fuzz_early_setup: 23| 2|void fuzz_early_setup(void) { 24| | /* Set stderr to point to normal stderr by default */ 25| 2| fuzz.fake_stderr = stderr; 26| 2|} fuzz_common_setup: 28| 1|void fuzz_common_setup(void) { 29| 1| disallow_core(); 30| 1| fuzz.fuzzing = 1; 31| 1| fuzz.wrapfds = 1; 32| 1| fuzz.do_jmp = 1; 33| 1| fuzz.input = m_malloc(sizeof(buffer)); 34| 1| _dropbear_log = fuzz_dropbear_log; 35| 1| crypto_init(); 36| 1| fuzz_seed("start", 5); 37| | /* let any messages get flushed */ 38| 1| setlinebuf(stdout); 39| |#if DEBUG_TRACE 40| | if (debug_trace) 41| | { 42| | fprintf(stderr, "Dropbear fuzzer: -v specified, not disabling stderr output\n"); 43| | } 44| | else 45| |#endif 46| 1| if (getenv("DROPBEAR_KEEP_STDERR")) { ------------------ | Branch (46:9): [True: 0, False: 1] ------------------ 47| 0| fprintf(stderr, "Dropbear fuzzer: DROPBEAR_KEEP_STDERR, not disabling stderr output\n"); 48| 0| } 49| 1| else 50| 1| { 51| 1| fprintf(stderr, "Dropbear fuzzer: Disabling stderr output\n"); 52| 1| fuzz.fake_stderr = fopen("/dev/null", "w"); 53| 1| assert(fuzz.fake_stderr); 54| 1| } 55| 1|} fuzz_set_input: 57| 3.99k|int fuzz_set_input(const uint8_t *Data, size_t Size) { 58| | 59| 3.99k| fuzz.input->data = (unsigned char*)Data; 60| 3.99k| fuzz.input->size = Size; 61| 3.99k| fuzz.input->len = Size; 62| 3.99k| fuzz.input->pos = 0; 63| | 64| 3.99k| memset(&ses, 0x0, sizeof(ses)); 65| 3.99k| memset(&svr_ses, 0x0, sizeof(svr_ses)); 66| 3.99k| memset(&cli_ses, 0x0, sizeof(cli_ses)); 67| 3.99k| wrapfd_setup(fuzz.input); 68| | // printhex("input", fuzz.input->data, fuzz.input->len); 69| | 70| 3.99k| fuzz_seed(fuzz.input->data, MIN(fuzz.input->len, 16)); 71| | 72| 3.99k| return DROPBEAR_SUCCESS; ------------------ | | 102| 3.99k|#define DROPBEAR_SUCCESS 0 ------------------ 73| 3.99k|} fuzz_svr_setup: 89| 1|void fuzz_svr_setup(void) { 90| 1| fuzz_common_setup(); 91| | 92| 1| _dropbear_exit = svr_dropbear_exit; 93| | 94| 1| char *argv[] = { 95| 1| "dropbear", 96| 1| "-E", 97| 1| }; 98| | 99| 1| int argc = sizeof(argv) / sizeof(*argv); 100| 1| svr_getopts(argc, argv); 101| | 102| 1| load_fixed_hostkeys(); 103| 1|} fuzz_svr_hook_preloop: 105| 3.99k|void fuzz_svr_hook_preloop() { 106| 3.99k| if (fuzz.svr_postauth) { ------------------ | Branch (106:9): [True: 0, False: 3.99k] ------------------ 107| 0| ses.authstate.authdone = 1; 108| 0| fill_passwd("root"); 109| 0| } 110| 3.99k|} fuzz_kex_fakealgos: 197| 17.5k|void fuzz_kex_fakealgos(void) { 198| 17.5k| ses.newkeys->recv.crypt_mode = &dropbear_mode_none; 199| 17.5k| ses.newkeys->recv.algo_mac = &dropbear_nohash; 200| 17.5k|} fuzz_get_socket_address: 203| 7.99k| char **remote_host, char **remote_port, int UNUSED(host_lookup)) { 204| 7.99k| if (local_host) { ------------------ | Branch (204:9): [True: 0, False: 7.99k] ------------------ 205| 0| *local_host = m_strdup("fuzzlocalhost"); 206| 0| } 207| 7.99k| if (local_port) { ------------------ | Branch (207:9): [True: 0, False: 7.99k] ------------------ 208| 0| *local_port = m_strdup("1234"); 209| 0| } 210| 7.99k| if (remote_host) { ------------------ | Branch (210:9): [True: 7.99k, False: 0] ------------------ 211| 7.99k| *remote_host = m_strdup("fuzzremotehost"); 212| 7.99k| } 213| 7.99k| if (remote_port) { ------------------ | Branch (213:9): [True: 3.99k, False: 3.99k] ------------------ 214| 3.99k| *remote_port = m_strdup("9876"); 215| 3.99k| } 216| 7.99k|} fuzz_run_server: 264| 3.99k|int fuzz_run_server(const uint8_t *Data, size_t Size, int skip_kexmaths, int postauth) { 265| 3.99k| static int once = 0; 266| 3.99k| if (!once) { ------------------ | Branch (266:9): [True: 1, False: 3.99k] ------------------ 267| 1| fuzz_svr_setup(); 268| 1| fuzz.skip_kexmaths = skip_kexmaths; 269| 1| once = 1; 270| 1| } 271| | 272| 3.99k| fuzz.svr_postauth = postauth; 273| | 274| 3.99k| if (fuzz_set_input(Data, Size) == DROPBEAR_FAILURE) { ------------------ | | 103| 3.99k|#define DROPBEAR_FAILURE -1 ------------------ | Branch (274:9): [True: 0, False: 3.99k] ------------------ 275| 0| return 0; 276| 0| } 277| | 278| 3.99k| uint32_t wrapseed; 279| 3.99k| genrandom((void*)&wrapseed, sizeof(wrapseed)); 280| 3.99k| wrapfd_setseed(wrapseed); 281| | 282| 3.99k| int fakesock = wrapfd_new_fuzzinput(); 283| | 284| 3.99k| m_malloc_set_epoch(1); 285| 3.99k| fuzz.do_jmp = 1; 286| 3.99k| if (setjmp(fuzz.jmp) == 0) { ------------------ | Branch (286:9): [True: 3.99k, False: 0] ------------------ 287| 3.99k| svr_session(fakesock, fakesock); 288| 0| m_malloc_free_epoch(1, 0); 289| 0| } else { 290| 0| fuzz.do_jmp = 0; 291| 0| m_malloc_free_epoch(1, 1); 292| 0| TRACE(("dropbear_exit longjmped")) 293| | /* dropbear_exit jumped here */ 294| 0| } 295| | 296| 0| return 0; 297| 3.99k|} fuzz_dump: 345| 147k|void fuzz_dump(const unsigned char* data, size_t len) { 346| 147k| if (fuzz.dumping) { ------------------ | Branch (346:9): [True: 0, False: 147k] ------------------ 347| 0| TRACE(("dump %zu", len)) 348| 0| assert(atomicio(vwrite, fuzz.recv_dumpfd, (void*)data, len) == len); 349| 0| } 350| 147k|} fuzz_getpwnam: 373| 502|struct passwd* fuzz_getpwnam(const char *login) { 374| 502| if (!fuzz.fuzzing) { ------------------ | Branch (374:9): [True: 0, False: 502] ------------------ 375| 0| return getpwnam(login); 376| 0| } 377| 502| if (strcmp(login, pwd_other.pw_name) == 0) { ------------------ | Branch (377:9): [True: 0, False: 502] ------------------ 378| 0| return &pwd_other; 379| 0| } 380| 502| if (strcmp(login, pwd_root.pw_name) == 0) { ------------------ | Branch (380:9): [True: 31, False: 471] ------------------ 381| 31| return &pwd_root; 382| 31| } 383| 471| return NULL; 384| 502|} fuzz-common.c:fuzz_dropbear_log: 84| 4.59k|static void fuzz_dropbear_log(int UNUSED(priority), const char* UNUSED(format), va_list UNUSED(param)) { 85| | /* No print */ 86| 4.59k|} fuzz-common.c:load_fixed_hostkeys: 153| 1|static void load_fixed_hostkeys(void) { 154| | 155| 1| buffer *b = buf_new(3000); 156| 1| enum signkey_type type; 157| | 158| 1| TRACE(("load fixed hostkeys")) 159| | 160| 1| svr_opts.hostkey = new_sign_key(); 161| | 162| 1| buf_setlen(b, 0); 163| 1| buf_putbytes(b, keyr, keyr_len); 164| 1| buf_setpos(b, 0); 165| 1| type = DROPBEAR_SIGNKEY_RSA; 166| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (166:9): [True: 0, False: 1] ------------------ 167| 0| dropbear_exit("failed fixed rsa hostkey"); 168| 0| } 169| | 170| 1| buf_setlen(b, 0); 171| 1| buf_putbytes(b, keyd, keyd_len); 172| 1| buf_setpos(b, 0); 173| 1| type = DROPBEAR_SIGNKEY_DSS; 174| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (174:9): [True: 0, False: 1] ------------------ 175| 0| dropbear_exit("failed fixed dss hostkey"); 176| 0| } 177| | 178| 1| buf_setlen(b, 0); 179| 1| buf_putbytes(b, keye, keye_len); 180| 1| buf_setpos(b, 0); 181| 1| type = DROPBEAR_SIGNKEY_ECDSA_NISTP256; 182| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (182:9): [True: 0, False: 1] ------------------ 183| 0| dropbear_exit("failed fixed ecdsa hostkey"); 184| 0| } 185| | 186| 1| buf_setlen(b, 0); 187| 1| buf_putbytes(b, keyed25519, keyed25519_len); 188| 1| buf_setpos(b, 0); 189| 1| type = DROPBEAR_SIGNKEY_ED25519; 190| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (190:9): [True: 0, False: 1] ------------------ 191| 0| dropbear_exit("failed fixed ed25519 hostkey"); 192| 0| } 193| | 194| 1| buf_free(b); 195| 1|} fuzz-sshpacketmutator.c:alloc_static_buffers: 126| 2|static void alloc_static_buffers() { 127| | 128| 2| int i; 129| 2| oup = buf_new(MAX_OUT_SIZE); 130| 2| alloc_packetA = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 215| 2|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ 131| 2| alloc_packetB = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 215| 2|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ 132| | 133| 1.00k| for (i = 0; i < MAX_FUZZ_PACKETS; i++) { ------------------ | | 20| 1.00k|#define MAX_FUZZ_PACKETS 500 ------------------ | Branch (133:17): [True: 1.00k, False: 2] ------------------ 134| 1.00k| packets1[i] = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 215| 1.00k|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ 135| 1.00k| } 136| 1.00k| for (i = 0; i < MAX_FUZZ_PACKETS; i++) { ------------------ | | 20| 1.00k|#define MAX_FUZZ_PACKETS 500 ------------------ | Branch (136:17): [True: 1.00k, False: 2] ------------------ 137| 1.00k| packets2[i] = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 215| 1.00k|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ 138| 1.00k| } 139| 2|} wrapfd_setup: 32| 3.99k|void wrapfd_setup(buffer *buf) { 33| 3.99k| TRACE(("wrapfd_setup")) 34| | 35| | // clean old ones 36| 3.99k| int i; 37| 31.9k| for (i = 0; i <= wrapfd_maxfd; i++) { ------------------ | Branch (37:14): [True: 27.9k, False: 3.99k] ------------------ 38| 27.9k| if (wrap_fds[i].mode != UNUSED) { ------------------ | Branch (38:7): [True: 2.15k, False: 25.8k] ------------------ 39| 2.15k| wrapfd_remove(i); 40| 2.15k| } 41| 27.9k| } 42| 3.99k| wrapfd_maxfd = -1; 43| | 44| 3.99k| memset(rand_state, 0x0, sizeof(rand_state)); 45| 3.99k| wrapfd_setseed(50); 46| 3.99k| input_buf = buf; 47| 3.99k|} wrapfd_setseed: 49| 7.99k|void wrapfd_setseed(uint32_t seed) { 50| 7.99k| memcpy(rand_state, &seed, sizeof(seed)); 51| 7.99k| nrand48(rand_state); 52| 7.99k|} wrapfd_new_fuzzinput: 54| 3.99k|int wrapfd_new_fuzzinput() { 55| 3.99k| if (devnull_fd == -1) { ------------------ | Branch (55:6): [True: 1, False: 3.99k] ------------------ 56| 1| devnull_fd = open("/dev/null", O_RDONLY); 57| 1| assert(devnull_fd != -1); 58| 1| } 59| | 60| 3.99k| int fd = dup(devnull_fd); 61| 3.99k| assert(fd != -1); 62| 3.99k| assert(wrap_fds[fd].mode == UNUSED); 63| 3.99k| wrap_fds[fd].mode = COMMONBUF; 64| 3.99k| wrap_fds[fd].closein = 0; 65| 3.99k| wrap_fds[fd].closeout = 0; 66| 3.99k| wrapfd_maxfd = MAX(fd, wrapfd_maxfd); 67| | 68| 3.99k| return fd; 69| 3.99k|} wrapfd_close: 105| 1.84k|int wrapfd_close(int fd) { 106| 1.84k| if (fd >= 0 && fd <= IOWRAP_MAXFD && wrap_fds[fd].mode != UNUSED) { ------------------ | | 9| 3.68k|#define IOWRAP_MAXFD (FD_SETSIZE-1) ------------------ | Branch (106:6): [True: 1.84k, False: 0] | Branch (106:17): [True: 1.84k, False: 0] | Branch (106:39): [True: 1.84k, False: 0] ------------------ 107| 1.84k| wrapfd_remove(fd); 108| 1.84k| return 0; 109| 1.84k| } else { 110| 0| return close(fd); 111| 0| } 112| 1.84k|} wrapfd_read: 114| 501k|int wrapfd_read(int fd, void *out, size_t count) { 115| 501k| size_t maxread; 116| | 117| 501k| if (!fuzz.wrapfds) { ------------------ | Branch (117:6): [True: 0, False: 501k] ------------------ 118| 0| return read(fd, out, count); 119| 0| } 120| | 121| 501k| if (fd < 0 || fd > IOWRAP_MAXFD || wrap_fds[fd].mode == UNUSED) { ------------------ | | 9| 1.00M|#define IOWRAP_MAXFD (FD_SETSIZE-1) ------------------ | Branch (121:6): [True: 0, False: 501k] | Branch (121:16): [True: 0, False: 501k] | Branch (121:37): [True: 0, False: 501k] ------------------ 122| | /* XXX - assertion failure? */ 123| 0| TRACE(("Bad read descriptor %d\n", fd)) 124| 0| errno = EBADF; 125| 0| return -1; 126| 0| } 127| | 128| 501k| assert(count != 0); 129| | 130| 501k| if (wrap_fds[fd].closein || erand48(rand_state) < CHANCE_CLOSE) { ------------------ | Branch (130:6): [True: 0, False: 501k] | Branch (130:30): [True: 9, False: 501k] ------------------ 131| 9| wrap_fds[fd].closein = 1; 132| 9| errno = ECONNRESET; 133| 9| return -1; 134| 9| } 135| | 136| 501k| if (erand48(rand_state) < CHANCE_INTR) { ------------------ | Branch (136:6): [True: 521, False: 500k] ------------------ 137| 521| errno = EINTR; 138| 521| return -1; 139| 521| } 140| | 141| 500k| if (input_buf && wrap_fds[fd].mode == COMMONBUF) { ------------------ | Branch (141:6): [True: 500k, False: 0] | Branch (141:19): [True: 500k, False: 0] ------------------ 142| 500k| maxread = MIN(input_buf->len - input_buf->pos, count); 143| | /* returns 0 if buf is EOF, as intended */ 144| 500k| if (maxread > 0) { ------------------ | Branch (144:7): [True: 498k, False: 1.79k] ------------------ 145| 498k| maxread = nrand48(rand_state) % maxread + 1; 146| 498k| } 147| 500k| memcpy(out, buf_getptr(input_buf, maxread), maxread); 148| 500k| buf_incrpos(input_buf, maxread); 149| 500k| return maxread; 150| 500k| } 151| | 152| | // return fixed output, of random length 153| 0| maxread = MIN(MAX_RANDOM_IN, count); 154| 0| maxread = nrand48(rand_state) % maxread + 1; 155| 0| memset(out, 0xef, maxread); 156| 0| return maxread; 157| 500k|} wrapfd_select: 196| 487k| fd_set *exceptfds, struct timeval *timeout) { 197| 487k| int i, nset, sel; 198| 487k| int ret = 0; 199| 487k| int fdlist[IOWRAP_MAXFD+1]; 200| | 201| 487k| if (!fuzz.wrapfds) { ------------------ | Branch (201:6): [True: 0, False: 487k] ------------------ 202| 0| return select(nfds, readfds, writefds, exceptfds, timeout); 203| 0| } 204| | 205| 487k| assert(nfds <= IOWRAP_MAXFD+1); 206| | 207| 487k| if (erand48(rand_state) < CHANCE_INTR) { ------------------ | Branch (207:6): [True: 677, False: 486k] ------------------ 208| 677| errno = EINTR; 209| 677| return -1; 210| 677| } 211| | 212| | /* read */ 213| 486k| if (readfds != NULL && erand48(rand_state) < CHANCE_READ1) { ------------------ | Branch (213:6): [True: 486k, False: 0] | Branch (213:25): [True: 460k, False: 26.4k] ------------------ 214| 3.68M| for (i = 0, nset = 0; i < nfds; i++) { ------------------ | Branch (214:25): [True: 3.22M, False: 460k] ------------------ 215| 3.22M| if (FD_ISSET(i, readfds)) { 216| 452k| assert(wrap_fds[i].mode != UNUSED); 217| 452k| fdlist[nset] = i; 218| 452k| nset++; 219| 452k| } 220| 3.22M| } 221| 460k| DROPBEAR_FD_ZERO(readfds); ------------------ | | 104| 460k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 222| | 223| 460k| if (nset > 0) { ------------------ | Branch (223:7): [True: 452k, False: 7.79k] ------------------ 224| | /* set one */ 225| 452k| sel = fdlist[nrand48(rand_state) % nset]; 226| 452k| FD_SET(sel, readfds); 227| 452k| ret++; 228| | 229| 452k| if (erand48(rand_state) < CHANCE_READ2) { ------------------ | Branch (229:8): [True: 226k, False: 225k] ------------------ 230| 226k| sel = fdlist[nrand48(rand_state) % nset]; 231| 226k| if (!FD_ISSET(sel, readfds)) { ------------------ | Branch (231:9): [True: 0, False: 226k] ------------------ 232| 0| FD_SET(sel, readfds); 233| 0| ret++; 234| 0| } 235| 226k| } 236| 452k| } 237| 460k| } 238| | 239| | /* write */ 240| 486k| if (writefds != NULL && erand48(rand_state) < CHANCE_WRITE1) { ------------------ | Branch (240:6): [True: 411k, False: 75.6k] | Branch (240:26): [True: 395k, False: 15.9k] ------------------ 241| 3.16M| for (i = 0, nset = 0; i < nfds; i++) { ------------------ | Branch (241:25): [True: 2.76M, False: 395k] ------------------ 242| 2.76M| if (FD_ISSET(i, writefds)) { 243| 24.0k| assert(wrap_fds[i].mode != UNUSED); 244| 24.0k| fdlist[nset] = i; 245| 24.0k| nset++; 246| 24.0k| } 247| 2.76M| } 248| 395k| DROPBEAR_FD_ZERO(writefds); ------------------ | | 104| 395k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 249| | 250| | /* set one */ 251| 395k| if (nset > 0) { ------------------ | Branch (251:7): [True: 24.0k, False: 371k] ------------------ 252| 24.0k| sel = fdlist[nrand48(rand_state) % nset]; 253| 24.0k| FD_SET(sel, writefds); 254| 24.0k| ret++; 255| | 256| 24.0k| if (erand48(rand_state) < CHANCE_WRITE2) { ------------------ | Branch (256:8): [True: 9.72k, False: 14.3k] ------------------ 257| 9.72k| sel = fdlist[nrand48(rand_state) % nset]; 258| 9.72k| if (!FD_ISSET(sel, writefds)) { ------------------ | Branch (258:9): [True: 0, False: 9.72k] ------------------ 259| 0| FD_SET(sel, writefds); 260| 0| ret++; 261| 0| } 262| 9.72k| } 263| 24.0k| } 264| 395k| } 265| 486k| return ret; 266| 486k|} fuzz-wrapfd.c:wrapfd_remove: 96| 3.99k|static void wrapfd_remove(int fd) { 97| 3.99k| TRACE(("wrapfd_remove %d", fd)) 98| 3.99k| assert(fd >= 0); 99| 3.99k| assert(fd <= IOWRAP_MAXFD); 100| 3.99k| assert(wrap_fds[fd].mode != UNUSED); 101| 3.99k| wrap_fds[fd].mode = UNUSED; 102| 3.99k| close(fd); 103| 3.99k|} LLVMFuzzerTestOneInput: 3| 3.99k|int LLVMFuzzerTestOneInput(const uint8_t *Data, size_t Size) { 4| 3.99k| return fuzz_run_server(Data, Size, 0, 0); 5| 3.99k|} rijndael_setup: 123| 13.2k|{ 124| 13.2k| int i; 125| 13.2k| ulong32 temp, *rk; 126| 13.2k|#ifndef ENCRYPT_ONLY 127| 13.2k| ulong32 *rrk; 128| 13.2k|#endif 129| 13.2k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 13.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 130| 13.2k| LTC_ARGCHK(skey != NULL); ------------------ | | 32| 13.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 131| | 132| 13.2k| if (keylen != 16 && keylen != 24 && keylen != 32) { ------------------ | Branch (132:9): [True: 5.86k, False: 7.34k] | Branch (132:25): [True: 5.86k, False: 0] | Branch (132:41): [True: 0, False: 5.86k] ------------------ 133| 0| return CRYPT_INVALID_KEYSIZE; 134| 0| } 135| | 136| 13.2k| if (num_rounds != 0 && num_rounds != (10 + ((keylen/8)-2)*2)) { ------------------ | Branch (136:9): [True: 0, False: 13.2k] | Branch (136:28): [True: 0, False: 0] ------------------ 137| 0| return CRYPT_INVALID_ROUNDS; 138| 0| } 139| | 140| 13.2k| skey->rijndael.Nr = 10 + ((keylen/8)-2)*2; 141| | 142| | /* setup the forward key */ 143| 13.2k| i = 0; 144| 13.2k| rk = skey->rijndael.eK; 145| 13.2k| LOAD32H(rk[0], key ); ------------------ | | 66| 13.2k|#define LOAD32H(x, y) \ | | 67| 13.2k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 13.2k|#define XMEMCPY memcpy | | ------------------ | | 68| 13.2k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 146| 13.2k| LOAD32H(rk[1], key + 4); ------------------ | | 66| 13.2k|#define LOAD32H(x, y) \ | | 67| 13.2k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 13.2k|#define XMEMCPY memcpy | | ------------------ | | 68| 13.2k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 147| 13.2k| LOAD32H(rk[2], key + 8); ------------------ | | 66| 13.2k|#define LOAD32H(x, y) \ | | 67| 13.2k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 13.2k|#define XMEMCPY memcpy | | ------------------ | | 68| 13.2k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 148| 13.2k| LOAD32H(rk[3], key + 12); ------------------ | | 66| 13.2k|#define LOAD32H(x, y) \ | | 67| 13.2k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 13.2k|#define XMEMCPY memcpy | | ------------------ | | 68| 13.2k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 149| 13.2k| if (keylen == 16) { ------------------ | Branch (149:9): [True: 7.34k, False: 5.86k] ------------------ 150| 73.4k| for (;;) { 151| 73.4k| temp = rk[3]; 152| 73.4k| rk[4] = rk[0] ^ setup_mix(temp) ^ rcon[i]; 153| 73.4k| rk[5] = rk[1] ^ rk[4]; 154| 73.4k| rk[6] = rk[2] ^ rk[5]; 155| 73.4k| rk[7] = rk[3] ^ rk[6]; 156| 73.4k| if (++i == 10) { ------------------ | Branch (156:17): [True: 7.34k, False: 66.1k] ------------------ 157| 7.34k| break; 158| 7.34k| } 159| 66.1k| rk += 4; 160| 66.1k| } 161| 7.34k| } else if (keylen == 24) { ------------------ | Branch (161:16): [True: 0, False: 5.86k] ------------------ 162| 0| LOAD32H(rk[4], key + 16); ------------------ | | 66| 0|#define LOAD32H(x, y) \ | | 67| 0|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 0|#define XMEMCPY memcpy | | ------------------ | | 68| 0| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 163| 0| LOAD32H(rk[5], key + 20); ------------------ | | 66| 0|#define LOAD32H(x, y) \ | | 67| 0|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 0|#define XMEMCPY memcpy | | ------------------ | | 68| 0| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 164| 0| for (;;) { 165| | #ifdef _MSC_VER 166| | temp = skey->rijndael.eK[rk - skey->rijndael.eK + 5]; 167| | #else 168| 0| temp = rk[5]; 169| 0| #endif 170| 0| rk[ 6] = rk[ 0] ^ setup_mix(temp) ^ rcon[i]; 171| 0| rk[ 7] = rk[ 1] ^ rk[ 6]; 172| 0| rk[ 8] = rk[ 2] ^ rk[ 7]; 173| 0| rk[ 9] = rk[ 3] ^ rk[ 8]; 174| 0| if (++i == 8) { ------------------ | Branch (174:17): [True: 0, False: 0] ------------------ 175| 0| break; 176| 0| } 177| 0| rk[10] = rk[ 4] ^ rk[ 9]; 178| 0| rk[11] = rk[ 5] ^ rk[10]; 179| 0| rk += 6; 180| 0| } 181| 5.86k| } else if (keylen == 32) { ------------------ | Branch (181:16): [True: 5.86k, False: 0] ------------------ 182| 5.86k| LOAD32H(rk[4], key + 16); ------------------ | | 66| 5.86k|#define LOAD32H(x, y) \ | | 67| 5.86k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 5.86k|#define XMEMCPY memcpy | | ------------------ | | 68| 5.86k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 183| 5.86k| LOAD32H(rk[5], key + 20); ------------------ | | 66| 5.86k|#define LOAD32H(x, y) \ | | 67| 5.86k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 5.86k|#define XMEMCPY memcpy | | ------------------ | | 68| 5.86k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 184| 5.86k| LOAD32H(rk[6], key + 24); ------------------ | | 66| 5.86k|#define LOAD32H(x, y) \ | | 67| 5.86k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 5.86k|#define XMEMCPY memcpy | | ------------------ | | 68| 5.86k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 185| 5.86k| LOAD32H(rk[7], key + 28); ------------------ | | 66| 5.86k|#define LOAD32H(x, y) \ | | 67| 5.86k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 5.86k|#define XMEMCPY memcpy | | ------------------ | | 68| 5.86k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 186| 41.0k| for (;;) { 187| | #ifdef _MSC_VER 188| | temp = skey->rijndael.eK[rk - skey->rijndael.eK + 7]; 189| | #else 190| 41.0k| temp = rk[7]; 191| 41.0k| #endif 192| 41.0k| rk[ 8] = rk[ 0] ^ setup_mix(temp) ^ rcon[i]; 193| 41.0k| rk[ 9] = rk[ 1] ^ rk[ 8]; 194| 41.0k| rk[10] = rk[ 2] ^ rk[ 9]; 195| 41.0k| rk[11] = rk[ 3] ^ rk[10]; 196| 41.0k| if (++i == 7) { ------------------ | Branch (196:17): [True: 5.86k, False: 35.2k] ------------------ 197| 5.86k| break; 198| 5.86k| } 199| 35.2k| temp = rk[11]; 200| 35.2k| rk[12] = rk[ 4] ^ setup_mix(RORc(temp, 8)); ------------------ | | 283| 35.2k|#define RORc(word,i) ({ \ | | 284| 35.2k| ulong32 __RORc_tmp = (word); \ | | 285| 35.2k| __asm__ ("rorl %2, %0" : \ | | 286| 35.2k| "=r" (__RORc_tmp) : \ | | 287| 35.2k| "0" (__RORc_tmp), \ | | 288| 35.2k| "I" (i)); \ | | 289| 35.2k| __RORc_tmp; \ | | 290| 35.2k| }) ------------------ 201| 35.2k| rk[13] = rk[ 5] ^ rk[12]; 202| 35.2k| rk[14] = rk[ 6] ^ rk[13]; 203| 35.2k| rk[15] = rk[ 7] ^ rk[14]; 204| 35.2k| rk += 8; 205| 35.2k| } 206| 5.86k| } else { 207| | /* this can't happen */ 208| | /* coverity[dead_error_line] */ 209| 0| return CRYPT_ERROR; 210| 0| } 211| | 212| 13.2k|#ifndef ENCRYPT_ONLY 213| | /* setup the inverse key now */ 214| 13.2k| rk = skey->rijndael.dK; 215| 13.2k| rrk = skey->rijndael.eK + (28 + keylen) - 4; 216| | 217| | /* apply the inverse MixColumn transform to all round keys but the first and the last: */ 218| | /* copy first */ 219| 13.2k| *rk++ = *rrk++; 220| 13.2k| *rk++ = *rrk++; 221| 13.2k| *rk++ = *rrk++; 222| 13.2k| *rk = *rrk; 223| 13.2k| rk -= 3; rrk -= 3; 224| | 225| 155k| for (i = 1; i < skey->rijndael.Nr; i++) { ------------------ | Branch (225:17): [True: 142k, False: 13.2k] ------------------ 226| 142k| rrk -= 4; 227| 142k| rk += 4; 228| 142k| #ifdef LTC_SMALL_CODE 229| 142k| temp = rrk[0]; 230| 142k| rk[0] = setup_mix2(temp); 231| 142k| temp = rrk[1]; 232| 142k| rk[1] = setup_mix2(temp); 233| 142k| temp = rrk[2]; 234| 142k| rk[2] = setup_mix2(temp); 235| 142k| temp = rrk[3]; 236| 142k| rk[3] = setup_mix2(temp); 237| | #else 238| | temp = rrk[0]; 239| | rk[0] = 240| | Tks0[byte(temp, 3)] ^ 241| | Tks1[byte(temp, 2)] ^ 242| | Tks2[byte(temp, 1)] ^ 243| | Tks3[byte(temp, 0)]; 244| | temp = rrk[1]; 245| | rk[1] = 246| | Tks0[byte(temp, 3)] ^ 247| | Tks1[byte(temp, 2)] ^ 248| | Tks2[byte(temp, 1)] ^ 249| | Tks3[byte(temp, 0)]; 250| | temp = rrk[2]; 251| | rk[2] = 252| | Tks0[byte(temp, 3)] ^ 253| | Tks1[byte(temp, 2)] ^ 254| | Tks2[byte(temp, 1)] ^ 255| | Tks3[byte(temp, 0)]; 256| | temp = rrk[3]; 257| | rk[3] = 258| | Tks0[byte(temp, 3)] ^ 259| | Tks1[byte(temp, 2)] ^ 260| | Tks2[byte(temp, 1)] ^ 261| | Tks3[byte(temp, 0)]; 262| | #endif 263| | 264| 142k| } 265| | 266| | /* copy last */ 267| 13.2k| rrk -= 4; 268| 13.2k| rk += 4; 269| 13.2k| *rk++ = *rrk++; 270| 13.2k| *rk++ = *rrk++; 271| 13.2k| *rk++ = *rrk++; 272| 13.2k| *rk = *rrk; 273| 13.2k|#endif /* ENCRYPT_ONLY */ 274| | 275| 13.2k| return CRYPT_OK; 276| 13.2k|} rijndael_ecb_encrypt: 290| 856k|{ 291| 856k| ulong32 s0, s1, s2, s3, t0, t1, t2, t3, *rk; 292| 856k| int Nr, r; 293| | 294| 856k| LTC_ARGCHK(pt != NULL); ------------------ | | 32| 856k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 856k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 295| 856k| LTC_ARGCHK(ct != NULL); ------------------ | | 32| 856k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 856k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 296| 856k| LTC_ARGCHK(skey != NULL); ------------------ | | 32| 856k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 856k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 297| | 298| 856k| Nr = skey->rijndael.Nr; 299| 856k| rk = skey->rijndael.eK; 300| | 301| | /* 302| | * map byte array block to cipher state 303| | * and add initial round key: 304| | */ 305| 856k| LOAD32H(s0, pt ); s0 ^= rk[0]; ------------------ | | 66| 856k|#define LOAD32H(x, y) \ | | 67| 856k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 856k|#define XMEMCPY memcpy | | ------------------ | | 68| 856k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 306| 856k| LOAD32H(s1, pt + 4); s1 ^= rk[1]; ------------------ | | 66| 856k|#define LOAD32H(x, y) \ | | 67| 856k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 856k|#define XMEMCPY memcpy | | ------------------ | | 68| 856k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 307| 856k| LOAD32H(s2, pt + 8); s2 ^= rk[2]; ------------------ | | 66| 856k|#define LOAD32H(x, y) \ | | 67| 856k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 856k|#define XMEMCPY memcpy | | ------------------ | | 68| 856k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 308| 856k| LOAD32H(s3, pt + 12); s3 ^= rk[3]; ------------------ | | 66| 856k|#define LOAD32H(x, y) \ | | 67| 856k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 856k|#define XMEMCPY memcpy | | ------------------ | | 68| 856k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 309| | 310| 856k|#ifdef LTC_SMALL_CODE 311| | 312| 9.32M| for (r = 0; ; r++) { 313| 9.32M| rk += 4; 314| 9.32M| t0 = 315| 9.32M| Te0(byte(s0, 3)) ^ ------------------ | | 306| 9.32M|#define Te0(x) TE0[x] ------------------ 316| 9.32M| Te1(byte(s1, 2)) ^ ------------------ | | 307| 9.32M|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 9.32M|#define RORc(word,i) ({ \ | | | | 284| 9.32M| ulong32 __RORc_tmp = (word); \ | | | | 285| 9.32M| __asm__ ("rorl %2, %0" : \ | | | | 286| 9.32M| "=r" (__RORc_tmp) : \ | | | | 287| 9.32M| "0" (__RORc_tmp), \ | | | | 288| 9.32M| "I" (i)); \ | | | | 289| 9.32M| __RORc_tmp; \ | | | | 290| 9.32M| }) | | ------------------ ------------------ 317| 9.32M| Te2(byte(s2, 1)) ^ ------------------ | | 308| 9.32M|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 9.32M|#define RORc(word,i) ({ \ | | | | 284| 9.32M| ulong32 __RORc_tmp = (word); \ | | | | 285| 9.32M| __asm__ ("rorl %2, %0" : \ | | | | 286| 9.32M| "=r" (__RORc_tmp) : \ | | | | 287| 9.32M| "0" (__RORc_tmp), \ | | | | 288| 9.32M| "I" (i)); \ | | | | 289| 9.32M| __RORc_tmp; \ | | | | 290| 9.32M| }) | | ------------------ ------------------ 318| 9.32M| Te3(byte(s3, 0)) ^ ------------------ | | 309| 9.32M|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 9.32M|#define RORc(word,i) ({ \ | | | | 284| 9.32M| ulong32 __RORc_tmp = (word); \ | | | | 285| 9.32M| __asm__ ("rorl %2, %0" : \ | | | | 286| 9.32M| "=r" (__RORc_tmp) : \ | | | | 287| 9.32M| "0" (__RORc_tmp), \ | | | | 288| 9.32M| "I" (i)); \ | | | | 289| 9.32M| __RORc_tmp; \ | | | | 290| 9.32M| }) | | ------------------ ------------------ 319| 9.32M| rk[0]; 320| 9.32M| t1 = 321| 9.32M| Te0(byte(s1, 3)) ^ ------------------ | | 306| 9.32M|#define Te0(x) TE0[x] ------------------ 322| 9.32M| Te1(byte(s2, 2)) ^ ------------------ | | 307| 9.32M|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 9.32M|#define RORc(word,i) ({ \ | | | | 284| 9.32M| ulong32 __RORc_tmp = (word); \ | | | | 285| 9.32M| __asm__ ("rorl %2, %0" : \ | | | | 286| 9.32M| "=r" (__RORc_tmp) : \ | | | | 287| 9.32M| "0" (__RORc_tmp), \ | | | | 288| 9.32M| "I" (i)); \ | | | | 289| 9.32M| __RORc_tmp; \ | | | | 290| 9.32M| }) | | ------------------ ------------------ 323| 9.32M| Te2(byte(s3, 1)) ^ ------------------ | | 308| 9.32M|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 9.32M|#define RORc(word,i) ({ \ | | | | 284| 9.32M| ulong32 __RORc_tmp = (word); \ | | | | 285| 9.32M| __asm__ ("rorl %2, %0" : \ | | | | 286| 9.32M| "=r" (__RORc_tmp) : \ | | | | 287| 9.32M| "0" (__RORc_tmp), \ | | | | 288| 9.32M| "I" (i)); \ | | | | 289| 9.32M| __RORc_tmp; \ | | | | 290| 9.32M| }) | | ------------------ ------------------ 324| 9.32M| Te3(byte(s0, 0)) ^ ------------------ | | 309| 9.32M|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 9.32M|#define RORc(word,i) ({ \ | | | | 284| 9.32M| ulong32 __RORc_tmp = (word); \ | | | | 285| 9.32M| __asm__ ("rorl %2, %0" : \ | | | | 286| 9.32M| "=r" (__RORc_tmp) : \ | | | | 287| 9.32M| "0" (__RORc_tmp), \ | | | | 288| 9.32M| "I" (i)); \ | | | | 289| 9.32M| __RORc_tmp; \ | | | | 290| 9.32M| }) | | ------------------ ------------------ 325| 9.32M| rk[1]; 326| 9.32M| t2 = 327| 9.32M| Te0(byte(s2, 3)) ^ ------------------ | | 306| 9.32M|#define Te0(x) TE0[x] ------------------ 328| 9.32M| Te1(byte(s3, 2)) ^ ------------------ | | 307| 9.32M|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 9.32M|#define RORc(word,i) ({ \ | | | | 284| 9.32M| ulong32 __RORc_tmp = (word); \ | | | | 285| 9.32M| __asm__ ("rorl %2, %0" : \ | | | | 286| 9.32M| "=r" (__RORc_tmp) : \ | | | | 287| 9.32M| "0" (__RORc_tmp), \ | | | | 288| 9.32M| "I" (i)); \ | | | | 289| 9.32M| __RORc_tmp; \ | | | | 290| 9.32M| }) | | ------------------ ------------------ 329| 9.32M| Te2(byte(s0, 1)) ^ ------------------ | | 308| 9.32M|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 9.32M|#define RORc(word,i) ({ \ | | | | 284| 9.32M| ulong32 __RORc_tmp = (word); \ | | | | 285| 9.32M| __asm__ ("rorl %2, %0" : \ | | | | 286| 9.32M| "=r" (__RORc_tmp) : \ | | | | 287| 9.32M| "0" (__RORc_tmp), \ | | | | 288| 9.32M| "I" (i)); \ | | | | 289| 9.32M| __RORc_tmp; \ | | | | 290| 9.32M| }) | | ------------------ ------------------ 330| 9.32M| Te3(byte(s1, 0)) ^ ------------------ | | 309| 9.32M|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 9.32M|#define RORc(word,i) ({ \ | | | | 284| 9.32M| ulong32 __RORc_tmp = (word); \ | | | | 285| 9.32M| __asm__ ("rorl %2, %0" : \ | | | | 286| 9.32M| "=r" (__RORc_tmp) : \ | | | | 287| 9.32M| "0" (__RORc_tmp), \ | | | | 288| 9.32M| "I" (i)); \ | | | | 289| 9.32M| __RORc_tmp; \ | | | | 290| 9.32M| }) | | ------------------ ------------------ 331| 9.32M| rk[2]; 332| 9.32M| t3 = 333| 9.32M| Te0(byte(s3, 3)) ^ ------------------ | | 306| 9.32M|#define Te0(x) TE0[x] ------------------ 334| 9.32M| Te1(byte(s0, 2)) ^ ------------------ | | 307| 9.32M|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 9.32M|#define RORc(word,i) ({ \ | | | | 284| 9.32M| ulong32 __RORc_tmp = (word); \ | | | | 285| 9.32M| __asm__ ("rorl %2, %0" : \ | | | | 286| 9.32M| "=r" (__RORc_tmp) : \ | | | | 287| 9.32M| "0" (__RORc_tmp), \ | | | | 288| 9.32M| "I" (i)); \ | | | | 289| 9.32M| __RORc_tmp; \ | | | | 290| 9.32M| }) | | ------------------ ------------------ 335| 9.32M| Te2(byte(s1, 1)) ^ ------------------ | | 308| 9.32M|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 9.32M|#define RORc(word,i) ({ \ | | | | 284| 9.32M| ulong32 __RORc_tmp = (word); \ | | | | 285| 9.32M| __asm__ ("rorl %2, %0" : \ | | | | 286| 9.32M| "=r" (__RORc_tmp) : \ | | | | 287| 9.32M| "0" (__RORc_tmp), \ | | | | 288| 9.32M| "I" (i)); \ | | | | 289| 9.32M| __RORc_tmp; \ | | | | 290| 9.32M| }) | | ------------------ ------------------ 336| 9.32M| Te3(byte(s2, 0)) ^ ------------------ | | 309| 9.32M|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 9.32M|#define RORc(word,i) ({ \ | | | | 284| 9.32M| ulong32 __RORc_tmp = (word); \ | | | | 285| 9.32M| __asm__ ("rorl %2, %0" : \ | | | | 286| 9.32M| "=r" (__RORc_tmp) : \ | | | | 287| 9.32M| "0" (__RORc_tmp), \ | | | | 288| 9.32M| "I" (i)); \ | | | | 289| 9.32M| __RORc_tmp; \ | | | | 290| 9.32M| }) | | ------------------ ------------------ 337| 9.32M| rk[3]; 338| 9.32M| if (r == Nr-2) { ------------------ | Branch (338:13): [True: 856k, False: 8.47M] ------------------ 339| 856k| break; 340| 856k| } 341| 8.47M| s0 = t0; s1 = t1; s2 = t2; s3 = t3; 342| 8.47M| } 343| 856k| rk += 4; 344| | 345| |#else 346| | 347| | /* 348| | * Nr - 1 full rounds: 349| | */ 350| | r = Nr >> 1; 351| | for (;;) { 352| | t0 = 353| | Te0(byte(s0, 3)) ^ 354| | Te1(byte(s1, 2)) ^ 355| | Te2(byte(s2, 1)) ^ 356| | Te3(byte(s3, 0)) ^ 357| | rk[4]; 358| | t1 = 359| | Te0(byte(s1, 3)) ^ 360| | Te1(byte(s2, 2)) ^ 361| | Te2(byte(s3, 1)) ^ 362| | Te3(byte(s0, 0)) ^ 363| | rk[5]; 364| | t2 = 365| | Te0(byte(s2, 3)) ^ 366| | Te1(byte(s3, 2)) ^ 367| | Te2(byte(s0, 1)) ^ 368| | Te3(byte(s1, 0)) ^ 369| | rk[6]; 370| | t3 = 371| | Te0(byte(s3, 3)) ^ 372| | Te1(byte(s0, 2)) ^ 373| | Te2(byte(s1, 1)) ^ 374| | Te3(byte(s2, 0)) ^ 375| | rk[7]; 376| | 377| | rk += 8; 378| | if (--r == 0) { 379| | break; 380| | } 381| | 382| | s0 = 383| | Te0(byte(t0, 3)) ^ 384| | Te1(byte(t1, 2)) ^ 385| | Te2(byte(t2, 1)) ^ 386| | Te3(byte(t3, 0)) ^ 387| | rk[0]; 388| | s1 = 389| | Te0(byte(t1, 3)) ^ 390| | Te1(byte(t2, 2)) ^ 391| | Te2(byte(t3, 1)) ^ 392| | Te3(byte(t0, 0)) ^ 393| | rk[1]; 394| | s2 = 395| | Te0(byte(t2, 3)) ^ 396| | Te1(byte(t3, 2)) ^ 397| | Te2(byte(t0, 1)) ^ 398| | Te3(byte(t1, 0)) ^ 399| | rk[2]; 400| | s3 = 401| | Te0(byte(t3, 3)) ^ 402| | Te1(byte(t0, 2)) ^ 403| | Te2(byte(t1, 1)) ^ 404| | Te3(byte(t2, 0)) ^ 405| | rk[3]; 406| | } 407| | 408| |#endif 409| | 410| | /* 411| | * apply last round and 412| | * map cipher state to byte array block: 413| | */ 414| 856k| s0 = 415| 856k| (Te4_3[byte(t0, 3)]) ^ ------------------ | | 319| 856k|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t0, 3)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 416| 856k| (Te4_2[byte(t1, 2)]) ^ ------------------ | | 318| 856k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t1, 2)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 417| 856k| (Te4_1[byte(t2, 1)]) ^ ------------------ | | 317| 856k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t2, 1)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 418| 856k| (Te4_0[byte(t3, 0)]) ^ ------------------ | | 316| 856k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t3, 0)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 419| 856k| rk[0]; 420| 856k| STORE32H(s0, ct); ------------------ | | 62| 856k|#define STORE32H(x, y) \ | | 63| 856k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 856k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 856k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 421| 856k| s1 = 422| 856k| (Te4_3[byte(t1, 3)]) ^ ------------------ | | 319| 856k|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t1, 3)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 423| 856k| (Te4_2[byte(t2, 2)]) ^ ------------------ | | 318| 856k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t2, 2)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 424| 856k| (Te4_1[byte(t3, 1)]) ^ ------------------ | | 317| 856k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t3, 1)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 425| 856k| (Te4_0[byte(t0, 0)]) ^ ------------------ | | 316| 856k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t0, 0)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 426| 856k| rk[1]; 427| 856k| STORE32H(s1, ct+4); ------------------ | | 62| 856k|#define STORE32H(x, y) \ | | 63| 856k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 856k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 856k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 428| 856k| s2 = 429| 856k| (Te4_3[byte(t2, 3)]) ^ ------------------ | | 319| 856k|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t2, 3)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 430| 856k| (Te4_2[byte(t3, 2)]) ^ ------------------ | | 318| 856k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t3, 2)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 431| 856k| (Te4_1[byte(t0, 1)]) ^ ------------------ | | 317| 856k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t0, 1)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 432| 856k| (Te4_0[byte(t1, 0)]) ^ ------------------ | | 316| 856k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t1, 0)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 433| 856k| rk[2]; 434| 856k| STORE32H(s2, ct+8); ------------------ | | 62| 856k|#define STORE32H(x, y) \ | | 63| 856k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 856k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 856k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 435| 856k| s3 = 436| 856k| (Te4_3[byte(t3, 3)]) ^ ------------------ | | 319| 856k|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t3, 3)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 437| 856k| (Te4_2[byte(t0, 2)]) ^ ------------------ | | 318| 856k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t0, 2)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 438| 856k| (Te4_1[byte(t1, 1)]) ^ ------------------ | | 317| 856k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t1, 1)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 439| 856k| (Te4_0[byte(t2, 0)]) ^ ------------------ | | 316| 856k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t2, 0)]) ^ ------------------ | | 436| 856k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 440| 856k| rk[3]; 441| 856k| STORE32H(s3, ct+12); ------------------ | | 62| 856k|#define STORE32H(x, y) \ | | 63| 856k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 856k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 856k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 442| | 443| 856k| return CRYPT_OK; 444| 856k|} aes.c:setup_mix: 95| 149k|{ 96| 149k| return (Te4_3[byte(temp, 2)]) ^ ------------------ | | 319| 149k|#define Te4_3 0xFF000000 & Te4 ------------------ return (Te4_3[byte(temp, 2)]) ^ ------------------ | | 436| 149k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 97| 149k| (Te4_2[byte(temp, 1)]) ^ ------------------ | | 318| 149k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(temp, 1)]) ^ ------------------ | | 436| 149k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 98| 149k| (Te4_1[byte(temp, 0)]) ^ ------------------ | | 317| 149k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(temp, 0)]) ^ ------------------ | | 436| 149k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 99| 149k| (Te4_0[byte(temp, 3)]); ------------------ | | 316| 149k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(temp, 3)]); ------------------ | | 436| 149k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 100| 149k|} aes.c:setup_mix2: 105| 569k|{ 106| 569k| return Td0(255 & Te4[byte(temp, 3)]) ^ ------------------ | | 311| 569k|#define Td0(x) TD0[x] ------------------ 107| 569k| Td1(255 & Te4[byte(temp, 2)]) ^ ------------------ | | 312| 569k|#define Td1(x) RORc(TD0[x], 8) | | ------------------ | | | | 283| 569k|#define RORc(word,i) ({ \ | | | | 284| 569k| ulong32 __RORc_tmp = (word); \ | | | | 285| 569k| __asm__ ("rorl %2, %0" : \ | | | | 286| 569k| "=r" (__RORc_tmp) : \ | | | | 287| 569k| "0" (__RORc_tmp), \ | | | | 288| 569k| "I" (i)); \ | | | | 289| 569k| __RORc_tmp; \ | | | | 290| 569k| }) | | ------------------ ------------------ 108| 569k| Td2(255 & Te4[byte(temp, 1)]) ^ ------------------ | | 313| 569k|#define Td2(x) RORc(TD0[x], 16) | | ------------------ | | | | 283| 569k|#define RORc(word,i) ({ \ | | | | 284| 569k| ulong32 __RORc_tmp = (word); \ | | | | 285| 569k| __asm__ ("rorl %2, %0" : \ | | | | 286| 569k| "=r" (__RORc_tmp) : \ | | | | 287| 569k| "0" (__RORc_tmp), \ | | | | 288| 569k| "I" (i)); \ | | | | 289| 569k| __RORc_tmp; \ | | | | 290| 569k| }) | | ------------------ ------------------ 109| 569k| Td3(255 & Te4[byte(temp, 0)]); ------------------ | | 314| 569k|#define Td3(x) RORc(TD0[x], 24) | | ------------------ | | | | 283| 569k|#define RORc(word,i) ({ \ | | | | 284| 569k| ulong32 __RORc_tmp = (word); \ | | | | 285| 569k| __asm__ ("rorl %2, %0" : \ | | | | 286| 569k| "=r" (__RORc_tmp) : \ | | | | 287| 569k| "0" (__RORc_tmp), \ | | | | 288| 569k| "I" (i)); \ | | | | 289| 569k| __RORc_tmp; \ | | | | 290| 569k| }) | | ------------------ ------------------ 110| 569k|} sha1_init: 164| 37.3k|{ 165| 37.3k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 37.3k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 37.3k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 166| 37.3k| md->sha1.state[0] = 0x67452301UL; 167| 37.3k| md->sha1.state[1] = 0xefcdab89UL; 168| 37.3k| md->sha1.state[2] = 0x98badcfeUL; 169| 37.3k| md->sha1.state[3] = 0x10325476UL; 170| 37.3k| md->sha1.state[4] = 0xc3d2e1f0UL; 171| 37.3k| md->sha1.curlen = 0; 172| 37.3k| md->sha1.length = 0; 173| 37.3k| return CRYPT_OK; 174| 37.3k|} sha1_done: 192| 130k|{ 193| 130k| int i; 194| | 195| 130k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 130k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 130k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 196| 130k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 130k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 130k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 197| | 198| 130k| if (md->sha1.curlen >= sizeof(md->sha1.buf)) { ------------------ | Branch (198:9): [True: 0, False: 130k] ------------------ 199| 0| return CRYPT_INVALID_ARG; 200| 0| } 201| | 202| | /* increase the length of the message */ 203| 130k| md->sha1.length += md->sha1.curlen * 8; 204| | 205| | /* append the '1' bit */ 206| 130k| md->sha1.buf[md->sha1.curlen++] = (unsigned char)0x80; 207| | 208| | /* if the length is currently above 56 bytes we append zeros 209| | * then compress. Then we can fall back to padding zeros and length 210| | * encoding like normal. 211| | */ 212| 130k| if (md->sha1.curlen > 56) { ------------------ | Branch (212:9): [True: 4.74k, False: 126k] ------------------ 213| 21.4k| while (md->sha1.curlen < 64) { ------------------ | Branch (213:16): [True: 16.7k, False: 4.74k] ------------------ 214| 16.7k| md->sha1.buf[md->sha1.curlen++] = (unsigned char)0; 215| 16.7k| } 216| 4.74k| sha1_compress(md, md->sha1.buf); 217| 4.74k| md->sha1.curlen = 0; 218| 4.74k| } 219| | 220| | /* pad upto 56 bytes of zeroes */ 221| 3.49M| while (md->sha1.curlen < 56) { ------------------ | Branch (221:12): [True: 3.36M, False: 130k] ------------------ 222| 3.36M| md->sha1.buf[md->sha1.curlen++] = (unsigned char)0; 223| 3.36M| } 224| | 225| | /* store length */ 226| 130k| STORE64H(md->sha1.length, md->sha1.buf+56); ------------------ | | 101| 130k|#define STORE64H(x, y) \ | | 102| 130k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 130k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 130k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 227| 130k| sha1_compress(md, md->sha1.buf); 228| | 229| | /* copy output */ 230| 785k| for (i = 0; i < 5; i++) { ------------------ | Branch (230:17): [True: 654k, False: 130k] ------------------ 231| 654k| STORE32H(md->sha1.state[i], out+(4*i)); ------------------ | | 62| 654k|#define STORE32H(x, y) \ | | 63| 654k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 654k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 654k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 232| 654k| } 233| |#ifdef LTC_CLEAN_STACK 234| | zeromem(md, sizeof(hash_state)); 235| |#endif 236| 130k| return CRYPT_OK; 237| 130k|} sha1.c:sha1_compress: 47| 464k|{ 48| 464k| ulong32 a,b,c,d,e,W[80],i; 49| 464k|#ifdef LTC_SMALL_CODE 50| 464k| ulong32 t; 51| 464k|#endif 52| | 53| | /* copy the state into 512-bits into W[0..15] */ 54| 7.90M| for (i = 0; i < 16; i++) { ------------------ | Branch (54:17): [True: 7.43M, False: 464k] ------------------ 55| 7.43M| LOAD32H(W[i], buf + (4*i)); ------------------ | | 66| 7.43M|#define LOAD32H(x, y) \ | | 67| 7.43M|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 7.43M|#define XMEMCPY memcpy | | ------------------ | | 68| 7.43M| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 56| 7.43M| } 57| | 58| | /* copy state */ 59| 464k| a = md->sha1.state[0]; 60| 464k| b = md->sha1.state[1]; 61| 464k| c = md->sha1.state[2]; 62| 464k| d = md->sha1.state[3]; 63| 464k| e = md->sha1.state[4]; 64| | 65| | /* expand it */ 66| 30.2M| for (i = 16; i < 80; i++) { ------------------ | Branch (66:18): [True: 29.7M, False: 464k] ------------------ 67| 29.7M| W[i] = ROL(W[i-3] ^ W[i-8] ^ W[i-14] ^ W[i-16], 1); 68| 29.7M| } 69| | 70| | /* compress */ 71| | /* round one */ 72| 464k| #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); 73| 464k| #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); 74| 464k| #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); 75| 464k| #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); 76| | 77| 464k|#ifdef LTC_SMALL_CODE 78| | 79| 9.76M| for (i = 0; i < 20; ) { ------------------ | Branch (79:17): [True: 9.29M, False: 464k] ------------------ 80| 9.29M| FF0(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; ------------------ | | 72| 9.29M| #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 9.29M|#define ROLc(word,i) ({ \ | | | | 276| 9.29M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 9.29M| __asm__ ("roll %2, %0" : \ | | | | 278| 9.29M| "=r" (__ROLc_tmp) : \ | | | | 279| 9.29M| "0" (__ROLc_tmp), \ | | | | 280| 9.29M| "I" (i)); \ | | | | 281| 9.29M| __ROLc_tmp; \ | | | | 282| 9.29M| }) | | ------------------ | | #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); | | ------------------ | | | | 37| 9.29M|#define F0(x,y,z) (z ^ (x & (y ^ z))) | | ------------------ | | #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 9.29M|#define ROLc(word,i) ({ \ | | | | 276| 9.29M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 9.29M| __asm__ ("roll %2, %0" : \ | | | | 278| 9.29M| "=r" (__ROLc_tmp) : \ | | | | 279| 9.29M| "0" (__ROLc_tmp), \ | | | | 280| 9.29M| "I" (i)); \ | | | | 281| 9.29M| __ROLc_tmp; \ | | | | 282| 9.29M| }) | | ------------------ ------------------ 81| 9.29M| } 82| | 83| 9.76M| for (; i < 40; ) { ------------------ | Branch (83:12): [True: 9.29M, False: 464k] ------------------ 84| 9.29M| FF1(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; ------------------ | | 73| 9.29M| #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 9.29M|#define ROLc(word,i) ({ \ | | | | 276| 9.29M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 9.29M| __asm__ ("roll %2, %0" : \ | | | | 278| 9.29M| "=r" (__ROLc_tmp) : \ | | | | 279| 9.29M| "0" (__ROLc_tmp), \ | | | | 280| 9.29M| "I" (i)); \ | | | | 281| 9.29M| __ROLc_tmp; \ | | | | 282| 9.29M| }) | | ------------------ | | #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); | | ------------------ | | | | 38| 9.29M|#define F1(x,y,z) (x ^ y ^ z) | | ------------------ | | #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 9.29M|#define ROLc(word,i) ({ \ | | | | 276| 9.29M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 9.29M| __asm__ ("roll %2, %0" : \ | | | | 278| 9.29M| "=r" (__ROLc_tmp) : \ | | | | 279| 9.29M| "0" (__ROLc_tmp), \ | | | | 280| 9.29M| "I" (i)); \ | | | | 281| 9.29M| __ROLc_tmp; \ | | | | 282| 9.29M| }) | | ------------------ ------------------ 85| 9.29M| } 86| | 87| 9.76M| for (; i < 60; ) { ------------------ | Branch (87:12): [True: 9.29M, False: 464k] ------------------ 88| 9.29M| FF2(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; ------------------ | | 74| 9.29M| #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); | | ------------------ | | | | 275| 9.29M|#define ROLc(word,i) ({ \ | | | | 276| 9.29M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 9.29M| __asm__ ("roll %2, %0" : \ | | | | 278| 9.29M| "=r" (__ROLc_tmp) : \ | | | | 279| 9.29M| "0" (__ROLc_tmp), \ | | | | 280| 9.29M| "I" (i)); \ | | | | 281| 9.29M| __ROLc_tmp; \ | | | | 282| 9.29M| }) | | ------------------ | | #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); | | ------------------ | | | | 39| 9.29M|#define F2(x,y,z) ((x & y) | (z & (x | y))) | | ------------------ | | #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); | | ------------------ | | | | 275| 9.29M|#define ROLc(word,i) ({ \ | | | | 276| 9.29M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 9.29M| __asm__ ("roll %2, %0" : \ | | | | 278| 9.29M| "=r" (__ROLc_tmp) : \ | | | | 279| 9.29M| "0" (__ROLc_tmp), \ | | | | 280| 9.29M| "I" (i)); \ | | | | 281| 9.29M| __ROLc_tmp; \ | | | | 282| 9.29M| }) | | ------------------ ------------------ 89| 9.29M| } 90| | 91| 9.76M| for (; i < 80; ) { ------------------ | Branch (91:12): [True: 9.29M, False: 464k] ------------------ 92| 9.29M| FF3(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; ------------------ | | 75| 9.29M| #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 9.29M|#define ROLc(word,i) ({ \ | | | | 276| 9.29M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 9.29M| __asm__ ("roll %2, %0" : \ | | | | 278| 9.29M| "=r" (__ROLc_tmp) : \ | | | | 279| 9.29M| "0" (__ROLc_tmp), \ | | | | 280| 9.29M| "I" (i)); \ | | | | 281| 9.29M| __ROLc_tmp; \ | | | | 282| 9.29M| }) | | ------------------ | | #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); | | ------------------ | | | | 40| 9.29M|#define F3(x,y,z) (x ^ y ^ z) | | ------------------ | | #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 9.29M|#define ROLc(word,i) ({ \ | | | | 276| 9.29M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 9.29M| __asm__ ("roll %2, %0" : \ | | | | 278| 9.29M| "=r" (__ROLc_tmp) : \ | | | | 279| 9.29M| "0" (__ROLc_tmp), \ | | | | 280| 9.29M| "I" (i)); \ | | | | 281| 9.29M| __ROLc_tmp; \ | | | | 282| 9.29M| }) | | ------------------ ------------------ 93| 9.29M| } 94| | 95| |#else 96| | 97| | for (i = 0; i < 20; ) { 98| | FF0(a,b,c,d,e,i++); 99| | FF0(e,a,b,c,d,i++); 100| | FF0(d,e,a,b,c,i++); 101| | FF0(c,d,e,a,b,i++); 102| | FF0(b,c,d,e,a,i++); 103| | } 104| | 105| | /* round two */ 106| | for (; i < 40; ) { 107| | FF1(a,b,c,d,e,i++); 108| | FF1(e,a,b,c,d,i++); 109| | FF1(d,e,a,b,c,i++); 110| | FF1(c,d,e,a,b,i++); 111| | FF1(b,c,d,e,a,i++); 112| | } 113| | 114| | /* round three */ 115| | for (; i < 60; ) { 116| | FF2(a,b,c,d,e,i++); 117| | FF2(e,a,b,c,d,i++); 118| | FF2(d,e,a,b,c,i++); 119| | FF2(c,d,e,a,b,i++); 120| | FF2(b,c,d,e,a,i++); 121| | } 122| | 123| | /* round four */ 124| | for (; i < 80; ) { 125| | FF3(a,b,c,d,e,i++); 126| | FF3(e,a,b,c,d,i++); 127| | FF3(d,e,a,b,c,i++); 128| | FF3(c,d,e,a,b,i++); 129| | FF3(b,c,d,e,a,i++); 130| | } 131| |#endif 132| | 133| 464k| #undef FF0 134| 464k| #undef FF1 135| 464k| #undef FF2 136| 464k| #undef FF3 137| | 138| | /* store */ 139| 464k| md->sha1.state[0] = md->sha1.state[0] + a; 140| 464k| md->sha1.state[1] = md->sha1.state[1] + b; 141| 464k| md->sha1.state[2] = md->sha1.state[2] + c; 142| 464k| md->sha1.state[3] = md->sha1.state[3] + d; 143| 464k| md->sha1.state[4] = md->sha1.state[4] + e; 144| | 145| 464k| return CRYPT_OK; 146| 464k|} sha256_init: 205| 343k|{ 206| 343k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 343k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 343k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 207| | 208| 343k| md->sha256.curlen = 0; 209| 343k| md->sha256.length = 0; 210| 343k| md->sha256.state[0] = 0x6A09E667UL; 211| 343k| md->sha256.state[1] = 0xBB67AE85UL; 212| 343k| md->sha256.state[2] = 0x3C6EF372UL; 213| 343k| md->sha256.state[3] = 0xA54FF53AUL; 214| 343k| md->sha256.state[4] = 0x510E527FUL; 215| 343k| md->sha256.state[5] = 0x9B05688CUL; 216| 343k| md->sha256.state[6] = 0x1F83D9ABUL; 217| 343k| md->sha256.state[7] = 0x5BE0CD19UL; 218| 343k| return CRYPT_OK; 219| 343k|} sha256_done: 237| 388k|{ 238| 388k| int i; 239| | 240| 388k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 388k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 388k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 241| 388k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 388k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 388k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 242| | 243| 388k| if (md->sha256.curlen >= sizeof(md->sha256.buf)) { ------------------ | Branch (243:9): [True: 0, False: 388k] ------------------ 244| 0| return CRYPT_INVALID_ARG; 245| 0| } 246| | 247| | 248| | /* increase the length of the message */ 249| 388k| md->sha256.length += md->sha256.curlen * 8; 250| | 251| | /* append the '1' bit */ 252| 388k| md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80; 253| | 254| | /* if the length is currently above 56 bytes we append zeros 255| | * then compress. Then we can fall back to padding zeros and length 256| | * encoding like normal. 257| | */ 258| 388k| if (md->sha256.curlen > 56) { ------------------ | Branch (258:9): [True: 3.45k, False: 385k] ------------------ 259| 9.46k| while (md->sha256.curlen < 64) { ------------------ | Branch (259:16): [True: 6.00k, False: 3.45k] ------------------ 260| 6.00k| md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; 261| 6.00k| } 262| 3.45k| sha256_compress(md, md->sha256.buf); 263| 3.45k| md->sha256.curlen = 0; 264| 3.45k| } 265| | 266| | /* pad upto 56 bytes of zeroes */ 267| 8.84M| while (md->sha256.curlen < 56) { ------------------ | Branch (267:12): [True: 8.45M, False: 388k] ------------------ 268| 8.45M| md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; 269| 8.45M| } 270| | 271| | /* store length */ 272| 388k| STORE64H(md->sha256.length, md->sha256.buf+56); ------------------ | | 101| 388k|#define STORE64H(x, y) \ | | 102| 388k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 388k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 388k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 273| 388k| sha256_compress(md, md->sha256.buf); 274| | 275| | /* copy output */ 276| 3.49M| for (i = 0; i < 8; i++) { ------------------ | Branch (276:17): [True: 3.11M, False: 388k] ------------------ 277| 3.11M| STORE32H(md->sha256.state[i], out+(4*i)); ------------------ | | 62| 3.11M|#define STORE32H(x, y) \ | | 63| 3.11M|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 3.11M| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 3.11M|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 278| 3.11M| } 279| |#ifdef LTC_CLEAN_STACK 280| | zeromem(md, sizeof(hash_state)); 281| |#endif 282| 388k| return CRYPT_OK; 283| 388k|} sha256.c:sha256_compress: 71| 829k|{ 72| 829k| ulong32 S[8], W[64], t0, t1; 73| 829k|#ifdef LTC_SMALL_CODE 74| 829k| ulong32 t; 75| 829k|#endif 76| 829k| int i; 77| | 78| | /* copy state into S */ 79| 7.46M| for (i = 0; i < 8; i++) { ------------------ | Branch (79:17): [True: 6.63M, False: 829k] ------------------ 80| 6.63M| S[i] = md->sha256.state[i]; 81| 6.63M| } 82| | 83| | /* copy the state into 512-bits into W[0..15] */ 84| 14.1M| for (i = 0; i < 16; i++) { ------------------ | Branch (84:17): [True: 13.2M, False: 829k] ------------------ 85| 13.2M| LOAD32H(W[i], buf + (4*i)); ------------------ | | 66| 13.2M|#define LOAD32H(x, y) \ | | 67| 13.2M|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 13.2M|#define XMEMCPY memcpy | | ------------------ | | 68| 13.2M| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 86| 13.2M| } 87| | 88| | /* fill W[16..63] */ 89| 40.6M| for (i = 16; i < 64; i++) { ------------------ | Branch (89:18): [True: 39.8M, False: 829k] ------------------ 90| 39.8M| W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 63| 39.8M|#define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) | | ------------------ | | | | 58| 39.8M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 39.8M|#define RORc(word,i) ({ \ | | | | | | 284| 39.8M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 39.8M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 39.8M| "=r" (__RORc_tmp) : \ | | | | | | 287| 39.8M| "0" (__RORc_tmp), \ | | | | | | 288| 39.8M| "I" (i)); \ | | | | | | 289| 39.8M| __RORc_tmp; \ | | | | | | 290| 39.8M| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) | | ------------------ | | | | 58| 39.8M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 39.8M|#define RORc(word,i) ({ \ | | | | | | 284| 39.8M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 39.8M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 39.8M| "=r" (__RORc_tmp) : \ | | | | | | 287| 39.8M| "0" (__RORc_tmp), \ | | | | | | 288| 39.8M| "I" (i)); \ | | | | | | 289| 39.8M| __RORc_tmp; \ | | | | | | 290| 39.8M| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) | | ------------------ | | | | 59| 39.8M|#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) | | ------------------ ------------------ W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 62| 39.8M|#define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) | | ------------------ | | | | 58| 39.8M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 39.8M|#define RORc(word,i) ({ \ | | | | | | 284| 39.8M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 39.8M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 39.8M| "=r" (__RORc_tmp) : \ | | | | | | 287| 39.8M| "0" (__RORc_tmp), \ | | | | | | 288| 39.8M| "I" (i)); \ | | | | | | 289| 39.8M| __RORc_tmp; \ | | | | | | 290| 39.8M| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) | | ------------------ | | | | 58| 39.8M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 39.8M|#define RORc(word,i) ({ \ | | | | | | 284| 39.8M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 39.8M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 39.8M| "=r" (__RORc_tmp) : \ | | | | | | 287| 39.8M| "0" (__RORc_tmp), \ | | | | | | 288| 39.8M| "I" (i)); \ | | | | | | 289| 39.8M| __RORc_tmp; \ | | | | | | 290| 39.8M| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) | | ------------------ | | | | 59| 39.8M|#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) | | ------------------ ------------------ 91| 39.8M| } 92| | 93| | /* Compress */ 94| 829k|#ifdef LTC_SMALL_CODE 95| 829k|#define RND(a,b,c,d,e,f,g,h,i) \ 96| 829k| t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ 97| 829k| t1 = Sigma0(a) + Maj(a, b, c); \ 98| 829k| d += t0; \ 99| 829k| h = t0 + t1; 100| | 101| 53.9M| for (i = 0; i < 64; ++i) { ------------------ | Branch (101:18): [True: 53.1M, False: 829k] ------------------ 102| 53.1M| RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i); ------------------ | | 96| 53.1M| t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ | | ------------------ | | | | 61| 53.1M|#define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) | | | | ------------------ | | | | | | 58| 53.1M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 53.1M|#define RORc(word,i) ({ \ | | | | | | | | 284| 53.1M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 53.1M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 53.1M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 53.1M| "0" (__RORc_tmp), \ | | | | | | | | 288| 53.1M| "I" (i)); \ | | | | | | | | 289| 53.1M| __RORc_tmp; \ | | | | | | | | 290| 53.1M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) | | | | ------------------ | | | | | | 58| 53.1M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 53.1M|#define RORc(word,i) ({ \ | | | | | | | | 284| 53.1M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 53.1M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 53.1M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 53.1M| "0" (__RORc_tmp), \ | | | | | | | | 288| 53.1M| "I" (i)); \ | | | | | | | | 289| 53.1M| __RORc_tmp; \ | | | | | | | | 290| 53.1M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) | | | | ------------------ | | | | | | 58| 53.1M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 53.1M|#define RORc(word,i) ({ \ | | | | | | | | 284| 53.1M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 53.1M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 53.1M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 53.1M| "0" (__RORc_tmp), \ | | | | | | | | 288| 53.1M| "I" (i)); \ | | | | | | | | 289| 53.1M| __RORc_tmp; \ | | | | | | | | 290| 53.1M| }) | | | | | | ------------------ | | | | ------------------ | | ------------------ | | t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ | | ------------------ | | | | 56| 53.1M|#define Ch(x,y,z) (z ^ (x & (y ^ z))) | | ------------------ | | 97| 53.1M| t1 = Sigma0(a) + Maj(a, b, c); \ | | ------------------ | | | | 60| 53.1M|#define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) | | | | ------------------ | | | | | | 58| 53.1M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 53.1M|#define RORc(word,i) ({ \ | | | | | | | | 284| 53.1M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 53.1M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 53.1M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 53.1M| "0" (__RORc_tmp), \ | | | | | | | | 288| 53.1M| "I" (i)); \ | | | | | | | | 289| 53.1M| __RORc_tmp; \ | | | | | | | | 290| 53.1M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) | | | | ------------------ | | | | | | 58| 53.1M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 53.1M|#define RORc(word,i) ({ \ | | | | | | | | 284| 53.1M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 53.1M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 53.1M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 53.1M| "0" (__RORc_tmp), \ | | | | | | | | 288| 53.1M| "I" (i)); \ | | | | | | | | 289| 53.1M| __RORc_tmp; \ | | | | | | | | 290| 53.1M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) | | | | ------------------ | | | | | | 58| 53.1M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 53.1M|#define RORc(word,i) ({ \ | | | | | | | | 284| 53.1M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 53.1M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 53.1M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 53.1M| "0" (__RORc_tmp), \ | | | | | | | | 288| 53.1M| "I" (i)); \ | | | | | | | | 289| 53.1M| __RORc_tmp; \ | | | | | | | | 290| 53.1M| }) | | | | | | ------------------ | | | | ------------------ | | ------------------ | | t1 = Sigma0(a) + Maj(a, b, c); \ | | ------------------ | | | | 57| 53.1M|#define Maj(x,y,z) (((x | y) & z) | (x & y)) | | ------------------ | | 98| 53.1M| d += t0; \ | | 99| 53.1M| h = t0 + t1; ------------------ 103| 53.1M| t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; 104| 53.1M| S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t; 105| 53.1M| } 106| |#else 107| |#define RND(a,b,c,d,e,f,g,h,i,ki) \ 108| | t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i]; \ 109| | t1 = Sigma0(a) + Maj(a, b, c); \ 110| | d += t0; \ 111| | h = t0 + t1; 112| | 113| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],0,0x428a2f98); 114| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],1,0x71374491); 115| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],2,0xb5c0fbcf); 116| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],3,0xe9b5dba5); 117| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],4,0x3956c25b); 118| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],5,0x59f111f1); 119| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],6,0x923f82a4); 120| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],7,0xab1c5ed5); 121| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],8,0xd807aa98); 122| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],9,0x12835b01); 123| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],10,0x243185be); 124| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],11,0x550c7dc3); 125| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],12,0x72be5d74); 126| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],13,0x80deb1fe); 127| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],14,0x9bdc06a7); 128| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],15,0xc19bf174); 129| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],16,0xe49b69c1); 130| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],17,0xefbe4786); 131| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],18,0x0fc19dc6); 132| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],19,0x240ca1cc); 133| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],20,0x2de92c6f); 134| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],21,0x4a7484aa); 135| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],22,0x5cb0a9dc); 136| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],23,0x76f988da); 137| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],24,0x983e5152); 138| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],25,0xa831c66d); 139| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],26,0xb00327c8); 140| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],27,0xbf597fc7); 141| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],28,0xc6e00bf3); 142| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],29,0xd5a79147); 143| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],30,0x06ca6351); 144| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],31,0x14292967); 145| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],32,0x27b70a85); 146| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],33,0x2e1b2138); 147| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],34,0x4d2c6dfc); 148| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],35,0x53380d13); 149| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],36,0x650a7354); 150| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],37,0x766a0abb); 151| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],38,0x81c2c92e); 152| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],39,0x92722c85); 153| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],40,0xa2bfe8a1); 154| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],41,0xa81a664b); 155| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],42,0xc24b8b70); 156| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],43,0xc76c51a3); 157| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],44,0xd192e819); 158| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],45,0xd6990624); 159| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],46,0xf40e3585); 160| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],47,0x106aa070); 161| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],48,0x19a4c116); 162| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],49,0x1e376c08); 163| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],50,0x2748774c); 164| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],51,0x34b0bcb5); 165| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],52,0x391c0cb3); 166| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],53,0x4ed8aa4a); 167| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],54,0x5b9cca4f); 168| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],55,0x682e6ff3); 169| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],56,0x748f82ee); 170| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],57,0x78a5636f); 171| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],58,0x84c87814); 172| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],59,0x8cc70208); 173| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],60,0x90befffa); 174| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],61,0xa4506ceb); 175| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7); 176| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2); 177| | 178| |#undef RND 179| | 180| |#endif 181| | 182| | /* feedback */ 183| 7.46M| for (i = 0; i < 8; i++) { ------------------ | Branch (183:17): [True: 6.63M, False: 829k] ------------------ 184| 6.63M| md->sha256.state[i] = md->sha256.state[i] + S[i]; 185| 6.63M| } 186| 829k| return CRYPT_OK; 187| 829k|} sha512_init: 174| 2.98k|{ 175| 2.98k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 2.98k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 2.98k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 176| 2.98k| md->sha512.curlen = 0; 177| 2.98k| md->sha512.length = 0; 178| 2.98k| md->sha512.state[0] = CONST64(0x6a09e667f3bcc908); ------------------ | | 200| 2.98k| #define CONST64(n) n ## ULL ------------------ 179| 2.98k| md->sha512.state[1] = CONST64(0xbb67ae8584caa73b); ------------------ | | 200| 2.98k| #define CONST64(n) n ## ULL ------------------ 180| 2.98k| md->sha512.state[2] = CONST64(0x3c6ef372fe94f82b); ------------------ | | 200| 2.98k| #define CONST64(n) n ## ULL ------------------ 181| 2.98k| md->sha512.state[3] = CONST64(0xa54ff53a5f1d36f1); ------------------ | | 200| 2.98k| #define CONST64(n) n ## ULL ------------------ 182| 2.98k| md->sha512.state[4] = CONST64(0x510e527fade682d1); ------------------ | | 200| 2.98k| #define CONST64(n) n ## ULL ------------------ 183| 2.98k| md->sha512.state[5] = CONST64(0x9b05688c2b3e6c1f); ------------------ | | 200| 2.98k| #define CONST64(n) n ## ULL ------------------ 184| 2.98k| md->sha512.state[6] = CONST64(0x1f83d9abfb41bd6b); ------------------ | | 200| 2.98k| #define CONST64(n) n ## ULL ------------------ 185| 2.98k| md->sha512.state[7] = CONST64(0x5be0cd19137e2179); ------------------ | | 200| 2.98k| #define CONST64(n) n ## ULL ------------------ 186| 2.98k| return CRYPT_OK; 187| 2.98k|} sha512_done: 205| 2.98k|{ 206| 2.98k| int i; 207| | 208| 2.98k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 2.98k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 2.98k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 209| 2.98k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 2.98k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 2.98k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 210| | 211| 2.98k| if (md->sha512.curlen >= sizeof(md->sha512.buf)) { ------------------ | Branch (211:9): [True: 0, False: 2.98k] ------------------ 212| 0| return CRYPT_INVALID_ARG; 213| 0| } 214| | 215| | /* increase the length of the message */ 216| 2.98k| md->sha512.length += md->sha512.curlen * CONST64(8); ------------------ | | 200| 2.98k| #define CONST64(n) n ## ULL ------------------ 217| | 218| | /* append the '1' bit */ 219| 2.98k| md->sha512.buf[md->sha512.curlen++] = (unsigned char)0x80; 220| | 221| | /* if the length is currently above 112 bytes we append zeros 222| | * then compress. Then we can fall back to padding zeros and length 223| | * encoding like normal. 224| | */ 225| 2.98k| if (md->sha512.curlen > 112) { ------------------ | Branch (225:9): [True: 0, False: 2.98k] ------------------ 226| 0| while (md->sha512.curlen < 128) { ------------------ | Branch (226:16): [True: 0, False: 0] ------------------ 227| 0| md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; 228| 0| } 229| 0| sha512_compress(md, md->sha512.buf); 230| 0| md->sha512.curlen = 0; 231| 0| } 232| | 233| | /* pad upto 120 bytes of zeroes 234| | * note: that from 112 to 120 is the 64 MSB of the length. We assume that you won't hash 235| | * > 2^64 bits of data... :-) 236| | */ 237| 190k| while (md->sha512.curlen < 120) { ------------------ | Branch (237:12): [True: 187k, False: 2.98k] ------------------ 238| 187k| md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; 239| 187k| } 240| | 241| | /* store length */ 242| 2.98k| STORE64H(md->sha512.length, md->sha512.buf+120); ------------------ | | 101| 2.98k|#define STORE64H(x, y) \ | | 102| 2.98k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 2.98k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 2.98k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 243| 2.98k| sha512_compress(md, md->sha512.buf); 244| | 245| | /* copy output */ 246| 26.8k| for (i = 0; i < 8; i++) { ------------------ | Branch (246:17): [True: 23.8k, False: 2.98k] ------------------ 247| 23.8k| STORE64H(md->sha512.state[i], out+(8*i)); ------------------ | | 101| 23.8k|#define STORE64H(x, y) \ | | 102| 23.8k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 23.8k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 23.8k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 248| 23.8k| } 249| |#ifdef LTC_CLEAN_STACK 250| | zeromem(md, sizeof(hash_state)); 251| |#endif 252| 2.98k| return CRYPT_OK; 253| 2.98k|} sha512.c:sha512_compress: 96| 2.98k|{ 97| 2.98k| ulong64 S[8], W[80], t0, t1; 98| 2.98k| int i; 99| | 100| | /* copy state into S */ 101| 26.8k| for (i = 0; i < 8; i++) { ------------------ | Branch (101:17): [True: 23.8k, False: 2.98k] ------------------ 102| 23.8k| S[i] = md->sha512.state[i]; 103| 23.8k| } 104| | 105| | /* copy the state into 1024-bits into W[0..15] */ 106| 50.7k| for (i = 0; i < 16; i++) { ------------------ | Branch (106:17): [True: 47.7k, False: 2.98k] ------------------ 107| 47.7k| LOAD64H(W[i], buf + (8*i)); ------------------ | | 105| 47.7k|#define LOAD64H(x, y) \ | | 106| 47.7k|do { XMEMCPY (&(x), (y), 8); \ | | ------------------ | | | | 39| 47.7k|#define XMEMCPY memcpy | | ------------------ | | 107| 47.7k| (x) = __builtin_bswap64 ((x)); } while(0) | | ------------------ | | | Branch (107:46): [Folded - Ignored] | | ------------------ ------------------ 108| 47.7k| } 109| | 110| | /* fill W[16..79] */ 111| 194k| for (i = 16; i < 80; i++) { ------------------ | Branch (111:18): [True: 191k, False: 2.98k] ------------------ 112| 191k| W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 88| 191k|#define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) | | ------------------ | | | | 83| 191k|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 191k|#define ROR64c(word,i) ({ \ | | | | | | 385| 191k| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 191k| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 191k| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 191k| "0" (__ROR64c_tmp), \ | | | | | | 389| 191k| "J" (i)); \ | | | | | | 390| 191k| __ROR64c_tmp; \ | | | | | | 391| 191k| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) | | ------------------ | | | | 83| 191k|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 191k|#define ROR64c(word,i) ({ \ | | | | | | 385| 191k| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 191k| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 191k| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 191k| "0" (__ROR64c_tmp), \ | | | | | | 389| 191k| "J" (i)); \ | | | | | | 390| 191k| __ROR64c_tmp; \ | | | | | | 391| 191k| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) | | ------------------ | | | | 84| 191k|#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) | | | | ------------------ | | | | | | 200| 191k| #define CONST64(n) n ## ULL | | | | ------------------ | | ------------------ ------------------ W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 87| 191k|#define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) | | ------------------ | | | | 83| 191k|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 191k|#define ROR64c(word,i) ({ \ | | | | | | 385| 191k| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 191k| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 191k| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 191k| "0" (__ROR64c_tmp), \ | | | | | | 389| 191k| "J" (i)); \ | | | | | | 390| 191k| __ROR64c_tmp; \ | | | | | | 391| 191k| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) | | ------------------ | | | | 83| 191k|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 191k|#define ROR64c(word,i) ({ \ | | | | | | 385| 191k| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 191k| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 191k| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 191k| "0" (__ROR64c_tmp), \ | | | | | | 389| 191k| "J" (i)); \ | | | | | | 390| 191k| __ROR64c_tmp; \ | | | | | | 391| 191k| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) | | ------------------ | | | | 84| 191k|#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) | | | | ------------------ | | | | | | 200| 191k| #define CONST64(n) n ## ULL | | | | ------------------ | | ------------------ ------------------ 113| 191k| } 114| | 115| | /* Compress */ 116| 2.98k|#ifdef LTC_SMALL_CODE 117| 241k| for (i = 0; i < 80; i++) { ------------------ | Branch (117:17): [True: 238k, False: 2.98k] ------------------ 118| 238k| t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i]; ------------------ | | 86| 238k|#define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) | | ------------------ | | | | 83| 238k|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 238k|#define ROR64c(word,i) ({ \ | | | | | | 385| 238k| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 238k| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 238k| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 238k| "0" (__ROR64c_tmp), \ | | | | | | 389| 238k| "J" (i)); \ | | | | | | 390| 238k| __ROR64c_tmp; \ | | | | | | 391| 238k| }) | | | | ------------------ | | ------------------ | | #define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) | | ------------------ | | | | 83| 238k|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 238k|#define ROR64c(word,i) ({ \ | | | | | | 385| 238k| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 238k| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 238k| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 238k| "0" (__ROR64c_tmp), \ | | | | | | 389| 238k| "J" (i)); \ | | | | | | 390| 238k| __ROR64c_tmp; \ | | | | | | 391| 238k| }) | | | | ------------------ | | ------------------ | | #define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) | | ------------------ | | | | 83| 238k|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 238k|#define ROR64c(word,i) ({ \ | | | | | | 385| 238k| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 238k| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 238k| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 238k| "0" (__ROR64c_tmp), \ | | | | | | 389| 238k| "J" (i)); \ | | | | | | 390| 238k| __ROR64c_tmp; \ | | | | | | 391| 238k| }) | | | | ------------------ | | ------------------ ------------------ t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i]; ------------------ | | 81| 238k|#define Ch(x,y,z) (z ^ (x & (y ^ z))) ------------------ 119| 238k| t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]); ------------------ | | 85| 238k|#define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) | | ------------------ | | | | 83| 238k|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 238k|#define ROR64c(word,i) ({ \ | | | | | | 385| 238k| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 238k| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 238k| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 238k| "0" (__ROR64c_tmp), \ | | | | | | 389| 238k| "J" (i)); \ | | | | | | 390| 238k| __ROR64c_tmp; \ | | | | | | 391| 238k| }) | | | | ------------------ | | ------------------ | | #define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) | | ------------------ | | | | 83| 238k|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 238k|#define ROR64c(word,i) ({ \ | | | | | | 385| 238k| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 238k| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 238k| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 238k| "0" (__ROR64c_tmp), \ | | | | | | 389| 238k| "J" (i)); \ | | | | | | 390| 238k| __ROR64c_tmp; \ | | | | | | 391| 238k| }) | | | | ------------------ | | ------------------ | | #define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) | | ------------------ | | | | 83| 238k|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 238k|#define ROR64c(word,i) ({ \ | | | | | | 385| 238k| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 238k| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 238k| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 238k| "0" (__ROR64c_tmp), \ | | | | | | 389| 238k| "J" (i)); \ | | | | | | 390| 238k| __ROR64c_tmp; \ | | | | | | 391| 238k| }) | | | | ------------------ | | ------------------ ------------------ t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]); ------------------ | | 82| 238k|#define Maj(x,y,z) (((x | y) & z) | (x & y)) ------------------ 120| 238k| S[7] = S[6]; 121| 238k| S[6] = S[5]; 122| 238k| S[5] = S[4]; 123| 238k| S[4] = S[3] + t0; 124| 238k| S[3] = S[2]; 125| 238k| S[2] = S[1]; 126| 238k| S[1] = S[0]; 127| 238k| S[0] = t0 + t1; 128| 238k| } 129| |#else 130| |#define RND(a,b,c,d,e,f,g,h,i) \ 131| | t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ 132| | t1 = Sigma0(a) + Maj(a, b, c); \ 133| | d += t0; \ 134| | h = t0 + t1; 135| | 136| | for (i = 0; i < 80; i += 8) { 137| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0); 138| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1); 139| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2); 140| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3); 141| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4); 142| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5); 143| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); 144| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); 145| | } 146| |#endif 147| | 148| | 149| | /* feedback */ 150| 26.8k| for (i = 0; i < 8; i++) { ------------------ | Branch (150:17): [True: 23.8k, False: 2.98k] ------------------ 151| 23.8k| md->sha512.state[i] = md->sha512.state[i] + S[i]; 152| 23.8k| } 153| | 154| 2.98k| return CRYPT_OK; 155| 2.98k|} sha1_process: 491| 201k|int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) \ 492| 201k|{ \ 493| 201k| unsigned long n; \ 494| 201k| int err; \ 495| 201k| LTC_ARGCHK(md != NULL); \ ------------------ | | 32| 201k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 201k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 496| 201k| LTC_ARGCHK(in != NULL); \ ------------------ | | 32| 201k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 201k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 497| 201k| if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ ------------------ | Branch (497:9): [True: 0, False: 201k] ------------------ 498| 0| return CRYPT_INVALID_ARG; \ 499| 0| } \ 500| 201k| if ((md-> state_var .length + inlen) < md-> state_var .length) { \ ------------------ | Branch (500:9): [True: 0, False: 201k] ------------------ 501| 0| return CRYPT_HASH_OVERFLOW; \ 502| 0| } \ 503| 716k| while (inlen > 0) { \ ------------------ | Branch (503:12): [True: 515k, False: 201k] ------------------ 504| 515k| if (md-> state_var .curlen == 0 && inlen >= block_size) { \ ------------------ | Branch (504:13): [True: 357k, False: 157k] | Branch (504:44): [True: 291k, False: 65.6k] ------------------ 505| 291k| if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) { \ ------------------ | Branch (505:16): [True: 0, False: 291k] ------------------ 506| 0| return err; \ 507| 0| } \ 508| 291k| md-> state_var .length += block_size * 8; \ 509| 291k| in += block_size; \ 510| 291k| inlen -= block_size; \ 511| 291k| } else { \ 512| 223k| n = MIN(inlen, (block_size - md-> state_var .curlen)); \ ------------------ | | 425| 223k| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 185k, False: 37.5k] | | ------------------ ------------------ 513| 223k| XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ ------------------ | | 39| 223k|#define XMEMCPY memcpy ------------------ 514| 223k| md-> state_var .curlen += n; \ 515| 223k| in += n; \ 516| 223k| inlen -= n; \ 517| 223k| if (md-> state_var .curlen == block_size) { \ ------------------ | Branch (517:16): [True: 37.5k, False: 185k] ------------------ 518| 37.5k| if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) { \ ------------------ | Branch (518:19): [True: 0, False: 37.5k] ------------------ 519| 0| return err; \ 520| 0| } \ 521| 37.5k| md-> state_var .length += 8*block_size; \ 522| 37.5k| md-> state_var .curlen = 0; \ 523| 37.5k| } \ 524| 223k| } \ 525| 515k| } \ 526| 201k| return CRYPT_OK; \ 527| 201k|} sha256_process: 491| 803k|int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) \ 492| 803k|{ \ 493| 803k| unsigned long n; \ 494| 803k| int err; \ 495| 803k| LTC_ARGCHK(md != NULL); \ ------------------ | | 32| 803k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 803k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 496| 803k| LTC_ARGCHK(in != NULL); \ ------------------ | | 32| 803k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 803k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 497| 803k| if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ ------------------ | Branch (497:9): [True: 0, False: 803k] ------------------ 498| 0| return CRYPT_INVALID_ARG; \ 499| 0| } \ 500| 803k| if ((md-> state_var .length + inlen) < md-> state_var .length) { \ ------------------ | Branch (500:9): [True: 0, False: 803k] ------------------ 501| 0| return CRYPT_HASH_OVERFLOW; \ 502| 0| } \ 503| 1.97M| while (inlen > 0) { \ ------------------ | Branch (503:12): [True: 1.16M, False: 803k] ------------------ 504| 1.16M| if (md-> state_var .curlen == 0 && inlen >= block_size) { \ ------------------ | Branch (504:13): [True: 780k, False: 386k] | Branch (504:44): [True: 405k, False: 374k] ------------------ 505| 405k| if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) { \ ------------------ | Branch (505:16): [True: 0, False: 405k] ------------------ 506| 0| return err; \ 507| 0| } \ 508| 405k| md-> state_var .length += block_size * 8; \ 509| 405k| in += block_size; \ 510| 405k| inlen -= block_size; \ 511| 761k| } else { \ 512| 761k| n = MIN(inlen, (block_size - md-> state_var .curlen)); \ ------------------ | | 425| 761k| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 729k, False: 31.5k] | | ------------------ ------------------ 513| 761k| XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ ------------------ | | 39| 761k|#define XMEMCPY memcpy ------------------ 514| 761k| md-> state_var .curlen += n; \ 515| 761k| in += n; \ 516| 761k| inlen -= n; \ 517| 761k| if (md-> state_var .curlen == block_size) { \ ------------------ | Branch (517:16): [True: 31.5k, False: 729k] ------------------ 518| 31.5k| if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) { \ ------------------ | Branch (518:19): [True: 0, False: 31.5k] ------------------ 519| 0| return err; \ 520| 0| } \ 521| 31.5k| md-> state_var .length += 8*block_size; \ 522| 31.5k| md-> state_var .curlen = 0; \ 523| 31.5k| } \ 524| 761k| } \ 525| 1.16M| } \ 526| 803k| return CRYPT_OK; \ 527| 803k|} sha512_process: 491| 5.97k|int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) \ 492| 5.97k|{ \ 493| 5.97k| unsigned long n; \ 494| 5.97k| int err; \ 495| 5.97k| LTC_ARGCHK(md != NULL); \ ------------------ | | 32| 5.97k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 5.97k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 496| 5.97k| LTC_ARGCHK(in != NULL); \ ------------------ | | 32| 5.97k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 5.97k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 497| 5.97k| if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ ------------------ | Branch (497:9): [True: 0, False: 5.97k] ------------------ 498| 0| return CRYPT_INVALID_ARG; \ 499| 0| } \ 500| 5.97k| if ((md-> state_var .length + inlen) < md-> state_var .length) { \ ------------------ | Branch (500:9): [True: 0, False: 5.97k] ------------------ 501| 0| return CRYPT_HASH_OVERFLOW; \ 502| 0| } \ 503| 11.9k| while (inlen > 0) { \ ------------------ | Branch (503:12): [True: 5.97k, False: 5.97k] ------------------ 504| 5.97k| if (md-> state_var .curlen == 0 && inlen >= block_size) { \ ------------------ | Branch (504:13): [True: 2.98k, False: 2.98k] | Branch (504:44): [True: 0, False: 2.98k] ------------------ 505| 0| if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) { \ ------------------ | Branch (505:16): [True: 0, False: 0] ------------------ 506| 0| return err; \ 507| 0| } \ 508| 0| md-> state_var .length += block_size * 8; \ 509| 0| in += block_size; \ 510| 0| inlen -= block_size; \ 511| 5.97k| } else { \ 512| 5.97k| n = MIN(inlen, (block_size - md-> state_var .curlen)); \ ------------------ | | 425| 5.97k| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 5.97k, False: 0] | | ------------------ ------------------ 513| 5.97k| XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ ------------------ | | 39| 5.97k|#define XMEMCPY memcpy ------------------ 514| 5.97k| md-> state_var .curlen += n; \ 515| 5.97k| in += n; \ 516| 5.97k| inlen -= n; \ 517| 5.97k| if (md-> state_var .curlen == block_size) { \ ------------------ | Branch (517:16): [True: 0, False: 5.97k] ------------------ 518| 0| if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) { \ ------------------ | Branch (518:19): [True: 0, False: 0] ------------------ 519| 0| return err; \ 520| 0| } \ 521| 0| md-> state_var .length += 8*block_size; \ 522| 0| md-> state_var .curlen = 0; \ 523| 0| } \ 524| 5.97k| } \ 525| 5.97k| } \ 526| 5.97k| return CRYPT_OK; \ 527| 5.97k|} sha1.c:ROL: 258| 29.7M|{ 259| 29.7M| asm ("roll %%cl,%0" 260| 29.7M| :"=r" (word) 261| 29.7M| :"0" (word),"c" (i)); 262| 29.7M| return word; 263| 29.7M|} chacha_crypt.c:ROL: 258| 29.7M|{ 259| 29.7M| asm ("roll %%cl,%0" 260| 29.7M| :"=r" (word) 261| 29.7M| :"0" (word),"c" (i)); 262| 29.7M| return word; 263| 29.7M|} hmac_done: 28| 40.1k|{ 29| 40.1k| unsigned char buf[MAXBLOCKSIZE], isha[MAXBLOCKSIZE]; 30| 40.1k| unsigned long hashsize, i; 31| 40.1k| int hash, err; 32| | 33| 40.1k| LTC_ARGCHK(hmac != NULL); ------------------ | | 32| 40.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 40.1k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 34| 40.1k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 40.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 40.1k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 35| | 36| | /* test hash */ 37| 40.1k| hash = hmac->hash; 38| 40.1k| if((err = hash_is_valid(hash)) != CRYPT_OK) { ------------------ | Branch (38:8): [True: 0, False: 40.1k] ------------------ 39| 0| return err; 40| 0| } 41| | 42| | /* get the hash message digest size */ 43| 40.1k| hashsize = hash_descriptor[hash].hashsize; 44| | 45| 40.1k| if ((err = hash_descriptor[hash].done(&hmac->md, isha)) != CRYPT_OK) { ------------------ | Branch (45:9): [True: 0, False: 40.1k] ------------------ 46| 0| goto LBL_ERR; 47| 0| } 48| | 49| | /* Create the second HMAC vector vector for step (3) */ 50| 2.60M| for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) { ------------------ | | 18| 2.60M|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (50:14): [True: 2.56M, False: 40.1k] ------------------ 51| 2.56M| buf[i] = hmac->key[i] ^ 0x5C; 52| 2.56M| } 53| | 54| | /* Now calculate the "outer" hash for step (5), (6), and (7) */ 55| 40.1k| if ((err = hash_descriptor[hash].init(&hmac->md)) != CRYPT_OK) { ------------------ | Branch (55:9): [True: 0, False: 40.1k] ------------------ 56| 0| goto LBL_ERR; 57| 0| } 58| 40.1k| if ((err = hash_descriptor[hash].process(&hmac->md, buf, LTC_HMAC_BLOCKSIZE)) != CRYPT_OK) { ------------------ | | 18| 40.1k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (58:9): [True: 0, False: 40.1k] ------------------ 59| 0| goto LBL_ERR; 60| 0| } 61| 40.1k| if ((err = hash_descriptor[hash].process(&hmac->md, isha, hashsize)) != CRYPT_OK) { ------------------ | Branch (61:9): [True: 0, False: 40.1k] ------------------ 62| 0| goto LBL_ERR; 63| 0| } 64| 40.1k| if ((err = hash_descriptor[hash].done(&hmac->md, buf)) != CRYPT_OK) { ------------------ | Branch (64:9): [True: 0, False: 40.1k] ------------------ 65| 0| goto LBL_ERR; 66| 0| } 67| | 68| | /* copy to output */ 69| 1.28M| for (i = 0; i < hashsize && i < *outlen; i++) { ------------------ | Branch (69:17): [True: 1.24M, False: 40.1k] | Branch (69:33): [True: 1.24M, False: 0] ------------------ 70| 1.24M| out[i] = buf[i]; 71| 1.24M| } 72| 40.1k| *outlen = i; 73| | 74| 40.1k| err = CRYPT_OK; 75| 40.1k|LBL_ERR: 76| 40.1k| XFREE(hmac->key); ------------------ | | 17| 40.1k|#define XFREE m_free_direct ------------------ 77| |#ifdef LTC_CLEAN_STACK 78| | zeromem(isha, hashsize); 79| | zeromem(buf, hashsize); 80| | zeromem(hmac, sizeof(*hmac)); 81| |#endif 82| | 83| 40.1k| return err; 84| 40.1k|} hmac_init: 29| 40.1k|{ 30| 40.1k| unsigned char buf[MAXBLOCKSIZE]; 31| 40.1k| unsigned long hashsize; 32| 40.1k| unsigned long i, z; 33| 40.1k| int err; 34| | 35| 40.1k| LTC_ARGCHK(hmac != NULL); ------------------ | | 32| 40.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 40.1k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 36| 40.1k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 40.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 40.1k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 37| | 38| | /* valid hash? */ 39| 40.1k| if ((err = hash_is_valid(hash)) != CRYPT_OK) { ------------------ | Branch (39:9): [True: 0, False: 40.1k] ------------------ 40| 0| return err; 41| 0| } 42| 40.1k| hmac->hash = hash; 43| 40.1k| hashsize = hash_descriptor[hash].hashsize; 44| | 45| | /* valid key length? */ 46| 40.1k| if (keylen == 0) { ------------------ | Branch (46:9): [True: 0, False: 40.1k] ------------------ 47| 0| return CRYPT_INVALID_KEYSIZE; 48| 0| } 49| | 50| | /* allocate memory for key */ 51| 40.1k| hmac->key = XMALLOC(LTC_HMAC_BLOCKSIZE); ------------------ | | 16| 40.1k|#define XMALLOC m_malloc ------------------ hmac->key = XMALLOC(LTC_HMAC_BLOCKSIZE); ------------------ | | 18| 40.1k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ 52| 40.1k| if (hmac->key == NULL) { ------------------ | Branch (52:9): [True: 0, False: 40.1k] ------------------ 53| 0| return CRYPT_MEM; 54| 0| } 55| | 56| | /* (1) make sure we have a large enough key */ 57| 40.1k| if(keylen > LTC_HMAC_BLOCKSIZE) { ------------------ | | 18| 40.1k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (57:8): [True: 0, False: 40.1k] ------------------ 58| 0| z = LTC_HMAC_BLOCKSIZE; ------------------ | | 18| 0|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ 59| 0| if ((err = hash_memory(hash, key, keylen, hmac->key, &z)) != CRYPT_OK) { ------------------ | Branch (59:13): [True: 0, False: 0] ------------------ 60| 0| goto LBL_ERR; 61| 0| } 62| 0| keylen = hashsize; 63| 40.1k| } else { 64| 40.1k| XMEMCPY(hmac->key, key, (size_t)keylen); ------------------ | | 39| 40.1k|#define XMEMCPY memcpy ------------------ 65| 40.1k| } 66| | 67| 40.1k| if(keylen < LTC_HMAC_BLOCKSIZE) { ------------------ | | 18| 40.1k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (67:8): [True: 40.1k, False: 0] ------------------ 68| 40.1k| zeromem((hmac->key) + keylen, (size_t)(LTC_HMAC_BLOCKSIZE - keylen)); ------------------ | | 18| 40.1k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ 69| 40.1k| } 70| | 71| | /* Create the initialization vector for step (3) */ 72| 2.60M| for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) { ------------------ | | 18| 2.60M|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (72:14): [True: 2.56M, False: 40.1k] ------------------ 73| 2.56M| buf[i] = hmac->key[i] ^ 0x36; 74| 2.56M| } 75| | 76| | /* Pre-pend that to the hash data */ 77| 40.1k| if ((err = hash_descriptor[hash].init(&hmac->md)) != CRYPT_OK) { ------------------ | Branch (77:9): [True: 0, False: 40.1k] ------------------ 78| 0| goto LBL_ERR; 79| 0| } 80| | 81| 40.1k| if ((err = hash_descriptor[hash].process(&hmac->md, buf, LTC_HMAC_BLOCKSIZE)) != CRYPT_OK) { ------------------ | | 18| 40.1k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (81:9): [True: 0, False: 40.1k] ------------------ 82| 0| goto LBL_ERR; 83| 0| } 84| 40.1k| goto done; 85| 40.1k|LBL_ERR: 86| | /* free the key since we failed */ 87| 0| XFREE(hmac->key); ------------------ | | 17| 0|#define XFREE m_free_direct ------------------ 88| 40.1k|done: 89| |#ifdef LTC_CLEAN_STACK 90| | zeromem(buf, LTC_HMAC_BLOCKSIZE); 91| |#endif 92| | 93| 40.1k| return err; 94| 0|} hmac_process: 26| 80.2k|{ 27| 80.2k| int err; 28| 80.2k| LTC_ARGCHK(hmac != NULL); ------------------ | | 32| 80.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 80.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 29| 80.2k| LTC_ARGCHK(in != NULL); ------------------ | | 32| 80.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 80.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 30| 80.2k| if ((err = hash_is_valid(hmac->hash)) != CRYPT_OK) { ------------------ | Branch (30:9): [True: 0, False: 80.2k] ------------------ 31| 0| return err; 32| 0| } 33| 80.2k| return hash_descriptor[hmac->hash].process(&hmac->md, in, inlen); 34| 80.2k|} poly1305_init: 90| 13.6k|{ 91| 13.6k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 13.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 92| 13.6k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 13.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 93| 13.6k| LTC_ARGCHK(keylen == 32); ------------------ | | 32| 13.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 94| | 95| | /* r &= 0xffffffc0ffffffc0ffffffc0fffffff */ 96| 13.6k| LOAD32L(st->r[0], key + 0); st->r[0] = (st->r[0] ) & 0x3ffffff; ------------------ | | 167| 13.6k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 13.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 97| 13.6k| LOAD32L(st->r[1], key + 3); st->r[1] = (st->r[1] >> 2) & 0x3ffff03; ------------------ | | 167| 13.6k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 13.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 98| 13.6k| LOAD32L(st->r[2], key + 6); st->r[2] = (st->r[2] >> 4) & 0x3ffc0ff; ------------------ | | 167| 13.6k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 13.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 99| 13.6k| LOAD32L(st->r[3], key + 9); st->r[3] = (st->r[3] >> 6) & 0x3f03fff; ------------------ | | 167| 13.6k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 13.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 100| 13.6k| LOAD32L(st->r[4], key + 12); st->r[4] = (st->r[4] >> 8) & 0x00fffff; ------------------ | | 167| 13.6k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 13.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 101| | 102| | /* h = 0 */ 103| 13.6k| st->h[0] = 0; 104| 13.6k| st->h[1] = 0; 105| 13.6k| st->h[2] = 0; 106| 13.6k| st->h[3] = 0; 107| 13.6k| st->h[4] = 0; 108| | 109| | /* save pad for later */ 110| 13.6k| LOAD32L(st->pad[0], key + 16); ------------------ | | 167| 13.6k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 13.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 111| 13.6k| LOAD32L(st->pad[1], key + 20); ------------------ | | 167| 13.6k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 13.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 112| 13.6k| LOAD32L(st->pad[2], key + 24); ------------------ | | 167| 13.6k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 13.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 113| 13.6k| LOAD32L(st->pad[3], key + 28); ------------------ | | 167| 13.6k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 13.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 114| | 115| 13.6k| st->leftover = 0; 116| 13.6k| st->final = 0; 117| 13.6k| return CRYPT_OK; 118| 13.6k|} poly1305_process: 128| 13.6k|{ 129| 13.6k| unsigned long i; 130| | 131| 13.6k| if (inlen == 0) return CRYPT_OK; /* nothing to do */ ------------------ | Branch (131:8): [True: 0, False: 13.6k] ------------------ 132| 13.6k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 13.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 133| 13.6k| LTC_ARGCHK(in != NULL); ------------------ | | 32| 13.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 134| | 135| | /* handle leftover */ 136| 13.6k| if (st->leftover) { ------------------ | Branch (136:8): [True: 0, False: 13.6k] ------------------ 137| 0| unsigned long want = (16 - st->leftover); 138| 0| if (want > inlen) want = inlen; ------------------ | Branch (138:11): [True: 0, False: 0] ------------------ 139| 0| for (i = 0; i < want; i++) st->buffer[st->leftover + i] = in[i]; ------------------ | Branch (139:19): [True: 0, False: 0] ------------------ 140| 0| inlen -= want; 141| 0| in += want; 142| 0| st->leftover += want; 143| 0| if (st->leftover < 16) return CRYPT_OK; ------------------ | Branch (143:11): [True: 0, False: 0] ------------------ 144| 0| _poly1305_block(st, st->buffer, 16); 145| 0| st->leftover = 0; 146| 0| } 147| | 148| | /* process full blocks */ 149| 13.6k| if (inlen >= 16) { ------------------ | Branch (149:8): [True: 13.6k, False: 0] ------------------ 150| 13.6k| unsigned long want = (inlen & ~(16 - 1)); 151| 13.6k| _poly1305_block(st, in, want); 152| 13.6k| in += want; 153| 13.6k| inlen -= want; 154| 13.6k| } 155| | 156| | /* store leftover */ 157| 13.6k| if (inlen) { ------------------ | Branch (157:8): [True: 13.6k, False: 0] ------------------ 158| 73.5k| for (i = 0; i < inlen; i++) st->buffer[st->leftover + i] = in[i]; ------------------ | Branch (158:19): [True: 59.8k, False: 13.6k] ------------------ 159| 13.6k| st->leftover += inlen; 160| 13.6k| } 161| 13.6k| return CRYPT_OK; 162| 13.6k|} poly1305_done: 172| 13.6k|{ 173| 13.6k| ulong32 h0,h1,h2,h3,h4,c; 174| 13.6k| ulong32 g0,g1,g2,g3,g4; 175| 13.6k| ulong64 f; 176| 13.6k| ulong32 mask; 177| | 178| 13.6k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 13.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 179| 13.6k| LTC_ARGCHK(mac != NULL); ------------------ | | 32| 13.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 180| 13.6k| LTC_ARGCHK(maclen != NULL); ------------------ | | 32| 13.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 181| 13.6k| LTC_ARGCHK(*maclen >= 16); ------------------ | | 32| 13.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 182| | 183| | /* process the remaining block */ 184| 13.6k| if (st->leftover) { ------------------ | Branch (184:8): [True: 13.6k, False: 0] ------------------ 185| 13.6k| unsigned long i = st->leftover; 186| 13.6k| st->buffer[i++] = 1; 187| 159k| for (; i < 16; i++) st->buffer[i] = 0; ------------------ | Branch (187:14): [True: 145k, False: 13.6k] ------------------ 188| 13.6k| st->final = 1; 189| 13.6k| _poly1305_block(st, st->buffer, 16); 190| 13.6k| } 191| | 192| | /* fully carry h */ 193| 13.6k| h0 = st->h[0]; 194| 13.6k| h1 = st->h[1]; 195| 13.6k| h2 = st->h[2]; 196| 13.6k| h3 = st->h[3]; 197| 13.6k| h4 = st->h[4]; 198| | 199| 13.6k| c = h1 >> 26; h1 = h1 & 0x3ffffff; 200| 13.6k| h2 += c; c = h2 >> 26; h2 = h2 & 0x3ffffff; 201| 13.6k| h3 += c; c = h3 >> 26; h3 = h3 & 0x3ffffff; 202| 13.6k| h4 += c; c = h4 >> 26; h4 = h4 & 0x3ffffff; 203| 13.6k| h0 += c * 5; c = h0 >> 26; h0 = h0 & 0x3ffffff; 204| 13.6k| h1 += c; 205| | 206| | /* compute h + -p */ 207| 13.6k| g0 = h0 + 5; c = g0 >> 26; g0 &= 0x3ffffff; 208| 13.6k| g1 = h1 + c; c = g1 >> 26; g1 &= 0x3ffffff; 209| 13.6k| g2 = h2 + c; c = g2 >> 26; g2 &= 0x3ffffff; 210| 13.6k| g3 = h3 + c; c = g3 >> 26; g3 &= 0x3ffffff; 211| 13.6k| g4 = h4 + c - (1UL << 26); 212| | 213| | /* select h if h < p, or h + -p if h >= p */ 214| 13.6k| mask = (g4 >> 31) - 1; 215| 13.6k| g0 &= mask; 216| 13.6k| g1 &= mask; 217| 13.6k| g2 &= mask; 218| 13.6k| g3 &= mask; 219| 13.6k| g4 &= mask; 220| 13.6k| mask = ~mask; 221| 13.6k| h0 = (h0 & mask) | g0; 222| 13.6k| h1 = (h1 & mask) | g1; 223| 13.6k| h2 = (h2 & mask) | g2; 224| 13.6k| h3 = (h3 & mask) | g3; 225| 13.6k| h4 = (h4 & mask) | g4; 226| | 227| | /* h = h % (2^128) */ 228| 13.6k| h0 = ((h0 ) | (h1 << 26)) & 0xffffffff; 229| 13.6k| h1 = ((h1 >> 6) | (h2 << 20)) & 0xffffffff; 230| 13.6k| h2 = ((h2 >> 12) | (h3 << 14)) & 0xffffffff; 231| 13.6k| h3 = ((h3 >> 18) | (h4 << 8)) & 0xffffffff; 232| | 233| | /* mac = (h + pad) % (2^128) */ 234| 13.6k| f = (ulong64)h0 + st->pad[0] ; h0 = (ulong32)f; 235| 13.6k| f = (ulong64)h1 + st->pad[1] + (f >> 32); h1 = (ulong32)f; 236| 13.6k| f = (ulong64)h2 + st->pad[2] + (f >> 32); h2 = (ulong32)f; 237| 13.6k| f = (ulong64)h3 + st->pad[3] + (f >> 32); h3 = (ulong32)f; 238| | 239| 13.6k| STORE32L(h0, mac + 0); ------------------ | | 164| 13.6k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 13.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 240| 13.6k| STORE32L(h1, mac + 4); ------------------ | | 164| 13.6k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 13.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 241| 13.6k| STORE32L(h2, mac + 8); ------------------ | | 164| 13.6k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 13.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 242| 13.6k| STORE32L(h3, mac + 12); ------------------ | | 164| 13.6k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 13.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 243| | 244| | /* zero out the state */ 245| 13.6k| st->h[0] = 0; 246| 13.6k| st->h[1] = 0; 247| 13.6k| st->h[2] = 0; 248| 13.6k| st->h[3] = 0; 249| 13.6k| st->h[4] = 0; 250| 13.6k| st->r[0] = 0; 251| 13.6k| st->r[1] = 0; 252| 13.6k| st->r[2] = 0; 253| 13.6k| st->r[3] = 0; 254| 13.6k| st->r[4] = 0; 255| 13.6k| st->pad[0] = 0; 256| 13.6k| st->pad[1] = 0; 257| 13.6k| st->pad[2] = 0; 258| 13.6k| st->pad[3] = 0; 259| | 260| 13.6k| *maclen = 16; 261| 13.6k| return CRYPT_OK; 262| 13.6k|} poly1305.c:_poly1305_block: 21| 27.3k|{ 22| 27.3k| const unsigned long hibit = (st->final) ? 0 : (1UL << 24); /* 1 << 128 */ ------------------ | Branch (22:32): [True: 13.6k, False: 13.6k] ------------------ 23| 27.3k| ulong32 r0,r1,r2,r3,r4; 24| 27.3k| ulong32 s1,s2,s3,s4; 25| 27.3k| ulong32 h0,h1,h2,h3,h4; 26| 27.3k| ulong32 tmp; 27| 27.3k| ulong64 d0,d1,d2,d3,d4; 28| 27.3k| ulong32 c; 29| | 30| 27.3k| r0 = st->r[0]; 31| 27.3k| r1 = st->r[1]; 32| 27.3k| r2 = st->r[2]; 33| 27.3k| r3 = st->r[3]; 34| 27.3k| r4 = st->r[4]; 35| | 36| 27.3k| s1 = r1 * 5; 37| 27.3k| s2 = r2 * 5; 38| 27.3k| s3 = r3 * 5; 39| 27.3k| s4 = r4 * 5; 40| | 41| 27.3k| h0 = st->h[0]; 42| 27.3k| h1 = st->h[1]; 43| 27.3k| h2 = st->h[2]; 44| 27.3k| h3 = st->h[3]; 45| 27.3k| h4 = st->h[4]; 46| | 47| 277k| while (inlen >= 16) { ------------------ | Branch (47:11): [True: 249k, False: 27.3k] ------------------ 48| | /* h += in[i] */ 49| 249k| LOAD32L(tmp, in+ 0); h0 += (tmp ) & 0x3ffffff; ------------------ | | 167| 249k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 249k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 50| 249k| LOAD32L(tmp, in+ 3); h1 += (tmp >> 2) & 0x3ffffff; ------------------ | | 167| 249k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 249k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 51| 249k| LOAD32L(tmp, in+ 6); h2 += (tmp >> 4) & 0x3ffffff; ------------------ | | 167| 249k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 249k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 52| 249k| LOAD32L(tmp, in+ 9); h3 += (tmp >> 6) & 0x3ffffff; ------------------ | | 167| 249k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 249k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 53| 249k| LOAD32L(tmp, in+12); h4 += (tmp >> 8) | hibit; ------------------ | | 167| 249k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 249k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 54| | 55| | /* h *= r */ 56| 249k| d0 = ((ulong64)h0 * r0) + ((ulong64)h1 * s4) + ((ulong64)h2 * s3) + ((ulong64)h3 * s2) + ((ulong64)h4 * s1); 57| 249k| d1 = ((ulong64)h0 * r1) + ((ulong64)h1 * r0) + ((ulong64)h2 * s4) + ((ulong64)h3 * s3) + ((ulong64)h4 * s2); 58| 249k| d2 = ((ulong64)h0 * r2) + ((ulong64)h1 * r1) + ((ulong64)h2 * r0) + ((ulong64)h3 * s4) + ((ulong64)h4 * s3); 59| 249k| d3 = ((ulong64)h0 * r3) + ((ulong64)h1 * r2) + ((ulong64)h2 * r1) + ((ulong64)h3 * r0) + ((ulong64)h4 * s4); 60| 249k| d4 = ((ulong64)h0 * r4) + ((ulong64)h1 * r3) + ((ulong64)h2 * r2) + ((ulong64)h3 * r1) + ((ulong64)h4 * r0); 61| | 62| | /* (partial) h %= p */ 63| 249k| c = (ulong32)(d0 >> 26); h0 = (ulong32)d0 & 0x3ffffff; 64| 249k| d1 += c; c = (ulong32)(d1 >> 26); h1 = (ulong32)d1 & 0x3ffffff; 65| 249k| d2 += c; c = (ulong32)(d2 >> 26); h2 = (ulong32)d2 & 0x3ffffff; 66| 249k| d3 += c; c = (ulong32)(d3 >> 26); h3 = (ulong32)d3 & 0x3ffffff; 67| 249k| d4 += c; c = (ulong32)(d4 >> 26); h4 = (ulong32)d4 & 0x3ffffff; 68| 249k| h0 += c * 5; c = (h0 >> 26); h0 = h0 & 0x3ffffff; 69| 249k| h1 += c; 70| | 71| 249k| in += 16; 72| 249k| inlen -= 16; 73| 249k| } 74| | 75| 27.3k| st->h[0] = h0; 76| 27.3k| st->h[1] = h1; 77| 27.3k| st->h[2] = h2; 78| 27.3k| st->h[3] = h3; 79| 27.3k| st->h[4] = h4; 80| 27.3k|} ltm_desc.c:init: 58| 8.38M|{ 59| 8.38M| int err; 60| | 61| 8.38M| LTC_ARGCHK(a != NULL); ------------------ | | 32| 8.38M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 8.38M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 62| | 63| 8.38M| if ((err = init_mpi(a)) != CRYPT_OK) { ------------------ | Branch (63:8): [True: 0, False: 8.38M] ------------------ 64| 0| return err; 65| 0| } 66| 8.38M| if ((err = mpi_to_ltc_error(mp_init(*a))) != CRYPT_OK) { ------------------ | Branch (66:8): [True: 0, False: 8.38M] ------------------ 67| 0| XFREE(*a); ------------------ | | 17| 0|#define XFREE m_free_direct ------------------ 68| 0| } 69| 8.38M| return err; 70| 8.38M|} ltm_desc.c:init_mpi: 46| 8.38M|{ 47| 8.38M| LTC_ARGCHK(a != NULL); ------------------ | | 32| 8.38M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 8.38M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 48| | 49| 8.38M| *a = XCALLOC(1, sizeof(mp_int)); ------------------ | | 19| 8.38M|#define XCALLOC m_calloc ------------------ 50| 8.38M| if (*a == NULL) { ------------------ | Branch (50:8): [True: 0, False: 8.38M] ------------------ 51| 0| return CRYPT_MEM; 52| 8.38M| } else { 53| 8.38M| return CRYPT_OK; 54| 8.38M| } 55| 8.38M|} ltm_desc.c:mpi_to_ltc_error: 34| 112M|{ 35| 112M| size_t x; 36| | 37| 112M| for (x = 0; x < sizeof(mpi_to_ltc_codes)/sizeof(mpi_to_ltc_codes[0]); x++) { ------------------ | Branch (37:16): [True: 112M, False: 0] ------------------ 38| 112M| if (err == mpi_to_ltc_codes[x].mpi_code) { ------------------ | Branch (38:12): [True: 112M, False: 0] ------------------ 39| 112M| return mpi_to_ltc_codes[x].ltc_code; 40| 112M| } 41| 112M| } 42| 0| return CRYPT_ERROR; 43| 112M|} ltm_desc.c:deinit: 73| 8.38M|{ 74| 8.38M| LTC_ARGCHKVD(a != NULL); ------------------ | | 33| 8.38M|#define LTC_ARGCHKVD(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (33:34): [True: 0, False: 8.38M] | | | Branch (33:89): [Folded - Ignored] | | ------------------ ------------------ 75| 8.38M| mp_clear(a); 76| 8.38M| XFREE(a); ------------------ | | 17| 8.38M|#define XFREE m_free_direct ------------------ 77| 8.38M|} ltm_desc.c:copy: 87| 7.62M|{ 88| 7.62M| LTC_ARGCHK(a != NULL); ------------------ | | 32| 7.62M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 7.62M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 89| 7.62M| LTC_ARGCHK(b != NULL); ------------------ | | 32| 7.62M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 7.62M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 90| 7.62M| return mpi_to_ltc_error(mp_copy(a, b)); 91| 7.62M|} ltm_desc.c:set_int: 104| 7.53k|{ 105| 7.53k| LTC_ARGCHK(a != NULL); ------------------ | | 32| 7.53k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 7.53k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 106| 7.53k| mp_set_u32(a, b); 107| 7.53k| return CRYPT_OK; 108| 7.53k|} ltm_desc.c:get_digit: 117| 2.38M|{ 118| 2.38M| mp_int *A; 119| 2.38M| LTC_ARGCHK(a != NULL); ------------------ | | 32| 2.38M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 2.38M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 120| 2.38M| A = a; 121| 2.38M| return (n >= A->used || n < 0) ? 0 : A->dp[n]; ------------------ | Branch (121:12): [True: 0, False: 2.38M] | Branch (121:28): [True: 0, False: 2.38M] ------------------ 122| 2.38M|} ltm_desc.c:get_digit_count: 125| 2.37M|{ 126| 2.37M| mp_int *A; 127| 2.37M| LTC_ARGCHK(a != NULL); ------------------ | | 32| 2.37M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 2.37M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 128| 2.37M| A = a; 129| 2.37M| return A->used; 130| 2.37M|} ltm_desc.c:compare: 133| 11.8M|{ 134| 11.8M| LTC_ARGCHK(a != NULL); ------------------ | | 32| 11.8M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 11.8M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 135| 11.8M| LTC_ARGCHK(b != NULL); ------------------ | | 32| 11.8M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 11.8M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 136| 11.8M| switch (mp_cmp(a, b)) { 137| 6.23M| case MP_LT: return LTC_MP_LT; ------------------ | | 154| 6.23M|#define MP_LT -1 /* less than */ ------------------ case MP_LT: return LTC_MP_LT; ------------------ | | 12| 6.23M|#define LTC_MP_LT -1 ------------------ | Branch (137:7): [True: 6.23M, False: 5.60M] ------------------ 138| 0| case MP_EQ: return LTC_MP_EQ; ------------------ | | 155| 0|#define MP_EQ 0 /* equal to */ ------------------ case MP_EQ: return LTC_MP_EQ; ------------------ | | 13| 0|#define LTC_MP_EQ 0 ------------------ | Branch (138:7): [True: 0, False: 11.8M] ------------------ 139| 5.60M| case MP_GT: return LTC_MP_GT; ------------------ | | 156| 5.60M|#define MP_GT 1 /* greater than */ ------------------ case MP_GT: return LTC_MP_GT; ------------------ | | 14| 5.60M|#define LTC_MP_GT 1 ------------------ | Branch (139:7): [True: 5.60M, False: 6.23M] ------------------ 140| 0| default: return 0; ------------------ | Branch (140:7): [True: 0, False: 11.8M] ------------------ 141| 11.8M| } 142| 11.8M|} ltm_desc.c:compare_d: 145| 13.0M|{ 146| 13.0M| LTC_ARGCHK(a != NULL); ------------------ | | 32| 13.0M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.0M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 147| 13.0M| switch (mp_cmp_d(a, b)) { 148| 6.09M| case MP_LT: return LTC_MP_LT; ------------------ | | 154| 6.09M|#define MP_LT -1 /* less than */ ------------------ case MP_LT: return LTC_MP_LT; ------------------ | | 12| 6.09M|#define LTC_MP_LT -1 ------------------ | Branch (148:7): [True: 6.09M, False: 6.92M] ------------------ 149| 0| case MP_EQ: return LTC_MP_EQ; ------------------ | | 155| 0|#define MP_EQ 0 /* equal to */ ------------------ case MP_EQ: return LTC_MP_EQ; ------------------ | | 13| 0|#define LTC_MP_EQ 0 ------------------ | Branch (149:7): [True: 0, False: 13.0M] ------------------ 150| 6.92M| case MP_GT: return LTC_MP_GT; ------------------ | | 156| 6.92M|#define MP_GT 1 /* greater than */ ------------------ case MP_GT: return LTC_MP_GT; ------------------ | | 14| 6.92M|#define LTC_MP_GT 1 ------------------ | Branch (150:7): [True: 6.92M, False: 6.09M] ------------------ 151| 0| default: return 0; ------------------ | Branch (151:7): [True: 0, False: 13.0M] ------------------ 152| 13.0M| } 153| 13.0M|} ltm_desc.c:read_radix: 178| 18.4k|{ 179| 18.4k| LTC_ARGCHK(a != NULL); ------------------ | | 32| 18.4k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 18.4k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 180| 18.4k| LTC_ARGCHK(b != NULL); ------------------ | | 32| 18.4k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 18.4k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 181| 18.4k| return mpi_to_ltc_error(mp_read_radix(a, b, radix)); 182| 18.4k|} ltm_desc.c:unsigned_size: 194| 13.7k|{ 195| 13.7k| LTC_ARGCHK(a != NULL); ------------------ | | 32| 13.7k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.7k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 196| 13.7k| return (unsigned long)mp_ubin_size(a); 197| 13.7k|} ltm_desc.c:unsigned_write: 201| 13.7k|{ 202| 13.7k| LTC_ARGCHK(a != NULL); ------------------ | | 32| 13.7k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.7k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 203| 13.7k| LTC_ARGCHK(b != NULL); ------------------ | | 32| 13.7k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.7k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 204| 13.7k| return mpi_to_ltc_error(mp_to_ubin(a, b, SIZE_MAX, NULL)); 205| 13.7k|} ltm_desc.c:unsigned_read: 209| 7.19k|{ 210| 7.19k| LTC_ARGCHK(a != NULL); ------------------ | | 32| 7.19k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 7.19k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 211| 7.19k| LTC_ARGCHK(b != NULL); ------------------ | | 32| 7.19k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 7.19k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 212| 7.19k| return mpi_to_ltc_error(mp_from_ubin(a, b, (size_t)len)); 213| 7.19k|} ltm_desc.c:add: 217| 17.9M|{ 218| 17.9M| LTC_ARGCHK(a != NULL); ------------------ | | 32| 17.9M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.9M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 219| 17.9M| LTC_ARGCHK(b != NULL); ------------------ | | 32| 17.9M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.9M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 220| 17.9M| LTC_ARGCHK(c != NULL); ------------------ | | 32| 17.9M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.9M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 221| 17.9M| return mpi_to_ltc_error(mp_add(a, b, c)); 222| 17.9M|} ltm_desc.c:sub: 233| 19.1M|{ 234| 19.1M| LTC_ARGCHK(a != NULL); ------------------ | | 32| 19.1M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 19.1M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 235| 19.1M| LTC_ARGCHK(b != NULL); ------------------ | | 32| 19.1M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 19.1M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 236| 19.1M| LTC_ARGCHK(c != NULL); ------------------ | | 32| 19.1M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 19.1M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 237| 19.1M| return mpi_to_ltc_error(mp_sub(a, b, c)); 238| 19.1M|} ltm_desc.c:mul: 249| 18.9M|{ 250| 18.9M| LTC_ARGCHK(a != NULL); ------------------ | | 32| 18.9M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 18.9M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 251| 18.9M| LTC_ARGCHK(b != NULL); ------------------ | | 32| 18.9M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 18.9M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 252| 18.9M| LTC_ARGCHK(c != NULL); ------------------ | | 32| 18.9M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 18.9M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 253| 18.9M| return mpi_to_ltc_error(mp_mul(a, b, c)); 254| 18.9M|} ltm_desc.c:sqr: 265| 9.47M|{ 266| 9.47M| LTC_ARGCHK(a != NULL); ------------------ | | 32| 9.47M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 9.47M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 267| 9.47M| LTC_ARGCHK(b != NULL); ------------------ | | 32| 9.47M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 9.47M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 268| 9.47M| return mpi_to_ltc_error(mp_sqr(a, b)); 269| 9.47M|} ltm_desc.c:divide: 273| 14.5k|{ 274| 14.5k| LTC_ARGCHK(a != NULL); ------------------ | | 32| 14.5k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 14.5k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 275| 14.5k| LTC_ARGCHK(b != NULL); ------------------ | | 32| 14.5k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 14.5k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 276| 14.5k| return mpi_to_ltc_error(mp_div(a, b, c, d)); 277| 14.5k|} ltm_desc.c:div_2: 280| 2.36M|{ 281| 2.36M| LTC_ARGCHK(a != NULL); ------------------ | | 32| 2.36M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 2.36M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 282| 2.36M| LTC_ARGCHK(b != NULL); ------------------ | | 32| 2.36M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 2.36M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 283| 2.36M| return mpi_to_ltc_error(mp_div_2(a, b)); 284| 2.36M|} ltm_desc.c:mulmod: 339| 18.1k|{ 340| 18.1k| LTC_ARGCHK(a != NULL); ------------------ | | 32| 18.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 18.1k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 341| 18.1k| LTC_ARGCHK(b != NULL); ------------------ | | 32| 18.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 18.1k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 342| 18.1k| LTC_ARGCHK(c != NULL); ------------------ | | 32| 18.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 18.1k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 343| 18.1k| LTC_ARGCHK(d != NULL); ------------------ | | 32| 18.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 18.1k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 344| 18.1k| return mpi_to_ltc_error(mp_mulmod(a,b,c,d)); 345| 18.1k|} ltm_desc.c:invmod: 357| 7.19k|{ 358| 7.19k| LTC_ARGCHK(a != NULL); ------------------ | | 32| 7.19k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 7.19k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 359| 7.19k| LTC_ARGCHK(b != NULL); ------------------ | | 32| 7.19k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 7.19k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 360| 7.19k| LTC_ARGCHK(c != NULL); ------------------ | | 32| 7.19k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 7.19k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 361| 7.19k| return mpi_to_ltc_error(mp_invmod(a, b, c)); 362| 7.19k|} ltm_desc.c:montgomery_setup: 366| 3.76k|{ 367| 3.76k| int err; 368| 3.76k| LTC_ARGCHK(a != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 369| 3.76k| LTC_ARGCHK(b != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 370| 3.76k| *b = XCALLOC(1, sizeof(mp_digit)); ------------------ | | 19| 3.76k|#define XCALLOC m_calloc ------------------ 371| 3.76k| if (*b == NULL) { ------------------ | Branch (371:8): [True: 0, False: 3.76k] ------------------ 372| 0| return CRYPT_MEM; 373| 0| } 374| 3.76k| if ((err = mpi_to_ltc_error(mp_montgomery_setup(a, (mp_digit *)*b))) != CRYPT_OK) { ------------------ | Branch (374:8): [True: 0, False: 3.76k] ------------------ 375| 0| XFREE(*b); ------------------ | | 17| 0|#define XFREE m_free_direct ------------------ 376| 0| } 377| 3.76k| return err; 378| 3.76k|} ltm_desc.c:montgomery_normalization: 382| 3.76k|{ 383| 3.76k| LTC_ARGCHK(a != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 384| 3.76k| LTC_ARGCHK(b != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 385| 3.76k| return mpi_to_ltc_error(mp_montgomery_calc_normalization(a, b)); 386| 3.76k|} ltm_desc.c:montgomery_reduce: 390| 28.3M|{ 391| 28.3M| LTC_ARGCHK(a != NULL); ------------------ | | 32| 28.3M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 28.3M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 392| 28.3M| LTC_ARGCHK(b != NULL); ------------------ | | 32| 28.3M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 28.3M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 393| 28.3M| LTC_ARGCHK(c != NULL); ------------------ | | 32| 28.3M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 28.3M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 394| 28.3M| return mpi_to_ltc_error(mp_montgomery_reduce(a, b, *((mp_digit *)c))); 395| 28.3M|} ltm_desc.c:montgomery_deinit: 399| 3.76k|{ 400| 3.76k| XFREE(a); ------------------ | | 17| 3.76k|#define XFREE m_free_direct ------------------ 401| 3.76k|} ltc_init_multi: 15| 2.39M|{ 16| 2.39M| void **cur = a; 17| 2.39M| int np = 0; 18| 2.39M| va_list args; 19| | 20| 2.39M| va_start(args, a); 21| 10.7M| while (cur != NULL) { ------------------ | Branch (21:11): [True: 8.37M, False: 2.39M] ------------------ 22| 8.37M| if (mp_init(cur) != CRYPT_OK) { ------------------ | | 516| 8.37M|#define mp_init(a) ltc_mp.init(a) ------------------ | Branch (22:12): [True: 0, False: 8.37M] ------------------ 23| | /* failed */ 24| 0| va_list clean_list; 25| | 26| 0| va_start(clean_list, a); 27| 0| cur = a; 28| 0| while (np--) { ------------------ | Branch (28:18): [True: 0, False: 0] ------------------ 29| 0| mp_clear(*cur); ------------------ | | 518| 0|#define mp_clear(a) ltc_mp.deinit(a) ------------------ 30| 0| cur = va_arg(clean_list, void**); 31| 0| } 32| 0| va_end(clean_list); 33| 0| va_end(args); 34| 0| return CRYPT_MEM; 35| 0| } 36| 8.37M| ++np; 37| 8.37M| cur = va_arg(args, void**); 38| 8.37M| } 39| 2.39M| va_end(args); 40| 2.39M| return CRYPT_OK; 41| 2.39M|} ltc_deinit_multi: 44| 2.39M|{ 45| 2.39M| void *cur = a; 46| 2.39M| va_list args; 47| | 48| 2.39M| va_start(args, a); 49| 10.7M| while (cur != NULL) { ------------------ | Branch (49:11): [True: 8.37M, False: 2.39M] ------------------ 50| 8.37M| mp_clear(cur); ------------------ | | 518| 8.37M|#define mp_clear(a) ltc_mp.deinit(a) ------------------ 51| 8.37M| cur = va_arg(args, void *); 52| 8.37M| } 53| 2.39M| va_end(args); 54| 2.39M|} cipher_is_valid: 22| 53.3k|{ 23| 53.3k| LTC_MUTEX_LOCK(<c_cipher_mutex); 24| 53.3k| if (idx < 0 || idx >= TAB_SIZE || cipher_descriptor[idx].name == NULL) { ------------------ | | 14| 106k|#define TAB_SIZE 5 ------------------ | Branch (24:8): [True: 0, False: 53.3k] | Branch (24:19): [True: 0, False: 53.3k] | Branch (24:38): [True: 0, False: 53.3k] ------------------ 25| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 26| 0| return CRYPT_INVALID_CIPHER; 27| 0| } 28| 53.3k| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 29| 53.3k| return CRYPT_OK; 30| 53.3k|} find_cipher: 22| 26.4k|{ 23| 26.4k| int x; 24| 26.4k| LTC_ARGCHK(name != NULL); ------------------ | | 32| 26.4k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 26.4k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 25| 26.4k| LTC_MUTEX_LOCK(<c_cipher_mutex); 26| 26.4k| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 26.4k|#define TAB_SIZE 5 ------------------ | Branch (26:16): [True: 26.4k, False: 0] ------------------ 27| 26.4k| if (cipher_descriptor[x].name != NULL && !XSTRCMP(cipher_descriptor[x].name, name)) { ------------------ | | 54| 26.4k|#define XSTRCMP strcmp ------------------ | Branch (27:12): [True: 26.4k, False: 0] | Branch (27:49): [True: 26.4k, False: 0] ------------------ 28| 26.4k| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 29| 26.4k| return x; 30| 26.4k| } 31| 26.4k| } 32| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 33| 0| return -1; 34| 26.4k|} find_hash: 22| 13.2k|{ 23| 13.2k| int x; 24| 13.2k| LTC_ARGCHK(name != NULL); ------------------ | | 32| 13.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 25| 13.2k| LTC_MUTEX_LOCK(<c_hash_mutex); 26| 25.7k| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 25.7k|#define TAB_SIZE 5 ------------------ | Branch (26:16): [True: 25.7k, False: 0] ------------------ 27| 25.7k| if (hash_descriptor[x].name != NULL && XSTRCMP(hash_descriptor[x].name, name) == 0) { ------------------ | | 54| 25.7k|#define XSTRCMP strcmp ------------------ | Branch (27:12): [True: 25.7k, False: 0] | Branch (27:47): [True: 13.2k, False: 12.5k] ------------------ 28| 13.2k| LTC_MUTEX_UNLOCK(<c_hash_mutex); 29| 13.2k| return x; 30| 13.2k| } 31| 25.7k| } 32| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 33| 0| return -1; 34| 13.2k|} hash_is_valid: 22| 160k|{ 23| 160k| LTC_MUTEX_LOCK(<c_hash_mutex); 24| 160k| if (idx < 0 || idx >= TAB_SIZE || hash_descriptor[idx].name == NULL) { ------------------ | | 14| 321k|#define TAB_SIZE 5 ------------------ | Branch (24:8): [True: 0, False: 160k] | Branch (24:19): [True: 0, False: 160k] | Branch (24:38): [True: 0, False: 160k] ------------------ 25| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 26| 0| return CRYPT_INVALID_HASH; 27| 0| } 28| 160k| LTC_MUTEX_UNLOCK(<c_hash_mutex); 29| 160k| return CRYPT_OK; 30| 160k|} prng_is_valid: 22| 3.76k|{ 23| 3.76k| LTC_MUTEX_LOCK(<c_prng_mutex); 24| 3.76k| if (idx < 0 || idx >= TAB_SIZE || prng_descriptor[idx].name == NULL) { ------------------ | | 14| 7.53k|#define TAB_SIZE 5 ------------------ | Branch (24:8): [True: 0, False: 3.76k] | Branch (24:19): [True: 0, False: 3.76k] | Branch (24:38): [True: 0, False: 3.76k] ------------------ 25| 0| LTC_MUTEX_UNLOCK(<c_prng_mutex); 26| 0| return CRYPT_INVALID_PRNG; 27| 0| } 28| 3.76k| LTC_MUTEX_UNLOCK(<c_prng_mutex); 29| 3.76k| return CRYPT_OK; 30| 3.76k|} register_cipher: 22| 1|{ 23| 1| int x; 24| | 25| 1| LTC_ARGCHK(cipher != NULL); ------------------ | | 32| 1|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 26| | 27| | /* is it already registered? */ 28| 1| LTC_MUTEX_LOCK(<c_cipher_mutex); 29| 6| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 6|#define TAB_SIZE 5 ------------------ | Branch (29:16): [True: 5, False: 1] ------------------ 30| 5| if (cipher_descriptor[x].name != NULL && cipher_descriptor[x].ID == cipher->ID) { ------------------ | Branch (30:12): [True: 0, False: 5] | Branch (30:49): [True: 0, False: 0] ------------------ 31| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 32| 0| return x; 33| 0| } 34| 5| } 35| | 36| | /* find a blank spot */ 37| 1| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 1|#define TAB_SIZE 5 ------------------ | Branch (37:16): [True: 1, False: 0] ------------------ 38| 1| if (cipher_descriptor[x].name == NULL) { ------------------ | Branch (38:12): [True: 1, False: 0] ------------------ 39| 1| XMEMCPY(&cipher_descriptor[x], cipher, sizeof(struct ltc_cipher_descriptor)); ------------------ | | 39| 1|#define XMEMCPY memcpy ------------------ 40| 1| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 41| 1| return x; 42| 1| } 43| 1| } 44| | 45| | /* no spot */ 46| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 47| 0| return -1; 48| 1|} register_hash: 22| 4|{ 23| 4| int x; 24| | 25| 4| LTC_ARGCHK(hash != NULL); ------------------ | | 32| 4|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 4] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 26| | 27| | /* is it already registered? */ 28| 4| LTC_MUTEX_LOCK(<c_hash_mutex); 29| 24| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 24|#define TAB_SIZE 5 ------------------ | Branch (29:16): [True: 20, False: 4] ------------------ 30| 20| if (XMEMCMP(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)) == 0) { ------------------ | | 45| 20|#define XMEMCMP memcmp ------------------ | Branch (30:12): [True: 0, False: 20] ------------------ 31| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 32| 0| return x; 33| 0| } 34| 20| } 35| | 36| | /* find a blank spot */ 37| 10| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 10|#define TAB_SIZE 5 ------------------ | Branch (37:16): [True: 10, False: 0] ------------------ 38| 10| if (hash_descriptor[x].name == NULL) { ------------------ | Branch (38:12): [True: 4, False: 6] ------------------ 39| 4| XMEMCPY(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)); ------------------ | | 39| 4|#define XMEMCPY memcpy ------------------ 40| 4| LTC_MUTEX_UNLOCK(<c_hash_mutex); 41| 4| return x; 42| 4| } 43| 10| } 44| | 45| | /* no spot */ 46| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 47| 0| return -1; 48| 4|} register_prng: 22| 1|{ 23| 1| int x; 24| | 25| 1| LTC_ARGCHK(prng != NULL); ------------------ | | 32| 1|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 26| | 27| | /* is it already registered? */ 28| 1| LTC_MUTEX_LOCK(<c_prng_mutex); 29| 6| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 6|#define TAB_SIZE 5 ------------------ | Branch (29:16): [True: 5, False: 1] ------------------ 30| 5| if (XMEMCMP(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)) == 0) { ------------------ | | 45| 5|#define XMEMCMP memcmp ------------------ | Branch (30:12): [True: 0, False: 5] ------------------ 31| 0| LTC_MUTEX_UNLOCK(<c_prng_mutex); 32| 0| return x; 33| 0| } 34| 5| } 35| | 36| | /* find a blank spot */ 37| 1| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 1|#define TAB_SIZE 5 ------------------ | Branch (37:16): [True: 1, False: 0] ------------------ 38| 1| if (prng_descriptor[x].name == NULL) { ------------------ | Branch (38:12): [True: 1, False: 0] ------------------ 39| 1| XMEMCPY(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)); ------------------ | | 39| 1|#define XMEMCPY memcpy ------------------ 40| 1| LTC_MUTEX_UNLOCK(<c_prng_mutex); 41| 1| return x; 42| 1| } 43| 1| } 44| | 45| | /* no spot */ 46| 0| LTC_MUTEX_UNLOCK(<c_prng_mutex); 47| 0| return -1; 48| 1|} zeromem: 23| 53.8k|{ 24| 53.8k| m_burn((void*)out, outlen); 25| 53.8k|} ctr_encrypt: 87| 40.1k|{ 88| 40.1k| int err, fr; 89| | 90| 40.1k| LTC_ARGCHK(pt != NULL); ------------------ | | 32| 40.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 40.1k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 91| 40.1k| LTC_ARGCHK(ct != NULL); ------------------ | | 32| 40.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 40.1k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 92| 40.1k| LTC_ARGCHK(ctr != NULL); ------------------ | | 32| 40.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 40.1k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 93| | 94| 40.1k| if ((err = cipher_is_valid(ctr->cipher)) != CRYPT_OK) { ------------------ | Branch (94:8): [True: 0, False: 40.1k] ------------------ 95| 0| return err; 96| 0| } 97| | 98| | /* is blocklen/padlen valid? */ 99| 40.1k| if ((ctr->blocklen < 1) || (ctr->blocklen > (int)sizeof(ctr->ctr)) || ------------------ | Branch (99:8): [True: 0, False: 40.1k] | Branch (99:31): [True: 0, False: 40.1k] ------------------ 100| 40.1k| (ctr->padlen < 0) || (ctr->padlen > (int)sizeof(ctr->pad))) { ------------------ | Branch (100:8): [True: 0, False: 40.1k] | Branch (100:31): [True: 0, False: 40.1k] ------------------ 101| 0| return CRYPT_INVALID_ARG; 102| 0| } 103| | 104| 40.1k|#ifdef LTC_FAST 105| 40.1k| if (ctr->blocklen % sizeof(LTC_FAST_TYPE)) { ------------------ | Branch (105:8): [True: 0, False: 40.1k] ------------------ 106| 0| return CRYPT_INVALID_ARG; 107| 0| } 108| 40.1k|#endif 109| | 110| | /* handle acceleration only if pad is empty, accelerator is present and length is >= a block size */ 111| 40.1k| if ((cipher_descriptor[ctr->cipher].accel_ctr_encrypt != NULL) && (len >= (unsigned long)ctr->blocklen)) { ------------------ | Branch (111:8): [True: 0, False: 40.1k] | Branch (111:70): [True: 0, False: 0] ------------------ 112| 0| if (ctr->padlen < ctr->blocklen) { ------------------ | Branch (112:10): [True: 0, False: 0] ------------------ 113| 0| fr = ctr->blocklen - ctr->padlen; 114| 0| if ((err = _ctr_encrypt(pt, ct, fr, ctr)) != CRYPT_OK) { ------------------ | Branch (114:12): [True: 0, False: 0] ------------------ 115| 0| return err; 116| 0| } 117| 0| pt += fr; 118| 0| ct += fr; 119| 0| len -= fr; 120| 0| } 121| | 122| 0| if (len >= (unsigned long)ctr->blocklen) { ------------------ | Branch (122:10): [True: 0, False: 0] ------------------ 123| 0| if ((err = cipher_descriptor[ctr->cipher].accel_ctr_encrypt(pt, ct, len/ctr->blocklen, ctr->ctr, ctr->mode, &ctr->key)) != CRYPT_OK) { ------------------ | Branch (123:12): [True: 0, False: 0] ------------------ 124| 0| return err; 125| 0| } 126| 0| pt += (len / ctr->blocklen) * ctr->blocklen; 127| 0| ct += (len / ctr->blocklen) * ctr->blocklen; 128| 0| len %= ctr->blocklen; 129| 0| } 130| 0| } 131| | 132| 40.1k| return _ctr_encrypt(pt, ct, len, ctr); 133| 40.1k|} ctr_encrypt.c:_ctr_encrypt: 28| 40.1k|{ 29| 40.1k| int x, err; 30| | 31| 895k| while (len) { ------------------ | Branch (31:11): [True: 855k, False: 40.1k] ------------------ 32| | /* is the pad empty? */ 33| 855k| if (ctr->padlen == ctr->blocklen) { ------------------ | Branch (33:11): [True: 843k, False: 12.0k] ------------------ 34| | /* increment counter */ 35| 843k| if (ctr->mode == CTR_COUNTER_LITTLE_ENDIAN) { ------------------ | | 859| 843k|#define CTR_COUNTER_LITTLE_ENDIAN 0x0000 ------------------ | Branch (35:14): [True: 0, False: 843k] ------------------ 36| | /* little-endian */ 37| 0| for (x = 0; x < ctr->ctrlen; x++) { ------------------ | Branch (37:25): [True: 0, False: 0] ------------------ 38| 0| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 39| 0| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (39:20): [True: 0, False: 0] ------------------ 40| 0| break; 41| 0| } 42| 0| } 43| 843k| } else { 44| | /* big-endian */ 45| 846k| for (x = ctr->blocklen-1; x >= ctr->ctrlen; x--) { ------------------ | Branch (45:39): [True: 846k, False: 0] ------------------ 46| 846k| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 47| 846k| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (47:20): [True: 843k, False: 3.21k] ------------------ 48| 843k| break; 49| 843k| } 50| 846k| } 51| 843k| } 52| | 53| | /* encrypt it */ 54| 843k| if ((err = cipher_descriptor[ctr->cipher].ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key)) != CRYPT_OK) { ------------------ | Branch (54:14): [True: 0, False: 843k] ------------------ 55| 0| return err; 56| 0| } 57| 843k| ctr->padlen = 0; 58| 843k| } 59| 855k|#ifdef LTC_FAST 60| 855k| if ((ctr->padlen == 0) && (len >= (unsigned long)ctr->blocklen)) { ------------------ | Branch (60:11): [True: 855k, False: 0] | Branch (60:33): [True: 855k, False: 0] ------------------ 61| 2.56M| for (x = 0; x < ctr->blocklen; x += sizeof(LTC_FAST_TYPE)) { ------------------ | Branch (61:22): [True: 1.71M, False: 855k] ------------------ 62| 1.71M| *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ct + x)) = *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)pt + x)) ^ ------------------ | | 244| 1.71M| #define LTC_FAST_TYPE_PTR_CAST(x) ((LTC_FAST_TYPE*)(void*)(x)) ------------------ *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ct + x)) = *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)pt + x)) ^ ------------------ | | 244| 1.71M| #define LTC_FAST_TYPE_PTR_CAST(x) ((LTC_FAST_TYPE*)(void*)(x)) ------------------ 63| 1.71M| *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ctr->pad + x)); ------------------ | | 244| 1.71M| #define LTC_FAST_TYPE_PTR_CAST(x) ((LTC_FAST_TYPE*)(void*)(x)) ------------------ 64| 1.71M| } 65| 855k| pt += ctr->blocklen; 66| 855k| ct += ctr->blocklen; 67| 855k| len -= ctr->blocklen; 68| 855k| ctr->padlen = ctr->blocklen; 69| 855k| continue; 70| 855k| } 71| 0|#endif 72| 0| *ct++ = *pt++ ^ ctr->pad[ctr->padlen++]; 73| 0| --len; 74| 0| } 75| 40.1k| return CRYPT_OK; 76| 40.1k|} ctr_start: 35| 13.2k|{ 36| 13.2k| int x, err; 37| | 38| 13.2k| LTC_ARGCHK(IV != NULL); ------------------ | | 32| 13.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 39| 13.2k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 13.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 40| 13.2k| LTC_ARGCHK(ctr != NULL); ------------------ | | 32| 13.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 41| | 42| | /* bad param? */ 43| 13.2k| if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { ------------------ | Branch (43:8): [True: 0, False: 13.2k] ------------------ 44| 0| return err; 45| 0| } 46| | 47| | /* ctrlen == counter width */ 48| 13.2k| ctr->ctrlen = (ctr_mode & 255) ? (ctr_mode & 255) : cipher_descriptor[cipher].block_length; ------------------ | Branch (48:20): [True: 0, False: 13.2k] ------------------ 49| 13.2k| if (ctr->ctrlen > cipher_descriptor[cipher].block_length) { ------------------ | Branch (49:8): [True: 0, False: 13.2k] ------------------ 50| 0| return CRYPT_INVALID_ARG; 51| 0| } 52| | 53| 13.2k| if ((ctr_mode & 0x1000) == CTR_COUNTER_BIG_ENDIAN) { ------------------ | | 860| 13.2k|#define CTR_COUNTER_BIG_ENDIAN 0x1000 ------------------ | Branch (53:8): [True: 13.2k, False: 0] ------------------ 54| 13.2k| ctr->ctrlen = cipher_descriptor[cipher].block_length - ctr->ctrlen; 55| 13.2k| } 56| | 57| | /* setup cipher */ 58| 13.2k| if ((err = cipher_descriptor[cipher].setup(key, keylen, num_rounds, &ctr->key)) != CRYPT_OK) { ------------------ | Branch (58:8): [True: 0, False: 13.2k] ------------------ 59| 0| return err; 60| 0| } 61| | 62| | /* copy ctr */ 63| 13.2k| ctr->blocklen = cipher_descriptor[cipher].block_length; 64| 13.2k| ctr->cipher = cipher; 65| 13.2k| ctr->padlen = 0; 66| 13.2k| ctr->mode = ctr_mode & 0x1000; 67| 224k| for (x = 0; x < ctr->blocklen; x++) { ------------------ | Branch (67:16): [True: 211k, False: 13.2k] ------------------ 68| 211k| ctr->ctr[x] = IV[x]; 69| 211k| } 70| | 71| 13.2k| if (ctr_mode & LTC_CTR_RFC3686) { ------------------ | | 861| 13.2k|#define LTC_CTR_RFC3686 0x2000 ------------------ | Branch (71:8): [True: 0, False: 13.2k] ------------------ 72| | /* increment the IV as per RFC 3686 */ 73| 0| if (ctr->mode == CTR_COUNTER_LITTLE_ENDIAN) { ------------------ | | 859| 0|#define CTR_COUNTER_LITTLE_ENDIAN 0x0000 ------------------ | Branch (73:11): [True: 0, False: 0] ------------------ 74| | /* little-endian */ 75| 0| for (x = 0; x < ctr->ctrlen; x++) { ------------------ | Branch (75:22): [True: 0, False: 0] ------------------ 76| 0| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 77| 0| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (77:18): [True: 0, False: 0] ------------------ 78| 0| break; 79| 0| } 80| 0| } 81| 0| } else { 82| | /* big-endian */ 83| 0| for (x = ctr->blocklen-1; x >= ctr->ctrlen; x--) { ------------------ | Branch (83:36): [True: 0, False: 0] ------------------ 84| 0| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 85| 0| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (85:18): [True: 0, False: 0] ------------------ 86| 0| break; 87| 0| } 88| 0| } 89| 0| } 90| 0| } 91| | 92| 13.2k| return cipher_descriptor[ctr->cipher].ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key); 93| 13.2k|} ecc_ansi_x963_export: 31| 6.87k|{ 32| 6.87k| unsigned char buf[ECC_BUF_SIZE]; 33| 6.87k| unsigned long numlen, xlen, ylen; 34| | 35| 6.87k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 6.87k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 6.87k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 36| 6.87k| LTC_ARGCHK(outlen != NULL); ------------------ | | 32| 6.87k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 6.87k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 37| | 38| 6.87k| if (ltc_ecc_is_valid_idx(key->idx) == 0) { ------------------ | Branch (38:8): [True: 0, False: 6.87k] ------------------ 39| 0| return CRYPT_INVALID_ARG; 40| 0| } 41| 6.87k| numlen = key->dp->size; 42| 6.87k| xlen = mp_unsigned_bin_size(key->pubkey.x); ------------------ | | 539| 6.87k|#define mp_unsigned_bin_size(a) ltc_mp.unsigned_size(a) ------------------ 43| 6.87k| ylen = mp_unsigned_bin_size(key->pubkey.y); ------------------ | | 539| 6.87k|#define mp_unsigned_bin_size(a) ltc_mp.unsigned_size(a) ------------------ 44| | 45| 6.87k| if (xlen > numlen || ylen > numlen || sizeof(buf) < numlen) { ------------------ | Branch (45:8): [True: 0, False: 6.87k] | Branch (45:25): [True: 0, False: 6.87k] | Branch (45:42): [True: 0, False: 6.87k] ------------------ 46| 0| return CRYPT_BUFFER_OVERFLOW; 47| 0| } 48| | 49| 6.87k| if (*outlen < (1 + 2*numlen)) { ------------------ | Branch (49:8): [True: 0, False: 6.87k] ------------------ 50| 0| *outlen = 1 + 2*numlen; 51| 0| return CRYPT_BUFFER_OVERFLOW; 52| 0| } 53| | 54| 6.87k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 6.87k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 6.87k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 55| | 56| | /* store byte 0x04 */ 57| 6.87k| out[0] = 0x04; 58| | 59| | /* pad and store x */ 60| 6.87k| zeromem(buf, sizeof(buf)); 61| 6.87k| mp_to_unsigned_bin(key->pubkey.x, buf + (numlen - xlen)); ------------------ | | 540| 6.87k|#define mp_to_unsigned_bin(a, b) ltc_mp.unsigned_write(a, b) ------------------ 62| 6.87k| XMEMCPY(out+1, buf, numlen); ------------------ | | 39| 6.87k|#define XMEMCPY memcpy ------------------ 63| | 64| | /* pad and store y */ 65| 6.87k| zeromem(buf, sizeof(buf)); 66| 6.87k| mp_to_unsigned_bin(key->pubkey.y, buf + (numlen - ylen)); ------------------ | | 540| 6.87k|#define mp_to_unsigned_bin(a, b) ltc_mp.unsigned_write(a, b) ------------------ 67| 6.87k| XMEMCPY(out+1+numlen, buf, numlen); ------------------ | | 39| 6.87k|#define XMEMCPY memcpy ------------------ 68| | 69| 6.87k| *outlen = 1 + 2*numlen; 70| 6.87k| return CRYPT_OK; 71| 6.87k|} ecc_free: 29| 3.43k|{ 30| 3.43k| LTC_ARGCHKVD(key != NULL); ------------------ | | 33| 3.43k|#define LTC_ARGCHKVD(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (33:34): [True: 0, False: 3.43k] | | | Branch (33:89): [Folded - Ignored] | | ------------------ ------------------ 31| 3.43k| mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); ------------------ | | 519| 3.43k|#define mp_clear_multi ltc_deinit_multi ------------------ 32| 3.43k|} ecc_make_key_ex: 49| 3.76k|{ 50| 3.76k| int err; 51| 3.76k| ecc_point *base; 52| 3.76k| void *prime, *order; 53| 3.76k| unsigned char *buf; 54| 3.76k| int keysize; 55| | 56| 3.76k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 57| 3.76k| LTC_ARGCHK(ltc_mp.name != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 58| 3.76k| LTC_ARGCHK(dp != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 59| | 60| | /* good prng? */ 61| 3.76k| if ((err = prng_is_valid(wprng)) != CRYPT_OK) { ------------------ | Branch (61:8): [True: 0, False: 3.76k] ------------------ 62| 0| return err; 63| 0| } 64| | 65| 3.76k| key->idx = -1; 66| 3.76k| key->dp = dp; 67| 3.76k| keysize = dp->size; 68| | 69| | /* allocate ram */ 70| 3.76k| base = NULL; 71| 3.76k| buf = XMALLOC(ECC_MAXSIZE); ------------------ | | 16| 3.76k|#define XMALLOC m_malloc ------------------ buf = XMALLOC(ECC_MAXSIZE); ------------------ | | 249| 3.76k|#define ECC_MAXSIZE 66 ------------------ 72| 3.76k| if (buf == NULL) { ------------------ | Branch (72:8): [True: 0, False: 3.76k] ------------------ 73| 0| return CRYPT_MEM; 74| 0| } 75| | 76| | /* make up random string */ 77| 3.76k| if (prng_descriptor[wprng].read(buf, (unsigned long)keysize, prng) != (unsigned long)keysize) { ------------------ | Branch (77:8): [True: 0, False: 3.76k] ------------------ 78| 0| err = CRYPT_ERROR_READPRNG; 79| 0| goto ERR_BUF; 80| 0| } 81| | 82| | /* setup the key variables */ 83| 3.76k| if ((err = mp_init_multi(&key->pubkey.x, &key->pubkey.y, &key->pubkey.z, &key->k, &prime, &order, NULL)) != CRYPT_OK) { ------------------ | | 517| 3.76k|#define mp_init_multi ltc_init_multi ------------------ | Branch (83:8): [True: 0, False: 3.76k] ------------------ 84| 0| goto ERR_BUF; 85| 0| } 86| 3.76k| base = ltc_ecc_new_point(); 87| 3.76k| if (base == NULL) { ------------------ | Branch (87:8): [True: 0, False: 3.76k] ------------------ 88| 0| err = CRYPT_MEM; 89| 0| goto errkey; 90| 0| } 91| | 92| | /* read in the specs for this key */ 93| 3.76k| if ((err = mp_read_radix(prime, (char *)key->dp->prime, 16)) != CRYPT_OK) { goto errkey; } ------------------ | | 537| 3.76k|#define mp_read_radix(a, b, c) ltc_mp.read_radix(a, b, c) ------------------ | Branch (93:8): [True: 0, False: 3.76k] ------------------ 94| 3.76k| if ((err = mp_read_radix(order, (char *)key->dp->order, 16)) != CRYPT_OK) { goto errkey; } ------------------ | | 537| 3.76k|#define mp_read_radix(a, b, c) ltc_mp.read_radix(a, b, c) ------------------ | Branch (94:8): [True: 0, False: 3.76k] ------------------ 95| 3.76k| if ((err = mp_read_radix(base->x, (char *)key->dp->Gx, 16)) != CRYPT_OK) { goto errkey; } ------------------ | | 537| 3.76k|#define mp_read_radix(a, b, c) ltc_mp.read_radix(a, b, c) ------------------ | Branch (95:8): [True: 0, False: 3.76k] ------------------ 96| 3.76k| if ((err = mp_read_radix(base->y, (char *)key->dp->Gy, 16)) != CRYPT_OK) { goto errkey; } ------------------ | | 537| 3.76k|#define mp_read_radix(a, b, c) ltc_mp.read_radix(a, b, c) ------------------ | Branch (96:8): [True: 0, False: 3.76k] ------------------ 97| 3.76k| if ((err = mp_set(base->z, 1)) != CRYPT_OK) { goto errkey; } ------------------ | | 526| 3.76k|#define mp_set(a, b) ltc_mp.set_int(a, b) ------------------ | Branch (97:8): [True: 0, False: 3.76k] ------------------ 98| 3.76k| if ((err = mp_read_unsigned_bin(key->k, (unsigned char *)buf, keysize)) != CRYPT_OK) { goto errkey; } ------------------ | | 541| 3.76k|#define mp_read_unsigned_bin(a, b, c) ltc_mp.unsigned_read(a, b, c) ------------------ | Branch (98:8): [True: 0, False: 3.76k] ------------------ 99| | 100| | /* the key should be smaller than the order of base point */ 101| 3.76k| if (mp_cmp(key->k, order) != LTC_MP_LT) { ------------------ | | 531| 3.76k|#define mp_cmp(a, b) ltc_mp.compare(a, b) ------------------ if (mp_cmp(key->k, order) != LTC_MP_LT) { ------------------ | | 12| 3.76k|#define LTC_MP_LT -1 ------------------ | Branch (101:8): [True: 180, False: 3.58k] ------------------ 102| 180| if((err = mp_mod(key->k, order, key->k)) != CRYPT_OK) { goto errkey; } ------------------ | | 552| 180|#define mp_mod(a, b, c) ltc_mp.mpdiv(a, b, NULL, c) ------------------ | Branch (102:11): [True: 0, False: 180] ------------------ 103| 180| } 104| | /* make the public key */ 105| 3.76k| if ((err = ltc_mp.ecc_ptmul(key->k, base, &key->pubkey, prime, 1)) != CRYPT_OK) { goto errkey; } ------------------ | Branch (105:8): [True: 0, False: 3.76k] ------------------ 106| 3.76k| key->type = PK_PRIVATE; 107| | 108| | /* free up ram */ 109| 3.76k| err = CRYPT_OK; 110| 3.76k| goto cleanup; 111| 0|errkey: 112| 0| mp_clear_multi(key->pubkey.x, key->pubkey.y, key->pubkey.z, key->k, NULL); ------------------ | | 519| 0|#define mp_clear_multi ltc_deinit_multi ------------------ 113| 3.76k|cleanup: 114| 3.76k| ltc_ecc_del_point(base); 115| 3.76k| mp_clear_multi(prime, order, NULL); ------------------ | | 519| 3.76k|#define mp_clear_multi ltc_deinit_multi ------------------ 116| 3.76k|ERR_BUF: 117| |#ifdef LTC_CLEAN_STACK 118| | zeromem(buf, ECC_MAXSIZE); 119| |#endif 120| 3.76k| XFREE(buf); ------------------ | | 17| 3.76k|#define XFREE m_free_direct ------------------ 121| 3.76k| return err; 122| 3.76k|} ltc_ecc_is_valid_idx: 29| 6.87k|{ 30| 6.87k| int x; 31| | 32| 61.8k| for (x = 0; ltc_ecc_sets[x].size != 0; x++); ------------------ | Branch (32:16): [True: 54.9k, False: 6.87k] ------------------ 33| | /* -1 is a valid index --- indicating that the domain params were supplied by the user */ 34| 6.87k| if ((n >= -1) && (n < x)) { ------------------ | Branch (34:8): [True: 6.87k, False: 0] | Branch (34:21): [True: 6.87k, False: 0] ------------------ 35| 6.87k| return 1; 36| 6.87k| } 37| 0| return 0; 38| 6.87k|} ltc_ecc_map: 32| 3.76k|{ 33| 3.76k| void *t1, *t2; 34| 3.76k| int err; 35| | 36| 3.76k| LTC_ARGCHK(P != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 37| 3.76k| LTC_ARGCHK(modulus != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 38| 3.76k| LTC_ARGCHK(mp != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 39| | 40| 3.76k| if ((err = mp_init_multi(&t1, &t2, NULL)) != CRYPT_OK) { ------------------ | | 517| 3.76k|#define mp_init_multi ltc_init_multi ------------------ | Branch (40:8): [True: 0, False: 3.76k] ------------------ 41| 0| return err; 42| 0| } 43| | 44| | /* first map z back to normal */ 45| 3.76k| if ((err = mp_montgomery_reduce(P->z, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 3.76k|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (45:8): [True: 0, False: 3.76k] ------------------ 46| | 47| | /* get 1/z */ 48| 3.76k| if ((err = mp_invmod(P->z, modulus, t1)) != CRYPT_OK) { goto done; } ------------------ | | 561| 3.76k|#define mp_invmod(a, b, c) ltc_mp.invmod(a, b, c) ------------------ | Branch (48:8): [True: 0, False: 3.76k] ------------------ 49| | 50| | /* get 1/z^2 and 1/z^3 */ 51| 3.76k| if ((err = mp_sqr(t1, t2)) != CRYPT_OK) { goto done; } ------------------ | | 549| 3.76k|#define mp_sqr(a, b) ltc_mp.sqr(a, b) ------------------ | Branch (51:8): [True: 0, False: 3.76k] ------------------ 52| 3.76k| if ((err = mp_mod(t2, modulus, t2)) != CRYPT_OK) { goto done; } ------------------ | | 552| 3.76k|#define mp_mod(a, b, c) ltc_mp.mpdiv(a, b, NULL, c) ------------------ | Branch (52:8): [True: 0, False: 3.76k] ------------------ 53| 3.76k| if ((err = mp_mul(t1, t2, t1)) != CRYPT_OK) { goto done; } ------------------ | | 547| 3.76k|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (53:8): [True: 0, False: 3.76k] ------------------ 54| 3.76k| if ((err = mp_mod(t1, modulus, t1)) != CRYPT_OK) { goto done; } ------------------ | | 552| 3.76k|#define mp_mod(a, b, c) ltc_mp.mpdiv(a, b, NULL, c) ------------------ | Branch (54:8): [True: 0, False: 3.76k] ------------------ 55| | 56| | /* multiply against x/y */ 57| 3.76k| if ((err = mp_mul(P->x, t2, P->x)) != CRYPT_OK) { goto done; } ------------------ | | 547| 3.76k|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (57:8): [True: 0, False: 3.76k] ------------------ 58| 3.76k| if ((err = mp_montgomery_reduce(P->x, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 3.76k|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (58:8): [True: 0, False: 3.76k] ------------------ 59| 3.76k| if ((err = mp_mul(P->y, t1, P->y)) != CRYPT_OK) { goto done; } ------------------ | | 547| 3.76k|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (59:8): [True: 0, False: 3.76k] ------------------ 60| 3.76k| if ((err = mp_montgomery_reduce(P->y, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 3.76k|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (60:8): [True: 0, False: 3.76k] ------------------ 61| 3.76k| if ((err = mp_set(P->z, 1)) != CRYPT_OK) { goto done; } ------------------ | | 526| 3.76k|#define mp_set(a, b) ltc_mp.set_int(a, b) ------------------ | Branch (61:8): [True: 0, False: 3.76k] ------------------ 62| | 63| 3.76k| err = CRYPT_OK; 64| 3.76k|done: 65| 3.76k| mp_clear_multi(t1, t2, NULL); ------------------ | | 519| 3.76k|#define mp_clear_multi ltc_deinit_multi ------------------ 66| 3.76k| return err; 67| 3.76k|} ltc_ecc_mulmod: 36| 3.76k|{ 37| 3.76k| ecc_point *tG, *M[3]; 38| 3.76k| int i, j, err; 39| 3.76k| void *mu, *mp; 40| 3.76k| ltc_mp_digit buf; 41| 3.76k| int bitcnt, mode, digidx; 42| | 43| 3.76k| LTC_ARGCHK(k != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 44| 3.76k| LTC_ARGCHK(G != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 45| 3.76k| LTC_ARGCHK(R != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 46| 3.76k| LTC_ARGCHK(modulus != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 47| | 48| | /* init montgomery reduction */ 49| 3.76k| if ((err = mp_montgomery_setup(modulus, &mp)) != CRYPT_OK) { ------------------ | | 563| 3.76k|#define mp_montgomery_setup(a, b) ltc_mp.montgomery_setup(a, b) ------------------ | Branch (49:8): [True: 0, False: 3.76k] ------------------ 50| 0| return err; 51| 0| } 52| 3.76k| if ((err = mp_init(&mu)) != CRYPT_OK) { ------------------ | | 516| 3.76k|#define mp_init(a) ltc_mp.init(a) ------------------ | Branch (52:8): [True: 0, False: 3.76k] ------------------ 53| 0| mp_montgomery_free(mp); ------------------ | | 566| 0|#define mp_montgomery_free(a) ltc_mp.montgomery_deinit(a) ------------------ 54| 0| return err; 55| 0| } 56| 3.76k| if ((err = mp_montgomery_normalization(mu, modulus)) != CRYPT_OK) { ------------------ | | 564| 3.76k|#define mp_montgomery_normalization(a, b) ltc_mp.montgomery_normalization(a, b) ------------------ | Branch (56:8): [True: 0, False: 3.76k] ------------------ 57| 0| mp_clear(mu); ------------------ | | 518| 0|#define mp_clear(a) ltc_mp.deinit(a) ------------------ 58| 0| mp_montgomery_free(mp); ------------------ | | 566| 0|#define mp_montgomery_free(a) ltc_mp.montgomery_deinit(a) ------------------ 59| 0| return err; 60| 0| } 61| | 62| | /* alloc ram for window temps */ 63| 15.0k| for (i = 0; i < 3; i++) { ------------------ | Branch (63:16): [True: 11.2k, False: 3.76k] ------------------ 64| 11.2k| M[i] = ltc_ecc_new_point(); 65| 11.2k| if (M[i] == NULL) { ------------------ | Branch (65:11): [True: 0, False: 11.2k] ------------------ 66| 0| for (j = 0; j < i; j++) { ------------------ | Branch (66:22): [True: 0, False: 0] ------------------ 67| 0| ltc_ecc_del_point(M[j]); 68| 0| } 69| 0| mp_clear(mu); ------------------ | | 518| 0|#define mp_clear(a) ltc_mp.deinit(a) ------------------ 70| 0| mp_montgomery_free(mp); ------------------ | | 566| 0|#define mp_montgomery_free(a) ltc_mp.montgomery_deinit(a) ------------------ 71| 0| return CRYPT_MEM; 72| 0| } 73| 11.2k| } 74| | 75| | /* make a copy of G incase R==G */ 76| 3.76k| tG = ltc_ecc_new_point(); 77| 3.76k| if (tG == NULL) { err = CRYPT_MEM; goto done; } ------------------ | Branch (77:8): [True: 0, False: 3.76k] ------------------ 78| | 79| | /* tG = G and convert to montgomery */ 80| 3.76k| if ((err = mp_mulmod(G->x, mu, modulus, tG->x)) != CRYPT_OK) { goto done; } ------------------ | | 559| 3.76k|#define mp_mulmod(a, b, c, d) ltc_mp.mulmod(a, b, c, d) ------------------ | Branch (80:8): [True: 0, False: 3.76k] ------------------ 81| 3.76k| if ((err = mp_mulmod(G->y, mu, modulus, tG->y)) != CRYPT_OK) { goto done; } ------------------ | | 559| 3.76k|#define mp_mulmod(a, b, c, d) ltc_mp.mulmod(a, b, c, d) ------------------ | Branch (81:8): [True: 0, False: 3.76k] ------------------ 82| 3.76k| if ((err = mp_mulmod(G->z, mu, modulus, tG->z)) != CRYPT_OK) { goto done; } ------------------ | | 559| 3.76k|#define mp_mulmod(a, b, c, d) ltc_mp.mulmod(a, b, c, d) ------------------ | Branch (82:8): [True: 0, False: 3.76k] ------------------ 83| 3.76k| mp_clear(mu); ------------------ | | 518| 3.76k|#define mp_clear(a) ltc_mp.deinit(a) ------------------ 84| 3.76k| mu = NULL; 85| | 86| | /* calc the M tab */ 87| | /* M[0] == G */ 88| 3.76k| if ((err = mp_copy(tG->x, M[0]->x)) != CRYPT_OK) { goto done; } ------------------ | | 524| 3.76k|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (88:8): [True: 0, False: 3.76k] ------------------ 89| 3.76k| if ((err = mp_copy(tG->y, M[0]->y)) != CRYPT_OK) { goto done; } ------------------ | | 524| 3.76k|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (89:8): [True: 0, False: 3.76k] ------------------ 90| 3.76k| if ((err = mp_copy(tG->z, M[0]->z)) != CRYPT_OK) { goto done; } ------------------ | | 524| 3.76k|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (90:8): [True: 0, False: 3.76k] ------------------ 91| | /* M[1] == 2G */ 92| 3.76k| if ((err = ltc_mp.ecc_ptdbl(tG, M[1], modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | Branch (92:8): [True: 0, False: 3.76k] ------------------ 93| | 94| | /* setup sliding window */ 95| 3.76k| mode = 0; 96| 3.76k| bitcnt = 1; 97| 3.76k| buf = 0; 98| 3.76k| digidx = mp_get_digit_count(k) - 1; ------------------ | | 530| 3.76k|#define mp_get_digit_count(a) ltc_mp.get_digit_count(a) ------------------ 99| | 100| | /* perform ops */ 101| 1.18M| for (;;) { 102| | /* grab next digit as required */ 103| 1.18M| if (--bitcnt == 0) { ------------------ | Branch (103:11): [True: 23.4k, False: 1.16M] ------------------ 104| 23.4k| if (digidx == -1) { ------------------ | Branch (104:14): [True: 3.76k, False: 19.6k] ------------------ 105| 3.76k| break; 106| 3.76k| } 107| 19.6k| buf = mp_get_digit(k, digidx); ------------------ | | 529| 19.6k|#define mp_get_digit(a, n) ltc_mp.get_digit(a, n) ------------------ 108| 19.6k| bitcnt = (int) MP_DIGIT_BIT; ------------------ | | 513| 19.6k|#define MP_DIGIT_BIT ltc_mp.bits_per_digit ------------------ 109| 19.6k| --digidx; 110| 19.6k| } 111| | 112| | /* grab the next msb from the ltiplicand */ 113| 1.18M| i = (buf >> (MP_DIGIT_BIT - 1)) & 1; ------------------ | | 513| 1.18M|#define MP_DIGIT_BIT ltc_mp.bits_per_digit ------------------ 114| 1.18M| buf <<= 1; 115| | 116| 1.18M| if (mode == 0 && i == 0) { ------------------ | Branch (116:11): [True: 167k, False: 1.01M] | Branch (116:24): [True: 163k, False: 3.76k] ------------------ 117| | /* dummy operations */ 118| 163k| if ((err = ltc_mp.ecc_ptadd(M[0], M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | Branch (118:14): [True: 0, False: 163k] ------------------ 119| 163k| if ((err = ltc_mp.ecc_ptdbl(M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | Branch (119:14): [True: 0, False: 163k] ------------------ 120| 163k| continue; 121| 163k| } 122| | 123| 1.01M| if (mode == 0 && i == 1) { ------------------ | Branch (123:11): [True: 3.76k, False: 1.01M] | Branch (123:24): [True: 3.76k, False: 0] ------------------ 124| 3.76k| mode = 1; 125| | /* dummy operations */ 126| 3.76k| if ((err = ltc_mp.ecc_ptadd(M[0], M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | Branch (126:14): [True: 0, False: 3.76k] ------------------ 127| 3.76k| if ((err = ltc_mp.ecc_ptdbl(M[1], M[2], modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | Branch (127:14): [True: 0, False: 3.76k] ------------------ 128| 3.76k| continue; 129| 3.76k| } 130| | 131| 1.01M| if ((err = ltc_mp.ecc_ptadd(M[0], M[1], M[i^1], modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | Branch (131:11): [True: 0, False: 1.01M] ------------------ 132| 1.01M| if ((err = ltc_mp.ecc_ptdbl(M[i], M[i], modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | Branch (132:11): [True: 0, False: 1.01M] ------------------ 133| 1.01M| } 134| | 135| | /* copy result out */ 136| 3.76k| if ((err = mp_copy(M[0]->x, R->x)) != CRYPT_OK) { goto done; } ------------------ | | 524| 3.76k|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (136:8): [True: 0, False: 3.76k] ------------------ 137| 3.76k| if ((err = mp_copy(M[0]->y, R->y)) != CRYPT_OK) { goto done; } ------------------ | | 524| 3.76k|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (137:8): [True: 0, False: 3.76k] ------------------ 138| 3.76k| if ((err = mp_copy(M[0]->z, R->z)) != CRYPT_OK) { goto done; } ------------------ | | 524| 3.76k|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (138:8): [True: 0, False: 3.76k] ------------------ 139| | 140| | /* map R back from projective space */ 141| 3.76k| if (map) { ------------------ | Branch (141:8): [True: 3.76k, False: 0] ------------------ 142| 3.76k| err = ltc_ecc_map(R, modulus, mp); 143| 3.76k| } else { 144| 0| err = CRYPT_OK; 145| 0| } 146| 3.76k|done: 147| 3.76k| if (mu != NULL) { ------------------ | Branch (147:8): [True: 0, False: 3.76k] ------------------ 148| 0| mp_clear(mu); ------------------ | | 518| 0|#define mp_clear(a) ltc_mp.deinit(a) ------------------ 149| 0| } 150| 3.76k| mp_montgomery_free(mp); ------------------ | | 566| 3.76k|#define mp_montgomery_free(a) ltc_mp.montgomery_deinit(a) ------------------ 151| 3.76k| ltc_ecc_del_point(tG); 152| 15.0k| for (i = 0; i < 3; i++) { ------------------ | Branch (152:16): [True: 11.2k, False: 3.76k] ------------------ 153| 11.2k| ltc_ecc_del_point(M[i]); 154| 11.2k| } 155| 3.76k| return err; 156| 3.76k|} ltc_ecc_new_point: 29| 18.8k|{ 30| 18.8k| ecc_point *p; 31| 18.8k| p = XCALLOC(1, sizeof(*p)); ------------------ | | 19| 18.8k|#define XCALLOC m_calloc ------------------ 32| 18.8k| if (p == NULL) { ------------------ | Branch (32:8): [True: 0, False: 18.8k] ------------------ 33| 0| return NULL; 34| 0| } 35| 18.8k| if (mp_init_multi(&p->x, &p->y, &p->z, NULL) != CRYPT_OK) { ------------------ | | 517| 18.8k|#define mp_init_multi ltc_init_multi ------------------ | Branch (35:8): [True: 0, False: 18.8k] ------------------ 36| 0| XFREE(p); ------------------ | | 17| 0|#define XFREE m_free_direct ------------------ 37| 0| return NULL; 38| 0| } 39| 18.8k| return p; 40| 18.8k|} ltc_ecc_del_point: 46| 18.8k|{ 47| | /* prevents free'ing null arguments */ 48| 18.8k| if (p != NULL) { ------------------ | Branch (48:8): [True: 18.8k, False: 0] ------------------ 49| 18.8k| mp_clear_multi(p->x, p->y, p->z, NULL); /* note: p->z may be NULL but that's ok with this function anyways */ ------------------ | | 519| 18.8k|#define mp_clear_multi ltc_deinit_multi ------------------ 50| 18.8k| XFREE(p); ------------------ | | 17| 18.8k|#define XFREE m_free_direct ------------------ 51| 18.8k| } 52| 18.8k|} ltc_ecc_projective_add_point: 34| 1.18M|{ 35| 1.18M| void *t1, *t2, *x, *y, *z; 36| 1.18M| int err; 37| | 38| 1.18M| LTC_ARGCHK(P != NULL); ------------------ | | 32| 1.18M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.18M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 39| 1.18M| LTC_ARGCHK(Q != NULL); ------------------ | | 32| 1.18M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.18M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 40| 1.18M| LTC_ARGCHK(R != NULL); ------------------ | | 32| 1.18M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.18M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 41| 1.18M| LTC_ARGCHK(modulus != NULL); ------------------ | | 32| 1.18M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.18M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 42| 1.18M| LTC_ARGCHK(mp != NULL); ------------------ | | 32| 1.18M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.18M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 43| | 44| 1.18M| if ((err = mp_init_multi(&t1, &t2, &x, &y, &z, NULL)) != CRYPT_OK) { ------------------ | | 517| 1.18M|#define mp_init_multi ltc_init_multi ------------------ | Branch (44:8): [True: 0, False: 1.18M] ------------------ 45| 0| return err; 46| 0| } 47| | 48| | /* should we dbl instead? */ 49| 1.18M| if ((err = mp_sub(modulus, Q->y, t1)) != CRYPT_OK) { goto done; } ------------------ | | 545| 1.18M|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (49:8): [True: 0, False: 1.18M] ------------------ 50| | 51| 1.18M| if ( (mp_cmp(P->x, Q->x) == LTC_MP_EQ) && ------------------ | | 531| 1.18M|#define mp_cmp(a, b) ltc_mp.compare(a, b) ------------------ if ( (mp_cmp(P->x, Q->x) == LTC_MP_EQ) && ------------------ | | 13| 1.18M|#define LTC_MP_EQ 0 ------------------ | Branch (51:9): [True: 0, False: 1.18M] ------------------ 52| 1.18M| (Q->z != NULL && mp_cmp(P->z, Q->z) == LTC_MP_EQ) && ------------------ | | 531| 0|#define mp_cmp(a, b) ltc_mp.compare(a, b) ------------------ (Q->z != NULL && mp_cmp(P->z, Q->z) == LTC_MP_EQ) && ------------------ | | 13| 0|#define LTC_MP_EQ 0 ------------------ | Branch (52:10): [True: 0, False: 0] | Branch (52:26): [True: 0, False: 0] ------------------ 53| 1.18M| (mp_cmp(P->y, Q->y) == LTC_MP_EQ || mp_cmp(P->y, t1) == LTC_MP_EQ)) { ------------------ | | 531| 0|#define mp_cmp(a, b) ltc_mp.compare(a, b) ------------------ (mp_cmp(P->y, Q->y) == LTC_MP_EQ || mp_cmp(P->y, t1) == LTC_MP_EQ)) { ------------------ | | 13| 0|#define LTC_MP_EQ 0 ------------------ (mp_cmp(P->y, Q->y) == LTC_MP_EQ || mp_cmp(P->y, t1) == LTC_MP_EQ)) { ------------------ | | 531| 0|#define mp_cmp(a, b) ltc_mp.compare(a, b) ------------------ (mp_cmp(P->y, Q->y) == LTC_MP_EQ || mp_cmp(P->y, t1) == LTC_MP_EQ)) { ------------------ | | 13| 0|#define LTC_MP_EQ 0 ------------------ | Branch (53:10): [True: 0, False: 0] | Branch (53:45): [True: 0, False: 0] ------------------ 54| 0| mp_clear_multi(t1, t2, x, y, z, NULL); ------------------ | | 519| 0|#define mp_clear_multi ltc_deinit_multi ------------------ 55| 0| return ltc_ecc_projective_dbl_point(P, R, modulus, mp); 56| 0| } 57| | 58| 1.18M| if ((err = mp_copy(P->x, x)) != CRYPT_OK) { goto done; } ------------------ | | 524| 1.18M|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (58:8): [True: 0, False: 1.18M] ------------------ 59| 1.18M| if ((err = mp_copy(P->y, y)) != CRYPT_OK) { goto done; } ------------------ | | 524| 1.18M|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (59:8): [True: 0, False: 1.18M] ------------------ 60| 1.18M| if ((err = mp_copy(P->z, z)) != CRYPT_OK) { goto done; } ------------------ | | 524| 1.18M|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (60:8): [True: 0, False: 1.18M] ------------------ 61| | 62| | /* if Z is one then these are no-operations */ 63| 1.18M| if (Q->z != NULL) { ------------------ | Branch (63:8): [True: 1.18M, False: 0] ------------------ 64| | /* T1 = Z' * Z' */ 65| 1.18M| if ((err = mp_sqr(Q->z, t1)) != CRYPT_OK) { goto done; } ------------------ | | 549| 1.18M|#define mp_sqr(a, b) ltc_mp.sqr(a, b) ------------------ | Branch (65:11): [True: 0, False: 1.18M] ------------------ 66| 1.18M| if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (66:11): [True: 0, False: 1.18M] ------------------ 67| | /* X = X * T1 */ 68| 1.18M| if ((err = mp_mul(t1, x, x)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (68:11): [True: 0, False: 1.18M] ------------------ 69| 1.18M| if ((err = mp_montgomery_reduce(x, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (69:11): [True: 0, False: 1.18M] ------------------ 70| | /* T1 = Z' * T1 */ 71| 1.18M| if ((err = mp_mul(Q->z, t1, t1)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (71:11): [True: 0, False: 1.18M] ------------------ 72| 1.18M| if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (72:11): [True: 0, False: 1.18M] ------------------ 73| | /* Y = Y * T1 */ 74| 1.18M| if ((err = mp_mul(t1, y, y)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (74:11): [True: 0, False: 1.18M] ------------------ 75| 1.18M| if ((err = mp_montgomery_reduce(y, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (75:11): [True: 0, False: 1.18M] ------------------ 76| 1.18M| } 77| | 78| | /* T1 = Z*Z */ 79| 1.18M| if ((err = mp_sqr(z, t1)) != CRYPT_OK) { goto done; } ------------------ | | 549| 1.18M|#define mp_sqr(a, b) ltc_mp.sqr(a, b) ------------------ | Branch (79:8): [True: 0, False: 1.18M] ------------------ 80| 1.18M| if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (80:8): [True: 0, False: 1.18M] ------------------ 81| | /* T2 = X' * T1 */ 82| 1.18M| if ((err = mp_mul(Q->x, t1, t2)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (82:8): [True: 0, False: 1.18M] ------------------ 83| 1.18M| if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (83:8): [True: 0, False: 1.18M] ------------------ 84| | /* T1 = Z * T1 */ 85| 1.18M| if ((err = mp_mul(z, t1, t1)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (85:8): [True: 0, False: 1.18M] ------------------ 86| 1.18M| if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (86:8): [True: 0, False: 1.18M] ------------------ 87| | /* T1 = Y' * T1 */ 88| 1.18M| if ((err = mp_mul(Q->y, t1, t1)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (88:8): [True: 0, False: 1.18M] ------------------ 89| 1.18M| if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (89:8): [True: 0, False: 1.18M] ------------------ 90| | 91| | /* Y = Y - T1 */ 92| 1.18M| if ((err = mp_sub(y, t1, y)) != CRYPT_OK) { goto done; } ------------------ | | 545| 1.18M|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (92:8): [True: 0, False: 1.18M] ------------------ 93| 1.18M| if (mp_cmp_d(y, 0) == LTC_MP_LT) { ------------------ | | 532| 1.18M|#define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) ------------------ if (mp_cmp_d(y, 0) == LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (93:8): [True: 503k, False: 678k] ------------------ 94| 503k| if ((err = mp_add(y, modulus, y)) != CRYPT_OK) { goto done; } ------------------ | | 543| 503k|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (94:11): [True: 0, False: 503k] ------------------ 95| 503k| } 96| | /* T1 = 2T1 */ 97| 1.18M| if ((err = mp_add(t1, t1, t1)) != CRYPT_OK) { goto done; } ------------------ | | 543| 1.18M|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (97:8): [True: 0, False: 1.18M] ------------------ 98| 1.18M| if (mp_cmp(t1, modulus) != LTC_MP_LT) { ------------------ | | 531| 1.18M|#define mp_cmp(a, b) ltc_mp.compare(a, b) ------------------ if (mp_cmp(t1, modulus) != LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (98:8): [True: 506k, False: 674k] ------------------ 99| 506k| if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } ------------------ | | 545| 506k|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (99:11): [True: 0, False: 506k] ------------------ 100| 506k| } 101| | /* T1 = Y + T1 */ 102| 1.18M| if ((err = mp_add(t1, y, t1)) != CRYPT_OK) { goto done; } ------------------ | | 543| 1.18M|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (102:8): [True: 0, False: 1.18M] ------------------ 103| 1.18M| if (mp_cmp(t1, modulus) != LTC_MP_LT) { ------------------ | | 531| 1.18M|#define mp_cmp(a, b) ltc_mp.compare(a, b) ------------------ if (mp_cmp(t1, modulus) != LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (103:8): [True: 506k, False: 674k] ------------------ 104| 506k| if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } ------------------ | | 545| 506k|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (104:11): [True: 0, False: 506k] ------------------ 105| 506k| } 106| | /* X = X - T2 */ 107| 1.18M| if ((err = mp_sub(x, t2, x)) != CRYPT_OK) { goto done; } ------------------ | | 545| 1.18M|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (107:8): [True: 0, False: 1.18M] ------------------ 108| 1.18M| if (mp_cmp_d(x, 0) == LTC_MP_LT) { ------------------ | | 532| 1.18M|#define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) ------------------ if (mp_cmp_d(x, 0) == LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (108:8): [True: 672k, False: 508k] ------------------ 109| 672k| if ((err = mp_add(x, modulus, x)) != CRYPT_OK) { goto done; } ------------------ | | 543| 672k|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (109:11): [True: 0, False: 672k] ------------------ 110| 672k| } 111| | /* T2 = 2T2 */ 112| 1.18M| if ((err = mp_add(t2, t2, t2)) != CRYPT_OK) { goto done; } ------------------ | | 543| 1.18M|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (112:8): [True: 0, False: 1.18M] ------------------ 113| 1.18M| if (mp_cmp(t2, modulus) != LTC_MP_LT) { ------------------ | | 531| 1.18M|#define mp_cmp(a, b) ltc_mp.compare(a, b) ------------------ if (mp_cmp(t2, modulus) != LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (113:8): [True: 507k, False: 674k] ------------------ 114| 507k| if ((err = mp_sub(t2, modulus, t2)) != CRYPT_OK) { goto done; } ------------------ | | 545| 507k|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (114:11): [True: 0, False: 507k] ------------------ 115| 507k| } 116| | /* T2 = X + T2 */ 117| 1.18M| if ((err = mp_add(t2, x, t2)) != CRYPT_OK) { goto done; } ------------------ | | 543| 1.18M|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (117:8): [True: 0, False: 1.18M] ------------------ 118| 1.18M| if (mp_cmp(t2, modulus) != LTC_MP_LT) { ------------------ | | 531| 1.18M|#define mp_cmp(a, b) ltc_mp.compare(a, b) ------------------ if (mp_cmp(t2, modulus) != LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (118:8): [True: 671k, False: 510k] ------------------ 119| 671k| if ((err = mp_sub(t2, modulus, t2)) != CRYPT_OK) { goto done; } ------------------ | | 545| 671k|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (119:11): [True: 0, False: 671k] ------------------ 120| 671k| } 121| | 122| | /* if Z' != 1 */ 123| 1.18M| if (Q->z != NULL) { ------------------ | Branch (123:8): [True: 1.18M, False: 0] ------------------ 124| | /* Z = Z * Z' */ 125| 1.18M| if ((err = mp_mul(z, Q->z, z)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (125:11): [True: 0, False: 1.18M] ------------------ 126| 1.18M| if ((err = mp_montgomery_reduce(z, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (126:11): [True: 0, False: 1.18M] ------------------ 127| 1.18M| } 128| | 129| | /* Z = Z * X */ 130| 1.18M| if ((err = mp_mul(z, x, z)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (130:8): [True: 0, False: 1.18M] ------------------ 131| 1.18M| if ((err = mp_montgomery_reduce(z, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (131:8): [True: 0, False: 1.18M] ------------------ 132| | 133| | /* T1 = T1 * X */ 134| 1.18M| if ((err = mp_mul(t1, x, t1)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (134:8): [True: 0, False: 1.18M] ------------------ 135| 1.18M| if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (135:8): [True: 0, False: 1.18M] ------------------ 136| | /* X = X * X */ 137| 1.18M| if ((err = mp_sqr(x, x)) != CRYPT_OK) { goto done; } ------------------ | | 549| 1.18M|#define mp_sqr(a, b) ltc_mp.sqr(a, b) ------------------ | Branch (137:8): [True: 0, False: 1.18M] ------------------ 138| 1.18M| if ((err = mp_montgomery_reduce(x, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (138:8): [True: 0, False: 1.18M] ------------------ 139| | /* T2 = T2 * x */ 140| 1.18M| if ((err = mp_mul(t2, x, t2)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (140:8): [True: 0, False: 1.18M] ------------------ 141| 1.18M| if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (141:8): [True: 0, False: 1.18M] ------------------ 142| | /* T1 = T1 * X */ 143| 1.18M| if ((err = mp_mul(t1, x, t1)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (143:8): [True: 0, False: 1.18M] ------------------ 144| 1.18M| if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (144:8): [True: 0, False: 1.18M] ------------------ 145| | 146| | /* X = Y*Y */ 147| 1.18M| if ((err = mp_sqr(y, x)) != CRYPT_OK) { goto done; } ------------------ | | 549| 1.18M|#define mp_sqr(a, b) ltc_mp.sqr(a, b) ------------------ | Branch (147:8): [True: 0, False: 1.18M] ------------------ 148| 1.18M| if ((err = mp_montgomery_reduce(x, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (148:8): [True: 0, False: 1.18M] ------------------ 149| | /* X = X - T2 */ 150| 1.18M| if ((err = mp_sub(x, t2, x)) != CRYPT_OK) { goto done; } ------------------ | | 545| 1.18M|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (150:8): [True: 0, False: 1.18M] ------------------ 151| 1.18M| if (mp_cmp_d(x, 0) == LTC_MP_LT) { ------------------ | | 532| 1.18M|#define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) ------------------ if (mp_cmp_d(x, 0) == LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (151:8): [True: 511k, False: 669k] ------------------ 152| 511k| if ((err = mp_add(x, modulus, x)) != CRYPT_OK) { goto done; } ------------------ | | 543| 511k|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (152:11): [True: 0, False: 511k] ------------------ 153| 511k| } 154| | 155| | /* T2 = T2 - X */ 156| 1.18M| if ((err = mp_sub(t2, x, t2)) != CRYPT_OK) { goto done; } ------------------ | | 545| 1.18M|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (156:8): [True: 0, False: 1.18M] ------------------ 157| 1.18M| if (mp_cmp_d(t2, 0) == LTC_MP_LT) { ------------------ | | 532| 1.18M|#define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) ------------------ if (mp_cmp_d(t2, 0) == LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (157:8): [True: 674k, False: 507k] ------------------ 158| 674k| if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } ------------------ | | 543| 674k|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (158:11): [True: 0, False: 674k] ------------------ 159| 674k| } 160| | /* T2 = T2 - X */ 161| 1.18M| if ((err = mp_sub(t2, x, t2)) != CRYPT_OK) { goto done; } ------------------ | | 545| 1.18M|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (161:8): [True: 0, False: 1.18M] ------------------ 162| 1.18M| if (mp_cmp_d(t2, 0) == LTC_MP_LT) { ------------------ | | 532| 1.18M|#define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) ------------------ if (mp_cmp_d(t2, 0) == LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (162:8): [True: 510k, False: 670k] ------------------ 163| 510k| if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } ------------------ | | 543| 510k|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (163:11): [True: 0, False: 510k] ------------------ 164| 510k| } 165| | /* T2 = T2 * Y */ 166| 1.18M| if ((err = mp_mul(t2, y, t2)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (166:8): [True: 0, False: 1.18M] ------------------ 167| 1.18M| if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (167:8): [True: 0, False: 1.18M] ------------------ 168| | /* Y = T2 - T1 */ 169| 1.18M| if ((err = mp_sub(t2, t1, y)) != CRYPT_OK) { goto done; } ------------------ | | 545| 1.18M|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (169:8): [True: 0, False: 1.18M] ------------------ 170| 1.18M| if (mp_cmp_d(y, 0) == LTC_MP_LT) { ------------------ | | 532| 1.18M|#define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) ------------------ if (mp_cmp_d(y, 0) == LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (170:8): [True: 512k, False: 668k] ------------------ 171| 512k| if ((err = mp_add(y, modulus, y)) != CRYPT_OK) { goto done; } ------------------ | | 543| 512k|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (171:11): [True: 0, False: 512k] ------------------ 172| 512k| } 173| | /* Y = Y/2 */ 174| 1.18M| if (mp_isodd(y)) { ------------------ | | 572| 1.18M|#define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) | | ------------------ | | | | 530| 1.18M|#define mp_get_digit_count(a) ltc_mp.get_digit_count(a) | | ------------------ | | #define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) | | ------------------ | | | | 529| 1.18M|#define mp_get_digit(a, n) ltc_mp.get_digit(a, n) | | ------------------ | | #define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) | | ------------------ | | | | 17| 670k|#define LTC_MP_YES 1 | | ------------------ | | #define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) | | ------------------ | | | | 16| 510k|#define LTC_MP_NO 0 | | ------------------ | | #define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) | | ------------------ | | | | 16| 0|#define LTC_MP_NO 0 | | ------------------ | | | Branch (572:38): [True: 670k, False: 510k] | | | Branch (572:39): [True: 1.18M, False: 0] | | | Branch (572:68): [True: 670k, False: 510k] | | ------------------ ------------------ 175| 670k| if ((err = mp_add(y, modulus, y)) != CRYPT_OK) { goto done; } ------------------ | | 543| 670k|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (175:11): [True: 0, False: 670k] ------------------ 176| 670k| } 177| 1.18M| if ((err = mp_div_2(y, y)) != CRYPT_OK) { goto done; } ------------------ | | 551| 1.18M|#define mp_div_2(a, b) ltc_mp.div_2(a, b) ------------------ | Branch (177:8): [True: 0, False: 1.18M] ------------------ 178| | 179| 1.18M| if ((err = mp_copy(x, R->x)) != CRYPT_OK) { goto done; } ------------------ | | 524| 1.18M|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (179:8): [True: 0, False: 1.18M] ------------------ 180| 1.18M| if ((err = mp_copy(y, R->y)) != CRYPT_OK) { goto done; } ------------------ | | 524| 1.18M|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (180:8): [True: 0, False: 1.18M] ------------------ 181| 1.18M| if ((err = mp_copy(z, R->z)) != CRYPT_OK) { goto done; } ------------------ | | 524| 1.18M|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (181:8): [True: 0, False: 1.18M] ------------------ 182| | 183| 1.18M| err = CRYPT_OK; 184| 1.18M|done: 185| 1.18M| mp_clear_multi(t1, t2, x, y, z, NULL); ------------------ | | 519| 1.18M|#define mp_clear_multi ltc_deinit_multi ------------------ 186| 1.18M| return err; 187| 1.18M|} ltc_ecc_projective_dbl_point: 33| 1.18M|{ 34| 1.18M| void *t1, *t2; 35| 1.18M| int err; 36| | 37| 1.18M| LTC_ARGCHK(P != NULL); ------------------ | | 32| 1.18M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.18M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 38| 1.18M| LTC_ARGCHK(R != NULL); ------------------ | | 32| 1.18M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.18M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 39| 1.18M| LTC_ARGCHK(modulus != NULL); ------------------ | | 32| 1.18M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.18M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 40| 1.18M| LTC_ARGCHK(mp != NULL); ------------------ | | 32| 1.18M|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.18M] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 41| | 42| 1.18M| if ((err = mp_init_multi(&t1, &t2, NULL)) != CRYPT_OK) { ------------------ | | 517| 1.18M|#define mp_init_multi ltc_init_multi ------------------ | Branch (42:8): [True: 0, False: 1.18M] ------------------ 43| 0| return err; 44| 0| } 45| | 46| 1.18M| if (P != R) { ------------------ | Branch (46:8): [True: 171k, False: 1.01M] ------------------ 47| 171k| if ((err = mp_copy(P->x, R->x)) != CRYPT_OK) { goto done; } ------------------ | | 524| 171k|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (47:11): [True: 0, False: 171k] ------------------ 48| 171k| if ((err = mp_copy(P->y, R->y)) != CRYPT_OK) { goto done; } ------------------ | | 524| 171k|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (48:11): [True: 0, False: 171k] ------------------ 49| 171k| if ((err = mp_copy(P->z, R->z)) != CRYPT_OK) { goto done; } ------------------ | | 524| 171k|#define mp_copy(a, b) ltc_mp.copy(a, b) ------------------ | Branch (49:11): [True: 0, False: 171k] ------------------ 50| 171k| } 51| | 52| | /* t1 = Z * Z */ 53| 1.18M| if ((err = mp_sqr(R->z, t1)) != CRYPT_OK) { goto done; } ------------------ | | 549| 1.18M|#define mp_sqr(a, b) ltc_mp.sqr(a, b) ------------------ | Branch (53:8): [True: 0, False: 1.18M] ------------------ 54| 1.18M| if ((err = mp_montgomery_reduce(t1, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (54:8): [True: 0, False: 1.18M] ------------------ 55| | /* Z = Y * Z */ 56| 1.18M| if ((err = mp_mul(R->z, R->y, R->z)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (56:8): [True: 0, False: 1.18M] ------------------ 57| 1.18M| if ((err = mp_montgomery_reduce(R->z, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (57:8): [True: 0, False: 1.18M] ------------------ 58| | /* Z = 2Z */ 59| 1.18M| if ((err = mp_add(R->z, R->z, R->z)) != CRYPT_OK) { goto done; } ------------------ | | 543| 1.18M|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (59:8): [True: 0, False: 1.18M] ------------------ 60| 1.18M| if (mp_cmp(R->z, modulus) != LTC_MP_LT) { ------------------ | | 531| 1.18M|#define mp_cmp(a, b) ltc_mp.compare(a, b) ------------------ if (mp_cmp(R->z, modulus) != LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (60:8): [True: 673k, False: 512k] ------------------ 61| 673k| if ((err = mp_sub(R->z, modulus, R->z)) != CRYPT_OK) { goto done; } ------------------ | | 545| 673k|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (61:11): [True: 0, False: 673k] ------------------ 62| 673k| } 63| | 64| | /* T2 = X - T1 */ 65| 1.18M| if ((err = mp_sub(R->x, t1, t2)) != CRYPT_OK) { goto done; } ------------------ | | 545| 1.18M|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (65:8): [True: 0, False: 1.18M] ------------------ 66| 1.18M| if (mp_cmp_d(t2, 0) == LTC_MP_LT) { ------------------ | | 532| 1.18M|#define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) ------------------ if (mp_cmp_d(t2, 0) == LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (66:8): [True: 508k, False: 676k] ------------------ 67| 508k| if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } ------------------ | | 543| 508k|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (67:11): [True: 0, False: 508k] ------------------ 68| 508k| } 69| | /* T1 = X + T1 */ 70| 1.18M| if ((err = mp_add(t1, R->x, t1)) != CRYPT_OK) { goto done; } ------------------ | | 543| 1.18M|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (70:8): [True: 0, False: 1.18M] ------------------ 71| 1.18M| if (mp_cmp(t1, modulus) != LTC_MP_LT) { ------------------ | | 531| 1.18M|#define mp_cmp(a, b) ltc_mp.compare(a, b) ------------------ if (mp_cmp(t1, modulus) != LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (71:8): [True: 510k, False: 674k] ------------------ 72| 510k| if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } ------------------ | | 545| 510k|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (72:11): [True: 0, False: 510k] ------------------ 73| 510k| } 74| | /* T2 = T1 * T2 */ 75| 1.18M| if ((err = mp_mul(t1, t2, t2)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (75:8): [True: 0, False: 1.18M] ------------------ 76| 1.18M| if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (76:8): [True: 0, False: 1.18M] ------------------ 77| | /* T1 = 2T2 */ 78| 1.18M| if ((err = mp_add(t2, t2, t1)) != CRYPT_OK) { goto done; } ------------------ | | 543| 1.18M|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (78:8): [True: 0, False: 1.18M] ------------------ 79| 1.18M| if (mp_cmp(t1, modulus) != LTC_MP_LT) { ------------------ | | 531| 1.18M|#define mp_cmp(a, b) ltc_mp.compare(a, b) ------------------ if (mp_cmp(t1, modulus) != LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (79:8): [True: 518k, False: 666k] ------------------ 80| 518k| if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } ------------------ | | 545| 518k|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (80:11): [True: 0, False: 518k] ------------------ 81| 518k| } 82| | /* T1 = T1 + T2 */ 83| 1.18M| if ((err = mp_add(t1, t2, t1)) != CRYPT_OK) { goto done; } ------------------ | | 543| 1.18M|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (83:8): [True: 0, False: 1.18M] ------------------ 84| 1.18M| if (mp_cmp(t1, modulus) != LTC_MP_LT) { ------------------ | | 531| 1.18M|#define mp_cmp(a, b) ltc_mp.compare(a, b) ------------------ if (mp_cmp(t1, modulus) != LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (84:8): [True: 518k, False: 667k] ------------------ 85| 518k| if ((err = mp_sub(t1, modulus, t1)) != CRYPT_OK) { goto done; } ------------------ | | 545| 518k|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (85:11): [True: 0, False: 518k] ------------------ 86| 518k| } 87| | 88| | /* Y = 2Y */ 89| 1.18M| if ((err = mp_add(R->y, R->y, R->y)) != CRYPT_OK) { goto done; } ------------------ | | 543| 1.18M|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (89:8): [True: 0, False: 1.18M] ------------------ 90| 1.18M| if (mp_cmp(R->y, modulus) != LTC_MP_LT) { ------------------ | | 531| 1.18M|#define mp_cmp(a, b) ltc_mp.compare(a, b) ------------------ if (mp_cmp(R->y, modulus) != LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (90:8): [True: 513k, False: 671k] ------------------ 91| 513k| if ((err = mp_sub(R->y, modulus, R->y)) != CRYPT_OK) { goto done; } ------------------ | | 545| 513k|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (91:11): [True: 0, False: 513k] ------------------ 92| 513k| } 93| | /* Y = Y * Y */ 94| 1.18M| if ((err = mp_sqr(R->y, R->y)) != CRYPT_OK) { goto done; } ------------------ | | 549| 1.18M|#define mp_sqr(a, b) ltc_mp.sqr(a, b) ------------------ | Branch (94:8): [True: 0, False: 1.18M] ------------------ 95| 1.18M| if ((err = mp_montgomery_reduce(R->y, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (95:8): [True: 0, False: 1.18M] ------------------ 96| | /* T2 = Y * Y */ 97| 1.18M| if ((err = mp_sqr(R->y, t2)) != CRYPT_OK) { goto done; } ------------------ | | 549| 1.18M|#define mp_sqr(a, b) ltc_mp.sqr(a, b) ------------------ | Branch (97:8): [True: 0, False: 1.18M] ------------------ 98| 1.18M| if ((err = mp_montgomery_reduce(t2, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (98:8): [True: 0, False: 1.18M] ------------------ 99| | /* T2 = T2/2 */ 100| 1.18M| if (mp_isodd(t2)) { ------------------ | | 572| 1.18M|#define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) | | ------------------ | | | | 530| 1.18M|#define mp_get_digit_count(a) ltc_mp.get_digit_count(a) | | ------------------ | | #define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) | | ------------------ | | | | 529| 1.18M|#define mp_get_digit(a, n) ltc_mp.get_digit(a, n) | | ------------------ | | #define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) | | ------------------ | | | | 17| 504k|#define LTC_MP_YES 1 | | ------------------ | | #define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) | | ------------------ | | | | 16| 681k|#define LTC_MP_NO 0 | | ------------------ | | #define mp_isodd(a) (mp_get_digit_count(a) > 0 ? (mp_get_digit(a, 0) & 1 ? LTC_MP_YES : LTC_MP_NO) : LTC_MP_NO) | | ------------------ | | | | 16| 0|#define LTC_MP_NO 0 | | ------------------ | | | Branch (572:38): [True: 504k, False: 681k] | | | Branch (572:39): [True: 1.18M, False: 0] | | | Branch (572:68): [True: 504k, False: 681k] | | ------------------ ------------------ 101| 504k| if ((err = mp_add(t2, modulus, t2)) != CRYPT_OK) { goto done; } ------------------ | | 543| 504k|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (101:11): [True: 0, False: 504k] ------------------ 102| 504k| } 103| 1.18M| if ((err = mp_div_2(t2, t2)) != CRYPT_OK) { goto done; } ------------------ | | 551| 1.18M|#define mp_div_2(a, b) ltc_mp.div_2(a, b) ------------------ | Branch (103:8): [True: 0, False: 1.18M] ------------------ 104| | /* Y = Y * X */ 105| 1.18M| if ((err = mp_mul(R->y, R->x, R->y)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (105:8): [True: 0, False: 1.18M] ------------------ 106| 1.18M| if ((err = mp_montgomery_reduce(R->y, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (106:8): [True: 0, False: 1.18M] ------------------ 107| | 108| | /* X = T1 * T1 */ 109| 1.18M| if ((err = mp_sqr(t1, R->x)) != CRYPT_OK) { goto done; } ------------------ | | 549| 1.18M|#define mp_sqr(a, b) ltc_mp.sqr(a, b) ------------------ | Branch (109:8): [True: 0, False: 1.18M] ------------------ 110| 1.18M| if ((err = mp_montgomery_reduce(R->x, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (110:8): [True: 0, False: 1.18M] ------------------ 111| | /* X = X - Y */ 112| 1.18M| if ((err = mp_sub(R->x, R->y, R->x)) != CRYPT_OK) { goto done; } ------------------ | | 545| 1.18M|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (112:8): [True: 0, False: 1.18M] ------------------ 113| 1.18M| if (mp_cmp_d(R->x, 0) == LTC_MP_LT) { ------------------ | | 532| 1.18M|#define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) ------------------ if (mp_cmp_d(R->x, 0) == LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (113:8): [True: 509k, False: 676k] ------------------ 114| 509k| if ((err = mp_add(R->x, modulus, R->x)) != CRYPT_OK) { goto done; } ------------------ | | 543| 509k|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (114:11): [True: 0, False: 509k] ------------------ 115| 509k| } 116| | /* X = X - Y */ 117| 1.18M| if ((err = mp_sub(R->x, R->y, R->x)) != CRYPT_OK) { goto done; } ------------------ | | 545| 1.18M|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (117:8): [True: 0, False: 1.18M] ------------------ 118| 1.18M| if (mp_cmp_d(R->x, 0) == LTC_MP_LT) { ------------------ | | 532| 1.18M|#define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) ------------------ if (mp_cmp_d(R->x, 0) == LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (118:8): [True: 671k, False: 513k] ------------------ 119| 671k| if ((err = mp_add(R->x, modulus, R->x)) != CRYPT_OK) { goto done; } ------------------ | | 543| 671k|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (119:11): [True: 0, False: 671k] ------------------ 120| 671k| } 121| | 122| | /* Y = Y - X */ 123| 1.18M| if ((err = mp_sub(R->y, R->x, R->y)) != CRYPT_OK) { goto done; } ------------------ | | 545| 1.18M|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (123:8): [True: 0, False: 1.18M] ------------------ 124| 1.18M| if (mp_cmp_d(R->y, 0) == LTC_MP_LT) { ------------------ | | 532| 1.18M|#define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) ------------------ if (mp_cmp_d(R->y, 0) == LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (124:8): [True: 516k, False: 668k] ------------------ 125| 516k| if ((err = mp_add(R->y, modulus, R->y)) != CRYPT_OK) { goto done; } ------------------ | | 543| 516k|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (125:11): [True: 0, False: 516k] ------------------ 126| 516k| } 127| | /* Y = Y * T1 */ 128| 1.18M| if ((err = mp_mul(R->y, t1, R->y)) != CRYPT_OK) { goto done; } ------------------ | | 547| 1.18M|#define mp_mul(a, b, c) ltc_mp.mul(a, b, c) ------------------ | Branch (128:8): [True: 0, False: 1.18M] ------------------ 129| 1.18M| if ((err = mp_montgomery_reduce(R->y, modulus, mp)) != CRYPT_OK) { goto done; } ------------------ | | 565| 1.18M|#define mp_montgomery_reduce(a, b, c) ltc_mp.montgomery_reduce(a, b, c) ------------------ | Branch (129:8): [True: 0, False: 1.18M] ------------------ 130| | /* Y = Y - T2 */ 131| 1.18M| if ((err = mp_sub(R->y, t2, R->y)) != CRYPT_OK) { goto done; } ------------------ | | 545| 1.18M|#define mp_sub(a, b, c) ltc_mp.sub(a, b, c) ------------------ | Branch (131:8): [True: 0, False: 1.18M] ------------------ 132| 1.18M| if (mp_cmp_d(R->y, 0) == LTC_MP_LT) { ------------------ | | 532| 1.18M|#define mp_cmp_d(a, b) ltc_mp.compare_d(a, b) ------------------ if (mp_cmp_d(R->y, 0) == LTC_MP_LT) { ------------------ | | 12| 1.18M|#define LTC_MP_LT -1 ------------------ | Branch (132:8): [True: 505k, False: 679k] ------------------ 133| 505k| if ((err = mp_add(R->y, modulus, R->y)) != CRYPT_OK) { goto done; } ------------------ | | 543| 505k|#define mp_add(a, b, c) ltc_mp.add(a, b, c) ------------------ | Branch (133:11): [True: 0, False: 505k] ------------------ 134| 505k| } 135| | 136| 1.18M| err = CRYPT_OK; 137| 1.18M|done: 138| 1.18M| mp_clear_multi(t1, t2, NULL); ------------------ | | 519| 1.18M|#define mp_clear_multi ltc_deinit_multi ------------------ 139| 1.18M| return err; 140| 1.18M|} chacha_crypt: 55| 41.0k|{ 56| 41.0k| unsigned char buf[64]; 57| 41.0k| unsigned long i, j; 58| | 59| 41.0k| if (inlen == 0) return CRYPT_OK; /* nothing to do */ ------------------ | Branch (59:8): [True: 0, False: 41.0k] ------------------ 60| | 61| 41.0k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 41.0k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 41.0k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 62| 41.0k| LTC_ARGCHK(in != NULL); ------------------ | | 32| 41.0k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 41.0k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 63| 41.0k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 41.0k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 41.0k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 64| 41.0k| LTC_ARGCHK(st->ivlen != 0); ------------------ | | 32| 41.0k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 41.0k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 65| | 66| 41.0k| if (st->ksleft > 0) { ------------------ | Branch (66:8): [True: 0, False: 41.0k] ------------------ 67| 0| j = MIN(st->ksleft, inlen); ------------------ | | 425| 0| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 0, False: 0] | | ------------------ ------------------ 68| 0| for (i = 0; i < j; ++i, st->ksleft--) out[i] = in[i] ^ st->kstream[64 - st->ksleft]; ------------------ | Branch (68:19): [True: 0, False: 0] ------------------ 69| 0| inlen -= j; 70| 0| if (inlen == 0) return CRYPT_OK; ------------------ | Branch (70:11): [True: 0, False: 0] ------------------ 71| 0| out += j; 72| 0| in += j; 73| 0| } 74| 92.9k| for (;;) { 75| 92.9k| _chacha_block(buf, st->input, st->rounds); 76| 92.9k| if (st->ivlen == 8) { ------------------ | Branch (76:10): [True: 92.9k, False: 0] ------------------ 77| | /* IV-64bit, increment 64bit counter */ 78| 92.9k| if (0 == ++st->input[12] && 0 == ++st->input[13]) return CRYPT_OVERFLOW; ------------------ | Branch (78:12): [True: 0, False: 92.9k] | Branch (78:36): [True: 0, False: 0] ------------------ 79| 92.9k| } 80| 0| else { 81| | /* IV-96bit, increment 32bit counter */ 82| 0| if (0 == ++st->input[12]) return CRYPT_OVERFLOW; ------------------ | Branch (82:12): [True: 0, False: 0] ------------------ 83| 0| } 84| 92.9k| if (inlen <= 64) { ------------------ | Branch (84:10): [True: 41.0k, False: 51.8k] ------------------ 85| 999k| for (i = 0; i < inlen; ++i) out[i] = in[i] ^ buf[i]; ------------------ | Branch (85:20): [True: 958k, False: 41.0k] ------------------ 86| 41.0k| st->ksleft = 64 - inlen; 87| 1.71M| for (i = inlen; i < 64; ++i) st->kstream[i] = buf[i]; ------------------ | Branch (87:24): [True: 1.67M, False: 41.0k] ------------------ 88| 41.0k| return CRYPT_OK; 89| 41.0k| } 90| 3.37M| for (i = 0; i < 64; ++i) out[i] = in[i] ^ buf[i]; ------------------ | Branch (90:18): [True: 3.31M, False: 51.8k] ------------------ 91| 51.8k| inlen -= 64; 92| 51.8k| out += 64; 93| 51.8k| in += 64; 94| 51.8k| } 95| 41.0k|} chacha_crypt.c:_chacha_block: 26| 92.9k|{ 27| 92.9k| ulong32 x[16]; 28| 92.9k| int i; 29| 92.9k| XMEMCPY(x, input, sizeof(x)); ------------------ | | 39| 92.9k|#define XMEMCPY memcpy ------------------ 30| 1.02M| for (i = rounds; i > 0; i -= 2) { ------------------ | Branch (30:21): [True: 929k, False: 92.9k] ------------------ 31| 929k| QUARTERROUND(0, 4, 8,12) ------------------ | | 20| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 32| 929k| QUARTERROUND(1, 5, 9,13) ------------------ | | 20| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 33| 929k| QUARTERROUND(2, 6,10,14) ------------------ | | 20| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 34| 929k| QUARTERROUND(3, 7,11,15) ------------------ | | 20| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 35| 929k| QUARTERROUND(0, 5,10,15) ------------------ | | 20| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 36| 929k| QUARTERROUND(1, 6,11,12) ------------------ | | 20| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 37| 929k| QUARTERROUND(2, 7, 8,13) ------------------ | | 20| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 38| 929k| QUARTERROUND(3, 4, 9,14) ------------------ | | 20| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 929k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 929k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 39| 929k| } 40| 1.57M| for (i = 0; i < 16; ++i) { ------------------ | Branch (40:16): [True: 1.48M, False: 92.9k] ------------------ 41| 1.48M| x[i] += input[i]; 42| 1.48M| STORE32L(x[i], output + 4 * i); ------------------ | | 164| 1.48M| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 1.48M|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 43| 1.48M| } 44| 92.9k|} chacha_ivctr64: 28| 41.0k|{ 29| 41.0k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 41.0k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 41.0k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 30| 41.0k| LTC_ARGCHK(iv != NULL); ------------------ | | 32| 41.0k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 41.0k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 31| | /* 64bit IV + 64bit counter */ 32| 41.0k| LTC_ARGCHK(ivlen == 8); ------------------ | | 32| 41.0k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 41.0k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 33| | 34| 41.0k| st->input[12] = (ulong32)(counter & 0xFFFFFFFF); 35| 41.0k| st->input[13] = (ulong32)(counter >> 32); 36| 41.0k| LOAD32L(st->input[14], iv + 0); ------------------ | | 167| 41.0k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 41.0k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 37| 41.0k| LOAD32L(st->input[15], iv + 4); ------------------ | | 167| 41.0k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 41.0k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 38| 41.0k| st->ksleft = 0; 39| 41.0k| st->ivlen = ivlen; 40| 41.0k| return CRYPT_OK; 41| 41.0k|} chacha_keystream: 27| 13.6k|{ 28| 13.6k| if (outlen == 0) return CRYPT_OK; /* nothing to do */ ------------------ | Branch (28:8): [True: 0, False: 13.6k] ------------------ 29| 13.6k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 13.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 13.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 30| 13.6k| XMEMSET(out, 0, outlen); ------------------ | | 36| 13.6k|#define XMEMSET memset ------------------ 31| 13.6k| return chacha_crypt(st, out, outlen, out); 32| 13.6k|} chacha_setup: 31| 7.24k|{ 32| 7.24k| const char *constants; 33| | 34| 7.24k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 7.24k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 7.24k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 35| 7.24k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 7.24k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 7.24k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 36| 7.24k| LTC_ARGCHK(keylen == 32 || keylen == 16); ------------------ | | 32| 7.24k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:34): [True: 7.24k, False: 0] | | | Branch (32:34): [True: 0, False: 0] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 37| | 38| 7.24k| if (rounds == 0) rounds = 20; ------------------ | Branch (38:8): [True: 0, False: 7.24k] ------------------ 39| | 40| 7.24k| LOAD32L(st->input[4], key + 0); ------------------ | | 167| 7.24k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 7.24k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 41| 7.24k| LOAD32L(st->input[5], key + 4); ------------------ | | 167| 7.24k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 7.24k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 42| 7.24k| LOAD32L(st->input[6], key + 8); ------------------ | | 167| 7.24k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 7.24k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 43| 7.24k| LOAD32L(st->input[7], key + 12); ------------------ | | 167| 7.24k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 7.24k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 44| 7.24k| if (keylen == 32) { /* 256bit */ ------------------ | Branch (44:8): [True: 7.24k, False: 0] ------------------ 45| 7.24k| key += 16; 46| 7.24k| constants = sigma; 47| 7.24k| } else { /* 128bit */ 48| 0| constants = tau; 49| 0| } 50| 7.24k| LOAD32L(st->input[8], key + 0); ------------------ | | 167| 7.24k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 7.24k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 51| 7.24k| LOAD32L(st->input[9], key + 4); ------------------ | | 167| 7.24k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 7.24k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 52| 7.24k| LOAD32L(st->input[10], key + 8); ------------------ | | 167| 7.24k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 7.24k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 53| 7.24k| LOAD32L(st->input[11], key + 12); ------------------ | | 167| 7.24k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 7.24k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 54| 7.24k| LOAD32L(st->input[0], constants + 0); ------------------ | | 167| 7.24k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 7.24k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 55| 7.24k| LOAD32L(st->input[1], constants + 4); ------------------ | | 167| 7.24k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 7.24k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 56| 7.24k| LOAD32L(st->input[2], constants + 8); ------------------ | | 167| 7.24k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 7.24k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 57| 7.24k| LOAD32L(st->input[3], constants + 12); ------------------ | | 167| 7.24k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 7.24k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 58| 7.24k| st->rounds = rounds; /* e.g. 20 for chacha20 */ 59| 7.24k| st->ivlen = 0; /* will be set later by chacha_ivctr(32|64) */ 60| 7.24k| return CRYPT_OK; 61| 7.24k|} mp_2expt: 12| 39.5k|{ 13| 39.5k| mp_err err; 14| | 15| | /* zero a as per default */ 16| 39.5k| mp_zero(a); 17| | 18| | /* grow a to accomodate the single bit */ 19| 39.5k| if ((err = mp_grow(a, (b / MP_DIGIT_BIT) + 1)) != MP_OKAY) { ------------------ | | 82| 39.5k|# define MP_DIGIT_BIT 60 ------------------ if ((err = mp_grow(a, (b / MP_DIGIT_BIT) + 1)) != MP_OKAY) { ------------------ | | 161| 39.5k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (19:8): [True: 0, False: 39.5k] ------------------ 20| 0| return err; 21| 0| } 22| | 23| | /* set the used count of where the bit will go */ 24| 39.5k| a->used = (b / MP_DIGIT_BIT) + 1; ------------------ | | 82| 39.5k|# define MP_DIGIT_BIT 60 ------------------ 25| | 26| | /* put the single bit in its place */ 27| 39.5k| a->dp[b / MP_DIGIT_BIT] = (mp_digit)1 << (mp_digit)(b % MP_DIGIT_BIT); ------------------ | | 82| 39.5k|# define MP_DIGIT_BIT 60 ------------------ a->dp[b / MP_DIGIT_BIT] = (mp_digit)1 << (mp_digit)(b % MP_DIGIT_BIT); ------------------ | | 82| 39.5k|# define MP_DIGIT_BIT 60 ------------------ 28| | 29| 39.5k| return MP_OKAY; ------------------ | | 161| 39.5k|#define MP_OKAY 0 /* no error */ ------------------ 30| 39.5k|} mp_add: 8| 17.9M|{ 9| 17.9M| mp_sign sa, sb; 10| 17.9M| mp_err err; 11| | 12| | /* get sign of both inputs */ 13| 17.9M| sa = a->sign; 14| 17.9M| sb = b->sign; 15| | 16| | /* handle two cases, not four */ 17| 17.9M| if (sa == sb) { ------------------ | Branch (17:8): [True: 11.8M, False: 6.11M] ------------------ 18| | /* both positive or both negative */ 19| | /* add their magnitudes, copy the sign */ 20| 11.8M| c->sign = sa; 21| 11.8M| err = s_mp_add(a, b, c); 22| 11.8M| } else { 23| | /* one positive, the other negative */ 24| | /* subtract the one with the greater magnitude from */ 25| | /* the one of the lesser magnitude. The result gets */ 26| | /* the sign of the one with the greater magnitude. */ 27| 6.11M| if (mp_cmp_mag(a, b) == MP_LT) { ------------------ | | 154| 6.11M|#define MP_LT -1 /* less than */ ------------------ | Branch (27:11): [True: 6.11M, False: 185] ------------------ 28| 6.11M| c->sign = sb; 29| 6.11M| err = s_mp_sub(b, a, c); 30| 6.11M| } else { 31| 185| c->sign = sa; 32| 185| err = s_mp_sub(a, b, c); 33| 185| } 34| 6.11M| } 35| 17.9M| return err; 36| 17.9M|} mp_add_d: 8| 1.24M|{ 9| 1.24M| mp_err err; 10| 1.24M| int ix, oldused; 11| 1.24M| mp_digit *tmpa, *tmpc; 12| | 13| | /* grow c as required */ 14| 1.24M| if (c->alloc < (a->used + 1)) { ------------------ | Branch (14:8): [True: 0, False: 1.24M] ------------------ 15| 0| if ((err = mp_grow(c, a->used + 1)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (15:11): [True: 0, False: 0] ------------------ 16| 0| return err; 17| 0| } 18| 0| } 19| | 20| | /* if a is negative and |a| >= b, call c = |a| - b */ 21| 1.24M| if ((a->sign == MP_NEG) && ((a->used > 1) || (a->dp[0] >= b))) { ------------------ | | 152| 1.24M|#define MP_NEG 1 /* negative */ ------------------ | Branch (21:8): [True: 0, False: 1.24M] | Branch (21:32): [True: 0, False: 0] | Branch (21:49): [True: 0, False: 0] ------------------ 22| 0| mp_int a_ = *a; 23| | /* temporarily fix sign of a */ 24| 0| a_.sign = MP_ZPOS; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ 25| | 26| | /* c = |a| - b */ 27| 0| err = mp_sub_d(&a_, b, c); 28| | 29| | /* fix sign */ 30| 0| c->sign = MP_NEG; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ 31| | 32| | /* clamp */ 33| 0| mp_clamp(c); 34| | 35| 0| return err; 36| 0| } 37| | 38| | /* old number of used digits in c */ 39| 1.24M| oldused = c->used; 40| | 41| | /* source alias */ 42| 1.24M| tmpa = a->dp; 43| | 44| | /* destination alias */ 45| 1.24M| tmpc = c->dp; 46| | 47| | /* if a is positive */ 48| 1.24M| if (a->sign == MP_ZPOS) { ------------------ | | 151| 1.24M|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (48:8): [True: 1.24M, False: 0] ------------------ 49| | /* add digits, mu is carry */ 50| 1.24M| mp_digit mu = b; 51| 4.76M| for (ix = 0; ix < a->used; ix++) { ------------------ | Branch (51:20): [True: 3.52M, False: 1.24M] ------------------ 52| 3.52M| *tmpc = *tmpa++ + mu; 53| 3.52M| mu = *tmpc >> MP_DIGIT_BIT; ------------------ | | 82| 3.52M|# define MP_DIGIT_BIT 60 ------------------ 54| 3.52M| *tmpc++ &= MP_MASK; ------------------ | | 106| 3.52M|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 3.52M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 55| 3.52M| } 56| | /* set final carry */ 57| 1.24M| ix++; 58| 1.24M| *tmpc++ = mu; 59| | 60| | /* setup size */ 61| 1.24M| c->used = a->used + 1; 62| 1.24M| } else { 63| | /* a was negative and |a| < b */ 64| 0| c->used = 1; 65| | 66| | /* the result is a single digit */ 67| 0| if (a->used == 1) { ------------------ | Branch (67:11): [True: 0, False: 0] ------------------ 68| 0| *tmpc++ = b - a->dp[0]; 69| 0| } else { 70| 0| *tmpc++ = b; 71| 0| } 72| | 73| | /* setup count so the clearing of oldused 74| | * can fall through correctly 75| | */ 76| 0| ix = 1; 77| 0| } 78| | 79| | /* sign always positive */ 80| 1.24M| c->sign = MP_ZPOS; ------------------ | | 151| 1.24M|#define MP_ZPOS 0 /* positive integer */ ------------------ 81| | 82| | /* now zero to oldused */ 83| 1.24M| MP_ZERO_DIGITS(tmpc, oldused - ix); ------------------ | | 89| 1.24M|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 1.24M|do { \ | | 91| 1.24M| int zd_ = (digits); \ | | 92| 1.24M| mp_digit* zm_ = (mem); \ | | 93| 1.24M| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 1.24M] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 1.24M|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 84| 1.24M| mp_clamp(c); 85| | 86| 1.24M| return MP_OKAY; ------------------ | | 161| 1.24M|#define MP_OKAY 0 /* no error */ ------------------ 87| 1.24M|} mp_addmod: 8| 8.21k|{ 9| 8.21k| mp_err err; 10| 8.21k| mp_int t; 11| | 12| 8.21k| if ((err = mp_init(&t)) != MP_OKAY) { ------------------ | | 161| 8.21k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (12:8): [True: 0, False: 8.21k] ------------------ 13| 0| return err; 14| 0| } 15| | 16| 8.21k| if ((err = mp_add(a, b, &t)) != MP_OKAY) { ------------------ | | 161| 8.21k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (16:8): [True: 0, False: 8.21k] ------------------ 17| 0| goto LBL_ERR; 18| 0| } 19| 8.21k| err = mp_mod(&t, c, d); 20| | 21| 8.21k|LBL_ERR: 22| 8.21k| mp_clear(&t); 23| 8.21k| return err; 24| 8.21k|} mp_clamp: 14| 309M|{ 15| | /* decrease used while the most significant digit is 16| | * zero. 17| | */ 18| 514M| while ((a->used > 0) && (a->dp[a->used - 1] == 0u)) { ------------------ | Branch (18:11): [True: 513M, False: 330k] | Branch (18:28): [True: 205M, False: 308M] ------------------ 19| 205M| --(a->used); 20| 205M| } 21| | 22| | /* reset the sign flag if used == 0 */ 23| 309M| if (a->used == 0) { ------------------ | Branch (23:8): [True: 330k, False: 308M] ------------------ 24| 330k| a->sign = MP_ZPOS; ------------------ | | 151| 330k|#define MP_ZPOS 0 /* positive integer */ ------------------ 25| 330k| } 26| 309M|} mp_clear: 8| 11.2M|{ 9| | /* only do anything if a hasn't been freed previously */ 10| 11.2M| if (a->dp != NULL) { ------------------ | Branch (10:8): [True: 11.1M, False: 23.6k] ------------------ 11| | /* free ram */ 12| 11.1M| MP_FREE_DIGITS(a->dp, a->alloc); ------------------ | | 58| 11.1M|# define MP_FREE_DIGITS(mem, digits) \ | | 59| 11.1M|do { \ | | 60| 11.1M| int fd_ = (digits); \ | | 61| 11.1M| void* fm_ = (mem); \ | | 62| 11.1M| if (fm_ != NULL) { \ | | ------------------ | | | Branch (62:8): [True: 11.1M, False: 0] | | ------------------ | | 63| 11.1M| size_t fs_ = sizeof (mp_digit) * (size_t)fd_; \ | | 64| 11.1M| MP_ZERO_BUFFER(fm_, fs_); \ | | ------------------ | | | | 81| 11.1M|# define MP_ZERO_BUFFER(mem, size) \ | | | | 82| 11.1M|do { \ | | | | 83| 11.1M| size_t zs_ = (size); \ | | | | 84| 11.1M| char* zm_ = (char*)(mem); \ | | | | 85| 3.31G| while (zs_-- > 0u) { \ | | | | ------------------ | | | | | Branch (85:11): [True: 3.29G, False: 11.1M] | | | | ------------------ | | | | 86| 3.29G| *zm_++ = '\0'; \ | | | | 87| 3.29G| } \ | | | | 88| 11.1M|} while (0) | | | | ------------------ | | | | | Branch (88:10): [Folded - Ignored] | | | | ------------------ | | ------------------ | | 65| 11.1M| MP_FREE(fm_, fs_); \ | | ------------------ | | | | 1324| 11.1M|#define MP_FREE m_free_ltm | | ------------------ | | 66| 11.1M| } \ | | 67| 11.1M|} while (0) | | ------------------ | | | Branch (67:10): [Folded - Ignored] | | ------------------ ------------------ 13| | 14| | /* reset members to make debugging easier */ 15| 11.1M| a->dp = NULL; 16| 11.1M| a->alloc = a->used = 0; 17| 11.1M| a->sign = MP_ZPOS; ------------------ | | 151| 11.1M|#define MP_ZPOS 0 /* positive integer */ ------------------ 18| 11.1M| } 19| 11.2M|} mp_clear_multi: 9| 60.8k|{ 10| 60.8k| mp_int *next_mp = mp; 11| 60.8k| va_list args; 12| 60.8k| va_start(args, mp); 13| 307k| while (next_mp != NULL) { ------------------ | Branch (13:11): [True: 246k, False: 60.8k] ------------------ 14| 246k| mp_clear(next_mp); 15| 246k| next_mp = va_arg(args, mp_int *); 16| 246k| } 17| 60.8k| va_end(args); 18| 60.8k|} mp_cmp: 8| 20.2M|{ 9| | /* compare based on sign */ 10| 20.2M| if (a->sign != b->sign) { ------------------ | Branch (10:8): [True: 0, False: 20.2M] ------------------ 11| 0| if (a->sign == MP_NEG) { ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ | Branch (11:11): [True: 0, False: 0] ------------------ 12| 0| return MP_LT; ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ 13| 0| } else { 14| 0| return MP_GT; ------------------ | | 156| 0|#define MP_GT 1 /* greater than */ ------------------ 15| 0| } 16| 0| } 17| | 18| | /* compare digits */ 19| 20.2M| if (a->sign == MP_NEG) { ------------------ | | 152| 20.2M|#define MP_NEG 1 /* negative */ ------------------ | Branch (19:8): [True: 0, False: 20.2M] ------------------ 20| | /* if negative compare opposite direction */ 21| 0| return mp_cmp_mag(b, a); 22| 20.2M| } else { 23| 20.2M| return mp_cmp_mag(a, b); 24| 20.2M| } 25| 20.2M|} mp_cmp_d: 8| 13.0M|{ 9| | /* compare based on sign */ 10| 13.0M| if (a->sign == MP_NEG) { ------------------ | | 152| 13.0M|#define MP_NEG 1 /* negative */ ------------------ | Branch (10:8): [True: 6.09M, False: 6.99M] ------------------ 11| 6.09M| return MP_LT; ------------------ | | 154| 6.09M|#define MP_LT -1 /* less than */ ------------------ 12| 6.09M| } 13| | 14| | /* compare based on magnitude */ 15| 6.99M| if (a->used > 1) { ------------------ | Branch (15:8): [True: 6.96M, False: 28.8k] ------------------ 16| 6.96M| return MP_GT; ------------------ | | 156| 6.96M|#define MP_GT 1 /* greater than */ ------------------ 17| 6.96M| } 18| | 19| | /* compare the only digit of a to b */ 20| 28.8k| if (a->dp[0] > b) { ------------------ | Branch (20:8): [True: 9.15k, False: 19.6k] ------------------ 21| 9.15k| return MP_GT; ------------------ | | 156| 9.15k|#define MP_GT 1 /* greater than */ ------------------ 22| 19.6k| } else if (a->dp[0] < b) { ------------------ | Branch (22:15): [True: 29, False: 19.6k] ------------------ 23| 29| return MP_LT; ------------------ | | 154| 29|#define MP_LT -1 /* less than */ ------------------ 24| 19.6k| } else { 25| 19.6k| return MP_EQ; ------------------ | | 155| 19.6k|#define MP_EQ 0 /* equal to */ ------------------ 26| 19.6k| } 27| 28.8k|} mp_cmp_mag: 8| 153M|{ 9| 153M| int n; 10| 153M| const mp_digit *tmpa, *tmpb; 11| | 12| | /* compare based on # of non-zero digits */ 13| 153M| if (a->used > b->used) { ------------------ | Branch (13:8): [True: 658k, False: 152M] ------------------ 14| 658k| return MP_GT; ------------------ | | 156| 658k|#define MP_GT 1 /* greater than */ ------------------ 15| 658k| } 16| | 17| 152M| if (a->used < b->used) { ------------------ | Branch (17:8): [True: 1.95M, False: 150M] ------------------ 18| 1.95M| return MP_LT; ------------------ | | 154| 1.95M|#define MP_LT -1 /* less than */ ------------------ 19| 1.95M| } 20| | 21| | /* alias for a */ 22| 150M| tmpa = a->dp + (a->used - 1); 23| | 24| | /* alias for b */ 25| 150M| tmpb = b->dp + (a->used - 1); 26| | 27| | /* compare based on digits */ 28| 153M| for (n = 0; n < a->used; ++n, --tmpa, --tmpb) { ------------------ | Branch (28:16): [True: 153M, False: 51.7k] ------------------ 29| 153M| if (*tmpa > *tmpb) { ------------------ | Branch (29:11): [True: 35.8M, False: 118M] ------------------ 30| 35.8M| return MP_GT; ------------------ | | 156| 35.8M|#define MP_GT 1 /* greater than */ ------------------ 31| 35.8M| } 32| | 33| 118M| if (*tmpa < *tmpb) { ------------------ | Branch (33:11): [True: 114M, False: 3.19M] ------------------ 34| 114M| return MP_LT; ------------------ | | 154| 114M|#define MP_LT -1 /* less than */ ------------------ 35| 114M| } 36| 118M| } 37| 51.7k| return MP_EQ; ------------------ | | 155| 51.7k|#define MP_EQ 0 /* equal to */ ------------------ 38| 150M|} mp_copy: 8| 29.5M|{ 9| 29.5M| int n; 10| 29.5M| mp_digit *tmpa, *tmpb; 11| 29.5M| mp_err err; 12| | 13| | /* if dst == src do nothing */ 14| 29.5M| if (a == b) { ------------------ | Branch (14:8): [True: 21.3M, False: 8.11M] ------------------ 15| 21.3M| return MP_OKAY; ------------------ | | 161| 21.3M|#define MP_OKAY 0 /* no error */ ------------------ 16| 21.3M| } 17| | 18| | /* grow dest */ 19| 8.11M| if (b->alloc < a->used) { ------------------ | Branch (19:8): [True: 12.5k, False: 8.10M] ------------------ 20| 12.5k| if ((err = mp_grow(b, a->used)) != MP_OKAY) { ------------------ | | 161| 12.5k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (20:11): [True: 0, False: 12.5k] ------------------ 21| 0| return err; 22| 0| } 23| 12.5k| } 24| | 25| | /* zero b and copy the parameters over */ 26| | /* pointer aliases */ 27| | 28| | /* source */ 29| 8.11M| tmpa = a->dp; 30| | 31| | /* destination */ 32| 8.11M| tmpb = b->dp; 33| | 34| | /* copy all the digits */ 35| 57.6M| for (n = 0; n < a->used; n++) { ------------------ | Branch (35:16): [True: 49.5M, False: 8.11M] ------------------ 36| 49.5M| *tmpb++ = *tmpa++; 37| 49.5M| } 38| | 39| | /* clear high digits */ 40| 8.11M| MP_ZERO_DIGITS(tmpb, b->used - n); ------------------ | | 89| 8.11M|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 8.11M|do { \ | | 91| 8.11M| int zd_ = (digits); \ | | 92| 8.11M| mp_digit* zm_ = (mem); \ | | 93| 8.11M| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 41, False: 8.11M] | | ------------------ | | 94| 41| *zm_++ = 0; \ | | 95| 41| } \ | | 96| 8.11M|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 41| | 42| | /* copy used count and sign */ 43| 8.11M| b->used = a->used; 44| 8.11M| b->sign = a->sign; 45| 8.11M| return MP_OKAY; ------------------ | | 161| 8.11M|#define MP_OKAY 0 /* no error */ ------------------ 46| 8.11M|} mp_count_bits: 8| 598k|{ 9| 598k| int r; 10| 598k| mp_digit q; 11| | 12| | /* shortcut */ 13| 598k| if (MP_IS_ZERO(a)) { ------------------ | | 163| 598k|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 598k] | | ------------------ ------------------ 14| 0| return 0; 15| 0| } 16| | 17| | /* get number of digits and add that */ 18| 598k| r = (a->used - 1) * MP_DIGIT_BIT; ------------------ | | 82| 598k|# define MP_DIGIT_BIT 60 ------------------ 19| | 20| | /* take the last digit and count the bits in it */ 21| 598k| q = a->dp[a->used - 1]; 22| 9.20M| while (q > 0u) { ------------------ | Branch (22:11): [True: 8.60M, False: 598k] ------------------ 23| 8.60M| ++r; 24| 8.60M| q >>= 1u; 25| 8.60M| } 26| 598k| return r; 27| 598k|} mp_div: 87| 129k|{ 88| 129k| mp_int q, x, y, t1, t2; 89| 129k| int n, t, i, norm; 90| 129k| mp_sign neg; 91| 129k| mp_err err; 92| | 93| | /* is divisor zero ? */ 94| 129k| if (MP_IS_ZERO(b)) { ------------------ | | 163| 129k|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 129k] | | ------------------ ------------------ 95| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 96| 0| } 97| | 98| | /* if a < b then q=0, r = a */ 99| 129k| if (mp_cmp_mag(a, b) == MP_LT) { ------------------ | | 154| 129k|#define MP_LT -1 /* less than */ ------------------ | Branch (99:8): [True: 46.4k, False: 82.9k] ------------------ 100| 46.4k| if (d != NULL) { ------------------ | Branch (100:11): [True: 46.4k, False: 0] ------------------ 101| 46.4k| err = mp_copy(a, d); 102| 46.4k| } else { 103| 0| err = MP_OKAY; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ 104| 0| } 105| 46.4k| if (c != NULL) { ------------------ | Branch (105:11): [True: 0, False: 46.4k] ------------------ 106| 0| mp_zero(c); 107| 0| } 108| 46.4k| return err; 109| 46.4k| } 110| | 111| 82.9k| if ((err = mp_init_size(&q, a->used + 2)) != MP_OKAY) { ------------------ | | 161| 82.9k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (111:8): [True: 0, False: 82.9k] ------------------ 112| 0| return err; 113| 0| } 114| 82.9k| q.used = a->used + 2; 115| | 116| 82.9k| if ((err = mp_init(&t1)) != MP_OKAY) goto LBL_Q; ------------------ | | 161| 82.9k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (116:8): [True: 0, False: 82.9k] ------------------ 117| | 118| 82.9k| if ((err = mp_init(&t2)) != MP_OKAY) goto LBL_T1; ------------------ | | 161| 82.9k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (118:8): [True: 0, False: 82.9k] ------------------ 119| | 120| 82.9k| if ((err = mp_init_copy(&x, a)) != MP_OKAY) goto LBL_T2; ------------------ | | 161| 82.9k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (120:8): [True: 0, False: 82.9k] ------------------ 121| | 122| 82.9k| if ((err = mp_init_copy(&y, b)) != MP_OKAY) goto LBL_X; ------------------ | | 161| 82.9k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (122:8): [True: 0, False: 82.9k] ------------------ 123| | 124| | /* fix the sign */ 125| 82.9k| neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 151| 82.9k|#define MP_ZPOS 0 /* positive integer */ ------------------ neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 152| 82.9k|#define MP_NEG 1 /* negative */ ------------------ | Branch (125:10): [True: 82.9k, False: 0] ------------------ 126| 82.9k| x.sign = y.sign = MP_ZPOS; ------------------ | | 151| 82.9k|#define MP_ZPOS 0 /* positive integer */ ------------------ 127| | 128| | /* normalize both x and y, ensure that y >= b/2, [b == 2**MP_DIGIT_BIT] */ 129| 82.9k| norm = mp_count_bits(&y) % MP_DIGIT_BIT; ------------------ | | 82| 82.9k|# define MP_DIGIT_BIT 60 ------------------ 130| 82.9k| if (norm < (MP_DIGIT_BIT - 1)) { ------------------ | | 82| 82.9k|# define MP_DIGIT_BIT 60 ------------------ | Branch (130:8): [True: 82.9k, False: 0] ------------------ 131| 82.9k| norm = (MP_DIGIT_BIT - 1) - norm; ------------------ | | 82| 82.9k|# define MP_DIGIT_BIT 60 ------------------ 132| 82.9k| if ((err = mp_mul_2d(&x, norm, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 82.9k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (132:11): [True: 0, False: 82.9k] ------------------ 133| 82.9k| if ((err = mp_mul_2d(&y, norm, &y)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 82.9k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (133:11): [True: 0, False: 82.9k] ------------------ 134| 82.9k| } else { 135| 0| norm = 0; 136| 0| } 137| | 138| | /* note hac does 0 based, so if used==5 then its 0,1,2,3,4, e.g. use 4 */ 139| 82.9k| n = x.used - 1; 140| 82.9k| t = y.used - 1; 141| | 142| | /* while (x >= y*b**n-t) do { q[n-t] += 1; x -= y*b**{n-t} } */ 143| | /* y = y*b**{n-t} */ 144| 82.9k| if ((err = mp_lshd(&y, n - t)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 82.9k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (144:8): [True: 0, False: 82.9k] ------------------ 145| | 146| 94.8k| while (mp_cmp(&x, &y) != MP_LT) { ------------------ | | 154| 94.8k|#define MP_LT -1 /* less than */ ------------------ | Branch (146:11): [True: 11.9k, False: 82.9k] ------------------ 147| 11.9k| ++(q.dp[n - t]); 148| 11.9k| if ((err = mp_sub(&x, &y, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 11.9k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (148:11): [True: 0, False: 11.9k] ------------------ 149| 11.9k| } 150| | 151| | /* reset y by shifting it back down */ 152| 82.9k| mp_rshd(&y, n - t); 153| | 154| | /* step 3. for i from n down to (t + 1) */ 155| 1.09M| for (i = n; i >= (t + 1); i--) { ------------------ | Branch (155:16): [True: 1.01M, False: 82.9k] ------------------ 156| 1.01M| if (i > x.used) { ------------------ | Branch (156:11): [True: 0, False: 1.01M] ------------------ 157| 0| continue; 158| 0| } 159| | 160| | /* step 3.1 if xi == yt then set q{i-t-1} to b-1, 161| | * otherwise set q{i-t-1} to (xi*b + x{i-1})/yt */ 162| 1.01M| if (x.dp[i] == y.dp[t]) { ------------------ | Branch (162:11): [True: 0, False: 1.01M] ------------------ 163| 0| q.dp[(i - t) - 1] = ((mp_digit)1 << (mp_digit)MP_DIGIT_BIT) - (mp_digit)1; ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ 164| 1.01M| } else { 165| 1.01M| mp_word tmp; 166| 1.01M| tmp = (mp_word)x.dp[i] << (mp_word)MP_DIGIT_BIT; ------------------ | | 82| 1.01M|# define MP_DIGIT_BIT 60 ------------------ 167| 1.01M| tmp |= (mp_word)x.dp[i - 1]; 168| 1.01M| tmp /= (mp_word)y.dp[t]; 169| 1.01M| if (tmp > (mp_word)MP_MASK) { ------------------ | | 106| 1.01M|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 1.01M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (169:14): [True: 0, False: 1.01M] ------------------ 170| 0| tmp = MP_MASK; ------------------ | | 106| 0|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 0|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 171| 0| } 172| 1.01M| q.dp[(i - t) - 1] = (mp_digit)(tmp & (mp_word)MP_MASK); ------------------ | | 106| 1.01M|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 1.01M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 173| 1.01M| } 174| | 175| | /* while (q{i-t-1} * (yt * b + y{t-1})) > 176| | xi * b**2 + xi-1 * b + xi-2 177| | 178| | do q{i-t-1} -= 1; 179| | */ 180| 1.01M| q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] + 1uL) & (mp_digit)MP_MASK; ------------------ | | 106| 1.01M|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 1.01M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 181| 1.90M| do { 182| 1.90M| q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] - 1uL) & (mp_digit)MP_MASK; ------------------ | | 106| 1.90M|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 1.90M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 183| | 184| | /* find left hand */ 185| 1.90M| mp_zero(&t1); 186| 1.90M| t1.dp[0] = ((t - 1) < 0) ? 0u : y.dp[t - 1]; ------------------ | Branch (186:21): [True: 0, False: 1.90M] ------------------ 187| 1.90M| t1.dp[1] = y.dp[t]; 188| 1.90M| t1.used = 2; 189| 1.90M| if ((err = mp_mul_d(&t1, q.dp[(i - t) - 1], &t1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 1.90M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (189:14): [True: 0, False: 1.90M] ------------------ 190| | 191| | /* find right hand */ 192| 1.90M| t2.dp[0] = ((i - 2) < 0) ? 0u : x.dp[i - 2]; ------------------ | Branch (192:21): [True: 0, False: 1.90M] ------------------ 193| 1.90M| t2.dp[1] = x.dp[i - 1]; /* i >= 1 always holds */ 194| 1.90M| t2.dp[2] = x.dp[i]; 195| 1.90M| t2.used = 3; 196| 1.90M| } while (mp_cmp_mag(&t1, &t2) == MP_GT); ------------------ | | 156| 1.90M|#define MP_GT 1 /* greater than */ ------------------ | Branch (196:16): [True: 890k, False: 1.01M] ------------------ 197| | 198| | /* step 3.3 x = x - q{i-t-1} * y * b**{i-t-1} */ 199| 1.01M| if ((err = mp_mul_d(&y, q.dp[(i - t) - 1], &t1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 1.01M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (199:11): [True: 0, False: 1.01M] ------------------ 200| | 201| 1.01M| if ((err = mp_lshd(&t1, (i - t) - 1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 1.01M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (201:11): [True: 0, False: 1.01M] ------------------ 202| | 203| 1.01M| if ((err = mp_sub(&x, &t1, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 1.01M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (203:11): [True: 0, False: 1.01M] ------------------ 204| | 205| | /* if x < 0 then { x = x + y*b**{i-t-1}; q{i-t-1} -= 1; } */ 206| 1.01M| if (x.sign == MP_NEG) { ------------------ | | 152| 1.01M|#define MP_NEG 1 /* negative */ ------------------ | Branch (206:11): [True: 0, False: 1.01M] ------------------ 207| 0| if ((err = mp_copy(&y, &t1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (207:14): [True: 0, False: 0] ------------------ 208| 0| if ((err = mp_lshd(&t1, (i - t) - 1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (208:14): [True: 0, False: 0] ------------------ 209| 0| if ((err = mp_add(&x, &t1, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (209:14): [True: 0, False: 0] ------------------ 210| | 211| 0| q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] - 1uL) & MP_MASK; ------------------ | | 106| 0|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 0|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 212| 0| } 213| 1.01M| } 214| | 215| | /* now q is the quotient and x is the remainder 216| | * [which we have to normalize] 217| | */ 218| | 219| | /* get sign before writing to c */ 220| 82.9k| x.sign = (x.used == 0) ? MP_ZPOS : a->sign; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (220:13): [True: 0, False: 82.9k] ------------------ 221| | 222| 82.9k| if (c != NULL) { ------------------ | Branch (222:8): [True: 0, False: 82.9k] ------------------ 223| 0| mp_clamp(&q); 224| 0| mp_exch(&q, c); 225| 0| c->sign = neg; 226| 0| } 227| | 228| 82.9k| if (d != NULL) { ------------------ | Branch (228:8): [True: 82.9k, False: 0] ------------------ 229| 82.9k| if ((err = mp_div_2d(&x, norm, &x, NULL)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 82.9k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (229:11): [True: 0, False: 82.9k] ------------------ 230| 82.9k| mp_exch(&x, d); 231| 82.9k| } 232| | 233| 82.9k| err = MP_OKAY; ------------------ | | 161| 82.9k|#define MP_OKAY 0 /* no error */ ------------------ 234| | 235| 82.9k|LBL_Y: 236| 82.9k| mp_clear(&y); 237| 82.9k|LBL_X: 238| 82.9k| mp_clear(&x); 239| 82.9k|LBL_T2: 240| 82.9k| mp_clear(&t2); 241| 82.9k|LBL_T1: 242| 82.9k| mp_clear(&t1); 243| 82.9k|LBL_Q: 244| 82.9k| mp_clear(&q); 245| 82.9k| return err; 246| 82.9k|} mp_div_2: 8| 35.7M|{ 9| 35.7M| int x, oldused; 10| 35.7M| mp_digit r, rr, *tmpa, *tmpb; 11| 35.7M| mp_err err; 12| | 13| | /* copy */ 14| 35.7M| if (b->alloc < a->used) { ------------------ | Branch (14:8): [True: 9.63k, False: 35.7M] ------------------ 15| 9.63k| if ((err = mp_grow(b, a->used)) != MP_OKAY) { ------------------ | | 161| 9.63k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (15:11): [True: 0, False: 9.63k] ------------------ 16| 0| return err; 17| 0| } 18| 9.63k| } 19| | 20| 35.7M| oldused = b->used; 21| 35.7M| b->used = a->used; 22| | 23| | /* source alias */ 24| 35.7M| tmpa = a->dp + b->used - 1; 25| | 26| | /* dest alias */ 27| 35.7M| tmpb = b->dp + b->used - 1; 28| | 29| | /* carry */ 30| 35.7M| r = 0; 31| 719M| for (x = b->used - 1; x >= 0; x--) { ------------------ | Branch (31:26): [True: 683M, False: 35.7M] ------------------ 32| | /* get the carry for the next iteration */ 33| 683M| rr = *tmpa & 1u; 34| | 35| | /* shift the current digit, add in carry and store */ 36| 683M| *tmpb-- = (*tmpa-- >> 1) | (r << (MP_DIGIT_BIT - 1)); ------------------ | | 82| 683M|# define MP_DIGIT_BIT 60 ------------------ 37| | 38| | /* forward carry to next iteration */ 39| 683M| r = rr; 40| 683M| } 41| | 42| | /* zero excess digits */ 43| 35.7M| MP_ZERO_DIGITS(b->dp + b->used, oldused - b->used); ------------------ | | 89| 35.7M|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 35.7M|do { \ | | 91| 35.7M| int zd_ = (digits); \ | | 92| 35.7M| mp_digit* zm_ = (mem); \ | | 93| 35.7M| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 35.7M] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 35.7M|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 44| | 45| 35.7M| b->sign = a->sign; 46| 35.7M| mp_clamp(b); 47| 35.7M| return MP_OKAY; ------------------ | | 161| 35.7M|#define MP_OKAY 0 /* no error */ ------------------ 48| 35.7M|} mp_div_2d: 8| 21.3M|{ 9| 21.3M| mp_digit D, r, rr; 10| 21.3M| int x; 11| 21.3M| mp_err err; 12| | 13| | /* if the shift count is <= 0 then we do no work */ 14| 21.3M| if (b <= 0) { ------------------ | Branch (14:8): [True: 0, False: 21.3M] ------------------ 15| 0| err = mp_copy(a, c); 16| 0| if (d != NULL) { ------------------ | Branch (16:11): [True: 0, False: 0] ------------------ 17| 0| mp_zero(d); 18| 0| } 19| 0| return err; 20| 0| } 21| | 22| | /* copy */ 23| 21.3M| if ((err = mp_copy(a, c)) != MP_OKAY) { ------------------ | | 161| 21.3M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (23:8): [True: 0, False: 21.3M] ------------------ 24| 0| return err; 25| 0| } 26| | /* 'a' should not be used after here - it might be the same as d */ 27| | 28| | /* get the remainder */ 29| 21.3M| if (d != NULL) { ------------------ | Branch (29:8): [True: 0, False: 21.3M] ------------------ 30| 0| if ((err = mp_mod_2d(a, b, d)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (30:11): [True: 0, False: 0] ------------------ 31| 0| return err; 32| 0| } 33| 0| } 34| | 35| | /* shift by as many digits in the bit count */ 36| 21.3M| if (b >= MP_DIGIT_BIT) { ------------------ | | 82| 21.3M|# define MP_DIGIT_BIT 60 ------------------ | Branch (36:8): [True: 0, False: 21.3M] ------------------ 37| 0| mp_rshd(c, b / MP_DIGIT_BIT); ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ 38| 0| } 39| | 40| | /* shift any bit count < MP_DIGIT_BIT */ 41| 21.3M| D = (mp_digit)(b % MP_DIGIT_BIT); ------------------ | | 82| 21.3M|# define MP_DIGIT_BIT 60 ------------------ 42| 21.3M| if (D != 0u) { ------------------ | Branch (42:8): [True: 21.3M, False: 0] ------------------ 43| 21.3M| mp_digit *tmpc, mask, shift; 44| | 45| | /* mask */ 46| 21.3M| mask = ((mp_digit)1 << D) - 1uL; 47| | 48| | /* shift for lsb */ 49| 21.3M| shift = (mp_digit)MP_DIGIT_BIT - D; ------------------ | | 82| 21.3M|# define MP_DIGIT_BIT 60 ------------------ 50| | 51| | /* alias */ 52| 21.3M| tmpc = c->dp + (c->used - 1); 53| | 54| | /* carry */ 55| 21.3M| r = 0; 56| 315M| for (x = c->used - 1; x >= 0; x--) { ------------------ | Branch (56:29): [True: 293M, False: 21.3M] ------------------ 57| | /* get the lower bits of this word in a temp */ 58| 293M| rr = *tmpc & mask; 59| | 60| | /* shift the current word and mix in the carry bits from the previous word */ 61| 293M| *tmpc = (*tmpc >> D) | (r << shift); 62| 293M| --tmpc; 63| | 64| | /* set the carry to the carry bits of the current word found above */ 65| 293M| r = rr; 66| 293M| } 67| 21.3M| } 68| 21.3M| mp_clamp(c); 69| 21.3M| return MP_OKAY; ------------------ | | 161| 21.3M|#define MP_OKAY 0 /* no error */ ------------------ 70| 21.3M|} mp_dr_is_modulus: 8| 35.8k|{ 9| 35.8k| int ix; 10| | 11| | /* must be at least two digits */ 12| 35.8k| if (a->used < 2) { ------------------ | Branch (12:8): [True: 0, False: 35.8k] ------------------ 13| 0| return MP_NO; ------------------ | | 159| 0|#define MP_NO 0 ------------------ 14| 0| } 15| | 16| | /* must be of the form b**k - a [a <= b] so all 17| | * but the first digit must be equal to -1 (mod b). 18| | */ 19| 35.8k| for (ix = 1; ix < a->used; ix++) { ------------------ | Branch (19:17): [True: 35.8k, False: 0] ------------------ 20| 35.8k| if (a->dp[ix] != MP_MASK) { ------------------ | | 106| 35.8k|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 35.8k|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (20:11): [True: 35.8k, False: 0] ------------------ 21| 35.8k| return MP_NO; ------------------ | | 159| 35.8k|#define MP_NO 0 ------------------ 22| 35.8k| } 23| 35.8k| } 24| 0| return MP_YES; ------------------ | | 158| 0|#define MP_YES 1 ------------------ 25| 35.8k|} mp_exch: 10| 253k|{ 11| 253k| mp_int t; 12| | 13| 253k| t = *a; 14| 253k| *a = *b; 15| 253k| *b = t; 16| 253k|} mp_exptmod: 12| 35.8k|{ 13| 35.8k| int dr; 14| | 15| | /* modulus P must be positive */ 16| 35.8k| if (P->sign == MP_NEG) { ------------------ | | 152| 35.8k|#define MP_NEG 1 /* negative */ ------------------ | Branch (16:8): [True: 0, False: 35.8k] ------------------ 17| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 18| 0| } 19| | 20| | /* if exponent X is negative we have to recurse */ 21| 35.8k| if (X->sign == MP_NEG) { ------------------ | | 152| 35.8k|#define MP_NEG 1 /* negative */ ------------------ | Branch (21:8): [True: 0, False: 35.8k] ------------------ 22| 0| mp_int tmpG, tmpX; 23| 0| mp_err err; 24| | 25| 0| if (!MP_HAS(MP_INVMOD)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ ------------------ | Branch (25:11): [Folded - Ignored] ------------------ 26| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 27| 0| } 28| | 29| 0| if ((err = mp_init_multi(&tmpG, &tmpX, NULL)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (29:11): [True: 0, False: 0] ------------------ 30| 0| return err; 31| 0| } 32| | 33| | /* first compute 1/G mod P */ 34| 0| if ((err = mp_invmod(G, P, &tmpG)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (34:11): [True: 0, False: 0] ------------------ 35| 0| goto LBL_ERR; 36| 0| } 37| | 38| | /* now get |X| */ 39| 0| if ((err = mp_abs(X, &tmpX)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (39:11): [True: 0, False: 0] ------------------ 40| 0| goto LBL_ERR; 41| 0| } 42| | 43| | /* and now compute (1/G)**|X| instead of G**X [X < 0] */ 44| 0| err = mp_exptmod(&tmpG, &tmpX, P, Y); 45| 0|LBL_ERR: 46| 0| mp_clear_multi(&tmpG, &tmpX, NULL); 47| 0| return err; 48| 0| } 49| | 50| | /* modified diminished radix reduction */ 51| 35.8k| if (MP_HAS(MP_REDUCE_IS_2K_L) && MP_HAS(MP_REDUCE_2K_L) && MP_HAS(S_MP_EXPTMOD) && ------------------ | | 150| 71.6k|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 35.8k|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 35.8k|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ if (MP_HAS(MP_REDUCE_IS_2K_L) && MP_HAS(MP_REDUCE_2K_L) && MP_HAS(S_MP_EXPTMOD) && ------------------ | | 150| 35.8k|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ if (MP_HAS(MP_REDUCE_IS_2K_L) && MP_HAS(MP_REDUCE_2K_L) && MP_HAS(S_MP_EXPTMOD) && ------------------ | | 150| 35.8k|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 52| 35.8k| (mp_reduce_is_2k_l(P) == MP_YES)) { ------------------ | | 158| 35.8k|#define MP_YES 1 ------------------ | Branch (52:8): [True: 0, False: 35.8k] ------------------ 53| 0| return s_mp_exptmod(G, X, P, Y, 1); 54| 0| } 55| | 56| | /* is it a DR modulus? default to no */ 57| 35.8k| dr = (MP_HAS(MP_DR_IS_MODULUS) && (mp_dr_is_modulus(P) == MP_YES)) ? 1 : 0; ------------------ | | 150| 71.6k|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 35.8k|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 35.8k|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ dr = (MP_HAS(MP_DR_IS_MODULUS) && (mp_dr_is_modulus(P) == MP_YES)) ? 1 : 0; ------------------ | | 158| 35.8k|#define MP_YES 1 ------------------ | Branch (57:38): [True: 0, False: 35.8k] ------------------ 58| | 59| | /* if not, is it a unrestricted DR modulus? */ 60| 35.8k| if (MP_HAS(MP_REDUCE_IS_2K) && (dr == 0)) { ------------------ | | 150| 71.6k|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 35.8k|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 35.8k|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ | Branch (60:35): [True: 35.8k, False: 0] ------------------ 61| 35.8k| dr = (mp_reduce_is_2k(P) == MP_YES) ? 2 : 0; ------------------ | | 158| 35.8k|#define MP_YES 1 ------------------ | Branch (61:12): [True: 0, False: 35.8k] ------------------ 62| 35.8k| } 63| | 64| | /* if the modulus is odd or dr != 0 use the montgomery method */ 65| 35.8k| if (MP_HAS(S_MP_EXPTMOD_FAST) && (MP_IS_ODD(P) || (dr != 0))) { ------------------ | | 150| 71.6k|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 35.8k|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 35.8k|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ if (MP_HAS(S_MP_EXPTMOD_FAST) && (MP_IS_ODD(P) || (dr != 0))) { ------------------ | | 165| 71.6k|#define MP_IS_ODD(a) (((a)->used > 0) && (((a)->dp[0] & 1u) == 1u)) | | ------------------ | | | Branch (165:24): [True: 35.8k, False: 0] | | | Branch (165:43): [True: 35.8k, False: 0] | | ------------------ ------------------ | Branch (65:54): [True: 0, False: 0] ------------------ 66| 35.8k| return s_mp_exptmod_fast(G, X, P, Y, dr); 67| 35.8k| } else if (MP_HAS(S_MP_EXPTMOD)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 68| | /* otherwise use the generic Barrett reduction technique */ 69| 0| return s_mp_exptmod(G, X, P, Y, 0); 70| 0| } else { 71| | /* no exptmod for evens */ 72| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 73| 0| } 74| 35.8k|} mp_from_ubin: 8| 83.5k|{ 9| 83.5k| mp_err err; 10| | 11| | /* make sure there are at least two digits */ 12| 83.5k| if (a->alloc < 2) { ------------------ | Branch (12:8): [True: 0, False: 83.5k] ------------------ 13| 0| if ((err = mp_grow(a, 2)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (13:11): [True: 0, False: 0] ------------------ 14| 0| return err; 15| 0| } 16| 0| } 17| | 18| | /* zero the int */ 19| 83.5k| mp_zero(a); 20| | 21| | /* read the bytes in */ 22| 11.1M| while (size-- > 0u) { ------------------ | Branch (22:11): [True: 11.0M, False: 83.5k] ------------------ 23| 11.0M| if ((err = mp_mul_2d(a, 8, a)) != MP_OKAY) { ------------------ | | 161| 11.0M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (23:11): [True: 0, False: 11.0M] ------------------ 24| 0| return err; 25| 0| } 26| | 27| 11.0M|#ifndef MP_8BIT 28| 11.0M| a->dp[0] |= *buf++; 29| 11.0M| a->used += 1; 30| |#else 31| | a->dp[0] = (*buf & MP_MASK); 32| | a->dp[1] |= ((*buf++ >> 7) & 1u); 33| | a->used += 2; 34| |#endif 35| 11.0M| } 36| 83.5k| mp_clamp(a); 37| 83.5k| return MP_OKAY; ------------------ | | 161| 83.5k|#define MP_OKAY 0 /* no error */ ------------------ 38| 83.5k|} mp_grow: 8| 2.31M|{ 9| 2.31M| int i; 10| 2.31M| mp_digit *tmp; 11| | 12| | /* if the alloc size is smaller alloc more ram */ 13| 2.31M| if (a->alloc < size) { ------------------ | Branch (13:8): [True: 2.27M, False: 39.5k] ------------------ 14| | /* reallocate the array a->dp 15| | * 16| | * We store the return in a temporary variable 17| | * in case the operation failed we don't want 18| | * to overwrite the dp member of a. 19| | */ 20| 2.27M| tmp = (mp_digit *) MP_REALLOC(a->dp, ------------------ | | 1325| 2.27M|#define MP_REALLOC m_realloc_ltm ------------------ 21| 2.27M| (size_t)a->alloc * sizeof(mp_digit), 22| 2.27M| (size_t)size * sizeof(mp_digit)); 23| 2.27M| if (tmp == NULL) { ------------------ | Branch (23:11): [True: 0, False: 2.27M] ------------------ 24| | /* reallocation failed but "a" is still valid [can be freed] */ 25| 0| return MP_MEM; ------------------ | | 163| 0|#define MP_MEM -2 /* out of mem */ ------------------ 26| 0| } 27| | 28| | /* reallocation succeeded so set a->dp */ 29| 2.27M| a->dp = tmp; 30| | 31| | /* zero excess digits */ 32| 2.27M| i = a->alloc; 33| 2.27M| a->alloc = size; 34| 2.27M| MP_ZERO_DIGITS(a->dp + i, a->alloc - i); ------------------ | | 89| 2.27M|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 2.27M|do { \ | | 91| 2.27M| int zd_ = (digits); \ | | 92| 2.27M| mp_digit* zm_ = (mem); \ | | 93| 59.1M| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 56.8M, False: 2.27M] | | ------------------ | | 94| 56.8M| *zm_++ = 0; \ | | 95| 56.8M| } \ | | 96| 2.27M|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 35| 2.27M| } 36| 2.31M| return MP_OKAY; ------------------ | | 161| 2.31M|#define MP_OKAY 0 /* no error */ ------------------ 37| 2.31M|} mp_init: 8| 8.83M|{ 9| | /* allocate memory required and clear it */ 10| 8.83M| a->dp = (mp_digit *) MP_CALLOC((size_t)MP_PREC, sizeof(mp_digit)); ------------------ | | 1326| 8.83M|#define MP_CALLOC m_calloc ------------------ a->dp = (mp_digit *) MP_CALLOC((size_t)MP_PREC, sizeof(mp_digit)); ------------------ | | 177| 8.83M|# define MP_PREC PRIVATE_MP_PREC | | ------------------ | | | | 193| 8.83M|# define PRIVATE_MP_PREC 32 /* default digits of precision */ | | ------------------ ------------------ 11| 8.83M| if (a->dp == NULL) { ------------------ | Branch (11:8): [True: 0, False: 8.83M] ------------------ 12| 0| return MP_MEM; ------------------ | | 163| 0|#define MP_MEM -2 /* out of mem */ ------------------ 13| 0| } 14| | 15| | /* set the used to zero, allocated digits to the default precision 16| | * and sign to positive */ 17| 8.83M| a->used = 0; 18| 8.83M| a->alloc = MP_PREC; ------------------ | | 177| 8.83M|# define MP_PREC PRIVATE_MP_PREC | | ------------------ | | | | 193| 8.83M|# define PRIVATE_MP_PREC 32 /* default digits of precision */ | | ------------------ ------------------ 19| 8.83M| a->sign = MP_ZPOS; ------------------ | | 151| 8.83M|#define MP_ZPOS 0 /* positive integer */ ------------------ 20| | 21| 8.83M| return MP_OKAY; ------------------ | | 161| 8.83M|#define MP_OKAY 0 /* no error */ ------------------ 22| 8.83M|} mp_init_copy: 8| 353k|{ 9| 353k| mp_err err; 10| | 11| 353k| if ((err = mp_init_size(a, b->used)) != MP_OKAY) { ------------------ | | 161| 353k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (11:8): [True: 0, False: 353k] ------------------ 12| 0| return err; 13| 0| } 14| | 15| 353k| if ((err = mp_copy(b, a)) != MP_OKAY) { ------------------ | | 161| 353k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (15:8): [True: 0, False: 353k] ------------------ 16| 0| mp_clear(a); 17| 0| } 18| | 19| 353k| return err; 20| 353k|} mp_init_multi: 9| 19.6k|{ 10| 19.6k| mp_err err = MP_OKAY; /* Assume ok until proven otherwise */ ------------------ | | 161| 19.6k|#define MP_OKAY 0 /* no error */ ------------------ 11| 19.6k| int n = 0; /* Number of ok inits */ 12| 19.6k| mp_int *cur_arg = mp; 13| 19.6k| va_list args; 14| | 15| 19.6k| va_start(args, mp); /* init args to next argument from caller */ 16| 137k| while (cur_arg != NULL) { ------------------ | Branch (16:11): [True: 117k, False: 19.6k] ------------------ 17| 117k| if (mp_init(cur_arg) != MP_OKAY) { ------------------ | | 161| 117k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (17:11): [True: 0, False: 117k] ------------------ 18| | /* Oops - error! Back-track and mp_clear what we already 19| | succeeded in init-ing, then return error. 20| | */ 21| 0| va_list clean_args; 22| | 23| | /* now start cleaning up */ 24| 0| cur_arg = mp; 25| 0| va_start(clean_args, mp); 26| 0| while (n-- != 0) { ------------------ | Branch (26:17): [True: 0, False: 0] ------------------ 27| 0| mp_clear(cur_arg); 28| 0| cur_arg = va_arg(clean_args, mp_int *); 29| 0| } 30| 0| va_end(clean_args); 31| 0| err = MP_MEM; ------------------ | | 163| 0|#define MP_MEM -2 /* out of mem */ ------------------ 32| 0| break; 33| 0| } 34| 117k| n++; 35| 117k| cur_arg = va_arg(args, mp_int *); 36| 117k| } 37| 19.6k| va_end(args); 38| 19.6k| return err; /* Assumed ok, if error flagged above. */ 39| 19.6k|} mp_init_size: 8| 2.34M|{ 9| 2.34M| size = MP_MAX(MP_MIN_PREC, size); ------------------ | | 157| 2.34M|#define MP_MAX(x, y) (((x) > (y)) ? (x) : (y)) | | ------------------ | | | Branch (157:23): [True: 17.8k, False: 2.32M] | | ------------------ ------------------ 10| | 11| | /* alloc mem */ 12| 2.34M| a->dp = (mp_digit *) MP_CALLOC((size_t)size, sizeof(mp_digit)); ------------------ | | 1326| 2.34M|#define MP_CALLOC m_calloc ------------------ 13| 2.34M| if (a->dp == NULL) { ------------------ | Branch (13:8): [True: 0, False: 2.34M] ------------------ 14| 0| return MP_MEM; ------------------ | | 163| 0|#define MP_MEM -2 /* out of mem */ ------------------ 15| 0| } 16| | 17| | /* set the members */ 18| 2.34M| a->used = 0; 19| 2.34M| a->alloc = size; 20| 2.34M| a->sign = MP_ZPOS; ------------------ | | 151| 2.34M|#define MP_ZPOS 0 /* positive integer */ ------------------ 21| | 22| 2.34M| return MP_OKAY; ------------------ | | 161| 2.34M|#define MP_OKAY 0 /* no error */ ------------------ 23| 2.34M|} mp_invmod: 8| 19.6k|{ 9| | /* b cannot be negative and has to be >1 */ 10| 19.6k| if ((b->sign == MP_NEG) || (mp_cmp_d(b, 1uL) != MP_GT)) { ------------------ | | 152| 19.6k|#define MP_NEG 1 /* negative */ ------------------ if ((b->sign == MP_NEG) || (mp_cmp_d(b, 1uL) != MP_GT)) { ------------------ | | 156| 19.6k|#define MP_GT 1 /* greater than */ ------------------ | Branch (10:8): [True: 0, False: 19.6k] | Branch (10:31): [True: 0, False: 19.6k] ------------------ 11| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 12| 0| } 13| | 14| | /* if the modulus is odd we can use a faster routine instead */ 15| 19.6k| if (MP_HAS(S_MP_INVMOD_FAST) && MP_IS_ODD(b)) { ------------------ | | 150| 39.2k|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 19.6k|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 19.6k|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ if (MP_HAS(S_MP_INVMOD_FAST) && MP_IS_ODD(b)) { ------------------ | | 165| 19.6k|#define MP_IS_ODD(a) (((a)->used > 0) && (((a)->dp[0] & 1u) == 1u)) | | ------------------ | | | Branch (165:24): [True: 19.6k, False: 0] | | | Branch (165:43): [True: 19.6k, False: 0] | | ------------------ ------------------ 16| 19.6k| return s_mp_invmod_fast(a, b, c); 17| 19.6k| } 18| | 19| 0| return MP_HAS(S_MP_INVMOD_SLOW) ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 20| 0| ? s_mp_invmod_slow(a, b, c) 21| 0| : MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 22| 19.6k|} mp_lshd: 8| 1.09M|{ 9| 1.09M| int x; 10| 1.09M| mp_err err; 11| 1.09M| mp_digit *top, *bottom; 12| | 13| | /* if its less than zero return */ 14| 1.09M| if (b <= 0) { ------------------ | Branch (14:8): [True: 82.9k, False: 1.01M] ------------------ 15| 82.9k| return MP_OKAY; ------------------ | | 161| 82.9k|#define MP_OKAY 0 /* no error */ ------------------ 16| 82.9k| } 17| | /* no need to shift 0 around */ 18| 1.01M| if (MP_IS_ZERO(a)) { ------------------ | | 163| 1.01M|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 1.01M] | | ------------------ ------------------ 19| 0| return MP_OKAY; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ 20| 0| } 21| | 22| | /* grow to fit the new digits */ 23| 1.01M| if (a->alloc < (a->used + b)) { ------------------ | Branch (23:8): [True: 97.0k, False: 918k] ------------------ 24| 97.0k| if ((err = mp_grow(a, a->used + b)) != MP_OKAY) { ------------------ | | 161| 97.0k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (24:11): [True: 0, False: 97.0k] ------------------ 25| 0| return err; 26| 0| } 27| 97.0k| } 28| | 29| | /* increment the used by the shift amount then copy upwards */ 30| 1.01M| a->used += b; 31| | 32| | /* top */ 33| 1.01M| top = a->dp + a->used - 1; 34| | 35| | /* base */ 36| 1.01M| bottom = (a->dp + a->used - 1) - b; 37| | 38| | /* much like mp_rshd this is implemented using a sliding window 39| | * except the window goes the otherway around. Copying from 40| | * the bottom to the top. see bn_mp_rshd.c for more info. 41| | */ 42| 26.1M| for (x = a->used - 1; x >= b; x--) { ------------------ | Branch (42:26): [True: 25.1M, False: 1.01M] ------------------ 43| 25.1M| *top-- = *bottom--; 44| 25.1M| } 45| | 46| | /* zero the lower digits */ 47| 1.01M| MP_ZERO_DIGITS(a->dp, b); ------------------ | | 89| 1.01M|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 1.01M|do { \ | | 91| 1.01M| int zd_ = (digits); \ | | 92| 1.01M| mp_digit* zm_ = (mem); \ | | 93| 14.2M| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 13.2M, False: 1.01M] | | ------------------ | | 94| 13.2M| *zm_++ = 0; \ | | 95| 13.2M| } \ | | 96| 1.01M|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 48| | 49| 1.01M| return MP_OKAY; ------------------ | | 161| 1.01M|#define MP_OKAY 0 /* no error */ ------------------ 50| 1.01M|} mp_mod: 8| 114k|{ 9| 114k| mp_int t; 10| 114k| mp_err err; 11| | 12| 114k| if ((err = mp_init_size(&t, b->used)) != MP_OKAY) { ------------------ | | 161| 114k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (12:8): [True: 0, False: 114k] ------------------ 13| 0| return err; 14| 0| } 15| | 16| 114k| if ((err = mp_div(a, b, NULL, &t)) != MP_OKAY) { ------------------ | | 161| 114k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (16:8): [True: 0, False: 114k] ------------------ 17| 0| goto LBL_ERR; 18| 0| } 19| | 20| 114k| if (MP_IS_ZERO(&t) || (t.sign == b->sign)) { ------------------ | | 163| 229k|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 114k] | | ------------------ ------------------ | Branch (20:26): [True: 114k, False: 0] ------------------ 21| 114k| err = MP_OKAY; ------------------ | | 161| 114k|#define MP_OKAY 0 /* no error */ ------------------ 22| 114k| mp_exch(&t, c); 23| 114k| } else { 24| 0| err = mp_add(b, &t, c); 25| 0| } 26| | 27| 114k|LBL_ERR: 28| 114k| mp_clear(&t); 29| 114k| return err; 30| 114k|} mp_montgomery_calc_normalization: 13| 39.5k|{ 14| 39.5k| int x, bits; 15| 39.5k| mp_err err; 16| | 17| | /* how many bits of last digit does b use */ 18| 39.5k| bits = mp_count_bits(b) % MP_DIGIT_BIT; ------------------ | | 82| 39.5k|# define MP_DIGIT_BIT 60 ------------------ 19| | 20| 39.5k| if (b->used > 1) { ------------------ | Branch (20:8): [True: 39.5k, False: 0] ------------------ 21| 39.5k| if ((err = mp_2expt(a, ((b->used - 1) * MP_DIGIT_BIT) + bits - 1)) != MP_OKAY) { ------------------ | | 82| 39.5k|# define MP_DIGIT_BIT 60 ------------------ if ((err = mp_2expt(a, ((b->used - 1) * MP_DIGIT_BIT) + bits - 1)) != MP_OKAY) { ------------------ | | 161| 39.5k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (21:11): [True: 0, False: 39.5k] ------------------ 22| 0| return err; 23| 0| } 24| 39.5k| } else { 25| 0| mp_set(a, 1uL); 26| 0| bits = 1; 27| 0| } 28| | 29| | 30| | /* now compute C = A * B mod b */ 31| 2.13M| for (x = bits - 1; x < (int)MP_DIGIT_BIT; x++) { ------------------ | | 82| 2.13M|# define MP_DIGIT_BIT 60 ------------------ | Branch (31:23): [True: 2.09M, False: 39.5k] ------------------ 32| 2.09M| if ((err = mp_mul_2(a, a)) != MP_OKAY) { ------------------ | | 161| 2.09M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (32:11): [True: 0, False: 2.09M] ------------------ 33| 0| return err; 34| 0| } 35| 2.09M| if (mp_cmp_mag(a, b) != MP_LT) { ------------------ | | 154| 2.09M|#define MP_LT -1 /* less than */ ------------------ | Branch (35:11): [True: 463k, False: 1.63M] ------------------ 36| 463k| if ((err = s_mp_sub(a, b, a)) != MP_OKAY) { ------------------ | | 161| 463k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (36:14): [True: 0, False: 463k] ------------------ 37| 0| return err; 38| 0| } 39| 463k| } 40| 2.09M| } 41| | 42| 39.5k| return MP_OKAY; ------------------ | | 161| 39.5k|#define MP_OKAY 0 /* no error */ ------------------ 43| 39.5k|} mp_montgomery_reduce: 8| 28.3M|{ 9| 28.3M| int ix, digs; 10| 28.3M| mp_err err; 11| 28.3M| mp_digit mu; 12| | 13| | /* can the fast reduction [comba] method be used? 14| | * 15| | * Note that unlike in mul you're safely allowed *less* 16| | * than the available columns [255 per default] since carries 17| | * are fixed up in the inner loop. 18| | */ 19| 28.3M| digs = (n->used * 2) + 1; 20| 28.3M| if ((digs < MP_WARRAY) && ------------------ | | 172| 28.3M|#define MP_WARRAY PRIVATE_MP_WARRAY | | ------------------ | | | | 203| 28.3M|#define PRIVATE_MP_WARRAY (int)(1uLL << (((CHAR_BIT * sizeof(private_mp_word)) - (2 * MP_DIGIT_BIT)) + 1)) | | | | ------------------ | | | | | | 82| 28.3M|# define MP_DIGIT_BIT 60 | | | | ------------------ | | ------------------ ------------------ | Branch (20:8): [True: 28.3M, False: 0] ------------------ 21| 28.3M| (x->used <= MP_WARRAY) && ------------------ | | 172| 28.3M|#define MP_WARRAY PRIVATE_MP_WARRAY | | ------------------ | | | | 203| 28.3M|#define PRIVATE_MP_WARRAY (int)(1uLL << (((CHAR_BIT * sizeof(private_mp_word)) - (2 * MP_DIGIT_BIT)) + 1)) | | | | ------------------ | | | | | | 82| 28.3M|# define MP_DIGIT_BIT 60 | | | | ------------------ | | ------------------ ------------------ | Branch (21:8): [True: 28.3M, False: 0] ------------------ 22| 28.3M| (n->used < MP_MAXFAST)) { ------------------ | | 168| 28.3M|#define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 167| 28.3M|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) | | ------------------ | | #define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 82| 28.3M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (22:8): [True: 28.3M, False: 0] ------------------ 23| 28.3M| return s_mp_montgomery_reduce_fast(x, n, rho); 24| 28.3M| } 25| | 26| | /* grow the input as required */ 27| 0| if (x->alloc < digs) { ------------------ | Branch (27:8): [True: 0, False: 0] ------------------ 28| 0| if ((err = mp_grow(x, digs)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (28:11): [True: 0, False: 0] ------------------ 29| 0| return err; 30| 0| } 31| 0| } 32| 0| x->used = digs; 33| | 34| 0| for (ix = 0; ix < n->used; ix++) { ------------------ | Branch (34:17): [True: 0, False: 0] ------------------ 35| | /* mu = ai * rho mod b 36| | * 37| | * The value of rho must be precalculated via 38| | * montgomery_setup() such that 39| | * it equals -1/n0 mod b this allows the 40| | * following inner loop to reduce the 41| | * input one digit at a time 42| | */ 43| 0| mu = (mp_digit)(((mp_word)x->dp[ix] * (mp_word)rho) & MP_MASK); ------------------ | | 106| 0|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 0|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 44| | 45| | /* a = a + mu * m * b**i */ 46| 0| { 47| 0| int iy; 48| 0| mp_digit *tmpn, *tmpx, u; 49| 0| mp_word r; 50| | 51| | /* alias for digits of the modulus */ 52| 0| tmpn = n->dp; 53| | 54| | /* alias for the digits of x [the input] */ 55| 0| tmpx = x->dp + ix; 56| | 57| | /* set the carry to zero */ 58| 0| u = 0; 59| | 60| | /* Multiply and add in place */ 61| 0| for (iy = 0; iy < n->used; iy++) { ------------------ | Branch (61:23): [True: 0, False: 0] ------------------ 62| | /* compute product and sum */ 63| 0| r = ((mp_word)mu * (mp_word)*tmpn++) + 64| 0| (mp_word)u + (mp_word)*tmpx; 65| | 66| | /* get carry */ 67| 0| u = (mp_digit)(r >> (mp_word)MP_DIGIT_BIT); ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ 68| | 69| | /* fix digit */ 70| 0| *tmpx++ = (mp_digit)(r & (mp_word)MP_MASK); ------------------ | | 106| 0|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 0|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 71| 0| } 72| | /* At this point the ix'th digit of x should be zero */ 73| | 74| | 75| | /* propagate carries upwards as required*/ 76| 0| while (u != 0u) { ------------------ | Branch (76:17): [True: 0, False: 0] ------------------ 77| 0| *tmpx += u; 78| 0| u = *tmpx >> MP_DIGIT_BIT; ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ 79| 0| *tmpx++ &= MP_MASK; ------------------ | | 106| 0|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 0|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 80| 0| } 81| 0| } 82| 0| } 83| | 84| | /* at this point the n.used'th least 85| | * significant digits of x are all zero 86| | * which means we can shift x to the 87| | * right by n.used digits and the 88| | * residue is unchanged. 89| | */ 90| | 91| | /* x = x/b**n.used */ 92| 0| mp_clamp(x); 93| 0| mp_rshd(x, n->used); 94| | 95| | /* if x >= n then x = x - n */ 96| 0| if (mp_cmp_mag(x, n) != MP_LT) { ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ | Branch (96:8): [True: 0, False: 0] ------------------ 97| 0| return s_mp_sub(x, n, x); 98| 0| } 99| | 100| 0| return MP_OKAY; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ 101| 0|} mp_montgomery_setup: 8| 39.5k|{ 9| 39.5k| mp_digit x, b; 10| | 11| | /* fast inversion mod 2**k 12| | * 13| | * Based on the fact that 14| | * 15| | * XA = 1 (mod 2**n) => (X(2-XA)) A = 1 (mod 2**2n) 16| | * => 2*X*A - X*X*A*A = 1 17| | * => 2*(1) - (1) = 1 18| | */ 19| 39.5k| b = n->dp[0]; 20| | 21| 39.5k| if ((b & 1u) == 0u) { ------------------ | Branch (21:8): [True: 0, False: 39.5k] ------------------ 22| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 23| 0| } 24| | 25| 39.5k| x = (((b + 2u) & 4u) << 1) + b; /* here x*a==1 mod 2**4 */ 26| 39.5k| x *= 2u - (b * x); /* here x*a==1 mod 2**8 */ 27| 39.5k|#if !defined(MP_8BIT) 28| 39.5k| x *= 2u - (b * x); /* here x*a==1 mod 2**16 */ 29| 39.5k|#endif 30| 39.5k|#if defined(MP_64BIT) || !(defined(MP_8BIT) || defined(MP_16BIT)) 31| 39.5k| x *= 2u - (b * x); /* here x*a==1 mod 2**32 */ 32| 39.5k|#endif 33| 39.5k|#ifdef MP_64BIT 34| 39.5k| x *= 2u - (b * x); /* here x*a==1 mod 2**64 */ 35| 39.5k|#endif 36| | 37| | /* rho = -1/m mod b */ 38| 39.5k| *rho = (mp_digit)(((mp_word)1 << (mp_word)MP_DIGIT_BIT) - x) & MP_MASK; ------------------ | | 82| 39.5k|# define MP_DIGIT_BIT 60 ------------------ *rho = (mp_digit)(((mp_word)1 << (mp_word)MP_DIGIT_BIT) - x) & MP_MASK; ------------------ | | 106| 39.5k|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 39.5k|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 39| | 40| 39.5k| return MP_OKAY; ------------------ | | 161| 39.5k|#define MP_OKAY 0 /* no error */ ------------------ 41| 39.5k|} mp_mul: 8| 26.8M|{ 9| 26.8M| mp_err err; 10| 26.8M| int min_len = MP_MIN(a->used, b->used), ------------------ | | 156| 26.8M|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 114k, False: 26.7M] | | ------------------ ------------------ 11| 26.8M| max_len = MP_MAX(a->used, b->used), ------------------ | | 157| 26.8M|#define MP_MAX(x, y) (((x) > (y)) ? (x) : (y)) | | ------------------ | | | Branch (157:23): [True: 859k, False: 26.0M] | | ------------------ ------------------ 12| 26.8M| digs = a->used + b->used + 1; 13| 26.8M| mp_sign neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 151| 26.8M|#define MP_ZPOS 0 /* positive integer */ ------------------ mp_sign neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ | Branch (13:18): [True: 26.8M, False: 0] ------------------ 14| | 15| 26.8M| if (MP_HAS(S_MP_BALANCE_MUL) && ------------------ | | 150| 53.7M|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 26.8M|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 26.8M|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 16| | /* Check sizes. The smaller one needs to be larger than the Karatsuba cut-off. 17| | * The bigger one needs to be at least about one MP_KARATSUBA_MUL_CUTOFF bigger 18| | * to make some sense, but it depends on architecture, OS, position of the 19| | * stars... so YMMV. 20| | * Using it to cut the input into slices small enough for fast_s_mp_mul_digs 21| | * was actually slower on the author's machine, but YMMV. 22| | */ 23| 26.8M| (min_len >= MP_KARATSUBA_MUL_CUTOFF) && ------------------ | | 121| 26.8M|# define MP_KARATSUBA_MUL_CUTOFF KARATSUBA_MUL_CUTOFF ------------------ | Branch (23:8): [True: 0, False: 26.8M] ------------------ 24| 26.8M| ((max_len / 2) >= MP_KARATSUBA_MUL_CUTOFF) && ------------------ | | 121| 0|# define MP_KARATSUBA_MUL_CUTOFF KARATSUBA_MUL_CUTOFF ------------------ | Branch (24:8): [True: 0, False: 0] ------------------ 25| | /* Not much effect was observed below a ratio of 1:2, but again: YMMV. */ 26| 26.8M| (max_len >= (2 * min_len))) { ------------------ | Branch (26:8): [True: 0, False: 0] ------------------ 27| 0| err = s_mp_balance_mul(a,b,c); 28| 26.8M| } else if (MP_HAS(S_MP_TOOM_MUL) && ------------------ | | 150| 53.7M|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 26.8M|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 26.8M|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 29| 26.8M| (min_len >= MP_TOOM_MUL_CUTOFF)) { ------------------ | | 123| 0|# define MP_TOOM_MUL_CUTOFF TOOM_MUL_CUTOFF ------------------ | Branch (29:15): [True: 0, False: 0] ------------------ 30| 0| err = s_mp_toom_mul(a, b, c); 31| 26.8M| } else if (MP_HAS(S_MP_KARATSUBA_MUL) && ------------------ | | 150| 53.7M|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 26.8M|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 26.8M|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 32| 26.8M| (min_len >= MP_KARATSUBA_MUL_CUTOFF)) { ------------------ | | 121| 0|# define MP_KARATSUBA_MUL_CUTOFF KARATSUBA_MUL_CUTOFF ------------------ | Branch (32:15): [True: 0, False: 0] ------------------ 33| 0| err = s_mp_karatsuba_mul(a, b, c); 34| 26.8M| } else if (MP_HAS(S_MP_MUL_DIGS_FAST) && ------------------ | | 150| 53.7M|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 26.8M|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 26.8M|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 35| | /* can we use the fast multiplier? 36| | * 37| | * The fast multiplier can be used if the output will 38| | * have less than MP_WARRAY digits and the number of 39| | * digits won't affect carry propagation 40| | */ 41| 26.8M| (digs < MP_WARRAY) && ------------------ | | 172| 26.8M|#define MP_WARRAY PRIVATE_MP_WARRAY | | ------------------ | | | | 203| 26.8M|#define PRIVATE_MP_WARRAY (int)(1uLL << (((CHAR_BIT * sizeof(private_mp_word)) - (2 * MP_DIGIT_BIT)) + 1)) | | | | ------------------ | | | | | | 82| 26.8M|# define MP_DIGIT_BIT 60 | | | | ------------------ | | ------------------ ------------------ | Branch (41:15): [True: 26.8M, False: 0] ------------------ 42| 26.8M| (min_len <= MP_MAXFAST)) { ------------------ | | 168| 26.8M|#define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 167| 26.8M|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) | | ------------------ | | #define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 82| 26.8M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (42:15): [True: 26.8M, False: 0] ------------------ 43| 26.8M| err = s_mp_mul_digs_fast(a, b, c, digs); 44| 26.8M| } else if (MP_HAS(S_MP_MUL_DIGS)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 45| 0| err = s_mp_mul_digs(a, b, c, digs); 46| 0| } else { 47| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 48| 0| } 49| 26.8M| c->sign = (c->used > 0) ? neg : MP_ZPOS; ------------------ | | 151| 26.8M|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (49:14): [True: 26.8M, False: 0] ------------------ 50| 26.8M| return err; 51| 26.8M|} mp_mul_2: 8| 2.09M|{ 9| 2.09M| int x, oldused; 10| 2.09M| mp_err err; 11| | 12| | /* grow to accomodate result */ 13| 2.09M| if (b->alloc < (a->used + 1)) { ------------------ | Branch (13:8): [True: 0, False: 2.09M] ------------------ 14| 0| if ((err = mp_grow(b, a->used + 1)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (14:11): [True: 0, False: 0] ------------------ 15| 0| return err; 16| 0| } 17| 0| } 18| | 19| 2.09M| oldused = b->used; 20| 2.09M| b->used = a->used; 21| | 22| 2.09M| { 23| 2.09M| mp_digit r, rr, *tmpa, *tmpb; 24| | 25| | /* alias for source */ 26| 2.09M| tmpa = a->dp; 27| | 28| | /* alias for dest */ 29| 2.09M| tmpb = b->dp; 30| | 31| | /* carry */ 32| 2.09M| r = 0; 33| 61.4M| for (x = 0; x < a->used; x++) { ------------------ | Branch (33:19): [True: 59.3M, False: 2.09M] ------------------ 34| | 35| | /* get what will be the *next* carry bit from the 36| | * MSB of the current digit 37| | */ 38| 59.3M| rr = *tmpa >> (mp_digit)(MP_DIGIT_BIT - 1); ------------------ | | 82| 59.3M|# define MP_DIGIT_BIT 60 ------------------ 39| | 40| | /* now shift up this digit, add in the carry [from the previous] */ 41| 59.3M| *tmpb++ = ((*tmpa++ << 1uL) | r) & MP_MASK; ------------------ | | 106| 59.3M|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 59.3M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 42| | 43| | /* copy the carry that would be from the source 44| | * digit into the next iteration 45| | */ 46| 59.3M| r = rr; 47| 59.3M| } 48| | 49| | /* new leading digit? */ 50| 2.09M| if (r != 0u) { ------------------ | Branch (50:11): [True: 44.5k, False: 2.05M] ------------------ 51| | /* add a MSB which is always 1 at this point */ 52| 44.5k| *tmpb = 1; 53| 44.5k| ++(b->used); 54| 44.5k| } 55| | 56| | /* now zero any excess digits on the destination 57| | * that we didn't write to 58| | */ 59| 2.09M| MP_ZERO_DIGITS(b->dp + b->used, oldused - b->used); ------------------ | | 89| 2.09M|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 2.09M|do { \ | | 91| 2.09M| int zd_ = (digits); \ | | 92| 2.09M| mp_digit* zm_ = (mem); \ | | 93| 2.09M| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 2.09M] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 2.09M|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 60| 2.09M| } 61| 2.09M| b->sign = a->sign; 62| 2.09M| return MP_OKAY; ------------------ | | 161| 2.09M|#define MP_OKAY 0 /* no error */ ------------------ 63| 2.09M|} mp_mul_2d: 8| 11.2M|{ 9| 11.2M| mp_digit d; 10| 11.2M| mp_err err; 11| | 12| | /* copy */ 13| 11.2M| if (a != c) { ------------------ | Branch (13:8): [True: 0, False: 11.2M] ------------------ 14| 0| if ((err = mp_copy(a, c)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (14:11): [True: 0, False: 0] ------------------ 15| 0| return err; 16| 0| } 17| 0| } 18| | 19| 11.2M| if (c->alloc < (c->used + (b / MP_DIGIT_BIT) + 1)) { ------------------ | | 82| 11.2M|# define MP_DIGIT_BIT 60 ------------------ | Branch (19:8): [True: 277k, False: 10.9M] ------------------ 20| 277k| if ((err = mp_grow(c, c->used + (b / MP_DIGIT_BIT) + 1)) != MP_OKAY) { ------------------ | | 82| 277k|# define MP_DIGIT_BIT 60 ------------------ if ((err = mp_grow(c, c->used + (b / MP_DIGIT_BIT) + 1)) != MP_OKAY) { ------------------ | | 161| 277k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (20:11): [True: 0, False: 277k] ------------------ 21| 0| return err; 22| 0| } 23| 277k| } 24| | 25| | /* shift by as many digits in the bit count */ 26| 11.2M| if (b >= MP_DIGIT_BIT) { ------------------ | | 82| 11.2M|# define MP_DIGIT_BIT 60 ------------------ | Branch (26:8): [True: 0, False: 11.2M] ------------------ 27| 0| if ((err = mp_lshd(c, b / MP_DIGIT_BIT)) != MP_OKAY) { ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ if ((err = mp_lshd(c, b / MP_DIGIT_BIT)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (27:11): [True: 0, False: 0] ------------------ 28| 0| return err; 29| 0| } 30| 0| } 31| | 32| | /* shift any bit count < MP_DIGIT_BIT */ 33| 11.2M| d = (mp_digit)(b % MP_DIGIT_BIT); ------------------ | | 82| 11.2M|# define MP_DIGIT_BIT 60 ------------------ 34| 11.2M| if (d != 0u) { ------------------ | Branch (34:8): [True: 11.2M, False: 0] ------------------ 35| 11.2M| mp_digit *tmpc, shift, mask, r, rr; 36| 11.2M| int x; 37| | 38| | /* bitmask for carries */ 39| 11.2M| mask = ((mp_digit)1 << d) - (mp_digit)1; 40| | 41| | /* shift for msbs */ 42| 11.2M| shift = (mp_digit)MP_DIGIT_BIT - d; ------------------ | | 82| 11.2M|# define MP_DIGIT_BIT 60 ------------------ 43| | 44| | /* alias */ 45| 11.2M| tmpc = c->dp; 46| | 47| | /* carry */ 48| 11.2M| r = 0; 49| 204M| for (x = 0; x < c->used; x++) { ------------------ | Branch (49:19): [True: 193M, False: 11.2M] ------------------ 50| | /* get the higher bits of the current word */ 51| 193M| rr = (*tmpc >> shift) & mask; 52| | 53| | /* shift the current word and OR in the carry */ 54| 193M| *tmpc = ((*tmpc << d) | r) & MP_MASK; ------------------ | | 106| 193M|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 193M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 55| 193M| ++tmpc; 56| | 57| | /* set the carry to the carry bits of the current word */ 58| 193M| r = rr; 59| 193M| } 60| | 61| | /* set final carry */ 62| 11.2M| if (r != 0u) { ------------------ | Branch (62:11): [True: 45.6k, False: 11.1M] ------------------ 63| 45.6k| c->dp[(c->used)++] = r; 64| 45.6k| } 65| 11.2M| } 66| 11.2M| mp_clamp(c); 67| 11.2M| return MP_OKAY; ------------------ | | 161| 11.2M|#define MP_OKAY 0 /* no error */ ------------------ 68| 11.2M|} mp_mul_d: 8| 4.16M|{ 9| 4.16M| mp_digit u, *tmpa, *tmpc; 10| 4.16M| mp_word r; 11| 4.16M| mp_err err; 12| 4.16M| int ix, olduse; 13| | 14| | /* make sure c is big enough to hold a*b */ 15| 4.16M| if (c->alloc < (a->used + 1)) { ------------------ | Branch (15:8): [True: 17.3k, False: 4.14M] ------------------ 16| 17.3k| if ((err = mp_grow(c, a->used + 1)) != MP_OKAY) { ------------------ | | 161| 17.3k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (16:11): [True: 0, False: 17.3k] ------------------ 17| 0| return err; 18| 0| } 19| 17.3k| } 20| | 21| | /* get the original destinations used count */ 22| 4.16M| olduse = c->used; 23| | 24| | /* set the sign */ 25| 4.16M| c->sign = a->sign; 26| | 27| | /* alias for a->dp [source] */ 28| 4.16M| tmpa = a->dp; 29| | 30| | /* alias for c->dp [dest] */ 31| 4.16M| tmpc = c->dp; 32| | 33| | /* zero carry */ 34| 4.16M| u = 0; 35| | 36| | /* compute columns */ 37| 35.6M| for (ix = 0; ix < a->used; ix++) { ------------------ | Branch (37:17): [True: 31.4M, False: 4.16M] ------------------ 38| | /* compute product and carry sum for this term */ 39| 31.4M| r = (mp_word)u + ((mp_word)*tmpa++ * (mp_word)b); 40| | 41| | /* mask off higher bits to get a single digit */ 42| 31.4M| *tmpc++ = (mp_digit)(r & (mp_word)MP_MASK); ------------------ | | 106| 31.4M|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 31.4M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 43| | 44| | /* send carry into next iteration */ 45| 31.4M| u = (mp_digit)(r >> (mp_word)MP_DIGIT_BIT); ------------------ | | 82| 31.4M|# define MP_DIGIT_BIT 60 ------------------ 46| 31.4M| } 47| | 48| | /* store final carry [if any] and increment ix offset */ 49| 4.16M| *tmpc++ = u; 50| 4.16M| ++ix; 51| | 52| | /* now zero digits above the top */ 53| 4.16M| MP_ZERO_DIGITS(tmpc, olduse - ix); ------------------ | | 89| 4.16M|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 4.16M|do { \ | | 91| 4.16M| int zd_ = (digits); \ | | 92| 4.16M| mp_digit* zm_ = (mem); \ | | 93| 4.16M| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 4.16M] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 4.16M|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 54| | 55| | /* set used count */ 56| 4.16M| c->used = a->used + 1; 57| 4.16M| mp_clamp(c); 58| | 59| 4.16M| return MP_OKAY; ------------------ | | 161| 4.16M|#define MP_OKAY 0 /* no error */ ------------------ 60| 4.16M|} mp_mulmod: 8| 78.8k|{ 9| 78.8k| mp_err err; 10| 78.8k| mp_int t; 11| | 12| 78.8k| if ((err = mp_init_size(&t, c->used)) != MP_OKAY) { ------------------ | | 161| 78.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (12:8): [True: 0, False: 78.8k] ------------------ 13| 0| return err; 14| 0| } 15| | 16| 78.8k| if ((err = mp_mul(a, b, &t)) != MP_OKAY) { ------------------ | | 161| 78.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (16:8): [True: 0, False: 78.8k] ------------------ 17| 0| goto LBL_ERR; 18| 0| } 19| 78.8k| err = mp_mod(&t, c, d); 20| | 21| 78.8k|LBL_ERR: 22| 78.8k| mp_clear(&t); 23| 78.8k| return err; 24| 78.8k|} mp_rand_source: 10| 1|{ 11| | /* Dropbear, don't reset to platform if source==NULL */ 12| 1| s_mp_rand_source = source; 13| 1|} mp_read_radix: 10| 18.4k|{ 11| 18.4k| mp_err err; 12| 18.4k| int y; 13| 18.4k| mp_sign neg; 14| 18.4k| unsigned pos; 15| 18.4k| char ch; 16| | 17| | /* zero the digit bignum */ 18| 18.4k| mp_zero(a); 19| | 20| | /* make sure the radix is ok */ 21| 18.4k| if ((radix < 2) || (radix > 64)) { ------------------ | Branch (21:8): [True: 0, False: 18.4k] | Branch (21:23): [True: 0, False: 18.4k] ------------------ 22| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 23| 0| } 24| | 25| | /* if the leading digit is a 26| | * minus set the sign to negative. 27| | */ 28| 18.4k| if (*str == '-') { ------------------ | Branch (28:8): [True: 0, False: 18.4k] ------------------ 29| 0| ++str; 30| 0| neg = MP_NEG; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ 31| 18.4k| } else { 32| 18.4k| neg = MP_ZPOS; ------------------ | | 151| 18.4k|#define MP_ZPOS 0 /* positive integer */ ------------------ 33| 18.4k| } 34| | 35| | /* set the integer to the default of zero */ 36| 18.4k| mp_zero(a); 37| | 38| | /* process each digit of the string */ 39| 1.26M| while (*str != '\0') { ------------------ | Branch (39:11): [True: 1.24M, False: 18.4k] ------------------ 40| | /* if the radix <= 36 the conversion is case insensitive 41| | * this allows numbers like 1AB and 1ab to represent the same value 42| | * [e.g. in hex] 43| | */ 44| 1.24M| ch = (radix <= 36) ? (char)MP_TOUPPER((int)*str) : *str; ------------------ | | 6| 1.24M|#define MP_TOUPPER(c) ((((c) >= 'a') && ((c) <= 'z')) ? (((c) + 'A') - 'a') : (c)) | | ------------------ | | | Branch (6:25): [True: 0, False: 1.24M] | | | Branch (6:41): [True: 0, False: 0] | | ------------------ ------------------ | Branch (44:12): [True: 1.24M, False: 0] ------------------ 45| 1.24M| pos = (unsigned)(ch - '('); 46| 1.24M| if (mp_s_rmap_reverse_sz < pos) { ------------------ | Branch (46:11): [True: 0, False: 1.24M] ------------------ 47| 0| break; 48| 0| } 49| 1.24M| y = (int)mp_s_rmap_reverse[pos]; 50| | 51| | /* if the char was found in the map 52| | * and is less than the given radix add it 53| | * to the number, otherwise exit the loop. 54| | */ 55| 1.24M| if ((y == 0xff) || (y >= radix)) { ------------------ | Branch (55:11): [True: 0, False: 1.24M] | Branch (55:26): [True: 0, False: 1.24M] ------------------ 56| 0| break; 57| 0| } 58| 1.24M| if ((err = mp_mul_d(a, (mp_digit)radix, a)) != MP_OKAY) { ------------------ | | 161| 1.24M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (58:11): [True: 0, False: 1.24M] ------------------ 59| 0| return err; 60| 0| } 61| 1.24M| if ((err = mp_add_d(a, (mp_digit)y, a)) != MP_OKAY) { ------------------ | | 161| 1.24M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (61:11): [True: 0, False: 1.24M] ------------------ 62| 0| return err; 63| 0| } 64| 1.24M| ++str; 65| 1.24M| } 66| | 67| | /* if an illegal character was found, fail. */ 68| 18.4k| if (!((*str == '\0') || (*str == '\r') || (*str == '\n'))) { ------------------ | Branch (68:10): [True: 18.4k, False: 0] | Branch (68:28): [True: 0, False: 0] | Branch (68:46): [True: 0, False: 0] ------------------ 69| 0| mp_zero(a); 70| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 71| 0| } 72| | 73| | /* set the sign only if a != 0 */ 74| 18.4k| if (!MP_IS_ZERO(a)) { ------------------ | | 163| 18.4k|#define MP_IS_ZERO(a) ((a)->used == 0) ------------------ | Branch (74:8): [True: 18.4k, False: 0] ------------------ 75| 18.4k| a->sign = neg; 76| 18.4k| } 77| 18.4k| return MP_OKAY; ------------------ | | 161| 18.4k|#define MP_OKAY 0 /* no error */ ------------------ 78| 18.4k|} mp_reduce_is_2k: 8| 35.8k|{ 9| 35.8k| int ix, iy, iw; 10| 35.8k| mp_digit iz; 11| | 12| 35.8k| if (a->used == 0) { ------------------ | Branch (12:8): [True: 0, False: 35.8k] ------------------ 13| 0| return MP_NO; ------------------ | | 159| 0|#define MP_NO 0 ------------------ 14| 35.8k| } else if (a->used == 1) { ------------------ | Branch (14:15): [True: 0, False: 35.8k] ------------------ 15| 0| return MP_YES; ------------------ | | 158| 0|#define MP_YES 1 ------------------ 16| 35.8k| } else if (a->used > 1) { ------------------ | Branch (16:15): [True: 35.8k, False: 0] ------------------ 17| 35.8k| iy = mp_count_bits(a); 18| 35.8k| iz = 1; 19| 35.8k| iw = 1; 20| | 21| | /* Test every bit from the second digit up, must be 1 */ 22| 204k| for (ix = MP_DIGIT_BIT; ix < iy; ix++) { ------------------ | | 82| 35.8k|# define MP_DIGIT_BIT 60 ------------------ | Branch (22:31): [True: 204k, False: 0] ------------------ 23| 204k| if ((a->dp[iw] & iz) == 0u) { ------------------ | Branch (23:14): [True: 35.8k, False: 168k] ------------------ 24| 35.8k| return MP_NO; ------------------ | | 159| 35.8k|#define MP_NO 0 ------------------ 25| 35.8k| } 26| 168k| iz <<= 1; 27| 168k| if (iz > MP_DIGIT_MAX) { ------------------ | | 107| 168k|#define MP_DIGIT_MAX MP_MASK | | ------------------ | | | | 106| 168k|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | | | ------------------ | | | | | | 82| 168k|# define MP_DIGIT_BIT 60 | | | | ------------------ | | ------------------ ------------------ | Branch (27:14): [True: 0, False: 168k] ------------------ 28| 0| ++iw; 29| 0| iz = 1; 30| 0| } 31| 168k| } 32| 0| return MP_YES; ------------------ | | 158| 0|#define MP_YES 1 ------------------ 33| 35.8k| } else { 34| 0| return MP_YES; ------------------ | | 158| 0|#define MP_YES 1 ------------------ 35| 0| } 36| 35.8k|} mp_reduce_is_2k_l: 8| 35.8k|{ 9| 35.8k| int ix, iy; 10| | 11| 35.8k| if (a->used == 0) { ------------------ | Branch (11:8): [True: 0, False: 35.8k] ------------------ 12| 0| return MP_NO; ------------------ | | 159| 0|#define MP_NO 0 ------------------ 13| 35.8k| } else if (a->used == 1) { ------------------ | Branch (13:15): [True: 0, False: 35.8k] ------------------ 14| 0| return MP_YES; ------------------ | | 158| 0|#define MP_YES 1 ------------------ 15| 35.8k| } else if (a->used > 1) { ------------------ | Branch (15:15): [True: 35.8k, False: 0] ------------------ 16| | /* if more than half of the digits are -1 we're sold */ 17| 1.14M| for (iy = ix = 0; ix < a->used; ix++) { ------------------ | Branch (17:25): [True: 1.11M, False: 35.8k] ------------------ 18| 1.11M| if (a->dp[ix] == MP_DIGIT_MAX) { ------------------ | | 107| 1.11M|#define MP_DIGIT_MAX MP_MASK | | ------------------ | | | | 106| 1.11M|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | | | ------------------ | | | | | | 82| 1.11M|# define MP_DIGIT_BIT 60 | | | | ------------------ | | ------------------ ------------------ | Branch (18:14): [True: 19.2k, False: 1.09M] ------------------ 19| 19.2k| ++iy; 20| 19.2k| } 21| 1.11M| } 22| 35.8k| return (iy >= (a->used/2)) ? MP_YES : MP_NO; ------------------ | | 158| 0|#define MP_YES 1 ------------------ return (iy >= (a->used/2)) ? MP_YES : MP_NO; ------------------ | | 159| 35.8k|#define MP_NO 0 ------------------ | Branch (22:14): [True: 0, False: 35.8k] ------------------ 23| 35.8k| } else { 24| 0| return MP_NO; ------------------ | | 159| 0|#define MP_NO 0 ------------------ 25| 0| } 26| 35.8k|} mp_rshd: 8| 82.9k|{ 9| 82.9k| int x; 10| 82.9k| mp_digit *bottom, *top; 11| | 12| | /* if b <= 0 then ignore it */ 13| 82.9k| if (b <= 0) { ------------------ | Branch (13:8): [True: 10.6k, False: 72.2k] ------------------ 14| 10.6k| return; 15| 10.6k| } 16| | 17| | /* if b > used then simply zero it and return */ 18| 72.2k| if (a->used <= b) { ------------------ | Branch (18:8): [True: 0, False: 72.2k] ------------------ 19| 0| mp_zero(a); 20| 0| return; 21| 0| } 22| | 23| | /* shift the digits down */ 24| | 25| | /* bottom */ 26| 72.2k| bottom = a->dp; 27| | 28| | /* top [offset into digits] */ 29| 72.2k| top = a->dp + b; 30| | 31| | /* this is implemented as a sliding window where 32| | * the window is b-digits long and digits from 33| | * the top of the window are copied to the bottom 34| | * 35| | * e.g. 36| | 37| | b-2 | b-1 | b0 | b1 | b2 | ... | bb | ----> 38| | /\ | ----> 39| | \-------------------/ ----> 40| | */ 41| 1.01M| for (x = 0; x < (a->used - b); x++) { ------------------ | Branch (41:16): [True: 942k, False: 72.2k] ------------------ 42| 942k| *bottom++ = *top++; 43| 942k| } 44| | 45| | /* zero the top digits */ 46| 72.2k| MP_ZERO_DIGITS(bottom, a->used - x); ------------------ | | 89| 72.2k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 72.2k|do { \ | | 91| 72.2k| int zd_ = (digits); \ | | 92| 72.2k| mp_digit* zm_ = (mem); \ | | 93| 1.08M| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 1.01M, False: 72.2k] | | ------------------ | | 94| 1.01M| *zm_++ = 0; \ | | 95| 1.01M| } \ | | 96| 72.2k|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 47| | 48| | /* remove excess digits */ 49| 72.2k| a->used -= b; 50| 72.2k|} mp_set: 8| 19.6k|{ 9| 19.6k| a->dp[0] = b & MP_MASK; ------------------ | | 106| 19.6k|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 19.6k|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 10| 19.6k| a->sign = MP_ZPOS; ------------------ | | 151| 19.6k|#define MP_ZPOS 0 /* positive integer */ ------------------ 11| 19.6k| a->used = (a->dp[0] != 0u) ? 1 : 0; ------------------ | Branch (11:15): [True: 19.6k, False: 0] ------------------ 12| 19.6k| MP_ZERO_DIGITS(a->dp + a->used, a->alloc - a->used); ------------------ | | 89| 19.6k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 19.6k|do { \ | | 91| 19.6k| int zd_ = (digits); \ | | 92| 19.6k| mp_digit* zm_ = (mem); \ | | 93| 627k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 607k, False: 19.6k] | | ------------------ | | 94| 607k| *zm_++ = 0; \ | | 95| 607k| } \ | | 96| 19.6k|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 13| 19.6k|} mp_sqr: 8| 58.9M|{ 9| 58.9M| mp_err err; 10| 58.9M| if (MP_HAS(S_MP_TOOM_SQR) && /* use Toom-Cook? */ ------------------ | | 150| 117M|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 58.9M|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 58.9M|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 11| 58.9M| (a->used >= MP_TOOM_SQR_CUTOFF)) { ------------------ | | 124| 0|# define MP_TOOM_SQR_CUTOFF TOOM_SQR_CUTOFF ------------------ | Branch (11:8): [True: 0, False: 0] ------------------ 12| 0| err = s_mp_toom_sqr(a, b); 13| 58.9M| } else if (MP_HAS(S_MP_KARATSUBA_SQR) && /* Karatsuba? */ ------------------ | | 150| 117M|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 58.9M|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 58.9M|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 14| 58.9M| (a->used >= MP_KARATSUBA_SQR_CUTOFF)) { ------------------ | | 122| 0|# define MP_KARATSUBA_SQR_CUTOFF KARATSUBA_SQR_CUTOFF ------------------ | Branch (14:15): [True: 0, False: 0] ------------------ 15| 0| err = s_mp_karatsuba_sqr(a, b); 16| 58.9M| } else if (MP_HAS(S_MP_SQR_FAST) && /* can we use the fast comba multiplier? */ ------------------ | | 150| 117M|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 58.9M|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 58.9M|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 17| 58.9M| (((a->used * 2) + 1) < MP_WARRAY) && ------------------ | | 172| 58.9M|#define MP_WARRAY PRIVATE_MP_WARRAY | | ------------------ | | | | 203| 58.9M|#define PRIVATE_MP_WARRAY (int)(1uLL << (((CHAR_BIT * sizeof(private_mp_word)) - (2 * MP_DIGIT_BIT)) + 1)) | | | | ------------------ | | | | | | 82| 58.9M|# define MP_DIGIT_BIT 60 | | | | ------------------ | | ------------------ ------------------ | Branch (17:15): [True: 58.9M, False: 0] ------------------ 18| 58.9M| (a->used < (MP_MAXFAST / 2))) { ------------------ | | 168| 58.9M|#define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 167| 58.9M|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) | | ------------------ | | #define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 82| 58.9M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (18:15): [True: 58.9M, False: 0] ------------------ 19| 58.9M| err = s_mp_sqr_fast(a, b); 20| 58.9M| } else if (MP_HAS(S_MP_SQR)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 21| 0| err = s_mp_sqr(a, b); 22| 0| } else { 23| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 24| 0| } 25| 58.9M| b->sign = MP_ZPOS; ------------------ | | 151| 58.9M|#define MP_ZPOS 0 /* positive integer */ ------------------ 26| 58.9M| return err; 27| 58.9M|} mp_sub: 8| 45.2M|{ 9| 45.2M| mp_sign sa = a->sign, sb = b->sign; 10| 45.2M| mp_err err; 11| | 12| 45.2M| if (sa != sb) { ------------------ | Branch (12:8): [True: 8.14M, False: 37.1M] ------------------ 13| | /* subtract a negative from a positive, OR */ 14| | /* subtract a positive from a negative. */ 15| | /* In either case, ADD their magnitudes, */ 16| | /* and use the sign of the first number. */ 17| 8.14M| c->sign = sa; 18| 8.14M| err = s_mp_add(a, b, c); 19| 37.1M| } else { 20| | /* subtract a positive from a positive, OR */ 21| | /* subtract a negative from a negative. */ 22| | /* First, take the difference between their */ 23| | /* magnitudes, then... */ 24| 37.1M| if (mp_cmp_mag(a, b) != MP_LT) { ------------------ | | 154| 37.1M|#define MP_LT -1 /* less than */ ------------------ | Branch (24:11): [True: 25.3M, False: 11.7M] ------------------ 25| | /* Copy the sign from the first */ 26| 25.3M| c->sign = sa; 27| | /* The first has a larger or equal magnitude */ 28| 25.3M| err = s_mp_sub(a, b, c); 29| 25.3M| } else { 30| | /* The result has the *opposite* sign from */ 31| | /* the first number. */ 32| 11.7M| c->sign = (sa == MP_ZPOS) ? MP_NEG : MP_ZPOS; ------------------ | | 151| 11.7M|#define MP_ZPOS 0 /* positive integer */ ------------------ c->sign = (sa == MP_ZPOS) ? MP_NEG : MP_ZPOS; ------------------ | | 152| 8.95M|#define MP_NEG 1 /* negative */ ------------------ c->sign = (sa == MP_ZPOS) ? MP_NEG : MP_ZPOS; ------------------ | | 151| 14.6M|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (32:20): [True: 8.95M, False: 2.82M] ------------------ 33| | /* The second has a larger magnitude */ 34| 11.7M| err = s_mp_sub(b, a, c); 35| 11.7M| } 36| 37.1M| } 37| 45.2M| return err; 38| 45.2M|} mp_sub_d: 8| 19.2k|{ 9| 19.2k| mp_digit *tmpa, *tmpc; 10| 19.2k| mp_err err; 11| 19.2k| int ix, oldused; 12| | 13| | /* grow c as required */ 14| 19.2k| if (c->alloc < (a->used + 1)) { ------------------ | Branch (14:8): [True: 19.2k, False: 0] ------------------ 15| 19.2k| if ((err = mp_grow(c, a->used + 1)) != MP_OKAY) { ------------------ | | 161| 19.2k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (15:11): [True: 0, False: 19.2k] ------------------ 16| 0| return err; 17| 0| } 18| 19.2k| } 19| | 20| | /* if a is negative just do an unsigned 21| | * addition [with fudged signs] 22| | */ 23| 19.2k| if (a->sign == MP_NEG) { ------------------ | | 152| 19.2k|#define MP_NEG 1 /* negative */ ------------------ | Branch (23:8): [True: 0, False: 19.2k] ------------------ 24| 0| mp_int a_ = *a; 25| 0| a_.sign = MP_ZPOS; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ 26| 0| err = mp_add_d(&a_, b, c); 27| 0| c->sign = MP_NEG; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ 28| | 29| | /* clamp */ 30| 0| mp_clamp(c); 31| | 32| 0| return err; 33| 0| } 34| | 35| | /* setup regs */ 36| 19.2k| oldused = c->used; 37| 19.2k| tmpa = a->dp; 38| 19.2k| tmpc = c->dp; 39| | 40| | /* if a <= b simply fix the single digit */ 41| 19.2k| if (((a->used == 1) && (a->dp[0] <= b)) || (a->used == 0)) { ------------------ | Branch (41:9): [True: 0, False: 19.2k] | Branch (41:27): [True: 0, False: 0] | Branch (41:47): [True: 0, False: 19.2k] ------------------ 42| 0| if (a->used == 1) { ------------------ | Branch (42:11): [True: 0, False: 0] ------------------ 43| 0| *tmpc++ = b - *tmpa; 44| 0| } else { 45| 0| *tmpc++ = b; 46| 0| } 47| 0| ix = 1; 48| | 49| | /* negative/1digit */ 50| 0| c->sign = MP_NEG; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ 51| 0| c->used = 1; 52| 19.2k| } else { 53| 19.2k| mp_digit mu = b; 54| | 55| | /* positive/size */ 56| 19.2k| c->sign = MP_ZPOS; ------------------ | | 151| 19.2k|#define MP_ZPOS 0 /* positive integer */ ------------------ 57| 19.2k| c->used = a->used; 58| | 59| | /* subtract digits, mu is carry */ 60| 693k| for (ix = 0; ix < a->used; ix++) { ------------------ | Branch (60:20): [True: 674k, False: 19.2k] ------------------ 61| 674k| *tmpc = *tmpa++ - mu; 62| 674k| mu = *tmpc >> (MP_SIZEOF_BITS(mp_digit) - 1u); ------------------ | | 167| 674k|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ 63| 674k| *tmpc++ &= MP_MASK; ------------------ | | 106| 674k|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 674k|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 64| 674k| } 65| 19.2k| } 66| | 67| | /* zero excess digits */ 68| 19.2k| MP_ZERO_DIGITS(tmpc, oldused - ix); ------------------ | | 89| 19.2k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 19.2k|do { \ | | 91| 19.2k| int zd_ = (digits); \ | | 92| 19.2k| mp_digit* zm_ = (mem); \ | | 93| 19.2k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 19.2k] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 19.2k|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 69| | 70| 19.2k| mp_clamp(c); 71| 19.2k| return MP_OKAY; ------------------ | | 161| 19.2k|#define MP_OKAY 0 /* no error */ ------------------ 72| 19.2k|} mp_to_ubin: 8| 187k|{ 9| 187k| size_t x, count; 10| 187k| mp_err err; 11| 187k| mp_int t; 12| | 13| 187k| count = mp_ubin_size(a); 14| 187k| if (count > maxlen) { ------------------ | Branch (14:8): [True: 0, False: 187k] ------------------ 15| 0| return MP_BUF; ------------------ | | 167| 0|#define MP_BUF -5 /* buffer overflow, supplied buffer too small */ ------------------ 16| 0| } 17| | 18| 187k| if ((err = mp_init_copy(&t, a)) != MP_OKAY) { ------------------ | | 161| 187k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (18:8): [True: 0, False: 187k] ------------------ 19| 0| return err; 20| 0| } 21| | 22| 21.4M| for (x = count; x --> 0u;) { ------------------ | Branch (22:20): [True: 21.2M, False: 187k] ------------------ 23| 21.2M|#ifndef MP_8BIT 24| 21.2M| buf[x] = (unsigned char)(t.dp[0] & 255u); 25| |#else 26| | buf[x] = (unsigned char)(t.dp[0] | ((t.dp[1] & 1u) << 7)); 27| |#endif 28| 21.2M| if ((err = mp_div_2d(&t, 8, &t, NULL)) != MP_OKAY) { ------------------ | | 161| 21.2M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (28:11): [True: 0, False: 21.2M] ------------------ 29| 0| goto LBL_ERR; 30| 0| } 31| 21.2M| } 32| | 33| 187k| if (written != NULL) { ------------------ | Branch (33:8): [True: 173k, False: 13.7k] ------------------ 34| 173k| *written = count; 35| 173k| } 36| | 37| 187k|LBL_ERR: 38| 187k| mp_clear(&t); 39| 187k| return err; 40| 187k|} mp_ubin_size: 8| 229k|{ 9| 229k| size_t size = (size_t)mp_count_bits(a); 10| 229k| return (size / 8u) + (((size & 7u) != 0u) ? 1u : 0u); ------------------ | Branch (10:26): [True: 122k, False: 107k] ------------------ 11| 229k|} mp_zero: 8| 2.06M|{ 9| 2.06M| a->sign = MP_ZPOS; ------------------ | | 151| 2.06M|#define MP_ZPOS 0 /* positive integer */ ------------------ 10| 2.06M| a->used = 0; 11| 2.06M| MP_ZERO_DIGITS(a->dp, a->alloc); ------------------ | | 89| 2.06M|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 2.06M|do { \ | | 91| 2.06M| int zd_ = (digits); \ | | 92| 2.06M| mp_digit* zm_ = (mem); \ | | 93| 115M| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 113M, False: 2.06M] | | ------------------ | | 94| 113M| *zm_++ = 0; \ | | 95| 113M| } \ | | 96| 2.06M|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 12| 2.06M|} s_mp_add: 8| 19.9M|{ 9| 19.9M| const mp_int *x; 10| 19.9M| mp_err err; 11| 19.9M| int olduse, min, max; 12| | 13| | /* find sizes, we let |a| <= |b| which means we have to sort 14| | * them. "x" will point to the input with the most digits 15| | */ 16| 19.9M| if (a->used > b->used) { ------------------ | Branch (16:8): [True: 26.8k, False: 19.9M] ------------------ 17| 26.8k| min = b->used; 18| 26.8k| max = a->used; 19| 26.8k| x = a; 20| 19.9M| } else { 21| 19.9M| min = a->used; 22| 19.9M| max = b->used; 23| 19.9M| x = b; 24| 19.9M| } 25| | 26| | /* init result */ 27| 19.9M| if (c->alloc < (max + 1)) { ------------------ | Branch (27:8): [True: 8.39k, False: 19.9M] ------------------ 28| 8.39k| if ((err = mp_grow(c, max + 1)) != MP_OKAY) { ------------------ | | 161| 8.39k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (28:11): [True: 0, False: 8.39k] ------------------ 29| 0| return err; 30| 0| } 31| 8.39k| } 32| | 33| | /* get old used digit count and set new one */ 34| 19.9M| olduse = c->used; 35| 19.9M| c->used = max + 1; 36| | 37| 19.9M| { 38| 19.9M| mp_digit u, *tmpa, *tmpb, *tmpc; 39| 19.9M| int i; 40| | 41| | /* alias for digit pointers */ 42| | 43| | /* first input */ 44| 19.9M| tmpa = a->dp; 45| | 46| | /* second input */ 47| 19.9M| tmpb = b->dp; 48| | 49| | /* destination */ 50| 19.9M| tmpc = c->dp; 51| | 52| | /* zero the carry */ 53| 19.9M| u = 0; 54| 299M| for (i = 0; i < min; i++) { ------------------ | Branch (54:19): [True: 279M, False: 19.9M] ------------------ 55| | /* Compute the sum at one digit, T[i] = A[i] + B[i] + U */ 56| 279M| *tmpc = *tmpa++ + *tmpb++ + u; 57| | 58| | /* U = carry bit of T[i] */ 59| 279M| u = *tmpc >> (mp_digit)MP_DIGIT_BIT; ------------------ | | 82| 279M|# define MP_DIGIT_BIT 60 ------------------ 60| | 61| | /* take away carry bit from T[i] */ 62| 279M| *tmpc++ &= MP_MASK; ------------------ | | 106| 279M|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 279M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 63| 279M| } 64| | 65| | /* now copy higher words if any, that is in A+B 66| | * if A or B has more digits add those in 67| | */ 68| 19.9M| if (min != max) { ------------------ | Branch (68:11): [True: 107k, False: 19.8M] ------------------ 69| 520k| for (; i < max; i++) { ------------------ | Branch (69:17): [True: 413k, False: 107k] ------------------ 70| | /* T[i] = X[i] + U */ 71| 413k| *tmpc = x->dp[i] + u; 72| | 73| | /* U = carry bit of T[i] */ 74| 413k| u = *tmpc >> (mp_digit)MP_DIGIT_BIT; ------------------ | | 82| 413k|# define MP_DIGIT_BIT 60 ------------------ 75| | 76| | /* take away carry bit from T[i] */ 77| 413k| *tmpc++ &= MP_MASK; ------------------ | | 106| 413k|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 413k|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 78| 413k| } 79| 107k| } 80| | 81| | /* add carry */ 82| 19.9M| *tmpc++ = u; 83| | 84| | /* clear digits above oldused */ 85| 19.9M| MP_ZERO_DIGITS(tmpc, olduse - c->used); ------------------ | | 89| 19.9M|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 19.9M|do { \ | | 91| 19.9M| int zd_ = (digits); \ | | 92| 19.9M| mp_digit* zm_ = (mem); \ | | 93| 19.9M| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 19.9M] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 19.9M|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 86| 19.9M| } 87| | 88| 19.9M| mp_clamp(c); 89| 19.9M| return MP_OKAY; ------------------ | | 161| 19.9M|#define MP_OKAY 0 /* no error */ ------------------ 90| 19.9M|} s_mp_exptmod_fast: 23| 35.8k|{ 24| 35.8k| mp_int M[TAB_SIZE], res; 25| 35.8k| mp_digit buf, mp; 26| 35.8k| int bitbuf, bitcpy, bitcnt, mode, digidx, x, y, winsize; 27| 35.8k| mp_err err; 28| | 29| | /* use a pointer to the reduction algorithm. This allows us to use 30| | * one of many reduction algorithms without modding the guts of 31| | * the code with if statements everywhere. 32| | */ 33| 35.8k| mp_err(*redux)(mp_int *x, const mp_int *n, mp_digit rho); 34| | 35| | /* find window size */ 36| 35.8k| x = mp_count_bits(X); 37| 35.8k| if (x <= 7) { ------------------ | Branch (37:8): [True: 0, False: 35.8k] ------------------ 38| 0| winsize = 2; 39| 35.8k| } else if (x <= 36) { ------------------ | Branch (39:15): [True: 4.19k, False: 31.6k] ------------------ 40| 4.19k| winsize = 3; 41| 31.6k| } else if (x <= 140) { ------------------ | Branch (41:15): [True: 3, False: 31.6k] ------------------ 42| 3| winsize = 4; 43| 31.6k| } else if (x <= 450) { ------------------ | Branch (43:15): [True: 8.21k, False: 23.4k] ------------------ 44| 8.21k| winsize = 5; 45| 23.4k| } else if (x <= 1303) { ------------------ | Branch (45:15): [True: 0, False: 23.4k] ------------------ 46| 0| winsize = 6; 47| 23.4k| } else if (x <= 3529) { ------------------ | Branch (47:15): [True: 23.4k, False: 0] ------------------ 48| 23.4k| winsize = 7; 49| 23.4k| } else { 50| 0| winsize = 8; 51| 0| } 52| | 53| 35.8k| winsize = MAX_WINSIZE ? MP_MIN(MAX_WINSIZE, winsize) : winsize; ------------------ | | 19| 35.8k|# define MAX_WINSIZE 0 | | ------------------ | | | Branch (19:24): [Folded - Ignored] | | ------------------ ------------------ winsize = MAX_WINSIZE ? MP_MIN(MAX_WINSIZE, winsize) : winsize; ------------------ | | 156| 0|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 0, False: 0] | | ------------------ ------------------ 54| | 55| | /* init M array */ 56| | /* init first cell */ 57| 35.8k| if ((err = mp_init_size(&M[1], P->alloc)) != MP_OKAY) { ------------------ | | 161| 35.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (57:8): [True: 0, False: 35.8k] ------------------ 58| 0| return err; 59| 0| } 60| | 61| | /* now init the second half of the array */ 62| 1.68M| for (x = 1<<(winsize-1); x < (1 << winsize); x++) { ------------------ | Branch (62:29): [True: 1.64M, False: 35.8k] ------------------ 63| 1.64M| if ((err = mp_init_size(&M[x], P->alloc)) != MP_OKAY) { ------------------ | | 161| 1.64M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (63:11): [True: 0, False: 1.64M] ------------------ 64| 0| for (y = 1<<(winsize-1); y < x; y++) { ------------------ | Branch (64:35): [True: 0, False: 0] ------------------ 65| 0| mp_clear(&M[y]); 66| 0| } 67| 0| mp_clear(&M[1]); 68| 0| return err; 69| 0| } 70| 1.64M| } 71| | 72| | /* determine and setup reduction code */ 73| 35.8k| if (redmode == 0) { ------------------ | Branch (73:8): [True: 35.8k, False: 0] ------------------ 74| 35.8k| if (MP_HAS(MP_MONTGOMERY_SETUP)) { ------------------ | | 150| 35.8k|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 35.8k|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 35.8k|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 75| | /* now setup montgomery */ 76| 35.8k| if ((err = mp_montgomery_setup(P, &mp)) != MP_OKAY) goto LBL_M; ------------------ | | 161| 35.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (76:14): [True: 0, False: 35.8k] ------------------ 77| 35.8k| } else { 78| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 79| 0| goto LBL_M; 80| 0| } 81| | 82| | /* automatically pick the comba one if available (saves quite a few calls/ifs) */ 83| 35.8k| if (MP_HAS(S_MP_MONTGOMERY_REDUCE_FAST) && ------------------ | | 150| 71.6k|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 35.8k|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 35.8k|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 84| 35.8k| (((P->used * 2) + 1) < MP_WARRAY) && ------------------ | | 172| 35.8k|#define MP_WARRAY PRIVATE_MP_WARRAY | | ------------------ | | | | 203| 35.8k|#define PRIVATE_MP_WARRAY (int)(1uLL << (((CHAR_BIT * sizeof(private_mp_word)) - (2 * MP_DIGIT_BIT)) + 1)) | | | | ------------------ | | | | | | 82| 35.8k|# define MP_DIGIT_BIT 60 | | | | ------------------ | | ------------------ ------------------ | Branch (84:11): [True: 35.8k, False: 0] ------------------ 85| 35.8k| (P->used < MP_MAXFAST)) { ------------------ | | 168| 35.8k|#define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 167| 35.8k|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) | | ------------------ | | #define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 82| 35.8k|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (85:11): [True: 35.8k, False: 0] ------------------ 86| 35.8k| redux = s_mp_montgomery_reduce_fast; 87| 35.8k| } else if (MP_HAS(MP_MONTGOMERY_REDUCE)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 88| | /* use slower baseline Montgomery method */ 89| 0| redux = mp_montgomery_reduce; 90| 0| } else { 91| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 92| 0| goto LBL_M; 93| 0| } 94| 35.8k| } else if (redmode == 1) { ------------------ | Branch (94:15): [True: 0, False: 0] ------------------ 95| 0| if (MP_HAS(MP_DR_SETUP) && MP_HAS(MP_DR_REDUCE)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ if (MP_HAS(MP_DR_SETUP) && MP_HAS(MP_DR_REDUCE)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 96| | /* setup DR reduction for moduli of the form B**k - b */ 97| 0| mp_dr_setup(P, &mp); 98| 0| redux = mp_dr_reduce; 99| 0| } else { 100| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 101| 0| goto LBL_M; 102| 0| } 103| 0| } else if (MP_HAS(MP_REDUCE_2K_SETUP) && MP_HAS(MP_REDUCE_2K)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ } else if (MP_HAS(MP_REDUCE_2K_SETUP) && MP_HAS(MP_REDUCE_2K)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 104| | /* setup DR reduction for moduli of the form 2**k - b */ 105| 0| if ((err = mp_reduce_2k_setup(P, &mp)) != MP_OKAY) goto LBL_M; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (105:11): [True: 0, False: 0] ------------------ 106| 0| redux = mp_reduce_2k; 107| 0| } else { 108| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 109| 0| goto LBL_M; 110| 0| } 111| | 112| | /* setup result */ 113| 35.8k| if ((err = mp_init_size(&res, P->alloc)) != MP_OKAY) goto LBL_M; ------------------ | | 161| 35.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (113:8): [True: 0, False: 35.8k] ------------------ 114| | 115| | /* create M table 116| | * 117| | 118| | * 119| | * The first half of the table is not computed though accept for M[0] and M[1] 120| | */ 121| | 122| 35.8k| if (redmode == 0) { ------------------ | Branch (122:8): [True: 35.8k, False: 0] ------------------ 123| 35.8k| if (MP_HAS(MP_MONTGOMERY_CALC_NORMALIZATION)) { ------------------ | | 150| 35.8k|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 35.8k|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 35.8k|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 124| | /* now we need R mod m */ 125| 35.8k| if ((err = mp_montgomery_calc_normalization(&res, P)) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 35.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (125:14): [True: 0, False: 35.8k] ------------------ 126| | 127| | /* now set M[1] to G * R mod m */ 128| 35.8k| if ((err = mp_mulmod(G, &res, P, &M[1])) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 35.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (128:14): [True: 0, False: 35.8k] ------------------ 129| 35.8k| } else { 130| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 131| 0| goto LBL_RES; 132| 0| } 133| 35.8k| } else { 134| 0| mp_set(&res, 1uL); 135| 0| if ((err = mp_mod(G, P, &M[1])) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (135:11): [True: 0, False: 0] ------------------ 136| 0| } 137| | 138| | /* compute the value at M[1<<(winsize-1)] by squaring M[1] (winsize-1) times */ 139| 35.8k| if ((err = mp_copy(&M[1], &M[(size_t)1 << (winsize - 1)])) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 35.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (139:8): [True: 0, False: 35.8k] ------------------ 140| | 141| 217k| for (x = 0; x < (winsize - 1); x++) { ------------------ | Branch (141:16): [True: 181k, False: 35.8k] ------------------ 142| 181k| if ((err = mp_sqr(&M[(size_t)1 << (winsize - 1)], &M[(size_t)1 << (winsize - 1)])) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 181k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (142:11): [True: 0, False: 181k] ------------------ 143| 181k| if ((err = redux(&M[(size_t)1 << (winsize - 1)], P, mp)) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 181k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (143:11): [True: 0, False: 181k] ------------------ 144| 181k| } 145| | 146| | /* create upper table */ 147| 1.64M| for (x = (1 << (winsize - 1)) + 1; x < (1 << winsize); x++) { ------------------ | Branch (147:39): [True: 1.61M, False: 35.8k] ------------------ 148| 1.61M| if ((err = mp_mul(&M[x - 1], &M[1], &M[x])) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 1.61M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (148:11): [True: 0, False: 1.61M] ------------------ 149| 1.61M| if ((err = redux(&M[x], P, mp)) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 1.61M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (149:11): [True: 0, False: 1.61M] ------------------ 150| 1.61M| } 151| | 152| | /* set initial mode and bit cnt */ 153| 35.8k| mode = 0; 154| 35.8k| bitcnt = 1; 155| 35.8k| buf = 0; 156| 35.8k| digidx = X->used - 1; 157| 35.8k| bitcpy = 0; 158| 35.8k| bitbuf = 0; 159| | 160| 50.9M| for (;;) { 161| | /* grab next digit as required */ 162| 50.9M| if (--bitcnt == 0) { ------------------ | Branch (162:11): [True: 884k, False: 50.0M] ------------------ 163| | /* if digidx == -1 we are out of digits so break */ 164| 884k| if (digidx == -1) { ------------------ | Branch (164:14): [True: 35.8k, False: 848k] ------------------ 165| 35.8k| break; 166| 35.8k| } 167| | /* read next digit and reset bitcnt */ 168| 848k| buf = X->dp[digidx--]; 169| 848k| bitcnt = (int)MP_DIGIT_BIT; ------------------ | | 82| 848k|# define MP_DIGIT_BIT 60 ------------------ 170| 848k| } 171| | 172| | /* grab the next msb from the exponent */ 173| 50.8M| y = (mp_digit)(buf >> (MP_DIGIT_BIT - 1)) & 1uL; ------------------ | | 82| 50.8M|# define MP_DIGIT_BIT 60 ------------------ 174| 50.8M| buf <<= (mp_digit)1; 175| | 176| | /* if the bit is zero and mode == 0 then we ignore it 177| | * These represent the leading zero bits before the first 1 bit 178| | * in the exponent. Technically this opt is not required but it 179| | * does lower the # of trivial squaring/reductions used 180| | */ 181| 50.8M| if ((mode == 0) && (y == 0)) { ------------------ | Branch (181:11): [True: 1.67M, False: 49.2M] | Branch (181:26): [True: 1.64M, False: 35.8k] ------------------ 182| 1.64M| continue; 183| 1.64M| } 184| | 185| | /* if the bit is zero and mode == 1 then we square */ 186| 49.2M| if ((mode == 1) && (y == 0)) { ------------------ | Branch (186:11): [True: 12.4M, False: 36.7M] | Branch (186:26): [True: 6.30M, False: 6.17M] ------------------ 187| 6.30M| if ((err = mp_sqr(&res, &res)) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 6.30M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (187:14): [True: 0, False: 6.30M] ------------------ 188| 6.30M| if ((err = redux(&res, P, mp)) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 6.30M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (188:14): [True: 0, False: 6.30M] ------------------ 189| 6.30M| continue; 190| 6.30M| } 191| | 192| | /* else we add it to the window */ 193| 42.9M| bitbuf |= (y << (winsize - ++bitcpy)); 194| 42.9M| mode = 2; 195| | 196| 42.9M| if (bitcpy == winsize) { ------------------ | Branch (196:11): [True: 6.18M, False: 36.7M] ------------------ 197| | /* ok window is filled so square as required and multiply */ 198| | /* square first */ 199| 49.0M| for (x = 0; x < winsize; x++) { ------------------ | Branch (199:22): [True: 42.8M, False: 6.18M] ------------------ 200| 42.8M| if ((err = mp_sqr(&res, &res)) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 42.8M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (200:17): [True: 0, False: 42.8M] ------------------ 201| 42.8M| if ((err = redux(&res, P, mp)) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 42.8M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (201:17): [True: 0, False: 42.8M] ------------------ 202| 42.8M| } 203| | 204| | /* then multiply */ 205| 6.18M| if ((err = mp_mul(&res, &M[bitbuf], &res)) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 6.18M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (205:14): [True: 0, False: 6.18M] ------------------ 206| 6.18M| if ((err = redux(&res, P, mp)) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 6.18M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (206:14): [True: 0, False: 6.18M] ------------------ 207| | 208| | /* empty window and reset */ 209| 6.18M| bitcpy = 0; 210| 6.18M| bitbuf = 0; 211| 6.18M| mode = 1; 212| 6.18M| } 213| 42.9M| } 214| | 215| | /* if bits remain then square/multiply */ 216| 35.8k| if ((mode == 2) && (bitcpy > 0)) { ------------------ | Branch (216:8): [True: 26.6k, False: 9.17k] | Branch (216:23): [True: 26.6k, False: 0] ------------------ 217| | /* square then multiply if the bit is set */ 218| 106k| for (x = 0; x < bitcpy; x++) { ------------------ | Branch (218:19): [True: 80.0k, False: 26.6k] ------------------ 219| 80.0k| if ((err = mp_sqr(&res, &res)) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 80.0k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (219:14): [True: 0, False: 80.0k] ------------------ 220| 80.0k| if ((err = redux(&res, P, mp)) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 80.0k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (220:14): [True: 0, False: 80.0k] ------------------ 221| | 222| | /* get next bit of the window */ 223| 80.0k| bitbuf <<= 1; 224| 80.0k| if ((bitbuf & (1 << winsize)) != 0) { ------------------ | Branch (224:14): [True: 55.2k, False: 24.8k] ------------------ 225| | /* then multiply */ 226| 55.2k| if ((err = mp_mul(&res, &M[1], &res)) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 55.2k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (226:17): [True: 0, False: 55.2k] ------------------ 227| 55.2k| if ((err = redux(&res, P, mp)) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 55.2k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (227:17): [True: 0, False: 55.2k] ------------------ 228| 55.2k| } 229| 80.0k| } 230| 26.6k| } 231| | 232| 35.8k| if (redmode == 0) { ------------------ | Branch (232:8): [True: 35.8k, False: 0] ------------------ 233| | /* fixup result if Montgomery reduction is used 234| | * recall that any value in a Montgomery system is 235| | * actually multiplied by R mod n. So we have 236| | * to reduce one more time to cancel out the factor 237| | * of R. 238| | */ 239| 35.8k| if ((err = redux(&res, P, mp)) != MP_OKAY) goto LBL_RES; ------------------ | | 161| 35.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (239:11): [True: 0, False: 35.8k] ------------------ 240| 35.8k| } 241| | 242| | /* swap res with Y */ 243| 35.8k| mp_exch(&res, Y); 244| 35.8k| err = MP_OKAY; ------------------ | | 161| 35.8k|#define MP_OKAY 0 /* no error */ ------------------ 245| 35.8k|LBL_RES: 246| 35.8k| mp_clear(&res); 247| 35.8k|LBL_M: 248| 35.8k| mp_clear(&M[1]); 249| 1.68M| for (x = 1<<(winsize-1); x < (1 << winsize); x++) { ------------------ | Branch (249:29): [True: 1.64M, False: 35.8k] ------------------ 250| 1.64M| mp_clear(&M[x]); 251| 1.64M| } 252| 35.8k| return err; 253| 35.8k|} s_mp_invmod_fast: 13| 19.6k|{ 14| 19.6k| mp_int x, y, u, v, B, D; 15| 19.6k| mp_sign neg; 16| 19.6k| mp_err err; 17| | 18| | /* 2. [modified] b must be odd */ 19| 19.6k| if (MP_IS_EVEN(b)) { ------------------ | | 164| 19.6k|#define MP_IS_EVEN(a) (((a)->used == 0) || (((a)->dp[0] & 1u) == 0u)) | | ------------------ | | | Branch (164:24): [True: 0, False: 19.6k] | | | Branch (164:44): [True: 0, False: 19.6k] | | ------------------ ------------------ 20| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 21| 0| } 22| | 23| | /* init all our temps */ 24| 19.6k| if ((err = mp_init_multi(&x, &y, &u, &v, &B, &D, NULL)) != MP_OKAY) { ------------------ | | 161| 19.6k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (24:8): [True: 0, False: 19.6k] ------------------ 25| 0| return err; 26| 0| } 27| | 28| | /* x == modulus, y == value to invert */ 29| 19.6k| if ((err = mp_copy(b, &x)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 19.6k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (29:8): [True: 0, False: 19.6k] ------------------ 30| | 31| | /* we need y = |a| */ 32| 19.6k| if ((err = mp_mod(a, b, &y)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 19.6k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (32:8): [True: 0, False: 19.6k] ------------------ 33| | 34| | /* if one of x,y is zero return an error! */ 35| 19.6k| if (MP_IS_ZERO(&x) || MP_IS_ZERO(&y)) { ------------------ | | 163| 39.2k|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 19.6k] | | ------------------ ------------------ if (MP_IS_ZERO(&x) || MP_IS_ZERO(&y)) { ------------------ | | 163| 19.6k|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 19.6k] | | ------------------ ------------------ 36| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 37| 0| goto LBL_ERR; 38| 0| } 39| | 40| | /* 3. u=x, v=y, A=1, B=0, C=0,D=1 */ 41| 19.6k| if ((err = mp_copy(&x, &u)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 19.6k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (41:8): [True: 0, False: 19.6k] ------------------ 42| 19.6k| if ((err = mp_copy(&y, &v)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 19.6k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (42:8): [True: 0, False: 19.6k] ------------------ 43| 19.6k| mp_set(&D, 1uL); 44| | 45| 8.32M|top: 46| | /* 4. while u is even do */ 47| 16.6M| while (MP_IS_EVEN(&u)) { ------------------ | | 164| 16.6M|#define MP_IS_EVEN(a) (((a)->used == 0) || (((a)->dp[0] & 1u) == 0u)) | | ------------------ | | | Branch (164:24): [True: 0, False: 16.6M] | | | Branch (164:44): [True: 8.35M, False: 8.32M] | | ------------------ ------------------ 48| | /* 4.1 u = u/2 */ 49| 8.35M| if ((err = mp_div_2(&u, &u)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 8.35M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (49:11): [True: 0, False: 8.35M] ------------------ 50| | 51| | /* 4.2 if B is odd then */ 52| 8.35M| if (MP_IS_ODD(&B)) { ------------------ | | 165| 8.35M|#define MP_IS_ODD(a) (((a)->used > 0) && (((a)->dp[0] & 1u) == 1u)) | | ------------------ | | | Branch (165:24): [True: 8.35M, False: 0] | | | Branch (165:43): [True: 4.17M, False: 4.18M] | | ------------------ ------------------ 53| 4.17M| if ((err = mp_sub(&B, &x, &B)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 4.17M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (53:14): [True: 0, False: 4.17M] ------------------ 54| 4.17M| } 55| | /* B = B/2 */ 56| 8.35M| if ((err = mp_div_2(&B, &B)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 8.35M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (56:11): [True: 0, False: 8.35M] ------------------ 57| 8.35M| } 58| | 59| | /* 5. while v is even do */ 60| 16.6M| while (MP_IS_EVEN(&v)) { ------------------ | | 164| 16.6M|#define MP_IS_EVEN(a) (((a)->used == 0) || (((a)->dp[0] & 1u) == 0u)) | | ------------------ | | | Branch (164:24): [True: 0, False: 16.6M] | | | Branch (164:44): [True: 8.34M, False: 8.32M] | | ------------------ ------------------ 61| | /* 5.1 v = v/2 */ 62| 8.34M| if ((err = mp_div_2(&v, &v)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 8.34M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (62:11): [True: 0, False: 8.34M] ------------------ 63| | 64| | /* 5.2 if D is odd then */ 65| 8.34M| if (MP_IS_ODD(&D)) { ------------------ | | 165| 8.34M|#define MP_IS_ODD(a) (((a)->used > 0) && (((a)->dp[0] & 1u) == 1u)) | | ------------------ | | | Branch (165:24): [True: 8.34M, False: 0] | | | Branch (165:43): [True: 4.29M, False: 4.04M] | | ------------------ ------------------ 66| | /* D = (D-x)/2 */ 67| 4.29M| if ((err = mp_sub(&D, &x, &D)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 4.29M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (67:14): [True: 0, False: 4.29M] ------------------ 68| 4.29M| } 69| | /* D = D/2 */ 70| 8.34M| if ((err = mp_div_2(&D, &D)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 8.34M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (70:11): [True: 0, False: 8.34M] ------------------ 71| 8.34M| } 72| | 73| | /* 6. if u >= v then */ 74| 8.32M| if (mp_cmp(&u, &v) != MP_LT) { ------------------ | | 154| 8.32M|#define MP_LT -1 /* less than */ ------------------ | Branch (74:8): [True: 4.17M, False: 4.15M] ------------------ 75| | /* u = u - v, B = B - D */ 76| 4.17M| if ((err = mp_sub(&u, &v, &u)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 4.17M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (76:11): [True: 0, False: 4.17M] ------------------ 77| | 78| 4.17M| if ((err = mp_sub(&B, &D, &B)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 4.17M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (78:11): [True: 0, False: 4.17M] ------------------ 79| 4.17M| } else { 80| | /* v - v - u, D = D - B */ 81| 4.15M| if ((err = mp_sub(&v, &u, &v)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 4.15M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (81:11): [True: 0, False: 4.15M] ------------------ 82| | 83| 4.15M| if ((err = mp_sub(&D, &B, &D)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 4.15M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (83:11): [True: 0, False: 4.15M] ------------------ 84| 4.15M| } 85| | 86| | /* if not zero goto step 4 */ 87| 8.32M| if (!MP_IS_ZERO(&u)) { ------------------ | | 163| 8.32M|#define MP_IS_ZERO(a) ((a)->used == 0) ------------------ | Branch (87:8): [True: 8.30M, False: 19.6k] ------------------ 88| 8.30M| goto top; 89| 8.30M| } 90| | 91| | /* now a = C, b = D, gcd == g*v */ 92| | 93| | /* if v != 1 then there is no inverse */ 94| 19.6k| if (mp_cmp_d(&v, 1uL) != MP_EQ) { ------------------ | | 155| 19.6k|#define MP_EQ 0 /* equal to */ ------------------ | Branch (94:8): [True: 0, False: 19.6k] ------------------ 95| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 96| 0| goto LBL_ERR; 97| 0| } 98| | 99| | /* b is now the inverse */ 100| 19.6k| neg = a->sign; 101| 36.3k| while (D.sign == MP_NEG) { ------------------ | | 152| 36.3k|#define MP_NEG 1 /* negative */ ------------------ | Branch (101:11): [True: 16.7k, False: 19.6k] ------------------ 102| 16.7k| if ((err = mp_add(&D, b, &D)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 16.7k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (102:11): [True: 0, False: 16.7k] ------------------ 103| 16.7k| } 104| | 105| | /* too big */ 106| 19.6k| while (mp_cmp_mag(&D, b) != MP_LT) { ------------------ | | 154| 19.6k|#define MP_LT -1 /* less than */ ------------------ | Branch (106:11): [True: 14, False: 19.6k] ------------------ 107| 14| if ((err = mp_sub(&D, b, &D)) != MP_OKAY) goto LBL_ERR; ------------------ | | 161| 14|#define MP_OKAY 0 /* no error */ ------------------ | Branch (107:11): [True: 0, False: 14] ------------------ 108| 14| } 109| | 110| 19.6k| mp_exch(&D, c); 111| 19.6k| c->sign = neg; 112| 19.6k| err = MP_OKAY; ------------------ | | 161| 19.6k|#define MP_OKAY 0 /* no error */ ------------------ 113| | 114| 19.6k|LBL_ERR: 115| 19.6k| mp_clear_multi(&x, &y, &u, &v, &B, &D, NULL); 116| 19.6k| return err; 117| 19.6k|} s_mp_montgomery_reduce_fast: 15| 85.7M|{ 16| 85.7M| int ix, olduse; 17| 85.7M| mp_err err; 18| 85.7M| mp_word W[MP_WARRAY]; 19| | 20| 85.7M| if (x->used > MP_WARRAY) { ------------------ | | 172| 85.7M|#define MP_WARRAY PRIVATE_MP_WARRAY | | ------------------ | | | | 203| 85.7M|#define PRIVATE_MP_WARRAY (int)(1uLL << (((CHAR_BIT * sizeof(private_mp_word)) - (2 * MP_DIGIT_BIT)) + 1)) | | | | ------------------ | | | | | | 82| 85.7M|# define MP_DIGIT_BIT 60 | | | | ------------------ | | ------------------ ------------------ | Branch (20:8): [True: 0, False: 85.7M] ------------------ 21| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 22| 0| } 23| | 24| | /* get old used count */ 25| 85.7M| olduse = x->used; 26| | 27| | /* grow a as required */ 28| 85.7M| if (x->alloc < (n->used + 1)) { ------------------ | Branch (28:8): [True: 0, False: 85.7M] ------------------ 29| 0| if ((err = mp_grow(x, n->used + 1)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (29:11): [True: 0, False: 0] ------------------ 30| 0| return err; 31| 0| } 32| 0| } 33| | 34| | /* first we have to get the digits of the input into 35| | * an array of double precision words W[...] 36| | */ 37| 85.7M| { 38| 85.7M| mp_word *_W; 39| 85.7M| mp_digit *tmpx; 40| | 41| | /* alias for the W[] array */ 42| 85.7M| _W = W; 43| | 44| | /* alias for the digits of x*/ 45| 85.7M| tmpx = x->dp; 46| | 47| | /* copy the digits of a into W[0..a->used-1] */ 48| 4.26G| for (ix = 0; ix < x->used; ix++) { ------------------ | Branch (48:20): [True: 4.17G, False: 85.7M] ------------------ 49| 4.17G| *_W++ = *tmpx++; 50| 4.17G| } 51| | 52| | /* zero the high words of W[a->used..m->used*2] */ 53| 85.7M| if (ix < ((n->used * 2) + 1)) { ------------------ | Branch (53:11): [True: 85.7M, False: 0] ------------------ 54| 85.7M| MP_ZERO_BUFFER(_W, sizeof(mp_word) * (size_t)(((n->used * 2) + 1) - ix)); ------------------ | | 81| 85.7M|# define MP_ZERO_BUFFER(mem, size) \ | | 82| 85.7M|do { \ | | 83| 85.7M| size_t zs_ = (size); \ | | 84| 85.7M| char* zm_ = (char*)(mem); \ | | 85| 2.82G| while (zs_-- > 0u) { \ | | ------------------ | | | Branch (85:11): [True: 2.73G, False: 85.7M] | | ------------------ | | 86| 2.73G| *zm_++ = '\0'; \ | | 87| 2.73G| } \ | | 88| 85.7M|} while (0) | | ------------------ | | | Branch (88:10): [Folded - Ignored] | | ------------------ ------------------ 55| 85.7M| } 56| 85.7M| } 57| | 58| | /* now we proceed to zero successive digits 59| | * from the least significant upwards 60| | */ 61| 2.21G| for (ix = 0; ix < n->used; ix++) { ------------------ | Branch (61:17): [True: 2.13G, False: 85.7M] ------------------ 62| | /* mu = ai * m' mod b 63| | * 64| | * We avoid a double precision multiplication (which isn't required) 65| | * by casting the value down to a mp_digit. Note this requires 66| | * that W[ix-1] have the carry cleared (see after the inner loop) 67| | */ 68| 2.13G| mp_digit mu; 69| 2.13G| mu = ((W[ix] & MP_MASK) * rho) & MP_MASK; ------------------ | | 106| 2.13G|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 2.13G|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ mu = ((W[ix] & MP_MASK) * rho) & MP_MASK; ------------------ | | 106| 2.13G|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 2.13G|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 70| | 71| | /* a = a + mu * m * b**i 72| | * 73| | * This is computed in place and on the fly. The multiplication 74| | * by b**i is handled by offseting which columns the results 75| | * are added to. 76| | * 77| | * Note the comba method normally doesn't handle carries in the 78| | * inner loop In this case we fix the carry from the previous 79| | * column since the Montgomery reduction requires digits of the 80| | * result (so far) [see above] to work. This is 81| | * handled by fixing up one carry after the inner loop. The 82| | * carry fixups are done in order so after these loops the 83| | * first m->used words of W[] have the carries fixed 84| | */ 85| 2.13G| { 86| 2.13G| int iy; 87| 2.13G| mp_digit *tmpn; 88| 2.13G| mp_word *_W; 89| | 90| | /* alias for the digits of the modulus */ 91| 2.13G| tmpn = n->dp; 92| | 93| | /* Alias for the columns set by an offset of ix */ 94| 2.13G| _W = W + ix; 95| | 96| | /* inner loop */ 97| 71.6G| for (iy = 0; iy < n->used; iy++) { ------------------ | Branch (97:23): [True: 69.5G, False: 2.13G] ------------------ 98| 69.5G| *_W++ += (mp_word)mu * (mp_word)*tmpn++; 99| 69.5G| } 100| 2.13G| } 101| | 102| | /* now fix carry for next digit, W[ix+1] */ 103| 2.13G| W[ix + 1] += W[ix] >> (mp_word)MP_DIGIT_BIT; ------------------ | | 82| 2.13G|# define MP_DIGIT_BIT 60 ------------------ 104| 2.13G| } 105| | 106| | /* now we have to propagate the carries and 107| | * shift the words downward [all those least 108| | * significant digits we zeroed]. 109| | */ 110| 85.7M| { 111| 85.7M| mp_digit *tmpx; 112| 85.7M| mp_word *_W, *_W1; 113| | 114| | /* nox fix rest of carries */ 115| | 116| | /* alias for current word */ 117| 85.7M| _W1 = W + ix; 118| | 119| | /* alias for next word, where the carry goes */ 120| 85.7M| _W = W + ++ix; 121| | 122| 2.21G| for (; ix < ((n->used * 2) + 1); ix++) { ------------------ | Branch (122:14): [True: 2.13G, False: 85.7M] ------------------ 123| 2.13G| *_W++ += *_W1++ >> (mp_word)MP_DIGIT_BIT; ------------------ | | 82| 2.13G|# define MP_DIGIT_BIT 60 ------------------ 124| 2.13G| } 125| | 126| | /* copy out, A = A/b**n 127| | * 128| | * The result is A/b**n but instead of converting from an 129| | * array of mp_word to mp_digit than calling mp_rshd 130| | * we just copy them in the right order 131| | */ 132| | 133| | /* alias for destination word */ 134| 85.7M| tmpx = x->dp; 135| | 136| | /* alias for shifted double precision result */ 137| 85.7M| _W = W + n->used; 138| | 139| 2.30G| for (ix = 0; ix < (n->used + 1); ix++) { ------------------ | Branch (139:20): [True: 2.21G, False: 85.7M] ------------------ 140| 2.21G| *tmpx++ = *_W++ & (mp_word)MP_MASK; ------------------ | | 106| 2.21G|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 2.21G|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 141| 2.21G| } 142| | 143| | /* zero oldused digits, if the input a was larger than 144| | * m->used+1 we'll have to clear the digits 145| | */ 146| 85.7M| MP_ZERO_DIGITS(tmpx, olduse - ix); ------------------ | | 89| 85.7M|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 85.7M|do { \ | | 91| 85.7M| int zd_ = (digits); \ | | 92| 85.7M| mp_digit* zm_ = (mem); \ | | 93| 2.04G| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 1.95G, False: 85.7M] | | ------------------ | | 94| 1.95G| *zm_++ = 0; \ | | 95| 1.95G| } \ | | 96| 85.7M|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 147| 85.7M| } 148| | 149| | /* set the max used and clamp */ 150| 85.7M| x->used = n->used + 1; 151| 85.7M| mp_clamp(x); 152| | 153| | /* if A >= m then A = A - m */ 154| 85.7M| if (mp_cmp_mag(x, n) != MP_LT) { ------------------ | | 154| 85.7M|#define MP_LT -1 /* less than */ ------------------ | Branch (154:8): [True: 3, False: 85.7M] ------------------ 155| 3| return s_mp_sub(x, n, x); 156| 3| } 157| 85.7M| return MP_OKAY; ------------------ | | 161| 85.7M|#define MP_OKAY 0 /* no error */ ------------------ 158| 85.7M|} s_mp_mul_digs_fast: 23| 26.8M|{ 24| 26.8M| int olduse, pa, ix, iz; 25| 26.8M| mp_err err; 26| 26.8M| mp_digit W[MP_WARRAY]; 27| 26.8M| mp_word _W; 28| | 29| | /* grow the destination as required */ 30| 26.8M| if (c->alloc < digs) { ------------------ | Branch (30:8): [True: 1.74M, False: 25.1M] ------------------ 31| 1.74M| if ((err = mp_grow(c, digs)) != MP_OKAY) { ------------------ | | 161| 1.74M|#define MP_OKAY 0 /* no error */ ------------------ | Branch (31:11): [True: 0, False: 1.74M] ------------------ 32| 0| return err; 33| 0| } 34| 1.74M| } 35| | 36| | /* number of output digits to produce */ 37| 26.8M| pa = MP_MIN(digs, a->used + b->used); ------------------ | | 156| 26.8M|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 0, False: 26.8M] | | ------------------ ------------------ 38| | 39| | /* clear the carry */ 40| 26.8M| _W = 0; 41| 769M| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (41:17): [True: 743M, False: 26.8M] ------------------ 42| 743M| int tx, ty; 43| 743M| int iy; 44| 743M| mp_digit *tmpx, *tmpy; 45| | 46| | /* get offsets into the two bignums */ 47| 743M| ty = MP_MIN(b->used-1, ix); ------------------ | | 156| 743M|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 371M, False: 371M] | | ------------------ ------------------ 48| 743M| tx = ix - ty; 49| | 50| | /* setup temp aliases */ 51| 743M| tmpx = a->dp + tx; 52| 743M| tmpy = b->dp + ty; 53| | 54| | /* this is the number of times the loop will iterrate, essentially 55| | while (tx++ < a->used && ty-- >= 0) { ... } 56| | */ 57| 743M| iy = MP_MIN(a->used-tx, ty+1); ------------------ | | 156| 743M|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 371M, False: 371M] | | ------------------ ------------------ 58| | 59| | /* execute loop */ 60| 10.6G| for (iz = 0; iz < iy; ++iz) { ------------------ | Branch (60:20): [True: 9.87G, False: 743M] ------------------ 61| 9.87G| _W += (mp_word)*tmpx++ * (mp_word)*tmpy--; 62| | 63| 9.87G| } 64| | 65| | /* store term */ 66| 743M| W[ix] = (mp_digit)_W & MP_MASK; ------------------ | | 106| 743M|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 743M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 67| | 68| | /* make next carry */ 69| 743M| _W = _W >> (mp_word)MP_DIGIT_BIT; ------------------ | | 82| 743M|# define MP_DIGIT_BIT 60 ------------------ 70| 743M| } 71| | 72| | /* setup dest */ 73| 26.8M| olduse = c->used; 74| 26.8M| c->used = pa; 75| | 76| 26.8M| { 77| 26.8M| mp_digit *tmpc; 78| 26.8M| tmpc = c->dp; 79| 769M| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (79:20): [True: 743M, False: 26.8M] ------------------ 80| | /* now extract the previous digit [below the carry] */ 81| 743M| *tmpc++ = W[ix]; 82| 743M| } 83| | 84| | /* clear unused digits [that existed in the old copy of c] */ 85| 26.8M| MP_ZERO_DIGITS(tmpc, olduse - ix); ------------------ | | 89| 26.8M|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 26.8M|do { \ | | 91| 26.8M| int zd_ = (digits); \ | | 92| 26.8M| mp_digit* zm_ = (mem); \ | | 93| 26.8M| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 26.8M] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 26.8M|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 86| 26.8M| } 87| 26.8M| mp_clamp(c); 88| 26.8M| return MP_OKAY; ------------------ | | 161| 26.8M|#define MP_OKAY 0 /* no error */ ------------------ 89| 26.8M|} s_mp_sqr_fast: 17| 58.9M|{ 18| 58.9M| int olduse, pa, ix, iz; 19| 58.9M| mp_digit W[MP_WARRAY], *tmpx; 20| 58.9M| mp_word W1; 21| 58.9M| mp_err err; 22| | 23| | /* grow the destination as required */ 24| 58.9M| pa = a->used + a->used; 25| 58.9M| if (b->alloc < pa) { ------------------ | Branch (25:8): [True: 84.0k, False: 58.8M] ------------------ 26| 84.0k| if ((err = mp_grow(b, pa)) != MP_OKAY) { ------------------ | | 161| 84.0k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (26:11): [True: 0, False: 84.0k] ------------------ 27| 0| return err; 28| 0| } 29| 84.0k| } 30| | 31| | /* number of output digits to produce */ 32| 58.9M| W1 = 0; 33| 3.57G| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (33:17): [True: 3.51G, False: 58.9M] ------------------ 34| 3.51G| int tx, ty, iy; 35| 3.51G| mp_word _W; 36| 3.51G| mp_digit *tmpy; 37| | 38| | /* clear counter */ 39| 3.51G| _W = 0; 40| | 41| | /* get offsets into the two bignums */ 42| 3.51G| ty = MP_MIN(a->used-1, ix); ------------------ | | 156| 3.51G|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 1.75G, False: 1.75G] | | ------------------ ------------------ 43| 3.51G| tx = ix - ty; 44| | 45| | /* setup temp aliases */ 46| 3.51G| tmpx = a->dp + tx; 47| 3.51G| tmpy = a->dp + ty; 48| | 49| | /* this is the number of times the loop will iterrate, essentially 50| | while (tx++ < a->used && ty-- >= 0) { ... } 51| | */ 52| 3.51G| iy = MP_MIN(a->used-tx, ty+1); ------------------ | | 156| 3.51G|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 1.75G, False: 1.75G] | | ------------------ ------------------ 53| | 54| | /* now for squaring tx can never equal ty 55| | * we halve the distance since they approach at a rate of 2x 56| | * and we have to round because odd cases need to be executed 57| | */ 58| 3.51G| iy = MP_MIN(iy, ((ty-tx)+1)>>1); ------------------ | | 156| 3.51G|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 0, False: 3.51G] | | ------------------ ------------------ 59| | 60| | /* execute loop */ 61| 32.4G| for (iz = 0; iz < iy; iz++) { ------------------ | Branch (61:20): [True: 28.9G, False: 3.51G] ------------------ 62| 28.9G| _W += (mp_word)*tmpx++ * (mp_word)*tmpy--; 63| 28.9G| } 64| | 65| | /* double the inner product and add carry */ 66| 3.51G| _W = _W + _W + W1; 67| | 68| | /* even columns have the square term in them */ 69| 3.51G| if (((unsigned)ix & 1u) == 0u) { ------------------ | Branch (69:11): [True: 1.75G, False: 1.75G] ------------------ 70| 1.75G| _W += (mp_word)a->dp[ix>>1] * (mp_word)a->dp[ix>>1]; 71| 1.75G| } 72| | 73| | /* store it */ 74| 3.51G| W[ix] = (mp_digit)_W & MP_MASK; ------------------ | | 106| 3.51G|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 3.51G|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 75| | 76| | /* make next carry */ 77| 3.51G| W1 = _W >> (mp_word)MP_DIGIT_BIT; ------------------ | | 82| 3.51G|# define MP_DIGIT_BIT 60 ------------------ 78| 3.51G| } 79| | 80| | /* setup dest */ 81| 58.9M| olduse = b->used; 82| 58.9M| b->used = a->used+a->used; 83| | 84| 58.9M| { 85| 58.9M| mp_digit *tmpb; 86| 58.9M| tmpb = b->dp; 87| 3.57G| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (87:20): [True: 3.51G, False: 58.9M] ------------------ 88| 3.51G| *tmpb++ = W[ix] & MP_MASK; ------------------ | | 106| 3.51G|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 3.51G|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 89| 3.51G| } 90| | 91| | /* clear unused digits [that existed in the old copy of c] */ 92| 58.9M| MP_ZERO_DIGITS(tmpb, olduse - ix); ------------------ | | 89| 58.9M|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 58.9M|do { \ | | 91| 58.9M| int zd_ = (digits); \ | | 92| 58.9M| mp_digit* zm_ = (mem); \ | | 93| 58.9M| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 31.5k, False: 58.9M] | | ------------------ | | 94| 31.5k| *zm_++ = 0; \ | | 95| 31.5k| } \ | | 96| 58.9M|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 93| 58.9M| } 94| 58.9M| mp_clamp(b); 95| 58.9M| return MP_OKAY; ------------------ | | 161| 58.9M|#define MP_OKAY 0 /* no error */ ------------------ 96| 58.9M|} s_mp_sub: 8| 43.7M|{ 9| 43.7M| int olduse, min, max; 10| 43.7M| mp_err err; 11| | 12| | /* find sizes */ 13| 43.7M| min = b->used; 14| 43.7M| max = a->used; 15| | 16| | /* init result */ 17| 43.7M| if (c->alloc < max) { ------------------ | Branch (17:8): [True: 1.65k, False: 43.6M] ------------------ 18| 1.65k| if ((err = mp_grow(c, max)) != MP_OKAY) { ------------------ | | 161| 1.65k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (18:11): [True: 0, False: 1.65k] ------------------ 19| 0| return err; 20| 0| } 21| 1.65k| } 22| 43.7M| olduse = c->used; 23| 43.7M| c->used = max; 24| | 25| 43.7M| { 26| 43.7M| mp_digit u, *tmpa, *tmpb, *tmpc; 27| 43.7M| int i; 28| | 29| | /* alias for digit pointers */ 30| 43.7M| tmpa = a->dp; 31| 43.7M| tmpb = b->dp; 32| 43.7M| tmpc = c->dp; 33| | 34| | /* set carry to zero */ 35| 43.7M| u = 0; 36| 568M| for (i = 0; i < min; i++) { ------------------ | Branch (36:19): [True: 524M, False: 43.7M] ------------------ 37| | /* T[i] = A[i] - B[i] - U */ 38| 524M| *tmpc = (*tmpa++ - *tmpb++) - u; 39| | 40| | /* U = carry bit of T[i] 41| | * Note this saves performing an AND operation since 42| | * if a carry does occur it will propagate all the way to the 43| | * MSB. As a result a single shift is enough to get the carry 44| | */ 45| 524M| u = *tmpc >> (MP_SIZEOF_BITS(mp_digit) - 1u); ------------------ | | 167| 524M|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ 46| | 47| | /* Clear carry from T[i] */ 48| 524M| *tmpc++ &= MP_MASK; ------------------ | | 106| 524M|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 524M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 49| 524M| } 50| | 51| | /* now copy higher words if any, e.g. if A has more digits than B */ 52| 44.3M| for (; i < max; i++) { ------------------ | Branch (52:14): [True: 637k, False: 43.7M] ------------------ 53| | /* T[i] = A[i] - U */ 54| 637k| *tmpc = *tmpa++ - u; 55| | 56| | /* U = carry bit of T[i] */ 57| 637k| u = *tmpc >> (MP_SIZEOF_BITS(mp_digit) - 1u); ------------------ | | 167| 637k|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ 58| | 59| | /* Clear carry from T[i] */ 60| 637k| *tmpc++ &= MP_MASK; ------------------ | | 106| 637k|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 637k|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 61| 637k| } 62| | 63| | /* clear digits above used (since we may not have grown result above) */ 64| 43.7M| MP_ZERO_DIGITS(tmpc, olduse - c->used); ------------------ | | 89| 43.7M|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 43.7M|do { \ | | 91| 43.7M| int zd_ = (digits); \ | | 92| 43.7M| mp_digit* zm_ = (mem); \ | | 93| 43.7M| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 43.7M] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 43.7M|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 65| 43.7M| } 66| | 67| 43.7M| mp_clamp(c); 68| 43.7M| return MP_OKAY; ------------------ | | 161| 43.7M|#define MP_OKAY 0 /* no error */ ------------------ 69| 43.7M|} mp_set_u32: 253| 7.53k| { \ 254| 7.53k| int i = 0; \ 255| 7.53k| while (b != 0u) { \ ------------------ | Branch (255:16): [True: 7.53k, False: 0] ------------------ 256| 7.53k| a->dp[i++] = ((mp_digit)b & MP_MASK); \ ------------------ | | 106| 7.53k|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 7.53k|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 257| 7.53k| if (MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) { break; } \ ------------------ | | 167| 7.53k|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ if (MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) { break; } \ ------------------ | | 82| 7.53k|# define MP_DIGIT_BIT 60 ------------------ | Branch (257:17): [Folded - Ignored] ------------------ 258| 7.53k| b >>= ((MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) ? 0 : MP_DIGIT_BIT); \ ------------------ | | 167| 0|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ b >>= ((MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) ? 0 : MP_DIGIT_BIT); \ ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ b >>= ((MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) ? 0 : MP_DIGIT_BIT); \ ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ | Branch (258:20): [Folded - Ignored] ------------------ 259| 0| } \ 260| 7.53k| a->used = i; \ 261| 7.53k| a->sign = MP_ZPOS; \ ------------------ | | 151| 7.53k|#define MP_ZPOS 0 /* positive integer */ ------------------ 262| 7.53k| MP_ZERO_DIGITS(a->dp + a->used, a->alloc - a->used); \ ------------------ | | 89| 7.53k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 7.53k|do { \ | | 91| 7.53k| int zd_ = (digits); \ | | 92| 7.53k| mp_digit* zm_ = (mem); \ | | 93| 240k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 233k, False: 7.53k] | | ------------------ | | 94| 233k| *zm_++ = 0; \ | | 95| 233k| } \ | | 96| 7.53k|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 263| 7.53k| } mp_set_ul: 253| 9.63k| { \ 254| 9.63k| int i = 0; \ 255| 19.2k| while (b != 0u) { \ ------------------ | Branch (255:16): [True: 9.63k, False: 9.63k] ------------------ 256| 9.63k| a->dp[i++] = ((mp_digit)b & MP_MASK); \ ------------------ | | 106| 9.63k|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 9.63k|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 257| 9.63k| if (MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) { break; } \ ------------------ | | 167| 9.63k|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ if (MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) { break; } \ ------------------ | | 82| 9.63k|# define MP_DIGIT_BIT 60 ------------------ | Branch (257:17): [Folded - Ignored] ------------------ 258| 9.63k| b >>= ((MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) ? 0 : MP_DIGIT_BIT); \ ------------------ | | 167| 9.63k|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ b >>= ((MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) ? 0 : MP_DIGIT_BIT); \ ------------------ | | 82| 9.63k|# define MP_DIGIT_BIT 60 ------------------ b >>= ((MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) ? 0 : MP_DIGIT_BIT); \ ------------------ | | 82| 9.63k|# define MP_DIGIT_BIT 60 ------------------ | Branch (258:20): [Folded - Ignored] ------------------ 259| 9.63k| } \ 260| 9.63k| a->used = i; \ 261| 9.63k| a->sign = MP_ZPOS; \ ------------------ | | 151| 9.63k|#define MP_ZPOS 0 /* positive integer */ ------------------ 262| 9.63k| MP_ZERO_DIGITS(a->dp + a->used, a->alloc - a->used); \ ------------------ | | 89| 9.63k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 9.63k|do { \ | | 91| 9.63k| int zd_ = (digits); \ | | 92| 9.63k| mp_digit* zm_ = (mem); \ | | 93| 308k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 298k, False: 9.63k] | | ------------------ | | 94| 298k| *zm_++ = 0; \ | | 95| 298k| } \ | | 96| 9.63k|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 263| 9.63k| } m_mp_init: 31| 9.77k|void m_mp_init(mp_int *mp) { 32| | 33| 9.77k| if (mp_init(mp) != MP_OKAY) { ------------------ | | 161| 9.77k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (33:6): [True: 0, False: 9.77k] ------------------ 34| 0| dropbear_exit("Mem alloc error"); 35| 0| } 36| 9.77k|} m_mp_init_multi: 41| 31.6k|{ 42| 31.6k| mp_int* cur_arg = mp; 43| 31.6k| va_list args; 44| | 45| 31.6k| va_start(args, mp); /* init args to next argument from caller */ 46| 165k| while (cur_arg != NULL) { ------------------ | Branch (46:9): [True: 133k, False: 31.6k] ------------------ 47| 133k| if (mp_init(cur_arg) != MP_OKAY) { ------------------ | | 161| 133k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (47:7): [True: 0, False: 133k] ------------------ 48| 0| dropbear_exit("Mem alloc error"); 49| 0| } 50| 133k| cur_arg = va_arg(args, mp_int*); 51| 133k| } 52| 31.6k| va_end(args); 53| 31.6k|} m_mp_alloc_init_multi: 56| 16.8k|{ 57| 16.8k| mp_int** cur_arg = mp; 58| 16.8k| va_list args; 59| | 60| 16.8k| va_start(args, mp); /* init args to next argument from caller */ 61| 33.7k| while (cur_arg != NULL) { ------------------ | Branch (61:9): [True: 16.8k, False: 16.8k] ------------------ 62| 16.8k| *cur_arg = m_malloc(sizeof(mp_int)); 63| 16.8k| if (mp_init(*cur_arg) != MP_OKAY) { ------------------ | | 161| 16.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (63:7): [True: 0, False: 16.8k] ------------------ 64| 0| dropbear_exit("Mem alloc error"); 65| 0| } 66| 16.8k| cur_arg = va_arg(args, mp_int**); 67| 16.8k| } 68| 16.8k| va_end(args); 69| 16.8k|} bytes_to_mp: 87| 66.6k|void bytes_to_mp(mp_int *mp, const unsigned char* bytes, unsigned int len) { 88| | 89| 66.6k| if (mp_from_ubin(mp, (unsigned char*)bytes, len) != MP_OKAY) { ------------------ | | 161| 66.6k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (89:6): [True: 0, False: 66.6k] ------------------ 90| 0| dropbear_exit("Mem alloc error"); 91| 0| } 92| 66.6k|} hash_process_mp: 96| 16.8k| hash_state *hs, const mp_int *mp) { 97| 16.8k| buffer * buf; 98| | 99| 16.8k| buf = buf_new(512 + 20); /* max buffer is a 4096 bit key, 100| | plus header + some leeway*/ 101| 16.8k| buf_putmpint(buf, mp); 102| 16.8k| hash_desc->process(hs, buf->data, buf->len); 103| 16.8k| buf_burn_free(buf); 104| 16.8k|} buf_new: 41| 296k|buffer* buf_new(unsigned int size) { 42| 296k| buffer* buf; 43| 296k| if (size > BUF_MAX_SIZE) { ------------------ | | 35| 296k|#define BUF_MAX_SIZE 1000000000 ------------------ | Branch (43:6): [True: 0, False: 296k] ------------------ 44| 0| dropbear_exit("buf->size too big"); 45| 0| } 46| | 47| 296k| buf = (buffer*)m_malloc(sizeof(buffer)+size); 48| 296k| buf->data = (unsigned char*)buf + sizeof(buffer); 49| 296k| buf->size = size; 50| 296k| return buf; 51| 296k|} buf_free: 54| 230k|void buf_free(buffer* buf) { 55| 230k| m_free(buf); ------------------ | | 24| 230k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 56| 230k|} buf_burn_free: 59| 63.2k|void buf_burn_free(buffer* buf) { 60| 63.2k| m_burn(buf->data, buf->size); 61| 63.2k| m_free(buf); ------------------ | | 24| 63.2k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 62| 63.2k|} buf_resize: 67| 18.3k|buffer* buf_resize(buffer *buf, unsigned int newsize) { 68| 18.3k| if (newsize > BUF_MAX_SIZE) { ------------------ | | 35| 18.3k|#define BUF_MAX_SIZE 1000000000 ------------------ | Branch (68:6): [True: 0, False: 18.3k] ------------------ 69| 0| dropbear_exit("buf->size too big"); 70| 0| } 71| | 72| 18.3k| buf = m_realloc(buf, sizeof(buffer)+newsize); 73| 18.3k| buf->data = (unsigned char*)buf + sizeof(buffer); 74| 18.3k| buf->size = newsize; 75| 18.3k| buf->len = MIN(newsize, buf->len); 76| 18.3k| buf->pos = MIN(newsize, buf->pos); 77| 18.3k| return buf; 78| 18.3k|} buf_newcopy: 82| 21.1k|buffer* buf_newcopy(const buffer* buf) { 83| | 84| 21.1k| buffer* ret; 85| | 86| 21.1k| ret = buf_new(buf->len); 87| 21.1k| ret->len = buf->len; 88| 21.1k| if (buf->len > 0) { ------------------ | Branch (88:6): [True: 21.1k, False: 0] ------------------ 89| 21.1k| memcpy(ret->data, buf->data, buf->len); 90| 21.1k| } 91| 21.1k| return ret; 92| 21.1k|} buf_setlen: 95| 303k|void buf_setlen(buffer* buf, unsigned int len) { 96| 303k| if (len > buf->size) { ------------------ | Branch (96:6): [True: 0, False: 303k] ------------------ 97| 0| dropbear_exit("Bad buf_setlen"); 98| 0| } 99| 303k| buf->len = len; 100| 303k| buf->pos = MIN(buf->pos, buf->len); 101| 303k|} buf_incrlen: 104| 1.57M|void buf_incrlen(buffer* buf, unsigned int incr) { 105| 1.57M| if (incr > BUF_MAX_INCR || buf->len + incr > buf->size) { ------------------ | | 34| 3.15M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (105:6): [True: 0, False: 1.57M] | Branch (105:29): [True: 0, False: 1.57M] ------------------ 106| 0| dropbear_exit("Bad buf_incrlen"); 107| 0| } 108| 1.57M| buf->len += incr; 109| 1.57M|} buf_setpos: 111| 1.26M|void buf_setpos(buffer* buf, unsigned int pos) { 112| | 113| 1.26M| if (pos > buf->len) { ------------------ | Branch (113:6): [True: 0, False: 1.26M] ------------------ 114| 0| dropbear_exit("Bad buf_setpos"); 115| 0| } 116| 1.26M| buf->pos = pos; 117| 1.26M|} buf_incrwritepos: 120| 2.33M|void buf_incrwritepos(buffer* buf, unsigned int incr) { 121| 2.33M| if (incr > BUF_MAX_INCR || buf->pos + incr > buf->size) { ------------------ | | 34| 4.66M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (121:6): [True: 0, False: 2.33M] | Branch (121:29): [True: 0, False: 2.33M] ------------------ 122| 0| dropbear_exit("Bad buf_incrwritepos"); 123| 0| } 124| 2.33M| buf->pos += incr; 125| 2.33M| if (buf->pos > buf->len) { ------------------ | Branch (125:6): [True: 1.90M, False: 426k] ------------------ 126| 1.90M| buf->len = buf->pos; 127| 1.90M| } 128| 2.33M|} buf_incrpos: 131| 1.40M|void buf_incrpos(buffer* buf, unsigned int incr) { 132| 1.40M| if (incr > BUF_MAX_INCR ------------------ | | 34| 2.81M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (132:6): [True: 9, False: 1.40M] ------------------ 133| 1.40M| || (buf->pos + incr) > buf->len) { ------------------ | Branch (133:6): [True: 137, False: 1.40M] ------------------ 134| 146| dropbear_exit("Bad buf_incrpos"); 135| 146| } 136| 1.40M| buf->pos += incr; 137| 1.40M|} buf_decrpos: 140| 4|void buf_decrpos(buffer* buf, unsigned int decr) { 141| 4| if (decr > buf->pos) { ------------------ | Branch (141:6): [True: 0, False: 4] ------------------ 142| 0| dropbear_exit("Bad buf_decrpos"); 143| 0| } 144| 4| buf->pos -= decr; 145| 4|} buf_getbyte: 148| 234k|unsigned char buf_getbyte(buffer* buf) { 149| | 150| | /* This check is really just ==, but the >= allows us to check for the 151| | * bad case of pos > len, which should _never_ happen. */ 152| 234k| if (buf->pos >= buf->len) { ------------------ | Branch (152:6): [True: 3, False: 234k] ------------------ 153| 3| dropbear_exit("Bad buf_getbyte"); 154| 3| } 155| 234k| return buf->data[buf->pos++]; 156| 234k|} buf_getbool: 159| 18.8k|unsigned char buf_getbool(buffer* buf) { 160| | 161| 18.8k| unsigned char b; 162| 18.8k| b = buf_getbyte(buf); 163| 18.8k| if (b != 0) ------------------ | Branch (163:6): [True: 1.80k, False: 17.0k] ------------------ 164| 1.80k| b = 1; 165| 18.8k| return b; 166| 18.8k|} buf_putbyte: 169| 1.55M|void buf_putbyte(buffer* buf, unsigned char val) { 170| | 171| 1.55M| if (buf->pos >= buf->len) { ------------------ | Branch (171:6): [True: 1.48M, False: 70.8k] ------------------ 172| 1.48M| buf_incrlen(buf, 1); 173| 1.48M| } 174| 1.55M| buf->data[buf->pos] = val; 175| 1.55M| buf->pos++; 176| 1.55M|} buf_getptr: 180| 1.75M|unsigned char* buf_getptr(const buffer* buf, unsigned int len) { 181| | 182| 1.75M| if (len > BUF_MAX_INCR || buf->pos + len > buf->len) { ------------------ | | 34| 3.51M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (182:6): [True: 6, False: 1.75M] | Branch (182:28): [True: 228, False: 1.75M] ------------------ 183| 234| dropbear_exit("Bad buf_getptr"); 184| 234| } 185| 1.75M| return &buf->data[buf->pos]; 186| 1.75M|} buf_getwriteptr: 190| 2.42M|unsigned char* buf_getwriteptr(const buffer* buf, unsigned int len) { 191| | 192| 2.42M| if (len > BUF_MAX_INCR || buf->pos + len > buf->size) { ------------------ | | 34| 4.84M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (192:6): [True: 0, False: 2.42M] | Branch (192:28): [True: 0, False: 2.42M] ------------------ 193| 0| dropbear_exit("Bad buf_getwriteptr"); 194| 0| } 195| 2.42M| return &buf->data[buf->pos]; 196| 2.42M|} buf_getstring: 201| 172k|char* buf_getstring(buffer* buf, unsigned int *retlen) { 202| | 203| 172k| unsigned int len; 204| 172k| char* ret; 205| 172k| void* src = NULL; 206| 172k| len = buf_getint(buf); 207| 172k| if (len > MAX_STRING_LEN) { ------------------ | | 228| 172k|#define MAX_STRING_LEN (MAX(MAX_CMD_LEN, 2400)) /* Sun SSH needs 2400 for algos, ------------------ | Branch (207:6): [True: 80, False: 172k] ------------------ 208| 80| dropbear_exit("String too long"); 209| 80| } 210| | 211| 172k| if (retlen != NULL) { ------------------ | Branch (211:6): [True: 172k, False: 28] ------------------ 212| 172k| *retlen = len; 213| 172k| } 214| 172k| src = buf_getptr(buf, len); 215| 172k| ret = m_malloc(len+1); 216| 172k| memcpy(ret, src, len); 217| 172k| buf_incrpos(buf, len); 218| 172k| ret[len] = '\0'; 219| | 220| 172k| return ret; 221| 172k|} buf_getstringbuf: 246| 7.71k|buffer * buf_getstringbuf(buffer *buf) { 247| 7.71k| return buf_getstringbuf_int(buf, 0); 248| 7.71k|} buf_eatstring: 257| 35.3k|void buf_eatstring(buffer *buf) { 258| | 259| 35.3k| buf_incrpos( buf, buf_getint(buf) ); 260| 35.3k|} buf_getint: 263| 316k|unsigned int buf_getint(buffer* buf) { 264| 316k| unsigned int ret; 265| | 266| 316k| LOAD32H(ret, buf_getptr(buf, 4)); ------------------ | | 66| 316k|#define LOAD32H(x, y) \ | | 67| 316k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 316k|#define XMEMCPY memcpy | | ------------------ | | 68| 316k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 267| 316k| buf_incrpos(buf, 4); 268| 316k| return ret; 269| 316k|} buf_putint: 272| 826k|void buf_putint(buffer* buf, int unsigned val) { 273| | 274| 826k| STORE32H(val, buf_getwriteptr(buf, 4)); ------------------ | | 62| 826k|#define STORE32H(x, y) \ | | 63| 826k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 826k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 826k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 275| 826k| buf_incrwritepos(buf, 4); 276| | 277| 826k|} buf_putstring: 280| 247k|void buf_putstring(buffer* buf, const char* str, unsigned int len) { 281| | 282| 247k| buf_putint(buf, len); 283| 247k| buf_putbytes(buf, (const unsigned char*)str, len); 284| | 285| 247k|} buf_putbufstring: 288| 56.2k|void buf_putbufstring(buffer *buf, const buffer* buf_str) { 289| 56.2k| buf_putstring(buf, (const char*)buf_str->data, buf_str->len); 290| 56.2k|} buf_putbytes: 294| 862k|void buf_putbytes(buffer *buf, const unsigned char *bytes, unsigned int len) { 295| 862k| memcpy(buf_getwriteptr(buf, len), bytes, len); 296| 862k| buf_incrwritepos(buf, len); 297| 862k|} buf_putmpint: 302| 152k|void buf_putmpint(buffer* buf, const mp_int * mp) { 303| 152k| size_t written; 304| 152k| unsigned int len, pad = 0; 305| 152k| TRACE2(("enter buf_putmpint")) 306| | 307| 152k| dropbear_assert(mp != NULL); ------------------ | | 83| 152k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 152k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 308| | 309| 152k| if (mp_isneg(mp)) { ------------------ | | 295| 152k|#define mp_isneg(a) (((a)->sign != MP_ZPOS) ? MP_YES : MP_NO) | | ------------------ | | | | 151| 152k|#define MP_ZPOS 0 /* positive integer */ | | ------------------ | | #define mp_isneg(a) (((a)->sign != MP_ZPOS) ? MP_YES : MP_NO) | | ------------------ | | | | 158| 0|#define MP_YES 1 | | ------------------ | | #define mp_isneg(a) (((a)->sign != MP_ZPOS) ? MP_YES : MP_NO) | | ------------------ | | | | 159| 152k|#define MP_NO 0 | | ------------------ | | | Branch (295:22): [True: 0, False: 152k] | | | Branch (295:23): [True: 0, False: 152k] | | ------------------ ------------------ 310| 0| dropbear_exit("negative bignum"); 311| 0| } 312| | 313| | /* zero check */ 314| 152k| if (mp_iszero(mp)) { ------------------ | | 292| 152k|#define mp_iszero(a) (((a)->used == 0) ? MP_YES : MP_NO) | | ------------------ | | | | 158| 0|#define MP_YES 1 | | ------------------ | | #define mp_iszero(a) (((a)->used == 0) ? MP_YES : MP_NO) | | ------------------ | | | | 159| 152k|#define MP_NO 0 | | ------------------ | | | Branch (292:22): [True: 0, False: 152k] | | | Branch (292:23): [True: 0, False: 152k] | | ------------------ ------------------ 315| 0| len = 0; 316| 152k| } else { 317| | /* SSH spec requires padding for mpints with the MSB set, this code 318| | * implements it */ 319| 152k| len = mp_count_bits(mp); 320| | /* if the top bit of MSB is set, we need to pad */ 321| 152k| pad = (len%8 == 0) ? 1 : 0; ------------------ | Branch (321:9): [True: 73.5k, False: 79.1k] ------------------ 322| 152k| len = len / 8 + 1; /* don't worry about rounding, we need it for 323| | padding anyway when len%8 == 0 */ 324| | 325| 152k| } 326| | 327| | /* store the length */ 328| 152k| buf_putint(buf, len); 329| | 330| | /* store the actual value */ 331| 152k| if (len > 0) { ------------------ | Branch (331:6): [True: 152k, False: 0] ------------------ 332| 152k| if (pad) { ------------------ | Branch (332:7): [True: 73.5k, False: 79.1k] ------------------ 333| 73.5k| buf_putbyte(buf, 0x00); 334| 73.5k| } 335| 152k| if (mp_to_ubin(mp, buf_getwriteptr(buf, len-pad), len-pad, &written) != MP_OKAY) { ------------------ | | 161| 152k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (335:7): [True: 0, False: 152k] ------------------ 336| 0| dropbear_exit("mpint error"); 337| 0| } 338| 152k| buf_incrwritepos(buf, written); 339| 152k| } 340| | 341| 152k| TRACE2(("leave buf_putmpint")) 342| 152k|} buf_getmpint: 347| 9.78k|int buf_getmpint(buffer* buf, mp_int* mp) { 348| | 349| 9.78k| unsigned int len; 350| 9.78k| len = buf_getint(buf); 351| | 352| 9.78k| if (len == 0) { ------------------ | Branch (352:6): [True: 2, False: 9.78k] ------------------ 353| 2| mp_zero(mp); 354| 2| return DROPBEAR_SUCCESS; ------------------ | | 102| 2|#define DROPBEAR_SUCCESS 0 ------------------ 355| 2| } 356| | 357| 9.78k| if (len > BUF_MAX_MPINT) { ------------------ | | 38| 9.78k|#define BUF_MAX_MPINT (8240 / 8) ------------------ | Branch (357:6): [True: 57, False: 9.72k] ------------------ 358| 57| return DROPBEAR_FAILURE; ------------------ | | 103| 57|#define DROPBEAR_FAILURE -1 ------------------ 359| 57| } 360| | 361| | /* check for negative */ 362| 9.72k| if (*buf_getptr(buf, 1) & (1 << (CHAR_BIT-1))) { ------------------ | Branch (362:6): [True: 11, False: 9.71k] ------------------ 363| 11| return DROPBEAR_FAILURE; ------------------ | | 103| 11|#define DROPBEAR_FAILURE -1 ------------------ 364| 11| } 365| | 366| 9.71k| if (mp_from_ubin(mp, buf_getptr(buf, len), len) != MP_OKAY) { ------------------ | | 161| 9.71k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (366:6): [True: 0, False: 9.71k] ------------------ 367| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 368| 0| } 369| | 370| 9.71k| buf_incrpos(buf, len); 371| 9.71k| return DROPBEAR_SUCCESS; ------------------ | | 102| 9.71k|#define DROPBEAR_SUCCESS 0 ------------------ 372| 9.71k|} buffer.c:buf_getstringbuf_int: 224| 7.71k|static buffer * buf_getstringbuf_int(buffer *buf, int incllen) { 225| 7.71k| buffer *ret = NULL; 226| 7.71k| unsigned int len = buf_getint(buf); 227| 7.71k| int extra = 0; 228| 7.71k| if (len > MAX_STRING_LEN) { ------------------ | | 228| 7.71k|#define MAX_STRING_LEN (MAX(MAX_CMD_LEN, 2400)) /* Sun SSH needs 2400 for algos, ------------------ | Branch (228:6): [True: 35, False: 7.68k] ------------------ 229| 35| dropbear_exit("String too long"); 230| 35| } 231| 7.68k| if (incllen) { ------------------ | Branch (231:6): [True: 0, False: 7.68k] ------------------ 232| 0| extra = 4; 233| 0| } 234| 7.68k| ret = buf_new(len+extra); 235| 7.68k| if (incllen) { ------------------ | Branch (235:6): [True: 0, False: 7.68k] ------------------ 236| 0| buf_putint(ret, len); 237| 0| } 238| 7.68k| memcpy(buf_getwriteptr(ret, len), buf_getptr(buf, len), len); 239| 7.68k| buf_incrpos(buf, len); 240| 7.68k| buf_incrlen(ret, len); 241| 7.68k| buf_setpos(ret, 0); 242| 7.68k| return ret; 243| 7.71k|} chachapoly.c:dropbear_chachapoly_start: 48| 3.62k| int UNUSED(num_rounds), dropbear_chachapoly_state *state) { 49| 3.62k| int err; 50| | 51| 3.62k| TRACE2(("enter dropbear_chachapoly_start")) 52| | 53| 3.62k| if (keylen != CHACHA20_KEY_LEN*2) { ------------------ | | 33| 3.62k|#define CHACHA20_KEY_LEN 32 ------------------ | Branch (53:6): [True: 0, False: 3.62k] ------------------ 54| 0| return CRYPT_ERROR; 55| 0| } 56| | 57| 3.62k| if ((err = chacha_setup(&state->chacha, key, ------------------ | Branch (57:6): [True: 0, False: 3.62k] ------------------ 58| 3.62k| CHACHA20_KEY_LEN, 20)) != CRYPT_OK) { ------------------ | | 33| 3.62k|#define CHACHA20_KEY_LEN 32 ------------------ 59| 0| return err; 60| 0| } 61| | 62| 3.62k| if ((err = chacha_setup(&state->header, key + CHACHA20_KEY_LEN, ------------------ | | 33| 3.62k|#define CHACHA20_KEY_LEN 32 ------------------ | Branch (62:6): [True: 0, False: 3.62k] ------------------ 63| 3.62k| CHACHA20_KEY_LEN, 20) != CRYPT_OK)) { ------------------ | | 33| 3.62k|#define CHACHA20_KEY_LEN 32 ------------------ 64| 0| return err; 65| 0| } 66| | 67| 3.62k| TRACE2(("leave dropbear_chachapoly_start")) 68| 3.62k| return CRYPT_OK; 69| 3.62k|} chachapoly.c:dropbear_chachapoly_crypt: 74| 13.6k| dropbear_chachapoly_state *state, int direction) { 75| 13.6k| poly1305_state poly; 76| 13.6k| unsigned char seqbuf[8], key[POLY1305_KEY_LEN], tag[POLY1305_TAG_LEN]; 77| 13.6k| int err; 78| | 79| 13.6k| TRACE2(("enter dropbear_chachapoly_crypt")) 80| | 81| 13.6k| if (len < 4 || taglen != POLY1305_TAG_LEN) { ------------------ | | 36| 13.6k|#define POLY1305_TAG_LEN 16 ------------------ | Branch (81:6): [True: 0, False: 13.6k] | Branch (81:17): [True: 0, False: 13.6k] ------------------ 82| 0| return CRYPT_ERROR; 83| 0| } 84| | 85| 13.6k| STORE64H((uint64_t)seq, seqbuf); ------------------ | | 101| 13.6k|#define STORE64H(x, y) \ | | 102| 13.6k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 13.6k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 13.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 86| 13.6k| chacha_ivctr64(&state->chacha, seqbuf, sizeof(seqbuf), 0); 87| 13.6k| if ((err = chacha_keystream(&state->chacha, key, sizeof(key))) != CRYPT_OK) { ------------------ | Branch (87:6): [True: 0, False: 13.6k] ------------------ 88| 0| return err; 89| 0| } 90| | 91| 13.6k| poly1305_init(&poly, key, sizeof(key)); 92| 13.6k| if (direction == LTC_DECRYPT) { ------------------ | | 70| 13.6k|#define LTC_DECRYPT 1 ------------------ | Branch (92:6): [True: 0, False: 13.6k] ------------------ 93| 0| poly1305_process(&poly, in, len); 94| 0| poly1305_done(&poly, tag, &taglen); 95| 0| if (constant_time_memcmp(in + len, tag, taglen) != 0) { ------------------ | Branch (95:7): [True: 0, False: 0] ------------------ 96| 0| return CRYPT_ERROR; 97| 0| } 98| 0| } 99| | 100| 13.6k| chacha_ivctr64(&state->header, seqbuf, sizeof(seqbuf), 0); 101| 13.6k| if ((err = chacha_crypt(&state->header, in, 4, out)) != CRYPT_OK) { ------------------ | Branch (101:6): [True: 0, False: 13.6k] ------------------ 102| 0| return err; 103| 0| } 104| | 105| 13.6k| chacha_ivctr64(&state->chacha, seqbuf, sizeof(seqbuf), 1); 106| 13.6k| if ((err = chacha_crypt(&state->chacha, in + 4, len - 4, out + 4)) != CRYPT_OK) { ------------------ | Branch (106:6): [True: 0, False: 13.6k] ------------------ 107| 0| return err; 108| 0| } 109| | 110| 13.6k| if (direction == LTC_ENCRYPT) { ------------------ | | 68| 13.6k|#define LTC_ENCRYPT 0 ------------------ | Branch (110:6): [True: 13.6k, False: 0] ------------------ 111| 13.6k| poly1305_process(&poly, out, len); 112| 13.6k| poly1305_done(&poly, out + len, &taglen); 113| 13.6k| } 114| | 115| 13.6k| TRACE2(("leave dropbear_chachapoly_crypt")) 116| 13.6k| return CRYPT_OK; 117| 13.6k|} buf_put_algolist_all: 315| 150k|void buf_put_algolist_all(buffer * buf, const algo_type localalgos[], int useall) { 316| 150k| unsigned int i, len; 317| 150k| unsigned int donefirst = 0; 318| 150k| unsigned int startpos; 319| | 320| 150k| startpos = buf->pos; 321| | /* Placeholder for length */ 322| 150k| buf_putint(buf, 0); 323| 715k| for (i = 0; localalgos[i].name != NULL; i++) { ------------------ | Branch (323:14): [True: 564k, False: 150k] ------------------ 324| 564k| if (localalgos[i].usable || useall) { ------------------ | Branch (324:7): [True: 545k, False: 18.8k] | Branch (324:31): [True: 0, False: 18.8k] ------------------ 325| 545k| if (donefirst) { ------------------ | Branch (325:8): [True: 395k, False: 150k] ------------------ 326| 395k| buf_putbyte(buf, ','); 327| 395k| } 328| 545k| donefirst = 1; 329| 545k| len = strlen(localalgos[i].name); 330| 545k| buf_putbytes(buf, (const unsigned char *) localalgos[i].name, len); 331| 545k| } 332| 564k| } 333| | /* Fill out the length */ 334| 150k| len = buf->pos - startpos - 4; 335| 150k| buf_setpos(buf, startpos); 336| 150k| buf_putint(buf, len); 337| 150k| TRACE(("algolist add %d '%.*s'", len, len, buf_getptr(buf, len))) 338| 150k| buf_incrwritepos(buf, len); 339| 150k|} buf_put_algolist: 341| 150k|void buf_put_algolist(buffer * buf, const algo_type localalgos[]) { 342| 150k| buf_put_algolist_all(buf, localalgos, 0); 343| 150k|} buf_has_algo: 387| 21.4k|int buf_has_algo(buffer *buf, const char *algo) { 388| 21.4k| unsigned char* algolist = NULL; 389| 21.4k| unsigned int orig_pos = buf->pos; 390| 21.4k| unsigned int len, remotecount, i; 391| 21.4k| const char *remotenames[MAX_PROPOSED_ALGO]; 392| 21.4k| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 21.4k|#define DROPBEAR_FAILURE -1 ------------------ 393| | 394| 21.4k| algolist = buf_getstring(buf, &len); 395| 21.4k| remotecount = MAX_PROPOSED_ALGO; ------------------ | | 209| 21.4k|#define MAX_PROPOSED_ALGO 50 ------------------ 396| 21.4k| get_algolist(algolist, len, remotenames, &remotecount); 397| 111k| for (i = 0; i < remotecount; i++) ------------------ | Branch (397:14): [True: 92.0k, False: 19.7k] ------------------ 398| 92.0k| { 399| 92.0k| if (strcmp(remotenames[i], algo) == 0) { ------------------ | Branch (399:7): [True: 1.72k, False: 90.3k] ------------------ 400| 1.72k| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1.72k|#define DROPBEAR_SUCCESS 0 ------------------ 401| 1.72k| break; 402| 1.72k| } 403| 92.0k| } 404| 21.4k| if (algolist) { ------------------ | Branch (404:6): [True: 21.4k, False: 79] ------------------ 405| 21.4k| m_free(algolist); ------------------ | | 24| 21.4k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 406| 21.4k| } 407| 21.4k| buf_setpos(buf, orig_pos); 408| 21.4k| return ret; 409| 21.4k|} buf_match_algo: 427| 142k| int kexguess2, int *goodguess) { 428| 142k| char * algolist = NULL; 429| 142k| const char *remotenames[MAX_PROPOSED_ALGO], *localnames[MAX_PROPOSED_ALGO]; 430| 142k| unsigned int len; 431| 142k| unsigned int remotecount, localcount, clicount, servcount, i, j; 432| 142k| algo_type * ret = NULL; 433| 142k| const char **clinames, **servnames; 434| | 435| 142k| if (goodguess) { ------------------ | Branch (435:6): [True: 35.9k, False: 106k] ------------------ 436| 35.9k| *goodguess = 0; 437| 35.9k| } 438| | 439| | /* get the comma-separated list from the buffer ie "algo1,algo2,algo3" */ 440| 142k| algolist = buf_getstring(buf, &len); 441| 142k| DEBUG3(("buf_match_algo: %s", algolist)) 442| 142k| remotecount = MAX_PROPOSED_ALGO; ------------------ | | 209| 142k|#define MAX_PROPOSED_ALGO 50 ------------------ 443| 142k| get_algolist(algolist, len, remotenames, &remotecount); 444| | 445| 678k| for (i = 0; localalgos[i].name != NULL; i++) { ------------------ | Branch (445:14): [True: 536k, False: 142k] ------------------ 446| 536k| if (localalgos[i].usable) { ------------------ | Branch (446:7): [True: 517k, False: 18.0k] ------------------ 447| 517k| localnames[i] = localalgos[i].name; 448| 517k| } else { 449| 18.0k| localnames[i] = NULL; 450| 18.0k| } 451| 536k| } 452| 142k| localcount = i; 453| | 454| 142k| if (IS_DROPBEAR_SERVER) { ------------------ | | 319| 142k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 142k, False: 79] | | ------------------ ------------------ 455| 142k| clinames = remotenames; 456| 142k| clicount = remotecount; 457| 142k| servnames = localnames; 458| 142k| servcount = localcount; 459| 142k| } else { 460| 79| clinames = localnames; 461| 79| clicount = localcount; 462| 79| servnames = remotenames; 463| 79| servcount = remotecount; 464| 79| } 465| | 466| | /* iterate and find the first match */ 467| 197k| for (i = 0; i < clicount; i++) { ------------------ | Branch (467:14): [True: 189k, False: 7.77k] ------------------ 468| 697k| for (j = 0; j < servcount; j++) { ------------------ | Branch (468:15): [True: 642k, False: 54.8k] ------------------ 469| 642k| if (!(servnames[j] && clinames[i])) { ------------------ | Branch (469:10): [True: 627k, False: 15.5k] | Branch (469:26): [True: 627k, False: 0] ------------------ 470| | /* unusable algos are NULL */ 471| 15.5k| continue; 472| 15.5k| } 473| 627k| if (strcmp(servnames[j], clinames[i]) == 0) { ------------------ | Branch (473:8): [True: 134k, False: 492k] ------------------ 474| | /* set if it was a good guess */ 475| 134k| if (goodguess != NULL) { ------------------ | Branch (475:9): [True: 35.6k, False: 98.9k] ------------------ 476| 35.6k| if (kexguess2) { ------------------ | Branch (476:10): [True: 3.36k, False: 32.2k] ------------------ 477| 3.36k| if (i == 0) { ------------------ | Branch (477:11): [True: 3.15k, False: 216] ------------------ 478| 3.15k| *goodguess = 1; 479| 3.15k| } 480| 32.2k| } else { 481| 32.2k| if (i == 0 && j == 0) { ------------------ | Branch (481:11): [True: 20.8k, False: 11.4k] | Branch (481:21): [True: 5.85k, False: 14.9k] ------------------ 482| 5.85k| *goodguess = 1; 483| 5.85k| } 484| 32.2k| } 485| 35.6k| } 486| | /* set the algo to return */ 487| 134k| if (IS_DROPBEAR_SERVER) { ------------------ | | 319| 134k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 134k, False: 0] | | ------------------ ------------------ 488| 134k| ret = &localalgos[j]; 489| 134k| } else { 490| 0| ret = &localalgos[i]; 491| 0| } 492| 134k| goto out; 493| 134k| } 494| 627k| } 495| 189k| } 496| | 497| 142k|out: 498| 142k| m_free(algolist); ------------------ | | 24| 142k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 499| 142k| return ret; 500| 142k|} common-algo.c:void_start: 50| 16.8k| int UNUSED(keylen), int UNUSED(num_rounds), void* UNUSED(cipher_state)) { 51| 16.8k| return CRYPT_OK; 52| 16.8k|} common-algo.c:void_cipher: 41| 161k| unsigned long len, void* UNUSED(cipher_state)) { 42| 161k| if (in != out) { ------------------ | Branch (42:6): [True: 0, False: 161k] ------------------ 43| 0| memmove(out, in, len); 44| 0| } 45| 161k| return CRYPT_OK; 46| 161k|} common-algo.c:dropbear_big_endian_ctr_start: 91| 13.2k| int num_rounds, symmetric_CTR *ctr) { 92| 13.2k| return ctr_start(cipher, IV, key, keylen, num_rounds, CTR_COUNTER_BIG_ENDIAN, ctr); ------------------ | | 860| 13.2k|#define CTR_COUNTER_BIG_ENDIAN 0x1000 ------------------ 93| 13.2k|} common-algo.c:get_algolist: 350| 163k| const char* *ret_list, unsigned int *ret_count) { 351| 163k| unsigned int max_count = *ret_count; 352| 163k| unsigned int i; 353| | 354| 163k| if (*ret_count == 0) { ------------------ | Branch (354:6): [True: 0, False: 163k] ------------------ 355| 0| return; 356| 0| } 357| 163k| if (algolist_len > MAX_PROPOSED_ALGO*(MAX_NAME_LEN+1)) { ------------------ | | 209| 163k|#define MAX_PROPOSED_ALGO 50 ------------------ if (algolist_len > MAX_PROPOSED_ALGO*(MAX_NAME_LEN+1)) { ------------------ | | 205| 163k|#define MAX_NAME_LEN 64 /* maximum length of a protocol name, isn't ------------------ | Branch (357:6): [True: 4, False: 163k] ------------------ 358| 4| *ret_count = 0; 359| 4| } 360| | 361| | /* ret_list will contain a list of the strings parsed out. 362| | We will have at least one string (even if it's just "") */ 363| 163k| ret_list[0] = algolist; 364| 163k| *ret_count = 1; 365| 4.37M| for (i = 0; i < algolist_len; i++) { ------------------ | Branch (365:14): [True: 4.21M, False: 158k] ------------------ 366| 4.21M| if (algolist[i] == '\0') { ------------------ | Branch (366:7): [True: 5.00k, False: 4.20M] ------------------ 367| | /* someone is trying something strange */ 368| 5.00k| *ret_count = 0; 369| 5.00k| return; 370| 5.00k| } 371| | 372| 4.20M| if (algolist[i] == ',') { ------------------ | Branch (372:7): [True: 187k, False: 4.02M] ------------------ 373| 187k| if (*ret_count >= max_count) { ------------------ | Branch (373:8): [True: 6, False: 187k] ------------------ 374| 6| dropbear_exit("Too many remote algorithms"); 375| 0| *ret_count = 0; 376| 0| return; 377| 6| } 378| 187k| algolist[i] = '\0'; 379| 187k| ret_list[*ret_count] = &algolist[i+1]; 380| 187k| (*ret_count)++; 381| 187k| } 382| 4.20M| } 383| 163k|} chaninitialise: 70| 3.99k|void chaninitialise(const struct ChanType *chantypes[]) { 71| | 72| | /* may as well create space for a single channel */ 73| 3.99k| ses.channels = (struct Channel**)m_malloc(sizeof(struct Channel*)); 74| 3.99k| ses.chansize = 1; 75| 3.99k| ses.channels[0] = NULL; 76| 3.99k| ses.chancount = 0; 77| | 78| 3.99k| ses.chantypes = chantypes; 79| | 80| 3.99k|#if DROPBEAR_LISTENERS 81| 3.99k| listeners_initialise(); 82| 3.99k|#endif 83| | 84| 3.99k|} chancleanup: 87| 3.99k|void chancleanup() { 88| | 89| 3.99k| unsigned int i; 90| | 91| 3.99k| TRACE(("enter chancleanup")) 92| 7.99k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (92:14): [True: 3.99k, False: 3.99k] ------------------ 93| 3.99k| if (ses.channels[i] != NULL) { ------------------ | Branch (93:7): [True: 0, False: 3.99k] ------------------ 94| 0| TRACE(("channel %d closing", i)) 95| 0| remove_channel(ses.channels[i]); 96| 0| } 97| 3.99k| } 98| 3.99k| m_free(ses.channels); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 99| 3.99k| TRACE(("leave chancleanup")) 100| 3.99k|} channelio: 199| 407k|void channelio(const fd_set *readfds, const fd_set *writefds) { 200| | 201| | /* Listeners such as TCP, X11, agent-auth */ 202| 407k| struct Channel *channel; 203| 407k| unsigned int i; 204| | 205| | /* foreach channel */ 206| 815k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (206:14): [True: 407k, False: 407k] ------------------ 207| | /* Close checking only needs to occur for channels that had IO events */ 208| 407k| int do_check_close = 0; 209| | 210| 407k| channel = ses.channels[i]; 211| 407k| if (channel == NULL) { ------------------ | Branch (211:7): [True: 407k, False: 0] ------------------ 212| | /* only process in-use channels */ 213| 407k| continue; 214| 407k| } 215| | 216| | /* read data and send it over the wire */ 217| 0| if (channel->readfd >= 0 && FD_ISSET(channel->readfd, readfds)) { ------------------ | Branch (217:7): [True: 0, False: 0] ------------------ 218| 0| TRACE(("send normal readfd")) 219| 0| send_msg_channel_data(channel, 0); 220| 0| do_check_close = 1; 221| 0| } 222| | 223| | /* read stderr data and send it over the wire */ 224| 0| if (ERRFD_IS_READ(channel) && channel->errfd >= 0 ------------------ | | 59| 0|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (59:32): [True: 0, False: 0] | | ------------------ ------------------ | Branch (224:33): [True: 0, False: 0] ------------------ 225| 0| && FD_ISSET(channel->errfd, readfds)) { 226| 0| TRACE(("send normal errfd")) 227| 0| send_msg_channel_data(channel, 1); 228| 0| do_check_close = 1; 229| 0| } 230| | 231| | /* write to program/pipe stdin */ 232| 0| if (channel->writefd >= 0 && FD_ISSET(channel->writefd, writefds)) { ------------------ | Branch (232:7): [True: 0, False: 0] ------------------ 233| 0| writechannel(channel, channel->writefd, channel->writebuf, NULL, NULL); 234| 0| do_check_close = 1; 235| 0| } 236| | 237| | /* stderr for client mode */ 238| 0| if (ERRFD_IS_WRITE(channel) ------------------ | | 60| 0|#define ERRFD_IS_WRITE(channel) (!ERRFD_IS_READ(channel)) | | ------------------ | | | | 59| 0|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (60:33): [True: 0, False: 0] | | ------------------ ------------------ 239| 0| && channel->errfd >= 0 && FD_ISSET(channel->errfd, writefds)) { ------------------ | Branch (239:8): [True: 0, False: 0] ------------------ 240| 0| writechannel(channel, channel->errfd, channel->extrabuf, NULL, NULL); 241| 0| do_check_close = 1; 242| 0| } 243| | 244| 0| if (ses.channel_signal_pending) { ------------------ | Branch (244:7): [True: 0, False: 0] ------------------ 245| | /* SIGCHLD can change channel state for server sessions */ 246| 0| do_check_close = 1; 247| 0| } 248| | 249| | /* handle any channel closing etc */ 250| 0| if (do_check_close) { ------------------ | Branch (250:7): [True: 0, False: 0] ------------------ 251| 0| check_close(channel); 252| 0| } 253| 0| } 254| | 255| 407k|#if DROPBEAR_LISTENERS 256| 407k| handle_listeners(readfds); 257| 407k|#endif 258| 407k|} setchannelfds: 541| 411k|void setchannelfds(fd_set *readfds, fd_set *writefds, int allow_reads) { 542| | 543| 411k| unsigned int i; 544| 411k| struct Channel * channel; 545| | 546| 823k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (546:14): [True: 411k, False: 411k] ------------------ 547| | 548| 411k| channel = ses.channels[i]; 549| 411k| if (channel == NULL) { ------------------ | Branch (549:7): [True: 411k, False: 0] ------------------ 550| 411k| continue; 551| 411k| } 552| | 553| | /* Stuff to put over the wire. 554| | Avoid queueing data to send if we're in the middle of a 555| | key re-exchange (!dataallowed), but still read from the 556| | FD if there's the possibility of "~."" to kill an 557| | interactive session (the read_mangler) */ 558| 0| if (channel->transwindow > 0 ------------------ | Branch (558:7): [True: 0, False: 0] ------------------ 559| 0| && ((ses.dataallowed && allow_reads) || channel->read_mangler)) { ------------------ | Branch (559:11): [True: 0, False: 0] | Branch (559:30): [True: 0, False: 0] | Branch (559:46): [True: 0, False: 0] ------------------ 560| | 561| 0| if (channel->readfd >= 0) { ------------------ | Branch (561:8): [True: 0, False: 0] ------------------ 562| 0| FD_SET(channel->readfd, readfds); 563| 0| } 564| | 565| 0| if (ERRFD_IS_READ(channel) && channel->errfd >= 0) { ------------------ | | 59| 0|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (59:32): [True: 0, False: 0] | | ------------------ ------------------ | Branch (565:34): [True: 0, False: 0] ------------------ 566| 0| FD_SET(channel->errfd, readfds); 567| 0| } 568| 0| } 569| | 570| | /* Stuff from the wire */ 571| 0| if (channel->writefd >= 0 && cbuf_getused(channel->writebuf) > 0) { ------------------ | Branch (571:7): [True: 0, False: 0] | Branch (571:32): [True: 0, False: 0] ------------------ 572| 0| FD_SET(channel->writefd, writefds); 573| 0| } 574| | 575| 0| if (ERRFD_IS_WRITE(channel) && channel->errfd >= 0 ------------------ | | 60| 0|#define ERRFD_IS_WRITE(channel) (!ERRFD_IS_READ(channel)) | | ------------------ | | | | 59| 0|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (60:33): [True: 0, False: 0] | | ------------------ ------------------ | Branch (575:34): [True: 0, False: 0] ------------------ 576| 0| && cbuf_getused(channel->extrabuf) > 0) { ------------------ | Branch (576:8): [True: 0, False: 0] ------------------ 577| 0| FD_SET(channel->errfd, writefds); 578| 0| } 579| | 580| 0| } /* foreach channel */ 581| | 582| 411k|#if DROPBEAR_LISTENERS 583| 411k| set_listener_fds(readfds); 584| 411k|#endif 585| | 586| 411k|} send_msg_kexinit: 55| 18.8k|void send_msg_kexinit() { 56| | 57| 18.8k| CHECKCLEARTOWRITE(); 58| 18.8k| buf_putbyte(ses.writepayload, SSH_MSG_KEXINIT); ------------------ | | 36| 18.8k|#define SSH_MSG_KEXINIT 20 ------------------ 59| | 60| | /* cookie */ 61| 18.8k| genrandom(buf_getwriteptr(ses.writepayload, 16), 16); 62| 18.8k| buf_incrwritepos(ses.writepayload, 16); 63| | 64| | /* kex algos */ 65| 18.8k| buf_put_algolist(ses.writepayload, sshkex); 66| | 67| | /* server_host_key_algorithms */ 68| 18.8k| buf_put_algolist(ses.writepayload, sigalgs); 69| | 70| | /* encryption_algorithms_client_to_server */ 71| 18.8k| buf_put_algolist(ses.writepayload, sshciphers); 72| | 73| | /* encryption_algorithms_server_to_client */ 74| 18.8k| buf_put_algolist(ses.writepayload, sshciphers); 75| | 76| | /* mac_algorithms_client_to_server */ 77| 18.8k| buf_put_algolist(ses.writepayload, sshhashes); 78| | 79| | /* mac_algorithms_server_to_client */ 80| 18.8k| buf_put_algolist(ses.writepayload, sshhashes); 81| | 82| | 83| | /* compression_algorithms_client_to_server */ 84| 18.8k| buf_put_algolist(ses.writepayload, ses.compress_algos); 85| | 86| | /* compression_algorithms_server_to_client */ 87| 18.8k| buf_put_algolist(ses.writepayload, ses.compress_algos); 88| | 89| | /* languages_client_to_server */ 90| 18.8k| buf_putstring(ses.writepayload, "", 0); 91| | 92| | /* languages_server_to_client */ 93| 18.8k| buf_putstring(ses.writepayload, "", 0); 94| | 95| | /* first_kex_packet_follows */ 96| 18.8k| buf_putbyte(ses.writepayload, (ses.send_kex_first_guess != NULL)); 97| | 98| | /* reserved unit32 */ 99| 18.8k| buf_putint(ses.writepayload, 0); 100| | 101| | /* set up transmitted kex packet buffer for hashing. 102| | * This is freed after the end of the kex */ 103| 18.8k| ses.transkexinit = buf_newcopy(ses.writepayload); 104| | 105| 18.8k| encrypt_packet(); 106| 18.8k| ses.dataallowed = 0; /* don't send other packets during kex */ 107| | 108| 18.8k| ses.kexstate.sentkexinit = 1; 109| | 110| 18.8k| ses.newkeys = (struct key_context*)m_malloc(sizeof(struct key_context)); 111| | 112| 18.8k| if (ses.send_kex_first_guess) { ------------------ | Branch (112:6): [True: 0, False: 18.8k] ------------------ 113| 0| ses.newkeys->algo_kex = first_usable_algo(sshkex)->data; 114| 0| ses.newkeys->algo_signature = first_usable_algo(sigalgs)->val; 115| 0| ses.newkeys->algo_hostkey = signkey_type_from_signature(ses.newkeys->algo_signature); 116| 0| ses.send_kex_first_guess(); 117| 0| } 118| | 119| 18.8k| TRACE(("DATAALLOWED=0")) 120| 18.8k| TRACE(("-> KEXINIT")) 121| | 122| 18.8k|} send_msg_newkeys: 166| 16.8k|void send_msg_newkeys() { 167| | 168| 16.8k| TRACE(("enter send_msg_newkeys")) 169| | 170| | /* generate the kexinit request */ 171| 16.8k| CHECKCLEARTOWRITE(); 172| 16.8k| buf_putbyte(ses.writepayload, SSH_MSG_NEWKEYS); ------------------ | | 37| 16.8k|#define SSH_MSG_NEWKEYS 21 ------------------ 173| 16.8k| encrypt_packet(); 174| | 175| | 176| | /* set up our state */ 177| 16.8k| ses.kexstate.sentnewkeys = 1; 178| 16.8k| if (ses.kexstate.donefirstkex) { ------------------ | Branch (178:6): [True: 14.4k, False: 2.36k] ------------------ 179| 14.4k| ses.kexstate.donesecondkex = 1; 180| 14.4k| } 181| 16.8k| ses.kexstate.donefirstkex = 1; 182| 16.8k| ses.dataallowed = 1; /* we can send other packets again now */ 183| 16.8k| gen_new_keys(); 184| 16.8k| switch_keys(); 185| | 186| 16.8k| TRACE(("leave send_msg_newkeys")) 187| 16.8k|} recv_msg_newkeys: 190| 15.8k|void recv_msg_newkeys() { 191| | 192| 15.8k| TRACE(("enter recv_msg_newkeys")) 193| | 194| 15.8k| ses.kexstate.recvnewkeys = 1; 195| 15.8k| switch_keys(); 196| | 197| 15.8k| TRACE(("leave recv_msg_newkeys")) 198| 15.8k|} kexfirstinitialise: 202| 3.99k|void kexfirstinitialise() { 203| 3.99k|#ifdef DISABLE_ZLIB 204| 3.99k| ses.compress_algos = ssh_nocompress; 205| |#else 206| | switch (opts.compress_mode) 207| | { 208| | case DROPBEAR_COMPRESS_DELAYED: 209| | ses.compress_algos = ssh_delaycompress; 210| | break; 211| | 212| | case DROPBEAR_COMPRESS_ON: 213| | ses.compress_algos = ssh_compress; 214| | break; 215| | 216| | case DROPBEAR_COMPRESS_OFF: 217| | ses.compress_algos = ssh_nocompress; 218| | break; 219| | } 220| |#endif 221| 3.99k| kexinitialise(); 222| 3.99k|} recv_msg_kexinit: 474| 18.2k|void recv_msg_kexinit() { 475| | 476| 18.2k| unsigned int kexhashbuf_len = 0; 477| 18.2k| unsigned int remote_ident_len = 0; 478| 18.2k| unsigned int local_ident_len = 0; 479| | 480| 18.2k| TRACE(("<- KEXINIT")) 481| 18.2k| TRACE(("enter recv_msg_kexinit")) 482| | 483| 18.2k| if (!ses.kexstate.sentkexinit) { ------------------ | Branch (483:6): [True: 14.8k, False: 3.39k] ------------------ 484| | /* we need to send a kex packet */ 485| 14.8k| send_msg_kexinit(); 486| 14.8k| TRACE(("continue recv_msg_kexinit: sent kexinit")) 487| 14.8k| } 488| | 489| | /* "Once a party has sent a SSH_MSG_KEXINIT message ... 490| | further SSH_MSG_KEXINIT messages MUST NOT be sent" */ 491| 18.2k| if (ses.kexstate.recvkexinit) { ------------------ | Branch (491:6): [True: 0, False: 18.2k] ------------------ 492| 0| dropbear_exit("Unexpected KEXINIT"); 493| 0| } 494| | 495| | /* start the kex hash */ 496| 18.2k| local_ident_len = strlen(LOCAL_IDENT); ------------------ | | 10| 18.2k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION | | ------------------ | | | | 7| 18.2k|#define DROPBEAR_VERSION "2022.83" | | ------------------ ------------------ 497| 18.2k| remote_ident_len = strlen(ses.remoteident); 498| | 499| 18.2k| kexhashbuf_len = local_ident_len + remote_ident_len 500| 18.2k| + ses.transkexinit->len + ses.payload->len 501| 18.2k| + KEXHASHBUF_MAX_INTS; ------------------ | | 240| 18.2k|#define KEXHASHBUF_MAX_INTS (1700 + 130 + 130 + 130) ------------------ 502| | 503| 18.2k| ses.kexhashbuf = buf_new(kexhashbuf_len); 504| | 505| 18.2k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 320| 18.2k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 18.2k] | | ------------------ ------------------ 506| | 507| | /* read the peer's choice of algos */ 508| 0| read_kex_algos(); 509| | 510| | /* V_C, the client's version string (CR and NL excluded) */ 511| 0| buf_putstring(ses.kexhashbuf, LOCAL_IDENT, local_ident_len); ------------------ | | 10| 0|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION | | ------------------ | | | | 7| 0|#define DROPBEAR_VERSION "2022.83" | | ------------------ ------------------ 512| | /* V_S, the server's version string (CR and NL excluded) */ 513| 0| buf_putstring(ses.kexhashbuf, ses.remoteident, remote_ident_len); 514| | 515| | /* I_C, the payload of the client's SSH_MSG_KEXINIT */ 516| 0| buf_putstring(ses.kexhashbuf, 517| 0| (const char*)ses.transkexinit->data, ses.transkexinit->len); 518| | /* I_S, the payload of the server's SSH_MSG_KEXINIT */ 519| 0| buf_setpos(ses.payload, ses.payload_beginning); 520| 0| buf_putstring(ses.kexhashbuf, 521| 0| (const char*)buf_getptr(ses.payload, ses.payload->len-ses.payload->pos), 522| 0| ses.payload->len-ses.payload->pos); 523| 0| ses.requirenext = SSH_MSG_KEXDH_REPLY; ------------------ | | 39| 0|#define SSH_MSG_KEXDH_REPLY 31 ------------------ 524| 18.2k| } else { 525| | /* SERVER */ 526| | 527| | /* read the peer's choice of algos */ 528| 18.2k| read_kex_algos(); 529| | /* V_C, the client's version string (CR and NL excluded) */ 530| 18.2k| buf_putstring(ses.kexhashbuf, ses.remoteident, remote_ident_len); 531| | /* V_S, the server's version string (CR and NL excluded) */ 532| 18.2k| buf_putstring(ses.kexhashbuf, LOCAL_IDENT, local_ident_len); ------------------ | | 10| 18.2k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION | | ------------------ | | | | 7| 18.2k|#define DROPBEAR_VERSION "2022.83" | | ------------------ ------------------ 533| | 534| | /* I_C, the payload of the client's SSH_MSG_KEXINIT */ 535| 18.2k| buf_setpos(ses.payload, ses.payload_beginning); 536| 18.2k| buf_putstring(ses.kexhashbuf, 537| 18.2k| (const char*)buf_getptr(ses.payload, ses.payload->len-ses.payload->pos), 538| 18.2k| ses.payload->len-ses.payload->pos); 539| | 540| | /* I_S, the payload of the server's SSH_MSG_KEXINIT */ 541| 18.2k| buf_putstring(ses.kexhashbuf, 542| 18.2k| (const char*)ses.transkexinit->data, ses.transkexinit->len); 543| | 544| 18.2k| ses.requirenext = SSH_MSG_KEXDH_INIT; ------------------ | | 38| 18.2k|#define SSH_MSG_KEXDH_INIT 30 ------------------ 545| 18.2k| } 546| | 547| 18.2k| buf_free(ses.transkexinit); 548| 18.2k| ses.transkexinit = NULL; 549| | /* the rest of ses.kexhashbuf will be done after DH exchange */ 550| | 551| 18.2k| ses.kexstate.recvkexinit = 1; 552| | 553| 18.2k| TRACE(("leave recv_msg_kexinit")) 554| 18.2k|} gen_kexdh_param: 566| 9.63k|struct kex_dh_param *gen_kexdh_param() { 567| 9.63k| struct kex_dh_param *param = NULL; 568| | 569| 9.63k| DEF_MP_INT(dh_p); ------------------ | | 80| 9.63k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 570| 9.63k| DEF_MP_INT(dh_q); ------------------ | | 80| 9.63k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 571| 9.63k| DEF_MP_INT(dh_g); ------------------ | | 80| 9.63k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 572| | 573| 9.63k| TRACE(("enter gen_kexdh_vals")) 574| | 575| 9.63k| param = m_malloc(sizeof(*param)); 576| 9.63k| m_mp_init_multi(¶m->pub, ¶m->priv, &dh_g, &dh_p, &dh_q, NULL); 577| | 578| | /* read the prime and generator*/ 579| 9.63k| load_dh_p(&dh_p); 580| | 581| 9.63k| mp_set_ul(&dh_g, DH_G_VAL); 582| | 583| | /* calculate q = (p-1)/2 */ 584| | /* dh_priv is just a temp var here */ 585| 9.63k| if (mp_sub_d(&dh_p, 1, ¶m->priv) != MP_OKAY) { ------------------ | | 161| 9.63k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (585:6): [True: 0, False: 9.63k] ------------------ 586| 0| dropbear_exit("Diffie-Hellman error"); 587| 0| } 588| 9.63k| if (mp_div_2(¶m->priv, &dh_q) != MP_OKAY) { ------------------ | | 161| 9.63k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (588:6): [True: 0, False: 9.63k] ------------------ 589| 0| dropbear_exit("Diffie-Hellman error"); 590| 0| } 591| | 592| | /* Generate a private portion 0 < dh_priv < dh_q */ 593| 9.63k| gen_random_mpint(&dh_q, ¶m->priv); 594| | 595| | /* f = g^y mod p */ 596| 9.63k| if (mp_exptmod(&dh_g, ¶m->priv, &dh_p, ¶m->pub) != MP_OKAY) { ------------------ | | 161| 9.63k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (596:6): [True: 0, False: 9.63k] ------------------ 597| 0| dropbear_exit("Diffie-Hellman error"); 598| 0| } 599| 9.63k| mp_clear_multi(&dh_g, &dh_p, &dh_q, NULL); 600| 9.63k| return param; 601| 9.63k|} free_kexdh_param: 604| 9.58k|{ 605| 9.58k| mp_clear_multi(¶m->pub, ¶m->priv, NULL); 606| 9.58k| m_free(param); ------------------ | | 24| 9.58k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 607| 9.58k|} kexdh_comb_key: 614| 9.63k| sign_key *hostkey) { 615| | 616| 9.63k| DEF_MP_INT(dh_p); ------------------ | | 80| 9.63k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 617| 9.63k| DEF_MP_INT(dh_p_min1); ------------------ | | 80| 9.63k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 618| 9.63k| mp_int *dh_e = NULL, *dh_f = NULL; 619| | 620| 9.63k| m_mp_init_multi(&dh_p, &dh_p_min1, NULL); 621| 9.63k| load_dh_p(&dh_p); 622| | 623| 9.63k| if (mp_sub_d(&dh_p, 1, &dh_p_min1) != MP_OKAY) { ------------------ | | 161| 9.63k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (623:6): [True: 0, False: 9.63k] ------------------ 624| 0| dropbear_exit("Diffie-Hellman error"); 625| 0| } 626| | 627| | /* Check that dh_pub_them (dh_e or dh_f) is in the range [2, p-2] */ 628| 9.63k| if (mp_cmp(dh_pub_them, &dh_p_min1) != MP_LT ------------------ | | 154| 19.2k|#define MP_LT -1 /* less than */ ------------------ | Branch (628:6): [True: 2, False: 9.63k] ------------------ 629| 9.63k| || mp_cmp_d(dh_pub_them, 1) != MP_GT) { ------------------ | | 156| 9.63k|#define MP_GT 1 /* greater than */ ------------------ | Branch (629:7): [True: 48, False: 9.58k] ------------------ 630| 50| dropbear_exit("Diffie-Hellman error"); 631| 50| } 632| | 633| | /* K = e^y mod p = f^x mod p */ 634| 9.58k| m_mp_alloc_init_multi(&ses.dh_K, NULL); 635| 9.58k| if (mp_exptmod(dh_pub_them, ¶m->priv, &dh_p, ses.dh_K) != MP_OKAY) { ------------------ | | 161| 9.58k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (635:6): [True: 0, False: 9.58k] ------------------ 636| 0| dropbear_exit("Diffie-Hellman error"); 637| 0| } 638| | 639| | /* clear no longer needed vars */ 640| 9.58k| mp_clear_multi(&dh_p, &dh_p_min1, NULL); 641| | 642| | /* From here on, the code needs to work with the _same_ vars on each side, 643| | * not vice-versaing for client/server */ 644| 9.58k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 320| 9.58k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 9.58k] | | ------------------ ------------------ 645| 0| dh_e = ¶m->pub; 646| 0| dh_f = dh_pub_them; 647| 9.58k| } else { 648| 9.58k| dh_e = dh_pub_them; 649| 9.58k| dh_f = ¶m->pub; 650| 9.58k| } 651| | 652| | /* Create the remainder of the hash buffer, to generate the exchange hash */ 653| | /* K_S, the host key */ 654| 9.58k| buf_put_pub_key(ses.kexhashbuf, hostkey, ses.newkeys->algo_hostkey); 655| | /* e, exchange value sent by the client */ 656| 9.58k| buf_putmpint(ses.kexhashbuf, dh_e); 657| | /* f, exchange value sent by the server */ 658| 9.58k| buf_putmpint(ses.kexhashbuf, dh_f); 659| | /* K, the shared secret */ 660| 9.58k| buf_putmpint(ses.kexhashbuf, ses.dh_K); 661| | 662| | /* calculate the hash H to sign */ 663| 9.58k| finish_kexhashbuf(); 664| 9.58k|} gen_kexecdh_param: 668| 331|struct kex_ecdh_param *gen_kexecdh_param() { 669| 331| struct kex_ecdh_param *param = m_malloc(sizeof(*param)); 670| 331| if (ecc_make_key_ex(NULL, dropbear_ltc_prng, ------------------ | Branch (670:6): [True: 0, False: 331] ------------------ 671| 331| ¶m->key, ses.newkeys->algo_kex->ecc_curve->dp) != CRYPT_OK) { 672| 0| dropbear_exit("ECC error"); 673| 0| } 674| 331| return param; 675| 331|} kexecdh_comb_key: 683| 331| sign_key *hostkey) { 684| 331| const struct dropbear_kex *algo_kex = ses.newkeys->algo_kex; 685| | /* public keys from client and server */ 686| 331| ecc_key *Q_C, *Q_S, *Q_them; 687| | 688| 331| Q_them = buf_get_ecc_raw_pubkey(pub_them, algo_kex->ecc_curve); 689| 331| if (Q_them == NULL) { ------------------ | Branch (689:6): [True: 330, False: 1] ------------------ 690| 330| dropbear_exit("ECC error"); 691| 330| } 692| | 693| 1| ses.dh_K = dropbear_ecc_shared_secret(Q_them, ¶m->key); 694| | 695| | /* Create the remainder of the hash buffer, to generate the exchange hash 696| | See RFC5656 section 4 page 7 */ 697| 1| if (IS_DROPBEAR_CLIENT) { ------------------ | | 320| 1|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 1] | | ------------------ ------------------ 698| 0| Q_C = ¶m->key; 699| 0| Q_S = Q_them; 700| 1| } else { 701| 1| Q_C = Q_them; 702| 1| Q_S = ¶m->key; 703| 1| } 704| | 705| | /* K_S, the host key */ 706| 1| buf_put_pub_key(ses.kexhashbuf, hostkey, ses.newkeys->algo_hostkey); 707| | /* Q_C, client's ephemeral public key octet string */ 708| 1| buf_put_ecc_raw_pubkey_string(ses.kexhashbuf, Q_C); 709| | /* Q_S, server's ephemeral public key octet string */ 710| 1| buf_put_ecc_raw_pubkey_string(ses.kexhashbuf, Q_S); 711| | /* K, the shared secret */ 712| 1| buf_putmpint(ses.kexhashbuf, ses.dh_K); 713| | 714| 1| ecc_free(Q_them); 715| 1| m_free(Q_them); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 716| | 717| | /* calculate the hash H to sign */ 718| 1| finish_kexhashbuf(); 719| 1|} gen_kexcurve25519_param: 723| 7.29k|struct kex_curve25519_param *gen_kexcurve25519_param() { 724| | /* Per http://cr.yp.to/ecdh.html */ 725| 7.29k| struct kex_curve25519_param *param = m_malloc(sizeof(*param)); 726| 7.29k| const unsigned char basepoint[32] = {9}; 727| | 728| 7.29k| genrandom(param->priv, CURVE25519_LEN); ------------------ | | 106| 7.29k|#define CURVE25519_LEN 32 ------------------ 729| 7.29k| dropbear_curve25519_scalarmult(param->pub, param->priv, basepoint); 730| | 731| 7.29k| return param; 732| 7.29k|} free_kexcurve25519_param: 734| 7.26k|void free_kexcurve25519_param(struct kex_curve25519_param *param) { 735| 7.26k| m_burn(param->priv, CURVE25519_LEN); ------------------ | | 106| 7.26k|#define CURVE25519_LEN 32 ------------------ 736| 7.26k| m_free(param); ------------------ | | 24| 7.26k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 737| 7.26k|} kexcurve25519_comb_key: 740| 7.29k| sign_key *hostkey) { 741| 7.29k| unsigned char out[CURVE25519_LEN]; 742| 7.29k| const unsigned char* Q_C = NULL; 743| 7.29k| const unsigned char* Q_S = NULL; 744| 7.29k| char zeroes[CURVE25519_LEN] = {0}; 745| | 746| 7.29k| if (buf_pub_them->len != CURVE25519_LEN) ------------------ | | 106| 7.29k|#define CURVE25519_LEN 32 ------------------ | Branch (746:6): [True: 29, False: 7.26k] ------------------ 747| 29| { 748| 29| dropbear_exit("Bad curve25519"); 749| 29| } 750| | 751| 7.26k| dropbear_curve25519_scalarmult(out, param->priv, buf_pub_them->data); 752| | 753| 7.26k| if (constant_time_memcmp(zeroes, out, CURVE25519_LEN) == 0) { ------------------ | | 106| 7.26k|#define CURVE25519_LEN 32 ------------------ | Branch (753:6): [True: 1, False: 7.26k] ------------------ 754| 1| dropbear_exit("Bad curve25519"); 755| 1| } 756| | 757| 7.26k| m_mp_alloc_init_multi(&ses.dh_K, NULL); 758| 7.26k| bytes_to_mp(ses.dh_K, out, CURVE25519_LEN); ------------------ | | 106| 7.26k|#define CURVE25519_LEN 32 ------------------ 759| 7.26k| m_burn(out, sizeof(out)); 760| | 761| | /* Create the remainder of the hash buffer, to generate the exchange hash. 762| | See RFC5656 section 4 page 7 */ 763| 7.26k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 320| 7.26k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 7.26k] | | ------------------ ------------------ 764| 0| Q_C = param->pub; 765| 0| Q_S = buf_pub_them->data; 766| 7.26k| } else { 767| 7.26k| Q_S = param->pub; 768| 7.26k| Q_C = buf_pub_them->data; 769| 7.26k| } 770| | 771| | /* K_S, the host key */ 772| 7.26k| buf_put_pub_key(ses.kexhashbuf, hostkey, ses.newkeys->algo_hostkey); 773| | /* Q_C, client's ephemeral public key octet string */ 774| 7.26k| buf_putstring(ses.kexhashbuf, (const char*)Q_C, CURVE25519_LEN); ------------------ | | 106| 7.26k|#define CURVE25519_LEN 32 ------------------ 775| | /* Q_S, server's ephemeral public key octet string */ 776| 7.26k| buf_putstring(ses.kexhashbuf, (const char*)Q_S, CURVE25519_LEN); ------------------ | | 106| 7.26k|#define CURVE25519_LEN 32 ------------------ 777| | /* K, the shared secret */ 778| 7.26k| buf_putmpint(ses.kexhashbuf, ses.dh_K); 779| | 780| | /* calculate the hash H to sign */ 781| 7.26k| finish_kexhashbuf(); 782| 7.26k|} finish_kexhashbuf: 786| 16.8k|void finish_kexhashbuf(void) { 787| 16.8k| hash_state hs; 788| 16.8k| const struct ltc_hash_descriptor *hash_desc = ses.newkeys->algo_kex->hash_desc; 789| | 790| 16.8k| hash_desc->init(&hs); 791| 16.8k| buf_setpos(ses.kexhashbuf, 0); 792| 16.8k| hash_desc->process(&hs, buf_getptr(ses.kexhashbuf, ses.kexhashbuf->len), 793| 16.8k| ses.kexhashbuf->len); 794| 16.8k| ses.hash = buf_new(hash_desc->hashsize); 795| 16.8k| hash_desc->done(&hs, buf_getwriteptr(ses.hash, hash_desc->hashsize)); 796| 16.8k| buf_setlen(ses.hash, hash_desc->hashsize); 797| | 798| |#if defined(DEBUG_KEXHASH) && DEBUG_TRACE 799| | if (!debug_trace) { 800| | printhex("kexhashbuf", ses.kexhashbuf->data, ses.kexhashbuf->len); 801| | printhex("kexhash", ses.hash->data, ses.hash->len); 802| | } 803| |#endif 804| | 805| 16.8k| buf_burn_free(ses.kexhashbuf); 806| 16.8k| m_burn(&hs, sizeof(hash_state)); 807| 16.8k| ses.kexhashbuf = NULL; 808| | 809| | /* first time around, we set the session_id to H */ 810| 16.8k| if (ses.session_id == NULL) { ------------------ | Branch (810:6): [True: 2.37k, False: 14.4k] ------------------ 811| | /* create the session_id, this never needs freeing */ 812| 2.37k| ses.session_id = buf_newcopy(ses.hash); 813| 2.37k| } 814| 16.8k|} common-kex.c:switch_keys: 124| 32.6k|static void switch_keys() { 125| 32.6k| TRACE2(("enter switch_keys")) 126| 32.6k| if (!(ses.kexstate.sentkexinit && ses.kexstate.recvkexinit)) { ------------------ | Branch (126:8): [True: 32.6k, False: 6] | Branch (126:36): [True: 32.6k, False: 0] ------------------ 127| 6| dropbear_exit("Unexpected newkeys message"); 128| 6| } 129| | 130| 32.6k| if (!ses.keys) { ------------------ | Branch (130:6): [True: 0, False: 32.6k] ------------------ 131| 0| ses.keys = m_malloc(sizeof(*ses.newkeys)); 132| 0| } 133| 32.6k| if (ses.kexstate.recvnewkeys && ses.newkeys->recv.valid) { ------------------ | Branch (133:6): [True: 15.8k, False: 16.8k] | Branch (133:34): [True: 15.8k, False: 0] ------------------ 134| 15.8k| TRACE(("switch_keys recv")) 135| |#ifndef DISABLE_ZLIB 136| | gen_new_zstream_recv(); 137| |#endif 138| 15.8k| ses.keys->recv = ses.newkeys->recv; 139| 15.8k| m_burn(&ses.newkeys->recv, sizeof(ses.newkeys->recv)); 140| 15.8k| ses.newkeys->recv.valid = 0; 141| 15.8k| } 142| 32.6k| if (ses.kexstate.sentnewkeys && ses.newkeys->trans.valid) { ------------------ | Branch (142:6): [True: 32.6k, False: 0] | Branch (142:34): [True: 16.8k, False: 15.8k] ------------------ 143| 16.8k| TRACE(("switch_keys trans")) 144| |#ifndef DISABLE_ZLIB 145| | gen_new_zstream_trans(); 146| |#endif 147| 16.8k| ses.keys->trans = ses.newkeys->trans; 148| 16.8k| m_burn(&ses.newkeys->trans, sizeof(ses.newkeys->trans)); 149| 16.8k| ses.newkeys->trans.valid = 0; 150| 16.8k| } 151| 32.6k| if (ses.kexstate.sentnewkeys && ses.kexstate.recvnewkeys) ------------------ | Branch (151:6): [True: 32.6k, False: 0] | Branch (151:34): [True: 15.8k, False: 16.8k] ------------------ 152| 15.8k| { 153| 15.8k| TRACE(("switch_keys done")) 154| 15.8k| ses.keys->algo_kex = ses.newkeys->algo_kex; 155| 15.8k| ses.keys->algo_hostkey = ses.newkeys->algo_hostkey; 156| 15.8k| ses.keys->algo_signature = ses.newkeys->algo_signature; 157| 15.8k| ses.keys->allow_compress = 0; 158| 15.8k| m_free(ses.newkeys); ------------------ | | 24| 15.8k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 159| 15.8k| ses.newkeys = NULL; 160| 15.8k| kexinitialise(); 161| 15.8k| } 162| 32.6k| TRACE2(("leave switch_keys")) 163| 32.6k|} common-kex.c:kexinitialise: 225| 19.8k|static void kexinitialise() { 226| | 227| 19.8k| TRACE(("kexinitialise()")) 228| | 229| | /* sent/recv'd MSG_KEXINIT */ 230| 19.8k| ses.kexstate.sentkexinit = 0; 231| 19.8k| ses.kexstate.recvkexinit = 0; 232| | 233| | /* sent/recv'd MSG_NEWKEYS */ 234| 19.8k| ses.kexstate.recvnewkeys = 0; 235| 19.8k| ses.kexstate.sentnewkeys = 0; 236| | 237| | /* first_packet_follows */ 238| 19.8k| ses.kexstate.them_firstfollows = 0; 239| | 240| 19.8k| ses.kexstate.datatrans = 0; 241| 19.8k| ses.kexstate.datarecv = 0; 242| | 243| 19.8k| ses.kexstate.our_first_follows_matches = 0; 244| | 245| 19.8k| ses.kexstate.lastkextime = monotonic_now(); 246| | 247| 19.8k|} common-kex.c:gen_new_keys: 288| 16.8k|static void gen_new_keys() { 289| | 290| 16.8k| unsigned char C2S_IV[MAX_IV_LEN]; 291| 16.8k| unsigned char C2S_key[MAX_KEY_LEN]; 292| 16.8k| unsigned char S2C_IV[MAX_IV_LEN]; 293| 16.8k| unsigned char S2C_key[MAX_KEY_LEN]; 294| | /* unsigned char key[MAX_KEY_LEN]; */ 295| 16.8k| unsigned char *trans_IV, *trans_key, *recv_IV, *recv_key; 296| | 297| 16.8k| hash_state hs; 298| 16.8k| const struct ltc_hash_descriptor *hash_desc = ses.newkeys->algo_kex->hash_desc; 299| 16.8k| char mactransletter, macrecvletter; /* Client or server specific */ 300| | 301| 16.8k| TRACE(("enter gen_new_keys")) 302| | /* the dh_K and hash are the start of all hashes, we make use of that */ 303| | 304| 16.8k| hash_desc->init(&hs); 305| 16.8k| hash_process_mp(hash_desc, &hs, ses.dh_K); 306| 16.8k| mp_clear(ses.dh_K); 307| 16.8k| m_free(ses.dh_K); ------------------ | | 24| 16.8k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 308| 16.8k| hash_desc->process(&hs, ses.hash->data, ses.hash->len); 309| 16.8k| buf_burn_free(ses.hash); 310| 16.8k| ses.hash = NULL; 311| | 312| 16.8k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 320| 16.8k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 16.8k] | | ------------------ ------------------ 313| 0| trans_IV = C2S_IV; 314| 0| recv_IV = S2C_IV; 315| 0| trans_key = C2S_key; 316| 0| recv_key = S2C_key; 317| 0| mactransletter = 'E'; 318| 0| macrecvletter = 'F'; 319| 16.8k| } else { 320| 16.8k| trans_IV = S2C_IV; 321| 16.8k| recv_IV = C2S_IV; 322| 16.8k| trans_key = S2C_key; 323| 16.8k| recv_key = C2S_key; 324| 16.8k| mactransletter = 'F'; 325| 16.8k| macrecvletter = 'E'; 326| 16.8k| } 327| | 328| 16.8k| hashkeys(C2S_IV, sizeof(C2S_IV), &hs, 'A'); 329| 16.8k| hashkeys(S2C_IV, sizeof(S2C_IV), &hs, 'B'); 330| 16.8k| hashkeys(C2S_key, sizeof(C2S_key), &hs, 'C'); 331| 16.8k| hashkeys(S2C_key, sizeof(S2C_key), &hs, 'D'); 332| | 333| 16.8k| if (ses.newkeys->recv.algo_crypt->cipherdesc != NULL) { ------------------ | Branch (333:6): [True: 16.8k, False: 0] ------------------ 334| 16.8k| int recv_cipher = -1; 335| 16.8k| if (ses.newkeys->recv.algo_crypt->cipherdesc->name != NULL) { ------------------ | Branch (335:7): [True: 13.2k, False: 3.62k] ------------------ 336| 13.2k| recv_cipher = find_cipher(ses.newkeys->recv.algo_crypt->cipherdesc->name); 337| 13.2k| if (recv_cipher < 0) { ------------------ | Branch (337:8): [True: 0, False: 13.2k] ------------------ 338| 0| dropbear_exit("Crypto error"); 339| 0| } 340| 13.2k| } 341| 16.8k| if (ses.newkeys->recv.crypt_mode->start(recv_cipher, ------------------ | Branch (341:7): [True: 0, False: 16.8k] ------------------ 342| 16.8k| recv_IV, recv_key, 343| 16.8k| ses.newkeys->recv.algo_crypt->keysize, 0, 344| 16.8k| &ses.newkeys->recv.cipher_state) != CRYPT_OK) { 345| 0| dropbear_exit("Crypto error"); 346| 0| } 347| 16.8k| } 348| | 349| 16.8k| if (ses.newkeys->trans.algo_crypt->cipherdesc != NULL) { ------------------ | Branch (349:6): [True: 16.8k, False: 0] ------------------ 350| 16.8k| int trans_cipher = -1; 351| 16.8k| if (ses.newkeys->trans.algo_crypt->cipherdesc->name != NULL) { ------------------ | Branch (351:7): [True: 13.2k, False: 3.62k] ------------------ 352| 13.2k| trans_cipher = find_cipher(ses.newkeys->trans.algo_crypt->cipherdesc->name); 353| 13.2k| if (trans_cipher < 0) { ------------------ | Branch (353:8): [True: 0, False: 13.2k] ------------------ 354| 0| dropbear_exit("Crypto error"); 355| 0| } 356| 13.2k| } 357| 16.8k| if (ses.newkeys->trans.crypt_mode->start(trans_cipher, ------------------ | Branch (357:7): [True: 0, False: 16.8k] ------------------ 358| 16.8k| trans_IV, trans_key, 359| 16.8k| ses.newkeys->trans.algo_crypt->keysize, 0, 360| 16.8k| &ses.newkeys->trans.cipher_state) != CRYPT_OK) { 361| 0| dropbear_exit("Crypto error"); 362| 0| } 363| 16.8k| } 364| | 365| 16.8k| if (ses.newkeys->trans.algo_mac->hash_desc != NULL) { ------------------ | Branch (365:6): [True: 13.2k, False: 3.62k] ------------------ 366| 13.2k| hashkeys(ses.newkeys->trans.mackey, 367| 13.2k| ses.newkeys->trans.algo_mac->keysize, &hs, mactransletter); 368| 13.2k| ses.newkeys->trans.hash_index = find_hash(ses.newkeys->trans.algo_mac->hash_desc->name); 369| 13.2k| } 370| | 371| 16.8k| if (ses.newkeys->recv.algo_mac->hash_desc != NULL) { ------------------ | Branch (371:6): [True: 0, False: 16.8k] ------------------ 372| 0| hashkeys(ses.newkeys->recv.mackey, 373| 0| ses.newkeys->recv.algo_mac->keysize, &hs, macrecvletter); 374| 0| ses.newkeys->recv.hash_index = find_hash(ses.newkeys->recv.algo_mac->hash_desc->name); 375| 0| } 376| | 377| | /* Ready to switch over */ 378| 16.8k| ses.newkeys->trans.valid = 1; 379| 16.8k| ses.newkeys->recv.valid = 1; 380| | 381| 16.8k| m_burn(C2S_IV, sizeof(C2S_IV)); 382| 16.8k| m_burn(C2S_key, sizeof(C2S_key)); 383| 16.8k| m_burn(S2C_IV, sizeof(S2C_IV)); 384| 16.8k| m_burn(S2C_key, sizeof(S2C_key)); 385| 16.8k| m_burn(&hs, sizeof(hash_state)); 386| | 387| 16.8k| TRACE(("leave gen_new_keys")) 388| 16.8k|} common-kex.c:hashkeys: 256| 80.5k| const hash_state * hs, const unsigned char X) { 257| | 258| 80.5k| const struct ltc_hash_descriptor *hash_desc = ses.newkeys->algo_kex->hash_desc; 259| 80.5k| hash_state hs2; 260| 80.5k| unsigned int offset; 261| 80.5k| unsigned char tmpout[MAX_HASH_SIZE]; 262| | 263| 80.5k| memcpy(&hs2, hs, sizeof(hash_state)); 264| 80.5k| hash_desc->process(&hs2, &X, 1); 265| 80.5k| hash_desc->process(&hs2, ses.session_id->data, ses.session_id->len); 266| 80.5k| hash_desc->done(&hs2, tmpout); 267| 80.5k| memcpy(out, tmpout, MIN(hash_desc->hashsize, outlen)); 268| 80.5k| for (offset = hash_desc->hashsize; 269| 156k| offset < outlen; ------------------ | Branch (269:4): [True: 75.6k, False: 80.5k] ------------------ 270| 80.5k| offset += hash_desc->hashsize) 271| 75.6k| { 272| | /* need to extend */ 273| 75.6k| memcpy(&hs2, hs, sizeof(hash_state)); 274| 75.6k| hash_desc->process(&hs2, out, offset); 275| 75.6k| hash_desc->done(&hs2, tmpout); 276| 75.6k| memcpy(&out[offset], tmpout, MIN(outlen - offset, hash_desc->hashsize)); 277| 75.6k| } 278| 80.5k| m_burn(&hs2, sizeof(hash_state)); 279| 80.5k|} common-kex.c:load_dh_p: 558| 19.2k|{ 559| 19.2k| bytes_to_mp(dh_p, ses.newkeys->algo_kex->dh_p_bytes, 560| 19.2k| ses.newkeys->algo_kex->dh_p_len); 561| 19.2k|} common-kex.c:read_kex_algos: 818| 18.2k|static void read_kex_algos() { 819| | 820| | /* for asymmetry */ 821| 18.2k| algo_type * c2s_hash_algo = NULL; 822| 18.2k| algo_type * s2c_hash_algo = NULL; 823| 18.2k| algo_type * c2s_cipher_algo = NULL; 824| 18.2k| algo_type * s2c_cipher_algo = NULL; 825| 18.2k| algo_type * c2s_comp_algo = NULL; 826| 18.2k| algo_type * s2c_comp_algo = NULL; 827| | /* the generic one */ 828| 18.2k| algo_type * algo = NULL; 829| | 830| | /* which algo couldn't match */ 831| 18.2k| char * erralgo = NULL; 832| | 833| 18.2k| int goodguess = 0; 834| 18.2k| int allgood = 1; /* we AND this with each goodguess and see if its still 835| | true after */ 836| 18.2k| int kexguess2 = 0; 837| | 838| 18.2k| buf_incrpos(ses.payload, 16); /* start after the cookie */ 839| | 840| 18.2k| memset(ses.newkeys, 0x0, sizeof(*ses.newkeys)); 841| | 842| | /* kex_algorithms */ 843| 18.2k|#if DROPBEAR_KEXGUESS2 844| 18.2k| if (buf_has_algo(ses.payload, KEXGUESS2_ALGO_NAME) == DROPBEAR_SUCCESS) { ------------------ | | 128| 18.2k|#define KEXGUESS2_ALGO_NAME "kexguess2@matt.ucc.asn.au" ------------------ if (buf_has_algo(ses.payload, KEXGUESS2_ALGO_NAME) == DROPBEAR_SUCCESS) { ------------------ | | 102| 18.2k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (844:6): [True: 1.69k, False: 16.5k] ------------------ 845| 1.69k| kexguess2 = 1; 846| 1.69k| } 847| 18.2k|#endif 848| | 849| 18.2k|#if DROPBEAR_EXT_INFO 850| | /* Determine if SSH_MSG_EXT_INFO messages should be sent. 851| | Should be done for the first key exchange. Only required on server side 852| | for server-sig-algs */ 853| 18.2k| if (IS_DROPBEAR_SERVER) { ------------------ | | 319| 18.2k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 18.0k, False: 129] | | ------------------ ------------------ 854| 18.0k| if (!ses.kexstate.donefirstkex) { ------------------ | Branch (854:7): [True: 3.31k, False: 14.7k] ------------------ 855| 3.31k| if (buf_has_algo(ses.payload, SSH_EXT_INFO_C) == DROPBEAR_SUCCESS) { ------------------ | | 100| 3.31k|#define SSH_EXT_INFO_C "ext-info-c" ------------------ if (buf_has_algo(ses.payload, SSH_EXT_INFO_C) == DROPBEAR_SUCCESS) { ------------------ | | 102| 3.31k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (855:8): [True: 29, False: 3.28k] ------------------ 856| 29| ses.allow_ext_info = 1; 857| 29| } 858| 3.31k| } 859| 18.0k| } 860| 18.2k|#endif 861| | 862| 18.2k| algo = buf_match_algo(ses.payload, sshkex, kexguess2, &goodguess); 863| 18.2k| allgood &= goodguess; 864| 18.2k| if (algo == NULL || algo->data == NULL) { ------------------ | Branch (864:6): [True: 371, False: 17.8k] | Branch (864:22): [True: 14, False: 17.8k] ------------------ 865| | /* kexguess2, ext-info-c, ext-info-s should not match negotiation */ 866| 256| erralgo = "kex"; 867| 256| goto error; 868| 256| } 869| 17.9k| TRACE(("kexguess2 %d", kexguess2)) 870| 17.9k| DEBUG3(("kex algo %s", algo->name)) 871| 17.9k| ses.newkeys->algo_kex = algo->data; 872| | 873| | /* server_host_key_algorithms */ 874| 17.9k| algo = buf_match_algo(ses.payload, sigalgs, kexguess2, &goodguess); 875| 17.9k| allgood &= goodguess; 876| 17.9k| if (algo == NULL) { ------------------ | Branch (876:6): [True: 3, False: 17.9k] ------------------ 877| 3| erralgo = "hostkey"; 878| 3| goto error; 879| 3| } 880| 17.9k| DEBUG2(("hostkey algo %s", algo->name)) 881| 17.9k| ses.newkeys->algo_signature = algo->val; 882| 17.9k| ses.newkeys->algo_hostkey = signkey_type_from_signature(ses.newkeys->algo_signature); 883| | 884| | /* encryption_algorithms_client_to_server */ 885| 17.9k| c2s_cipher_algo = buf_match_algo(ses.payload, sshciphers, 0, NULL); 886| 17.9k| if (c2s_cipher_algo == NULL) { ------------------ | Branch (886:6): [True: 14, False: 17.9k] ------------------ 887| 14| erralgo = "enc c->s"; 888| 14| goto error; 889| 14| } 890| 17.9k| DEBUG2(("enc c2s is %s", c2s_cipher_algo->name)) 891| | 892| | /* encryption_algorithms_server_to_client */ 893| 17.9k| s2c_cipher_algo = buf_match_algo(ses.payload, sshciphers, 0, NULL); 894| 17.9k| if (s2c_cipher_algo == NULL) { ------------------ | Branch (894:6): [True: 9, False: 17.9k] ------------------ 895| 9| erralgo = "enc s->c"; 896| 9| goto error; 897| 9| } 898| 17.9k| DEBUG2(("enc s2c is %s", s2c_cipher_algo->name)) 899| | 900| | /* mac_algorithms_client_to_server */ 901| 17.9k| c2s_hash_algo = buf_match_algo(ses.payload, sshhashes, 0, NULL); 902| 17.9k|#if DROPBEAR_AEAD_MODE 903| 17.9k| if (((struct dropbear_cipher_mode*)c2s_cipher_algo->mode)->aead_crypt != NULL) { ------------------ | Branch (903:6): [True: 3.69k, False: 14.2k] ------------------ 904| 3.69k| c2s_hash_algo = NULL; 905| 3.69k| } else 906| 14.2k|#endif 907| 14.2k| if (c2s_hash_algo == NULL) { ------------------ | Branch (907:6): [True: 12, False: 14.2k] ------------------ 908| 12| erralgo = "mac c->s"; 909| 12| goto error; 910| 12| } 911| 17.9k| DEBUG2(("hmac c2s is %s", c2s_hash_algo ? c2s_hash_algo->name : "")) 912| | 913| | /* mac_algorithms_server_to_client */ 914| 17.9k| s2c_hash_algo = buf_match_algo(ses.payload, sshhashes, 0, NULL); 915| 17.9k|#if DROPBEAR_AEAD_MODE 916| 17.9k| if (((struct dropbear_cipher_mode*)s2c_cipher_algo->mode)->aead_crypt != NULL) { ------------------ | Branch (916:6): [True: 3.69k, False: 14.2k] ------------------ 917| 3.69k| s2c_hash_algo = NULL; 918| 3.69k| } else 919| 14.2k|#endif 920| 14.2k| if (s2c_hash_algo == NULL) { ------------------ | Branch (920:6): [True: 8, False: 14.2k] ------------------ 921| 8| erralgo = "mac s->c"; 922| 8| goto error; 923| 8| } 924| 17.9k| DEBUG2(("hmac s2c is %s", s2c_hash_algo ? s2c_hash_algo->name : "")) 925| | 926| | /* compression_algorithms_client_to_server */ 927| 17.9k| c2s_comp_algo = buf_match_algo(ses.payload, ses.compress_algos, 0, NULL); 928| 17.9k| if (c2s_comp_algo == NULL) { ------------------ | Branch (928:6): [True: 8, False: 17.9k] ------------------ 929| 8| erralgo = "comp c->s"; 930| 8| goto error; 931| 8| } 932| 17.9k| DEBUG2(("comp c2s is %s", c2s_comp_algo->name)) 933| | 934| | /* compression_algorithms_server_to_client */ 935| 17.9k| s2c_comp_algo = buf_match_algo(ses.payload, ses.compress_algos, 0, NULL); 936| 17.9k| if (s2c_comp_algo == NULL) { ------------------ | Branch (936:6): [True: 4, False: 17.9k] ------------------ 937| 4| erralgo = "comp s->c"; 938| 4| goto error; 939| 4| } 940| 17.9k| DEBUG2(("comp s2c is %s", s2c_comp_algo->name)) 941| | 942| | /* languages_client_to_server */ 943| 17.9k| buf_eatstring(ses.payload); 944| | 945| | /* languages_server_to_client */ 946| 17.9k| buf_eatstring(ses.payload); 947| | 948| | /* their first_kex_packet_follows */ 949| 17.9k| if (buf_getbool(ses.payload)) { ------------------ | Branch (949:6): [True: 1.74k, False: 16.1k] ------------------ 950| 1.74k| TRACE(("them kex firstfollows. allgood %d", allgood)) 951| 1.74k| ses.kexstate.them_firstfollows = 1; 952| | /* if the guess wasn't good, we ignore the packet sent */ 953| 1.74k| if (!allgood) { ------------------ | Branch (953:7): [True: 185, False: 1.56k] ------------------ 954| 185| ses.ignorenext = 1; 955| 185| } 956| 1.74k| } 957| | 958| | /* Handle the asymmetry */ 959| 17.9k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 320| 17.9k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 17.9k] | | ------------------ ------------------ 960| 0| ses.newkeys->recv.algo_crypt = 961| 0| (struct dropbear_cipher*)s2c_cipher_algo->data; 962| 0| ses.newkeys->trans.algo_crypt = 963| 0| (struct dropbear_cipher*)c2s_cipher_algo->data; 964| 0| ses.newkeys->recv.crypt_mode = 965| 0| (struct dropbear_cipher_mode*)s2c_cipher_algo->mode; 966| 0| ses.newkeys->trans.crypt_mode = 967| 0| (struct dropbear_cipher_mode*)c2s_cipher_algo->mode; 968| 0| ses.newkeys->recv.algo_mac = 969| 0|#if DROPBEAR_AEAD_MODE 970| 0| s2c_hash_algo == NULL ? ses.newkeys->recv.crypt_mode->aead_mac : ------------------ | Branch (970:4): [True: 0, False: 0] ------------------ 971| 0|#endif 972| 0| (struct dropbear_hash*)s2c_hash_algo->data; 973| 0| ses.newkeys->trans.algo_mac = 974| 0|#if DROPBEAR_AEAD_MODE 975| 0| c2s_hash_algo == NULL ? ses.newkeys->trans.crypt_mode->aead_mac : ------------------ | Branch (975:4): [True: 0, False: 0] ------------------ 976| 0|#endif 977| 0| (struct dropbear_hash*)c2s_hash_algo->data; 978| 0| ses.newkeys->recv.algo_comp = s2c_comp_algo->val; 979| 0| ses.newkeys->trans.algo_comp = c2s_comp_algo->val; 980| 17.9k| } else { 981| | /* SERVER */ 982| 17.9k| ses.newkeys->recv.algo_crypt = 983| 17.9k| (struct dropbear_cipher*)c2s_cipher_algo->data; 984| 17.9k| ses.newkeys->trans.algo_crypt = 985| 17.9k| (struct dropbear_cipher*)s2c_cipher_algo->data; 986| 17.9k| ses.newkeys->recv.crypt_mode = 987| 17.9k| (struct dropbear_cipher_mode*)c2s_cipher_algo->mode; 988| 17.9k| ses.newkeys->trans.crypt_mode = 989| 17.9k| (struct dropbear_cipher_mode*)s2c_cipher_algo->mode; 990| 17.9k| ses.newkeys->recv.algo_mac = 991| 17.9k|#if DROPBEAR_AEAD_MODE 992| 17.9k| c2s_hash_algo == NULL ? ses.newkeys->recv.crypt_mode->aead_mac : ------------------ | Branch (992:4): [True: 3.67k, False: 14.2k] ------------------ 993| 17.9k|#endif 994| 17.9k| (struct dropbear_hash*)c2s_hash_algo->data; 995| 17.9k| ses.newkeys->trans.algo_mac = 996| 17.9k|#if DROPBEAR_AEAD_MODE 997| 17.9k| s2c_hash_algo == NULL ? ses.newkeys->trans.crypt_mode->aead_mac : ------------------ | Branch (997:4): [True: 3.67k, False: 14.2k] ------------------ 998| 17.9k|#endif 999| 17.9k| (struct dropbear_hash*)s2c_hash_algo->data; 1000| 17.9k| ses.newkeys->recv.algo_comp = c2s_comp_algo->val; 1001| 17.9k| ses.newkeys->trans.algo_comp = s2c_comp_algo->val; 1002| 17.9k| } 1003| | 1004| 17.9k|#if DROPBEAR_FUZZ 1005| 17.9k| if (fuzz.fuzzing) { ------------------ | Branch (1005:6): [True: 17.5k, False: 307] ------------------ 1006| 17.5k| fuzz_kex_fakealgos(); 1007| 17.5k| } 1008| 17.9k|#endif 1009| | 1010| | /* reserved for future extensions */ 1011| 17.9k| buf_getint(ses.payload); 1012| | 1013| 17.9k| if (ses.send_kex_first_guess && allgood) { ------------------ | Branch (1013:6): [True: 0, False: 17.9k] | Branch (1013:34): [True: 0, False: 0] ------------------ 1014| 0| TRACE(("our_first_follows_matches 1")) 1015| 0| ses.kexstate.our_first_follows_matches = 1; 1016| 0| } 1017| 17.9k| return; 1018| | 1019| 314|error: 1020| 314| dropbear_exit("No matching algo %s", erralgo); 1021| 17.9k|} common_session_init: 47| 3.99k|void common_session_init(int sock_in, int sock_out) { 48| 3.99k| time_t now; 49| | 50| |#if DEBUG_TRACE 51| | debug_start_net(); 52| |#endif 53| | 54| 3.99k| TRACE(("enter session_init")) 55| | 56| 3.99k| ses.sock_in = sock_in; 57| 3.99k| ses.sock_out = sock_out; 58| 3.99k| ses.maxfd = MAX(sock_in, sock_out); 59| | 60| 3.99k| if (sock_in >= 0) { ------------------ | Branch (60:6): [True: 3.99k, False: 0] ------------------ 61| 3.99k| setnonblocking(sock_in); 62| 3.99k| } 63| 3.99k| if (sock_out >= 0) { ------------------ | Branch (63:6): [True: 3.99k, False: 0] ------------------ 64| 3.99k| setnonblocking(sock_out); 65| 3.99k| } 66| | 67| 3.99k| ses.socket_prio = DROPBEAR_PRIO_NORMAL; 68| | /* Sets it to lowdelay */ 69| 3.99k| update_channel_prio(); 70| | 71| |#if !DROPBEAR_SVR_MULTIUSER 72| | /* A sanity check to prevent an accidental configuration option 73| | leaving multiuser systems exposed */ 74| | errno = 0; 75| | getuid(); 76| | if (errno != ENOSYS) { 77| | dropbear_exit("Non-multiuser Dropbear requires a non-multiuser kernel"); 78| | } 79| |#endif 80| | 81| 3.99k| now = monotonic_now(); 82| 3.99k| ses.connect_time = now; 83| 3.99k| ses.last_packet_time_keepalive_recv = now; 84| 3.99k| ses.last_packet_time_idle = now; 85| 3.99k| ses.last_packet_time_any_sent = 0; 86| 3.99k| ses.last_packet_time_keepalive_sent = 0; 87| | 88| 3.99k|#if DROPBEAR_FUZZ 89| 3.99k| if (!fuzz.fuzzing) ------------------ | Branch (89:6): [True: 0, False: 3.99k] ------------------ 90| 0|#endif 91| 0| { 92| 0| if (pipe(ses.signal_pipe) < 0) { ------------------ | Branch (92:6): [True: 0, False: 0] ------------------ 93| 0| dropbear_exit("Signal pipe failed"); 94| 0| } 95| 0| setnonblocking(ses.signal_pipe[0]); 96| 0| setnonblocking(ses.signal_pipe[1]); 97| 0| ses.maxfd = MAX(ses.maxfd, ses.signal_pipe[0]); 98| 0| ses.maxfd = MAX(ses.maxfd, ses.signal_pipe[1]); 99| 0| } 100| | 101| 3.99k| ses.writepayload = buf_new(TRANS_MAX_PAYLOAD_LEN); ------------------ | | 497| 3.99k|#define TRANS_MAX_PAYLOAD_LEN 16384 ------------------ 102| 3.99k| ses.transseq = 0; 103| | 104| 3.99k| ses.readbuf = NULL; 105| 3.99k| ses.payload = NULL; 106| 3.99k| ses.recvseq = 0; 107| | 108| 3.99k| initqueue(&ses.writequeue); 109| | 110| 3.99k| ses.requirenext = SSH_MSG_KEXINIT; ------------------ | | 36| 3.99k|#define SSH_MSG_KEXINIT 20 ------------------ 111| 3.99k| ses.dataallowed = 1; /* we can send data until we actually 112| | send the SSH_MSG_KEXINIT */ 113| 3.99k| ses.ignorenext = 0; 114| 3.99k| ses.lastpacket = 0; 115| 3.99k| ses.reply_queue_head = NULL; 116| 3.99k| ses.reply_queue_tail = NULL; 117| | 118| | /* set all the algos to none */ 119| 3.99k| ses.keys = (struct key_context*)m_malloc(sizeof(struct key_context)); 120| 3.99k| ses.newkeys = NULL; 121| 3.99k| ses.keys->recv.algo_crypt = &dropbear_nocipher; 122| 3.99k| ses.keys->trans.algo_crypt = &dropbear_nocipher; 123| 3.99k| ses.keys->recv.crypt_mode = &dropbear_mode_none; 124| 3.99k| ses.keys->trans.crypt_mode = &dropbear_mode_none; 125| | 126| 3.99k| ses.keys->recv.algo_mac = &dropbear_nohash; 127| 3.99k| ses.keys->trans.algo_mac = &dropbear_nohash; 128| | 129| 3.99k| ses.keys->algo_kex = NULL; 130| 3.99k| ses.keys->algo_hostkey = -1; 131| 3.99k| ses.keys->recv.algo_comp = DROPBEAR_COMP_NONE; 132| 3.99k| ses.keys->trans.algo_comp = DROPBEAR_COMP_NONE; 133| | 134| |#ifndef DISABLE_ZLIB 135| | ses.keys->recv.zstream = NULL; 136| | ses.keys->trans.zstream = NULL; 137| |#endif 138| | 139| | /* key exchange buffers */ 140| 3.99k| ses.session_id = NULL; 141| 3.99k| ses.kexhashbuf = NULL; 142| 3.99k| ses.transkexinit = NULL; 143| 3.99k| ses.dh_K = NULL; 144| 3.99k| ses.remoteident = NULL; 145| | 146| 3.99k| ses.chantypes = NULL; 147| | 148| 3.99k| ses.allowprivport = 0; 149| | 150| |#if DROPBEAR_PLUGIN 151| | ses.plugin_session = NULL; 152| |#endif 153| | 154| 3.99k| TRACE(("leave session_init")) 155| 3.99k|} session_loop: 157| 3.99k|void session_loop(void(*loophandler)(void)) { 158| | 159| 3.99k| fd_set readfd, writefd; 160| 3.99k| struct timeval timeout; 161| 3.99k| int val; 162| | 163| | /* main loop, select()s for all sockets in use */ 164| 411k| for(;;) { 165| 411k| const int writequeue_has_space = (ses.writequeue_len <= 2*TRANS_MAX_PAYLOAD_LEN); ------------------ | | 497| 411k|#define TRANS_MAX_PAYLOAD_LEN 16384 ------------------ 166| | 167| 411k| timeout.tv_sec = select_timeout(); 168| 411k| timeout.tv_usec = 0; 169| 411k| DROPBEAR_FD_ZERO(&writefd); ------------------ | | 104| 411k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 170| 411k| DROPBEAR_FD_ZERO(&readfd); ------------------ | | 104| 411k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 171| | 172| 411k| dropbear_assert(ses.payload == NULL); ------------------ | | 83| 411k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 411k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 173| | 174| | /* We get woken up when signal handlers write to this pipe. 175| | SIGCHLD in svr-chansession is the only one currently. */ 176| 411k|#if DROPBEAR_FUZZ 177| 411k| if (!fuzz.fuzzing) ------------------ | Branch (177:7): [True: 0, False: 411k] ------------------ 178| 0|#endif 179| 0| { 180| 0| FD_SET(ses.signal_pipe[0], &readfd); 181| 0| } 182| | 183| | /* set up for channels which can be read/written */ 184| 411k| setchannelfds(&readfd, &writefd, writequeue_has_space); 185| | 186| | /* Pending connections to test */ 187| 411k| set_connect_fds(&writefd); 188| | 189| | /* We delay reading from the input socket during initial setup until 190| | after we have written out our initial KEXINIT packet (empty writequeue). 191| | This means our initial packet can be in-flight while we're doing a blocking 192| | read for the remote ident. 193| | We also avoid reading from the socket if the writequeue is full, that avoids 194| | replies backing up */ 195| 411k| if (ses.sock_in != -1 ------------------ | Branch (195:7): [True: 411k, False: 0] ------------------ 196| 411k| && (ses.remoteident || isempty(&ses.writequeue)) ------------------ | Branch (196:8): [True: 399k, False: 12.1k] | Branch (196:27): [True: 4.11k, False: 7.99k] ------------------ 197| 411k| && writequeue_has_space) { ------------------ | Branch (197:7): [True: 403k, False: 0] ------------------ 198| 403k| FD_SET(ses.sock_in, &readfd); 199| 403k| } 200| | 201| | /* Ordering is important, this test must occur after any other function 202| | might have queued packets (such as connection handlers) */ 203| 411k| if (ses.sock_out != -1 && !isempty(&ses.writequeue)) { ------------------ | Branch (203:7): [True: 411k, False: 0] | Branch (203:29): [True: 24.8k, False: 386k] ------------------ 204| 24.8k| FD_SET(ses.sock_out, &writefd); 205| 24.8k| } 206| | 207| 411k| val = select(ses.maxfd+1, &readfd, &writefd, NULL, &timeout); ------------------ | | 53| 411k| wrapfd_select(nfds, readfds, writefds, exceptfds, timeout) ------------------ 208| | 209| 411k| if (ses.exitflag) { ------------------ | Branch (209:7): [True: 0, False: 411k] ------------------ 210| 0| dropbear_exit("Terminated by signal"); 211| 0| } 212| | 213| 411k| if (val < 0 && errno != EINTR) { ------------------ | Branch (213:7): [True: 581, False: 411k] | Branch (213:18): [True: 0, False: 581] ------------------ 214| 0| dropbear_exit("Error in select"); 215| 0| } 216| | 217| 411k| if (val <= 0) { ------------------ | Branch (217:7): [True: 19.4k, False: 392k] ------------------ 218| | /* If we were interrupted or the select timed out, we still 219| | * want to iterate over channels etc for reading, to handle 220| | * server processes exiting etc. 221| | * We don't want to read/write FDs. */ 222| 19.4k| DROPBEAR_FD_ZERO(&writefd); ------------------ | | 104| 19.4k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 223| 19.4k| DROPBEAR_FD_ZERO(&readfd); ------------------ | | 104| 19.4k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 224| 19.4k| } 225| | 226| | /* We'll just empty out the pipe if required. We don't do 227| | any thing with the data, since the pipe's purpose is purely to 228| | wake up the select() above. */ 229| 411k| ses.channel_signal_pending = 0; 230| 411k| if (FD_ISSET(ses.signal_pipe[0], &readfd)) { 231| 0| char x; 232| 0| TRACE(("signal pipe set")) 233| 0| while (read(ses.signal_pipe[0], &x, 1) > 0) {} ------------------ | | 55| 0|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ | Branch (233:11): [True: 0, False: 0] ------------------ 234| 0| ses.channel_signal_pending = 1; 235| 0| } 236| | 237| | /* check for auth timeout, rekeying required etc */ 238| 411k| checktimeouts(); 239| | 240| | /* process session socket's incoming data */ 241| 411k| if (ses.sock_in != -1) { ------------------ | Branch (241:7): [True: 411k, False: 0] ------------------ 242| 411k| if (FD_ISSET(ses.sock_in, &readfd)) { 243| 384k| if (!ses.remoteident) { ------------------ | Branch (243:9): [True: 3.99k, False: 380k] ------------------ 244| | /* blocking read of the version string */ 245| 3.99k| read_session_identification(); 246| 380k| } else { 247| 380k| read_packet(); 248| 380k| } 249| 384k| } 250| | 251| | /* Process the decrypted packet. After this, the read buffer 252| | * will be ready for a new packet */ 253| 411k| if (ses.payload != NULL) { ------------------ | Branch (253:8): [True: 72.1k, False: 339k] ------------------ 254| 72.1k| process_packet(); 255| 72.1k| } 256| 411k| } 257| | 258| | /* if required, flush out any queued reply packets that 259| | were being held up during a KEX */ 260| 411k| maybe_flush_reply_queue(); 261| | 262| 411k| handle_connect_fds(&writefd); 263| | 264| | /* loop handler prior to channelio, in case the server loophandler closes 265| | channels on process exit */ 266| 411k| loophandler(); 267| | 268| | /* process pipes etc for the channels, ses.dataallowed == 0 269| | * during rekeying ) */ 270| 411k| channelio(&readfd, &writefd); 271| | 272| | /* process session socket's outgoing data */ 273| 411k| if (ses.sock_out != -1) { ------------------ | Branch (273:7): [True: 407k, False: 3.99k] ------------------ 274| 407k| if (!isempty(&ses.writequeue)) { ------------------ | Branch (274:8): [True: 73.9k, False: 333k] ------------------ 275| 73.9k| write_packet(); 276| 73.9k| } 277| 407k| } 278| | 279| 411k| } /* for(;;) */ 280| | 281| | /* Not reached */ 282| 3.99k|} session_cleanup: 293| 3.99k|void session_cleanup() { 294| | 295| 3.99k| TRACE(("enter session_cleanup")) 296| | 297| | /* we can't cleanup if we don't know the session state */ 298| 3.99k| if (!ses.init_done) { ------------------ | Branch (298:6): [True: 0, False: 3.99k] ------------------ 299| 0| TRACE(("leave session_cleanup: !ses.init_done")) 300| 0| return; 301| 0| } 302| | 303| | /* BEWARE of changing order of functions here. */ 304| | 305| | /* Must be before extra_session_cleanup() */ 306| 3.99k| chancleanup(); 307| | 308| 3.99k| if (ses.extra_session_cleanup) { ------------------ | Branch (308:6): [True: 3.99k, False: 0] ------------------ 309| 3.99k| ses.extra_session_cleanup(); 310| 3.99k| } 311| | 312| | /* After these are freed most functions will fail */ 313| 3.99k|#if DROPBEAR_CLEANUP 314| | /* listeners call cleanup functions, this should occur before 315| | other session state is freed. */ 316| 3.99k| remove_all_listeners(); 317| | 318| 3.99k| remove_connect_pending(); 319| | 320| 4.91k| while (!isempty(&ses.writequeue)) { ------------------ | Branch (320:9): [True: 916, False: 3.99k] ------------------ 321| 916| buf_free(dequeue(&ses.writequeue)); 322| 916| } 323| | 324| 3.99k| m_free(ses.newkeys); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 325| |#ifndef DISABLE_ZLIB 326| | if (ses.keys->recv.zstream != NULL) { 327| | if (inflateEnd(ses.keys->recv.zstream) == Z_STREAM_ERROR) { 328| | dropbear_exit("Crypto error"); 329| | } 330| | m_free(ses.keys->recv.zstream); 331| | } 332| |#endif 333| | 334| 3.99k| m_free(ses.remoteident); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 335| 3.99k| m_free(ses.authstate.pw_dir); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 336| 3.99k| m_free(ses.authstate.pw_name); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 337| 3.99k| m_free(ses.authstate.pw_shell); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 338| 3.99k| m_free(ses.authstate.pw_passwd); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 339| 3.99k| m_free(ses.authstate.username); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 340| 3.99k|#endif 341| | 342| 3.99k| cleanup_buf(&ses.session_id); 343| 3.99k| cleanup_buf(&ses.hash); 344| 3.99k| cleanup_buf(&ses.payload); 345| 3.99k| cleanup_buf(&ses.readbuf); 346| 3.99k| cleanup_buf(&ses.writepayload); 347| 3.99k| cleanup_buf(&ses.kexhashbuf); 348| 3.99k| cleanup_buf(&ses.transkexinit); 349| 3.99k| if (ses.dh_K) { ------------------ | Branch (349:6): [True: 5, False: 3.99k] ------------------ 350| 5| mp_clear(ses.dh_K); 351| 5| } 352| 3.99k| m_free(ses.dh_K); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 353| | 354| 3.99k| m_burn(ses.keys, sizeof(struct key_context)); 355| 3.99k| m_free(ses.keys); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 356| | 357| 3.99k| TRACE(("leave session_cleanup")) 358| 3.99k|} send_session_identification: 360| 3.99k|void send_session_identification() { 361| 3.99k| buffer *writebuf = buf_new(strlen(LOCAL_IDENT "\r\n") + 1); ------------------ | | 10| 3.99k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION ------------------ 362| 3.99k| buf_putbytes(writebuf, (const unsigned char *) LOCAL_IDENT "\r\n", strlen(LOCAL_IDENT "\r\n")); ------------------ | | 10| 3.99k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION ------------------ buf_putbytes(writebuf, (const unsigned char *) LOCAL_IDENT "\r\n", strlen(LOCAL_IDENT "\r\n")); ------------------ | | 10| 3.99k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION ------------------ 363| 3.99k| writebuf_enqueue(writebuf); 364| 3.99k|} fill_passwd: 630| 502|void fill_passwd(const char* username) { 631| 502| struct passwd *pw = NULL; 632| 502| if (ses.authstate.pw_name) ------------------ | Branch (632:6): [True: 0, False: 502] ------------------ 633| 0| m_free(ses.authstate.pw_name); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 634| 502| if (ses.authstate.pw_dir) ------------------ | Branch (634:6): [True: 0, False: 502] ------------------ 635| 0| m_free(ses.authstate.pw_dir); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 636| 502| if (ses.authstate.pw_shell) ------------------ | Branch (636:6): [True: 0, False: 502] ------------------ 637| 0| m_free(ses.authstate.pw_shell); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 638| 502| if (ses.authstate.pw_passwd) ------------------ | Branch (638:6): [True: 0, False: 502] ------------------ 639| 0| m_free(ses.authstate.pw_passwd); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 640| | 641| 502| pw = getpwnam(username); ------------------ | | 108| 502|#define getpwnam(x) fuzz_getpwnam(x) ------------------ 642| 502| if (!pw) { ------------------ | Branch (642:6): [True: 471, False: 31] ------------------ 643| 471| return; 644| 471| } 645| 31| ses.authstate.pw_uid = pw->pw_uid; 646| 31| ses.authstate.pw_gid = pw->pw_gid; 647| 31| ses.authstate.pw_name = m_strdup(pw->pw_name); 648| 31| ses.authstate.pw_dir = m_strdup(pw->pw_dir); 649| 31| ses.authstate.pw_shell = m_strdup(pw->pw_shell); 650| 31| { 651| 31| char *passwd_crypt = pw->pw_passwd; 652| 31|#ifdef HAVE_SHADOW_H 653| | /* get the shadow password if possible */ 654| 31| struct spwd *spasswd = getspnam(ses.authstate.pw_name); 655| 31| if (spasswd && spasswd->sp_pwdp) { ------------------ | Branch (655:7): [True: 31, False: 0] | Branch (655:18): [True: 31, False: 0] ------------------ 656| 31| passwd_crypt = spasswd->sp_pwdp; 657| 31| } 658| 31|#endif 659| 31| if (!passwd_crypt) { ------------------ | Branch (659:7): [True: 0, False: 31] ------------------ 660| | /* android supposedly returns NULL */ 661| 0| passwd_crypt = "!!"; 662| 0| } 663| 31| ses.authstate.pw_passwd = m_strdup(passwd_crypt); 664| 31| } 665| 31|} update_channel_prio: 668| 3.99k|void update_channel_prio() { 669| 3.99k| enum dropbear_prio new_prio; 670| 3.99k| int any = 0; 671| 3.99k| unsigned int i; 672| | 673| 3.99k| TRACE(("update_channel_prio")) 674| | 675| 3.99k| if (ses.sock_out < 0) { ------------------ | Branch (675:6): [True: 0, False: 3.99k] ------------------ 676| 0| TRACE(("leave update_channel_prio: no socket")) 677| 0| return; 678| 0| } 679| | 680| 3.99k| new_prio = DROPBEAR_PRIO_NORMAL; 681| 3.99k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (681:14): [True: 0, False: 3.99k] ------------------ 682| 0| struct Channel *channel = ses.channels[i]; 683| 0| if (!channel) { ------------------ | Branch (683:7): [True: 0, False: 0] ------------------ 684| 0| continue; 685| 0| } 686| 0| any = 1; 687| 0| if (channel->prio == DROPBEAR_PRIO_LOWDELAY) { ------------------ | Branch (687:7): [True: 0, False: 0] ------------------ 688| 0| new_prio = DROPBEAR_PRIO_LOWDELAY; 689| 0| break; 690| 0| } 691| 0| } 692| | 693| 3.99k| if (any == 0) { ------------------ | Branch (693:6): [True: 3.99k, False: 0] ------------------ 694| | /* lowdelay during setup */ 695| 3.99k| TRACE(("update_channel_prio: not any")) 696| 3.99k| new_prio = DROPBEAR_PRIO_LOWDELAY; 697| 3.99k| } 698| | 699| 3.99k| if (new_prio != ses.socket_prio) { ------------------ | Branch (699:6): [True: 3.99k, False: 0] ------------------ 700| 3.99k| TRACE(("Dropbear priority transitioning %d -> %d", ses.socket_prio, new_prio)) 701| 3.99k| set_sock_priority(ses.sock_out, new_prio); 702| 3.99k| ses.socket_prio = new_prio; 703| 3.99k| } 704| 3.99k|} common-session.c:cleanup_buf: 284| 27.9k|static void cleanup_buf(buffer **buf) { 285| 27.9k| if (!*buf) { ------------------ | Branch (285:6): [True: 15.2k, False: 12.7k] ------------------ 286| 15.2k| return; 287| 15.2k| } 288| 12.7k| buf_burn_free(*buf); 289| 12.7k| *buf = NULL; 290| 12.7k|} common-session.c:read_session_identification: 366| 3.99k|static void read_session_identification() { 367| | /* max length of 255 chars */ 368| 3.99k| char linebuf[256]; 369| 3.99k| int len = 0; 370| 3.99k| char done = 0; 371| 3.99k| int i; 372| | 373| | /* Servers may send other lines of data before sending the 374| | * version string, client must be able to process such lines. 375| | * If they send more than 50 lines, something is wrong */ 376| 4.12k| for (i = IS_DROPBEAR_CLIENT ? 50 : 1; i > 0; i--) { ------------------ | | 320| 3.99k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 3.99k] | | ------------------ ------------------ | Branch (376:40): [True: 3.99k, False: 131] ------------------ 377| 3.99k| len = ident_readln(ses.sock_in, linebuf, sizeof(linebuf)); 378| | 379| 3.99k| if (len < 0 && errno != EINTR) { ------------------ | Branch (379:7): [True: 104, False: 3.89k] | Branch (379:18): [True: 13, False: 91] ------------------ 380| | /* It failed */ 381| 13| break; 382| 13| } 383| | 384| 3.98k| if (len >= 4 && memcmp(linebuf, "SSH-", 4) == 0) { ------------------ | Branch (384:7): [True: 3.89k, False: 93] | Branch (384:19): [True: 3.85k, False: 38] ------------------ 385| | /* start of line matches */ 386| 3.85k| done = 1; 387| 3.85k| break; 388| 3.85k| } 389| 3.98k| } 390| | 391| 3.99k| if (!done) { ------------------ | Branch (391:6): [True: 144, False: 3.85k] ------------------ 392| 144| TRACE(("error reading remote ident: %s\n", strerror(errno))) 393| 144| ses.remoteclosed(); 394| 3.85k| } else { 395| | /* linebuf is already null terminated */ 396| 3.85k| ses.remoteident = m_malloc(len); 397| 3.85k| memcpy(ses.remoteident, linebuf, len); 398| 3.85k| } 399| | 400| | /* Shall assume that 2.x will be backwards compatible. */ 401| 3.99k| if (strncmp(ses.remoteident, "SSH-2.", 6) != 0 ------------------ | Branch (401:6): [True: 59, False: 3.93k] ------------------ 402| 3.99k| && strncmp(ses.remoteident, "SSH-1.99-", 9) != 0) { ------------------ | Branch (402:7): [True: 58, False: 1] ------------------ 403| 58| dropbear_exit("Incompatible remote version '%s'", ses.remoteident); 404| 58| } 405| | 406| 3.99k| DEBUG1(("remoteident: %s", ses.remoteident)) 407| | 408| 3.99k|} common-session.c:ident_readln: 412| 3.99k|static int ident_readln(int fd, char* buf, int count) { 413| | 414| 3.99k| char in; 415| 3.99k| int pos = 0; 416| 3.99k| int num = 0; 417| 3.99k| fd_set fds; 418| 3.99k| struct timeval timeout; 419| | 420| 3.99k| TRACE(("enter ident_readln")) 421| | 422| 3.99k| if (count < 1) { ------------------ | Branch (422:6): [True: 0, False: 3.99k] ------------------ 423| 0| return -1; 424| 0| } 425| | 426| 3.99k| DROPBEAR_FD_ZERO(&fds); ------------------ | | 104| 3.99k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 427| | 428| | /* select since it's a non-blocking fd */ 429| | 430| | /* leave space to null-terminate */ 431| 75.7k| while (pos < count-1) { ------------------ | Branch (431:9): [True: 75.7k, False: 1] ------------------ 432| | 433| 75.7k| FD_SET(fd, &fds); 434| | 435| 75.7k| timeout.tv_sec = 1; 436| 75.7k| timeout.tv_usec = 0; 437| 75.7k| if (select(fd+1, &fds, NULL, NULL, &timeout) < 0) { ------------------ | | 53| 75.7k| wrapfd_select(nfds, readfds, writefds, exceptfds, timeout) ------------------ | Branch (437:7): [True: 96, False: 75.6k] ------------------ 438| 96| if (errno == EINTR) { ------------------ | Branch (438:8): [True: 96, False: 0] ------------------ 439| 96| continue; 440| 96| } 441| 0| TRACE(("leave ident_readln: select error")) 442| 0| return -1; 443| 96| } 444| | 445| 75.6k| checktimeouts(); 446| | 447| | /* Have to go one byte at a time, since we don't want to read past 448| | * the end, and have to somehow shove bytes back into the normal 449| | * packet reader */ 450| 75.6k| if (FD_ISSET(fd, &fds)) { 451| 75.6k| num = read(fd, &in, 1); ------------------ | | 55| 75.6k|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ 452| | /* a "\n" is a newline, "\r" we want to read in and keep going 453| | * so that it won't be read as part of the next line */ 454| 75.6k| if (num < 0) { ------------------ | Branch (454:8): [True: 127, False: 75.5k] ------------------ 455| | /* error */ 456| 127| if (errno == EINTR) { ------------------ | Branch (456:9): [True: 124, False: 3] ------------------ 457| 124| continue; /* not a real error */ 458| 124| } 459| 3| TRACE(("leave ident_readln: read error")) 460| 3| return -1; 461| 127| } 462| 75.5k| if (num == 0) { ------------------ | Branch (462:8): [True: 101, False: 75.4k] ------------------ 463| | /* EOF */ 464| 101| TRACE(("leave ident_readln: EOF")) 465| 101| return -1; 466| 101| } 467| | 468| 75.4k|#if DROPBEAR_FUZZ 469| 75.4k| fuzz_dump(&in, 1); 470| 75.4k|#endif 471| | 472| 75.4k| if (in == '\n') { ------------------ | Branch (472:8): [True: 3.89k, False: 71.5k] ------------------ 473| | /* end of ident string */ 474| 3.89k| break; 475| 3.89k| } 476| | /* we don't want to include '\r's */ 477| 71.5k| if (in != '\r') { ------------------ | Branch (477:8): [True: 58.6k, False: 12.9k] ------------------ 478| 58.6k| buf[pos] = in; 479| 58.6k| pos++; 480| 58.6k| } 481| 71.5k| } 482| 75.6k| } 483| | 484| 3.89k| buf[pos] = '\0'; 485| 3.89k| TRACE(("leave ident_readln: return %d", pos+1)) 486| 3.89k| return pos+1; 487| 3.99k|} common-session.c:checktimeouts: 533| 487k|static void checktimeouts() { 534| | 535| 487k| time_t now; 536| 487k| now = monotonic_now(); 537| | 538| 487k| if (IS_DROPBEAR_SERVER && ses.connect_time != 0 ------------------ | | 319| 974k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 487k, False: 0] | | ------------------ ------------------ | Branch (538:28): [True: 487k, False: 0] ------------------ 539| 487k| && elapsed(now, ses.connect_time) >= AUTH_TIMEOUT) { ------------------ | | 31| 487k|#define AUTH_TIMEOUT 300 /* we choose 5 minutes */ ------------------ | Branch (539:6): [True: 0, False: 487k] ------------------ 540| 0| dropbear_close("Timeout before auth"); 541| 0| } 542| | 543| | /* we can't rekey if we haven't done remote ident exchange yet */ 544| 487k| if (ses.remoteident == NULL) { ------------------ | Branch (544:6): [True: 87.7k, False: 399k] ------------------ 545| 87.7k| return; 546| 87.7k| } 547| | 548| 399k| if (!ses.kexstate.sentkexinit ------------------ | Branch (548:6): [True: 150k, False: 249k] ------------------ 549| 399k| && (elapsed(now, ses.kexstate.lastkextime) >= KEX_REKEY_TIMEOUT ------------------ | | 24| 300k|#define KEX_REKEY_TIMEOUT (3600 * 8) ------------------ | Branch (549:8): [True: 0, False: 150k] ------------------ 550| 150k| || ses.kexstate.datarecv+ses.kexstate.datatrans >= KEX_REKEY_DATA)) { ------------------ | | 27| 150k|#define KEX_REKEY_DATA (1<<30) /* 2^30 == 1GB, this value must be < INT_MAX */ ------------------ | Branch (550:7): [True: 0, False: 150k] ------------------ 551| 0| TRACE(("rekeying after timeout or max data reached")) 552| 0| send_msg_kexinit(); 553| 0| } 554| | 555| 399k| if (opts.keepalive_secs > 0 && ses.authstate.authdone) { ------------------ | Branch (555:6): [True: 0, False: 399k] | Branch (555:33): [True: 0, False: 0] ------------------ 556| | /* Avoid sending keepalives prior to auth - those are 557| | not valid pre-auth packet types */ 558| | 559| | /* Send keepalives if we've been idle */ 560| 0| if (elapsed(now, ses.last_packet_time_any_sent) >= opts.keepalive_secs) { ------------------ | Branch (560:7): [True: 0, False: 0] ------------------ 561| 0| send_msg_keepalive(); 562| 0| } 563| | 564| | /* Also send an explicit keepalive message to trigger a response 565| | if the remote end hasn't sent us anything */ 566| 0| if (elapsed(now, ses.last_packet_time_keepalive_recv) >= opts.keepalive_secs ------------------ | Branch (566:7): [True: 0, False: 0] ------------------ 567| 0| && elapsed(now, ses.last_packet_time_keepalive_sent) >= opts.keepalive_secs) { ------------------ | Branch (567:7): [True: 0, False: 0] ------------------ 568| 0| send_msg_keepalive(); 569| 0| } 570| | 571| 0| if (elapsed(now, ses.last_packet_time_keepalive_recv) ------------------ | Branch (571:7): [True: 0, False: 0] ------------------ 572| 0| >= opts.keepalive_secs * DEFAULT_KEEPALIVE_LIMIT) { ------------------ | | 510| 0|#define DEFAULT_KEEPALIVE_LIMIT 3 ------------------ 573| 0| dropbear_exit("Keepalive timeout"); 574| 0| } 575| 0| } 576| | 577| 399k| if (opts.idle_timeout_secs > 0 ------------------ | Branch (577:6): [True: 0, False: 399k] ------------------ 578| 399k| && elapsed(now, ses.last_packet_time_idle) >= opts.idle_timeout_secs) { ------------------ | Branch (578:7): [True: 0, False: 0] ------------------ 579| 0| dropbear_close("Idle timeout"); 580| 0| } 581| 399k|} common-session.c:elapsed: 523| 1.76M|static long elapsed(time_t now, time_t prev) { 524| 1.76M| time_t del = now - prev; 525| 1.76M| if (del > LONG_MAX) { ------------------ | Branch (525:6): [True: 0, False: 1.76M] ------------------ 526| 0| return LONG_MAX; 527| 0| } 528| 1.76M| return (long)del; 529| 1.76M|} common-session.c:select_timeout: 594| 411k|static long select_timeout() { 595| | /* determine the minimum timeout that might be required, so 596| | as to avoid waking when unneccessary */ 597| 411k| long timeout = KEX_REKEY_TIMEOUT; ------------------ | | 24| 411k|#define KEX_REKEY_TIMEOUT (3600 * 8) ------------------ 598| 411k| time_t now = monotonic_now(); 599| | 600| 411k| if (!ses.kexstate.sentkexinit) { ------------------ | Branch (600:6): [True: 150k, False: 261k] ------------------ 601| 150k| update_timeout(KEX_REKEY_TIMEOUT, now, ses.kexstate.lastkextime, &timeout); ------------------ | | 24| 150k|#define KEX_REKEY_TIMEOUT (3600 * 8) ------------------ 602| 150k| } 603| | 604| 411k| if (ses.authstate.authdone != 1 && IS_DROPBEAR_SERVER) { ------------------ | | 319| 411k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 411k, False: 0] | | ------------------ ------------------ | Branch (604:6): [True: 411k, False: 0] ------------------ 605| | /* AUTH_TIMEOUT is only relevant before authdone */ 606| 411k| update_timeout(AUTH_TIMEOUT, now, ses.connect_time, &timeout); ------------------ | | 31| 411k|#define AUTH_TIMEOUT 300 /* we choose 5 minutes */ ------------------ 607| 411k| } 608| | 609| 411k| if (ses.authstate.authdone) { ------------------ | Branch (609:6): [True: 0, False: 411k] ------------------ 610| 0| update_timeout(opts.keepalive_secs, now, 611| 0| MAX(ses.last_packet_time_keepalive_recv, ses.last_packet_time_keepalive_sent), 612| 0| &timeout); 613| 0| } 614| | 615| 411k| update_timeout(opts.idle_timeout_secs, now, ses.last_packet_time_idle, 616| 411k| &timeout); 617| | 618| | /* clamp negative timeouts to zero - event has already triggered */ 619| 411k| return MAX(timeout, 0); 620| 411k|} common-session.c:update_timeout: 583| 973k|static void update_timeout(long limit, time_t now, time_t last_event, long * timeout) { 584| 973k| TRACE2(("update_timeout limit %ld, now %llu, last %llu, timeout %ld", 585| 973k| limit, 586| 973k| (unsigned long long)now, 587| 973k| (unsigned long long)last_event, *timeout)) 588| 973k| if (last_event > 0 && limit > 0) { ------------------ | Branch (588:6): [True: 973k, False: 0] | Branch (588:24): [True: 561k, False: 411k] ------------------ 589| 561k| *timeout = MIN(*timeout, elapsed(now, last_event) + limit); 590| 561k| TRACE2(("new timeout %ld", *timeout)) 591| 561k| } 592| 973k|} crypto_init: 21| 1|void crypto_init() { 22| | 23| 1| const struct ltc_cipher_descriptor *regciphers[] = { 24| 1|#if DROPBEAR_AES 25| 1| &aes_desc, 26| 1|#endif 27| |#if DROPBEAR_3DES 28| | &des3_desc, 29| |#endif 30| 1| NULL 31| 1| }; 32| | 33| 1| const struct ltc_hash_descriptor *reghashes[] = { 34| 1|#if DROPBEAR_SHA1_HMAC 35| 1| &sha1_desc, 36| 1|#endif 37| 1|#if DROPBEAR_SHA256 38| 1| &sha256_desc, 39| 1|#endif 40| 1|#if DROPBEAR_SHA384 41| 1| &sha384_desc, 42| 1|#endif 43| 1|#if DROPBEAR_SHA512 44| 1| &sha512_desc, 45| 1|#endif 46| 1| NULL 47| 1| }; 48| 1| int i; 49| | 50| 2| for (i = 0; regciphers[i] != NULL; i++) { ------------------ | Branch (50:14): [True: 1, False: 1] ------------------ 51| 1| if (register_cipher(regciphers[i]) == -1) { ------------------ | Branch (51:7): [True: 0, False: 1] ------------------ 52| 0| dropbear_exit("Error registering crypto"); 53| 0| } 54| 1| } 55| | 56| 5| for (i = 0; reghashes[i] != NULL; i++) { ------------------ | Branch (56:14): [True: 4, False: 1] ------------------ 57| 4| if (register_hash(reghashes[i]) == -1) { ------------------ | Branch (57:7): [True: 0, False: 4] ------------------ 58| 0| dropbear_exit("Error registering crypto"); 59| 0| } 60| 4| } 61| | 62| 1|#if DROPBEAR_LTC_PRNG 63| 1| dropbear_ltc_prng = register_prng(&dropbear_prng_desc); 64| 1| if (dropbear_ltc_prng == -1) { ------------------ | Branch (64:6): [True: 0, False: 1] ------------------ 65| 0| dropbear_exit("Error registering crypto"); 66| 0| } 67| 1|#endif 68| | 69| 1| mp_rand_source(dropbear_rand_source); 70| | 71| 1|#if DROPBEAR_ECC 72| 1| ltc_mp = ltm_desc; 73| 1| dropbear_ecc_fill_dp(); 74| 1|#endif 75| 1|} dropbear_curve25519_scalarmult: 212| 14.5k|{ 213| 14.5k| u8 z[32]; 214| 14.5k| i64 x[80],r,i; 215| 14.5k| gf a,b,c,d,e,f; 216| 451k| FOR(i,31) z[i]=n[i]; ------------------ | | 34| 465k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 451k, False: 14.5k] | | ------------------ ------------------ 217| 14.5k| z[31]=(n[31]&127)|64; 218| 14.5k| z[0]&=248; 219| 14.5k| unpack25519(x,p); 220| 232k| FOR(i,16) { ------------------ | | 34| 247k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 232k, False: 14.5k] | | ------------------ ------------------ 221| 232k| b[i]=x[i]; 222| 232k| d[i]=a[i]=c[i]=0; 223| 232k| } 224| 14.5k| a[0]=d[0]=1; 225| 3.72M| for(i=254;i>=0;--i) { ------------------ | Branch (225:13): [True: 3.71M, False: 14.5k] ------------------ 226| 3.71M| r=(z[i>>3]>>(i&7))&1; 227| 3.71M| sel25519(a,b,r); 228| 3.71M| sel25519(c,d,r); 229| 3.71M| A(e,a,c); 230| 3.71M| Z(a,a,c); 231| 3.71M| A(c,b,d); 232| 3.71M| Z(b,b,d); 233| 3.71M| S(d,e); 234| 3.71M| S(f,a); 235| 3.71M| M(a,c,a); 236| 3.71M| M(c,b,e); 237| 3.71M| A(e,a,c); 238| 3.71M| Z(a,a,c); 239| 3.71M| S(b,a); 240| 3.71M| Z(c,d,f); 241| 3.71M| M(a,c,_121665); 242| 3.71M| A(a,a,d); 243| 3.71M| M(c,c,a); 244| 3.71M| M(a,d,f); 245| 3.71M| M(d,b,x); 246| 3.71M| S(b,e); 247| 3.71M| sel25519(a,b,r); 248| 3.71M| sel25519(c,d,r); 249| 3.71M| } 250| 232k| FOR(i,16) { ------------------ | | 34| 247k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 232k, False: 14.5k] | | ------------------ ------------------ 251| 232k| x[i+16]=a[i]; 252| 232k| x[i+32]=c[i]; 253| 232k| x[i+48]=b[i]; 254| 232k| x[i+64]=d[i]; 255| 232k| } 256| 14.5k| inv25519(x+32,x+32); 257| 14.5k| M(x+16,x+16,x+32); 258| 14.5k| pack25519(q,x+16); 259| 14.5k|} dropbear_ed25519_sign: 393| 995|{ 394| 995| hash_state hs; 395| 995| u8 d[64],h[64],r[64]; 396| 995| i64 x[64]; 397| 995| gf p[4]; 398| 995| u32 i,j; 399| | 400| 995| crypto_hash(d, sk, 32); 401| 995| d[0] &= 248; 402| 995| d[31] &= 127; 403| 995| d[31] |= 64; 404| | 405| 995| *slen = 64; 406| | 407| 995| sha512_init(&hs); 408| 995| sha512_process(&hs,d + 32,32); 409| 995| sha512_process(&hs,m,mlen); 410| 995| sha512_done(&hs,r); 411| 995| reduce(r); 412| 995| scalarbase(p,r); 413| 995| pack(s,p); 414| | 415| 995| sha512_init(&hs); 416| 995| sha512_process(&hs,s,32); 417| 995| sha512_process(&hs,pk,32); 418| 995| sha512_process(&hs,m,mlen); 419| 995| sha512_done(&hs,h); 420| 995| reduce(h); 421| | 422| 63.6k| FOR(i,64) x[i] = 0; ------------------ | | 34| 64.6k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 63.6k, False: 995] | | ------------------ ------------------ 423| 31.8k| FOR(i,32) x[i] = (u64) r[i]; ------------------ | | 34| 32.8k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 31.8k, False: 995] | | ------------------ ------------------ 424| 1.01M| FOR(i,32) FOR(j,32) x[i+j] += h[i] * (u64) d[j]; ------------------ | | 34| 32.8k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 31.8k, False: 995] | | ------------------ ------------------ FOR(i,32) FOR(j,32) x[i+j] += h[i] * (u64) d[j]; ------------------ | | 34| 1.05M|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 1.01M, False: 31.8k] | | ------------------ ------------------ 425| 995| modL(s + 32,x); 426| 995|} curve25519.c:unpack25519: 150| 14.5k|{ 151| 14.5k| int i; 152| 232k| FOR(i,16) o[i]=n[2*i]+((i64)n[2*i+1]<<8); ------------------ | | 34| 247k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 232k, False: 14.5k] | | ------------------ ------------------ 153| 14.5k| o[15]&=0x7fff; 154| 14.5k|} curve25519.c:sel25519: 96| 16.9M|{ 97| 16.9M| i64 t,i,c=~(b-1); 98| 270M| FOR(i,16) { ------------------ | | 34| 287M|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 270M, False: 16.9M] | | ------------------ ------------------ 99| 270M| t= c&(p[i]^q[i]); 100| 270M| p[i]^=t; 101| 270M| q[i]^=t; 102| 270M| } 103| 16.9M|} curve25519.c:A: 157| 17.3M|{ 158| 17.3M| int i; 159| 278M| FOR(i,16) o[i]=a[i]+b[i]; ------------------ | | 34| 295M|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 278M, False: 17.3M] | | ------------------ ------------------ 160| 17.3M|} curve25519.c:Z: 163| 16.8M|{ 164| 16.8M| int i; 165| 270M| FOR(i,16) o[i]=a[i]-b[i]; ------------------ | | 34| 287M|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 270M, False: 16.8M] | | ------------------ ------------------ 166| 16.8M|} curve25519.c:S: 180| 18.7M|{ 181| 18.7M| M(o,a,a); 182| 18.7M|} curve25519.c:M: 169| 49.5M|{ 170| 49.5M| i64 i,j,t[31]; 171| 1.53G| FOR(i,31) t[i]=0; ------------------ | | 34| 1.58G|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 1.53G, False: 49.5M] | | ------------------ ------------------ 172| 12.6G| FOR(i,16) FOR(j,16) t[i+j]+=a[i]*b[j]; ------------------ | | 34| 842M|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 793M, False: 49.5M] | | ------------------ ------------------ FOR(i,16) FOR(j,16) t[i+j]+=a[i]*b[j]; ------------------ | | 34| 13.4G|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 12.6G, False: 793M] | | ------------------ ------------------ 173| 743M| FOR(i,15) t[i]+=38*t[i+16]; ------------------ | | 34| 793M|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 743M, False: 49.5M] | | ------------------ ------------------ 174| 793M| FOR(i,16) o[i]=t[i]; ------------------ | | 34| 842M|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 793M, False: 49.5M] | | ------------------ ------------------ 175| 49.5M| car25519(o); 176| 49.5M| car25519(o); 177| 49.5M|} curve25519.c:car25519: 84| 99.2M|{ 85| 99.2M| int i; 86| 99.2M| i64 c; 87| 1.58G| FOR(i,16) { ------------------ | | 34| 1.68G|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 1.58G, False: 99.2M] | | ------------------ ------------------ 88| 1.58G| o[i]+=(1LL<<16); 89| 1.58G| c=o[i]>>16; 90| 1.58G| o[(i+1)*(i<15)]+=c-1+37*(c-1)*(i==15); 91| 1.58G| o[i]-=c<<16; 92| 1.58G| } 93| 99.2M|} curve25519.c:inv25519: 185| 15.5k|{ 186| 15.5k| gf c; 187| 15.5k| int a; 188| 248k| FOR(a,16) c[a]=i[a]; ------------------ | | 34| 264k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 248k, False: 15.5k] | | ------------------ ------------------ 189| 3.96M| for(a=253;a>=0;a--) { ------------------ | Branch (189:13): [True: 3.94M, False: 15.5k] ------------------ 190| 3.94M| S(c,c); 191| 3.94M| if(a!=2&&a!=4) M(c,c,i); ------------------ | Branch (191:8): [True: 3.93M, False: 15.5k] | Branch (191:14): [True: 3.91M, False: 15.5k] ------------------ 192| 3.94M| } 193| 248k| FOR(a,16) o[a]=c[a]; ------------------ | | 34| 264k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 248k, False: 15.5k] | | ------------------ ------------------ 194| 15.5k|} curve25519.c:pack25519: 106| 16.5k|{ 107| 16.5k| int i,j,b; 108| 16.5k| gf m,t; 109| 264k| FOR(i,16) t[i]=n[i]; ------------------ | | 34| 281k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 264k, False: 16.5k] | | ------------------ ------------------ 110| 16.5k| car25519(t); 111| 16.5k| car25519(t); 112| 16.5k| car25519(t); 113| 33.0k| FOR(j,2) { ------------------ | | 34| 49.6k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 33.0k, False: 16.5k] | | ------------------ ------------------ 114| 33.0k| m[0]=t[0]-0xffed; 115| 496k| for(i=1;i<15;i++) { ------------------ | Branch (115:13): [True: 463k, False: 33.0k] ------------------ 116| 463k| m[i]=t[i]-0xffff-((m[i-1]>>16)&1); 117| 463k| m[i-1]&=0xffff; 118| 463k| } 119| 33.0k| m[15]=t[15]-0x7fff-((m[14]>>16)&1); 120| 33.0k| b=(m[15]>>16)&1; 121| 33.0k| m[14]&=0xffff; 122| 33.0k| sel25519(t,m,1-b); 123| 33.0k| } 124| 264k| FOR(i,16) { ------------------ | | 34| 281k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 264k, False: 16.5k] | | ------------------ ------------------ 125| 264k| o[2*i]=t[i]&0xff; 126| 264k| o[2*i+1]=t[i]>>8; 127| 264k| } 128| 16.5k|} curve25519.c:crypto_hash: 264| 995|{ 265| 995| hash_state hs; 266| | 267| 995| sha512_init(&hs); 268| 995| sha512_process(&hs, m, n); 269| 995| return sha512_done(&hs, out); 270| 995|} curve25519.c:scalarbase: 331| 995|{ 332| 995| gf q[4]; 333| 995| set25519(q[0],X); 334| 995| set25519(q[1],Y); 335| 995| set25519(q[2],gf1); 336| 995| M(q[3],X,Y); 337| 995| scalarmult(p,q,s); 338| 995|} curve25519.c:set25519: 77| 6.96k|{ 78| 6.96k| int i; 79| 111k| FOR(i,16) r[i]=a[i]; ------------------ | | 34| 118k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 111k, False: 6.96k] | | ------------------ ------------------ 80| 6.96k|} curve25519.c:pack: 305| 995|{ 306| 995| gf tx, ty, zi; 307| 995| inv25519(zi, p[2]); 308| 995| M(tx, p[0], zi); 309| 995| M(ty, p[1], zi); 310| 995| pack25519(r, ty); 311| 995| r[31] ^= par25519(tx) << 7; 312| 995|} curve25519.c:par25519: 142| 995|{ 143| 995| u8 d[32]; 144| 995| pack25519(d,a); 145| 995| return d[0]&1; 146| 995|} curve25519.c:reduce: 385| 1.99k|{ 386| 1.99k| i64 x[64],i; 387| 127k| FOR(i,64) x[i] = (u64) r[i]; ------------------ | | 34| 129k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 127k, False: 1.99k] | | ------------------ ------------------ 388| 127k| FOR(i,64) r[i] = 0; ------------------ | | 34| 129k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 127k, False: 1.99k] | | ------------------ ------------------ 389| 1.99k| modL(r,x); 390| 1.99k|} curve25519.c:modL: 359| 2.98k|{ 360| 2.98k| i64 carry,i,j; 361| 98.5k| for (i = 63;i >= 32;--i) { ------------------ | Branch (361:15): [True: 95.5k, False: 2.98k] ------------------ 362| 95.5k| carry = 0; 363| 2.00M| for (j = i - 32;j < i - 12;++j) { ------------------ | Branch (363:21): [True: 1.91M, False: 95.5k] ------------------ 364| 1.91M| x[j] += carry - 16 * x[i] * L[j - (i - 32)]; 365| 1.91M| carry = (x[j] + 128) >> 8; 366| 1.91M| x[j] -= carry << 8; 367| 1.91M| } 368| 95.5k| x[j] += carry; 369| 95.5k| x[i] = 0; 370| 95.5k| } 371| 2.98k| carry = 0; 372| 95.5k| FOR(j,32) { ------------------ | | 34| 98.5k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 95.5k, False: 2.98k] | | ------------------ ------------------ 373| 95.5k| x[j] += carry - (x[31] >> 4) * L[j]; 374| 95.5k| carry = x[j] >> 8; 375| 95.5k| x[j] &= 255; 376| 95.5k| } 377| 95.5k| FOR(j,32) x[j] -= carry * L[j]; ------------------ | | 34| 98.5k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 95.5k, False: 2.98k] | | ------------------ ------------------ 378| 95.5k| FOR(i,32) { ------------------ | | 34| 98.5k|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 95.5k, False: 2.98k] | | ------------------ ------------------ 379| 95.5k| x[i+1] += x[i] >> 8; 380| 95.5k| r[i] = x[i] & 255; 381| 95.5k| } 382| 2.98k|} curve25519.c:scalarmult: 315| 995|{ 316| 995| int i; 317| 995| set25519(p[0],gf0); 318| 995| set25519(p[1],gf1); 319| 995| set25519(p[2],gf1); 320| 995| set25519(p[3],gf0); 321| 255k| for (i = 255;i >= 0;--i) { ------------------ | Branch (321:16): [True: 254k, False: 995] ------------------ 322| 254k| u8 b = (s[i/8]>>(i&7))&1; 323| 254k| cswap(p,q,b); 324| 254k| add(q,p); 325| 254k| add(p,p); 326| 254k| cswap(p,q,b); 327| 254k| } 328| 995|} curve25519.c:cswap: 298| 509k|{ 299| 509k| int i; 300| 509k| FOR(i,4) ------------------ | | 34| 2.54M|#define FOR(i,n) for (i = 0;i < n;++i) | | ------------------ | | | Branch (34:29): [True: 2.03M, False: 509k] | | ------------------ ------------------ 301| 2.03M| sel25519(p[i],q[i],b); 302| 509k|} curve25519.c:add: 273| 509k|{ 274| 509k| gf a,b,c,d,t,e,f,g,h; 275| | 276| 509k| Z(a, p[1], p[0]); 277| 509k| Z(t, q[1], q[0]); 278| 509k| M(a, a, t); 279| 509k| A(b, p[0], p[1]); 280| 509k| A(t, q[0], q[1]); 281| 509k| M(b, b, t); 282| 509k| M(c, p[3], q[3]); 283| 509k| M(c, c, D2); 284| 509k| M(d, p[2], q[2]); 285| 509k| A(d, d, d); 286| 509k| Z(e, b, a); 287| 509k| Z(f, d, c); 288| 509k| A(g, d, c); 289| 509k| A(h, b, a); 290| | 291| 509k| M(p[0], e, f); 292| 509k| M(p[1], h, g); 293| 509k| M(p[2], g, f); 294| 509k| M(p[3], e, h); 295| 509k|} m_burn: 5| 505k|void m_burn(void *data, unsigned int len) { 6| | 7| |#if defined(HAVE_MEMSET_S) 8| | memset_s(data, len, 0x0, len); 9| |#elif defined(HAVE_EXPLICIT_BZERO) 10| 505k| explicit_bzero(data, len); 11| |#else 12| | /* This must be volatile to avoid compiler optimisation */ 13| | volatile void *p = data; 14| | memset((void*)p, 0x0, len); 15| |#endif 16| 505k|} m_calloc: 5| 19.5M|void * m_calloc(size_t nmemb, size_t size) { 6| 19.5M| if (SIZE_T_MAX / nmemb < size) { ------------------ | | 166| 19.5M|#define SIZE_T_MAX ULONG_MAX ------------------ | Branch (6:9): [True: 0, False: 19.5M] ------------------ 7| 0| dropbear_exit("m_calloc failed"); 8| 0| } 9| 19.5M| return m_malloc(nmemb*size); 10| 19.5M|} m_strdup: 12| 12.6k|void * m_strdup(const char * str) { 13| 12.6k| char* ret; 14| 12.6k| unsigned int len; 15| 12.6k| len = strlen(str); 16| | 17| 12.6k| ret = m_malloc(len+1); 18| 12.6k| if (ret == NULL) { ------------------ | Branch (18:9): [True: 0, False: 12.6k] ------------------ 19| 0| dropbear_exit("m_strdup failed"); 20| 0| } 21| 12.6k| memcpy(ret, str, len+1); 22| 12.6k| return ret; 23| 12.6k|} m_malloc_set_epoch: 76| 3.99k|void m_malloc_set_epoch(unsigned int epoch) { 77| 3.99k| current_epoch = epoch; 78| 3.99k|} m_malloc_free_epoch: 80| 3.99k|void m_malloc_free_epoch(unsigned int epoch, int dofree) { 81| 3.99k| struct dbmalloc_header* header; 82| 3.99k| struct dbmalloc_header* nextheader = NULL; 83| 3.99k| struct dbmalloc_header* oldstaple = staple; 84| 3.99k| staple = NULL; 85| | /* free allocations from this epoch, create a new staple-anchored list from 86| | the remainder */ 87| 4.16M| for (header = oldstaple; header; header = nextheader) ------------------ | Branch (87:30): [True: 4.16M, False: 3.99k] ------------------ 88| 4.16M| { 89| 4.16M| nextheader = header->next; 90| 4.16M| if (header->epoch == epoch) { ------------------ | Branch (90:13): [True: 4.59k, False: 4.15M] ------------------ 91| 4.59k| if (dofree) { ------------------ | Branch (91:17): [True: 4.59k, False: 0] ------------------ 92| 4.59k| free(header); 93| 4.59k| } 94| 4.15M| } else { 95| 4.15M| header->prev = NULL; 96| 4.15M| header->next = NULL; 97| 4.15M| put_alloc(header); 98| 4.15M| } 99| 4.16M| } 100| 3.99k|} m_malloc: 131| 20.2M|void * m_malloc(size_t size) { 132| 20.2M| char* mem = NULL; 133| 20.2M| struct dbmalloc_header* header = NULL; 134| | 135| 20.2M| if (size == 0 || size > 1e9) { ------------------ | Branch (135:9): [True: 0, False: 20.2M] | Branch (135:22): [True: 0, False: 20.2M] ------------------ 136| 0| dropbear_exit("m_malloc failed"); 137| 0| } 138| | 139| 20.2M| size = size + sizeof(struct dbmalloc_header); 140| | 141| 20.2M| mem = calloc(1, size); 142| 20.2M| if (mem == NULL) { ------------------ | Branch (142:9): [True: 0, False: 20.2M] ------------------ 143| 0| dropbear_exit("m_malloc failed"); 144| 0| } 145| 20.2M| header = (struct dbmalloc_header*)mem; 146| 20.2M| put_alloc(header); 147| 20.2M| header->epoch = current_epoch; 148| 20.2M| return &mem[sizeof(struct dbmalloc_header)]; 149| 20.2M|} m_realloc: 151| 2.28M|void * m_realloc(void* ptr, size_t size) { 152| 2.28M| char* mem = NULL; 153| 2.28M| struct dbmalloc_header* header = NULL; 154| 2.28M| if (size == 0 || size > 1e9) { ------------------ | Branch (154:9): [True: 0, False: 2.28M] | Branch (154:22): [True: 0, False: 2.28M] ------------------ 155| 0| dropbear_exit("m_realloc failed"); 156| 0| } 157| | 158| 2.28M| header = get_header(ptr); 159| 2.28M| remove_alloc(header); 160| | 161| 2.28M| size = size + sizeof(struct dbmalloc_header); 162| 2.28M| mem = realloc(header, size); 163| 2.28M| if (mem == NULL) { ------------------ | Branch (163:9): [True: 0, False: 2.28M] ------------------ 164| 0| dropbear_exit("m_realloc failed"); 165| 0| } 166| | 167| 2.28M| header = (struct dbmalloc_header*)mem; 168| 2.28M| put_alloc(header); 169| 2.28M| return &mem[sizeof(struct dbmalloc_header)]; 170| 2.28M|} m_free_direct: 172| 20.3M|void m_free_direct(void* ptr) { 173| 20.3M| struct dbmalloc_header* header = NULL; 174| 20.3M| if (!ptr) { ------------------ | Branch (174:9): [True: 24.5k, False: 20.2M] ------------------ 175| 24.5k| return; 176| 24.5k| } 177| 20.2M| header = get_header(ptr); 178| 20.2M| remove_alloc(header); 179| 20.2M| free(header); 180| 20.2M|} m_realloc_ltm: 184| 2.27M|void * m_realloc_ltm(void* ptr, size_t oldsize, size_t newsize) { 185| 2.27M| (void)oldsize; 186| 2.27M| return m_realloc(ptr, newsize); 187| 2.27M|} m_free_ltm: 189| 11.1M|void m_free_ltm(void *mem, size_t size) { 190| 11.1M| (void)size; 191| 11.1M| m_free_direct(mem); 192| 11.1M|} dbmalloc.c:put_alloc: 102| 26.7M|static void put_alloc(struct dbmalloc_header *header) { 103| 26.7M| assert(header->next == NULL); 104| 26.7M| assert(header->prev == NULL); 105| 26.7M| if (staple) { ------------------ | Branch (105:9): [True: 26.7M, False: 3.99k] ------------------ 106| 26.7M| staple->prev = header; 107| 26.7M| } 108| 26.7M| header->next = staple; 109| 26.7M| staple = header; 110| 26.7M|} dbmalloc.c:get_header: 126| 22.5M|static struct dbmalloc_header* get_header(void* ptr) { 127| 22.5M| char* bptr = ptr; 128| 22.5M| return (struct dbmalloc_header*)&bptr[-sizeof(struct dbmalloc_header)]; 129| 22.5M|} dbmalloc.c:remove_alloc: 112| 22.5M|static void remove_alloc(struct dbmalloc_header *header) { 113| 22.5M| if (header->prev) { ------------------ | Branch (113:9): [True: 16.7M, False: 5.80M] ------------------ 114| 16.7M| header->prev->next = header->next; 115| 16.7M| } 116| 22.5M| if (header->next) { ------------------ | Branch (116:9): [True: 22.5M, False: 0] ------------------ 117| 22.5M| header->next->prev = header->prev; 118| 22.5M| } 119| 22.5M| if (staple == header) { ------------------ | Branch (119:9): [True: 5.80M, False: 16.7M] ------------------ 120| 5.80M| staple = header->next; 121| 5.80M| } 122| 22.5M| header->prev = NULL; 123| 22.5M| header->next = NULL; 124| 22.5M|} fuzz_seed: 153| 3.99k|void fuzz_seed(const unsigned char* dat, unsigned int len) { 154| 3.99k| hash_state hs; 155| 3.99k| sha256_init(&hs); 156| 3.99k| sha256_process(&hs, "fuzzfuzzfuzz", strlen("fuzzfuzzfuzz")); 157| 3.99k| sha256_process(&hs, dat, len); 158| 3.99k| sha256_done(&hs, hashpool); 159| 3.99k| counter = 0; 160| 3.99k| donerandinit = 1; 161| 3.99k|} genrandom: 316| 133k|void genrandom(unsigned char* buf, unsigned int len) { 317| | 318| 133k| hash_state hs; 319| 133k| unsigned char hash[SHA256_HASH_SIZE]; 320| 133k| unsigned int copylen; 321| | 322| 133k| if (!donerandinit) { ------------------ | Branch (322:6): [True: 0, False: 133k] ------------------ 323| 0| dropbear_exit("seedrandom not done"); 324| 0| } 325| | 326| 379k| while (len > 0) { ------------------ | Branch (326:9): [True: 246k, False: 133k] ------------------ 327| 246k| sha256_init(&hs); 328| 246k| sha256_process(&hs, (void*)hashpool, sizeof(hashpool)); 329| 246k| sha256_process(&hs, (void*)&counter, sizeof(counter)); 330| 246k| sha256_done(&hs, hash); 331| | 332| 246k| counter++; 333| 246k| if (counter > MAX_COUNTER) { ------------------ | | 35| 246k|#define MAX_COUNTER (1<<30) ------------------ | Branch (333:7): [True: 0, False: 246k] ------------------ 334| 0| seedrandom(); 335| 0| } 336| | 337| 246k| copylen = MIN(len, SHA256_HASH_SIZE); 338| 246k| memcpy(buf, hash, copylen); 339| 246k| len -= copylen; 340| 246k| buf += copylen; 341| 246k| } 342| 133k| m_burn(hash, sizeof(hash)); 343| 133k|} gen_random_mpint: 350| 22.0k|void gen_random_mpint(const mp_int *max, mp_int *rand) { 351| | 352| 22.0k| unsigned char *randbuf = NULL; 353| 22.0k| unsigned int len = 0; 354| 22.0k| const unsigned char masks[] = {0xff, 0x01, 0x03, 0x07, 0x0f, 0x1f, 0x3f, 0x7f}; 355| | 356| 22.0k| const int size_bits = mp_count_bits(max); 357| | 358| 22.0k| len = size_bits / 8; 359| 22.0k| if ((size_bits % 8) != 0) { ------------------ | Branch (359:6): [True: 9.63k, False: 12.4k] ------------------ 360| 9.63k| len += 1; 361| 9.63k| } 362| | 363| 22.0k| randbuf = (unsigned char*)m_malloc(len); 364| 27.7k| do { 365| 27.7k| genrandom(randbuf, len); 366| | /* Mask out the unrequired bits - mp_read_unsigned_bin expects 367| | * MSB first.*/ 368| 27.7k| randbuf[0] &= masks[size_bits % 8]; 369| | 370| 27.7k| bytes_to_mp(rand, randbuf, len); 371| | 372| | /* keep regenerating until we get one satisfying 373| | * 0 < rand < max */ 374| 27.7k| } while (!(mp_cmp(rand, max) == MP_LT && mp_cmp_d(rand, 0) == MP_GT)); ------------------ | | 154| 55.4k|#define MP_LT -1 /* less than */ ------------------ } while (!(mp_cmp(rand, max) == MP_LT && mp_cmp_d(rand, 0) == MP_GT)); ------------------ | | 156| 22.0k|#define MP_GT 1 /* greater than */ ------------------ | Branch (374:13): [True: 22.0k, False: 5.67k] | Branch (374:43): [True: 22.0k, False: 0] ------------------ 375| 22.0k| m_burn(randbuf, len); 376| 22.0k| m_free(randbuf); ------------------ | | 24| 22.0k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 377| 22.0k|} dropbear_close: 95| 1.84k|void dropbear_close(const char* format, ...) { 96| | 97| 1.84k| va_list param; 98| | 99| 1.84k| va_start(param, format); 100| 1.84k| _dropbear_exit(EXIT_SUCCESS, format, param); 101| 0| va_end(param); 102| | 103| 0|} dropbear_exit: 105| 2.15k|void dropbear_exit(const char* format, ...) { 106| | 107| 2.15k| va_list param; 108| | 109| 2.15k| va_start(param, format); 110| 2.15k| _dropbear_exit(EXIT_FAILURE, format, param); 111| 0| va_end(param); 112| 0|} dropbear_log: 148| 4.59k|void dropbear_log(int priority, const char* format, ...) { 149| | 150| 4.59k| va_list param; 151| | 152| 4.59k| va_start(param, format); 153| 4.59k| _dropbear_log(priority, format, param); 154| 4.59k| va_end(param); 155| 4.59k|} m_close: 560| 1.84k|void m_close(int fd) { 561| 1.84k| int val; 562| | 563| 1.84k| if (fd < 0) { ------------------ | Branch (563:6): [True: 0, False: 1.84k] ------------------ 564| 0| return; 565| 0| } 566| | 567| 1.84k| do { 568| 1.84k| val = close(fd); ------------------ | | 56| 1.84k|#define close(fd) wrapfd_close(fd) ------------------ 569| 1.84k| } while (val < 0 && errno == EINTR); ------------------ | Branch (569:11): [True: 0, False: 1.84k] | Branch (569:22): [True: 0, False: 0] ------------------ 570| | 571| 1.84k| if (val < 0 && errno != EBADF) { ------------------ | Branch (571:6): [True: 0, False: 1.84k] | Branch (571:17): [True: 0, False: 0] ------------------ 572| | /* Linux says EIO can happen */ 573| 0| dropbear_exit("Error closing fd %d, %s", fd, strerror(errno)); 574| 0| } 575| 1.84k|} setnonblocking: 577| 7.99k|void setnonblocking(int fd) { 578| | 579| 7.99k| TRACE(("setnonblocking: %d", fd)) 580| | 581| 7.99k|#if DROPBEAR_FUZZ 582| 7.99k| if (fuzz.fuzzing) { ------------------ | Branch (582:6): [True: 7.99k, False: 0] ------------------ 583| 7.99k| return; 584| 7.99k| } 585| 0|#endif 586| | 587| 0| if (fcntl(fd, F_SETFL, O_NONBLOCK) < 0) { ------------------ | Branch (587:6): [True: 0, False: 0] ------------------ 588| 0| if (errno == ENODEV) { ------------------ | Branch (588:7): [True: 0, False: 0] ------------------ 589| | /* Some devices (like /dev/null redirected in) 590| | * can't be set to non-blocking */ 591| 0| TRACE(("ignoring ENODEV for setnonblocking")) 592| 0| } else { 593| 0| { 594| 0| dropbear_exit("Couldn't set nonblocking"); 595| 0| } 596| 0| } 597| 0| } 598| 0| TRACE(("leave setnonblocking")) 599| 0|} disallow_core: 601| 1|void disallow_core() { 602| 1| struct rlimit lim = {0}; 603| 1| if (getrlimit(RLIMIT_CORE, &lim) < 0) { ------------------ | Branch (603:6): [True: 0, False: 1] ------------------ 604| 0| TRACE(("getrlimit(RLIMIT_CORE) failed")); 605| 0| } 606| 1| lim.rlim_cur = 0; 607| 1| if (setrlimit(RLIMIT_CORE, &lim) < 0) { ------------------ | Branch (607:6): [True: 0, False: 1] ------------------ 608| 0| TRACE(("setrlimit(RLIMIT_CORE) failed")); 609| 0| } 610| 1|} expand_homedir_path: 638| 1|char * expand_homedir_path(const char *inpath) { 639| 1| struct passwd *pw = NULL; 640| 1| if (strncmp(inpath, "~/", 2) == 0) { ------------------ | Branch (640:6): [True: 0, False: 1] ------------------ 641| 0| char *homedir = getenv("HOME"); 642| | 643| 0| if (!homedir) { ------------------ | Branch (643:7): [True: 0, False: 0] ------------------ 644| 0| pw = getpwuid(getuid()); ------------------ | | 109| 0|#define getpwuid(x) fuzz_getpwuid(x) ------------------ 645| 0| if (pw) { ------------------ | Branch (645:8): [True: 0, False: 0] ------------------ 646| 0| homedir = pw->pw_dir; 647| 0| } 648| 0| } 649| | 650| 0| if (homedir) { ------------------ | Branch (650:7): [True: 0, False: 0] ------------------ 651| 0| int len = strlen(inpath)-2 + strlen(homedir) + 2; 652| 0| char *buf = m_malloc(len); 653| 0| snprintf(buf, len, "%s/%s", homedir, inpath+2); 654| 0| return buf; 655| 0| } 656| 0| } 657| | 658| | /* Fallback */ 659| 1| return m_strdup(inpath); 660| 1|} constant_time_memcmp: 663| 7.26k|{ 664| 7.26k| const char *xa = a, *xb = b; 665| 7.26k| uint8_t c = 0; 666| 7.26k| size_t i; 667| 239k| for (i = 0; i < n; i++) ------------------ | Branch (667:14): [True: 232k, False: 7.26k] ------------------ 668| 232k| { 669| 232k| c |= (xa[i] ^ xb[i]); 670| 232k| } 671| 7.26k| return c; 672| 7.26k|} gettime_wrapper: 675| 1.06M|void gettime_wrapper(struct timespec *now) { 676| 1.06M| struct timeval tv; 677| 1.06M|#if DROPBEAR_FUZZ 678| 1.06M| if (fuzz.fuzzing) { ------------------ | Branch (678:6): [True: 1.06M, False: 0] ------------------ 679| | /* time stands still when fuzzing */ 680| 1.06M| now->tv_sec = 5; 681| 1.06M| now->tv_nsec = 0; 682| 1.06M| } 683| 1.06M|#endif 684| | 685| 1.06M|#if defined(HAVE_CLOCK_GETTIME) && defined(CLOCK_MONOTONIC) 686| | /* POSIX monotonic clock. Newer Linux, BSD, MacOSX >10.12 */ 687| 1.06M| if (clock_gettime(CLOCK_MONOTONIC, now) == 0) { ------------------ | Branch (687:6): [True: 1.06M, False: 0] ------------------ 688| 1.06M| return; 689| 1.06M| } 690| 0|#endif 691| | 692| 0|#if defined(__linux__) && defined(SYS_clock_gettime) 693| 0| { 694| | /* Old linux toolchain - kernel might support it but not the build headers */ 695| | /* Also glibc <2.17 requires -lrt which we neglect to add */ 696| 0| static int linux_monotonic_failed = 0; 697| 0| if (!linux_monotonic_failed) { ------------------ | Branch (697:6): [True: 0, False: 0] ------------------ 698| | /* CLOCK_MONOTONIC isn't in some headers */ 699| 0| int clock_source_monotonic = 1; 700| 0| if (syscall(SYS_clock_gettime, clock_source_monotonic, now) == 0) { ------------------ | Branch (700:7): [True: 0, False: 0] ------------------ 701| 0| return; 702| 0| } else { 703| | /* Don't try again */ 704| 0| linux_monotonic_failed = 1; 705| 0| } 706| 0| } 707| 0| } 708| 0|#endif /* linux fallback clock_gettime */ 709| | 710| |#if defined(HAVE_MACH_ABSOLUTE_TIME) 711| | { 712| | /* OS X pre 10.12, see https://developer.apple.com/library/mac/qa/qa1398/_index.html */ 713| | static mach_timebase_info_data_t timebase_info; 714| | uint64_t scaled_time; 715| | if (timebase_info.denom == 0) { 716| | mach_timebase_info(&timebase_info); 717| | } 718| | scaled_time = mach_absolute_time() * timebase_info.numer / timebase_info.denom; 719| | now->tv_sec = scaled_time / 1000000000; 720| | now->tv_nsec = scaled_time % 1000000000; 721| | } 722| |#endif /* osx mach_absolute_time */ 723| | 724| | /* Fallback for everything else - this will sometimes go backwards */ 725| 0| gettimeofday(&tv, NULL); 726| 0| now->tv_sec = tv.tv_sec; 727| 0| now->tv_nsec = 1000*(long)tv.tv_usec; 728| 0|} monotonic_now: 731| 1.06M|time_t monotonic_now() { 732| 1.06M| struct timespec ts; 733| 1.06M| gettime_wrapper(&ts); 734| 1.06M| return ts.tv_sec; 735| 1.06M|} buf_get_dss_pub_key: 46| 1|int buf_get_dss_pub_key(buffer* buf, dropbear_dss_key *key) { 47| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 48| | 49| 1| TRACE(("enter buf_get_dss_pub_key")) 50| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 51| 1| m_mp_alloc_init_multi(&key->p, &key->q, &key->g, &key->y, NULL); 52| 1| key->x = NULL; 53| | 54| 1| buf_incrpos(buf, 4+SSH_SIGNKEY_DSS_LEN); /* int + "ssh-dss" */ ------------------ | | 111| 1|#define SSH_SIGNKEY_DSS_LEN 7 ------------------ 55| 1| if (buf_getmpint(buf, key->p) == DROPBEAR_FAILURE ------------------ | | 103| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (55:6): [True: 0, False: 1] ------------------ 56| 1| || buf_getmpint(buf, key->q) == DROPBEAR_FAILURE ------------------ | | 103| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (56:6): [True: 0, False: 1] ------------------ 57| 1| || buf_getmpint(buf, key->g) == DROPBEAR_FAILURE ------------------ | | 103| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (57:6): [True: 0, False: 1] ------------------ 58| 1| || buf_getmpint(buf, key->y) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (58:6): [True: 0, False: 1] ------------------ 59| 0| TRACE(("leave buf_get_dss_pub_key: failed reading mpints")) 60| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 61| 0| goto out; 62| 0| } 63| | 64| 1| if (mp_count_bits(key->p) != DSS_P_BITS) { ------------------ | | 44| 1|#define DSS_P_BITS 1024 ------------------ | Branch (64:6): [True: 0, False: 1] ------------------ 65| 0| dropbear_log(LOG_WARNING, "Bad DSS p"); 66| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 67| 0| goto out; 68| 0| } 69| | 70| 1| if (mp_count_bits(key->q) != DSS_Q_BITS) { ------------------ | | 45| 1|#define DSS_Q_BITS 160 ------------------ | Branch (70:6): [True: 0, False: 1] ------------------ 71| 0| dropbear_log(LOG_WARNING, "Bad DSS q"); 72| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 73| 0| goto out; 74| 0| } 75| | 76| | /* test 1 < g < p */ 77| 1| if (mp_cmp_d(key->g, 1) != MP_GT) { ------------------ | | 156| 1|#define MP_GT 1 /* greater than */ ------------------ | Branch (77:6): [True: 0, False: 1] ------------------ 78| 0| dropbear_log(LOG_WARNING, "Bad DSS g"); 79| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 80| 0| goto out; 81| 0| } 82| 1| if (mp_cmp(key->g, key->p) != MP_LT) { ------------------ | | 154| 1|#define MP_LT -1 /* less than */ ------------------ | Branch (82:6): [True: 0, False: 1] ------------------ 83| 0| dropbear_log(LOG_WARNING, "Bad DSS g"); 84| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 85| 0| goto out; 86| 0| } 87| | 88| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 89| 1| TRACE(("leave buf_get_dss_pub_key: success")) 90| 1|out: 91| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (91:6): [True: 0, False: 1] ------------------ 92| 0| m_mp_free_multi(&key->p, &key->q, &key->g, &key->y, NULL); 93| 0| } 94| 1| return ret; 95| 1|} buf_get_dss_priv_key: 100| 1|int buf_get_dss_priv_key(buffer* buf, dropbear_dss_key *key) { 101| | 102| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 103| | 104| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 105| | 106| 1| ret = buf_get_dss_pub_key(buf, key); 107| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (107:6): [True: 0, False: 1] ------------------ 108| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 109| 0| } 110| | 111| 1| m_mp_alloc_init_multi(&key->x, NULL); 112| 1| ret = buf_getmpint(buf, key->x); 113| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (113:6): [True: 0, False: 1] ------------------ 114| 0| m_mp_free_multi(&key->x, NULL); 115| 0| } 116| | 117| 1| return ret; 118| 1|} dss_key_free: 122| 1|void dss_key_free(dropbear_dss_key *key) { 123| | 124| 1| TRACE2(("enter dsa_key_free")) 125| 1| if (key == NULL) { ------------------ | Branch (125:6): [True: 1, False: 0] ------------------ 126| 1| TRACE2(("enter dsa_key_free: key == NULL")) 127| 1| return; 128| 1| } 129| 0| m_mp_free_multi(&key->p, &key->q, &key->g, &key->y, &key->x, NULL); 130| 0| m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 131| 0| TRACE2(("leave dsa_key_free")) 132| 0|} buf_put_dss_pub_key: 142| 16.4k|void buf_put_dss_pub_key(buffer* buf, const dropbear_dss_key *key) { 143| | 144| 16.4k| dropbear_assert(key != NULL); ------------------ | | 83| 16.4k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 16.4k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 145| 16.4k| buf_putstring(buf, SSH_SIGNKEY_DSS, SSH_SIGNKEY_DSS_LEN); ------------------ | | 110| 16.4k|#define SSH_SIGNKEY_DSS "ssh-dss" ------------------ buf_putstring(buf, SSH_SIGNKEY_DSS, SSH_SIGNKEY_DSS_LEN); ------------------ | | 111| 16.4k|#define SSH_SIGNKEY_DSS_LEN 7 ------------------ 146| 16.4k| buf_putmpint(buf, key->p); 147| 16.4k| buf_putmpint(buf, key->q); 148| 16.4k| buf_putmpint(buf, key->g); 149| 16.4k| buf_putmpint(buf, key->y); 150| | 151| 16.4k|} buf_put_dss_sign: 283| 8.21k|void buf_put_dss_sign(buffer* buf, const dropbear_dss_key *key, const buffer *data_buf) { 284| 8.21k| unsigned char msghash[SHA1_HASH_SIZE]; 285| 8.21k| unsigned int writelen; 286| 8.21k| unsigned int i; 287| 8.21k| size_t written; 288| 8.21k| DEF_MP_INT(dss_k); ------------------ | | 80| 8.21k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 289| 8.21k| DEF_MP_INT(dss_m); ------------------ | | 80| 8.21k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 290| 8.21k| DEF_MP_INT(dss_temp1); ------------------ | | 80| 8.21k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 291| 8.21k| DEF_MP_INT(dss_temp2); ------------------ | | 80| 8.21k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 292| 8.21k| DEF_MP_INT(dss_r); ------------------ | | 80| 8.21k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 293| 8.21k| DEF_MP_INT(dss_s); ------------------ | | 80| 8.21k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 294| 8.21k| hash_state hs; 295| | 296| 8.21k| TRACE(("enter buf_put_dss_sign")) 297| 8.21k| dropbear_assert(key != NULL); ------------------ | | 83| 8.21k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 8.21k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 298| | 299| | /* hash the data */ 300| 8.21k| sha1_init(&hs); 301| 8.21k| sha1_process(&hs, data_buf->data, data_buf->len); 302| 8.21k| sha1_done(&hs, msghash); 303| | 304| 8.21k| m_mp_init_multi(&dss_k, &dss_temp1, &dss_temp2, &dss_r, &dss_s, 305| 8.21k| &dss_m, NULL); 306| | /* the random number generator's input has included the private key which 307| | * avoids DSS's problem of private key exposure due to low entropy */ 308| 8.21k| gen_random_mpint(key->q, &dss_k); 309| | 310| | /* now generate the actual signature */ 311| 8.21k| bytes_to_mp(&dss_m, msghash, SHA1_HASH_SIZE); ------------------ | | 120| 8.21k|#define SHA1_HASH_SIZE 20 ------------------ 312| | 313| | /* g^k mod p */ 314| 8.21k| if (mp_exptmod(key->g, &dss_k, key->p, &dss_temp1) != MP_OKAY) { ------------------ | | 161| 8.21k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (314:6): [True: 0, False: 8.21k] ------------------ 315| 0| dropbear_exit("DSS error"); 316| 0| } 317| | /* r = (g^k mod p) mod q */ 318| 8.21k| if (mp_mod(&dss_temp1, key->q, &dss_r) != MP_OKAY) { ------------------ | | 161| 8.21k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (318:6): [True: 0, False: 8.21k] ------------------ 319| 0| dropbear_exit("DSS error"); 320| 0| } 321| | 322| | /* x*r mod q */ 323| 8.21k| if (mp_mulmod(&dss_r, key->x, key->q, &dss_temp1) != MP_OKAY) { ------------------ | | 161| 8.21k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (323:6): [True: 0, False: 8.21k] ------------------ 324| 0| dropbear_exit("DSS error"); 325| 0| } 326| | /* (SHA1(M) + xr) mod q) */ 327| 8.21k| if (mp_addmod(&dss_m, &dss_temp1, key->q, &dss_temp2) != MP_OKAY) { ------------------ | | 161| 8.21k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (327:6): [True: 0, False: 8.21k] ------------------ 328| 0| dropbear_exit("DSS error"); 329| 0| } 330| | 331| | /* (k^-1) mod q */ 332| 8.21k| if (mp_invmod(&dss_k, key->q, &dss_temp1) != MP_OKAY) { ------------------ | | 161| 8.21k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (332:6): [True: 0, False: 8.21k] ------------------ 333| 0| dropbear_exit("DSS error"); 334| 0| } 335| | 336| | /* s = (k^-1(SHA1(M) + xr)) mod q */ 337| 8.21k| if (mp_mulmod(&dss_temp1, &dss_temp2, key->q, &dss_s) != MP_OKAY) { ------------------ | | 161| 8.21k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (337:6): [True: 0, False: 8.21k] ------------------ 338| 0| dropbear_exit("DSS error"); 339| 0| } 340| | 341| 8.21k| buf_putstring(buf, SSH_SIGNKEY_DSS, SSH_SIGNKEY_DSS_LEN); ------------------ | | 110| 8.21k|#define SSH_SIGNKEY_DSS "ssh-dss" ------------------ buf_putstring(buf, SSH_SIGNKEY_DSS, SSH_SIGNKEY_DSS_LEN); ------------------ | | 111| 8.21k|#define SSH_SIGNKEY_DSS_LEN 7 ------------------ 342| 8.21k| buf_putint(buf, 2*SHA1_HASH_SIZE); ------------------ | | 120| 8.21k|#define SHA1_HASH_SIZE 20 ------------------ 343| | 344| 8.21k| writelen = mp_ubin_size(&dss_r); 345| 8.21k| dropbear_assert(writelen <= SHA1_HASH_SIZE); ------------------ | | 83| 8.21k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 8.21k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 346| | /* need to pad to 160 bits with leading zeros */ 347| 8.25k| for (i = 0; i < SHA1_HASH_SIZE - writelen; i++) { ------------------ | | 120| 8.25k|#define SHA1_HASH_SIZE 20 ------------------ | Branch (347:14): [True: 44, False: 8.21k] ------------------ 348| 44| buf_putbyte(buf, 0); 349| 44| } 350| 8.21k| if (mp_to_ubin(&dss_r, buf_getwriteptr(buf, writelen), writelen, &written) ------------------ | Branch (350:6): [True: 0, False: 8.21k] ------------------ 351| 8.21k| != MP_OKAY) { ------------------ | | 161| 8.21k|#define MP_OKAY 0 /* no error */ ------------------ 352| 0| dropbear_exit("DSS error"); 353| 0| } 354| 8.21k| mp_clear(&dss_r); 355| 8.21k| buf_incrwritepos(buf, written); 356| | 357| 8.21k| writelen = mp_ubin_size(&dss_s); 358| 8.21k| dropbear_assert(writelen <= SHA1_HASH_SIZE); ------------------ | | 83| 8.21k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 8.21k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 359| | /* need to pad to 160 bits with leading zeros */ 360| 8.26k| for (i = 0; i < SHA1_HASH_SIZE - writelen; i++) { ------------------ | | 120| 8.26k|#define SHA1_HASH_SIZE 20 ------------------ | Branch (360:14): [True: 51, False: 8.21k] ------------------ 361| 51| buf_putbyte(buf, 0); 362| 51| } 363| 8.21k| if (mp_to_ubin(&dss_s, buf_getwriteptr(buf, writelen), writelen, &written) ------------------ | Branch (363:6): [True: 0, False: 8.21k] ------------------ 364| 8.21k| != MP_OKAY) { ------------------ | | 161| 8.21k|#define MP_OKAY 0 /* no error */ ------------------ 365| 0| dropbear_exit("DSS error"); 366| 0| } 367| 8.21k| mp_clear(&dss_s); 368| 8.21k| buf_incrwritepos(buf, written); 369| | 370| 8.21k| mp_clear_multi(&dss_k, &dss_temp1, &dss_temp2, &dss_r, &dss_s, 371| 8.21k| &dss_m, NULL); 372| | 373| | /* create the signature to return */ 374| | 375| 8.21k| TRACE(("leave buf_put_dss_sign")) 376| 8.21k|} dropbear_ecc_fill_dp: 47| 1|void dropbear_ecc_fill_dp() { 48| 1| struct dropbear_ecc_curve **curve; 49| | /* libtomcrypt guarantees they're ordered by size */ 50| 1| const ltc_ecc_set_type *dp = ltc_ecc_sets; 51| 4| for (curve = dropbear_ecc_curves; *curve; curve++) { ------------------ | Branch (51:36): [True: 3, False: 1] ------------------ 52| 10| for (;dp->size > 0; dp++) { ------------------ | Branch (52:9): [True: 10, False: 0] ------------------ 53| 10| if (dp->size == (*curve)->ltc_size) { ------------------ | Branch (53:8): [True: 3, False: 7] ------------------ 54| 3| (*curve)->dp = dp; 55| 3| break; 56| 3| } 57| 10| } 58| 3| if (!(*curve)->dp) { ------------------ | Branch (58:7): [True: 0, False: 3] ------------------ 59| 0| dropbear_exit("Missing ECC params %s", (*curve)->name); 60| 0| } 61| 3| } 62| 1|} curve_for_dp: 64| 10.3k|struct dropbear_ecc_curve* curve_for_dp(const ltc_ecc_set_type *dp) { 65| 10.3k| struct dropbear_ecc_curve **curve = NULL; 66| 10.3k| for (curve = dropbear_ecc_curves; *curve; curve++) { ------------------ | Branch (66:36): [True: 10.3k, False: 0] ------------------ 67| 10.3k| if ((*curve)->dp == dp) { ------------------ | Branch (67:7): [True: 10.3k, False: 0] ------------------ 68| 10.3k| break; 69| 10.3k| } 70| 10.3k| } 71| 10.3k| assert(*curve); 72| 10.3k| return *curve; 73| 10.3k|} new_ecc_key: 75| 1|ecc_key * new_ecc_key(void) { 76| 1| ecc_key *key = m_malloc(sizeof(*key)); 77| 1| m_mp_alloc_init_multi((mp_int**)&key->pubkey.x, (mp_int**)&key->pubkey.y, 78| 1| (mp_int**)&key->pubkey.z, (mp_int**)&key->k, NULL); 79| 1| return key; 80| 1|} buf_put_ecc_raw_pubkey_string: 135| 6.87k|void buf_put_ecc_raw_pubkey_string(buffer *buf, ecc_key *key) { 136| 6.87k| unsigned long len = key->dp->size*2 + 1; 137| 6.87k| int err; 138| 6.87k| buf_putint(buf, len); 139| 6.87k| err = ecc_ansi_x963_export(key, buf_getwriteptr(buf, len), &len); 140| 6.87k| if (err != CRYPT_OK) { ------------------ | Branch (140:6): [True: 0, False: 6.87k] ------------------ 141| 0| dropbear_exit("ECC error"); 142| 0| } 143| 6.87k| buf_incrwritepos(buf, len); 144| 6.87k|} buf_get_ecc_raw_pubkey: 147| 332|ecc_key * buf_get_ecc_raw_pubkey(buffer *buf, const struct dropbear_ecc_curve *curve) { 148| 332| ecc_key *key = NULL; 149| 332| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 332|#define DROPBEAR_FAILURE -1 ------------------ 150| 332| const unsigned int size = curve->dp->size; 151| 332| unsigned char first; 152| | 153| 332| TRACE(("enter buf_get_ecc_raw_pubkey")) 154| | 155| 332| buf_setpos(buf, 0); 156| 332| first = buf_getbyte(buf); 157| 332| if (first == 2 || first == 3) { ------------------ | Branch (157:6): [True: 11, False: 321] | Branch (157:20): [True: 122, False: 199] ------------------ 158| 132| dropbear_log(LOG_WARNING, "Dropbear doesn't support ECC point compression"); 159| 132| return NULL; 160| 132| } 161| 200| if (first != 4 || buf->len != 1+2*size) { ------------------ | Branch (161:6): [True: 182, False: 18] | Branch (161:20): [True: 17, False: 1] ------------------ 162| 198| TRACE(("leave, wrong size")) 163| 198| return NULL; 164| 198| } 165| | 166| 2| key = new_ecc_key(); 167| 2| key->dp = curve->dp; 168| | 169| 2| if (mp_from_ubin(key->pubkey.x, buf_getptr(buf, size), size) != MP_OKAY) { ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (169:6): [True: 0, False: 2] ------------------ 170| 0| TRACE(("failed to read x")) 171| 0| goto out; 172| 0| } 173| 2| buf_incrpos(buf, size); 174| | 175| 2| if (mp_from_ubin(key->pubkey.y, buf_getptr(buf, size), size) != MP_OKAY) { ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (175:6): [True: 0, False: 2] ------------------ 176| 0| TRACE(("failed to read y")) 177| 0| goto out; 178| 0| } 179| 2| buf_incrpos(buf, size); 180| | 181| 2| mp_set(key->pubkey.z, 1); 182| | 183| 2| if (ecc_is_point(key) != CRYPT_OK) { ------------------ | Branch (183:6): [True: 0, False: 2] ------------------ 184| 0| TRACE(("failed, not a point")) 185| 0| goto out; 186| 0| } 187| | 188| | /* SEC1 3.2.3.1 Check that Q != 0 */ 189| 2| if (mp_cmp_d(key->pubkey.x, 0) == LTC_MP_EQ) { ------------------ | | 13| 2|#define LTC_MP_EQ 0 ------------------ | Branch (189:6): [True: 0, False: 2] ------------------ 190| 0| TRACE(("failed, x == 0")) 191| 0| goto out; 192| 0| } 193| 2| if (mp_cmp_d(key->pubkey.y, 0) == LTC_MP_EQ) { ------------------ | | 13| 2|#define LTC_MP_EQ 0 ------------------ | Branch (193:6): [True: 0, False: 2] ------------------ 194| 0| TRACE(("failed, y == 0")) 195| 0| goto out; 196| 0| } 197| | 198| 2| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 2|#define DROPBEAR_SUCCESS 0 ------------------ 199| | 200| 2| out: 201| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (201:6): [True: 0, False: 1] ------------------ 202| 0| if (key) { ------------------ | Branch (202:7): [True: 0, False: 0] ------------------ 203| 0| ecc_free(key); 204| 0| m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 205| 0| key = NULL; 206| 0| } 207| 0| } 208| | 209| 1| return key; 210| | 211| 2|} ecc.c:ecc_is_point: 85| 1|{ 86| 1| mp_int *prime, *b, *t1, *t2; 87| 1| int err; 88| | 89| 1| m_mp_alloc_init_multi(&prime, &b, &t1, &t2, NULL); 90| | 91| | /* load prime and b */ 92| 1| if ((err = mp_read_radix(prime, key->dp->prime, 16)) != CRYPT_OK) { goto error; } ------------------ | Branch (92:6): [True: 0, False: 1] ------------------ 93| 1| if ((err = mp_read_radix(b, key->dp->B, 16)) != CRYPT_OK) { goto error; } ------------------ | Branch (93:6): [True: 0, False: 1] ------------------ 94| | 95| | /* compute y^2 */ 96| 1| if ((err = mp_sqr(key->pubkey.y, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (96:6): [True: 0, False: 1] ------------------ 97| | 98| | /* compute x^3 */ 99| 1| if ((err = mp_sqr(key->pubkey.x, t2)) != CRYPT_OK) { goto error; } ------------------ | Branch (99:6): [True: 0, False: 1] ------------------ 100| 1| if ((err = mp_mod(t2, prime, t2)) != CRYPT_OK) { goto error; } ------------------ | Branch (100:6): [True: 0, False: 1] ------------------ 101| 1| if ((err = mp_mul(key->pubkey.x, t2, t2)) != CRYPT_OK) { goto error; } ------------------ | Branch (101:6): [True: 0, False: 1] ------------------ 102| | 103| | /* compute y^2 - x^3 */ 104| 1| if ((err = mp_sub(t1, t2, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (104:6): [True: 0, False: 1] ------------------ 105| | 106| | /* compute y^2 - x^3 + 3x */ 107| 1| if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (107:6): [True: 0, False: 1] ------------------ 108| 1| if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (108:6): [True: 0, False: 1] ------------------ 109| 1| if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (109:6): [True: 0, False: 1] ------------------ 110| 1| if ((err = mp_mod(t1, prime, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (110:6): [True: 0, False: 1] ------------------ 111| 1| while (mp_cmp_d(t1, 0) == LTC_MP_LT) { ------------------ | | 12| 1|#define LTC_MP_LT -1 ------------------ | Branch (111:9): [True: 0, False: 1] ------------------ 112| 0| if ((err = mp_add(t1, prime, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (112:7): [True: 0, False: 0] ------------------ 113| 0| } 114| 1| while (mp_cmp(t1, prime) != LTC_MP_LT) { ------------------ | | 12| 1|#define LTC_MP_LT -1 ------------------ | Branch (114:9): [True: 0, False: 1] ------------------ 115| 0| if ((err = mp_sub(t1, prime, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (115:7): [True: 0, False: 0] ------------------ 116| 0| } 117| | 118| | /* compare to b */ 119| 1| if (mp_cmp(t1, b) != LTC_MP_EQ) { ------------------ | | 13| 1|#define LTC_MP_EQ 0 ------------------ | Branch (119:6): [True: 0, False: 1] ------------------ 120| 0| err = CRYPT_INVALID_PACKET; 121| 1| } else { 122| 1| err = CRYPT_OK; 123| 1| } 124| | 125| 1| error: 126| 1| mp_clear_multi(prime, b, t1, t2, NULL); 127| 1| m_free(prime); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 128| 1| m_free(b); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 129| 1| m_free(t1); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 130| 1| m_free(t2); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 131| 1| return err; 132| 1|} signkey_is_ecdsa: 11| 50.9k|{ 12| 50.9k| return type == DROPBEAR_SIGNKEY_ECDSA_NISTP256 ------------------ | Branch (12:9): [True: 10.3k, False: 40.6k] ------------------ 13| 50.9k| || type == DROPBEAR_SIGNKEY_ECDSA_NISTP384 ------------------ | Branch (13:6): [True: 1, False: 40.6k] ------------------ 14| 50.9k| || type == DROPBEAR_SIGNKEY_ECDSA_NISTP521; ------------------ | Branch (14:6): [True: 1, False: 40.6k] ------------------ 15| 50.9k|} buf_get_ecdsa_pub_key: 77| 1|ecc_key *buf_get_ecdsa_pub_key(buffer* buf) { 78| 1| unsigned char *key_ident = NULL, *identifier = NULL; 79| 1| unsigned int key_ident_len, identifier_len; 80| 1| buffer *q_buf = NULL; 81| 1| struct dropbear_ecc_curve **curve; 82| 1| ecc_key *new_key = NULL; 83| | 84| | /* string "ecdsa-sha2-[identifier]" or "sk-ecdsa-sha2-nistp256@openssh.com" */ 85| 1| key_ident = (unsigned char*)buf_getstring(buf, &key_ident_len); 86| | /* string "[identifier]" */ 87| 1| identifier = (unsigned char*)buf_getstring(buf, &identifier_len); 88| | 89| 1| if (strcmp (key_ident, "sk-ecdsa-sha2-nistp256@openssh.com") == 0) { ------------------ | Branch (89:6): [True: 0, False: 1] ------------------ 90| 0| if (strcmp (identifier, "nistp256") != 0) { ------------------ | Branch (90:7): [True: 0, False: 0] ------------------ 91| 0| TRACE(("mismatching identifiers")) 92| 0| goto out; 93| 0| } 94| 1| } else { 95| 1| if (key_ident_len != identifier_len + strlen ("ecdsa-sha2-")) { ------------------ | Branch (95:7): [True: 0, False: 1] ------------------ 96| 0| TRACE(("Bad identifier lengths")) 97| 0| goto out; 98| 0| } 99| 1| if (memcmp(&key_ident[strlen ("ecdsa-sha2-")], identifier, identifier_len) != 0) { ------------------ | Branch (99:7): [True: 0, False: 1] ------------------ 100| 0| TRACE(("mismatching identifiers")) 101| 0| goto out; 102| 0| } 103| 1| } 104| | 105| 1| for (curve = dropbear_ecc_curves; *curve; curve++) { ------------------ | Branch (105:36): [True: 1, False: 0] ------------------ 106| 1| if (memcmp(identifier, (char*)(*curve)->name, strlen((char*)(*curve)->name)) == 0) { ------------------ | Branch (106:7): [True: 1, False: 0] ------------------ 107| 1| break; 108| 1| } 109| 1| } 110| 1| if (!*curve) { ------------------ | Branch (110:6): [True: 0, False: 1] ------------------ 111| 0| TRACE(("couldn't match ecc curve")) 112| 0| goto out; 113| 0| } 114| | 115| | /* string Q */ 116| 1| q_buf = buf_getstringbuf(buf); 117| 1| new_key = buf_get_ecc_raw_pubkey(q_buf, *curve); 118| | 119| 1|out: 120| 1| m_free(key_ident); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 121| 1| m_free(identifier); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 122| 1| if (q_buf) { ------------------ | Branch (122:6): [True: 1, False: 0] ------------------ 123| 1| buf_free(q_buf); 124| 1| q_buf = NULL; 125| 1| } 126| 1| TRACE(("leave buf_get_ecdsa_pub_key")) 127| 1| return new_key; 128| 1|} buf_get_ecdsa_priv_key: 130| 1|ecc_key *buf_get_ecdsa_priv_key(buffer *buf) { 131| 1| ecc_key *new_key = NULL; 132| 1| TRACE(("enter buf_get_ecdsa_priv_key")) 133| 1| new_key = buf_get_ecdsa_pub_key(buf); 134| 1| if (!new_key) { ------------------ | Branch (134:6): [True: 0, False: 1] ------------------ 135| 0| return NULL; 136| 0| } 137| | 138| 1| if (buf_getmpint(buf, new_key->k) != DROPBEAR_SUCCESS) { ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (138:6): [True: 0, False: 1] ------------------ 139| 0| ecc_free(new_key); 140| 0| m_free(new_key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 141| 0| return NULL; 142| 0| } 143| | 144| 1| return new_key; 145| 1|} buf_put_ecdsa_pub_key: 147| 6.87k|void buf_put_ecdsa_pub_key(buffer *buf, ecc_key *key) { 148| 6.87k| struct dropbear_ecc_curve *curve = NULL; 149| 6.87k| char key_ident[30]; 150| | 151| 6.87k| curve = curve_for_dp(key->dp); 152| 6.87k| snprintf(key_ident, sizeof(key_ident), "ecdsa-sha2-%s", curve->name); 153| 6.87k| buf_putstring(buf, key_ident, strlen(key_ident)); 154| 6.87k| buf_putstring(buf, curve->name, strlen(curve->name)); 155| 6.87k| buf_put_ecc_raw_pubkey_string(buf, key); 156| 6.87k|} buf_put_ecdsa_sign: 163| 3.43k|void buf_put_ecdsa_sign(buffer *buf, const ecc_key *key, const buffer *data_buf) { 164| | /* Based on libtomcrypt's ecc_sign_hash but without the asn1 */ 165| 3.43k| int err = DROPBEAR_FAILURE; ------------------ | | 103| 3.43k|#define DROPBEAR_FAILURE -1 ------------------ 166| 3.43k| struct dropbear_ecc_curve *curve = NULL; 167| 3.43k| hash_state hs; 168| 3.43k| unsigned char hash[64]; 169| 3.43k| void *e = NULL, *p = NULL, *s = NULL, *r; 170| 3.43k| char key_ident[30]; 171| 3.43k| buffer *sigbuf = NULL; 172| | 173| 3.43k| TRACE(("buf_put_ecdsa_sign")) 174| 3.43k| curve = curve_for_dp(key->dp); 175| | 176| 3.43k| if (ltc_init_multi(&r, &s, &p, &e, NULL) != CRYPT_OK) { ------------------ | Branch (176:6): [True: 0, False: 3.43k] ------------------ 177| 0| goto out; 178| 0| } 179| | 180| 3.43k| curve->hash_desc->init(&hs); 181| 3.43k| curve->hash_desc->process(&hs, data_buf->data, data_buf->len); 182| 3.43k| curve->hash_desc->done(&hs, hash); 183| | 184| 3.43k| if (ltc_mp.unsigned_read(e, hash, curve->hash_desc->hashsize) != CRYPT_OK) { ------------------ | Branch (184:6): [True: 0, False: 3.43k] ------------------ 185| 0| goto out; 186| 0| } 187| | 188| 3.43k| if (ltc_mp.read_radix(p, (char *)key->dp->order, 16) != CRYPT_OK) { ------------------ | Branch (188:6): [True: 0, False: 3.43k] ------------------ 189| 0| goto out; 190| 0| } 191| | 192| 3.43k| for (;;) { 193| 3.43k| ecc_key R_key; /* ephemeral key */ 194| 3.43k| if (ecc_make_key_ex(NULL, dropbear_ltc_prng, &R_key, key->dp) != CRYPT_OK) { ------------------ | Branch (194:7): [True: 0, False: 3.43k] ------------------ 195| 0| goto out; 196| 0| } 197| 3.43k| if (ltc_mp.mpdiv(R_key.pubkey.x, p, NULL, r) != CRYPT_OK) { ------------------ | Branch (197:7): [True: 0, False: 3.43k] ------------------ 198| 0| goto out; 199| 0| } 200| 3.43k| if (ltc_mp.compare_d(r, 0) == LTC_MP_EQ) { ------------------ | | 13| 3.43k|#define LTC_MP_EQ 0 ------------------ | Branch (200:7): [True: 0, False: 3.43k] ------------------ 201| | /* try again */ 202| 0| ecc_free(&R_key); 203| 0| continue; 204| 0| } 205| | /* k = 1/k */ 206| 3.43k| if (ltc_mp.invmod(R_key.k, p, R_key.k) != CRYPT_OK) { ------------------ | Branch (206:7): [True: 0, False: 3.43k] ------------------ 207| 0| goto out; 208| 0| } 209| | /* s = xr */ 210| 3.43k| if (ltc_mp.mulmod(key->k, r, p, s) != CRYPT_OK) { ------------------ | Branch (210:7): [True: 0, False: 3.43k] ------------------ 211| 0| goto out; 212| 0| } 213| | /* s = e + xr */ 214| 3.43k| if (ltc_mp.add(e, s, s) != CRYPT_OK) { ------------------ | Branch (214:7): [True: 0, False: 3.43k] ------------------ 215| 0| goto out; 216| 0| } 217| 3.43k| if (ltc_mp.mpdiv(s, p, NULL, s) != CRYPT_OK) { ------------------ | Branch (217:7): [True: 0, False: 3.43k] ------------------ 218| 0| goto out; 219| 0| } 220| | /* s = (e + xr)/k */ 221| 3.43k| if (ltc_mp.mulmod(s, R_key.k, p, s) != CRYPT_OK) { ------------------ | Branch (221:7): [True: 0, False: 3.43k] ------------------ 222| 0| goto out; 223| 0| } 224| 3.43k| ecc_free(&R_key); 225| | 226| 3.43k| if (ltc_mp.compare_d(s, 0) != LTC_MP_EQ) { ------------------ | | 13| 3.43k|#define LTC_MP_EQ 0 ------------------ | Branch (226:7): [True: 3.43k, False: 0] ------------------ 227| 3.43k| break; 228| 3.43k| } 229| 3.43k| } 230| | 231| 3.43k| snprintf(key_ident, sizeof(key_ident), "ecdsa-sha2-%s", curve->name); 232| 3.43k| buf_putstring(buf, key_ident, strlen(key_ident)); 233| | /* enough for nistp521 */ 234| 3.43k| sigbuf = buf_new(200); 235| 3.43k| buf_putmpint(sigbuf, (mp_int*)r); 236| 3.43k| buf_putmpint(sigbuf, (mp_int*)s); 237| 3.43k| buf_putbufstring(buf, sigbuf); 238| | 239| 3.43k| err = DROPBEAR_SUCCESS; ------------------ | | 102| 3.43k|#define DROPBEAR_SUCCESS 0 ------------------ 240| | 241| 3.43k|out: 242| 3.43k| if (r && s && p && e) { ------------------ | Branch (242:6): [True: 3.43k, False: 0] | Branch (242:11): [True: 3.43k, False: 0] | Branch (242:16): [True: 3.43k, False: 0] | Branch (242:21): [True: 3.43k, False: 0] ------------------ 243| 3.43k| ltc_deinit_multi(r, s, p, e, NULL); 244| 3.43k| } 245| | 246| 3.43k| if (sigbuf) { ------------------ | Branch (246:6): [True: 3.43k, False: 0] ------------------ 247| 3.43k| buf_free(sigbuf); 248| 3.43k| } 249| | 250| 3.43k| if (err == DROPBEAR_FAILURE) { ------------------ | | 103| 3.43k|#define DROPBEAR_FAILURE -1 ------------------ | Branch (250:6): [True: 0, False: 3.43k] ------------------ 251| 0| dropbear_exit("ECC error"); 252| 0| } 253| 3.43k|} buf_get_ed25519_priv_key: 78| 1|int buf_get_ed25519_priv_key(buffer *buf, dropbear_ed25519_key *key) { 79| | 80| 1| unsigned int len; 81| | 82| 1| TRACE(("enter buf_get_ed25519_priv_key")) 83| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 84| | 85| 1| buf_incrpos(buf, 4+SSH_SIGNKEY_ED25519_LEN); /* int + "ssh-ed25519" */ ------------------ | | 115| 1|#define SSH_SIGNKEY_ED25519_LEN 11 ------------------ 86| | 87| 1| len = buf_getint(buf); 88| 1| if (len != CURVE25519_LEN*2 || buf->len - buf->pos < len) { ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ | Branch (88:6): [True: 0, False: 1] | Branch (88:33): [True: 0, False: 1] ------------------ 89| 0| TRACE(("leave buf_get_ed25519_priv_key: failure")) 90| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 91| 0| } 92| | 93| 1| memcpy(key->priv, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ memcpy(key->priv, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 94| 1| buf_incrpos(buf, CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 95| 1| memcpy(key->pub, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ memcpy(key->pub, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 96| 1| buf_incrpos(buf, CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 97| | 98| 1| TRACE(("leave buf_get_ed25519_priv_key: success")) 99| 1| return DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 100| 1|} ed25519_key_free: 103| 1|void ed25519_key_free(dropbear_ed25519_key *key) { 104| | 105| 1| TRACE2(("enter ed25519_key_free")) 106| | 107| 1| if (key == NULL) { ------------------ | Branch (107:6): [True: 1, False: 0] ------------------ 108| 1| TRACE2(("leave ed25519_key_free: key == NULL")) 109| 1| return; 110| 1| } 111| 0| m_burn(key->priv, CURVE25519_LEN); ------------------ | | 34| 0|#define CURVE25519_LEN 32 ------------------ 112| 0| m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 113| | 114| 0| TRACE2(("leave ed25519_key_free")) 115| 0|} buf_put_ed25519_pub_key: 118| 2.00k|void buf_put_ed25519_pub_key(buffer *buf, const dropbear_ed25519_key *key) { 119| | 120| 2.00k| TRACE(("enter buf_put_ed25519_pub_key")) 121| 2.00k| dropbear_assert(key != NULL); ------------------ | | 83| 2.00k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 2.00k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 122| | 123| 2.00k| buf_putstring(buf, SSH_SIGNKEY_ED25519, SSH_SIGNKEY_ED25519_LEN); ------------------ | | 114| 2.00k|#define SSH_SIGNKEY_ED25519 "ssh-ed25519" ------------------ buf_putstring(buf, SSH_SIGNKEY_ED25519, SSH_SIGNKEY_ED25519_LEN); ------------------ | | 115| 2.00k|#define SSH_SIGNKEY_ED25519_LEN 11 ------------------ 124| 2.00k| buf_putstring(buf, key->pub, CURVE25519_LEN); ------------------ | | 34| 2.00k|#define CURVE25519_LEN 32 ------------------ 125| | 126| 2.00k| TRACE(("leave buf_put_ed25519_pub_key")) 127| 2.00k|} buf_put_ed25519_sign: 145| 995|void buf_put_ed25519_sign(buffer* buf, const dropbear_ed25519_key *key, const buffer *data_buf) { 146| | 147| 995| unsigned char s[64]; 148| 995| unsigned long slen = sizeof(s); 149| | 150| 995| TRACE(("enter buf_put_ed25519_sign")) 151| 995| dropbear_assert(key != NULL); ------------------ | | 83| 995|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 995] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 152| | 153| 995| dropbear_ed25519_sign(data_buf->data, data_buf->len, s, &slen, key->priv, key->pub); 154| 995| buf_putstring(buf, SSH_SIGNKEY_ED25519, SSH_SIGNKEY_ED25519_LEN); ------------------ | | 114| 995|#define SSH_SIGNKEY_ED25519 "ssh-ed25519" ------------------ buf_putstring(buf, SSH_SIGNKEY_ED25519, SSH_SIGNKEY_ED25519_LEN); ------------------ | | 115| 995|#define SSH_SIGNKEY_ED25519_LEN 11 ------------------ 155| 995| buf_putstring(buf, s, slen); 156| | 157| 995| TRACE(("leave buf_put_ed25519_sign")) 158| 995|} listeners_initialise: 30| 3.99k|void listeners_initialise() { 31| | 32| | /* just one slot to start with */ 33| 3.99k| ses.listeners = (struct Listener**)m_malloc(sizeof(struct Listener*)); 34| 3.99k| ses.listensize = 1; 35| 3.99k| ses.listeners[0] = NULL; 36| | 37| 3.99k|} set_listener_fds: 39| 411k|void set_listener_fds(fd_set * readfds) { 40| | 41| 411k| unsigned int i, j; 42| 411k| struct Listener *listener; 43| | 44| | /* check each in turn */ 45| 823k| for (i = 0; i < ses.listensize; i++) { ------------------ | Branch (45:14): [True: 411k, False: 411k] ------------------ 46| 411k| listener = ses.listeners[i]; 47| 411k| if (listener != NULL) { ------------------ | Branch (47:7): [True: 0, False: 411k] ------------------ 48| 0| for (j = 0; j < listener->nsocks; j++) { ------------------ | Branch (48:16): [True: 0, False: 0] ------------------ 49| 0| FD_SET(listener->socks[j], readfds); 50| 0| } 51| 0| } 52| 411k| } 53| 411k|} handle_listeners: 56| 407k|void handle_listeners(const fd_set * readfds) { 57| | 58| 407k| unsigned int i, j; 59| 407k| struct Listener *listener; 60| 407k| int sock; 61| | 62| | /* check each in turn */ 63| 815k| for (i = 0; i < ses.listensize; i++) { ------------------ | Branch (63:14): [True: 407k, False: 407k] ------------------ 64| 407k| listener = ses.listeners[i]; 65| 407k| if (listener != NULL) { ------------------ | Branch (65:7): [True: 0, False: 407k] ------------------ 66| 0| for (j = 0; j < listener->nsocks; j++) { ------------------ | Branch (66:16): [True: 0, False: 0] ------------------ 67| 0| sock = listener->socks[j]; 68| 0| if (FD_ISSET(sock, readfds)) { 69| 0| listener->acceptor(listener, sock); 70| 0| } 71| 0| } 72| 0| } 73| 407k| } 74| 407k|} /* Woo brace matching */ remove_all_listeners: 166| 3.99k|void remove_all_listeners(void) { 167| 3.99k| unsigned int i; 168| 7.99k| for (i = 0; i < ses.listensize; i++) { ------------------ | Branch (168:14): [True: 3.99k, False: 3.99k] ------------------ 169| 3.99k| if (ses.listeners[i]) { ------------------ | Branch (169:7): [True: 0, False: 3.99k] ------------------ 170| 0| remove_listener(ses.listeners[i]); 171| 0| } 172| 3.99k| } 173| 3.99k| m_free(ses.listeners); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 174| 3.99k|} dropbear_prng_read: 70| 3.76k|{ 71| 3.76k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 3.76k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.76k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 72| 3.76k| genrandom(out, outlen); 73| 3.76k| return outlen; 74| 3.76k|} remove_connect_pending: 228| 3.99k|void remove_connect_pending() { 229| 3.99k| while (ses.conn_pending.first) { ------------------ | Branch (229:9): [True: 0, False: 3.99k] ------------------ 230| 0| struct dropbear_progress_connection *c = ses.conn_pending.first->item; 231| 0| remove_connect(c, ses.conn_pending.first); 232| 0| } 233| 3.99k|} set_connect_fds: 236| 411k|void set_connect_fds(fd_set *writefd) { 237| 411k| m_list_elem *iter; 238| 411k| iter = ses.conn_pending.first; 239| 411k| while (iter) { ------------------ | Branch (239:9): [True: 0, False: 411k] ------------------ 240| 0| m_list_elem *next_iter = iter->next; 241| 0| struct dropbear_progress_connection *c = iter->item; 242| | /* Set one going */ 243| 0| while (c->res_iter && c->sock < 0) { ------------------ | Branch (243:10): [True: 0, False: 0] | Branch (243:25): [True: 0, False: 0] ------------------ 244| 0| connect_try_next(c); 245| 0| } 246| 0| if (c->sock >= 0) { ------------------ | Branch (246:7): [True: 0, False: 0] ------------------ 247| 0| FD_SET(c->sock, writefd); 248| 0| } else { 249| | /* Final failure */ 250| 0| if (!c->errstring) { ------------------ | Branch (250:8): [True: 0, False: 0] ------------------ 251| 0| c->errstring = m_strdup("unexpected failure"); 252| 0| } 253| 0| c->cb(DROPBEAR_FAILURE, -1, c->cb_data, c->errstring); ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 254| 0| remove_connect(c, iter); 255| 0| } 256| 0| iter = next_iter; 257| 0| } 258| 411k|} handle_connect_fds: 260| 407k|void handle_connect_fds(const fd_set *writefd) { 261| 407k| m_list_elem *iter; 262| 407k| for (iter = ses.conn_pending.first; iter; iter = iter->next) { ------------------ | Branch (262:38): [True: 0, False: 407k] ------------------ 263| 0| int val; 264| 0| socklen_t vallen = sizeof(val); 265| 0| struct dropbear_progress_connection *c = iter->item; 266| | 267| 0| if (c->sock < 0 || !FD_ISSET(c->sock, writefd)) { ------------------ | Branch (267:7): [True: 0, False: 0] | Branch (267:22): [True: 0, False: 0] ------------------ 268| 0| continue; 269| 0| } 270| | 271| 0| TRACE(("handling %s port %s socket %d", c->remotehost, c->remoteport, c->sock)); 272| | 273| 0| if (getsockopt(c->sock, SOL_SOCKET, SO_ERROR, &val, &vallen) != 0) { ------------------ | Branch (273:7): [True: 0, False: 0] ------------------ 274| 0| TRACE(("handle_connect_fds getsockopt(%d) SO_ERROR failed: %s", c->sock, strerror(errno))) 275| | /* This isn't expected to happen - Unix has surprises though, continue gracefully. */ 276| 0| m_close(c->sock); 277| 0| c->sock = -1; 278| 0| } else if (val != 0) { ------------------ | Branch (278:14): [True: 0, False: 0] ------------------ 279| | /* Connect failed */ 280| 0| TRACE(("connect to %s port %s failed.", c->remotehost, c->remoteport)) 281| 0| m_close(c->sock); 282| 0| c->sock = -1; 283| | 284| 0| m_free(c->errstring); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 285| 0| c->errstring = m_strdup(strerror(val)); 286| 0| } else { 287| | /* New connection has been established */ 288| 0| c->cb(DROPBEAR_SUCCESS, c->sock, c->cb_data, NULL); ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ 289| 0| remove_connect(c, iter); 290| 0| TRACE(("leave handle_connect_fds - success")) 291| | /* Must return here - remove_connect() invalidates iter */ 292| 0| return; 293| 0| } 294| 0| } 295| 407k|} packet_queue_to_iovec: 301| 73.9k|void packet_queue_to_iovec(const struct Queue *queue, struct iovec *iov, unsigned int *iov_count) { 302| 73.9k| struct Link *l; 303| 73.9k| unsigned int i; 304| 73.9k| int len; 305| 73.9k| buffer *writebuf; 306| | 307| |#ifndef IOV_MAX 308| | #if defined(__CYGWIN__) && !defined(UIO_MAXIOV) 309| | #define IOV_MAX 1024 310| | #elif defined(__sgi) 311| | #define IOV_MAX 512 312| | #else 313| | #define IOV_MAX UIO_MAXIOV 314| | #endif 315| |#endif 316| | 317| 73.9k| *iov_count = MIN(MIN(queue->count, IOV_MAX), *iov_count); 318| | 319| 168k| for (l = queue->head, i = 0; i < *iov_count; l = l->link, i++) ------------------ | Branch (319:31): [True: 94.8k, False: 73.9k] ------------------ 320| 94.8k| { 321| 94.8k| writebuf = (buffer*)l->item; 322| 94.8k| len = writebuf->len - writebuf->pos; 323| 94.8k| dropbear_assert(len > 0); ------------------ | | 83| 94.8k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 94.8k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 324| 94.8k| TRACE2(("write_packet writev #%d len %d/%d", i, 325| 94.8k| len, writebuf->len)) 326| 94.8k| iov[i].iov_base = buf_getptr(writebuf, len); 327| 94.8k| iov[i].iov_len = len; 328| 94.8k| } 329| 73.9k|} packet_queue_consume: 331| 73.9k|void packet_queue_consume(struct Queue *queue, ssize_t written) { 332| 73.9k| buffer *writebuf; 333| 73.9k| int len; 334| 147k| while (written > 0) { ------------------ | Branch (334:9): [True: 73.9k, False: 73.9k] ------------------ 335| 73.9k| writebuf = (buffer*)examine(queue); 336| 73.9k| len = writebuf->len - writebuf->pos; 337| 73.9k| if (len > written) { ------------------ | Branch (337:7): [True: 0, False: 73.9k] ------------------ 338| | /* partial buffer write */ 339| 0| buf_incrpos(writebuf, written); 340| 0| written = 0; 341| 73.9k| } else { 342| 73.9k| written -= len; 343| 73.9k| dequeue(queue); 344| 73.9k| buf_free(writebuf); 345| 73.9k| } 346| 73.9k| } 347| 73.9k|} set_sock_priority: 367| 3.99k|void set_sock_priority(int sock, enum dropbear_prio prio) { 368| | 369| 3.99k| int rc; 370| 3.99k| int val; 371| | 372| 3.99k|#if DROPBEAR_FUZZ 373| 3.99k| if (fuzz.fuzzing) { ------------------ | Branch (373:6): [True: 3.99k, False: 0] ------------------ 374| 3.99k| TRACE(("fuzzing skips set_sock_prio")) 375| 3.99k| return; 376| 3.99k| } 377| 0|#endif 378| | /* Don't log ENOTSOCK errors so that this can harmlessly be called 379| | * on a client '-J' proxy pipe */ 380| | 381| 0| if (opts.disable_ip_tos == 0) { ------------------ | Branch (381:6): [True: 0, False: 0] ------------------ 382| 0|#ifdef IP_TOS 383| | /* Set the DSCP field for outbound IP packet priority. 384| | rfc4594 has some guidance to meanings. 385| | 386| | We set AF21 as "Low-Latency" class for interactive (tty session, 387| | also handshake/setup packets). Other traffic is left at the default. 388| | 389| | OpenSSH at present uses AF21/CS1, rationale 390| | https://cvsweb.openbsd.org/src/usr.bin/ssh/readconf.c#rev1.284 391| | 392| | Old Dropbear/OpenSSH and Debian/Ubuntu OpenSSH (at Jan 2022) use 393| | IPTOS_LOWDELAY/IPTOS_THROUGHPUT 394| | 395| | DSCP constants are from Linux headers, applicable to other platforms 396| | such as macos. 397| | */ 398| 0| if (prio == DROPBEAR_PRIO_LOWDELAY) { ------------------ | Branch (398:6): [True: 0, False: 0] ------------------ 399| 0| val = 0x48; /* IPTOS_DSCP_AF21 */ 400| 0| } else { 401| 0| val = 0; /* default */ 402| 0| } 403| 0|#if defined(IPPROTO_IPV6) && defined(IPV6_TCLASS) 404| 0| rc = setsockopt(sock, IPPROTO_IPV6, IPV6_TCLASS, (void*)&val, sizeof(val)); 405| 0| if (rc < 0 && errno != ENOTSOCK) { ------------------ | Branch (405:6): [True: 0, False: 0] | Branch (405:16): [True: 0, False: 0] ------------------ 406| 0| TRACE(("Couldn't set IPV6_TCLASS (%s)", strerror(errno))); 407| 0| } 408| 0|#endif 409| 0| rc = setsockopt(sock, IPPROTO_IP, IP_TOS, (void*)&val, sizeof(val)); 410| 0| if (rc < 0 && errno != ENOTSOCK) { ------------------ | Branch (410:6): [True: 0, False: 0] | Branch (410:16): [True: 0, False: 0] ------------------ 411| 0| TRACE(("Couldn't set IP_TOS (%s)", strerror(errno))); 412| 0| } 413| 0|#endif /* IP_TOS */ 414| 0| } 415| | 416| 0|#ifdef HAVE_LINUX_PKT_SCHED_H 417| | /* Set scheduling priority within the local Linux network stack */ 418| 0| if (prio == DROPBEAR_PRIO_LOWDELAY) { ------------------ | Branch (418:6): [True: 0, False: 0] ------------------ 419| 0| val = TC_PRIO_INTERACTIVE; 420| 0| } else { 421| 0| val = 0; 422| 0| } 423| | /* linux specific, sets QoS class. see tc-prio(8) */ 424| 0| rc = setsockopt(sock, SOL_SOCKET, SO_PRIORITY, (void*) &val, sizeof(val)); 425| 0| if (rc < 0 && errno != ENOTSOCK) { ------------------ | Branch (425:6): [True: 0, False: 0] | Branch (425:16): [True: 0, False: 0] ------------------ 426| 0| TRACE(("Couldn't set SO_PRIORITY (%s)", strerror(errno))) 427| 0| } 428| 0|#endif 429| | 430| 0|} get_socket_address: 613| 7.99k|{ 614| 7.99k| struct sockaddr_storage addr; 615| 7.99k| socklen_t addrlen; 616| | 617| 7.99k|#if DROPBEAR_FUZZ 618| 7.99k| if (fuzz.fuzzing) { ------------------ | Branch (618:6): [True: 7.99k, False: 0] ------------------ 619| 7.99k| fuzz_get_socket_address(fd, local_host, local_port, remote_host, remote_port, host_lookup); 620| 7.99k| return; 621| 7.99k| } 622| 0|#endif 623| | 624| 0| if (local_host || local_port) { ------------------ | Branch (624:6): [True: 0, False: 0] | Branch (624:20): [True: 0, False: 0] ------------------ 625| 0| addrlen = sizeof(addr); 626| 0| if (getsockname(fd, (struct sockaddr*)&addr, &addrlen) < 0) { ------------------ | Branch (626:7): [True: 0, False: 0] ------------------ 627| 0| dropbear_exit("Failed socket address: %s", strerror(errno)); 628| 0| } 629| 0| getaddrstring(&addr, local_host, local_port, host_lookup); 630| 0| } 631| 0| if (remote_host || remote_port) { ------------------ | Branch (631:6): [True: 0, False: 0] | Branch (631:21): [True: 0, False: 0] ------------------ 632| 0| addrlen = sizeof(addr); 633| 0| if (getpeername(fd, (struct sockaddr*)&addr, &addrlen) < 0) { ------------------ | Branch (633:7): [True: 0, False: 0] ------------------ 634| 0| dropbear_exit("Failed socket address: %s", strerror(errno)); 635| 0| } 636| 0| getaddrstring(&addr, remote_host, remote_port, host_lookup); 637| 0| } 638| 0|} write_packet: 58| 73.9k|void write_packet() { 59| | 60| 73.9k| ssize_t written; 61| 73.9k|#if defined(HAVE_WRITEV) && (defined(IOV_MAX) || defined(UIO_MAXIOV)) 62| | /* 50 is somewhat arbitrary */ 63| 73.9k| unsigned int iov_count = 50; 64| 73.9k| struct iovec iov[50]; 65| |#else 66| | int len; 67| | buffer* writebuf; 68| |#endif 69| | 70| 73.9k| TRACE2(("enter write_packet")) 71| 73.9k| dropbear_assert(!isempty(&ses.writequeue)); ------------------ | | 83| 73.9k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 73.9k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 72| | 73| 73.9k|#if defined(HAVE_WRITEV) && (defined(IOV_MAX) || defined(UIO_MAXIOV)) 74| | 75| 73.9k| packet_queue_to_iovec(&ses.writequeue, iov, &iov_count); 76| | /* This may return EAGAIN. The main loop sometimes 77| | calls write_packet() without bothering to test with select() since 78| | it's likely to be necessary */ 79| 73.9k|#if DROPBEAR_FUZZ 80| 73.9k| if (fuzz.fuzzing) { ------------------ | Branch (80:6): [True: 73.9k, False: 0] ------------------ 81| | /* pretend to write one packet at a time */ 82| | /* TODO(fuzz): randomise amount written based on the fuzz input */ 83| 73.9k| written = iov[0].iov_len; 84| 73.9k| } 85| 0| else 86| 0|#endif 87| 0| { 88| 0| written = writev(ses.sock_out, iov, iov_count); 89| 0| if (written < 0) { ------------------ | Branch (89:6): [True: 0, False: 0] ------------------ 90| 0| if (errno == EINTR || errno == EAGAIN) { ------------------ | Branch (90:7): [True: 0, False: 0] | Branch (90:25): [True: 0, False: 0] ------------------ 91| 0| TRACE2(("leave write_packet: EINTR")) 92| 0| return; 93| 0| } else { 94| 0| dropbear_exit("Error writing: %s", strerror(errno)); 95| 0| } 96| 0| } 97| 0| } 98| | 99| 73.9k| packet_queue_consume(&ses.writequeue, written); 100| 73.9k| ses.writequeue_len -= written; 101| | 102| 73.9k| if (written == 0) { ------------------ | Branch (102:6): [True: 0, False: 73.9k] ------------------ 103| 0| ses.remoteclosed(); 104| 0| } 105| | 106| |#else /* No writev () */ 107| |#if DROPBEAR_FUZZ 108| | _Static_assert(0, "No fuzzing code for no-writev writes"); 109| |#endif 110| | /* Get the next buffer in the queue of encrypted packets to write*/ 111| | writebuf = (buffer*)examine(&ses.writequeue); 112| | 113| | len = writebuf->len - writebuf->pos; 114| | dropbear_assert(len > 0); 115| | /* Try to write as much as possible */ 116| | written = write(ses.sock_out, buf_getptr(writebuf, len), len); 117| | 118| | if (written < 0) { 119| | if (errno == EINTR || errno == EAGAIN) { 120| | TRACE2(("leave writepacket: EINTR")) 121| | return; 122| | } else { 123| | dropbear_exit("Error writing: %s", strerror(errno)); 124| | } 125| | } 126| | 127| | if (written == 0) { 128| | ses.remoteclosed(); 129| | } 130| | 131| | ses.writequeue_len -= written; 132| | 133| | if (written == len) { 134| | /* We've finished with the packet, free it */ 135| | dequeue(&ses.writequeue); 136| | buf_free(writebuf); 137| | writebuf = NULL; 138| | } else { 139| | /* More packet left to write, leave it in the queue for later */ 140| | buf_incrpos(writebuf, written); 141| | } 142| |#endif /* writev */ 143| | 144| 73.9k| TRACE2(("leave write_packet")) 145| 73.9k|} read_packet: 150| 380k|void read_packet() { 151| | 152| 380k| int len; 153| 380k| unsigned int maxlen; 154| 380k| unsigned char blocksize; 155| | 156| 380k| TRACE2(("enter read_packet")) 157| 380k| blocksize = ses.keys->recv.algo_crypt->blocksize; 158| | 159| 380k| if (ses.readbuf == NULL || ses.readbuf->len < blocksize) { ------------------ | Branch (159:6): [True: 73.9k, False: 306k] | Branch (159:29): [True: 144k, False: 161k] ------------------ 160| 218k| int ret; 161| | /* In the first blocksize of a packet */ 162| | 163| | /* Read the first blocksize of the packet, so we can decrypt it and 164| | * find the length of the whole packet */ 165| 218k| ret = read_packet_init(); 166| | 167| 218k| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 218k|#define DROPBEAR_FAILURE -1 ------------------ | Branch (167:7): [True: 144k, False: 73.9k] ------------------ 168| | /* didn't read enough to determine the length */ 169| 144k| TRACE2(("leave read_packet: packetinit done")) 170| 144k| return; 171| 144k| } 172| 218k| } 173| | 174| | /* Attempt to read the remainder of the packet, note that there 175| | * mightn't be any available (EAGAIN) */ 176| 235k| maxlen = ses.readbuf->len - ses.readbuf->pos; 177| 235k| if (maxlen == 0) { ------------------ | Branch (177:6): [True: 27.3k, False: 208k] ------------------ 178| | /* Occurs when the packet is only a single block long and has all 179| | * been read in read_packet_init(). Usually means that MAC is disabled 180| | */ 181| 27.3k| len = 0; 182| 208k| } else { 183| 208k| len = read(ses.sock_in, buf_getptr(ses.readbuf, maxlen), maxlen); ------------------ | | 55| 208k|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ 184| | 185| 208k| if (len == 0) { ------------------ | Branch (185:7): [True: 146, False: 208k] ------------------ 186| 146| ses.remoteclosed(); 187| 146| } 188| | 189| 208k| if (len < 0) { ------------------ | Branch (189:7): [True: 203, False: 208k] ------------------ 190| 203| if (errno == EINTR || errno == EAGAIN) { ------------------ | Branch (190:8): [True: 201, False: 2] | Branch (190:26): [True: 0, False: 2] ------------------ 191| 201| TRACE2(("leave read_packet: EINTR or EAGAIN")) 192| 201| return; 193| 201| } else { 194| 2| dropbear_exit("Error reading: %s", strerror(errno)); 195| 2| } 196| 203| } 197| | 198| 208k| buf_incrpos(ses.readbuf, len); 199| 208k| } 200| | 201| 235k| if ((unsigned int)len == maxlen) { ------------------ | Branch (201:6): [True: 72.1k, False: 163k] ------------------ 202| | /* The whole packet has been read */ 203| 72.1k| decrypt_packet(); 204| | /* The main select() loop process_packet() to 205| | * handle the packet contents... */ 206| 72.1k| } 207| 235k| TRACE2(("leave read_packet")) 208| 235k|} decrypt_packet: 298| 72.1k|void decrypt_packet() { 299| | 300| 72.1k| unsigned char blocksize; 301| 72.1k| unsigned char macsize; 302| 72.1k| unsigned int padlen; 303| 72.1k| unsigned int len; 304| | 305| 72.1k| TRACE2(("enter decrypt_packet")) 306| 72.1k| blocksize = ses.keys->recv.algo_crypt->blocksize; 307| 72.1k| macsize = ses.keys->recv.algo_mac->hashsize; 308| | 309| 72.1k| ses.kexstate.datarecv += ses.readbuf->len; 310| | 311| 72.1k|#if DROPBEAR_AEAD_MODE 312| 72.1k| if (ses.keys->recv.crypt_mode->aead_crypt) { ------------------ | Branch (312:6): [True: 0, False: 72.1k] ------------------ 313| | /* first blocksize is not decrypted yet */ 314| 0| buf_setpos(ses.readbuf, 0); 315| | 316| | /* decrypt it in-place */ 317| 0| len = ses.readbuf->len - macsize - ses.readbuf->pos; 318| 0| if (ses.keys->recv.crypt_mode->aead_crypt(ses.recvseq, ------------------ | Branch (318:7): [True: 0, False: 0] ------------------ 319| 0| buf_getptr(ses.readbuf, len + macsize), 320| 0| buf_getwriteptr(ses.readbuf, len), 321| 0| len, macsize, 322| 0| &ses.keys->recv.cipher_state, LTC_DECRYPT) != CRYPT_OK) { ------------------ | | 70| 0|#define LTC_DECRYPT 1 ------------------ 323| 0| dropbear_exit("Error decrypting"); 324| 0| } 325| 0| buf_incrpos(ses.readbuf, len); 326| 0| } else 327| 72.1k|#endif 328| 72.1k| { 329| | /* we've already decrypted the first blocksize in read_packet_init */ 330| 72.1k| buf_setpos(ses.readbuf, blocksize); 331| | 332| | /* decrypt it in-place */ 333| 72.1k| len = ses.readbuf->len - macsize - ses.readbuf->pos; 334| 72.1k| if (ses.keys->recv.crypt_mode->decrypt( ------------------ | Branch (334:7): [True: 0, False: 72.1k] ------------------ 335| 72.1k| buf_getptr(ses.readbuf, len), 336| 72.1k| buf_getwriteptr(ses.readbuf, len), 337| 72.1k| len, 338| 72.1k| &ses.keys->recv.cipher_state) != CRYPT_OK) { 339| 0| dropbear_exit("Error decrypting"); 340| 0| } 341| 72.1k| buf_incrpos(ses.readbuf, len); 342| | 343| | /* check the hmac */ 344| 72.1k| if (checkmac() != DROPBEAR_SUCCESS) { ------------------ | | 102| 72.1k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (344:7): [True: 0, False: 72.1k] ------------------ 345| 0| dropbear_exit("Integrity error"); 346| 0| } 347| | 348| 72.1k| } 349| | 350| 72.1k|#if DROPBEAR_FUZZ 351| 72.1k| fuzz_dump(ses.readbuf->data, ses.readbuf->len); 352| 72.1k|#endif 353| | 354| | /* get padding length */ 355| 72.1k| buf_setpos(ses.readbuf, PACKET_PADDING_OFF); ------------------ | | 48| 72.1k|#define PACKET_PADDING_OFF 4 ------------------ 356| 72.1k| padlen = buf_getbyte(ses.readbuf); 357| | 358| | /* payload length */ 359| | /* - 4 - 1 is for LEN and PADLEN values */ 360| 72.1k| len = ses.readbuf->len - padlen - 4 - 1 - macsize; 361| 72.1k| if ((len > RECV_MAX_PAYLOAD_LEN+ZLIB_COMPRESS_EXPANSION) || (len < 1)) { ------------------ | | 492| 72.1k|#define RECV_MAX_PAYLOAD_LEN 32768 ------------------ if ((len > RECV_MAX_PAYLOAD_LEN+ZLIB_COMPRESS_EXPANSION) || (len < 1)) { ------------------ | | 50| 72.1k|#define ZLIB_COMPRESS_EXPANSION (((RECV_MAX_PAYLOAD_LEN/16384)+1)*5 + 6) | | ------------------ | | | | 492| 72.1k|#define RECV_MAX_PAYLOAD_LEN 32768 | | ------------------ ------------------ | Branch (361:6): [True: 15, False: 72.1k] | Branch (361:62): [True: 1, False: 72.1k] ------------------ 362| 16| dropbear_exit("Bad packet size %u", len); 363| 16| } 364| | 365| 72.1k| buf_setpos(ses.readbuf, PACKET_PAYLOAD_OFF); ------------------ | | 49| 72.1k|#define PACKET_PAYLOAD_OFF 5 ------------------ 366| | 367| |#ifndef DISABLE_ZLIB 368| | if (is_compress_recv()) { 369| | /* decompress */ 370| | ses.payload = buf_decompress(ses.readbuf, len); 371| | buf_setpos(ses.payload, 0); 372| | ses.payload_beginning = 0; 373| | buf_free(ses.readbuf); 374| | } else 375| |#endif 376| 72.1k| { 377| 72.1k| ses.payload = ses.readbuf; 378| 72.1k| ses.payload_beginning = ses.payload->pos; 379| 72.1k| buf_setlen(ses.payload, ses.payload->pos + len); 380| 72.1k| } 381| 72.1k| ses.readbuf = NULL; 382| | 383| 72.1k| ses.recvseq++; 384| | 385| 72.1k| TRACE2(("leave decrypt_packet")) 386| 72.1k|} maybe_flush_reply_queue: 495| 407k|void maybe_flush_reply_queue() { 496| 407k| struct packetlist *tmp_item = NULL, *curr_item = NULL; 497| 407k| if (!ses.dataallowed) ------------------ | Branch (497:6): [True: 171k, False: 236k] ------------------ 498| 171k| { 499| 171k| TRACE(("maybe_empty_reply_queue - no data allowed")) 500| 171k| return; 501| 171k| } 502| | 503| 236k| for (curr_item = ses.reply_queue_head; curr_item; ) { ------------------ | Branch (503:41): [True: 0, False: 236k] ------------------ 504| 0| CHECKCLEARTOWRITE(); 505| 0| buf_putbytes(ses.writepayload, 506| 0| curr_item->payload->data, curr_item->payload->len); 507| | 508| 0| buf_free(curr_item->payload); 509| 0| tmp_item = curr_item; 510| 0| curr_item = curr_item->next; 511| 0| m_free(tmp_item); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 512| 0| encrypt_packet(); 513| 0| } 514| 236k| ses.reply_queue_head = ses.reply_queue_tail = NULL; 515| 236k|} encrypt_packet: 519| 70.8k|void encrypt_packet() { 520| | 521| 70.8k| unsigned char padlen; 522| 70.8k| unsigned char blocksize, mac_size; 523| 70.8k| buffer * writebuf; /* the packet which will go on the wire. This is 524| | encrypted in-place. */ 525| 70.8k| unsigned char packet_type; 526| 70.8k| unsigned int len, encrypt_buf_size; 527| 70.8k| unsigned char mac_bytes[MAX_MAC_LEN]; 528| | 529| 70.8k| time_t now; 530| | 531| 70.8k| TRACE2(("enter encrypt_packet()")) 532| | 533| 70.8k| buf_setpos(ses.writepayload, 0); 534| 70.8k| packet_type = buf_getbyte(ses.writepayload); 535| 70.8k| buf_setpos(ses.writepayload, 0); 536| | 537| 70.8k| TRACE2(("encrypt_packet type is %d", packet_type)) 538| | 539| 70.8k| if ((!ses.dataallowed && !packet_is_okay_kex(packet_type))) { ------------------ | Branch (539:7): [True: 42.7k, False: 28.1k] | Branch (539:27): [True: 0, False: 42.7k] ------------------ 540| | /* During key exchange only particular packets are allowed. 541| | Since this packet_type isn't OK we just enqueue it to send 542| | after the KEX, see maybe_flush_reply_queue */ 543| 0| enqueue_reply_packet(); 544| 0| return; 545| 0| } 546| | 547| 70.8k| blocksize = ses.keys->trans.algo_crypt->blocksize; 548| 70.8k| mac_size = ses.keys->trans.algo_mac->hashsize; 549| | 550| | /* Encrypted packet len is payload+5. We need to then make sure 551| | * there is enough space for padding or MIN_PACKET_LEN. 552| | * Add extra 3 since we need at least 4 bytes of padding */ 553| 70.8k| encrypt_buf_size = (ses.writepayload->len+4+1) 554| 70.8k| + MAX(MIN_PACKET_LEN, blocksize) + 3 555| | /* add space for the MAC at the end */ 556| 70.8k| + mac_size 557| |#ifndef DISABLE_ZLIB 558| | /* some extra in case 'compression' makes it larger */ 559| | + ZLIB_COMPRESS_EXPANSION 560| |#endif 561| | /* and an extra cleartext (stripped before transmission) byte for the 562| | * packet type */ 563| 70.8k| + 1; 564| | 565| 70.8k| writebuf = buf_new(encrypt_buf_size); 566| 70.8k| buf_setlen(writebuf, PACKET_PAYLOAD_OFF); ------------------ | | 49| 70.8k|#define PACKET_PAYLOAD_OFF 5 ------------------ 567| 70.8k| buf_setpos(writebuf, PACKET_PAYLOAD_OFF); ------------------ | | 49| 70.8k|#define PACKET_PAYLOAD_OFF 5 ------------------ 568| | 569| |#ifndef DISABLE_ZLIB 570| | /* compression */ 571| | if (is_compress_trans()) { 572| | buf_compress(writebuf, ses.writepayload, ses.writepayload->len); 573| | } else 574| |#endif 575| 70.8k| { 576| 70.8k| memcpy(buf_getwriteptr(writebuf, ses.writepayload->len), 577| 70.8k| buf_getptr(ses.writepayload, ses.writepayload->len), 578| 70.8k| ses.writepayload->len); 579| 70.8k| buf_incrwritepos(writebuf, ses.writepayload->len); 580| 70.8k| } 581| | 582| | /* finished with payload */ 583| 70.8k| buf_setpos(ses.writepayload, 0); 584| 70.8k| buf_setlen(ses.writepayload, 0); 585| | 586| | /* length of padding - packet length excluding the packetlength uint32 587| | * field in aead mode must be a multiple of blocksize, with a minimum of 588| | * 4 bytes of padding */ 589| 70.8k| len = writebuf->len; 590| 70.8k|#if DROPBEAR_AEAD_MODE 591| 70.8k| if (ses.keys->trans.crypt_mode->aead_crypt) { ------------------ | Branch (591:6): [True: 13.6k, False: 57.2k] ------------------ 592| 13.6k| len -= 4; 593| 13.6k| } 594| 70.8k|#endif 595| 70.8k| padlen = blocksize - len % blocksize; 596| 70.8k| if (padlen < 4) { ------------------ | Branch (596:6): [True: 8.37k, False: 62.5k] ------------------ 597| 8.37k| padlen += blocksize; 598| 8.37k| } 599| | /* check for min packet length */ 600| 70.8k| if (writebuf->len + padlen < MIN_PACKET_LEN) { ------------------ | | 213| 70.8k|#define MIN_PACKET_LEN 16 ------------------ | Branch (600:6): [True: 3.26k, False: 67.6k] ------------------ 601| 3.26k| padlen += blocksize; 602| 3.26k| } 603| | 604| 70.8k| buf_setpos(writebuf, 0); 605| | /* packet length excluding the packetlength uint32 */ 606| 70.8k| buf_putint(writebuf, writebuf->len + padlen - 4); 607| | 608| | /* padding len */ 609| 70.8k| buf_putbyte(writebuf, padlen); 610| | /* actual padding */ 611| 70.8k| buf_setpos(writebuf, writebuf->len); 612| 70.8k| buf_incrlen(writebuf, padlen); 613| 70.8k| genrandom(buf_getptr(writebuf, padlen), padlen); 614| | 615| 70.8k|#if DROPBEAR_AEAD_MODE 616| 70.8k| if (ses.keys->trans.crypt_mode->aead_crypt) { ------------------ | Branch (616:6): [True: 13.6k, False: 57.2k] ------------------ 617| | /* do the actual encryption, in-place */ 618| 13.6k| buf_setpos(writebuf, 0); 619| | /* encrypt it in-place*/ 620| 13.6k| len = writebuf->len; 621| 13.6k| buf_incrlen(writebuf, mac_size); 622| 13.6k| if (ses.keys->trans.crypt_mode->aead_crypt(ses.transseq, ------------------ | Branch (622:7): [True: 0, False: 13.6k] ------------------ 623| 13.6k| buf_getptr(writebuf, len), 624| 13.6k| buf_getwriteptr(writebuf, len + mac_size), 625| 13.6k| len, mac_size, 626| 13.6k| &ses.keys->trans.cipher_state, LTC_ENCRYPT) != CRYPT_OK) { ------------------ | | 68| 13.6k|#define LTC_ENCRYPT 0 ------------------ 627| 0| dropbear_exit("Error encrypting"); 628| 0| } 629| 13.6k| buf_incrpos(writebuf, len + mac_size); 630| 13.6k| } else 631| 57.2k|#endif 632| 57.2k| { 633| 57.2k| make_mac(ses.transseq, &ses.keys->trans, writebuf, writebuf->len, mac_bytes); 634| | 635| | /* do the actual encryption, in-place */ 636| 57.2k| buf_setpos(writebuf, 0); 637| | /* encrypt it in-place*/ 638| 57.2k| len = writebuf->len; 639| 57.2k| if (ses.keys->trans.crypt_mode->encrypt( ------------------ | Branch (639:7): [True: 0, False: 57.2k] ------------------ 640| 57.2k| buf_getptr(writebuf, len), 641| 57.2k| buf_getwriteptr(writebuf, len), 642| 57.2k| len, 643| 57.2k| &ses.keys->trans.cipher_state) != CRYPT_OK) { 644| 0| dropbear_exit("Error encrypting"); 645| 0| } 646| 57.2k| buf_incrpos(writebuf, len); 647| | 648| | /* stick the MAC on it */ 649| 57.2k| buf_putbytes(writebuf, mac_bytes, mac_size); 650| 57.2k| } 651| | 652| | /* Update counts */ 653| 70.8k| ses.kexstate.datatrans += writebuf->len; 654| | 655| 70.8k| writebuf_enqueue(writebuf); 656| | 657| | /* Update counts */ 658| 70.8k| ses.transseq++; 659| | 660| 70.8k| now = monotonic_now(); 661| 70.8k| ses.last_packet_time_any_sent = now; 662| | /* idle timeout shouldn't be affected by responses to keepalives. 663| | send_msg_keepalive() itself also does tricks with 664| | ses.last_packet_idle_time - read that if modifying this code */ 665| 70.8k| if (packet_type != SSH_MSG_REQUEST_FAILURE ------------------ | | 65| 141k|#define SSH_MSG_REQUEST_FAILURE 82 ------------------ | Branch (665:6): [True: 70.8k, False: 0] ------------------ 666| 70.8k| && packet_type != SSH_MSG_UNIMPLEMENTED ------------------ | | 31| 141k|#define SSH_MSG_UNIMPLEMENTED 3 ------------------ | Branch (666:6): [True: 54.8k, False: 16.0k] ------------------ 667| 70.8k| && packet_type != SSH_MSG_IGNORE) { ------------------ | | 30| 54.8k|#define SSH_MSG_IGNORE 2 ------------------ | Branch (667:6): [True: 54.8k, False: 0] ------------------ 668| 54.8k| ses.last_packet_time_idle = now; 669| | 670| 54.8k| } 671| | 672| 70.8k| TRACE2(("leave encrypt_packet()")) 673| 70.8k|} writebuf_enqueue: 675| 74.8k|void writebuf_enqueue(buffer * writebuf) { 676| | /* enqueue the packet for sending. It will get freed after transmission. */ 677| 74.8k| buf_setpos(writebuf, 0); 678| 74.8k| enqueue(&ses.writequeue, (void*)writebuf); 679| 74.8k| ses.writequeue_len += writebuf->len; 680| 74.8k|} packet.c:read_packet_init: 214| 218k|static int read_packet_init() { 215| | 216| 218k| unsigned int maxlen; 217| 218k| int slen; 218| 218k| unsigned int len, plen; 219| 218k| unsigned int blocksize; 220| 218k| unsigned int macsize; 221| | 222| | 223| 218k| blocksize = ses.keys->recv.algo_crypt->blocksize; 224| 218k| macsize = ses.keys->recv.algo_mac->hashsize; 225| | 226| 218k| if (ses.readbuf == NULL) { ------------------ | Branch (226:6): [True: 73.9k, False: 144k] ------------------ 227| | /* start of a new packet */ 228| 73.9k| ses.readbuf = buf_new(INIT_READBUF); ------------------ | | 51| 73.9k|#define INIT_READBUF 128 ------------------ 229| 73.9k| } 230| | 231| 218k| maxlen = blocksize - ses.readbuf->pos; 232| | 233| | /* read the rest of the packet if possible */ 234| 218k| slen = read(ses.sock_in, buf_getwriteptr(ses.readbuf, maxlen), ------------------ | | 55| 218k|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ 235| 218k| maxlen); 236| 218k| if (slen == 0) { ------------------ | Branch (236:6): [True: 1.55k, False: 217k] ------------------ 237| 1.55k| ses.remoteclosed(); 238| 1.55k| } 239| 218k| if (slen < 0) { ------------------ | Branch (239:6): [True: 200, False: 218k] ------------------ 240| 200| if (errno == EINTR || errno == EAGAIN) { ------------------ | Branch (240:7): [True: 196, False: 4] | Branch (240:25): [True: 0, False: 4] ------------------ 241| 196| TRACE2(("leave read_packet_init: EINTR")) 242| 196| return DROPBEAR_FAILURE; ------------------ | | 103| 196|#define DROPBEAR_FAILURE -1 ------------------ 243| 196| } 244| 4| dropbear_exit("Error reading: %s", strerror(errno)); 245| 200| } 246| | 247| 218k| buf_incrwritepos(ses.readbuf, slen); 248| | 249| 218k| if ((unsigned int)slen != maxlen) { ------------------ | Branch (249:6): [True: 144k, False: 73.9k] ------------------ 250| | /* don't have enough bytes to determine length, get next time */ 251| 144k| return DROPBEAR_FAILURE; ------------------ | | 103| 144k|#define DROPBEAR_FAILURE -1 ------------------ 252| 144k| } 253| | 254| | /* now we have the first block, need to get packet length, so we decrypt 255| | * the first block (only need first 4 bytes) */ 256| 73.9k| buf_setpos(ses.readbuf, 0); 257| 73.9k|#if DROPBEAR_AEAD_MODE 258| 73.9k| if (ses.keys->recv.crypt_mode->aead_crypt) { ------------------ | Branch (258:6): [True: 0, False: 73.9k] ------------------ 259| 0| if (ses.keys->recv.crypt_mode->aead_getlength(ses.recvseq, ------------------ | Branch (259:7): [True: 0, False: 0] ------------------ 260| 0| buf_getptr(ses.readbuf, blocksize), &plen, 261| 0| blocksize, 262| 0| &ses.keys->recv.cipher_state) != CRYPT_OK) { 263| 0| dropbear_exit("Error decrypting"); 264| 0| } 265| 0| len = plen + 4 + macsize; 266| 0| } else 267| 73.9k|#endif 268| 73.9k| { 269| 73.9k| if (ses.keys->recv.crypt_mode->decrypt(buf_getptr(ses.readbuf, blocksize), ------------------ | Branch (269:7): [True: 0, False: 73.9k] ------------------ 270| 73.9k| buf_getwriteptr(ses.readbuf, blocksize), 271| 73.9k| blocksize, 272| 73.9k| &ses.keys->recv.cipher_state) != CRYPT_OK) { 273| 0| dropbear_exit("Error decrypting"); 274| 0| } 275| 73.9k| plen = buf_getint(ses.readbuf) + 4; 276| 73.9k| len = plen + macsize; 277| 73.9k| } 278| | 279| 73.9k| TRACE2(("packet size is %u, block %u mac %u", len, blocksize, macsize)) 280| | 281| | 282| | /* check packet length */ 283| 73.9k| if ((len > RECV_MAX_PACKET_LEN) || ------------------ | | 215| 73.9k|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ | Branch (283:6): [True: 1.63k, False: 72.3k] ------------------ 284| 73.9k| (plen < blocksize) || ------------------ | Branch (284:3): [True: 10, False: 72.3k] ------------------ 285| 73.9k| (plen % blocksize != 0)) { ------------------ | Branch (285:3): [True: 35, False: 72.2k] ------------------ 286| 123| dropbear_exit("Integrity error (bad packet size %u)", len); 287| 123| } 288| | 289| 73.8k| if (len > ses.readbuf->size) { ------------------ | Branch (289:6): [True: 18.3k, False: 55.4k] ------------------ 290| 18.3k| ses.readbuf = buf_resize(ses.readbuf, len); 291| 18.3k| } 292| 73.8k| buf_setlen(ses.readbuf, len); 293| 73.8k| buf_setpos(ses.readbuf, blocksize); 294| 73.8k| return DROPBEAR_SUCCESS; ------------------ | | 102| 73.8k|#define DROPBEAR_SUCCESS 0 ------------------ 295| 73.9k|} packet.c:checkmac: 390| 72.1k|static int checkmac() { 391| | 392| 72.1k| unsigned char mac_bytes[MAX_MAC_LEN]; 393| 72.1k| unsigned int mac_size, contents_len; 394| | 395| 72.1k| mac_size = ses.keys->recv.algo_mac->hashsize; 396| 72.1k| contents_len = ses.readbuf->len - mac_size; 397| | 398| 72.1k| buf_setpos(ses.readbuf, 0); 399| 72.1k| make_mac(ses.recvseq, &ses.keys->recv, ses.readbuf, contents_len, mac_bytes); 400| | 401| 72.1k|#if DROPBEAR_FUZZ 402| 72.1k| if (fuzz.fuzzing) { ------------------ | Branch (402:6): [True: 72.1k, False: 0] ------------------ 403| | /* fail 1 in 2000 times to test error path. */ 404| 72.1k| unsigned int value = 0; 405| 72.1k| if (mac_size > sizeof(value)) { ------------------ | Branch (405:7): [True: 0, False: 72.1k] ------------------ 406| 0| memcpy(&value, mac_bytes, sizeof(value)); 407| 0| } 408| 72.1k| if (value % 2000 == 99) { ------------------ | Branch (408:7): [True: 0, False: 72.1k] ------------------ 409| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 410| 0| } 411| 72.1k| return DROPBEAR_SUCCESS; ------------------ | | 102| 72.1k|#define DROPBEAR_SUCCESS 0 ------------------ 412| 72.1k| } 413| 0|#endif 414| | 415| | /* compare the hash */ 416| 0| buf_setpos(ses.readbuf, contents_len); 417| 0| if (constant_time_memcmp(mac_bytes, buf_getptr(ses.readbuf, mac_size), mac_size) != 0) { ------------------ | Branch (417:6): [True: 0, False: 0] ------------------ 418| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 419| 0| } else { 420| 0| return DROPBEAR_SUCCESS; ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ 421| 0| } 422| 0|} packet.c:packet_is_okay_kex: 464| 42.7k|static int packet_is_okay_kex(unsigned char type) { 465| 42.7k| if (type >= SSH_MSG_USERAUTH_REQUEST) { ------------------ | | 42| 42.7k|#define SSH_MSG_USERAUTH_REQUEST 50 ------------------ | Branch (465:6): [True: 0, False: 42.7k] ------------------ 466| 0| return 0; 467| 0| } 468| 42.7k| if (type == SSH_MSG_SERVICE_REQUEST || type == SSH_MSG_SERVICE_ACCEPT) { ------------------ | | 33| 85.5k|#define SSH_MSG_SERVICE_REQUEST 5 ------------------ if (type == SSH_MSG_SERVICE_REQUEST || type == SSH_MSG_SERVICE_ACCEPT) { ------------------ | | 34| 42.7k|#define SSH_MSG_SERVICE_ACCEPT 6 ------------------ | Branch (468:6): [True: 0, False: 42.7k] | Branch (468:41): [True: 0, False: 42.7k] ------------------ 469| 0| return 0; 470| 0| } 471| 42.7k| if (type == SSH_MSG_KEXINIT) { ------------------ | | 36| 42.7k|#define SSH_MSG_KEXINIT 20 ------------------ | Branch (471:6): [True: 0, False: 42.7k] ------------------ 472| | /* XXX should this die horribly if !dataallowed ?? */ 473| 0| return 0; 474| 0| } 475| 42.7k| return 1; 476| 42.7k|} packet.c:make_mac: 687| 129k| unsigned char *output_mac) { 688| 129k| unsigned char seqbuf[4]; 689| 129k| unsigned long bufsize; 690| 129k| hmac_state hmac; 691| | 692| 129k| if (key_state->algo_mac->hashsize > 0) { ------------------ | Branch (692:6): [True: 40.1k, False: 89.2k] ------------------ 693| | /* calculate the mac */ 694| 40.1k| if (hmac_init(&hmac, ------------------ | Branch (694:7): [True: 0, False: 40.1k] ------------------ 695| 40.1k| key_state->hash_index, 696| 40.1k| key_state->mackey, 697| 40.1k| key_state->algo_mac->keysize) != CRYPT_OK) { 698| 0| dropbear_exit("HMAC error"); 699| 0| } 700| | 701| | /* sequence number */ 702| 40.1k| STORE32H(seqno, seqbuf); ------------------ | | 62| 40.1k|#define STORE32H(x, y) \ | | 63| 40.1k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 40.1k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 40.1k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 703| 40.1k| if (hmac_process(&hmac, seqbuf, 4) != CRYPT_OK) { ------------------ | Branch (703:7): [True: 0, False: 40.1k] ------------------ 704| 0| dropbear_exit("HMAC error"); 705| 0| } 706| | 707| | /* the actual contents */ 708| 40.1k| buf_setpos(clear_buf, 0); 709| 40.1k| if (hmac_process(&hmac, ------------------ | Branch (709:7): [True: 0, False: 40.1k] ------------------ 710| 40.1k| buf_getptr(clear_buf, clear_len), 711| 40.1k| clear_len) != CRYPT_OK) { 712| 0| dropbear_exit("HMAC error"); 713| 0| } 714| | 715| 40.1k| bufsize = MAX_MAC_LEN; ------------------ | | 134| 40.1k|#define MAX_MAC_LEN 32 ------------------ 716| 40.1k| if (hmac_done(&hmac, output_mac, &bufsize) != CRYPT_OK) { ------------------ | Branch (716:7): [True: 0, False: 40.1k] ------------------ 717| 0| dropbear_exit("HMAC error"); 718| 0| } 719| 40.1k| } 720| 129k| TRACE2(("leave writemac")) 721| 129k|} process_packet: 43| 72.1k|void process_packet() { 44| | 45| 72.1k| unsigned char type; 46| 72.1k| unsigned int i; 47| 72.1k| time_t now; 48| | 49| 72.1k| TRACE2(("enter process_packet")) 50| | 51| 72.1k| type = buf_getbyte(ses.payload); 52| 72.1k| TRACE(("process_packet: packet type = %d, len %d", type, ses.payload->len)) 53| | 54| 72.1k| now = monotonic_now(); 55| 72.1k| ses.last_packet_time_keepalive_recv = now; 56| | 57| | /* These packets we can receive at any time */ 58| 72.1k| switch(type) { ------------------ | Branch (58:9): [True: 70.7k, False: 1.38k] ------------------ 59| | 60| 285| case SSH_MSG_IGNORE: ------------------ | | 30| 285|#define SSH_MSG_IGNORE 2 ------------------ | Branch (60:3): [True: 285, False: 71.8k] ------------------ 61| 285| goto out; 62| 489| case SSH_MSG_DEBUG: ------------------ | | 32| 489|#define SSH_MSG_DEBUG 4 ------------------ | Branch (62:3): [True: 489, False: 71.6k] ------------------ 63| 489| goto out; 64| | 65| 606| case SSH_MSG_UNIMPLEMENTED: ------------------ | | 31| 606|#define SSH_MSG_UNIMPLEMENTED 3 ------------------ | Branch (65:3): [True: 606, False: 71.5k] ------------------ 66| | /* debugging XXX */ 67| 606| TRACE(("SSH_MSG_UNIMPLEMENTED")) 68| 606| goto out; 69| | 70| 3| case SSH_MSG_DISCONNECT: ------------------ | | 29| 3|#define SSH_MSG_DISCONNECT 1 ------------------ | Branch (70:3): [True: 3, False: 72.1k] ------------------ 71| | /* TODO cleanup? */ 72| 3| dropbear_close("Disconnect received"); 73| 72.1k| } 74| | 75| | /* Ignore these packet types so that keepalives don't interfere with 76| | idle detection. This is slightly incorrect since a tcp forwarded 77| | global request with failure won't trigger the idle timeout, 78| | but that's probably acceptable */ 79| 70.7k| if (!(type == SSH_MSG_GLOBAL_REQUEST ------------------ | | 63| 141k|#define SSH_MSG_GLOBAL_REQUEST 80 ------------------ | Branch (79:8): [True: 1, False: 70.7k] ------------------ 80| 70.7k| || type == SSH_MSG_REQUEST_FAILURE ------------------ | | 65| 141k|#define SSH_MSG_REQUEST_FAILURE 82 ------------------ | Branch (80:6): [True: 1, False: 70.7k] ------------------ 81| 70.7k| || type == SSH_MSG_CHANNEL_FAILURE)) { ------------------ | | 76| 70.7k|#define SSH_MSG_CHANNEL_FAILURE 100 ------------------ | Branch (81:6): [True: 2, False: 70.7k] ------------------ 82| 70.7k| ses.last_packet_time_idle = now; 83| 70.7k| } 84| | 85| | /* This applies for KEX, where the spec says the next packet MUST be 86| | * NEWKEYS */ 87| 70.7k| if (ses.requirenext != 0) { ------------------ | Branch (87:6): [True: 51.8k, False: 18.8k] ------------------ 88| 51.8k| if (ses.requirenext == type) ------------------ | Branch (88:7): [True: 36.8k, False: 15.0k] ------------------ 89| 36.8k| { 90| | /* Got what we expected */ 91| 36.8k| TRACE(("got expected packet %d during kexinit", type)) 92| 36.8k| } 93| 15.0k| else 94| 15.0k| { 95| | /* RFC4253 7.1 - various messages are allowed at this point. 96| | The only ones we know about have already been handled though, 97| | so just return "unimplemented" */ 98| 15.0k| if (type >= 1 && type <= 49 ------------------ | Branch (98:8): [True: 14.9k, False: 14] | Branch (98:21): [True: 14.9k, False: 44] ------------------ 99| 15.0k| && type != SSH_MSG_SERVICE_REQUEST ------------------ | | 33| 29.9k|#define SSH_MSG_SERVICE_REQUEST 5 ------------------ | Branch (99:8): [True: 14.9k, False: 1] ------------------ 100| 15.0k| && type != SSH_MSG_SERVICE_ACCEPT ------------------ | | 34| 29.9k|#define SSH_MSG_SERVICE_ACCEPT 6 ------------------ | Branch (100:8): [True: 14.9k, False: 1] ------------------ 101| 15.0k| && type != SSH_MSG_KEXINIT) ------------------ | | 36| 14.9k|#define SSH_MSG_KEXINIT 20 ------------------ | Branch (101:8): [True: 14.9k, False: 1] ------------------ 102| 14.9k| { 103| 14.9k| TRACE(("unknown allowed packet during kexinit")) 104| 14.9k| recv_unimplemented(); 105| 14.9k| goto out; 106| 14.9k| } 107| 61| else 108| 61| { 109| 61| TRACE(("disallowed packet during kexinit")) 110| 61| dropbear_exit("Unexpected packet type %d, expected %d", type, 111| 61| ses.requirenext); 112| 61| } 113| 15.0k| } 114| 51.8k| } 115| | 116| | /* Check if we should ignore this packet. Used currently only for 117| | * KEX code, with first_kex_packet_follows */ 118| 55.7k| if (ses.ignorenext) { ------------------ | Branch (118:6): [True: 151, False: 55.5k] ------------------ 119| 151| TRACE(("Ignoring packet, type = %d", type)) 120| 151| ses.ignorenext = 0; 121| 151| goto out; 122| 151| } 123| | 124| | /* Only clear the flag after we have checked ignorenext */ 125| 55.5k| if (ses.requirenext != 0 && ses.requirenext == type) ------------------ | Branch (125:6): [True: 36.7k, False: 18.8k] | Branch (125:30): [True: 36.7k, False: 0] ------------------ 126| 36.7k| { 127| 36.7k| ses.requirenext = 0; 128| 36.7k| } 129| | 130| | 131| | /* Kindly the protocol authors gave all the preauth packets type values 132| | * less-than-or-equal-to 60 ( == MAX_UNAUTH_PACKET_TYPE ). 133| | * NOTE: if the protocol changes and new types are added, revisit this 134| | * assumption */ 135| 55.5k| if ( !ses.authstate.authdone && type > MAX_UNAUTH_PACKET_TYPE ) { ------------------ | | 38| 55.5k|#define MAX_UNAUTH_PACKET_TYPE SSH_MSG_USERAUTH_PK_OK | | ------------------ | | | | 52| 55.5k|#define SSH_MSG_USERAUTH_PK_OK 60 | | ------------------ ------------------ | Branch (135:7): [True: 55.5k, False: 0] | Branch (135:34): [True: 4, False: 55.5k] ------------------ 136| 4| dropbear_exit("Received message %d before userauth", type); 137| 4| } 138| | 139| 337k| for (i = 0; ; i++) { 140| 337k| if (ses.packettypes[i].type == 0) { ------------------ | Branch (140:7): [True: 1.12k, False: 336k] ------------------ 141| | /* end of list */ 142| 1.12k| break; 143| 1.12k| } 144| | 145| 336k| if (ses.packettypes[i].type == type) { ------------------ | Branch (145:7): [True: 54.4k, False: 282k] ------------------ 146| 54.4k| ses.packettypes[i].handler(); 147| 54.4k| goto out; 148| 54.4k| } 149| 336k| } 150| | 151| | 152| | /* TODO do something more here? */ 153| 1.12k| TRACE(("preauth unknown packet")) 154| 1.12k| recv_unimplemented(); 155| | 156| 70.1k|out: 157| 70.1k| ses.lastpacket = type; 158| 70.1k| buf_free(ses.payload); 159| 70.1k| ses.payload = NULL; 160| | 161| 70.1k| TRACE2(("leave process_packet")) 162| 70.1k|} process-packet.c:recv_unimplemented: 170| 16.0k|static void recv_unimplemented() { 171| | 172| 16.0k| CHECKCLEARTOWRITE(); 173| | 174| 16.0k| buf_putbyte(ses.writepayload, SSH_MSG_UNIMPLEMENTED); ------------------ | | 31| 16.0k|#define SSH_MSG_UNIMPLEMENTED 3 ------------------ 175| | /* the decryption routine increments the sequence number, we must 176| | * decrement */ 177| 16.0k| buf_putint(ses.writepayload, ses.recvseq - 1); 178| | 179| 16.0k| encrypt_packet(); 180| 16.0k|} initqueue: 29| 3.99k|void initqueue(struct Queue* queue) { 30| | 31| 3.99k| queue->head = NULL; 32| 3.99k| queue->tail = NULL; 33| 3.99k| queue->count = 0; 34| 3.99k|} isempty: 36| 1.05M|int isempty(const struct Queue* queue) { 37| | 38| 1.05M| return (queue->head == NULL); 39| 1.05M|} dequeue: 41| 74.8k|void* dequeue(struct Queue* queue) { 42| | 43| 74.8k| void* ret; 44| 74.8k| struct Link* oldhead; 45| 74.8k| dropbear_assert(!isempty(queue)); ------------------ | | 83| 74.8k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 74.8k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 46| | 47| 74.8k| ret = queue->head->item; 48| 74.8k| oldhead = queue->head; 49| | 50| 74.8k| if (oldhead->link != NULL) { ------------------ | Branch (50:6): [True: 20.8k, False: 54.0k] ------------------ 51| 20.8k| queue->head = oldhead->link; 52| 54.0k| } else { 53| 54.0k| queue->head = NULL; 54| 54.0k| queue->tail = NULL; 55| 54.0k| TRACE(("empty queue dequeing")) 56| 54.0k| } 57| | 58| 74.8k| m_free(oldhead); ------------------ | | 24| 74.8k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 59| 74.8k| queue->count--; 60| 74.8k| return ret; 61| 74.8k|} examine: 63| 73.9k|void *examine(const struct Queue* queue) { 64| | 65| 73.9k| dropbear_assert(!isempty(queue)); ------------------ | | 83| 73.9k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 73.9k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 66| 73.9k| return queue->head->item; 67| 73.9k|} enqueue: 69| 74.8k|void enqueue(struct Queue* queue, void* item) { 70| | 71| 74.8k| struct Link* newlink; 72| | 73| 74.8k| newlink = (struct Link*)m_malloc(sizeof(struct Link)); 74| | 75| 74.8k| newlink->item = item; 76| 74.8k| newlink->link = NULL; 77| | 78| 74.8k| if (queue->tail != NULL) { ------------------ | Branch (78:6): [True: 20.8k, False: 54.0k] ------------------ 79| 20.8k| queue->tail->link = newlink; 80| 20.8k| } 81| 74.8k| queue->tail = newlink; 82| | 83| 74.8k| if (queue->head == NULL) { ------------------ | Branch (83:6): [True: 54.0k, False: 20.8k] ------------------ 84| 54.0k| queue->head = newlink; 85| 54.0k| } 86| 74.8k| queue->count++; 87| 74.8k|} buf_get_rsa_pub_key: 53| 1|int buf_get_rsa_pub_key(buffer* buf, dropbear_rsa_key *key) { 54| | 55| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 56| 1| TRACE(("enter buf_get_rsa_pub_key")) 57| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 58| 1| m_mp_alloc_init_multi(&key->e, &key->n, NULL); 59| 1| key->d = NULL; 60| 1| key->p = NULL; 61| 1| key->q = NULL; 62| | 63| 1| buf_incrpos(buf, 4+SSH_SIGNKEY_RSA_LEN); /* int + "ssh-rsa" */ ------------------ | | 113| 1|#define SSH_SIGNKEY_RSA_LEN 7 ------------------ 64| | 65| 1| if (buf_getmpint(buf, key->e) == DROPBEAR_FAILURE ------------------ | | 103| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (65:6): [True: 0, False: 1] ------------------ 66| 1| || buf_getmpint(buf, key->n) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (66:6): [True: 0, False: 1] ------------------ 67| 0| TRACE(("leave buf_get_rsa_pub_key: failure")) 68| 0| goto out; 69| 0| } 70| | 71| 1| if (mp_count_bits(key->n) < MIN_RSA_KEYLEN) { ------------------ | | 65| 1|#define MIN_RSA_KEYLEN 1024 ------------------ | Branch (71:6): [True: 0, False: 1] ------------------ 72| 0| dropbear_log(LOG_WARNING, "RSA key too short"); 73| 0| goto out; 74| 0| } 75| | 76| | /* 64 bit is limit used by openssl, so we won't block any keys in the wild */ 77| 1| if (mp_count_bits(key->e) > 64) { ------------------ | Branch (77:6): [True: 0, False: 1] ------------------ 78| 0| dropbear_log(LOG_WARNING, "RSA key bad e"); 79| 0| goto out; 80| 0| } 81| | 82| 1| TRACE(("leave buf_get_rsa_pub_key: success")) 83| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 84| 1|out: 85| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (85:6): [True: 0, False: 1] ------------------ 86| 0| m_mp_free_multi(&key->e, &key->n, NULL); 87| 0| } 88| 1| return ret; 89| 1|} buf_get_rsa_priv_key: 94| 1|int buf_get_rsa_priv_key(buffer* buf, dropbear_rsa_key *key) { 95| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 96| | 97| 1| TRACE(("enter buf_get_rsa_priv_key")) 98| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 99| | 100| 1| if (buf_get_rsa_pub_key(buf, key) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (100:6): [True: 0, False: 1] ------------------ 101| 0| TRACE(("leave buf_get_rsa_priv_key: pub: ret == DROPBEAR_FAILURE")) 102| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 103| 0| } 104| | 105| 1| key->d = NULL; 106| 1| key->p = NULL; 107| 1| key->q = NULL; 108| | 109| 1| m_mp_alloc_init_multi(&key->d, NULL); 110| 1| if (buf_getmpint(buf, key->d) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (110:6): [True: 0, False: 1] ------------------ 111| 0| TRACE(("leave buf_get_rsa_priv_key: d: ret == DROPBEAR_FAILURE")) 112| 0| goto out; 113| 0| } 114| | 115| 1| if (buf->pos == buf->len) { ------------------ | Branch (115:6): [True: 0, False: 1] ------------------ 116| | /* old Dropbear private keys didn't keep p and q, so we will ignore them*/ 117| 1| } else { 118| 1| m_mp_alloc_init_multi(&key->p, &key->q, NULL); 119| | 120| 1| if (buf_getmpint(buf, key->p) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (120:7): [True: 0, False: 1] ------------------ 121| 0| TRACE(("leave buf_get_rsa_priv_key: p: ret == DROPBEAR_FAILURE")) 122| 0| goto out; 123| 0| } 124| | 125| 1| if (buf_getmpint(buf, key->q) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (125:7): [True: 0, False: 1] ------------------ 126| 0| TRACE(("leave buf_get_rsa_priv_key: q: ret == DROPBEAR_FAILURE")) 127| 0| goto out; 128| 0| } 129| 1| } 130| | 131| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 132| 1|out: 133| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (133:6): [True: 0, False: 1] ------------------ 134| 0| m_mp_free_multi(&key->d, &key->p, &key->q, NULL); 135| 0| } 136| 1| TRACE(("leave buf_get_rsa_priv_key")) 137| 1| return ret; 138| 1|} rsa_key_free: 142| 1|void rsa_key_free(dropbear_rsa_key *key) { 143| | 144| 1| TRACE2(("enter rsa_key_free")) 145| | 146| 1| if (key == NULL) { ------------------ | Branch (146:6): [True: 1, False: 0] ------------------ 147| 1| TRACE2(("leave rsa_key_free: key == NULL")) 148| 1| return; 149| 1| } 150| 0| m_mp_free_multi(&key->d, &key->e, &key->p, &key->q, &key->n, NULL); 151| 0| m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 152| 0| TRACE2(("leave rsa_key_free")) 153| 0|} buf_put_rsa_pub_key: 161| 8.72k|void buf_put_rsa_pub_key(buffer* buf, const dropbear_rsa_key *key) { 162| | 163| 8.72k| TRACE(("enter buf_put_rsa_pub_key")) 164| 8.72k| dropbear_assert(key != NULL); ------------------ | | 83| 8.72k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 8.72k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 165| | 166| 8.72k| buf_putstring(buf, SSH_SIGNKEY_RSA, SSH_SIGNKEY_RSA_LEN); ------------------ | | 112| 8.72k|#define SSH_SIGNKEY_RSA "ssh-rsa" ------------------ buf_putstring(buf, SSH_SIGNKEY_RSA, SSH_SIGNKEY_RSA_LEN); ------------------ | | 113| 8.72k|#define SSH_SIGNKEY_RSA_LEN 7 ------------------ 167| 8.72k| buf_putmpint(buf, key->e); 168| 8.72k| buf_putmpint(buf, key->n); 169| | 170| 8.72k| TRACE(("leave buf_put_rsa_pub_key")) 171| | 172| 8.72k|} buf_put_rsa_sign: 256| 4.19k| enum signature_type sigtype, const buffer *data_buf) { 257| 4.19k| const char *name = NULL; 258| 4.19k| unsigned int nsize, ssize, namelen = 0; 259| 4.19k| unsigned int i; 260| 4.19k| size_t written; 261| 4.19k| DEF_MP_INT(rsa_s); ------------------ | | 80| 4.19k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 262| 4.19k| DEF_MP_INT(rsa_tmp1); ------------------ | | 80| 4.19k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 263| 4.19k| DEF_MP_INT(rsa_tmp2); ------------------ | | 80| 4.19k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 264| 4.19k| DEF_MP_INT(rsa_tmp3); ------------------ | | 80| 4.19k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 265| | 266| 4.19k| TRACE(("enter buf_put_rsa_sign")) 267| 4.19k| dropbear_assert(key != NULL); ------------------ | | 83| 4.19k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 4.19k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 268| | 269| 4.19k| m_mp_init_multi(&rsa_s, &rsa_tmp1, &rsa_tmp2, &rsa_tmp3, NULL); 270| | 271| 4.19k| rsa_pad_em(key, data_buf, &rsa_tmp1, sigtype); 272| | 273| | /* the actual signing of the padded data */ 274| | 275| 4.19k|#if DROPBEAR_RSA_BLINDING 276| | 277| | /* With blinding, s = (r^(-1))((em)*r^e)^d mod n */ 278| | 279| | /* generate the r blinding value */ 280| | /* rsa_tmp2 is r */ 281| 4.19k| gen_random_mpint(key->n, &rsa_tmp2); 282| | 283| | /* rsa_tmp1 is em */ 284| | /* em' = em * r^e mod n */ 285| | 286| | /* rsa_s used as a temp var*/ 287| 4.19k| if (mp_exptmod(&rsa_tmp2, key->e, key->n, &rsa_s) != MP_OKAY) { ------------------ | | 161| 4.19k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (287:6): [True: 0, False: 4.19k] ------------------ 288| 0| dropbear_exit("RSA error"); 289| 0| } 290| 4.19k| if (mp_invmod(&rsa_tmp2, key->n, &rsa_tmp3) != MP_OKAY) { ------------------ | | 161| 4.19k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (290:6): [True: 0, False: 4.19k] ------------------ 291| 0| dropbear_exit("RSA error"); 292| 0| } 293| 4.19k| if (mp_mulmod(&rsa_tmp1, &rsa_s, key->n, &rsa_tmp2) != MP_OKAY) { ------------------ | | 161| 4.19k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (293:6): [True: 0, False: 4.19k] ------------------ 294| 0| dropbear_exit("RSA error"); 295| 0| } 296| | 297| | /* rsa_tmp2 is em' */ 298| | /* s' = (em')^d mod n */ 299| 4.19k| if (mp_exptmod(&rsa_tmp2, key->d, key->n, &rsa_tmp1) != MP_OKAY) { ------------------ | | 161| 4.19k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (299:6): [True: 0, False: 4.19k] ------------------ 300| 0| dropbear_exit("RSA error"); 301| 0| } 302| | 303| | /* rsa_tmp1 is s' */ 304| | /* rsa_tmp3 is r^(-1) mod n */ 305| | /* s = (s')r^(-1) mod n */ 306| 4.19k| if (mp_mulmod(&rsa_tmp1, &rsa_tmp3, key->n, &rsa_s) != MP_OKAY) { ------------------ | | 161| 4.19k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (306:6): [True: 0, False: 4.19k] ------------------ 307| 0| dropbear_exit("RSA error"); 308| 0| } 309| | 310| |#else 311| | 312| | /* s = em^d mod n */ 313| | /* rsa_tmp1 is em */ 314| | if (mp_exptmod(&rsa_tmp1, key->d, key->n, &rsa_s) != MP_OKAY) { 315| | dropbear_exit("RSA error"); 316| | } 317| | 318| |#endif /* DROPBEAR_RSA_BLINDING */ 319| | 320| 4.19k| mp_clear_multi(&rsa_tmp1, &rsa_tmp2, &rsa_tmp3, NULL); 321| | 322| | /* create the signature to return */ 323| 4.19k| name = signature_name_from_type(sigtype, &namelen); 324| 4.19k| buf_putstring(buf, name, namelen); 325| | 326| 4.19k| nsize = mp_ubin_size(key->n); 327| | 328| | /* string rsa_signature_blob length */ 329| 4.19k| buf_putint(buf, nsize); 330| | /* pad out s to same length as n */ 331| 4.19k| ssize = mp_ubin_size(&rsa_s); 332| 4.19k| dropbear_assert(ssize <= nsize); ------------------ | | 83| 4.19k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 4.19k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 333| 4.23k| for (i = 0; i < nsize-ssize; i++) { ------------------ | Branch (333:14): [True: 42, False: 4.19k] ------------------ 334| 42| buf_putbyte(buf, 0x00); 335| 42| } 336| | 337| 4.19k| if (mp_to_ubin(&rsa_s, buf_getwriteptr(buf, ssize), ssize, &written) != MP_OKAY) { ------------------ | | 161| 4.19k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (337:6): [True: 0, False: 4.19k] ------------------ 338| 0| dropbear_exit("RSA error"); 339| 0| } 340| 4.19k| buf_incrwritepos(buf, written); 341| 4.19k| mp_clear(&rsa_s); 342| | 343| |#if defined(DEBUG_RSA) && DEBUG_TRACE 344| | if (!debug_trace) { 345| | printhex("RSA sig", buf->data, buf->len); 346| | } 347| |#endif 348| | 349| | 350| 4.19k| TRACE(("leave buf_put_rsa_sign")) 351| 4.19k|} rsa.c:rsa_pad_em: 356| 4.19k| const buffer *data_buf, mp_int * rsa_em, enum signature_type sigtype) { 357| | /* EM = 0x00 || 0x01 || PS || 0x00 || T 358| | PS is padding of 0xff to make EM the size of key->n 359| | 360| | T is the DER encoding of the hash alg (sha1 or sha256) 361| | */ 362| | 363| | /* From rfc8017 page 46 */ 364| 4.19k|#if DROPBEAR_RSA_SHA1 365| 4.19k| const unsigned char T_sha1[] = 366| 4.19k| {0x30, 0x21, 0x30, 0x09, 0x06, 0x05, 0x2b, 367| 4.19k| 0x0e, 0x03, 0x02, 0x1a, 0x05, 0x00, 0x04, 0x14}; 368| 4.19k|#endif 369| 4.19k|#if DROPBEAR_RSA_SHA256 370| 4.19k| const unsigned char T_sha256[] = 371| 4.19k| {0x30, 0x31, 0x30, 0x0d, 0x06, 0x09, 0x60, 0x86, 0x48, 0x01, 372| 4.19k| 0x65, 0x03, 0x04, 0x02, 0x01, 0x05, 0x00, 0x04, 0x20}; 373| 4.19k|#endif 374| | 375| 4.19k| int Tlen = 0; 376| 4.19k| const unsigned char *T = NULL; 377| 4.19k| const struct ltc_hash_descriptor *hash_desc = NULL; 378| 4.19k| buffer * rsa_EM = NULL; 379| 4.19k| hash_state hs; 380| 4.19k| unsigned int nsize; 381| | 382| 4.19k| switch (sigtype) { 383| 0|#if DROPBEAR_RSA_SHA1 384| 3.91k| case DROPBEAR_SIGNATURE_RSA_SHA1: ------------------ | Branch (384:3): [True: 3.91k, False: 285] ------------------ 385| 3.91k| Tlen = sizeof(T_sha1); 386| 3.91k| T = T_sha1; 387| 3.91k| hash_desc = &sha1_desc; 388| 3.91k| break; 389| 0|#endif 390| 0|#if DROPBEAR_RSA_SHA256 391| 285| case DROPBEAR_SIGNATURE_RSA_SHA256: ------------------ | Branch (391:3): [True: 285, False: 3.91k] ------------------ 392| 285| Tlen = sizeof(T_sha256); 393| 285| T = T_sha256; 394| 285| hash_desc = &sha256_desc; 395| 285| break; 396| 0|#endif 397| 0| default: ------------------ | Branch (397:3): [True: 0, False: 4.19k] ------------------ 398| 0| assert(0); 399| 4.19k| } 400| | 401| | 402| 4.19k| nsize = mp_ubin_size(key->n); 403| | 404| 4.19k| rsa_EM = buf_new(nsize); 405| | /* type byte */ 406| 4.19k| buf_putbyte(rsa_EM, 0x00); 407| 4.19k| buf_putbyte(rsa_EM, 0x01); 408| | /* Padding with PS 0xFF bytes */ 409| 914k| while(rsa_EM->pos != rsa_EM->size - (1 + Tlen + hash_desc->hashsize)) { ------------------ | Branch (409:8): [True: 910k, False: 4.19k] ------------------ 410| 910k| buf_putbyte(rsa_EM, 0xff); 411| 910k| } 412| 4.19k| buf_putbyte(rsa_EM, 0x00); 413| | /* Magic ASN1 stuff */ 414| 4.19k| buf_putbytes(rsa_EM, T, Tlen); 415| | 416| | /* The hash of the data */ 417| 4.19k| hash_desc->init(&hs); 418| 4.19k| hash_desc->process(&hs, data_buf->data, data_buf->len); 419| 4.19k| hash_desc->done(&hs, buf_getwriteptr(rsa_EM, hash_desc->hashsize)); 420| 4.19k| buf_incrwritepos(rsa_EM, hash_desc->hashsize); 421| | 422| 4.19k| dropbear_assert(rsa_EM->pos == rsa_EM->size); ------------------ | | 83| 4.19k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 4.19k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 423| | 424| | /* Create the mp_int from the encoded bytes */ 425| 4.19k| buf_setpos(rsa_EM, 0); 426| 4.19k| bytes_to_mp(rsa_em, buf_getptr(rsa_EM, rsa_EM->size), 427| 4.19k| rsa_EM->size); 428| 4.19k| buf_free(rsa_EM); 429| 4.19k|} new_sign_key: 62| 1|sign_key * new_sign_key() { 63| | 64| 1| sign_key * ret; 65| | 66| 1| ret = (sign_key*)m_malloc(sizeof(sign_key)); 67| 1| ret->type = DROPBEAR_SIGNKEY_NONE; 68| 1| ret->source = SIGNKEY_SOURCE_INVALID; 69| 1| return ret; 70| 1|} signkey_type_from_name: 86| 961|enum signkey_type signkey_type_from_name(const char* name, unsigned int namelen) { 87| 961| int i; 88| 8.62k| for (i = 0; i < DROPBEAR_SIGNKEY_NUM_NAMED; i++) { ------------------ | Branch (88:14): [True: 7.66k, False: 957] ------------------ 89| 7.66k| const char *fixed_name = signkey_names[i]; 90| 7.66k| if (namelen == strlen(fixed_name) ------------------ | Branch (90:7): [True: 5, False: 7.66k] ------------------ 91| 7.66k| && memcmp(fixed_name, name, namelen) == 0) { ------------------ | Branch (91:7): [True: 4, False: 1] ------------------ 92| | 93| 4|#if DROPBEAR_ECDSA 94| | /* Some of the ECDSA key sizes are defined even if they're not compiled in */ 95| 4| if (0 ------------------ | Branch (95:8): [Folded - Ignored] ------------------ 96| |#if !DROPBEAR_ECC_256 97| | || i == DROPBEAR_SIGNKEY_ECDSA_NISTP256 98| |#endif 99| |#if !DROPBEAR_ECC_384 100| | || i == DROPBEAR_SIGNKEY_ECDSA_NISTP384 101| |#endif 102| |#if !DROPBEAR_ECC_521 103| | || i == DROPBEAR_SIGNKEY_ECDSA_NISTP521 104| |#endif 105| 4| ) { 106| 0| TRACE(("attempt to use ecdsa type %d not compiled in", i)) 107| 0| return DROPBEAR_SIGNKEY_NONE; 108| 0| } 109| 4|#endif 110| | 111| 4| return (enum signkey_type)i; 112| 4| } 113| 7.66k| } 114| | 115| 957| TRACE(("signkey_type_from_name unexpected key type.")) 116| | 117| 957| return DROPBEAR_SIGNKEY_NONE; 118| 961|} signature_name_from_type: 122| 4.19k|const char* signature_name_from_type(enum signature_type type, unsigned int *namelen) { 123| 4.19k|#if DROPBEAR_RSA 124| 4.19k|#if DROPBEAR_RSA_SHA256 125| 4.19k| if (type == DROPBEAR_SIGNATURE_RSA_SHA256) { ------------------ | Branch (125:6): [True: 285, False: 3.91k] ------------------ 126| 285| if (namelen) { ------------------ | Branch (126:7): [True: 285, False: 0] ------------------ 127| 285| *namelen = strlen(SSH_SIGNATURE_RSA_SHA256); ------------------ | | 117| 285|#define SSH_SIGNATURE_RSA_SHA256 "rsa-sha2-256" ------------------ 128| 285| } 129| 285| return SSH_SIGNATURE_RSA_SHA256; ------------------ | | 117| 285|#define SSH_SIGNATURE_RSA_SHA256 "rsa-sha2-256" ------------------ 130| 285| } 131| 3.91k|#endif 132| 3.91k|#if DROPBEAR_RSA_SHA1 133| 3.91k| if (type == DROPBEAR_SIGNATURE_RSA_SHA1) { ------------------ | Branch (133:6): [True: 3.91k, False: 0] ------------------ 134| 3.91k| if (namelen) { ------------------ | Branch (134:7): [True: 3.91k, False: 0] ------------------ 135| 3.91k| *namelen = strlen(SSH_SIGNKEY_RSA); ------------------ | | 112| 3.91k|#define SSH_SIGNKEY_RSA "ssh-rsa" ------------------ 136| 3.91k| } 137| 3.91k| return SSH_SIGNKEY_RSA; ------------------ | | 112| 3.91k|#define SSH_SIGNKEY_RSA "ssh-rsa" ------------------ 138| 3.91k| } 139| 0|#endif 140| 0|#endif /* DROPBEAR_RSA */ 141| 0| return signkey_name_from_type((enum signkey_type)type, namelen); 142| 3.91k|} signature_type_from_name: 145| 957|enum signature_type signature_type_from_name(const char* name, unsigned int namelen) { 146| 957|#if DROPBEAR_RSA 147| 957|#if DROPBEAR_RSA_SHA256 148| 957| if (namelen == strlen(SSH_SIGNATURE_RSA_SHA256) ------------------ | | 117| 957|#define SSH_SIGNATURE_RSA_SHA256 "rsa-sha2-256" ------------------ | Branch (148:6): [True: 957, False: 0] ------------------ 149| 957| && memcmp(name, SSH_SIGNATURE_RSA_SHA256, namelen) == 0) { ------------------ | | 117| 957|#define SSH_SIGNATURE_RSA_SHA256 "rsa-sha2-256" ------------------ | Branch (149:6): [True: 0, False: 957] ------------------ 150| 0| return DROPBEAR_SIGNATURE_RSA_SHA256; 151| 0| } 152| 957|#endif 153| 957|#if DROPBEAR_RSA_SHA1 154| 957| if (namelen == strlen(SSH_SIGNKEY_RSA) ------------------ | | 112| 957|#define SSH_SIGNKEY_RSA "ssh-rsa" ------------------ | Branch (154:6): [True: 0, False: 957] ------------------ 155| 957| && memcmp(name, SSH_SIGNKEY_RSA, namelen) == 0) { ------------------ | | 112| 0|#define SSH_SIGNKEY_RSA "ssh-rsa" ------------------ | Branch (155:6): [True: 0, False: 0] ------------------ 156| 0| return DROPBEAR_SIGNATURE_RSA_SHA1; 157| 0| } 158| 957|#endif 159| 957|#endif /* DROPBEAR_RSA */ 160| 957| return (enum signature_type)signkey_type_from_name(name, namelen); 161| 957|} signkey_type_from_signature: 173| 34.6k|enum signkey_type signkey_type_from_signature(enum signature_type sigtype) { 174| 34.6k|#if DROPBEAR_RSA 175| 34.6k|#if DROPBEAR_RSA_SHA256 176| 34.6k| if (sigtype == DROPBEAR_SIGNATURE_RSA_SHA256) { ------------------ | Branch (176:6): [True: 577, False: 34.0k] ------------------ 177| 577| return DROPBEAR_SIGNKEY_RSA; 178| 577| } 179| 34.0k|#endif 180| 34.0k|#if DROPBEAR_RSA_SHA1 181| 34.0k| if (sigtype == DROPBEAR_SIGNATURE_RSA_SHA1) { ------------------ | Branch (181:6): [True: 8.42k, False: 25.6k] ------------------ 182| 8.42k| return DROPBEAR_SIGNKEY_RSA; 183| 8.42k| } 184| 25.6k|#endif 185| 25.6k|#endif /* DROPBEAR_RSA */ 186| 25.6k| assert((int)sigtype < (int)DROPBEAR_SIGNKEY_NUM_NAMED); 187| 25.6k| return (enum signkey_type)sigtype; 188| 25.6k|} signkey_key_ptr: 193| 10.3k|signkey_key_ptr(sign_key *key, enum signkey_type type) { 194| 10.3k| switch (type) { 195| 0|#if DROPBEAR_ED25519 196| 0| case DROPBEAR_SIGNKEY_ED25519: ------------------ | Branch (196:3): [True: 0, False: 10.3k] ------------------ 197| 0|#if DROPBEAR_SK_ED25519 198| 0| case DROPBEAR_SIGNKEY_SK_ED25519: ------------------ | Branch (198:3): [True: 0, False: 10.3k] ------------------ 199| 0|#endif 200| 0| return (void**)&key->ed25519key; 201| 0|#endif 202| 0|#if DROPBEAR_ECDSA 203| 0|#if DROPBEAR_ECC_256 204| 10.3k| case DROPBEAR_SIGNKEY_ECDSA_NISTP256: ------------------ | Branch (204:3): [True: 10.3k, False: 2] ------------------ 205| 10.3k|#if DROPBEAR_SK_ECDSA 206| 10.3k| case DROPBEAR_SIGNKEY_SK_ECDSA_NISTP256: ------------------ | Branch (206:3): [True: 0, False: 10.3k] ------------------ 207| 10.3k|#endif 208| 10.3k| return (void**)&key->ecckey256; 209| 0|#endif 210| 0|#if DROPBEAR_ECC_384 211| 1| case DROPBEAR_SIGNKEY_ECDSA_NISTP384: ------------------ | Branch (211:3): [True: 1, False: 10.3k] ------------------ 212| 1| return (void**)&key->ecckey384; 213| 0|#endif 214| 0|#if DROPBEAR_ECC_521 215| 1| case DROPBEAR_SIGNKEY_ECDSA_NISTP521: ------------------ | Branch (215:3): [True: 1, False: 10.3k] ------------------ 216| 1| return (void**)&key->ecckey521; 217| 0|#endif 218| 0|#endif /* DROPBEAR_ECDSA */ 219| 0|#if DROPBEAR_RSA 220| 0| case DROPBEAR_SIGNKEY_RSA: ------------------ | Branch (220:3): [True: 0, False: 10.3k] ------------------ 221| 0| return (void**)&key->rsakey; 222| 0|#endif 223| 0|#if DROPBEAR_DSS 224| 0| case DROPBEAR_SIGNKEY_DSS: ------------------ | Branch (224:3): [True: 0, False: 10.3k] ------------------ 225| 0| return (void**)&key->dsskey; 226| 0|#endif 227| 0| default: ------------------ | Branch (227:3): [True: 0, False: 10.3k] ------------------ 228| 0| return NULL; 229| 10.3k| } 230| 10.3k|} buf_get_priv_key: 339| 4|int buf_get_priv_key(buffer *buf, sign_key *key, enum signkey_type *type) { 340| | 341| 4| char *ident; 342| 4| unsigned int len; 343| 4| enum signkey_type keytype; 344| 4| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 4|#define DROPBEAR_FAILURE -1 ------------------ 345| | 346| 4| TRACE2(("enter buf_get_priv_key")) 347| | 348| 4| ident = buf_getstring(buf, &len); 349| 4| keytype = signkey_type_from_name(ident, len); 350| 4| m_free(ident); ------------------ | | 24| 4|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 351| | 352| 4| if (*type != DROPBEAR_SIGNKEY_ANY && *type != keytype) { ------------------ | Branch (352:6): [True: 4, False: 0] | Branch (352:39): [True: 0, False: 4] ------------------ 353| 0| TRACE(("wrong key type: %d %d", *type, keytype)) 354| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 355| 0| } 356| | 357| 4| *type = keytype; 358| | 359| | /* Rewind the buffer back before "ssh-rsa" etc */ 360| 4| buf_decrpos(buf, len + 4); 361| | 362| 4|#if DROPBEAR_DSS 363| 4| if (keytype == DROPBEAR_SIGNKEY_DSS) { ------------------ | Branch (363:6): [True: 1, False: 3] ------------------ 364| 1| dss_key_free(key->dsskey); 365| 1| key->dsskey = m_malloc(sizeof(*key->dsskey)); 366| 1| ret = buf_get_dss_priv_key(buf, key->dsskey); 367| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (367:7): [True: 0, False: 1] ------------------ 368| 0| dss_key_free(key->dsskey); 369| 0| key->dsskey = NULL; 370| 0| } 371| 1| } 372| 4|#endif 373| 4|#if DROPBEAR_RSA 374| 4| if (keytype == DROPBEAR_SIGNKEY_RSA) { ------------------ | Branch (374:6): [True: 1, False: 3] ------------------ 375| 1| rsa_key_free(key->rsakey); 376| 1| key->rsakey = m_malloc(sizeof(*key->rsakey)); 377| 1| ret = buf_get_rsa_priv_key(buf, key->rsakey); 378| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (378:7): [True: 0, False: 1] ------------------ 379| 0| rsa_key_free(key->rsakey); 380| 0| key->rsakey = NULL; 381| 0| } 382| 1| } 383| 4|#endif 384| 4|#if DROPBEAR_ECDSA 385| 4| if (signkey_is_ecdsa(keytype)) { ------------------ | Branch (385:6): [True: 1, False: 3] ------------------ 386| 1| ecc_key **eck = (ecc_key**)signkey_key_ptr(key, keytype); 387| 1| if (eck) { ------------------ | Branch (387:7): [True: 1, False: 0] ------------------ 388| 1| if (*eck) { ------------------ | Branch (388:8): [True: 0, False: 1] ------------------ 389| 0| ecc_free(*eck); 390| 0| m_free(*eck); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 391| 0| *eck = NULL; 392| 0| } 393| 1| *eck = buf_get_ecdsa_priv_key(buf); 394| 1| if (*eck) { ------------------ | Branch (394:8): [True: 1, False: 0] ------------------ 395| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 396| 1| } 397| 1| } 398| 1| } 399| 4|#endif 400| 4|#if DROPBEAR_ED25519 401| 4| if (keytype == DROPBEAR_SIGNKEY_ED25519) { ------------------ | Branch (401:6): [True: 1, False: 3] ------------------ 402| 1| ed25519_key_free(key->ed25519key); 403| 1| key->ed25519key = m_malloc(sizeof(*key->ed25519key)); 404| 1| ret = buf_get_ed25519_priv_key(buf, key->ed25519key); 405| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (405:7): [True: 0, False: 1] ------------------ 406| 0| m_free(key->ed25519key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 407| 0| key->ed25519key = NULL; 408| 0| } 409| 1| } 410| 4|#endif 411| | 412| 4| TRACE2(("leave buf_get_priv_key")) 413| | 414| 4| return ret; 415| | 416| 4|} buf_put_pub_key: 419| 34.1k|void buf_put_pub_key(buffer* buf, sign_key *key, enum signkey_type type) { 420| | 421| 34.1k| buffer *pubkeys; 422| | 423| 34.1k| TRACE2(("enter buf_put_pub_key")) 424| 34.1k| pubkeys = buf_new(MAX_PUBKEY_SIZE); ------------------ | | 232| 34.1k|#define MAX_PUBKEY_SIZE 1700 ------------------ 425| | 426| 34.1k|#if DROPBEAR_DSS 427| 34.1k| if (type == DROPBEAR_SIGNKEY_DSS) { ------------------ | Branch (427:6): [True: 16.4k, False: 17.6k] ------------------ 428| 16.4k| buf_put_dss_pub_key(pubkeys, key->dsskey); 429| 16.4k| } 430| 34.1k|#endif 431| 34.1k|#if DROPBEAR_RSA 432| 34.1k| if (type == DROPBEAR_SIGNKEY_RSA) { ------------------ | Branch (432:6): [True: 8.72k, False: 25.3k] ------------------ 433| 8.72k| buf_put_rsa_pub_key(pubkeys, key->rsakey); 434| 8.72k| } 435| 34.1k|#endif 436| 34.1k|#if DROPBEAR_ECDSA 437| 34.1k| if (signkey_is_ecdsa(type)) { ------------------ | Branch (437:6): [True: 6.87k, False: 27.2k] ------------------ 438| 6.87k| ecc_key **eck = (ecc_key**)signkey_key_ptr(key, type); 439| 6.87k| if (eck && *eck) { ------------------ | Branch (439:7): [True: 6.87k, False: 0] | Branch (439:14): [True: 6.87k, False: 2] ------------------ 440| 6.87k| buf_put_ecdsa_pub_key(pubkeys, *eck); 441| 6.87k| } 442| 6.87k| } 443| 34.1k|#endif 444| 34.1k|#if DROPBEAR_ED25519 445| 34.1k| if (type == DROPBEAR_SIGNKEY_ED25519 ------------------ | Branch (445:6): [True: 1.99k, False: 32.1k] ------------------ 446| 34.1k|#if DROPBEAR_SK_ED25519 447| 34.1k| || type == DROPBEAR_SIGNKEY_SK_ED25519 ------------------ | Branch (447:6): [True: 11, False: 32.0k] ------------------ 448| 34.1k|#endif 449| 34.1k| ) { 450| 2.00k| buf_put_ed25519_pub_key(pubkeys, key->ed25519key); 451| 2.00k| } 452| 34.1k|#endif 453| 34.1k| if (pubkeys->len == 0) { ------------------ | Branch (453:6): [True: 2, False: 34.1k] ------------------ 454| 2| dropbear_exit("Bad key types in buf_put_pub_key"); 455| 2| } 456| | 457| 34.1k| buf_putbufstring(buf, pubkeys); 458| 34.1k| buf_free(pubkeys); 459| 34.1k| TRACE2(("leave buf_put_pub_key")) 460| 34.1k|} buf_put_sign: 592| 16.8k| const buffer *data_buf) { 593| 16.8k| buffer *sigblob = buf_new(MAX_PUBKEY_SIZE); ------------------ | | 232| 16.8k|#define MAX_PUBKEY_SIZE 1700 ------------------ 594| 16.8k| enum signkey_type keytype = signkey_type_from_signature(sigtype); 595| | 596| |#if DEBUG_TRACE > DROPBEAR_VERBOSE_LEVEL 597| | { 598| | const char* signame = signature_name_from_type(sigtype, NULL); 599| | TRACE(("buf_put_sign type %d %s", sigtype, signame)); 600| | } 601| |#endif 602| | 603| | 604| 16.8k|#if DROPBEAR_DSS 605| 16.8k| if (keytype == DROPBEAR_SIGNKEY_DSS) { ------------------ | Branch (605:6): [True: 8.21k, False: 8.63k] ------------------ 606| 8.21k| buf_put_dss_sign(sigblob, key->dsskey, data_buf); 607| 8.21k| } 608| 16.8k|#endif 609| 16.8k|#if DROPBEAR_RSA 610| 16.8k| if (keytype == DROPBEAR_SIGNKEY_RSA) { ------------------ | Branch (610:6): [True: 4.19k, False: 12.6k] ------------------ 611| 4.19k| buf_put_rsa_sign(sigblob, key->rsakey, sigtype, data_buf); 612| 4.19k| } 613| 16.8k|#endif 614| 16.8k|#if DROPBEAR_ECDSA 615| 16.8k| if (signkey_is_ecdsa(keytype)) { ------------------ | Branch (615:6): [True: 3.43k, False: 13.4k] ------------------ 616| 3.43k| ecc_key **eck = (ecc_key**)signkey_key_ptr(key, keytype); 617| 3.43k| if (eck && *eck) { ------------------ | Branch (617:7): [True: 3.43k, False: 0] | Branch (617:14): [True: 3.43k, False: 0] ------------------ 618| 3.43k| buf_put_ecdsa_sign(sigblob, *eck, data_buf); 619| 3.43k| } 620| 3.43k| } 621| 16.8k|#endif 622| 16.8k|#if DROPBEAR_ED25519 623| 16.8k| if (keytype == DROPBEAR_SIGNKEY_ED25519) { ------------------ | Branch (623:6): [True: 995, False: 15.8k] ------------------ 624| 995| buf_put_ed25519_sign(sigblob, key->ed25519key, data_buf); 625| 995| } 626| 16.8k|#endif 627| 16.8k| if (sigblob->len == 0) { ------------------ | Branch (627:6): [True: 5, False: 16.8k] ------------------ 628| 5| dropbear_exit("Non-matching signing type"); 629| 5| } 630| 16.8k| buf_putbufstring(buf, sigblob); 631| 16.8k| buf_free(sigblob); 632| | 633| 16.8k|} svr_authinitialise: 42| 3.99k|void svr_authinitialise() { 43| 3.99k| memset(&ses.authstate, 0, sizeof(ses.authstate)); 44| 3.99k|#if DROPBEAR_SVR_PUBKEY_AUTH 45| 3.99k| ses.authstate.authtypes |= AUTH_TYPE_PUBKEY; ------------------ | | 88| 3.99k|#define AUTH_TYPE_PUBKEY (1 << 1) ------------------ 46| 3.99k|#endif 47| 3.99k|#if DROPBEAR_SVR_PASSWORD_AUTH || DROPBEAR_SVR_PAM_AUTH 48| 3.99k| if (!svr_opts.noauthpass) { ------------------ | Branch (48:6): [True: 3.99k, False: 0] ------------------ 49| 3.99k| ses.authstate.authtypes |= AUTH_TYPE_PASSWORD; ------------------ | | 89| 3.99k|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ 50| 3.99k| } 51| 3.99k|#endif 52| 3.99k|} recv_msg_userauth_request: 73| 2.19k|void recv_msg_userauth_request() { 74| | 75| 2.19k| char *username = NULL, *servicename = NULL, *methodname = NULL; 76| 2.19k| unsigned int userlen, servicelen, methodlen; 77| 2.19k| int valid_user = 0; 78| | 79| 2.19k| TRACE(("enter recv_msg_userauth_request")) 80| | 81| | /* for compensating failure delay */ 82| 2.19k| gettime_wrapper(&ses.authstate.auth_starttime); 83| | 84| | /* ignore packets if auth is already done */ 85| 2.19k| if (ses.authstate.authdone == 1) { ------------------ | Branch (85:6): [True: 0, False: 2.19k] ------------------ 86| 0| TRACE(("leave recv_msg_userauth_request: authdone already")) 87| 0| return; 88| 0| } 89| | 90| | /* send the banner if it exists, it will only exist once */ 91| 2.19k| if (svr_opts.banner) { ------------------ | Branch (91:6): [True: 0, False: 2.19k] ------------------ 92| 0| send_msg_userauth_banner(svr_opts.banner); 93| 0| buf_free(svr_opts.banner); 94| 0| svr_opts.banner = NULL; 95| 0| } 96| | 97| 2.19k| username = buf_getstring(ses.payload, &userlen); 98| 2.19k| servicename = buf_getstring(ses.payload, &servicelen); 99| 2.19k| methodname = buf_getstring(ses.payload, &methodlen); 100| | 101| | /* only handle 'ssh-connection' currently */ 102| 2.19k| if (servicelen != SSH_SERVICE_CONNECTION_LEN ------------------ | | 107| 4.38k|#define SSH_SERVICE_CONNECTION_LEN 14 ------------------ | Branch (102:6): [True: 149, False: 2.04k] ------------------ 103| 2.19k| && (strncmp(servicename, SSH_SERVICE_CONNECTION, ------------------ | | 106| 149|#define SSH_SERVICE_CONNECTION "ssh-connection" ------------------ | Branch (103:7): [True: 131, False: 18] ------------------ 104| 149| SSH_SERVICE_CONNECTION_LEN) != 0)) { ------------------ | | 107| 149|#define SSH_SERVICE_CONNECTION_LEN 14 ------------------ 105| | 106| | /* TODO - disconnect here */ 107| 131| m_free(username); ------------------ | | 24| 131|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 108| 131| m_free(servicename); ------------------ | | 24| 131|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 109| 131| m_free(methodname); ------------------ | | 24| 131|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 110| 131| dropbear_exit("unknown service in auth"); 111| 131| } 112| | 113| | /* check username is good before continuing. 114| | * the 'incrfail' varies depending on the auth method to 115| | * avoid giving away which users exist on the system through 116| | * the time delay. */ 117| 2.06k| if (checkusername(username, userlen) == DROPBEAR_SUCCESS) { ------------------ | | 102| 2.06k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (117:6): [True: 1.15k, False: 904] ------------------ 118| 1.15k| valid_user = 1; 119| 1.15k| } 120| | 121| | /* user wants to know what methods are supported */ 122| 2.06k| if (methodlen == AUTH_METHOD_NONE_LEN && ------------------ | | 93| 4.12k|#define AUTH_METHOD_NONE_LEN 4 ------------------ | Branch (122:6): [True: 290, False: 1.77k] ------------------ 123| 2.06k| strncmp(methodname, AUTH_METHOD_NONE, ------------------ | | 92| 290|#define AUTH_METHOD_NONE "none" ------------------ | Branch (123:4): [True: 159, False: 131] ------------------ 124| 290| AUTH_METHOD_NONE_LEN) == 0) { ------------------ | | 93| 290|#define AUTH_METHOD_NONE_LEN 4 ------------------ 125| 159| TRACE(("recv_msg_userauth_request: 'none' request")) 126| 159| if (valid_user ------------------ | Branch (126:7): [True: 156, False: 3] ------------------ 127| 159| && svr_opts.allowblankpass ------------------ | Branch (127:8): [True: 0, False: 156] ------------------ 128| 159| && !svr_opts.noauthpass ------------------ | Branch (128:8): [True: 0, False: 0] ------------------ 129| 159| && !(svr_opts.norootpass && ses.authstate.pw_uid == 0) ------------------ | Branch (129:10): [True: 0, False: 0] | Branch (129:33): [True: 0, False: 0] ------------------ 130| 159| && ses.authstate.pw_passwd[0] == '\0') ------------------ | Branch (130:8): [True: 0, False: 0] ------------------ 131| 0| { 132| 0| dropbear_log(LOG_NOTICE, 133| 0| "Auth succeeded with blank password for '%s' from %s", 134| 0| ses.authstate.pw_name, 135| 0| svr_ses.addrstring); 136| 0| send_msg_userauth_success(); 137| 0| goto out; 138| 0| } 139| 159| else 140| 159| { 141| | /* 'none' has no failure delay */ 142| 159| send_msg_userauth_failure(0, 0); 143| 159| goto out; 144| 159| } 145| 159| } 146| | 147| 1.90k|#if DROPBEAR_SVR_PASSWORD_AUTH 148| 1.90k| if (!svr_opts.noauthpass && ------------------ | Branch (148:6): [True: 1.75k, False: 144] ------------------ 149| 1.90k| !(svr_opts.norootpass && ses.authstate.pw_uid == 0) ) { ------------------ | Branch (149:6): [True: 0, False: 1.75k] | Branch (149:29): [True: 0, False: 0] ------------------ 150| | /* user wants to try password auth */ 151| 1.75k| if (methodlen == AUTH_METHOD_PASSWORD_LEN && ------------------ | | 97| 3.51k|#define AUTH_METHOD_PASSWORD_LEN 8 ------------------ | Branch (151:7): [True: 193, False: 1.56k] ------------------ 152| 1.75k| strncmp(methodname, AUTH_METHOD_PASSWORD, ------------------ | | 96| 193|#define AUTH_METHOD_PASSWORD "password" ------------------ | Branch (152:5): [True: 58, False: 135] ------------------ 153| 193| AUTH_METHOD_PASSWORD_LEN) == 0) { ------------------ | | 97| 193|#define AUTH_METHOD_PASSWORD_LEN 8 ------------------ 154| 58| svr_auth_password(valid_user); 155| 58| goto out; 156| 58| } 157| 1.75k| } 158| 1.84k|#endif 159| | 160| |#if DROPBEAR_SVR_PAM_AUTH 161| | if (!svr_opts.noauthpass && 162| | !(svr_opts.norootpass && ses.authstate.pw_uid == 0) ) { 163| | /* user wants to try password auth */ 164| | if (methodlen == AUTH_METHOD_PASSWORD_LEN && 165| | strncmp(methodname, AUTH_METHOD_PASSWORD, 166| | AUTH_METHOD_PASSWORD_LEN) == 0) { 167| | svr_auth_pam(valid_user); 168| | goto out; 169| | } 170| | } 171| |#endif 172| | 173| 1.84k|#if DROPBEAR_SVR_PUBKEY_AUTH 174| | /* user wants to try pubkey auth */ 175| 1.84k| if (methodlen == AUTH_METHOD_PUBKEY_LEN && ------------------ | | 95| 3.69k|#define AUTH_METHOD_PUBKEY_LEN 9 ------------------ | Branch (175:6): [True: 1.28k, False: 558] ------------------ 176| 1.84k| strncmp(methodname, AUTH_METHOD_PUBKEY, ------------------ | | 94| 1.28k|#define AUTH_METHOD_PUBKEY "publickey" ------------------ | Branch (176:4): [True: 1.17k, False: 109] ------------------ 177| 1.28k| AUTH_METHOD_PUBKEY_LEN) == 0) { ------------------ | | 95| 1.28k|#define AUTH_METHOD_PUBKEY_LEN 9 ------------------ 178| 1.17k| svr_auth_pubkey(valid_user); 179| 1.17k| goto out; 180| 1.17k| } 181| 667|#endif 182| | 183| | /* nothing matched, we just fail with a delay */ 184| 667| send_msg_userauth_failure(0, 1); 185| | 186| 1.84k|out: 187| | 188| 1.84k| m_free(username); ------------------ | | 24| 1.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 189| 1.84k| m_free(servicename); ------------------ | | 24| 1.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 190| 1.84k| m_free(methodname); ------------------ | | 24| 1.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 191| 1.84k|} send_msg_userauth_failure: 348| 1.84k|void send_msg_userauth_failure(int partial, int incrfail) { 349| | 350| 1.84k| buffer *typebuf = NULL; 351| | 352| 1.84k| TRACE(("enter send_msg_userauth_failure")) 353| | 354| 1.84k| CHECKCLEARTOWRITE(); 355| | 356| 1.84k| buf_putbyte(ses.writepayload, SSH_MSG_USERAUTH_FAILURE); ------------------ | | 43| 1.84k|#define SSH_MSG_USERAUTH_FAILURE 51 ------------------ 357| | 358| | /* put a list of allowed types */ 359| 1.84k| typebuf = buf_new(30); /* long enough for PUBKEY and PASSWORD */ 360| | 361| 1.84k| if (ses.authstate.authtypes & AUTH_TYPE_PUBKEY) { ------------------ | | 88| 1.84k|#define AUTH_TYPE_PUBKEY (1 << 1) ------------------ | Branch (361:6): [True: 1.84k, False: 0] ------------------ 362| 1.84k| buf_putbytes(typebuf, (const unsigned char *)AUTH_METHOD_PUBKEY, AUTH_METHOD_PUBKEY_LEN); ------------------ | | 94| 1.84k|#define AUTH_METHOD_PUBKEY "publickey" ------------------ buf_putbytes(typebuf, (const unsigned char *)AUTH_METHOD_PUBKEY, AUTH_METHOD_PUBKEY_LEN); ------------------ | | 95| 1.84k|#define AUTH_METHOD_PUBKEY_LEN 9 ------------------ 363| 1.84k| if (ses.authstate.authtypes & AUTH_TYPE_PASSWORD) { ------------------ | | 89| 1.84k|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ | Branch (363:7): [True: 1.84k, False: 0] ------------------ 364| 1.84k| buf_putbyte(typebuf, ','); 365| 1.84k| } 366| 1.84k| } 367| | 368| 1.84k| if (ses.authstate.authtypes & AUTH_TYPE_PASSWORD) { ------------------ | | 89| 1.84k|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ | Branch (368:6): [True: 1.84k, False: 0] ------------------ 369| 1.84k| buf_putbytes(typebuf, (const unsigned char *)AUTH_METHOD_PASSWORD, AUTH_METHOD_PASSWORD_LEN); ------------------ | | 96| 1.84k|#define AUTH_METHOD_PASSWORD "password" ------------------ buf_putbytes(typebuf, (const unsigned char *)AUTH_METHOD_PASSWORD, AUTH_METHOD_PASSWORD_LEN); ------------------ | | 97| 1.84k|#define AUTH_METHOD_PASSWORD_LEN 8 ------------------ 370| 1.84k| } 371| | 372| 1.84k| buf_putbufstring(ses.writepayload, typebuf); 373| | 374| 1.84k| TRACE(("auth fail: methods %d, '%.*s'", ses.authstate.authtypes, 375| 1.84k| typebuf->len, typebuf->data)) 376| | 377| 1.84k| buf_free(typebuf); 378| | 379| 1.84k| buf_putbyte(ses.writepayload, partial ? 1 : 0); ------------------ | Branch (379:32): [True: 0, False: 1.84k] ------------------ 380| 1.84k| encrypt_packet(); 381| | 382| 1.84k| if (incrfail) { ------------------ | Branch (382:6): [True: 579, False: 1.26k] ------------------ 383| | /* The SSH_MSG_AUTH_FAILURE response is delayed to attempt to 384| | avoid user enumeration and slow brute force attempts. 385| | The delay is adjusted by the time already spent in processing 386| | authentication (ses.authstate.auth_starttime timestamp). */ 387| | 388| | /* Desired total delay 300ms +-50ms (in nanoseconds). 389| | Beware of integer overflow if increasing these values */ 390| 579| const unsigned int mindelay = 250000000; 391| 579| const unsigned int vardelay = 100000000; 392| 579| suseconds_t rand_delay; 393| 579| struct timespec delay; 394| | 395| 579| gettime_wrapper(&delay); 396| 579| delay.tv_sec -= ses.authstate.auth_starttime.tv_sec; 397| 579| delay.tv_nsec -= ses.authstate.auth_starttime.tv_nsec; 398| | 399| | /* carry */ 400| 579| if (delay.tv_nsec < 0) { ------------------ | Branch (400:7): [True: 0, False: 579] ------------------ 401| 0| delay.tv_nsec += 1000000000; 402| 0| delay.tv_sec -= 1; 403| 0| } 404| | 405| 579| genrandom((unsigned char*)&rand_delay, sizeof(rand_delay)); 406| 579| rand_delay = mindelay + (rand_delay % vardelay); 407| | 408| 579| if (delay.tv_sec == 0 && delay.tv_nsec <= mindelay) { ------------------ | Branch (408:7): [True: 579, False: 0] | Branch (408:28): [True: 579, False: 0] ------------------ 409| | /* Compensate for elapsed time */ 410| 579| delay.tv_nsec = rand_delay - delay.tv_nsec; 411| 579| } else { 412| | /* No time left or time went backwards, just delay anyway */ 413| 0| delay.tv_sec = 0; 414| 0| delay.tv_nsec = rand_delay; 415| 0| } 416| | 417| | 418| 579|#if DROPBEAR_FUZZ 419| 579| if (!fuzz.fuzzing) ------------------ | Branch (419:7): [True: 0, False: 579] ------------------ 420| 0|#endif 421| 0| { 422| 0| while (nanosleep(&delay, &delay) == -1 && errno == EINTR) { /* Go back to sleep */ } ------------------ | Branch (422:11): [True: 0, False: 0] | Branch (422:46): [True: 0, False: 0] ------------------ 423| 0| } 424| | 425| 579| ses.authstate.failcount++; 426| 579| } 427| | 428| 1.84k| if (ses.authstate.failcount >= svr_opts.maxauthtries) { ------------------ | Branch (428:6): [True: 2, False: 1.84k] ------------------ 429| 2| char * userstr; 430| | /* XXX - send disconnect ? */ 431| 2| TRACE(("Max auth tries reached, exiting")) 432| | 433| 2| if (ses.authstate.pw_name == NULL) { ------------------ | Branch (433:7): [True: 1, False: 1] ------------------ 434| 1| userstr = "is invalid"; 435| 1| } else { 436| 1| userstr = ses.authstate.pw_name; 437| 1| } 438| 2| dropbear_exit("Max auth tries reached - user '%s'", 439| 2| userstr); 440| 2| } 441| | 442| 1.84k| TRACE(("leave send_msg_userauth_failure")) 443| 1.84k|} svr-auth.c:checkusername: 231| 2.05k|static int checkusername(const char *username, unsigned int userlen) { 232| | 233| 2.05k| char* listshell = NULL; 234| 2.05k| char* usershell = NULL; 235| 2.05k| uid_t uid; 236| | 237| 2.05k| TRACE(("enter checkusername")) 238| 2.05k| if (userlen > MAX_USERNAME_LEN) { ------------------ | | 85| 2.05k|#define MAX_USERNAME_LEN 100 /* arbitrary for the moment */ ------------------ | Branch (238:6): [True: 18, False: 2.03k] ------------------ 239| 18| return DROPBEAR_FAILURE; ------------------ | | 103| 18|#define DROPBEAR_FAILURE -1 ------------------ 240| 18| } 241| | 242| 2.03k| if (strlen(username) != userlen) { ------------------ | Branch (242:6): [True: 7, False: 2.02k] ------------------ 243| 7| dropbear_exit("Attempted username with a null byte"); 244| 7| } 245| | 246| 2.02k| if (ses.authstate.username == NULL) { ------------------ | Branch (246:6): [True: 502, False: 1.52k] ------------------ 247| | /* first request */ 248| 502| fill_passwd(username); 249| 502| ses.authstate.username = m_strdup(username); 250| 1.52k| } else { 251| | /* check username hasn't changed */ 252| 1.52k| if (strcmp(username, ses.authstate.username) != 0) { ------------------ | Branch (252:7): [True: 126, False: 1.39k] ------------------ 253| 126| dropbear_exit("Client trying multiple usernames"); 254| 126| } 255| 1.52k| } 256| | 257| | /* avoids cluttering logs with repeated failure messages from 258| | consecutive authentication requests in a sesssion */ 259| 1.90k| if (ses.authstate.checkusername_failed) { ------------------ | Branch (259:6): [True: 271, False: 1.62k] ------------------ 260| 271| TRACE(("checkusername: returning cached failure")) 261| 271| return DROPBEAR_FAILURE; ------------------ | | 103| 271|#define DROPBEAR_FAILURE -1 ------------------ 262| 271| } 263| | 264| | /* check that user exists */ 265| 1.62k| if (!ses.authstate.pw_name) { ------------------ | Branch (265:6): [True: 471, False: 1.15k] ------------------ 266| 471| TRACE(("leave checkusername: user '%s' doesn't exist", username)) 267| 471| dropbear_log(LOG_WARNING, 268| 471| "Login attempt for nonexistent user"); 269| 471| ses.authstate.checkusername_failed = 1; 270| 471| return DROPBEAR_FAILURE; ------------------ | | 103| 471|#define DROPBEAR_FAILURE -1 ------------------ 271| 471| } 272| | 273| | /* check if we are running as non-root, and login user is different from the server */ 274| 1.15k| uid = geteuid(); 275| 1.15k| if (!(DROPBEAR_SVR_MULTIUSER && uid == 0) && uid != ses.authstate.pw_uid) { ------------------ | | 364| 2.31k|#define DROPBEAR_SVR_MULTIUSER 1 | | ------------------ | | | Branch (364:32): [Folded - Ignored] | | ------------------ ------------------ | Branch (275:34): [True: 1.15k, False: 0] | Branch (275:47): [True: 0, False: 0] ------------------ 276| 0| TRACE(("running as nonroot, only server uid is allowed")) 277| 0| dropbear_log(LOG_WARNING, 278| 0| "Login attempt with wrong user %s", 279| 0| ses.authstate.pw_name); 280| 0| ses.authstate.checkusername_failed = 1; 281| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 282| 0| } 283| | 284| | /* check for non-root if desired */ 285| 1.15k| if (svr_opts.norootlogin && ses.authstate.pw_uid == 0) { ------------------ | Branch (285:6): [True: 0, False: 1.15k] | Branch (285:30): [True: 0, False: 0] ------------------ 286| 0| TRACE(("leave checkusername: root login disabled")) 287| 0| dropbear_log(LOG_WARNING, "root login rejected"); 288| 0| ses.authstate.checkusername_failed = 1; 289| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 290| 0| } 291| | 292| | /* check for login restricted to certain group if desired */ 293| 1.15k|#ifdef HAVE_GETGROUPLIST 294| 1.15k| if (svr_opts.restrict_group) { ------------------ | Branch (294:6): [True: 0, False: 1.15k] ------------------ 295| 0| if (check_group_membership(svr_opts.restrict_group_gid, ------------------ | Branch (295:7): [True: 0, False: 0] ------------------ 296| 0| ses.authstate.pw_name, ses.authstate.pw_gid) == DROPBEAR_FAILURE) { ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 297| 0| dropbear_log(LOG_WARNING, 298| 0| "Logins are restricted to the group %s but user '%s' is not a member", 299| 0| svr_opts.restrict_group, ses.authstate.pw_name); 300| 0| ses.authstate.checkusername_failed = 1; 301| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 302| 0| } 303| 0| } 304| 1.15k|#endif /* HAVE_GETGROUPLIST */ 305| | 306| 1.15k| TRACE(("shell is %s", ses.authstate.pw_shell)) 307| | 308| | /* check that the shell is set */ 309| 1.15k| usershell = ses.authstate.pw_shell; 310| 1.15k| if (usershell[0] == '\0') { ------------------ | Branch (310:6): [True: 0, False: 1.15k] ------------------ 311| | /* empty shell in /etc/passwd means /bin/sh according to passwd(5) */ 312| 0| usershell = "/bin/sh"; 313| 0| } 314| | 315| | /* check the shell is valid. If /etc/shells doesn't exist, getusershell() 316| | * should return some standard shells like "/bin/sh" and "/bin/csh" (this 317| | * is platform-specific) */ 318| 1.15k| setusershell(); 319| 1.15k| while ((listshell = getusershell()) != NULL) { ------------------ | Branch (319:9): [True: 1.15k, False: 0] ------------------ 320| 1.15k| TRACE(("test shell is '%s'", listshell)) 321| 1.15k| if (strcmp(listshell, usershell) == 0) { ------------------ | Branch (321:7): [True: 1.15k, False: 0] ------------------ 322| | /* have a match */ 323| 1.15k| goto goodshell; 324| 1.15k| } 325| 1.15k| } 326| | /* no matching shell */ 327| 0| endusershell(); 328| 0| TRACE(("no matching shell")) 329| 0| ses.authstate.checkusername_failed = 1; 330| 0| dropbear_log(LOG_WARNING, "User '%s' has invalid shell, rejected", 331| 0| ses.authstate.pw_name); 332| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 333| | 334| 1.15k|goodshell: 335| 1.15k| endusershell(); 336| 1.15k| TRACE(("matching shell")) 337| | 338| 1.15k| TRACE(("uid = %d", ses.authstate.pw_uid)) 339| 1.15k| TRACE(("leave checkusername")) 340| 1.15k| return DROPBEAR_SUCCESS; ------------------ | | 102| 1.15k|#define DROPBEAR_SUCCESS 0 ------------------ 341| 1.15k|} svr_auth_password: 51| 58|void svr_auth_password(int valid_user) { 52| | 53| 58| char * passwdcrypt = NULL; /* the crypt from /etc/passwd or /etc/shadow */ 54| 58| char * testcrypt = NULL; /* crypt generated from the user's password sent */ 55| 58| char * password = NULL; 56| 58| unsigned int passwordlen; 57| 58| unsigned int changepw; 58| | 59| | /* check if client wants to change password */ 60| 58| changepw = buf_getbool(ses.payload); 61| 58| if (changepw) { ------------------ | Branch (61:6): [True: 27, False: 31] ------------------ 62| | /* not implemented by this server */ 63| 27| send_msg_userauth_failure(0, 1); 64| 27| return; 65| 27| } 66| | 67| 31| password = buf_getstring(ses.payload, &passwordlen); 68| 31| if (valid_user && passwordlen <= DROPBEAR_MAX_PASSWORD_LEN) { ------------------ | | 118| 0|#define DROPBEAR_MAX_PASSWORD_LEN 100 ------------------ | Branch (68:6): [True: 0, False: 31] | Branch (68:20): [True: 0, False: 0] ------------------ 69| | /* the first bytes of passwdcrypt are the salt */ 70| 0| passwdcrypt = ses.authstate.pw_passwd; 71| 0| testcrypt = crypt(password, passwdcrypt); 72| 0| } 73| 31| m_burn(password, passwordlen); 74| 31| m_free(password); ------------------ | | 24| 31|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 75| | 76| | /* After we have got the payload contents we can exit if the username 77| | is invalid. Invalid users have already been logged. */ 78| 31| if (!valid_user) { ------------------ | Branch (78:6): [True: 29, False: 2] ------------------ 79| 29| send_msg_userauth_failure(0, 1); 80| 29| return; 81| 29| } 82| | 83| 2| if (passwordlen > DROPBEAR_MAX_PASSWORD_LEN) { ------------------ | | 118| 2|#define DROPBEAR_MAX_PASSWORD_LEN 100 ------------------ | Branch (83:6): [True: 0, False: 2] ------------------ 84| 0| dropbear_log(LOG_WARNING, 85| 0| "Too-long password attempt for '%s' from %s", 86| 0| ses.authstate.pw_name, 87| 0| svr_ses.addrstring); 88| 0| send_msg_userauth_failure(0, 1); 89| 0| return; 90| 0| } 91| | 92| 2| if (testcrypt == NULL) { ------------------ | Branch (92:6): [True: 0, False: 2] ------------------ 93| | /* crypt() with an invalid salt like "!!" */ 94| 0| dropbear_log(LOG_WARNING, "User account '%s' is locked", 95| 0| ses.authstate.pw_name); 96| 0| send_msg_userauth_failure(0, 1); 97| 0| return; 98| 0| } 99| | 100| | /* check for empty password */ 101| 2| if (passwdcrypt[0] == '\0') { ------------------ | Branch (101:6): [True: 0, False: 2] ------------------ 102| 0| dropbear_log(LOG_WARNING, "User '%s' has blank password, rejected", 103| 0| ses.authstate.pw_name); 104| 0| send_msg_userauth_failure(0, 1); 105| 0| return; 106| 0| } 107| | 108| 2| if (constant_time_strcmp(testcrypt, passwdcrypt) == 0) { ------------------ | Branch (108:6): [True: 0, False: 2] ------------------ 109| 0| if (svr_opts.multiauthmethod && (ses.authstate.authtypes & ~AUTH_TYPE_PASSWORD)) { ------------------ | | 89| 0|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ | Branch (109:7): [True: 0, False: 0] | Branch (109:35): [True: 0, False: 0] ------------------ 110| | /* successful password authentication, but extra auth required */ 111| 0| dropbear_log(LOG_NOTICE, 112| 0| "Password auth succeeded for '%s' from %s, extra auth required", 113| 0| ses.authstate.pw_name, 114| 0| svr_ses.addrstring); 115| 0| ses.authstate.authtypes &= ~AUTH_TYPE_PASSWORD; /* password auth ok, delete the method flag */ ------------------ | | 89| 0|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ 116| 0| send_msg_userauth_failure(1, 0); /* Send partial success */ 117| 0| } else { 118| | /* successful authentication */ 119| 0| dropbear_log(LOG_NOTICE, 120| 0| "Password auth succeeded for '%s' from %s", 121| 0| ses.authstate.pw_name, 122| 0| svr_ses.addrstring); 123| 0| send_msg_userauth_success(); 124| 0| } 125| 2| } else { 126| 2| dropbear_log(LOG_WARNING, 127| 2| "Bad password attempt for '%s' from %s", 128| 2| ses.authstate.pw_name, 129| 2| svr_ses.addrstring); 130| 2| send_msg_userauth_failure(0, 1); 131| 2| } 132| 2|} svr_auth_pubkey: 83| 1.17k|void svr_auth_pubkey(int valid_user) { 84| | 85| 1.17k| unsigned char testkey; /* whether we're just checking if a key is usable */ 86| 1.17k| char* sigalgo = NULL; 87| 1.17k| unsigned int sigalgolen; 88| 1.17k| const char* keyalgo; 89| 1.17k| unsigned int keyalgolen; 90| 1.17k| unsigned char* keyblob = NULL; 91| 1.17k| unsigned int keybloblen; 92| 1.17k| unsigned int sign_payload_length; 93| 1.17k| buffer * signbuf = NULL; 94| 1.17k| sign_key * key = NULL; 95| 1.17k| char* fp = NULL; 96| 1.17k| enum signature_type sigtype; 97| 1.17k| enum signkey_type keytype; 98| 1.17k| int auth_failure = 1; 99| | 100| 1.17k| TRACE(("enter pubkeyauth")) 101| | 102| | /* 0 indicates user just wants to check if key can be used, 1 is an 103| | * actual attempt*/ 104| 1.17k| testkey = (buf_getbool(ses.payload) == 0); 105| | 106| 1.17k| sigalgo = buf_getstring(ses.payload, &sigalgolen); 107| 1.17k| keybloblen = buf_getint(ses.payload); 108| 1.17k| keyblob = buf_getptr(ses.payload, keybloblen); 109| | 110| 1.17k| if (!valid_user) { ------------------ | Branch (110:6): [True: 149, False: 1.02k] ------------------ 111| | /* Return failure once we have read the contents of the packet 112| | required to validate a public key. 113| | Avoids blind user enumeration though it isn't possible to prevent 114| | testing for user existence if the public key is known */ 115| 149| send_msg_userauth_failure(0, 0); 116| 149| goto out; 117| 149| } 118| | 119| 1.02k| sigtype = signature_type_from_name(sigalgo, sigalgolen); 120| 1.02k| if (sigtype == DROPBEAR_SIGNATURE_NONE) { ------------------ | Branch (120:6): [True: 957, False: 72] ------------------ 121| 957| send_msg_userauth_failure(0, 0); 122| 957| goto out; 123| 957| } 124| | 125| 72| keytype = signkey_type_from_signature(sigtype); 126| 72| keyalgo = signkey_name_from_type(keytype, &keyalgolen); 127| | 128| |#if DROPBEAR_PLUGIN 129| | if (svr_ses.plugin_instance != NULL) { 130| | char *options_buf; 131| | if (svr_ses.plugin_instance->checkpubkey( 132| | svr_ses.plugin_instance, 133| | &ses.plugin_session, 134| | keyalgo, 135| | keyalgolen, 136| | keyblob, 137| | keybloblen, 138| | ses.authstate.username) == DROPBEAR_SUCCESS) { 139| | /* Success */ 140| | auth_failure = 0; 141| | 142| | /* Options provided? */ 143| | options_buf = ses.plugin_session->get_options(ses.plugin_session); 144| | if (options_buf) { 145| | struct buf temp_buf = { 146| | .data = (unsigned char *)options_buf, 147| | .len = strlen(options_buf), 148| | .pos = 0, 149| | .size = 0 150| | }; 151| | int ret = svr_add_pubkey_options(&temp_buf, 0, "N/A"); 152| | if (ret == DROPBEAR_FAILURE) { 153| | /* Fail immediately as the plugin provided wrong options */ 154| | send_msg_userauth_failure(0, 0); 155| | goto out; 156| | } 157| | } 158| | } 159| | } 160| |#endif 161| | /* check if the key is valid */ 162| 72| if (auth_failure) { ------------------ | Branch (162:13): [True: 0, False: 72] ------------------ 163| 0| auth_failure = checkpubkey(keyalgo, keyalgolen, keyblob, keybloblen) == DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 164| 0| } 165| | 166| 72| if (auth_failure) { ------------------ | Branch (166:13): [True: 0, False: 72] ------------------ 167| 0| send_msg_userauth_failure(0, 0); 168| 0| goto out; 169| 0| } 170| | 171| | /* let them know that the key is ok to use */ 172| 72| if (testkey) { ------------------ | Branch (172:6): [True: 0, False: 72] ------------------ 173| 0| send_msg_userauth_pk_ok(sigalgo, sigalgolen, keyblob, keybloblen); 174| 0| goto out; 175| 0| } 176| | 177| | /* now we can actually verify the signature */ 178| | 179| | /* get the key */ 180| 72| key = new_sign_key(); 181| 72| if (buf_get_pub_key(ses.payload, key, &keytype) == DROPBEAR_FAILURE) { ------------------ | | 103| 72|#define DROPBEAR_FAILURE -1 ------------------ | Branch (181:6): [True: 0, False: 72] ------------------ 182| 0| send_msg_userauth_failure(0, 1); 183| 0| goto out; 184| 0| } 185| | 186| 72|#if DROPBEAR_SK_ECDSA || DROPBEAR_SK_ED25519 187| 72| key->sk_flags_mask = SSH_SK_USER_PRESENCE_REQD; ------------------ | | 131| 72|#define SSH_SK_USER_PRESENCE_REQD 0x01 ------------------ 188| 72| if (ses.authstate.pubkey_options && ses.authstate.pubkey_options->no_touch_required_flag) { ------------------ | Branch (188:6): [True: 0, False: 72] | Branch (188:38): [True: 0, False: 0] ------------------ 189| 0| key->sk_flags_mask &= ~SSH_SK_USER_PRESENCE_REQD; ------------------ | | 131| 0|#define SSH_SK_USER_PRESENCE_REQD 0x01 ------------------ 190| 0| } 191| 72| if (ses.authstate.pubkey_options && ses.authstate.pubkey_options->verify_required_flag) { ------------------ | Branch (191:6): [True: 0, False: 72] | Branch (191:38): [True: 0, False: 0] ------------------ 192| 0| key->sk_flags_mask |= SSH_SK_USER_VERIFICATION_REQD; ------------------ | | 132| 0|#define SSH_SK_USER_VERIFICATION_REQD 0x04 ------------------ 193| 0| } 194| 72|#endif 195| | 196| | /* create the data which has been signed - this a string containing 197| | * session_id, concatenated with the payload packet up to the signature */ 198| 72| assert(ses.payload_beginning <= ses.payload->pos); 199| 0| sign_payload_length = ses.payload->pos - ses.payload_beginning; 200| 0| signbuf = buf_new(ses.payload->pos + 4 + ses.session_id->len); 201| 0| buf_putbufstring(signbuf, ses.session_id); 202| | 203| | /* The entire contents of the payload prior. */ 204| 0| buf_setpos(ses.payload, ses.payload_beginning); 205| 0| buf_putbytes(signbuf, 206| 0| buf_getptr(ses.payload, sign_payload_length), 207| 0| sign_payload_length); 208| 0| buf_incrpos(ses.payload, sign_payload_length); 209| | 210| 0| buf_setpos(signbuf, 0); 211| | 212| | /* ... and finally verify the signature */ 213| 0| fp = sign_key_fingerprint(keyblob, keybloblen); 214| 0| if (buf_verify(ses.payload, key, sigtype, signbuf) == DROPBEAR_SUCCESS) { ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (214:6): [True: 0, False: 0] ------------------ 215| 0| if (svr_opts.multiauthmethod && (ses.authstate.authtypes & ~AUTH_TYPE_PUBKEY)) { ------------------ | | 88| 0|#define AUTH_TYPE_PUBKEY (1 << 1) ------------------ | Branch (215:7): [True: 0, False: 0] | Branch (215:35): [True: 0, False: 0] ------------------ 216| | /* successful pubkey authentication, but extra auth required */ 217| 0| dropbear_log(LOG_NOTICE, 218| 0| "Pubkey auth succeeded for '%s' with %s key %s from %s, extra auth required", 219| 0| ses.authstate.pw_name, 220| 0| signkey_name_from_type(keytype, NULL), fp, 221| 0| svr_ses.addrstring); 222| 0| ses.authstate.authtypes &= ~AUTH_TYPE_PUBKEY; /* pubkey auth ok, delete the method flag */ ------------------ | | 88| 0|#define AUTH_TYPE_PUBKEY (1 << 1) ------------------ 223| 0| send_msg_userauth_failure(1, 0); /* Send partial success */ 224| 0| } else { 225| | /* successful authentication */ 226| 0| dropbear_log(LOG_NOTICE, 227| 0| "Pubkey auth succeeded for '%s' with %s key %s from %s", 228| 0| ses.authstate.pw_name, 229| 0| signkey_name_from_type(keytype, NULL), fp, 230| 0| svr_ses.addrstring); 231| 0| send_msg_userauth_success(); 232| 0| } 233| |#if DROPBEAR_PLUGIN 234| | if ((ses.plugin_session != NULL) && (svr_ses.plugin_instance->auth_success != NULL)) { 235| | /* Was authenticated through the external plugin. tell plugin that signature verification was ok */ 236| | svr_ses.plugin_instance->auth_success(ses.plugin_session); 237| | } 238| |#endif 239| 0| } else { 240| 0| dropbear_log(LOG_WARNING, 241| 0| "Pubkey auth bad signature for '%s' with key %s from %s", 242| 0| ses.authstate.pw_name, fp, svr_ses.addrstring); 243| 0| send_msg_userauth_failure(0, 1); 244| 0| } 245| 0| m_free(fp); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 246| | 247| 1.10k|out: 248| | /* cleanup stuff */ 249| 1.10k| if (signbuf) { ------------------ | Branch (249:6): [True: 0, False: 1.10k] ------------------ 250| 0| buf_free(signbuf); 251| 0| } 252| 1.10k| if (sigalgo) { ------------------ | Branch (252:6): [True: 1.10k, False: 0] ------------------ 253| 1.10k| m_free(sigalgo); ------------------ | | 24| 1.10k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 254| 1.10k| } 255| 1.10k| if (key) { ------------------ | Branch (255:6): [True: 0, False: 1.10k] ------------------ 256| 0| sign_key_free(key); 257| 0| key = NULL; 258| 0| } 259| | /* Retain pubkey options only if auth succeeded */ 260| 1.10k| if (!ses.authstate.authdone) { ------------------ | Branch (260:6): [True: 1.10k, False: 0] ------------------ 261| 1.10k| svr_pubkey_options_cleanup(); 262| 1.10k| } 263| 1.10k| TRACE(("leave pubkeyauth")) 264| 1.10k|} svr_pubkey_options_cleanup: 135| 5.10k|void svr_pubkey_options_cleanup() { 136| 5.10k| if (ses.authstate.pubkey_options) { ------------------ | Branch (136:6): [True: 0, False: 5.10k] ------------------ 137| 0| if (ses.authstate.pubkey_options->forced_command) { ------------------ | Branch (137:7): [True: 0, False: 0] ------------------ 138| 0| m_free(ses.authstate.pubkey_options->forced_command); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 139| 0| } 140| 0| if (ses.authstate.pubkey_options->permit_open_destinations) { ------------------ | Branch (140:7): [True: 0, False: 0] ------------------ 141| 0| m_list_elem *iter = ses.authstate.pubkey_options->permit_open_destinations->first; 142| 0| while (iter) { ------------------ | Branch (142:11): [True: 0, False: 0] ------------------ 143| 0| struct PermitTCPFwdEntry *entry = (struct PermitTCPFwdEntry*)list_remove(iter); 144| 0| m_free(entry->host); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 145| 0| m_free(entry); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 146| 0| iter = ses.authstate.pubkey_options->permit_open_destinations->first; 147| 0| } 148| 0| m_free(ses.authstate.pubkey_options->permit_open_destinations); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 149| 0| } 150| 0| m_free(ses.authstate.pubkey_options); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 151| 0| } 152| 5.10k| if (ses.authstate.pubkey_info) { ------------------ | Branch (152:6): [True: 0, False: 5.10k] ------------------ 153| 0| m_free(ses.authstate.pubkey_info); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 154| 0| } 155| 5.10k|} svr_chansess_checksignal: 95| 407k|void svr_chansess_checksignal(void) { 96| 407k| int status; 97| 407k| pid_t pid; 98| | 99| 407k| if (!ses.channel_signal_pending) { ------------------ | Branch (99:6): [True: 407k, False: 0] ------------------ 100| 407k| return; 101| 407k| } 102| | 103| 0| while ((pid = waitpid(-1, &status, WNOHANG)) > 0) { ------------------ | Branch (103:9): [True: 0, False: 0] ------------------ 104| 0| unsigned int i; 105| 0| struct exitinfo *ex = NULL; 106| 0| TRACE(("svr_chansess_checksignal : pid %d", pid)) 107| | 108| 0| ex = NULL; 109| | /* find the corresponding chansess */ 110| 0| for (i = 0; i < svr_ses.childpidsize; i++) { ------------------ | Branch (110:15): [True: 0, False: 0] ------------------ 111| 0| if (svr_ses.childpids[i].pid == pid) { ------------------ | Branch (111:8): [True: 0, False: 0] ------------------ 112| 0| TRACE(("found match session")); 113| 0| ex = &svr_ses.childpids[i].chansess->exit; 114| 0| break; 115| 0| } 116| 0| } 117| | 118| | /* If the pid wasn't matched, then we might have hit the race mentioned 119| | * above. So we just store the info for the parent to deal with */ 120| 0| if (ex == NULL) { ------------------ | Branch (120:7): [True: 0, False: 0] ------------------ 121| 0| TRACE(("using lastexit")); 122| 0| ex = &svr_ses.lastexit; 123| 0| } 124| | 125| 0| ex->exitpid = pid; 126| 0| if (WIFEXITED(status)) { 127| 0| ex->exitstatus = WEXITSTATUS(status); 128| 0| } 129| 0| if (WIFSIGNALED(status)) { 130| 0| ex->exitsignal = WTERMSIG(status); 131| 0|#if !defined(AIX) && defined(WCOREDUMP) 132| 0| ex->exitcore = WCOREDUMP(status); 133| |#else 134| | ex->exitcore = 0; 135| |#endif 136| 0| } else { 137| | /* we use this to determine how pid exited */ 138| 0| ex->exitsignal = -1; 139| 0| } 140| 0| } 141| 0|} svr_chansessinitialise: 1077| 3.99k|void svr_chansessinitialise() { 1078| | 1079| 3.99k| struct sigaction sa_chld; 1080| | 1081| | /* single child process intially */ 1082| 3.99k| svr_ses.childpids = (struct ChildPid*)m_malloc(sizeof(struct ChildPid)); 1083| 3.99k| svr_ses.childpids[0].pid = -1; /* unused */ 1084| 3.99k| svr_ses.childpids[0].chansess = NULL; 1085| 3.99k| svr_ses.childpidsize = 1; 1086| 3.99k| svr_ses.lastexit.exitpid = -1; /* Nothing has exited yet */ 1087| 3.99k| sa_chld.sa_handler = sesssigchild_handler; 1088| 3.99k| sa_chld.sa_flags = SA_NOCLDSTOP; 1089| 3.99k| sigemptyset(&sa_chld.sa_mask); 1090| 3.99k| if (sigaction(SIGCHLD, &sa_chld, NULL) < 0) { ------------------ | Branch (1090:6): [True: 0, False: 3.99k] ------------------ 1091| 0| dropbear_exit("signal() error"); 1092| 0| } 1093| | 1094| 3.99k|} recv_msg_kexdh_init: 49| 17.4k|void recv_msg_kexdh_init() { 50| 17.4k| DEF_MP_INT(dh_e); ------------------ | | 80| 17.4k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 51| 17.4k| buffer *ecdh_qs = NULL; 52| | 53| 17.4k| TRACE(("enter recv_msg_kexdh_init")) 54| 17.4k| if (!ses.kexstate.recvkexinit) { ------------------ | Branch (54:6): [True: 9, False: 17.4k] ------------------ 55| 9| dropbear_exit("Premature kexdh_init message received"); 56| 9| } 57| | 58| 17.4k| switch (ses.newkeys->algo_kex->mode) { ------------------ | Branch (58:10): [True: 0, False: 17.4k] ------------------ 59| 0|#if DROPBEAR_NORMAL_DH 60| 9.77k| case DROPBEAR_KEX_NORMAL_DH: ------------------ | Branch (60:3): [True: 9.77k, False: 7.71k] ------------------ 61| 9.77k| m_mp_init(&dh_e); 62| 9.77k| if (buf_getmpint(ses.payload, &dh_e) != DROPBEAR_SUCCESS) { ------------------ | | 102| 9.77k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (62:8): [True: 68, False: 9.70k] ------------------ 63| 68| dropbear_exit("Bad kex value"); 64| 68| } 65| 9.70k| break; 66| 9.70k|#endif 67| 9.70k|#if DROPBEAR_ECDH 68| 9.70k| case DROPBEAR_KEX_ECDH: ------------------ | Branch (68:3): [True: 392, False: 17.0k] ------------------ 69| 392|#endif 70| 392|#if DROPBEAR_CURVE25519 71| 7.71k| case DROPBEAR_KEX_CURVE25519: ------------------ | Branch (71:3): [True: 7.32k, False: 10.1k] ------------------ 72| 7.71k|#endif 73| 7.71k|#if DROPBEAR_ECDH || DROPBEAR_CURVE25519 74| 7.71k| ecdh_qs = buf_getstringbuf(ses.payload); 75| 7.71k| break; 76| 17.4k|#endif 77| 17.4k| } 78| 17.3k| if (ses.payload->pos != ses.payload->len) { ------------------ | Branch (78:6): [True: 64, False: 17.2k] ------------------ 79| 64| dropbear_exit("Bad kex value"); 80| 64| } 81| | 82| 17.2k| send_msg_kexdh_reply(&dh_e, ecdh_qs); 83| | 84| 17.2k| mp_clear(&dh_e); 85| 17.2k| if (ecdh_qs) { ------------------ | Branch (85:6): [True: 7.26k, False: 9.99k] ------------------ 86| 7.26k| buf_free(ecdh_qs); 87| 7.26k| ecdh_qs = NULL; 88| 7.26k| } 89| | 90| 17.2k| send_msg_newkeys(); 91| | 92| 17.2k|#if DROPBEAR_EXT_INFO 93| | /* Only send it following the first newkeys */ 94| 17.2k| if (!ses.kexstate.donesecondkex && ses.allow_ext_info) { ------------------ | Branch (94:6): [True: 2.36k, False: 14.8k] | Branch (94:37): [True: 24, False: 2.34k] ------------------ 95| 24| send_msg_ext_info(); 96| 24| } 97| 17.2k|#endif 98| | 99| 17.2k| ses.requirenext = SSH_MSG_NEWKEYS; ------------------ | | 37| 17.2k|#define SSH_MSG_NEWKEYS 21 ------------------ 100| 17.2k| TRACE(("leave recv_msg_kexdh_init")) 101| 17.2k|} svr-kex.c:send_msg_kexdh_reply: 189| 17.2k|static void send_msg_kexdh_reply(mp_int *dh_e, buffer *ecdh_qs) { 190| 17.2k| TRACE(("enter send_msg_kexdh_reply")) 191| | 192| | /* we can start creating the kexdh_reply packet */ 193| 17.2k| CHECKCLEARTOWRITE(); 194| | 195| 17.2k|#if DROPBEAR_DELAY_HOSTKEY 196| 17.2k| if (svr_opts.delay_hostkey) ------------------ | Branch (196:6): [True: 0, False: 17.2k] ------------------ 197| 0| { 198| 0| svr_ensure_hostkey(); 199| 0| } 200| 17.2k|#endif 201| | 202| 17.2k|#if DROPBEAR_FUZZ 203| 17.2k| if (fuzz.fuzzing && fuzz.skip_kexmaths) { ------------------ | Branch (203:6): [True: 17.2k, False: 0] | Branch (203:22): [True: 0, False: 17.2k] ------------------ 204| 0| fuzz_fake_send_kexdh_reply(); 205| 0| return; 206| 0| } 207| 17.2k|#endif 208| | 209| 17.2k| buf_putbyte(ses.writepayload, SSH_MSG_KEXDH_REPLY); ------------------ | | 39| 17.2k|#define SSH_MSG_KEXDH_REPLY 31 ------------------ 210| 17.2k| buf_put_pub_key(ses.writepayload, svr_opts.hostkey, 211| 17.2k| ses.newkeys->algo_hostkey); 212| | 213| 17.2k| switch (ses.newkeys->algo_kex->mode) { ------------------ | Branch (213:10): [True: 2, False: 17.2k] ------------------ 214| 0|#if DROPBEAR_NORMAL_DH 215| 9.63k| case DROPBEAR_KEX_NORMAL_DH: ------------------ | Branch (215:3): [True: 9.63k, False: 7.62k] ------------------ 216| 9.63k| { 217| 9.63k| struct kex_dh_param * dh_param = gen_kexdh_param(); 218| 9.63k| kexdh_comb_key(dh_param, dh_e, svr_opts.hostkey); 219| | 220| | /* put f */ 221| 9.63k| buf_putmpint(ses.writepayload, &dh_param->pub); 222| 9.63k| free_kexdh_param(dh_param); 223| 9.63k| } 224| 9.63k| break; 225| 0|#endif 226| 0|#if DROPBEAR_ECDH 227| 331| case DROPBEAR_KEX_ECDH: ------------------ | Branch (227:3): [True: 331, False: 16.9k] ------------------ 228| 331| { 229| 331| struct kex_ecdh_param *ecdh_param = gen_kexecdh_param(); 230| 331| kexecdh_comb_key(ecdh_param, ecdh_qs, svr_opts.hostkey); 231| | 232| 331| buf_put_ecc_raw_pubkey_string(ses.writepayload, &ecdh_param->key); 233| 331| free_kexecdh_param(ecdh_param); 234| 331| } 235| 331| break; 236| 0|#endif 237| 0|#if DROPBEAR_CURVE25519 238| 7.29k| case DROPBEAR_KEX_CURVE25519: ------------------ | Branch (238:3): [True: 7.29k, False: 9.96k] ------------------ 239| 7.29k| { 240| 7.29k| struct kex_curve25519_param *param = gen_kexcurve25519_param(); 241| 7.29k| kexcurve25519_comb_key(param, ecdh_qs, svr_opts.hostkey); 242| | 243| 7.29k| buf_putstring(ses.writepayload, param->pub, CURVE25519_LEN); ------------------ | | 106| 7.29k|#define CURVE25519_LEN 32 ------------------ 244| 7.29k| free_kexcurve25519_param(param); 245| 7.29k| } 246| 7.29k| break; 247| 17.2k|#endif 248| 17.2k| } 249| | 250| | /* calc the signature */ 251| 16.8k| buf_put_sign(ses.writepayload, svr_opts.hostkey, 252| 16.8k| ses.newkeys->algo_signature, ses.hash); 253| | 254| | /* the SSH_MSG_KEXDH_REPLY is done */ 255| 16.8k| encrypt_packet(); 256| | 257| 16.8k| TRACE(("leave send_msg_kexdh_reply")) 258| 16.8k|} svr-kex.c:send_msg_ext_info: 262| 24|static void send_msg_ext_info(void) { 263| 24| TRACE(("enter send_msg_ext_info")) 264| | 265| 24| buf_putbyte(ses.writepayload, SSH_MSG_EXT_INFO); ------------------ | | 35| 24|#define SSH_MSG_EXT_INFO 7 ------------------ 266| | /* nr-extensions */ 267| 24| buf_putint(ses.writepayload, 1); 268| | 269| 24| buf_putstring(ses.writepayload, SSH_SERVER_SIG_ALGS, strlen(SSH_SERVER_SIG_ALGS)); ------------------ | | 101| 24|#define SSH_SERVER_SIG_ALGS "server-sig-algs" ------------------ buf_putstring(ses.writepayload, SSH_SERVER_SIG_ALGS, strlen(SSH_SERVER_SIG_ALGS)); ------------------ | | 101| 24|#define SSH_SERVER_SIG_ALGS "server-sig-algs" ------------------ 270| 24| buf_put_algolist_all(ses.writepayload, sigalgs, 1); 271| | 272| 24| encrypt_packet(); 273| | 274| 24| TRACE(("leave send_msg_ext_info")) 275| 24|} svr_getopts: 134| 1|void svr_getopts(int argc, char ** argv) { 135| | 136| 1| unsigned int i, j; 137| 1| char ** next = NULL; 138| 1| int nextisport = 0; 139| 1| char* recv_window_arg = NULL; 140| 1| char* keepalive_arg = NULL; 141| 1| char* idle_timeout_arg = NULL; 142| 1| char* maxauthtries_arg = NULL; 143| 1| char* reexec_fd_arg = NULL; 144| 1| char* keyfile = NULL; 145| 1| char c; 146| |#if DROPBEAR_PLUGIN 147| | char* pubkey_plugin = NULL; 148| |#endif 149| | 150| | 151| | /* see printhelp() for options */ 152| 1| svr_opts.bannerfile = NULL; 153| 1| svr_opts.banner = NULL; 154| 1| svr_opts.forced_command = NULL; 155| 1| svr_opts.forkbg = 1; 156| 1| svr_opts.norootlogin = 0; 157| 1|#ifdef HAVE_GETGROUPLIST 158| 1| svr_opts.restrict_group = NULL; 159| 1| svr_opts.restrict_group_gid = 0; 160| 1|#endif 161| 1| svr_opts.noauthpass = 0; 162| 1| svr_opts.norootpass = 0; 163| 1| svr_opts.allowblankpass = 0; 164| 1| svr_opts.multiauthmethod = 0; 165| 1| svr_opts.maxauthtries = MAX_AUTH_TRIES; ------------------ | | 428| 1|#define MAX_AUTH_TRIES 10 ------------------ 166| 1| svr_opts.inetdmode = 0; 167| 1| svr_opts.portcount = 0; 168| 1| svr_opts.hostkey = NULL; 169| 1| svr_opts.delay_hostkey = 0; 170| 1| svr_opts.pidfile = expand_homedir_path(DROPBEAR_PIDFILE); ------------------ | | 444| 1|#define DROPBEAR_PIDFILE "/var/run/dropbear.pid" ------------------ 171| 1|#if DROPBEAR_SVR_LOCALTCPFWD 172| 1| svr_opts.nolocaltcp = 0; 173| 1|#endif 174| 1|#if DROPBEAR_SVR_REMOTETCPFWD 175| 1| svr_opts.noremotetcp = 0; 176| 1|#endif 177| |#if DROPBEAR_PLUGIN 178| | svr_opts.pubkey_plugin = NULL; 179| | svr_opts.pubkey_plugin_options = NULL; 180| |#endif 181| 1| svr_opts.pass_on_env = 0; 182| 1| svr_opts.reexec_childpipe = -1; 183| | 184| |#ifndef DISABLE_ZLIB 185| | opts.compress_mode = DROPBEAR_COMPRESS_DELAYED; 186| |#endif 187| | 188| | /* not yet 189| | opts.ipv4 = 1; 190| | opts.ipv6 = 1; 191| | */ 192| 1|#if DO_MOTD 193| 1| svr_opts.domotd = 1; 194| 1|#endif 195| 1|#ifndef DISABLE_SYSLOG 196| 1| opts.usingsyslog = 1; 197| 1|#endif 198| 1| opts.recv_window = DEFAULT_RECV_WINDOW; ------------------ | | 487| 1|#define DEFAULT_RECV_WINDOW 24576 ------------------ 199| 1| opts.keepalive_secs = DEFAULT_KEEPALIVE; ------------------ | | 503| 1|#define DEFAULT_KEEPALIVE 0 ------------------ 200| 1| opts.idle_timeout_secs = DEFAULT_IDLE_TIMEOUT; ------------------ | | 516| 1|#define DEFAULT_IDLE_TIMEOUT 0 ------------------ 201| | 202| 1|#if DROPBEAR_SVR_REMOTETCPFWD 203| 1| opts.listen_fwd_all = 0; 204| 1|#endif 205| 1| opts.disable_ip_tos = 0; 206| | 207| 2| for (i = 1; i < (unsigned int)argc; i++) { ------------------ | Branch (207:14): [True: 1, False: 1] ------------------ 208| 1| if (argv[i][0] != '-' || argv[i][1] == '\0') ------------------ | Branch (208:7): [True: 0, False: 1] | Branch (208:28): [True: 0, False: 1] ------------------ 209| 0| dropbear_exit("Invalid argument: %s", argv[i]); 210| | 211| 2| for (j = 1; (c = argv[i][j]) != '\0' && !next && !nextisport; j++) { ------------------ | Branch (211:15): [True: 1, False: 1] | Branch (211:43): [True: 1, False: 0] | Branch (211:52): [True: 1, False: 0] ------------------ 212| 1| switch (c) { 213| 0| case 'b': ------------------ | Branch (213:5): [True: 0, False: 1] ------------------ 214| 0| next = &svr_opts.bannerfile; 215| 0| break; 216| 0| case 'c': ------------------ | Branch (216:5): [True: 0, False: 1] ------------------ 217| 0| next = &svr_opts.forced_command; 218| 0| break; 219| 0| case 'd': ------------------ | Branch (219:5): [True: 0, False: 1] ------------------ 220| 0| case 'r': ------------------ | Branch (220:5): [True: 0, False: 1] ------------------ 221| 0| next = &keyfile; 222| 0| break; 223| 0| case 'R': ------------------ | Branch (223:5): [True: 0, False: 1] ------------------ 224| 0| svr_opts.delay_hostkey = 1; 225| 0| break; 226| 0| case 'F': ------------------ | Branch (226:5): [True: 0, False: 1] ------------------ 227| 0| svr_opts.forkbg = 0; 228| 0| break; 229| 0|#ifndef DISABLE_SYSLOG 230| 1| case 'E': ------------------ | Branch (230:5): [True: 1, False: 0] ------------------ 231| 1| opts.usingsyslog = 0; 232| 1| break; 233| 0|#endif 234| 0| case 'e': ------------------ | Branch (234:5): [True: 0, False: 1] ------------------ 235| 0| svr_opts.pass_on_env = 1; 236| 0| break; 237| | 238| 0|#if DROPBEAR_SVR_LOCALTCPFWD 239| 0| case 'j': ------------------ | Branch (239:5): [True: 0, False: 1] ------------------ 240| 0| svr_opts.nolocaltcp = 1; 241| 0| break; 242| 0|#endif 243| 0|#if DROPBEAR_SVR_REMOTETCPFWD 244| 0| case 'k': ------------------ | Branch (244:5): [True: 0, False: 1] ------------------ 245| 0| svr_opts.noremotetcp = 1; 246| 0| break; 247| 0| case 'a': ------------------ | Branch (247:5): [True: 0, False: 1] ------------------ 248| 0| opts.listen_fwd_all = 1; 249| 0| break; 250| 0|#endif 251| 0|#if INETD_MODE 252| 0| case 'i': ------------------ | Branch (252:5): [True: 0, False: 1] ------------------ 253| 0| svr_opts.inetdmode = 1; 254| 0| break; 255| 0|#endif 256| 0|#if DROPBEAR_DO_REEXEC && NON_INETD_MODE 257| | /* For internal use by re-exec */ 258| 0| case '2': ------------------ | Branch (258:5): [True: 0, False: 1] ------------------ 259| 0| next = &reexec_fd_arg; 260| 0| break; 261| 0|#endif 262| 0| case 'p': ------------------ | Branch (262:5): [True: 0, False: 1] ------------------ 263| 0| nextisport = 1; 264| 0| break; 265| 0| case 'P': ------------------ | Branch (265:5): [True: 0, False: 1] ------------------ 266| 0| next = &svr_opts.pidfile; 267| 0| break; 268| 0|#if DO_MOTD 269| | /* motd is displayed by default, -m turns it off */ 270| 0| case 'm': ------------------ | Branch (270:5): [True: 0, False: 1] ------------------ 271| 0| svr_opts.domotd = 0; 272| 0| break; 273| 0|#endif 274| 0| case 'w': ------------------ | Branch (274:5): [True: 0, False: 1] ------------------ 275| 0| svr_opts.norootlogin = 1; 276| 0| break; 277| 0|#ifdef HAVE_GETGROUPLIST 278| 0| case 'G': ------------------ | Branch (278:5): [True: 0, False: 1] ------------------ 279| 0| next = &svr_opts.restrict_group; 280| 0| break; 281| 0|#endif 282| 0| case 'W': ------------------ | Branch (282:5): [True: 0, False: 1] ------------------ 283| 0| next = &recv_window_arg; 284| 0| break; 285| 0| case 'K': ------------------ | Branch (285:5): [True: 0, False: 1] ------------------ 286| 0| next = &keepalive_arg; 287| 0| break; 288| 0| case 'I': ------------------ | Branch (288:5): [True: 0, False: 1] ------------------ 289| 0| next = &idle_timeout_arg; 290| 0| break; 291| 0| case 'T': ------------------ | Branch (291:5): [True: 0, False: 1] ------------------ 292| 0| next = &maxauthtries_arg; 293| 0| break; 294| 0|#if DROPBEAR_SVR_PASSWORD_AUTH || DROPBEAR_SVR_PAM_AUTH 295| 0| case 's': ------------------ | Branch (295:5): [True: 0, False: 1] ------------------ 296| 0| svr_opts.noauthpass = 1; 297| 0| break; 298| 0| case 'g': ------------------ | Branch (298:5): [True: 0, False: 1] ------------------ 299| 0| svr_opts.norootpass = 1; 300| 0| break; 301| 0| case 'B': ------------------ | Branch (301:5): [True: 0, False: 1] ------------------ 302| 0| svr_opts.allowblankpass = 1; 303| 0| break; 304| 0| case 't': ------------------ | Branch (304:5): [True: 0, False: 1] ------------------ 305| 0| svr_opts.multiauthmethod = 1; 306| 0| break; 307| 0|#endif 308| 0| case 'h': ------------------ | Branch (308:5): [True: 0, False: 1] ------------------ 309| 0| printhelp(argv[0]); 310| 0| exit(EXIT_SUCCESS); 311| 0| break; 312| 0| case 'u': ------------------ | Branch (312:5): [True: 0, False: 1] ------------------ 313| | /* backwards compatibility with old urandom option */ 314| 0| break; 315| |#if DROPBEAR_PLUGIN 316| | case 'A': 317| | next = &pubkey_plugin; 318| | break; 319| |#endif 320| |#if DEBUG_TRACE 321| | case 'v': 322| | debug_trace++; 323| | break; 324| |#endif 325| 0| case 'V': ------------------ | Branch (325:5): [True: 0, False: 1] ------------------ 326| 0| print_version(); 327| 0| exit(EXIT_SUCCESS); 328| 0| break; 329| 0| case 'z': ------------------ | Branch (329:5): [True: 0, False: 1] ------------------ 330| 0| opts.disable_ip_tos = 1; 331| 0| break; 332| 0| default: ------------------ | Branch (332:5): [True: 0, False: 1] ------------------ 333| 0| fprintf(stderr, "Invalid option -%c\n", c); ------------------ | | 100| 0|#define stderr (fuzz.fake_stderr) ------------------ 334| 0| printhelp(argv[0]); 335| 0| exit(EXIT_FAILURE); 336| 0| break; 337| 1| } 338| 1| } 339| | 340| 1| if (!next && !nextisport) ------------------ | Branch (340:7): [True: 1, False: 0] | Branch (340:16): [True: 1, False: 0] ------------------ 341| 1| continue; 342| | 343| 0| if (c == '\0') { ------------------ | Branch (343:7): [True: 0, False: 0] ------------------ 344| 0| i++; 345| 0| j = 0; 346| 0| if (!argv[i]) { ------------------ | Branch (346:8): [True: 0, False: 0] ------------------ 347| 0| dropbear_exit("Missing argument"); 348| 0| } 349| 0| } 350| | 351| 0| if (nextisport) { ------------------ | Branch (351:7): [True: 0, False: 0] ------------------ 352| 0| addportandaddress(&argv[i][j]); 353| 0| nextisport = 0; 354| 0| } else if (next) { ------------------ | Branch (354:14): [True: 0, False: 0] ------------------ 355| 0| *next = &argv[i][j]; 356| 0| if (*next == NULL) { ------------------ | Branch (356:8): [True: 0, False: 0] ------------------ 357| 0| dropbear_exit("Invalid null argument"); 358| 0| } 359| 0| next = NULL; 360| | 361| 0| if (keyfile) { ------------------ | Branch (361:8): [True: 0, False: 0] ------------------ 362| 0| addhostkey(keyfile); 363| 0| keyfile = NULL; 364| 0| } 365| 0| } 366| 0| } 367| | 368| | /* Set up listening ports */ 369| 1| if (svr_opts.portcount == 0) { ------------------ | Branch (369:6): [True: 1, False: 0] ------------------ 370| 1| svr_opts.ports[0] = m_strdup(DROPBEAR_DEFPORT); ------------------ | | 23| 1|#define DROPBEAR_DEFPORT "22" ------------------ 371| 1| svr_opts.addresses[0] = m_strdup(DROPBEAR_DEFADDRESS); ------------------ | | 28| 1|#define DROPBEAR_DEFADDRESS "" ------------------ 372| 1| svr_opts.portcount = 1; 373| 1| } 374| | 375| 1| if (svr_opts.bannerfile) { ------------------ | Branch (375:6): [True: 0, False: 1] ------------------ 376| 0| struct stat buf; 377| 0| if (stat(svr_opts.bannerfile, &buf) != 0) { ------------------ | Branch (377:7): [True: 0, False: 0] ------------------ 378| 0| dropbear_exit("Error opening banner file '%s'", 379| 0| svr_opts.bannerfile); 380| 0| } 381| | 382| 0| if (buf.st_size > MAX_BANNER_SIZE) { ------------------ | | 68| 0|#define MAX_BANNER_SIZE 2050 /* this is 25*80 chars, any more is foolish */ ------------------ | Branch (382:7): [True: 0, False: 0] ------------------ 383| 0| dropbear_exit("Banner file too large, max is %d bytes", 384| 0| MAX_BANNER_SIZE); ------------------ | | 68| 0|#define MAX_BANNER_SIZE 2050 /* this is 25*80 chars, any more is foolish */ ------------------ 385| 0| } 386| | 387| 0| svr_opts.banner = buf_new(buf.st_size); 388| 0| if (buf_readfile(svr_opts.banner, svr_opts.bannerfile)!=DROPBEAR_SUCCESS) { ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (388:7): [True: 0, False: 0] ------------------ 389| 0| dropbear_exit("Error reading banner file '%s'", 390| 0| svr_opts.bannerfile); 391| 0| } 392| 0| buf_setpos(svr_opts.banner, 0); 393| 0| } 394| | 395| 1|#ifdef HAVE_GETGROUPLIST 396| 1| if (svr_opts.restrict_group) { ------------------ | Branch (396:6): [True: 0, False: 1] ------------------ 397| 0| struct group *restrictedgroup = getgrnam(svr_opts.restrict_group); 398| | 399| 0| if (restrictedgroup){ ------------------ | Branch (399:7): [True: 0, False: 0] ------------------ 400| 0| svr_opts.restrict_group_gid = restrictedgroup->gr_gid; 401| 0| } else { 402| 0| dropbear_exit("Cannot restrict logins to group '%s' as the group does not exist", svr_opts.restrict_group); 403| 0| } 404| 0| } 405| 1|#endif 406| | 407| 1| if (recv_window_arg) { ------------------ | Branch (407:6): [True: 0, False: 1] ------------------ 408| 0| parse_recv_window(recv_window_arg); 409| 0| } 410| | 411| 1| if (maxauthtries_arg) { ------------------ | Branch (411:6): [True: 0, False: 1] ------------------ 412| 0| unsigned int val = 0; 413| 0| if (m_str_to_uint(maxauthtries_arg, &val) == DROPBEAR_FAILURE ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (413:7): [True: 0, False: 0] ------------------ 414| 0| || val == 0) { ------------------ | Branch (414:7): [True: 0, False: 0] ------------------ 415| 0| dropbear_exit("Bad maxauthtries '%s'", maxauthtries_arg); 416| 0| } 417| 0| svr_opts.maxauthtries = val; 418| 0| } 419| | 420| | 421| 1| if (keepalive_arg) { ------------------ | Branch (421:6): [True: 0, False: 1] ------------------ 422| 0| unsigned int val; 423| 0| if (m_str_to_uint(keepalive_arg, &val) == DROPBEAR_FAILURE) { ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (423:7): [True: 0, False: 0] ------------------ 424| 0| dropbear_exit("Bad keepalive '%s'", keepalive_arg); 425| 0| } 426| 0| opts.keepalive_secs = val; 427| 0| } 428| | 429| 1| if (idle_timeout_arg) { ------------------ | Branch (429:6): [True: 0, False: 1] ------------------ 430| 0| unsigned int val; 431| 0| if (m_str_to_uint(idle_timeout_arg, &val) == DROPBEAR_FAILURE) { ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (431:7): [True: 0, False: 0] ------------------ 432| 0| dropbear_exit("Bad idle_timeout '%s'", idle_timeout_arg); 433| 0| } 434| 0| opts.idle_timeout_secs = val; 435| 0| } 436| | 437| 1| if (svr_opts.forced_command) { ------------------ | Branch (437:6): [True: 0, False: 1] ------------------ 438| 0| dropbear_log(LOG_INFO, "Forced command set to '%s'", svr_opts.forced_command); 439| 0| } 440| | 441| 1| if (reexec_fd_arg) { ------------------ | Branch (441:6): [True: 0, False: 1] ------------------ 442| 0| if (m_str_to_uint(reexec_fd_arg, &svr_opts.reexec_childpipe) == DROPBEAR_FAILURE ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (442:7): [True: 0, False: 0] ------------------ 443| 0| || svr_opts.reexec_childpipe < 0) { ------------------ | Branch (443:7): [True: 0, False: 0] ------------------ 444| 0| dropbear_exit("Bad -2"); 445| 0| } 446| 0| } 447| | 448| 1|#if INETD_MODE 449| 1| if (svr_opts.inetdmode && ( ------------------ | Branch (449:6): [True: 0, False: 1] | Branch (449:28): [True: 0, False: 0] ------------------ 450| 0| opts.usingsyslog == 0 451| |#if DEBUG_TRACE 452| | || debug_trace 453| |#endif 454| 0| )) { 455| | /* log output goes to stderr which would get sent over the inetd network socket */ 456| 0| dropbear_exit("Dropbear inetd mode is incompatible with debug -v or non-syslog"); 457| 0| } 458| 1|#endif 459| | 460| 1| if (svr_opts.multiauthmethod && svr_opts.noauthpass) { ------------------ | Branch (460:6): [True: 0, False: 1] | Branch (460:34): [True: 0, False: 0] ------------------ 461| 0| dropbear_exit("-t and -s are incompatible"); 462| 0| } 463| | 464| |#if DROPBEAR_PLUGIN 465| | if (pubkey_plugin) { 466| | svr_opts.pubkey_plugin = m_strdup(pubkey_plugin); 467| | char *args = strchr(svr_opts.pubkey_plugin, ','); 468| | if (args) { 469| | *args='\0'; 470| | ++args; 471| | } 472| | svr_opts.pubkey_plugin_options = args; 473| | } 474| |#endif 475| 1|} recv_msg_service_request: 37| 693|void recv_msg_service_request() { 38| | 39| 693| char * name; 40| 693| unsigned int len; 41| | 42| 693| TRACE(("enter recv_msg_service_request")) 43| | 44| 693| name = buf_getstring(ses.payload, &len); 45| | 46| | /* ssh-userauth */ 47| 693| if (len == SSH_SERVICE_USERAUTH_LEN && ------------------ | | 105| 1.38k|#define SSH_SERVICE_USERAUTH_LEN 12 ------------------ | Branch (47:6): [True: 562, False: 131] ------------------ 48| 693| strncmp(SSH_SERVICE_USERAUTH, name, len) == 0) { ------------------ | | 104| 562|#define SSH_SERVICE_USERAUTH "ssh-userauth" ------------------ | Branch (48:4): [True: 454, False: 108] ------------------ 49| | 50| 454| send_msg_service_accept(name, len); 51| 454| m_free(name); ------------------ | | 24| 454|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 52| 454| TRACE(("leave recv_msg_service_request: done ssh-userauth")) 53| 454| return; 54| 454| } 55| | 56| | /* ssh-connection */ 57| 239| if (len == SSH_SERVICE_CONNECTION_LEN && ------------------ | | 107| 478|#define SSH_SERVICE_CONNECTION_LEN 14 ------------------ | Branch (57:6): [True: 113, False: 126] ------------------ 58| 239| (strncmp(SSH_SERVICE_CONNECTION, name, len) == 0)) { ------------------ | | 106| 113|#define SSH_SERVICE_CONNECTION "ssh-connection" ------------------ | Branch (58:4): [True: 1, False: 112] ------------------ 59| 1| if (ses.authstate.authdone != 1) { ------------------ | Branch (59:7): [True: 1, False: 0] ------------------ 60| 1| dropbear_exit("Request for connection before auth"); 61| 1| } 62| | 63| 0| send_msg_service_accept(name, len); 64| 0| m_free(name); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 65| 0| TRACE(("leave recv_msg_service_request: done ssh-connection")) 66| 0| return; 67| 1| } 68| | 69| 238| m_free(name); ------------------ | | 24| 238|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 70| | /* TODO this should be a MSG_DISCONNECT */ 71| 238| dropbear_exit("Unrecognised SSH_MSG_SERVICE_REQUEST"); 72| | 73| | 74| 239|} svr-service.c:send_msg_service_accept: 76| 454|static void send_msg_service_accept(const char *name, int len) { 77| | 78| 454| TRACE(("accepting service %s", name)) 79| | 80| 454| CHECKCLEARTOWRITE(); 81| | 82| 454| buf_putbyte(ses.writepayload, SSH_MSG_SERVICE_ACCEPT); ------------------ | | 34| 454|#define SSH_MSG_SERVICE_ACCEPT 6 ------------------ 83| 454| buf_putstring(ses.writepayload, name, len); 84| | 85| 454| encrypt_packet(); 86| | 87| 454|} svr_session: 105| 3.99k|void svr_session(int sock, int childpipe) { 106| 3.99k| char *host, *port; 107| 3.99k| size_t len; 108| | 109| 3.99k| common_session_init(sock, sock); 110| | 111| | /* Initialise server specific parts of the session */ 112| 3.99k| svr_ses.childpipe = childpipe; 113| |#if DROPBEAR_VFORK 114| | svr_ses.server_pid = getpid(); 115| |#endif 116| | 117| | /* for logging the remote address */ 118| 3.99k| get_socket_address(ses.sock_in, NULL, NULL, &host, &port, 0); 119| 3.99k| len = strlen(host) + strlen(port) + 2; 120| 3.99k| svr_ses.addrstring = m_malloc(len); 121| 3.99k| snprintf(svr_ses.addrstring, len, "%s:%s", host, port); 122| 3.99k| m_free(host); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 123| 3.99k| m_free(port); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 124| | 125| |#if DROPBEAR_PLUGIN 126| | /* Initializes the PLUGIN Plugin */ 127| | svr_ses.plugin_handle = NULL; 128| | svr_ses.plugin_instance = NULL; 129| | if (svr_opts.pubkey_plugin) { 130| |#if DEBUG_TRACE 131| | const int verbose = debug_trace; 132| |#else 133| | const int verbose = 0; 134| |#endif 135| | PubkeyExtPlugin_newFn pluginConstructor; 136| | 137| | /* RTLD_NOW: fails if not all the symbols are resolved now. Better fail now than at run-time */ 138| | svr_ses.plugin_handle = dlopen(svr_opts.pubkey_plugin, RTLD_NOW); 139| | if (svr_ses.plugin_handle == NULL) { 140| | dropbear_exit("failed to load external pubkey plugin '%s': %s", svr_opts.pubkey_plugin, dlerror()); 141| | } 142| | pluginConstructor = (PubkeyExtPlugin_newFn)dlsym(svr_ses.plugin_handle, DROPBEAR_PUBKEY_PLUGIN_FNNAME_NEW); 143| | if (!pluginConstructor) { 144| | dropbear_exit("plugin constructor method not found in external pubkey plugin"); 145| | } 146| | 147| | /* Create an instance of the plugin */ 148| | svr_ses.plugin_instance = pluginConstructor(verbose, svr_opts.pubkey_plugin_options, svr_ses.addrstring); 149| | if (svr_ses.plugin_instance == NULL) { 150| | dropbear_exit("external plugin initialization failed"); 151| | } 152| | /* Check if the plugin is compatible */ 153| | if ( (svr_ses.plugin_instance->api_version[0] != DROPBEAR_PLUGIN_VERSION_MAJOR) || 154| | (svr_ses.plugin_instance->api_version[1] < DROPBEAR_PLUGIN_VERSION_MINOR) ) { 155| | dropbear_exit("plugin version check failed: " 156| | "Dropbear=%d.%d, plugin=%d.%d", 157| | DROPBEAR_PLUGIN_VERSION_MAJOR, DROPBEAR_PLUGIN_VERSION_MINOR, 158| | svr_ses.plugin_instance->api_version[0], svr_ses.plugin_instance->api_version[1]); 159| | } 160| | if (svr_ses.plugin_instance->api_version[1] > DROPBEAR_PLUGIN_VERSION_MINOR) { 161| | dropbear_log(LOG_WARNING, "plugin API newer than dropbear API: " 162| | "Dropbear=%d.%d, plugin=%d.%d", 163| | DROPBEAR_PLUGIN_VERSION_MAJOR, DROPBEAR_PLUGIN_VERSION_MINOR, 164| | svr_ses.plugin_instance->api_version[0], svr_ses.plugin_instance->api_version[1]); 165| | } 166| | dropbear_log(LOG_INFO, "successfully loaded and initialized pubkey plugin '%s'", svr_opts.pubkey_plugin); 167| | } 168| |#endif 169| | 170| 3.99k| svr_authinitialise(); 171| 3.99k| chaninitialise(svr_chantypes); 172| 3.99k| svr_chansessinitialise(); 173| 3.99k| svr_algos_initialise(); 174| | 175| 3.99k| get_socket_address(ses.sock_in, NULL, NULL, 176| 3.99k| &svr_ses.remotehost, NULL, 1); 177| | 178| | /* set up messages etc */ 179| 3.99k| ses.remoteclosed = svr_remoteclosed; 180| 3.99k| ses.extra_session_cleanup = svr_session_cleanup; 181| | 182| | /* packet handlers */ 183| 3.99k| ses.packettypes = svr_packettypes; 184| | 185| 3.99k| ses.isserver = 1; 186| | 187| | /* We're ready to go now */ 188| 3.99k| ses.init_done = 1; 189| | 190| | /* exchange identification, version etc */ 191| 3.99k| send_session_identification(); 192| | 193| 3.99k| kexfirstinitialise(); /* initialise the kex state */ 194| | 195| | /* start off with key exchange */ 196| 3.99k| send_msg_kexinit(); 197| | 198| 3.99k|#if DROPBEAR_FUZZ 199| 3.99k| if (fuzz.fuzzing) { ------------------ | Branch (199:9): [True: 3.99k, False: 0] ------------------ 200| 3.99k| fuzz_svr_hook_preloop(); 201| 3.99k| } 202| 3.99k|#endif 203| | 204| | /* Run the main for-loop. */ 205| 3.99k| session_loop(svr_chansess_checksignal); 206| | 207| | /* Not reached */ 208| | 209| 3.99k|} svr_dropbear_exit: 212| 3.99k|void svr_dropbear_exit(int exitcode, const char* format, va_list param) { 213| 3.99k| char exitmsg[150]; 214| 3.99k| char fullmsg[300]; 215| 3.99k| char fromaddr[60]; 216| 3.99k| int i; 217| 3.99k| int add_delay = 0; 218| | 219| |#if DROPBEAR_PLUGIN 220| | if ((ses.plugin_session != NULL)) { 221| | svr_ses.plugin_instance->delete_session(ses.plugin_session); 222| | } 223| | ses.plugin_session = NULL; 224| | svr_opts.pubkey_plugin_options = NULL; 225| | m_free(svr_opts.pubkey_plugin); 226| |#endif 227| | 228| | /* Render the formatted exit message */ 229| 3.99k| vsnprintf(exitmsg, sizeof(exitmsg), format, param); 230| | 231| | /* svr_ses.addrstring may not be set for some early exits, or for 232| | the listener process */ 233| 3.99k| fromaddr[0] = '\0'; 234| 3.99k| if (svr_ses.addrstring) { ------------------ | Branch (234:6): [True: 3.99k, False: 0] ------------------ 235| 3.99k| snprintf(fromaddr, sizeof(fromaddr), " from <%s>", svr_ses.addrstring); 236| 3.99k| } 237| | 238| | /* Add the prefix depending on session/auth state */ 239| 3.99k| if (!ses.init_done) { ------------------ | Branch (239:6): [True: 0, False: 3.99k] ------------------ 240| | /* before session init */ 241| 0| snprintf(fullmsg, sizeof(fullmsg), "Early exit%s: %s", fromaddr, exitmsg); 242| 3.99k| } else if (ses.authstate.authdone) { ------------------ | Branch (242:13): [True: 0, False: 3.99k] ------------------ 243| | /* user has authenticated */ 244| 0| snprintf(fullmsg, sizeof(fullmsg), 245| 0| "Exit (%s)%s: %s", 246| 0| ses.authstate.pw_name, fromaddr, exitmsg); 247| 3.99k| } else if (ses.authstate.pw_name) { ------------------ | Branch (247:13): [True: 31, False: 3.96k] ------------------ 248| | /* we have a potential user */ 249| 31| snprintf(fullmsg, sizeof(fullmsg), 250| 31| "Exit before auth%s: (user '%s', %u fails): %s", 251| 31| fromaddr, ses.authstate.pw_name, ses.authstate.failcount, exitmsg); 252| 31| add_delay = 1; 253| 3.96k| } else { 254| | /* before userauth */ 255| 3.96k| snprintf(fullmsg, sizeof(fullmsg), "Exit before auth%s: %s", fromaddr, exitmsg); 256| 3.96k| add_delay = 1; 257| 3.96k| } 258| | 259| 3.99k| dropbear_log(LOG_INFO, "%s", fullmsg); 260| | 261| | /* To make it harder for attackers, introduce a delay to keep an 262| | * unauthenticated session open a bit longer, thus blocking a connection 263| | * slot until after the delay. Without this, while there is a limit on 264| | * the amount of attempts an attacker can make at the same time 265| | * (MAX_UNAUTH_PER_IP), the time taken by dropbear to handle one attempt 266| | * is still short and thus for each of the allowed parallel attempts 267| | * many attempts can be chained one after the other. The attempt rate is 268| | * then: 269| | * "MAX_UNAUTH_PER_IP / ". 270| | * With the delay, this rate becomes: 271| | * "MAX_UNAUTH_PER_IP / UNAUTH_CLOSE_DELAY". 272| | */ 273| 3.99k| if ((add_delay != 0) && (UNAUTH_CLOSE_DELAY > 0)) { ------------------ | | 436| 3.99k|#define UNAUTH_CLOSE_DELAY 0 ------------------ | Branch (273:6): [True: 3.99k, False: 0] | Branch (273:26): [Folded - Ignored] ------------------ 274| 0| TRACE(("svr_dropbear_exit: start delay of %d seconds", UNAUTH_CLOSE_DELAY)); 275| 0| sleep(UNAUTH_CLOSE_DELAY); ------------------ | | 436| 0|#define UNAUTH_CLOSE_DELAY 0 ------------------ 276| 0| TRACE(("svr_dropbear_exit: end delay of %d seconds", UNAUTH_CLOSE_DELAY)); 277| 0| } 278| | 279| |#if DROPBEAR_VFORK 280| | /* For uclinux only the main server process should cleanup - we don't want 281| | * forked children doing that */ 282| | if (svr_ses.server_pid == getpid()) 283| |#endif 284| 3.99k| { 285| | /* must be after we've done with username etc */ 286| 3.99k| session_cleanup(); 287| 3.99k| } 288| | 289| 3.99k|#if DROPBEAR_FUZZ 290| | /* longjmp before cleaning up svr_opts */ 291| 3.99k| if (fuzz.do_jmp) { ------------------ | Branch (291:9): [True: 3.99k, False: 0] ------------------ 292| 3.99k| longjmp(fuzz.jmp, 1); 293| 3.99k| } 294| 0|#endif 295| | 296| 0| if (svr_opts.hostkey) { ------------------ | Branch (296:6): [True: 0, False: 0] ------------------ 297| 0| sign_key_free(svr_opts.hostkey); 298| 0| svr_opts.hostkey = NULL; 299| 0| } 300| 0| for (i = 0; i < DROPBEAR_MAX_PORTS; i++) { ------------------ | | 80| 0|#define DROPBEAR_MAX_PORTS 10 /* max number of ports which can be specified, ------------------ | Branch (300:14): [True: 0, False: 0] ------------------ 301| 0| m_free(svr_opts.addresses[i]); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 302| 0| m_free(svr_opts.ports[i]); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 303| 0| } 304| | 305| | 306| 0| exit(exitcode); 307| | 308| 3.99k|} svr-session.c:svr_session_cleanup: 83| 3.99k|svr_session_cleanup(void) { 84| | /* free potential public key options */ 85| 3.99k| svr_pubkey_options_cleanup(); 86| | 87| 3.99k| m_free(svr_ses.addrstring); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 88| 3.99k| m_free(svr_ses.remotehost); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 89| 3.99k| m_free(svr_ses.childpids); ------------------ | | 24| 3.99k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 90| 3.99k| svr_ses.childpidsize = 0; 91| | 92| |#if DROPBEAR_PLUGIN 93| | if (svr_ses.plugin_handle != NULL) { 94| | if (svr_ses.plugin_instance) { 95| | svr_ses.plugin_instance->delete_plugin(svr_ses.plugin_instance); 96| | svr_ses.plugin_instance = NULL; 97| | } 98| | 99| | dlclose(svr_ses.plugin_handle); 100| | svr_ses.plugin_handle = NULL; 101| | } 102| |#endif 103| 3.99k|} svr-session.c:svr_remoteclosed: 348| 1.84k|static void svr_remoteclosed() { 349| | 350| 1.84k| m_close(ses.sock_in); 351| 1.84k| if (ses.sock_in != ses.sock_out) { ------------------ | Branch (351:6): [True: 0, False: 1.84k] ------------------ 352| 0| m_close(ses.sock_out); 353| 0| } 354| 1.84k| ses.sock_in = -1; 355| 1.84k| ses.sock_out = -1; 356| 1.84k| dropbear_close("Exited normally"); 357| | 358| 1.84k|} svr-session.c:svr_algos_initialise: 360| 3.99k|static void svr_algos_initialise(void) { 361| 3.99k| algo_type *algo; 362| 39.9k| for (algo = sshkex; algo->name; algo++) { ------------------ | Branch (362:22): [True: 35.9k, False: 3.99k] ------------------ 363| |#if DROPBEAR_DH_GROUP1 && DROPBEAR_DH_GROUP1_CLIENTONLY 364| | if (strcmp(algo->name, "diffie-hellman-group1-sha1") == 0) { 365| | algo->usable = 0; 366| | } 367| |#endif 368| 35.9k|#if DROPBEAR_EXT_INFO 369| 35.9k| if (strcmp(algo->name, SSH_EXT_INFO_C) == 0) { ------------------ | | 100| 35.9k|#define SSH_EXT_INFO_C "ext-info-c" ------------------ | Branch (369:7): [True: 3.99k, False: 31.9k] ------------------ 370| 3.99k| algo->usable = 0; 371| 3.99k| } 372| 35.9k|#endif 373| 35.9k| } 374| 3.99k|}