (namelen > MAX_NAME_LEN) { ------------------ | | 205| 2.22k|#define MAX_NAME_LEN 64 /* maximum length of a protocol name, isn't ------------------ | Branch (90:6): [True: 65, False: 2.16k] ------------------ 91| 65| TRACE(("name len is wrong: %d", namelen)) 92| 65| goto out; 93| 65| } 94| | 95| 2.16k| if (strcmp("tcpip-forward", reqname) == 0) { ------------------ | Branch (95:6): [True: 1.63k, False: 525] ------------------ 96| 1.63k| int allocated_listen_port = 0; 97| 1.63k| ret = svr_remotetcpreq(&allocated_listen_port); 98| | /* client expects-port-number-to-make-use-of-server-allocated-ports */ 99| 1.63k| if (DROPBEAR_SUCCESS == ret) { ------------------ | | 102| 1.63k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (99:7): [True: 0, False: 1.63k] ------------------ 100| 0| CHECKCLEARTOWRITE(); 101| 0| buf_putbyte(ses.writepayload, SSH_MSG_REQUEST_SUCCESS); ------------------ | | 64| 0|#define SSH_MSG_REQUEST_SUCCESS 81 ------------------ 102| 0| buf_putint(ses.writepayload, allocated_listen_port); 103| 0| encrypt_packet(); 104| 0| wantreply = 0; /* avoid out: below sending another reply */ 105| 0| } 106| 1.63k| } else if (strcmp("cancel-tcpip-forward", reqname) == 0) { ------------------ | Branch (106:13): [True: 109, False: 416] ------------------ 107| 109| ret = svr_cancelremotetcp(); 108| 416| } else { 109| 416| TRACE(("reqname isn't tcpip-forward: '%s'", reqname)) 110| 416| } 111| | 112| 2.22k|out: 113| 2.22k| if (wantreply) { ------------------ | Branch (113:6): [True: 757, False: 1.46k] ------------------ 114| 757| if (ret == DROPBEAR_SUCCESS) { ------------------ | | 102| 757|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (114:7): [True: 0, False: 757] ------------------ 115| 0| send_msg_request_success(); 116| 757| } else { 117| 757| send_msg_request_failure(); 118| 757| } 119| 757| } 120| | 121| 2.22k| m_free(reqname); ------------------ | | 24| 2.22k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 122| | 123| 2.22k| TRACE(("leave recv_msg_global_request")) 124| 2.22k|} svr-tcpfwd.c:svr_cancelremotetcp: 136| 109|static int svr_cancelremotetcp() { 137| | 138| 109| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 109|#define DROPBEAR_FAILURE -1 ------------------ 139| 109| char * bindaddr = NULL; 140| 109| unsigned int addrlen; 141| 109| unsigned int port; 142| 109| struct Listener * listener = NULL; 143| 109| struct TCPListener tcpinfo; 144| | 145| 109| TRACE(("enter cancelremotetcp")) 146| | 147| 109| bindaddr = buf_getstring(ses.payload, &addrlen); 148| 109| if (addrlen > MAX_HOST_LEN) { ------------------ | | 78| 109|#define MAX_HOST_LEN 254 /* max hostname len for tcp fwding */ ------------------ | Branch (148:6): [True: 37, False: 72] ------------------ 149| 37| TRACE(("addr len too long: %d", addrlen)) 150| 37| goto out; 151| 37| } 152| | 153| 72| port = buf_getint(ses.payload); 154| | 155| 72| tcpinfo.sendaddr = NULL; 156| 72| tcpinfo.sendport = 0; 157| 72| tcpinfo.listenaddr = bindaddr; 158| 72| tcpinfo.listenport = port; 159| 72| listener = get_listener(CHANNEL_ID_TCPFORWARDED, &tcpinfo, matchtcp); ------------------ | | 76| 72|#define CHANNEL_ID_TCPFORWARDED 0x43612c67 ------------------ 160| 72| if (listener) { ------------------ | Branch (160:6): [True: 0, False: 72] ------------------ 161| 0| remove_listener( listener ); 162| 0| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ 163| 0| } 164| | 165| 105|out: 166| 105| m_free(bindaddr); ------------------ | | 24| 105|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 167| 105| TRACE(("leave cancelremotetcp")) 168| 105| return ret; 169| 72|} svr-tcpfwd.c:svr_remotetcpreq: 171| 1.63k|static int svr_remotetcpreq(int *allocated_listen_port) { 172| | 173| 1.63k| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1.63k|#define DROPBEAR_FAILURE -1 ------------------ 174| 1.63k| char * request_addr = NULL; 175| 1.63k| unsigned int addrlen; 176| 1.63k| struct TCPListener *tcpinfo = NULL; 177| 1.63k| unsigned int port; 178| 1.63k| struct Listener *listener = NULL; 179| | 180| 1.63k| TRACE(("enter remotetcpreq")) 181| | 182| 1.63k| request_addr = buf_getstring(ses.payload, &addrlen); 183| 1.63k| if (addrlen > MAX_HOST_LEN) { ------------------ | | 78| 1.63k|#define MAX_HOST_LEN 254 /* max hostname len for tcp fwding */ ------------------ | Branch (183:6): [True: 38, False: 1.60k] ------------------ 184| 38| TRACE(("addr len too long: %d", addrlen)) 185| 38| goto out; 186| 38| } 187| | 188| 1.60k| port = buf_getint(ses.payload); 189| | 190| 1.60k| if (port != 0) { ------------------ | Branch (190:6): [True: 1.52k, False: 74] ------------------ 191| 1.52k| if (port < 1 || port > 65535) { ------------------ | Branch (191:7): [True: 0, False: 1.52k] | Branch (191:19): [True: 64, False: 1.46k] ------------------ 192| 64| TRACE(("invalid port: %d", port)) 193| 64| goto out; 194| 64| } 195| | 196| 1.46k| if (!ses.allowprivport && port < IPPORT_RESERVED) { ------------------ | Branch (196:7): [True: 1.46k, False: 0] | Branch (196:29): [True: 309, False: 1.15k] ------------------ 197| 309| TRACE(("can't assign port < 1024 for non-root")) 198| 309| goto out; 199| 309| } 200| 1.46k| } 201| | 202| 1.22k| tcpinfo = (struct TCPListener*)m_malloc(sizeof(struct TCPListener)); 203| 1.22k| tcpinfo->sendaddr = NULL; 204| 1.22k| tcpinfo->sendport = 0; 205| 1.22k| tcpinfo->listenport = port; 206| 1.22k| tcpinfo->chantype = &svr_chan_tcpremote; 207| 1.22k| tcpinfo->tcp_type = forwarded; 208| | 209| 1.22k| tcpinfo->request_listenaddr = request_addr; 210| 1.22k| if (!opts.listen_fwd_all || (strcmp(request_addr, "localhost") == 0) ) { ------------------ | Branch (210:6): [True: 1.22k, False: 0] | Branch (210:30): [True: 0, False: 0] ------------------ 211| | /* NULL means "localhost only" */ 212| 1.22k| tcpinfo->listenaddr = NULL; 213| 1.22k| } 214| 4| else 215| 4| { 216| 4| tcpinfo->listenaddr = m_strdup(request_addr); 217| 4| } 218| | 219| 1.22k| ret = listen_tcpfwd(tcpinfo, &listener); 220| 1.22k| if (DROPBEAR_SUCCESS == ret) { ------------------ | | 102| 1.22k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (220:6): [True: 0, False: 1.22k] ------------------ 221| 0| tcpinfo->listenport = get_sock_port(listener->socks[0]); 222| 0| *allocated_listen_port = tcpinfo->listenport; 223| 0| } 224| | 225| 1.63k|out: 226| 1.63k| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1.63k|#define DROPBEAR_FAILURE -1 ------------------ | Branch (226:6): [True: 1.63k, False: 0] ------------------ 227| | /* we only free it if a listener wasn't created, since the listener 228| | * has to remember it if it's to be cancelled */ 229| 1.63k| m_free(request_addr); ------------------ | | 24| 1.63k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 230| 1.63k| m_free(tcpinfo); ------------------ | | 24| 1.63k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 231| 1.63k| } 232| | 233| 1.63k| TRACE(("leave remotetcpreq")) 234| | 235| 1.63k| return ret; 236| 1.22k|} svr-tcpfwd.c:newtcpdirect: 253| 323|static int newtcpdirect(struct Channel * channel) { 254| | 255| 323| char* desthost = NULL; 256| 323| unsigned int destport; 257| 323| char* orighost = NULL; 258| 323| unsigned int origport; 259| 323| char portstring[NI_MAXSERV]; 260| 323| unsigned int len; 261| 323| int err = SSH_OPEN_ADMINISTRATIVELY_PROHIBITED; ------------------ | | 33| 323|#define SSH_OPEN_ADMINISTRATIVELY_PROHIBITED 1 ------------------ 262| | 263| 323| TRACE(("newtcpdirect channel %d", channel->index)) 264| | 265| 323| if (svr_opts.nolocaltcp || !svr_pubkey_allows_tcpfwd()) { ------------------ | Branch (265:6): [True: 0, False: 323] | Branch (265:29): [True: 0, False: 323] ------------------ 266| 0| TRACE(("leave newtcpdirect: local tcp forwarding disabled")) 267| 0| goto out; 268| 0| } 269| | 270| 323| desthost = buf_getstring(ses.payload, &len); 271| 323| if (len > MAX_HOST_LEN) { ------------------ | | 78| 323|#define MAX_HOST_LEN 254 /* max hostname len for tcp fwding */ ------------------ | Branch (271:6): [True: 71, False: 252] ------------------ 272| 71| TRACE(("leave newtcpdirect: desthost too long")) 273| 71| goto out; 274| 71| } 275| | 276| 252| destport = buf_getint(ses.payload); 277| | 278| 252| orighost = buf_getstring(ses.payload, &len); 279| 252| if (len > MAX_HOST_LEN) { ------------------ | | 78| 252|#define MAX_HOST_LEN 254 /* max hostname len for tcp fwding */ ------------------ | Branch (279:6): [True: 36, False: 216] ------------------ 280| 36| TRACE(("leave newtcpdirect: orighost too long")) 281| 36| goto out; 282| 36| } 283| | 284| 216| origport = buf_getint(ses.payload); 285| | 286| | /* best be sure */ 287| 216| if (origport > 65535 || destport > 65535) { ------------------ | Branch (287:6): [True: 48, False: 168] | Branch (287:26): [True: 70, False: 98] ------------------ 288| 112| TRACE(("leave newtcpdirect: port > 65535")) 289| 112| goto out; 290| 112| } 291| | 292| 104| if (!svr_pubkey_allows_local_tcpfwd(desthost, destport)) { ------------------ | Branch (292:6): [True: 0, False: 104] ------------------ 293| 0| TRACE(("leave newtcpdirect: local tcp forwarding not permitted to requested destination")); 294| 0| goto out; 295| 0| } 296| | 297| 104| snprintf(portstring, sizeof(portstring), "%u", destport); 298| 104| channel->conn_pending = connect_remote(desthost, portstring, channel_connect_done, 299| 104| channel, NULL, NULL, DROPBEAR_PRIO_NORMAL); 300| | 301| 104| err = SSH_OPEN_IN_PROGRESS; ------------------ | | 39| 104|#define SSH_OPEN_IN_PROGRESS 99 ------------------ 302| | 303| 317|out: 304| 317| m_free(desthost); ------------------ | | 24| 317|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 305| 317| m_free(orighost); ------------------ | | 24| 317|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 306| 317| TRACE(("leave newtcpdirect: err %d", err)) 307| 317| return err; 308| 104|} listen_tcpfwd: 106| 1.22k|int listen_tcpfwd(struct TCPListener* tcpinfo, struct Listener **ret_listener) { 107| | 108| 1.22k| char portstring[NI_MAXSERV]; 109| 1.22k| int socks[DROPBEAR_MAX_SOCKS]; 110| 1.22k| int nsocks; 111| 1.22k| struct Listener *listener; 112| 1.22k| char* errstring = NULL; 113| | 114| 1.22k| TRACE(("enter listen_tcpfwd")) 115| | 116| | /* first we try to bind, so don't need to do so much cleanup on failure */ 117| 1.22k| snprintf(portstring, sizeof(portstring), "%u", tcpinfo->listenport); 118| | 119| 1.22k| nsocks = dropbear_listen(tcpinfo->listenaddr, portstring, socks, 120| 1.22k| DROPBEAR_MAX_SOCKS, &errstring, &ses.maxfd); ------------------ | | 242| 1.22k|#define DROPBEAR_MAX_SOCKS 2 /* IPv4, IPv6 are all we'll get for now. Revisit ------------------ 121| 1.22k| if (nsocks < 0) { ------------------ | Branch (121:6): [True: 1.22k, False: 0] ------------------ 122| 1.22k| dropbear_log(LOG_INFO, "TCP forward failed: %s", errstring); 123| 1.22k| m_free(errstring); ------------------ | | 24| 1.22k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 124| 1.22k| TRACE(("leave listen_tcpfwd: dropbear_listen failed")) 125| 1.22k| return DROPBEAR_FAILURE; ------------------ | | 103| 1.22k|#define DROPBEAR_FAILURE -1 ------------------ 126| 1.22k| } 127| 0| m_free(errstring); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 128| | 129| | /* new_listener will close the socks if it fails */ 130| 0| listener = new_listener(socks, nsocks, CHANNEL_ID_TCPFORWARDED, tcpinfo, ------------------ | | 76| 0|#define CHANNEL_ID_TCPFORWARDED 0x43612c67 ------------------ 131| 0| tcp_acceptor, cleanup_tcp); 132| | 133| 0| if (listener == NULL) { ------------------ | Branch (133:6): [True: 0, False: 0] ------------------ 134| 0| TRACE(("leave listen_tcpfwd: listener failed")) 135| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 136| 0| } 137| | 138| 0| if (ret_listener) { ------------------ | Branch (138:6): [True: 0, False: 0] ------------------ 139| 0| *ret_listener = listener; 140| 0| } 141| | 142| 0| TRACE(("leave listen_tcpfwd: success")) 143| 0| return DROPBEAR_SUCCESS; ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ 144| 0|}