fuzz_early_setup: 23| 2|void fuzz_early_setup(void) { 24| | /* Set stderr to point to normal stderr by default */ 25| 2| fuzz.fake_stderr = stderr; 26| 2|} fuzz_common_setup: 28| 1|void fuzz_common_setup(void) { 29| 1| disallow_core(); 30| 1| fuzz.fuzzing = 1; 31| 1| fuzz.wrapfds = 1; 32| 1| fuzz.do_jmp = 1; 33| 1| fuzz.input = m_malloc(sizeof(buffer)); 34| 1| _dropbear_log = fuzz_dropbear_log; 35| 1| crypto_init(); 36| 1| fuzz_seed("start", 5); 37| | /* let any messages get flushed */ 38| 1| setlinebuf(stdout); 39| |#if DEBUG_TRACE 40| | if (debug_trace) 41| | { 42| | fprintf(stderr, "Dropbear fuzzer: -v specified, not disabling stderr output\n"); 43| | } 44| | else 45| |#endif 46| 1| if (getenv("DROPBEAR_KEEP_STDERR")) { ------------------ | Branch (46:9): [True: 0, False: 1] ------------------ 47| 0| fprintf(stderr, "Dropbear fuzzer: DROPBEAR_KEEP_STDERR, not disabling stderr output\n"); 48| 0| } 49| 1| else 50| 1| { 51| 1| fprintf(stderr, "Dropbear fuzzer: Disabling stderr output\n"); 52| 1| fuzz.fake_stderr = fopen("/dev/null", "w"); 53| 1| assert(fuzz.fake_stderr); 54| 1| } 55| 1|} fuzz_set_input: 57| 3.14k|int fuzz_set_input(const uint8_t *Data, size_t Size) { 58| | 59| 3.14k| fuzz.input->data = (unsigned char*)Data; 60| 3.14k| fuzz.input->size = Size; 61| 3.14k| fuzz.input->len = Size; 62| 3.14k| fuzz.input->pos = 0; 63| | 64| 3.14k| memset(&ses, 0x0, sizeof(ses)); 65| 3.14k| memset(&svr_ses, 0x0, sizeof(svr_ses)); 66| 3.14k| memset(&cli_ses, 0x0, sizeof(cli_ses)); 67| 3.14k| wrapfd_setup(fuzz.input); 68| | // printhex("input", fuzz.input->data, fuzz.input->len); 69| | 70| 3.14k| fuzz_seed(fuzz.input->data, MIN(fuzz.input->len, 16)); 71| | 72| 3.14k| return DROPBEAR_SUCCESS; ------------------ | | 102| 3.14k|#define DROPBEAR_SUCCESS 0 ------------------ 73| 3.14k|} fuzz_svr_setup: 89| 1|void fuzz_svr_setup(void) { 90| 1| fuzz_common_setup(); 91| | 92| 1| _dropbear_exit = svr_dropbear_exit; 93| | 94| 1| char *argv[] = { 95| 1| "dropbear", 96| 1| "-E", 97| 1| }; 98| | 99| 1| int argc = sizeof(argv) / sizeof(*argv); 100| 1| svr_getopts(argc, argv); 101| | 102| 1| load_fixed_hostkeys(); 103| 1|} fuzz_svr_hook_preloop: 105| 3.14k|void fuzz_svr_hook_preloop() { 106| 3.14k| if (fuzz.svr_postauth) { ------------------ | Branch (106:9): [True: 0, False: 3.14k] ------------------ 107| 0| ses.authstate.authdone = 1; 108| 0| fill_passwd("root"); 109| 0| } 110| 3.14k|} fuzz_kex_fakealgos: 197| 9.32k|void fuzz_kex_fakealgos(void) { 198| 9.32k| ses.newkeys->recv.crypt_mode = &dropbear_mode_none; 199| 9.32k| ses.newkeys->recv.algo_mac = &dropbear_nohash; 200| 9.32k|} fuzz_get_socket_address: 203| 6.29k| char **remote_host, char **remote_port, int UNUSED(host_lookup)) { 204| 6.29k| if (local_host) { ------------------ | Branch (204:9): [True: 0, False: 6.29k] ------------------ 205| 0| *local_host = m_strdup("fuzzlocalhost"); 206| 0| } 207| 6.29k| if (local_port) { ------------------ | Branch (207:9): [True: 0, False: 6.29k] ------------------ 208| 0| *local_port = m_strdup("1234"); 209| 0| } 210| 6.29k| if (remote_host) { ------------------ | Branch (210:9): [True: 6.29k, False: 0] ------------------ 211| 6.29k| *remote_host = m_strdup("fuzzremotehost"); 212| 6.29k| } 213| 6.29k| if (remote_port) { ------------------ | Branch (213:9): [True: 3.14k, False: 3.14k] ------------------ 214| 3.14k| *remote_port = m_strdup("9876"); 215| 3.14k| } 216| 6.29k|} fuzz_fake_send_kexdh_reply: 219| 8.93k|void fuzz_fake_send_kexdh_reply(void) { 220| 8.93k| assert(!ses.dh_K); 221| 8.93k| m_mp_alloc_init_multi(&ses.dh_K, NULL); 222| 8.93k| mp_set_ul(ses.dh_K, 12345678uL); 223| 8.93k| finish_kexhashbuf(); 224| 8.93k|} fuzz_run_server: 264| 3.14k|int fuzz_run_server(const uint8_t *Data, size_t Size, int skip_kexmaths, int postauth) { 265| 3.14k| static int once = 0; 266| 3.14k| if (!once) { ------------------ | Branch (266:9): [True: 1, False: 3.14k] ------------------ 267| 1| fuzz_svr_setup(); 268| 1| fuzz.skip_kexmaths = skip_kexmaths; 269| 1| once = 1; 270| 1| } 271| | 272| 3.14k| fuzz.svr_postauth = postauth; 273| | 274| 3.14k| if (fuzz_set_input(Data, Size) == DROPBEAR_FAILURE) { ------------------ | | 103| 3.14k|#define DROPBEAR_FAILURE -1 ------------------ | Branch (274:9): [True: 0, False: 3.14k] ------------------ 275| 0| return 0; 276| 0| } 277| | 278| 3.14k| uint32_t wrapseed; 279| 3.14k| genrandom((void*)&wrapseed, sizeof(wrapseed)); 280| 3.14k| wrapfd_setseed(wrapseed); 281| | 282| 3.14k| int fakesock = wrapfd_new_fuzzinput(); 283| | 284| 3.14k| m_malloc_set_epoch(1); 285| 3.14k| fuzz.do_jmp = 1; 286| 3.14k| if (setjmp(fuzz.jmp) == 0) { ------------------ | Branch (286:9): [True: 3.14k, False: 0] ------------------ 287| 3.14k| svr_session(fakesock, fakesock); 288| 0| m_malloc_free_epoch(1, 0); 289| 0| } else { 290| 0| fuzz.do_jmp = 0; 291| 0| m_malloc_free_epoch(1, 1); 292| 0| TRACE(("dropbear_exit longjmped")) 293| | /* dropbear_exit jumped here */ 294| 0| } 295| | 296| 0| return 0; 297| 3.14k|} fuzz_dump: 345| 126k|void fuzz_dump(const unsigned char* data, size_t len) { 346| 126k| if (fuzz.dumping) { ------------------ | Branch (346:9): [True: 0, False: 126k] ------------------ 347| 0| TRACE(("dump %zu", len)) 348| 0| assert(atomicio(vwrite, fuzz.recv_dumpfd, (void*)data, len) == len); 349| 0| } 350| 126k|} fuzz_getpwnam: 373| 582|struct passwd* fuzz_getpwnam(const char *login) { 374| 582| if (!fuzz.fuzzing) { ------------------ | Branch (374:9): [True: 0, False: 582] ------------------ 375| 0| return getpwnam(login); 376| 0| } 377| 582| if (strcmp(login, pwd_other.pw_name) == 0) { ------------------ | Branch (377:9): [True: 0, False: 582] ------------------ 378| 0| return &pwd_other; 379| 0| } 380| 582| if (strcmp(login, pwd_root.pw_name) == 0) { ------------------ | Branch (380:9): [True: 23, False: 559] ------------------ 381| 23| return &pwd_root; 382| 23| } 383| 559| return NULL; 384| 582|} fuzz-common.c:fuzz_dropbear_log: 84| 3.70k|static void fuzz_dropbear_log(int UNUSED(priority), const char* UNUSED(format), va_list UNUSED(param)) { 85| | /* No print */ 86| 3.70k|} fuzz-common.c:load_fixed_hostkeys: 153| 1|static void load_fixed_hostkeys(void) { 154| | 155| 1| buffer *b = buf_new(3000); 156| 1| enum signkey_type type; 157| | 158| 1| TRACE(("load fixed hostkeys")) 159| | 160| 1| svr_opts.hostkey = new_sign_key(); 161| | 162| 1| buf_setlen(b, 0); 163| 1| buf_putbytes(b, keyr, keyr_len); 164| 1| buf_setpos(b, 0); 165| 1| type = DROPBEAR_SIGNKEY_RSA; 166| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (166:9): [True: 0, False: 1] ------------------ 167| 0| dropbear_exit("failed fixed rsa hostkey"); 168| 0| } 169| | 170| 1| buf_setlen(b, 0); 171| 1| buf_putbytes(b, keyd, keyd_len); 172| 1| buf_setpos(b, 0); 173| 1| type = DROPBEAR_SIGNKEY_DSS; 174| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (174:9): [True: 0, False: 1] ------------------ 175| 0| dropbear_exit("failed fixed dss hostkey"); 176| 0| } 177| | 178| 1| buf_setlen(b, 0); 179| 1| buf_putbytes(b, keye, keye_len); 180| 1| buf_setpos(b, 0); 181| 1| type = DROPBEAR_SIGNKEY_ECDSA_NISTP256; 182| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (182:9): [True: 0, False: 1] ------------------ 183| 0| dropbear_exit("failed fixed ecdsa hostkey"); 184| 0| } 185| | 186| 1| buf_setlen(b, 0); 187| 1| buf_putbytes(b, keyed25519, keyed25519_len); 188| 1| buf_setpos(b, 0); 189| 1| type = DROPBEAR_SIGNKEY_ED25519; 190| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (190:9): [True: 0, False: 1] ------------------ 191| 0| dropbear_exit("failed fixed ed25519 hostkey"); 192| 0| } 193| | 194| 1| buf_free(b); 195| 1|} fuzz-sshpacketmutator.c:alloc_static_buffers: 126| 2|static void alloc_static_buffers() { 127| | 128| 2| int i; 129| 2| oup = buf_new(MAX_OUT_SIZE); 130| 2| alloc_packetA = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 215| 2|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ 131| 2| alloc_packetB = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 215| 2|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ 132| | 133| 1.00k| for (i = 0; i < MAX_FUZZ_PACKETS; i++) { ------------------ | | 20| 1.00k|#define MAX_FUZZ_PACKETS 500 ------------------ | Branch (133:17): [True: 1.00k, False: 2] ------------------ 134| 1.00k| packets1[i] = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 215| 1.00k|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ 135| 1.00k| } 136| 1.00k| for (i = 0; i < MAX_FUZZ_PACKETS; i++) { ------------------ | | 20| 1.00k|#define MAX_FUZZ_PACKETS 500 ------------------ | Branch (136:17): [True: 1.00k, False: 2] ------------------ 137| 1.00k| packets2[i] = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 215| 1.00k|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ 138| 1.00k| } 139| 2|} wrapfd_setup: 32| 3.14k|void wrapfd_setup(buffer *buf) { 33| 3.14k| TRACE(("wrapfd_setup")) 34| | 35| | // clean old ones 36| 3.14k| int i; 37| 25.1k| for (i = 0; i <= wrapfd_maxfd; i++) { ------------------ | Branch (37:14): [True: 22.0k, False: 3.14k] ------------------ 38| 22.0k| if (wrap_fds[i].mode != UNUSED) { ------------------ | Branch (38:7): [True: 1.70k, False: 20.3k] ------------------ 39| 1.70k| wrapfd_remove(i); 40| 1.70k| } 41| 22.0k| } 42| 3.14k| wrapfd_maxfd = -1; 43| | 44| 3.14k| memset(rand_state, 0x0, sizeof(rand_state)); 45| 3.14k| wrapfd_setseed(50); 46| 3.14k| input_buf = buf; 47| 3.14k|} wrapfd_setseed: 49| 6.29k|void wrapfd_setseed(uint32_t seed) { 50| 6.29k| memcpy(rand_state, &seed, sizeof(seed)); 51| 6.29k| nrand48(rand_state); 52| 6.29k|} wrapfd_new_fuzzinput: 54| 3.14k|int wrapfd_new_fuzzinput() { 55| 3.14k| if (devnull_fd == -1) { ------------------ | Branch (55:6): [True: 1, False: 3.14k] ------------------ 56| 1| devnull_fd = open("/dev/null", O_RDONLY); 57| 1| assert(devnull_fd != -1); 58| 1| } 59| | 60| 3.14k| int fd = dup(devnull_fd); 61| 3.14k| assert(fd != -1); 62| 3.14k| assert(wrap_fds[fd].mode == UNUSED); 63| 3.14k| wrap_fds[fd].mode = COMMONBUF; 64| 3.14k| wrap_fds[fd].closein = 0; 65| 3.14k| wrap_fds[fd].closeout = 0; 66| 3.14k| wrapfd_maxfd = MAX(fd, wrapfd_maxfd); 67| | 68| 3.14k| return fd; 69| 3.14k|} wrapfd_close: 105| 1.43k|int wrapfd_close(int fd) { 106| 1.43k| if (fd >= 0 && fd <= IOWRAP_MAXFD && wrap_fds[fd].mode != UNUSED) { ------------------ | | 9| 2.87k|#define IOWRAP_MAXFD (FD_SETSIZE-1) ------------------ | Branch (106:6): [True: 1.43k, False: 0] | Branch (106:17): [True: 1.43k, False: 0] | Branch (106:39): [True: 1.43k, False: 0] ------------------ 107| 1.43k| wrapfd_remove(fd); 108| 1.43k| return 0; 109| 1.43k| } else { 110| 0| return close(fd); 111| 0| } 112| 1.43k|} wrapfd_read: 114| 353k|int wrapfd_read(int fd, void *out, size_t count) { 115| 353k| size_t maxread; 116| | 117| 353k| if (!fuzz.wrapfds) { ------------------ | Branch (117:6): [True: 0, False: 353k] ------------------ 118| 0| return read(fd, out, count); 119| 0| } 120| | 121| 353k| if (fd < 0 || fd > IOWRAP_MAXFD || wrap_fds[fd].mode == UNUSED) { ------------------ | | 9| 707k|#define IOWRAP_MAXFD (FD_SETSIZE-1) ------------------ | Branch (121:6): [True: 0, False: 353k] | Branch (121:16): [True: 0, False: 353k] | Branch (121:37): [True: 0, False: 353k] ------------------ 122| | /* XXX - assertion failure? */ 123| 0| TRACE(("Bad read descriptor %d\n", fd)) 124| 0| errno = EBADF; 125| 0| return -1; 126| 0| } 127| | 128| 353k| assert(count != 0); 129| | 130| 353k| if (wrap_fds[fd].closein || erand48(rand_state) < CHANCE_CLOSE) { ------------------ | Branch (130:6): [True: 0, False: 353k] | Branch (130:30): [True: 5, False: 353k] ------------------ 131| 5| wrap_fds[fd].closein = 1; 132| 5| errno = ECONNRESET; 133| 5| return -1; 134| 5| } 135| | 136| 353k| if (erand48(rand_state) < CHANCE_INTR) { ------------------ | Branch (136:6): [True: 443, False: 353k] ------------------ 137| 443| errno = EINTR; 138| 443| return -1; 139| 443| } 140| | 141| 353k| if (input_buf && wrap_fds[fd].mode == COMMONBUF) { ------------------ | Branch (141:6): [True: 353k, False: 0] | Branch (141:19): [True: 353k, False: 0] ------------------ 142| 353k| maxread = MIN(input_buf->len - input_buf->pos, count); 143| | /* returns 0 if buf is EOF, as intended */ 144| 353k| if (maxread > 0) { ------------------ | Branch (144:7): [True: 351k, False: 1.38k] ------------------ 145| 351k| maxread = nrand48(rand_state) % maxread + 1; 146| 351k| } 147| 353k| memcpy(out, buf_getptr(input_buf, maxread), maxread); 148| 353k| buf_incrpos(input_buf, maxread); 149| 353k| return maxread; 150| 353k| } 151| | 152| | // return fixed output, of random length 153| 0| maxread = MIN(MAX_RANDOM_IN, count); 154| 0| maxread = nrand48(rand_state) % maxread + 1; 155| 0| memset(out, 0xef, maxread); 156| 0| return maxread; 157| 353k|} wrapfd_select: 196| 344k| fd_set *exceptfds, struct timeval *timeout) { 197| 344k| int i, nset, sel; 198| 344k| int ret = 0; 199| 344k| int fdlist[IOWRAP_MAXFD+1]; 200| | 201| 344k| if (!fuzz.wrapfds) { ------------------ | Branch (201:6): [True: 0, False: 344k] ------------------ 202| 0| return select(nfds, readfds, writefds, exceptfds, timeout); 203| 0| } 204| | 205| 344k| assert(nfds <= IOWRAP_MAXFD+1); 206| | 207| 344k| if (erand48(rand_state) < CHANCE_INTR) { ------------------ | Branch (207:6): [True: 369, False: 344k] ------------------ 208| 369| errno = EINTR; 209| 369| return -1; 210| 369| } 211| | 212| | /* read */ 213| 344k| if (readfds != NULL && erand48(rand_state) < CHANCE_READ1) { ------------------ | Branch (213:6): [True: 344k, False: 0] | Branch (213:25): [True: 324k, False: 20.3k] ------------------ 214| 2.59M| for (i = 0, nset = 0; i < nfds; i++) { ------------------ | Branch (214:25): [True: 2.26M, False: 324k] ------------------ 215| 2.26M| if (FD_ISSET(i, readfds)) { 216| 318k| assert(wrap_fds[i].mode != UNUSED); 217| 318k| fdlist[nset] = i; 218| 318k| nset++; 219| 318k| } 220| 2.26M| } 221| 324k| DROPBEAR_FD_ZERO(readfds); ------------------ | | 104| 324k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 222| | 223| 324k| if (nset > 0) { ------------------ | Branch (223:7): [True: 318k, False: 6.15k] ------------------ 224| | /* set one */ 225| 318k| sel = fdlist[nrand48(rand_state) % nset]; 226| 318k| FD_SET(sel, readfds); 227| 318k| ret++; 228| | 229| 318k| if (erand48(rand_state) < CHANCE_READ2) { ------------------ | Branch (229:8): [True: 159k, False: 158k] ------------------ 230| 159k| sel = fdlist[nrand48(rand_state) % nset]; 231| 159k| if (!FD_ISSET(sel, readfds)) { ------------------ | Branch (231:9): [True: 0, False: 159k] ------------------ 232| 0| FD_SET(sel, readfds); 233| 0| ret++; 234| 0| } 235| 159k| } 236| 318k| } 237| 324k| } 238| | 239| | /* write */ 240| 344k| if (writefds != NULL && erand48(rand_state) < CHANCE_WRITE1) { ------------------ | Branch (240:6): [True: 272k, False: 72.1k] | Branch (240:26): [True: 261k, False: 11.2k] ------------------ 241| 2.08M| for (i = 0, nset = 0; i < nfds; i++) { ------------------ | Branch (241:25): [True: 1.82M, False: 261k] ------------------ 242| 1.82M| if (FD_ISSET(i, writefds)) { 243| 6.44k| assert(wrap_fds[i].mode != UNUSED); 244| 6.44k| fdlist[nset] = i; 245| 6.44k| nset++; 246| 6.44k| } 247| 1.82M| } 248| 261k| DROPBEAR_FD_ZERO(writefds); ------------------ | | 104| 261k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 249| | 250| | /* set one */ 251| 261k| if (nset > 0) { ------------------ | Branch (251:7): [True: 6.44k, False: 254k] ------------------ 252| 6.44k| sel = fdlist[nrand48(rand_state) % nset]; 253| 6.44k| FD_SET(sel, writefds); 254| 6.44k| ret++; 255| | 256| 6.44k| if (erand48(rand_state) < CHANCE_WRITE2) { ------------------ | Branch (256:8): [True: 1.53k, False: 4.90k] ------------------ 257| 1.53k| sel = fdlist[nrand48(rand_state) % nset]; 258| 1.53k| if (!FD_ISSET(sel, writefds)) { ------------------ | Branch (258:9): [True: 0, False: 1.53k] ------------------ 259| 0| FD_SET(sel, writefds); 260| 0| ret++; 261| 0| } 262| 1.53k| } 263| 6.44k| } 264| 261k| } 265| 344k| return ret; 266| 344k|} fuzz-wrapfd.c:wrapfd_remove: 96| 3.14k|static void wrapfd_remove(int fd) { 97| 3.14k| TRACE(("wrapfd_remove %d", fd)) 98| 3.14k| assert(fd >= 0); 99| 3.14k| assert(fd <= IOWRAP_MAXFD); 100| 3.14k| assert(wrap_fds[fd].mode != UNUSED); 101| 3.14k| wrap_fds[fd].mode = UNUSED; 102| 3.14k| close(fd); 103| 3.14k|} LLVMFuzzerTestOneInput: 3| 3.14k|int LLVMFuzzerTestOneInput(const uint8_t *Data, size_t Size) { 4| 3.14k| return fuzz_run_server(Data, Size, 1, 0); 5| 3.14k|} rijndael_setup: 123| 1.28k|{ 124| 1.28k| int i; 125| 1.28k| ulong32 temp, *rk; 126| 1.28k|#ifndef ENCRYPT_ONLY 127| 1.28k| ulong32 *rrk; 128| 1.28k|#endif 129| 1.28k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 1.28k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.28k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 130| 1.28k| LTC_ARGCHK(skey != NULL); ------------------ | | 32| 1.28k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.28k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 131| | 132| 1.28k| if (keylen != 16 && keylen != 24 && keylen != 32) { ------------------ | Branch (132:9): [True: 272, False: 1.01k] | Branch (132:25): [True: 272, False: 0] | Branch (132:41): [True: 0, False: 272] ------------------ 133| 0| return CRYPT_INVALID_KEYSIZE; 134| 0| } 135| | 136| 1.28k| if (num_rounds != 0 && num_rounds != (10 + ((keylen/8)-2)*2)) { ------------------ | Branch (136:9): [True: 0, False: 1.28k] | Branch (136:28): [True: 0, False: 0] ------------------ 137| 0| return CRYPT_INVALID_ROUNDS; 138| 0| } 139| | 140| 1.28k| skey->rijndael.Nr = 10 + ((keylen/8)-2)*2; 141| | 142| | /* setup the forward key */ 143| 1.28k| i = 0; 144| 1.28k| rk = skey->rijndael.eK; 145| 1.28k| LOAD32H(rk[0], key ); ------------------ | | 66| 1.28k|#define LOAD32H(x, y) \ | | 67| 1.28k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 1.28k|#define XMEMCPY memcpy | | ------------------ | | 68| 1.28k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 146| 1.28k| LOAD32H(rk[1], key + 4); ------------------ | | 66| 1.28k|#define LOAD32H(x, y) \ | | 67| 1.28k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 1.28k|#define XMEMCPY memcpy | | ------------------ | | 68| 1.28k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 147| 1.28k| LOAD32H(rk[2], key + 8); ------------------ | | 66| 1.28k|#define LOAD32H(x, y) \ | | 67| 1.28k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 1.28k|#define XMEMCPY memcpy | | ------------------ | | 68| 1.28k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 148| 1.28k| LOAD32H(rk[3], key + 12); ------------------ | | 66| 1.28k|#define LOAD32H(x, y) \ | | 67| 1.28k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 1.28k|#define XMEMCPY memcpy | | ------------------ | | 68| 1.28k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 149| 1.28k| if (keylen == 16) { ------------------ | Branch (149:9): [True: 1.01k, False: 272] ------------------ 150| 10.1k| for (;;) { 151| 10.1k| temp = rk[3]; 152| 10.1k| rk[4] = rk[0] ^ setup_mix(temp) ^ rcon[i]; 153| 10.1k| rk[5] = rk[1] ^ rk[4]; 154| 10.1k| rk[6] = rk[2] ^ rk[5]; 155| 10.1k| rk[7] = rk[3] ^ rk[6]; 156| 10.1k| if (++i == 10) { ------------------ | Branch (156:17): [True: 1.01k, False: 9.11k] ------------------ 157| 1.01k| break; 158| 1.01k| } 159| 9.11k| rk += 4; 160| 9.11k| } 161| 1.01k| } else if (keylen == 24) { ------------------ | Branch (161:16): [True: 0, False: 272] ------------------ 162| 0| LOAD32H(rk[4], key + 16); ------------------ | | 66| 0|#define LOAD32H(x, y) \ | | 67| 0|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 0|#define XMEMCPY memcpy | | ------------------ | | 68| 0| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 163| 0| LOAD32H(rk[5], key + 20); ------------------ | | 66| 0|#define LOAD32H(x, y) \ | | 67| 0|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 0|#define XMEMCPY memcpy | | ------------------ | | 68| 0| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 164| 0| for (;;) { 165| | #ifdef _MSC_VER 166| | temp = skey->rijndael.eK[rk - skey->rijndael.eK + 5]; 167| | #else 168| 0| temp = rk[5]; 169| 0| #endif 170| 0| rk[ 6] = rk[ 0] ^ setup_mix(temp) ^ rcon[i]; 171| 0| rk[ 7] = rk[ 1] ^ rk[ 6]; 172| 0| rk[ 8] = rk[ 2] ^ rk[ 7]; 173| 0| rk[ 9] = rk[ 3] ^ rk[ 8]; 174| 0| if (++i == 8) { ------------------ | Branch (174:17): [True: 0, False: 0] ------------------ 175| 0| break; 176| 0| } 177| 0| rk[10] = rk[ 4] ^ rk[ 9]; 178| 0| rk[11] = rk[ 5] ^ rk[10]; 179| 0| rk += 6; 180| 0| } 181| 272| } else if (keylen == 32) { ------------------ | Branch (181:16): [True: 272, False: 0] ------------------ 182| 272| LOAD32H(rk[4], key + 16); ------------------ | | 66| 272|#define LOAD32H(x, y) \ | | 67| 272|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 272|#define XMEMCPY memcpy | | ------------------ | | 68| 272| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 183| 272| LOAD32H(rk[5], key + 20); ------------------ | | 66| 272|#define LOAD32H(x, y) \ | | 67| 272|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 272|#define XMEMCPY memcpy | | ------------------ | | 68| 272| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 184| 272| LOAD32H(rk[6], key + 24); ------------------ | | 66| 272|#define LOAD32H(x, y) \ | | 67| 272|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 272|#define XMEMCPY memcpy | | ------------------ | | 68| 272| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 185| 272| LOAD32H(rk[7], key + 28); ------------------ | | 66| 272|#define LOAD32H(x, y) \ | | 67| 272|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 272|#define XMEMCPY memcpy | | ------------------ | | 68| 272| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 186| 1.90k| for (;;) { 187| | #ifdef _MSC_VER 188| | temp = skey->rijndael.eK[rk - skey->rijndael.eK + 7]; 189| | #else 190| 1.90k| temp = rk[7]; 191| 1.90k| #endif 192| 1.90k| rk[ 8] = rk[ 0] ^ setup_mix(temp) ^ rcon[i]; 193| 1.90k| rk[ 9] = rk[ 1] ^ rk[ 8]; 194| 1.90k| rk[10] = rk[ 2] ^ rk[ 9]; 195| 1.90k| rk[11] = rk[ 3] ^ rk[10]; 196| 1.90k| if (++i == 7) { ------------------ | Branch (196:17): [True: 272, False: 1.63k] ------------------ 197| 272| break; 198| 272| } 199| 1.63k| temp = rk[11]; 200| 1.63k| rk[12] = rk[ 4] ^ setup_mix(RORc(temp, 8)); ------------------ | | 283| 1.63k|#define RORc(word,i) ({ \ | | 284| 1.63k| ulong32 __RORc_tmp = (word); \ | | 285| 1.63k| __asm__ ("rorl %2, %0" : \ | | 286| 1.63k| "=r" (__RORc_tmp) : \ | | 287| 1.63k| "0" (__RORc_tmp), \ | | 288| 1.63k| "I" (i)); \ | | 289| 1.63k| __RORc_tmp; \ | | 290| 1.63k| }) ------------------ 201| 1.63k| rk[13] = rk[ 5] ^ rk[12]; 202| 1.63k| rk[14] = rk[ 6] ^ rk[13]; 203| 1.63k| rk[15] = rk[ 7] ^ rk[14]; 204| 1.63k| rk += 8; 205| 1.63k| } 206| 272| } else { 207| | /* this can't happen */ 208| | /* coverity[dead_error_line] */ 209| 0| return CRYPT_ERROR; 210| 0| } 211| | 212| 1.28k|#ifndef ENCRYPT_ONLY 213| | /* setup the inverse key now */ 214| 1.28k| rk = skey->rijndael.dK; 215| 1.28k| rrk = skey->rijndael.eK + (28 + keylen) - 4; 216| | 217| | /* apply the inverse MixColumn transform to all round keys but the first and the last: */ 218| | /* copy first */ 219| 1.28k| *rk++ = *rrk++; 220| 1.28k| *rk++ = *rrk++; 221| 1.28k| *rk++ = *rrk++; 222| 1.28k| *rk = *rrk; 223| 1.28k| rk -= 3; rrk -= 3; 224| | 225| 13.9k| for (i = 1; i < skey->rijndael.Nr; i++) { ------------------ | Branch (225:17): [True: 12.6k, False: 1.28k] ------------------ 226| 12.6k| rrk -= 4; 227| 12.6k| rk += 4; 228| 12.6k| #ifdef LTC_SMALL_CODE 229| 12.6k| temp = rrk[0]; 230| 12.6k| rk[0] = setup_mix2(temp); 231| 12.6k| temp = rrk[1]; 232| 12.6k| rk[1] = setup_mix2(temp); 233| 12.6k| temp = rrk[2]; 234| 12.6k| rk[2] = setup_mix2(temp); 235| 12.6k| temp = rrk[3]; 236| 12.6k| rk[3] = setup_mix2(temp); 237| | #else 238| | temp = rrk[0]; 239| | rk[0] = 240| | Tks0[byte(temp, 3)] ^ 241| | Tks1[byte(temp, 2)] ^ 242| | Tks2[byte(temp, 1)] ^ 243| | Tks3[byte(temp, 0)]; 244| | temp = rrk[1]; 245| | rk[1] = 246| | Tks0[byte(temp, 3)] ^ 247| | Tks1[byte(temp, 2)] ^ 248| | Tks2[byte(temp, 1)] ^ 249| | Tks3[byte(temp, 0)]; 250| | temp = rrk[2]; 251| | rk[2] = 252| | Tks0[byte(temp, 3)] ^ 253| | Tks1[byte(temp, 2)] ^ 254| | Tks2[byte(temp, 1)] ^ 255| | Tks3[byte(temp, 0)]; 256| | temp = rrk[3]; 257| | rk[3] = 258| | Tks0[byte(temp, 3)] ^ 259| | Tks1[byte(temp, 2)] ^ 260| | Tks2[byte(temp, 1)] ^ 261| | Tks3[byte(temp, 0)]; 262| | #endif 263| | 264| 12.6k| } 265| | 266| | /* copy last */ 267| 1.28k| rrk -= 4; 268| 1.28k| rk += 4; 269| 1.28k| *rk++ = *rrk++; 270| 1.28k| *rk++ = *rrk++; 271| 1.28k| *rk++ = *rrk++; 272| 1.28k| *rk = *rrk; 273| 1.28k|#endif /* ENCRYPT_ONLY */ 274| | 275| 1.28k| return CRYPT_OK; 276| 1.28k|} rijndael_ecb_encrypt: 290| 47.8k|{ 291| 47.8k| ulong32 s0, s1, s2, s3, t0, t1, t2, t3, *rk; 292| 47.8k| int Nr, r; 293| | 294| 47.8k| LTC_ARGCHK(pt != NULL); ------------------ | | 32| 47.8k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 47.8k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 295| 47.8k| LTC_ARGCHK(ct != NULL); ------------------ | | 32| 47.8k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 47.8k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 296| 47.8k| LTC_ARGCHK(skey != NULL); ------------------ | | 32| 47.8k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 47.8k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 297| | 298| 47.8k| Nr = skey->rijndael.Nr; 299| 47.8k| rk = skey->rijndael.eK; 300| | 301| | /* 302| | * map byte array block to cipher state 303| | * and add initial round key: 304| | */ 305| 47.8k| LOAD32H(s0, pt ); s0 ^= rk[0]; ------------------ | | 66| 47.8k|#define LOAD32H(x, y) \ | | 67| 47.8k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 47.8k|#define XMEMCPY memcpy | | ------------------ | | 68| 47.8k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 306| 47.8k| LOAD32H(s1, pt + 4); s1 ^= rk[1]; ------------------ | | 66| 47.8k|#define LOAD32H(x, y) \ | | 67| 47.8k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 47.8k|#define XMEMCPY memcpy | | ------------------ | | 68| 47.8k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 307| 47.8k| LOAD32H(s2, pt + 8); s2 ^= rk[2]; ------------------ | | 66| 47.8k|#define LOAD32H(x, y) \ | | 67| 47.8k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 47.8k|#define XMEMCPY memcpy | | ------------------ | | 68| 47.8k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 308| 47.8k| LOAD32H(s3, pt + 12); s3 ^= rk[3]; ------------------ | | 66| 47.8k|#define LOAD32H(x, y) \ | | 67| 47.8k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 47.8k|#define XMEMCPY memcpy | | ------------------ | | 68| 47.8k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 309| | 310| 47.8k|#ifdef LTC_SMALL_CODE 311| | 312| 472k| for (r = 0; ; r++) { 313| 472k| rk += 4; 314| 472k| t0 = 315| 472k| Te0(byte(s0, 3)) ^ ------------------ | | 306| 472k|#define Te0(x) TE0[x] ------------------ 316| 472k| Te1(byte(s1, 2)) ^ ------------------ | | 307| 472k|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 472k|#define RORc(word,i) ({ \ | | | | 284| 472k| ulong32 __RORc_tmp = (word); \ | | | | 285| 472k| __asm__ ("rorl %2, %0" : \ | | | | 286| 472k| "=r" (__RORc_tmp) : \ | | | | 287| 472k| "0" (__RORc_tmp), \ | | | | 288| 472k| "I" (i)); \ | | | | 289| 472k| __RORc_tmp; \ | | | | 290| 472k| }) | | ------------------ ------------------ 317| 472k| Te2(byte(s2, 1)) ^ ------------------ | | 308| 472k|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 472k|#define RORc(word,i) ({ \ | | | | 284| 472k| ulong32 __RORc_tmp = (word); \ | | | | 285| 472k| __asm__ ("rorl %2, %0" : \ | | | | 286| 472k| "=r" (__RORc_tmp) : \ | | | | 287| 472k| "0" (__RORc_tmp), \ | | | | 288| 472k| "I" (i)); \ | | | | 289| 472k| __RORc_tmp; \ | | | | 290| 472k| }) | | ------------------ ------------------ 318| 472k| Te3(byte(s3, 0)) ^ ------------------ | | 309| 472k|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 472k|#define RORc(word,i) ({ \ | | | | 284| 472k| ulong32 __RORc_tmp = (word); \ | | | | 285| 472k| __asm__ ("rorl %2, %0" : \ | | | | 286| 472k| "=r" (__RORc_tmp) : \ | | | | 287| 472k| "0" (__RORc_tmp), \ | | | | 288| 472k| "I" (i)); \ | | | | 289| 472k| __RORc_tmp; \ | | | | 290| 472k| }) | | ------------------ ------------------ 319| 472k| rk[0]; 320| 472k| t1 = 321| 472k| Te0(byte(s1, 3)) ^ ------------------ | | 306| 472k|#define Te0(x) TE0[x] ------------------ 322| 472k| Te1(byte(s2, 2)) ^ ------------------ | | 307| 472k|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 472k|#define RORc(word,i) ({ \ | | | | 284| 472k| ulong32 __RORc_tmp = (word); \ | | | | 285| 472k| __asm__ ("rorl %2, %0" : \ | | | | 286| 472k| "=r" (__RORc_tmp) : \ | | | | 287| 472k| "0" (__RORc_tmp), \ | | | | 288| 472k| "I" (i)); \ | | | | 289| 472k| __RORc_tmp; \ | | | | 290| 472k| }) | | ------------------ ------------------ 323| 472k| Te2(byte(s3, 1)) ^ ------------------ | | 308| 472k|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 472k|#define RORc(word,i) ({ \ | | | | 284| 472k| ulong32 __RORc_tmp = (word); \ | | | | 285| 472k| __asm__ ("rorl %2, %0" : \ | | | | 286| 472k| "=r" (__RORc_tmp) : \ | | | | 287| 472k| "0" (__RORc_tmp), \ | | | | 288| 472k| "I" (i)); \ | | | | 289| 472k| __RORc_tmp; \ | | | | 290| 472k| }) | | ------------------ ------------------ 324| 472k| Te3(byte(s0, 0)) ^ ------------------ | | 309| 472k|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 472k|#define RORc(word,i) ({ \ | | | | 284| 472k| ulong32 __RORc_tmp = (word); \ | | | | 285| 472k| __asm__ ("rorl %2, %0" : \ | | | | 286| 472k| "=r" (__RORc_tmp) : \ | | | | 287| 472k| "0" (__RORc_tmp), \ | | | | 288| 472k| "I" (i)); \ | | | | 289| 472k| __RORc_tmp; \ | | | | 290| 472k| }) | | ------------------ ------------------ 325| 472k| rk[1]; 326| 472k| t2 = 327| 472k| Te0(byte(s2, 3)) ^ ------------------ | | 306| 472k|#define Te0(x) TE0[x] ------------------ 328| 472k| Te1(byte(s3, 2)) ^ ------------------ | | 307| 472k|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 472k|#define RORc(word,i) ({ \ | | | | 284| 472k| ulong32 __RORc_tmp = (word); \ | | | | 285| 472k| __asm__ ("rorl %2, %0" : \ | | | | 286| 472k| "=r" (__RORc_tmp) : \ | | | | 287| 472k| "0" (__RORc_tmp), \ | | | | 288| 472k| "I" (i)); \ | | | | 289| 472k| __RORc_tmp; \ | | | | 290| 472k| }) | | ------------------ ------------------ 329| 472k| Te2(byte(s0, 1)) ^ ------------------ | | 308| 472k|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 472k|#define RORc(word,i) ({ \ | | | | 284| 472k| ulong32 __RORc_tmp = (word); \ | | | | 285| 472k| __asm__ ("rorl %2, %0" : \ | | | | 286| 472k| "=r" (__RORc_tmp) : \ | | | | 287| 472k| "0" (__RORc_tmp), \ | | | | 288| 472k| "I" (i)); \ | | | | 289| 472k| __RORc_tmp; \ | | | | 290| 472k| }) | | ------------------ ------------------ 330| 472k| Te3(byte(s1, 0)) ^ ------------------ | | 309| 472k|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 472k|#define RORc(word,i) ({ \ | | | | 284| 472k| ulong32 __RORc_tmp = (word); \ | | | | 285| 472k| __asm__ ("rorl %2, %0" : \ | | | | 286| 472k| "=r" (__RORc_tmp) : \ | | | | 287| 472k| "0" (__RORc_tmp), \ | | | | 288| 472k| "I" (i)); \ | | | | 289| 472k| __RORc_tmp; \ | | | | 290| 472k| }) | | ------------------ ------------------ 331| 472k| rk[2]; 332| 472k| t3 = 333| 472k| Te0(byte(s3, 3)) ^ ------------------ | | 306| 472k|#define Te0(x) TE0[x] ------------------ 334| 472k| Te1(byte(s0, 2)) ^ ------------------ | | 307| 472k|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 472k|#define RORc(word,i) ({ \ | | | | 284| 472k| ulong32 __RORc_tmp = (word); \ | | | | 285| 472k| __asm__ ("rorl %2, %0" : \ | | | | 286| 472k| "=r" (__RORc_tmp) : \ | | | | 287| 472k| "0" (__RORc_tmp), \ | | | | 288| 472k| "I" (i)); \ | | | | 289| 472k| __RORc_tmp; \ | | | | 290| 472k| }) | | ------------------ ------------------ 335| 472k| Te2(byte(s1, 1)) ^ ------------------ | | 308| 472k|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 472k|#define RORc(word,i) ({ \ | | | | 284| 472k| ulong32 __RORc_tmp = (word); \ | | | | 285| 472k| __asm__ ("rorl %2, %0" : \ | | | | 286| 472k| "=r" (__RORc_tmp) : \ | | | | 287| 472k| "0" (__RORc_tmp), \ | | | | 288| 472k| "I" (i)); \ | | | | 289| 472k| __RORc_tmp; \ | | | | 290| 472k| }) | | ------------------ ------------------ 336| 472k| Te3(byte(s2, 0)) ^ ------------------ | | 309| 472k|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 472k|#define RORc(word,i) ({ \ | | | | 284| 472k| ulong32 __RORc_tmp = (word); \ | | | | 285| 472k| __asm__ ("rorl %2, %0" : \ | | | | 286| 472k| "=r" (__RORc_tmp) : \ | | | | 287| 472k| "0" (__RORc_tmp), \ | | | | 288| 472k| "I" (i)); \ | | | | 289| 472k| __RORc_tmp; \ | | | | 290| 472k| }) | | ------------------ ------------------ 337| 472k| rk[3]; 338| 472k| if (r == Nr-2) { ------------------ | Branch (338:13): [True: 47.8k, False: 424k] ------------------ 339| 47.8k| break; 340| 47.8k| } 341| 424k| s0 = t0; s1 = t1; s2 = t2; s3 = t3; 342| 424k| } 343| 47.8k| rk += 4; 344| | 345| |#else 346| | 347| | /* 348| | * Nr - 1 full rounds: 349| | */ 350| | r = Nr >> 1; 351| | for (;;) { 352| | t0 = 353| | Te0(byte(s0, 3)) ^ 354| | Te1(byte(s1, 2)) ^ 355| | Te2(byte(s2, 1)) ^ 356| | Te3(byte(s3, 0)) ^ 357| | rk[4]; 358| | t1 = 359| | Te0(byte(s1, 3)) ^ 360| | Te1(byte(s2, 2)) ^ 361| | Te2(byte(s3, 1)) ^ 362| | Te3(byte(s0, 0)) ^ 363| | rk[5]; 364| | t2 = 365| | Te0(byte(s2, 3)) ^ 366| | Te1(byte(s3, 2)) ^ 367| | Te2(byte(s0, 1)) ^ 368| | Te3(byte(s1, 0)) ^ 369| | rk[6]; 370| | t3 = 371| | Te0(byte(s3, 3)) ^ 372| | Te1(byte(s0, 2)) ^ 373| | Te2(byte(s1, 1)) ^ 374| | Te3(byte(s2, 0)) ^ 375| | rk[7]; 376| | 377| | rk += 8; 378| | if (--r == 0) { 379| | break; 380| | } 381| | 382| | s0 = 383| | Te0(byte(t0, 3)) ^ 384| | Te1(byte(t1, 2)) ^ 385| | Te2(byte(t2, 1)) ^ 386| | Te3(byte(t3, 0)) ^ 387| | rk[0]; 388| | s1 = 389| | Te0(byte(t1, 3)) ^ 390| | Te1(byte(t2, 2)) ^ 391| | Te2(byte(t3, 1)) ^ 392| | Te3(byte(t0, 0)) ^ 393| | rk[1]; 394| | s2 = 395| | Te0(byte(t2, 3)) ^ 396| | Te1(byte(t3, 2)) ^ 397| | Te2(byte(t0, 1)) ^ 398| | Te3(byte(t1, 0)) ^ 399| | rk[2]; 400| | s3 = 401| | Te0(byte(t3, 3)) ^ 402| | Te1(byte(t0, 2)) ^ 403| | Te2(byte(t1, 1)) ^ 404| | Te3(byte(t2, 0)) ^ 405| | rk[3]; 406| | } 407| | 408| |#endif 409| | 410| | /* 411| | * apply last round and 412| | * map cipher state to byte array block: 413| | */ 414| 47.8k| s0 = 415| 47.8k| (Te4_3[byte(t0, 3)]) ^ ------------------ | | 319| 47.8k|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t0, 3)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 416| 47.8k| (Te4_2[byte(t1, 2)]) ^ ------------------ | | 318| 47.8k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t1, 2)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 417| 47.8k| (Te4_1[byte(t2, 1)]) ^ ------------------ | | 317| 47.8k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t2, 1)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 418| 47.8k| (Te4_0[byte(t3, 0)]) ^ ------------------ | | 316| 47.8k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t3, 0)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 419| 47.8k| rk[0]; 420| 47.8k| STORE32H(s0, ct); ------------------ | | 62| 47.8k|#define STORE32H(x, y) \ | | 63| 47.8k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 47.8k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 47.8k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 421| 47.8k| s1 = 422| 47.8k| (Te4_3[byte(t1, 3)]) ^ ------------------ | | 319| 47.8k|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t1, 3)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 423| 47.8k| (Te4_2[byte(t2, 2)]) ^ ------------------ | | 318| 47.8k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t2, 2)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 424| 47.8k| (Te4_1[byte(t3, 1)]) ^ ------------------ | | 317| 47.8k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t3, 1)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 425| 47.8k| (Te4_0[byte(t0, 0)]) ^ ------------------ | | 316| 47.8k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t0, 0)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 426| 47.8k| rk[1]; 427| 47.8k| STORE32H(s1, ct+4); ------------------ | | 62| 47.8k|#define STORE32H(x, y) \ | | 63| 47.8k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 47.8k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 47.8k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 428| 47.8k| s2 = 429| 47.8k| (Te4_3[byte(t2, 3)]) ^ ------------------ | | 319| 47.8k|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t2, 3)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 430| 47.8k| (Te4_2[byte(t3, 2)]) ^ ------------------ | | 318| 47.8k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t3, 2)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 431| 47.8k| (Te4_1[byte(t0, 1)]) ^ ------------------ | | 317| 47.8k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t0, 1)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 432| 47.8k| (Te4_0[byte(t1, 0)]) ^ ------------------ | | 316| 47.8k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t1, 0)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 433| 47.8k| rk[2]; 434| 47.8k| STORE32H(s2, ct+8); ------------------ | | 62| 47.8k|#define STORE32H(x, y) \ | | 63| 47.8k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 47.8k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 47.8k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 435| 47.8k| s3 = 436| 47.8k| (Te4_3[byte(t3, 3)]) ^ ------------------ | | 319| 47.8k|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t3, 3)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 437| 47.8k| (Te4_2[byte(t0, 2)]) ^ ------------------ | | 318| 47.8k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t0, 2)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 438| 47.8k| (Te4_1[byte(t1, 1)]) ^ ------------------ | | 317| 47.8k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t1, 1)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 439| 47.8k| (Te4_0[byte(t2, 0)]) ^ ------------------ | | 316| 47.8k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t2, 0)]) ^ ------------------ | | 436| 47.8k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 440| 47.8k| rk[3]; 441| 47.8k| STORE32H(s3, ct+12); ------------------ | | 62| 47.8k|#define STORE32H(x, y) \ | | 63| 47.8k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 47.8k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 47.8k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 442| | 443| 47.8k| return CRYPT_OK; 444| 47.8k|} aes.c:setup_mix: 95| 13.6k|{ 96| 13.6k| return (Te4_3[byte(temp, 2)]) ^ ------------------ | | 319| 13.6k|#define Te4_3 0xFF000000 & Te4 ------------------ return (Te4_3[byte(temp, 2)]) ^ ------------------ | | 436| 13.6k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 97| 13.6k| (Te4_2[byte(temp, 1)]) ^ ------------------ | | 318| 13.6k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(temp, 1)]) ^ ------------------ | | 436| 13.6k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 98| 13.6k| (Te4_1[byte(temp, 0)]) ^ ------------------ | | 317| 13.6k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(temp, 0)]) ^ ------------------ | | 436| 13.6k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 99| 13.6k| (Te4_0[byte(temp, 3)]); ------------------ | | 316| 13.6k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(temp, 3)]); ------------------ | | 436| 13.6k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 100| 13.6k|} aes.c:setup_mix2: 105| 50.6k|{ 106| 50.6k| return Td0(255 & Te4[byte(temp, 3)]) ^ ------------------ | | 311| 50.6k|#define Td0(x) TD0[x] ------------------ 107| 50.6k| Td1(255 & Te4[byte(temp, 2)]) ^ ------------------ | | 312| 50.6k|#define Td1(x) RORc(TD0[x], 8) | | ------------------ | | | | 283| 50.6k|#define RORc(word,i) ({ \ | | | | 284| 50.6k| ulong32 __RORc_tmp = (word); \ | | | | 285| 50.6k| __asm__ ("rorl %2, %0" : \ | | | | 286| 50.6k| "=r" (__RORc_tmp) : \ | | | | 287| 50.6k| "0" (__RORc_tmp), \ | | | | 288| 50.6k| "I" (i)); \ | | | | 289| 50.6k| __RORc_tmp; \ | | | | 290| 50.6k| }) | | ------------------ ------------------ 108| 50.6k| Td2(255 & Te4[byte(temp, 1)]) ^ ------------------ | | 313| 50.6k|#define Td2(x) RORc(TD0[x], 16) | | ------------------ | | | | 283| 50.6k|#define RORc(word,i) ({ \ | | | | 284| 50.6k| ulong32 __RORc_tmp = (word); \ | | | | 285| 50.6k| __asm__ ("rorl %2, %0" : \ | | | | 286| 50.6k| "=r" (__RORc_tmp) : \ | | | | 287| 50.6k| "0" (__RORc_tmp), \ | | | | 288| 50.6k| "I" (i)); \ | | | | 289| 50.6k| __RORc_tmp; \ | | | | 290| 50.6k| }) | | ------------------ ------------------ 109| 50.6k| Td3(255 & Te4[byte(temp, 0)]); ------------------ | | 314| 50.6k|#define Td3(x) RORc(TD0[x], 24) | | ------------------ | | | | 283| 50.6k|#define RORc(word,i) ({ \ | | | | 284| 50.6k| ulong32 __RORc_tmp = (word); \ | | | | 285| 50.6k| __asm__ ("rorl %2, %0" : \ | | | | 286| 50.6k| "=r" (__RORc_tmp) : \ | | | | 287| 50.6k| "0" (__RORc_tmp), \ | | | | 288| 50.6k| "I" (i)); \ | | | | 289| 50.6k| __RORc_tmp; \ | | | | 290| 50.6k| }) | | ------------------ ------------------ 110| 50.6k|} sha1_init: 164| 17.0k|{ 165| 17.0k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 17.0k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.0k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 166| 17.0k| md->sha1.state[0] = 0x67452301UL; 167| 17.0k| md->sha1.state[1] = 0xefcdab89UL; 168| 17.0k| md->sha1.state[2] = 0x98badcfeUL; 169| 17.0k| md->sha1.state[3] = 0x10325476UL; 170| 17.0k| md->sha1.state[4] = 0xc3d2e1f0UL; 171| 17.0k| md->sha1.curlen = 0; 172| 17.0k| md->sha1.length = 0; 173| 17.0k| return CRYPT_OK; 174| 17.0k|} sha1_done: 192| 52.4k|{ 193| 52.4k| int i; 194| | 195| 52.4k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 52.4k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 52.4k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 196| 52.4k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 52.4k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 52.4k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 197| | 198| 52.4k| if (md->sha1.curlen >= sizeof(md->sha1.buf)) { ------------------ | Branch (198:9): [True: 0, False: 52.4k] ------------------ 199| 0| return CRYPT_INVALID_ARG; 200| 0| } 201| | 202| | /* increase the length of the message */ 203| 52.4k| md->sha1.length += md->sha1.curlen * 8; 204| | 205| | /* append the '1' bit */ 206| 52.4k| md->sha1.buf[md->sha1.curlen++] = (unsigned char)0x80; 207| | 208| | /* if the length is currently above 56 bytes we append zeros 209| | * then compress. Then we can fall back to padding zeros and length 210| | * encoding like normal. 211| | */ 212| 52.4k| if (md->sha1.curlen > 56) { ------------------ | Branch (212:9): [True: 539, False: 51.9k] ------------------ 213| 1.24k| while (md->sha1.curlen < 64) { ------------------ | Branch (213:16): [True: 710, False: 539] ------------------ 214| 710| md->sha1.buf[md->sha1.curlen++] = (unsigned char)0; 215| 710| } 216| 539| sha1_compress(md, md->sha1.buf); 217| 539| md->sha1.curlen = 0; 218| 539| } 219| | 220| | /* pad upto 56 bytes of zeroes */ 221| 1.33M| while (md->sha1.curlen < 56) { ------------------ | Branch (221:12): [True: 1.28M, False: 52.4k] ------------------ 222| 1.28M| md->sha1.buf[md->sha1.curlen++] = (unsigned char)0; 223| 1.28M| } 224| | 225| | /* store length */ 226| 52.4k| STORE64H(md->sha1.length, md->sha1.buf+56); ------------------ | | 101| 52.4k|#define STORE64H(x, y) \ | | 102| 52.4k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 52.4k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 52.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 227| 52.4k| sha1_compress(md, md->sha1.buf); 228| | 229| | /* copy output */ 230| 314k| for (i = 0; i < 5; i++) { ------------------ | Branch (230:17): [True: 262k, False: 52.4k] ------------------ 231| 262k| STORE32H(md->sha1.state[i], out+(4*i)); ------------------ | | 62| 262k|#define STORE32H(x, y) \ | | 63| 262k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 262k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 262k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 232| 262k| } 233| |#ifdef LTC_CLEAN_STACK 234| | zeromem(md, sizeof(hash_state)); 235| |#endif 236| 52.4k| return CRYPT_OK; 237| 52.4k|} sha1.c:sha1_compress: 47| 132k|{ 48| 132k| ulong32 a,b,c,d,e,W[80],i; 49| 132k|#ifdef LTC_SMALL_CODE 50| 132k| ulong32 t; 51| 132k|#endif 52| | 53| | /* copy the state into 512-bits into W[0..15] */ 54| 2.25M| for (i = 0; i < 16; i++) { ------------------ | Branch (54:17): [True: 2.11M, False: 132k] ------------------ 55| 2.11M| LOAD32H(W[i], buf + (4*i)); ------------------ | | 66| 2.11M|#define LOAD32H(x, y) \ | | 67| 2.11M|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 2.11M|#define XMEMCPY memcpy | | ------------------ | | 68| 2.11M| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 56| 2.11M| } 57| | 58| | /* copy state */ 59| 132k| a = md->sha1.state[0]; 60| 132k| b = md->sha1.state[1]; 61| 132k| c = md->sha1.state[2]; 62| 132k| d = md->sha1.state[3]; 63| 132k| e = md->sha1.state[4]; 64| | 65| | /* expand it */ 66| 8.60M| for (i = 16; i < 80; i++) { ------------------ | Branch (66:18): [True: 8.47M, False: 132k] ------------------ 67| 8.47M| W[i] = ROL(W[i-3] ^ W[i-8] ^ W[i-14] ^ W[i-16], 1); 68| 8.47M| } 69| | 70| | /* compress */ 71| | /* round one */ 72| 132k| #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); 73| 132k| #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); 74| 132k| #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); 75| 132k| #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); 76| | 77| 132k|#ifdef LTC_SMALL_CODE 78| | 79| 2.78M| for (i = 0; i < 20; ) { ------------------ | Branch (79:17): [True: 2.64M, False: 132k] ------------------ 80| 2.64M| FF0(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; ------------------ | | 72| 2.64M| #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 2.64M|#define ROLc(word,i) ({ \ | | | | 276| 2.64M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 2.64M| __asm__ ("roll %2, %0" : \ | | | | 278| 2.64M| "=r" (__ROLc_tmp) : \ | | | | 279| 2.64M| "0" (__ROLc_tmp), \ | | | | 280| 2.64M| "I" (i)); \ | | | | 281| 2.64M| __ROLc_tmp; \ | | | | 282| 2.64M| }) | | ------------------ | | #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); | | ------------------ | | | | 37| 2.64M|#define F0(x,y,z) (z ^ (x & (y ^ z))) | | ------------------ | | #define FF0(a,b,c,d,e,i) e = (ROLc(a, 5) + F0(b,c,d) + e + W[i] + 0x5a827999UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 2.64M|#define ROLc(word,i) ({ \ | | | | 276| 2.64M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 2.64M| __asm__ ("roll %2, %0" : \ | | | | 278| 2.64M| "=r" (__ROLc_tmp) : \ | | | | 279| 2.64M| "0" (__ROLc_tmp), \ | | | | 280| 2.64M| "I" (i)); \ | | | | 281| 2.64M| __ROLc_tmp; \ | | | | 282| 2.64M| }) | | ------------------ ------------------ 81| 2.64M| } 82| | 83| 2.78M| for (; i < 40; ) { ------------------ | Branch (83:12): [True: 2.64M, False: 132k] ------------------ 84| 2.64M| FF1(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; ------------------ | | 73| 2.64M| #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 2.64M|#define ROLc(word,i) ({ \ | | | | 276| 2.64M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 2.64M| __asm__ ("roll %2, %0" : \ | | | | 278| 2.64M| "=r" (__ROLc_tmp) : \ | | | | 279| 2.64M| "0" (__ROLc_tmp), \ | | | | 280| 2.64M| "I" (i)); \ | | | | 281| 2.64M| __ROLc_tmp; \ | | | | 282| 2.64M| }) | | ------------------ | | #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); | | ------------------ | | | | 38| 2.64M|#define F1(x,y,z) (x ^ y ^ z) | | ------------------ | | #define FF1(a,b,c,d,e,i) e = (ROLc(a, 5) + F1(b,c,d) + e + W[i] + 0x6ed9eba1UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 2.64M|#define ROLc(word,i) ({ \ | | | | 276| 2.64M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 2.64M| __asm__ ("roll %2, %0" : \ | | | | 278| 2.64M| "=r" (__ROLc_tmp) : \ | | | | 279| 2.64M| "0" (__ROLc_tmp), \ | | | | 280| 2.64M| "I" (i)); \ | | | | 281| 2.64M| __ROLc_tmp; \ | | | | 282| 2.64M| }) | | ------------------ ------------------ 85| 2.64M| } 86| | 87| 2.78M| for (; i < 60; ) { ------------------ | Branch (87:12): [True: 2.64M, False: 132k] ------------------ 88| 2.64M| FF2(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; ------------------ | | 74| 2.64M| #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); | | ------------------ | | | | 275| 2.64M|#define ROLc(word,i) ({ \ | | | | 276| 2.64M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 2.64M| __asm__ ("roll %2, %0" : \ | | | | 278| 2.64M| "=r" (__ROLc_tmp) : \ | | | | 279| 2.64M| "0" (__ROLc_tmp), \ | | | | 280| 2.64M| "I" (i)); \ | | | | 281| 2.64M| __ROLc_tmp; \ | | | | 282| 2.64M| }) | | ------------------ | | #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); | | ------------------ | | | | 39| 2.64M|#define F2(x,y,z) ((x & y) | (z & (x | y))) | | ------------------ | | #define FF2(a,b,c,d,e,i) e = (ROLc(a, 5) + F2(b,c,d) + e + W[i] + 0x8f1bbcdcUL); b = ROLc(b, 30); | | ------------------ | | | | 275| 2.64M|#define ROLc(word,i) ({ \ | | | | 276| 2.64M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 2.64M| __asm__ ("roll %2, %0" : \ | | | | 278| 2.64M| "=r" (__ROLc_tmp) : \ | | | | 279| 2.64M| "0" (__ROLc_tmp), \ | | | | 280| 2.64M| "I" (i)); \ | | | | 281| 2.64M| __ROLc_tmp; \ | | | | 282| 2.64M| }) | | ------------------ ------------------ 89| 2.64M| } 90| | 91| 2.78M| for (; i < 80; ) { ------------------ | Branch (91:12): [True: 2.64M, False: 132k] ------------------ 92| 2.64M| FF3(a,b,c,d,e,i++); t = e; e = d; d = c; c = b; b = a; a = t; ------------------ | | 75| 2.64M| #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 2.64M|#define ROLc(word,i) ({ \ | | | | 276| 2.64M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 2.64M| __asm__ ("roll %2, %0" : \ | | | | 278| 2.64M| "=r" (__ROLc_tmp) : \ | | | | 279| 2.64M| "0" (__ROLc_tmp), \ | | | | 280| 2.64M| "I" (i)); \ | | | | 281| 2.64M| __ROLc_tmp; \ | | | | 282| 2.64M| }) | | ------------------ | | #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); | | ------------------ | | | | 40| 2.64M|#define F3(x,y,z) (x ^ y ^ z) | | ------------------ | | #define FF3(a,b,c,d,e,i) e = (ROLc(a, 5) + F3(b,c,d) + e + W[i] + 0xca62c1d6UL); b = ROLc(b, 30); | | ------------------ | | | | 275| 2.64M|#define ROLc(word,i) ({ \ | | | | 276| 2.64M| ulong32 __ROLc_tmp = (word); \ | | | | 277| 2.64M| __asm__ ("roll %2, %0" : \ | | | | 278| 2.64M| "=r" (__ROLc_tmp) : \ | | | | 279| 2.64M| "0" (__ROLc_tmp), \ | | | | 280| 2.64M| "I" (i)); \ | | | | 281| 2.64M| __ROLc_tmp; \ | | | | 282| 2.64M| }) | | ------------------ ------------------ 93| 2.64M| } 94| | 95| |#else 96| | 97| | for (i = 0; i < 20; ) { 98| | FF0(a,b,c,d,e,i++); 99| | FF0(e,a,b,c,d,i++); 100| | FF0(d,e,a,b,c,i++); 101| | FF0(c,d,e,a,b,i++); 102| | FF0(b,c,d,e,a,i++); 103| | } 104| | 105| | /* round two */ 106| | for (; i < 40; ) { 107| | FF1(a,b,c,d,e,i++); 108| | FF1(e,a,b,c,d,i++); 109| | FF1(d,e,a,b,c,i++); 110| | FF1(c,d,e,a,b,i++); 111| | FF1(b,c,d,e,a,i++); 112| | } 113| | 114| | /* round three */ 115| | for (; i < 60; ) { 116| | FF2(a,b,c,d,e,i++); 117| | FF2(e,a,b,c,d,i++); 118| | FF2(d,e,a,b,c,i++); 119| | FF2(c,d,e,a,b,i++); 120| | FF2(b,c,d,e,a,i++); 121| | } 122| | 123| | /* round four */ 124| | for (; i < 80; ) { 125| | FF3(a,b,c,d,e,i++); 126| | FF3(e,a,b,c,d,i++); 127| | FF3(d,e,a,b,c,i++); 128| | FF3(c,d,e,a,b,i++); 129| | FF3(b,c,d,e,a,i++); 130| | } 131| |#endif 132| | 133| 132k| #undef FF0 134| 132k| #undef FF1 135| 132k| #undef FF2 136| 132k| #undef FF3 137| | 138| | /* store */ 139| 132k| md->sha1.state[0] = md->sha1.state[0] + a; 140| 132k| md->sha1.state[1] = md->sha1.state[1] + b; 141| 132k| md->sha1.state[2] = md->sha1.state[2] + c; 142| 132k| md->sha1.state[3] = md->sha1.state[3] + d; 143| 132k| md->sha1.state[4] = md->sha1.state[4] + e; 144| | 145| 132k| return CRYPT_OK; 146| 132k|} sha256_init: 205| 74.0k|{ 206| 74.0k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 74.0k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 74.0k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 207| | 208| 74.0k| md->sha256.curlen = 0; 209| 74.0k| md->sha256.length = 0; 210| 74.0k| md->sha256.state[0] = 0x6A09E667UL; 211| 74.0k| md->sha256.state[1] = 0xBB67AE85UL; 212| 74.0k| md->sha256.state[2] = 0x3C6EF372UL; 213| 74.0k| md->sha256.state[3] = 0xA54FF53AUL; 214| 74.0k| md->sha256.state[4] = 0x510E527FUL; 215| 74.0k| md->sha256.state[5] = 0x9B05688CUL; 216| 74.0k| md->sha256.state[6] = 0x1F83D9ABUL; 217| 74.0k| md->sha256.state[7] = 0x5BE0CD19UL; 218| 74.0k| return CRYPT_OK; 219| 74.0k|} sha256_done: 237| 84.9k|{ 238| 84.9k| int i; 239| | 240| 84.9k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 84.9k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 84.9k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 241| 84.9k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 84.9k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 84.9k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 242| | 243| 84.9k| if (md->sha256.curlen >= sizeof(md->sha256.buf)) { ------------------ | Branch (243:9): [True: 0, False: 84.9k] ------------------ 244| 0| return CRYPT_INVALID_ARG; 245| 0| } 246| | 247| | 248| | /* increase the length of the message */ 249| 84.9k| md->sha256.length += md->sha256.curlen * 8; 250| | 251| | /* append the '1' bit */ 252| 84.9k| md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80; 253| | 254| | /* if the length is currently above 56 bytes we append zeros 255| | * then compress. Then we can fall back to padding zeros and length 256| | * encoding like normal. 257| | */ 258| 84.9k| if (md->sha256.curlen > 56) { ------------------ | Branch (258:9): [True: 362, False: 84.6k] ------------------ 259| 1.08k| while (md->sha256.curlen < 64) { ------------------ | Branch (259:16): [True: 724, False: 362] ------------------ 260| 724| md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; 261| 724| } 262| 362| sha256_compress(md, md->sha256.buf); 263| 362| md->sha256.curlen = 0; 264| 362| } 265| | 266| | /* pad upto 56 bytes of zeroes */ 267| 2.23M| while (md->sha256.curlen < 56) { ------------------ | Branch (267:12): [True: 2.14M, False: 84.9k] ------------------ 268| 2.14M| md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; 269| 2.14M| } 270| | 271| | /* store length */ 272| 84.9k| STORE64H(md->sha256.length, md->sha256.buf+56); ------------------ | | 101| 84.9k|#define STORE64H(x, y) \ | | 102| 84.9k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 84.9k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 84.9k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 273| 84.9k| sha256_compress(md, md->sha256.buf); 274| | 275| | /* copy output */ 276| 764k| for (i = 0; i < 8; i++) { ------------------ | Branch (276:17): [True: 679k, False: 84.9k] ------------------ 277| 679k| STORE32H(md->sha256.state[i], out+(4*i)); ------------------ | | 62| 679k|#define STORE32H(x, y) \ | | 63| 679k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 679k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 679k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 278| 679k| } 279| |#ifdef LTC_CLEAN_STACK 280| | zeromem(md, sizeof(hash_state)); 281| |#endif 282| 84.9k| return CRYPT_OK; 283| 84.9k|} sha256.c:sha256_compress: 71| 145k|{ 72| 145k| ulong32 S[8], W[64], t0, t1; 73| 145k|#ifdef LTC_SMALL_CODE 74| 145k| ulong32 t; 75| 145k|#endif 76| 145k| int i; 77| | 78| | /* copy state into S */ 79| 1.30M| for (i = 0; i < 8; i++) { ------------------ | Branch (79:17): [True: 1.16M, False: 145k] ------------------ 80| 1.16M| S[i] = md->sha256.state[i]; 81| 1.16M| } 82| | 83| | /* copy the state into 512-bits into W[0..15] */ 84| 2.47M| for (i = 0; i < 16; i++) { ------------------ | Branch (84:17): [True: 2.32M, False: 145k] ------------------ 85| 2.32M| LOAD32H(W[i], buf + (4*i)); ------------------ | | 66| 2.32M|#define LOAD32H(x, y) \ | | 67| 2.32M|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 2.32M|#define XMEMCPY memcpy | | ------------------ | | 68| 2.32M| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 86| 2.32M| } 87| | 88| | /* fill W[16..63] */ 89| 7.13M| for (i = 16; i < 64; i++) { ------------------ | Branch (89:18): [True: 6.98M, False: 145k] ------------------ 90| 6.98M| W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 63| 6.98M|#define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) | | ------------------ | | | | 58| 6.98M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 6.98M|#define RORc(word,i) ({ \ | | | | | | 284| 6.98M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 6.98M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 6.98M| "=r" (__RORc_tmp) : \ | | | | | | 287| 6.98M| "0" (__RORc_tmp), \ | | | | | | 288| 6.98M| "I" (i)); \ | | | | | | 289| 6.98M| __RORc_tmp; \ | | | | | | 290| 6.98M| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) | | ------------------ | | | | 58| 6.98M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 6.98M|#define RORc(word,i) ({ \ | | | | | | 284| 6.98M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 6.98M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 6.98M| "=r" (__RORc_tmp) : \ | | | | | | 287| 6.98M| "0" (__RORc_tmp), \ | | | | | | 288| 6.98M| "I" (i)); \ | | | | | | 289| 6.98M| __RORc_tmp; \ | | | | | | 290| 6.98M| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) | | ------------------ | | | | 59| 6.98M|#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) | | ------------------ ------------------ W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 62| 6.98M|#define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) | | ------------------ | | | | 58| 6.98M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 6.98M|#define RORc(word,i) ({ \ | | | | | | 284| 6.98M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 6.98M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 6.98M| "=r" (__RORc_tmp) : \ | | | | | | 287| 6.98M| "0" (__RORc_tmp), \ | | | | | | 288| 6.98M| "I" (i)); \ | | | | | | 289| 6.98M| __RORc_tmp; \ | | | | | | 290| 6.98M| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) | | ------------------ | | | | 58| 6.98M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 6.98M|#define RORc(word,i) ({ \ | | | | | | 284| 6.98M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 6.98M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 6.98M| "=r" (__RORc_tmp) : \ | | | | | | 287| 6.98M| "0" (__RORc_tmp), \ | | | | | | 288| 6.98M| "I" (i)); \ | | | | | | 289| 6.98M| __RORc_tmp; \ | | | | | | 290| 6.98M| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) | | ------------------ | | | | 59| 6.98M|#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) | | ------------------ ------------------ 91| 6.98M| } 92| | 93| | /* Compress */ 94| 145k|#ifdef LTC_SMALL_CODE 95| 145k|#define RND(a,b,c,d,e,f,g,h,i) \ 96| 145k| t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ 97| 145k| t1 = Sigma0(a) + Maj(a, b, c); \ 98| 145k| d += t0; \ 99| 145k| h = t0 + t1; 100| | 101| 9.46M| for (i = 0; i < 64; ++i) { ------------------ | Branch (101:18): [True: 9.31M, False: 145k] ------------------ 102| 9.31M| RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i); ------------------ | | 96| 9.31M| t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ | | ------------------ | | | | 61| 9.31M|#define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) | | | | ------------------ | | | | | | 58| 9.31M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 9.31M|#define RORc(word,i) ({ \ | | | | | | | | 284| 9.31M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 9.31M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 9.31M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 9.31M| "0" (__RORc_tmp), \ | | | | | | | | 288| 9.31M| "I" (i)); \ | | | | | | | | 289| 9.31M| __RORc_tmp; \ | | | | | | | | 290| 9.31M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) | | | | ------------------ | | | | | | 58| 9.31M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 9.31M|#define RORc(word,i) ({ \ | | | | | | | | 284| 9.31M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 9.31M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 9.31M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 9.31M| "0" (__RORc_tmp), \ | | | | | | | | 288| 9.31M| "I" (i)); \ | | | | | | | | 289| 9.31M| __RORc_tmp; \ | | | | | | | | 290| 9.31M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) | | | | ------------------ | | | | | | 58| 9.31M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 9.31M|#define RORc(word,i) ({ \ | | | | | | | | 284| 9.31M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 9.31M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 9.31M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 9.31M| "0" (__RORc_tmp), \ | | | | | | | | 288| 9.31M| "I" (i)); \ | | | | | | | | 289| 9.31M| __RORc_tmp; \ | | | | | | | | 290| 9.31M| }) | | | | | | ------------------ | | | | ------------------ | | ------------------ | | t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ | | ------------------ | | | | 56| 9.31M|#define Ch(x,y,z) (z ^ (x & (y ^ z))) | | ------------------ | | 97| 9.31M| t1 = Sigma0(a) + Maj(a, b, c); \ | | ------------------ | | | | 60| 9.31M|#define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) | | | | ------------------ | | | | | | 58| 9.31M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 9.31M|#define RORc(word,i) ({ \ | | | | | | | | 284| 9.31M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 9.31M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 9.31M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 9.31M| "0" (__RORc_tmp), \ | | | | | | | | 288| 9.31M| "I" (i)); \ | | | | | | | | 289| 9.31M| __RORc_tmp; \ | | | | | | | | 290| 9.31M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) | | | | ------------------ | | | | | | 58| 9.31M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 9.31M|#define RORc(word,i) ({ \ | | | | | | | | 284| 9.31M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 9.31M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 9.31M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 9.31M| "0" (__RORc_tmp), \ | | | | | | | | 288| 9.31M| "I" (i)); \ | | | | | | | | 289| 9.31M| __RORc_tmp; \ | | | | | | | | 290| 9.31M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) | | | | ------------------ | | | | | | 58| 9.31M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 9.31M|#define RORc(word,i) ({ \ | | | | | | | | 284| 9.31M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 9.31M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 9.31M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 9.31M| "0" (__RORc_tmp), \ | | | | | | | | 288| 9.31M| "I" (i)); \ | | | | | | | | 289| 9.31M| __RORc_tmp; \ | | | | | | | | 290| 9.31M| }) | | | | | | ------------------ | | | | ------------------ | | ------------------ | | t1 = Sigma0(a) + Maj(a, b, c); \ | | ------------------ | | | | 57| 9.31M|#define Maj(x,y,z) (((x | y) & z) | (x & y)) | | ------------------ | | 98| 9.31M| d += t0; \ | | 99| 9.31M| h = t0 + t1; ------------------ 103| 9.31M| t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; 104| 9.31M| S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t; 105| 9.31M| } 106| |#else 107| |#define RND(a,b,c,d,e,f,g,h,i,ki) \ 108| | t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i]; \ 109| | t1 = Sigma0(a) + Maj(a, b, c); \ 110| | d += t0; \ 111| | h = t0 + t1; 112| | 113| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],0,0x428a2f98); 114| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],1,0x71374491); 115| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],2,0xb5c0fbcf); 116| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],3,0xe9b5dba5); 117| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],4,0x3956c25b); 118| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],5,0x59f111f1); 119| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],6,0x923f82a4); 120| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],7,0xab1c5ed5); 121| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],8,0xd807aa98); 122| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],9,0x12835b01); 123| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],10,0x243185be); 124| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],11,0x550c7dc3); 125| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],12,0x72be5d74); 126| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],13,0x80deb1fe); 127| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],14,0x9bdc06a7); 128| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],15,0xc19bf174); 129| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],16,0xe49b69c1); 130| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],17,0xefbe4786); 131| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],18,0x0fc19dc6); 132| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],19,0x240ca1cc); 133| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],20,0x2de92c6f); 134| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],21,0x4a7484aa); 135| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],22,0x5cb0a9dc); 136| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],23,0x76f988da); 137| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],24,0x983e5152); 138| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],25,0xa831c66d); 139| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],26,0xb00327c8); 140| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],27,0xbf597fc7); 141| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],28,0xc6e00bf3); 142| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],29,0xd5a79147); 143| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],30,0x06ca6351); 144| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],31,0x14292967); 145| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],32,0x27b70a85); 146| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],33,0x2e1b2138); 147| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],34,0x4d2c6dfc); 148| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],35,0x53380d13); 149| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],36,0x650a7354); 150| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],37,0x766a0abb); 151| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],38,0x81c2c92e); 152| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],39,0x92722c85); 153| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],40,0xa2bfe8a1); 154| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],41,0xa81a664b); 155| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],42,0xc24b8b70); 156| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],43,0xc76c51a3); 157| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],44,0xd192e819); 158| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],45,0xd6990624); 159| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],46,0xf40e3585); 160| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],47,0x106aa070); 161| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],48,0x19a4c116); 162| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],49,0x1e376c08); 163| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],50,0x2748774c); 164| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],51,0x34b0bcb5); 165| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],52,0x391c0cb3); 166| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],53,0x4ed8aa4a); 167| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],54,0x5b9cca4f); 168| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],55,0x682e6ff3); 169| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],56,0x748f82ee); 170| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],57,0x78a5636f); 171| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],58,0x84c87814); 172| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],59,0x8cc70208); 173| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],60,0x90befffa); 174| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],61,0xa4506ceb); 175| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7); 176| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2); 177| | 178| |#undef RND 179| | 180| |#endif 181| | 182| | /* feedback */ 183| 1.30M| for (i = 0; i < 8; i++) { ------------------ | Branch (183:17): [True: 1.16M, False: 145k] ------------------ 184| 1.16M| md->sha256.state[i] = md->sha256.state[i] + S[i]; 185| 1.16M| } 186| 145k| return CRYPT_OK; 187| 145k|} sha384_init: 42| 4.08k|{ 43| 4.08k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 4.08k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 4.08k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 44| | 45| 4.08k| md->sha512.curlen = 0; 46| 4.08k| md->sha512.length = 0; 47| 4.08k| md->sha512.state[0] = CONST64(0xcbbb9d5dc1059ed8); ------------------ | | 200| 4.08k| #define CONST64(n) n ## ULL ------------------ 48| 4.08k| md->sha512.state[1] = CONST64(0x629a292a367cd507); ------------------ | | 200| 4.08k| #define CONST64(n) n ## ULL ------------------ 49| 4.08k| md->sha512.state[2] = CONST64(0x9159015a3070dd17); ------------------ | | 200| 4.08k| #define CONST64(n) n ## ULL ------------------ 50| 4.08k| md->sha512.state[3] = CONST64(0x152fecd8f70e5939); ------------------ | | 200| 4.08k| #define CONST64(n) n ## ULL ------------------ 51| 4.08k| md->sha512.state[4] = CONST64(0x67332667ffc00b31); ------------------ | | 200| 4.08k| #define CONST64(n) n ## ULL ------------------ 52| 4.08k| md->sha512.state[5] = CONST64(0x8eb44a8768581511); ------------------ | | 200| 4.08k| #define CONST64(n) n ## ULL ------------------ 53| 4.08k| md->sha512.state[6] = CONST64(0xdb0c2e0d64f98fa7); ------------------ | | 200| 4.08k| #define CONST64(n) n ## ULL ------------------ 54| 4.08k| md->sha512.state[7] = CONST64(0x47b5481dbefa4fa4); ------------------ | | 200| 4.08k| #define CONST64(n) n ## ULL ------------------ 55| 4.08k| return CRYPT_OK; 56| 4.08k|} sha384_done: 65| 14.4k|{ 66| 14.4k| unsigned char buf[64]; 67| | 68| 14.4k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 14.4k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 14.4k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 69| 14.4k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 14.4k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 14.4k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 70| | 71| 14.4k| if (md->sha512.curlen >= sizeof(md->sha512.buf)) { ------------------ | Branch (71:9): [True: 0, False: 14.4k] ------------------ 72| 0| return CRYPT_INVALID_ARG; 73| 0| } 74| | 75| 14.4k| sha512_done(md, buf); 76| 14.4k| XMEMCPY(out, buf, 48); ------------------ | | 39| 14.4k|#define XMEMCPY memcpy ------------------ 77| |#ifdef LTC_CLEAN_STACK 78| | zeromem(buf, sizeof(buf)); 79| |#endif 80| 14.4k| return CRYPT_OK; 81| 14.4k|} sha512_init: 174| 1.82k|{ 175| 1.82k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 1.82k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.82k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 176| 1.82k| md->sha512.curlen = 0; 177| 1.82k| md->sha512.length = 0; 178| 1.82k| md->sha512.state[0] = CONST64(0x6a09e667f3bcc908); ------------------ | | 200| 1.82k| #define CONST64(n) n ## ULL ------------------ 179| 1.82k| md->sha512.state[1] = CONST64(0xbb67ae8584caa73b); ------------------ | | 200| 1.82k| #define CONST64(n) n ## ULL ------------------ 180| 1.82k| md->sha512.state[2] = CONST64(0x3c6ef372fe94f82b); ------------------ | | 200| 1.82k| #define CONST64(n) n ## ULL ------------------ 181| 1.82k| md->sha512.state[3] = CONST64(0xa54ff53a5f1d36f1); ------------------ | | 200| 1.82k| #define CONST64(n) n ## ULL ------------------ 182| 1.82k| md->sha512.state[4] = CONST64(0x510e527fade682d1); ------------------ | | 200| 1.82k| #define CONST64(n) n ## ULL ------------------ 183| 1.82k| md->sha512.state[5] = CONST64(0x9b05688c2b3e6c1f); ------------------ | | 200| 1.82k| #define CONST64(n) n ## ULL ------------------ 184| 1.82k| md->sha512.state[6] = CONST64(0x1f83d9abfb41bd6b); ------------------ | | 200| 1.82k| #define CONST64(n) n ## ULL ------------------ 185| 1.82k| md->sha512.state[7] = CONST64(0x5be0cd19137e2179); ------------------ | | 200| 1.82k| #define CONST64(n) n ## ULL ------------------ 186| 1.82k| return CRYPT_OK; 187| 1.82k|} sha512_done: 205| 19.4k|{ 206| 19.4k| int i; 207| | 208| 19.4k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 19.4k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 19.4k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 209| 19.4k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 19.4k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 19.4k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 210| | 211| 19.4k| if (md->sha512.curlen >= sizeof(md->sha512.buf)) { ------------------ | Branch (211:9): [True: 0, False: 19.4k] ------------------ 212| 0| return CRYPT_INVALID_ARG; 213| 0| } 214| | 215| | /* increase the length of the message */ 216| 19.4k| md->sha512.length += md->sha512.curlen * CONST64(8); ------------------ | | 200| 19.4k| #define CONST64(n) n ## ULL ------------------ 217| | 218| | /* append the '1' bit */ 219| 19.4k| md->sha512.buf[md->sha512.curlen++] = (unsigned char)0x80; 220| | 221| | /* if the length is currently above 112 bytes we append zeros 222| | * then compress. Then we can fall back to padding zeros and length 223| | * encoding like normal. 224| | */ 225| 19.4k| if (md->sha512.curlen > 112) { ------------------ | Branch (225:9): [True: 3.32k, False: 16.1k] ------------------ 226| 23.1k| while (md->sha512.curlen < 128) { ------------------ | Branch (226:16): [True: 19.8k, False: 3.32k] ------------------ 227| 19.8k| md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; 228| 19.8k| } 229| 3.32k| sha512_compress(md, md->sha512.buf); 230| 3.32k| md->sha512.curlen = 0; 231| 3.32k| } 232| | 233| | /* pad upto 120 bytes of zeroes 234| | * note: that from 112 to 120 is the 64 MSB of the length. We assume that you won't hash 235| | * > 2^64 bits of data... :-) 236| | */ 237| 1.10M| while (md->sha512.curlen < 120) { ------------------ | Branch (237:12): [True: 1.08M, False: 19.4k] ------------------ 238| 1.08M| md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; 239| 1.08M| } 240| | 241| | /* store length */ 242| 19.4k| STORE64H(md->sha512.length, md->sha512.buf+120); ------------------ | | 101| 19.4k|#define STORE64H(x, y) \ | | 102| 19.4k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 19.4k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 19.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 243| 19.4k| sha512_compress(md, md->sha512.buf); 244| | 245| | /* copy output */ 246| 175k| for (i = 0; i < 8; i++) { ------------------ | Branch (246:17): [True: 155k, False: 19.4k] ------------------ 247| 155k| STORE64H(md->sha512.state[i], out+(8*i)); ------------------ | | 101| 155k|#define STORE64H(x, y) \ | | 102| 155k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 155k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 155k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 248| 155k| } 249| |#ifdef LTC_CLEAN_STACK 250| | zeromem(md, sizeof(hash_state)); 251| |#endif 252| 19.4k| return CRYPT_OK; 253| 19.4k|} sha512.c:sha512_compress: 96| 46.7k|{ 97| 46.7k| ulong64 S[8], W[80], t0, t1; 98| 46.7k| int i; 99| | 100| | /* copy state into S */ 101| 420k| for (i = 0; i < 8; i++) { ------------------ | Branch (101:17): [True: 374k, False: 46.7k] ------------------ 102| 374k| S[i] = md->sha512.state[i]; 103| 374k| } 104| | 105| | /* copy the state into 1024-bits into W[0..15] */ 106| 794k| for (i = 0; i < 16; i++) { ------------------ | Branch (106:17): [True: 748k, False: 46.7k] ------------------ 107| 748k| LOAD64H(W[i], buf + (8*i)); ------------------ | | 105| 748k|#define LOAD64H(x, y) \ | | 106| 748k|do { XMEMCPY (&(x), (y), 8); \ | | ------------------ | | | | 39| 748k|#define XMEMCPY memcpy | | ------------------ | | 107| 748k| (x) = __builtin_bswap64 ((x)); } while(0) | | ------------------ | | | Branch (107:46): [Folded - Ignored] | | ------------------ ------------------ 108| 748k| } 109| | 110| | /* fill W[16..79] */ 111| 3.03M| for (i = 16; i < 80; i++) { ------------------ | Branch (111:18): [True: 2.99M, False: 46.7k] ------------------ 112| 2.99M| W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 88| 2.99M|#define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) | | ------------------ | | | | 83| 2.99M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 2.99M|#define ROR64c(word,i) ({ \ | | | | | | 385| 2.99M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 2.99M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 2.99M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 2.99M| "0" (__ROR64c_tmp), \ | | | | | | 389| 2.99M| "J" (i)); \ | | | | | | 390| 2.99M| __ROR64c_tmp; \ | | | | | | 391| 2.99M| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) | | ------------------ | | | | 83| 2.99M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 2.99M|#define ROR64c(word,i) ({ \ | | | | | | 385| 2.99M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 2.99M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 2.99M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 2.99M| "0" (__ROR64c_tmp), \ | | | | | | 389| 2.99M| "J" (i)); \ | | | | | | 390| 2.99M| __ROR64c_tmp; \ | | | | | | 391| 2.99M| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) | | ------------------ | | | | 84| 2.99M|#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) | | | | ------------------ | | | | | | 200| 2.99M| #define CONST64(n) n ## ULL | | | | ------------------ | | ------------------ ------------------ W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 87| 2.99M|#define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) | | ------------------ | | | | 83| 2.99M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 2.99M|#define ROR64c(word,i) ({ \ | | | | | | 385| 2.99M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 2.99M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 2.99M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 2.99M| "0" (__ROR64c_tmp), \ | | | | | | 389| 2.99M| "J" (i)); \ | | | | | | 390| 2.99M| __ROR64c_tmp; \ | | | | | | 391| 2.99M| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) | | ------------------ | | | | 83| 2.99M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 2.99M|#define ROR64c(word,i) ({ \ | | | | | | 385| 2.99M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 2.99M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 2.99M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 2.99M| "0" (__ROR64c_tmp), \ | | | | | | 389| 2.99M| "J" (i)); \ | | | | | | 390| 2.99M| __ROR64c_tmp; \ | | | | | | 391| 2.99M| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) | | ------------------ | | | | 84| 2.99M|#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) | | | | ------------------ | | | | | | 200| 2.99M| #define CONST64(n) n ## ULL | | | | ------------------ | | ------------------ ------------------ 113| 2.99M| } 114| | 115| | /* Compress */ 116| 46.7k|#ifdef LTC_SMALL_CODE 117| 3.78M| for (i = 0; i < 80; i++) { ------------------ | Branch (117:17): [True: 3.74M, False: 46.7k] ------------------ 118| 3.74M| t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i]; ------------------ | | 86| 3.74M|#define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) | | ------------------ | | | | 83| 3.74M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 3.74M|#define ROR64c(word,i) ({ \ | | | | | | 385| 3.74M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 3.74M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 3.74M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 3.74M| "0" (__ROR64c_tmp), \ | | | | | | 389| 3.74M| "J" (i)); \ | | | | | | 390| 3.74M| __ROR64c_tmp; \ | | | | | | 391| 3.74M| }) | | | | ------------------ | | ------------------ | | #define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) | | ------------------ | | | | 83| 3.74M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 3.74M|#define ROR64c(word,i) ({ \ | | | | | | 385| 3.74M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 3.74M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 3.74M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 3.74M| "0" (__ROR64c_tmp), \ | | | | | | 389| 3.74M| "J" (i)); \ | | | | | | 390| 3.74M| __ROR64c_tmp; \ | | | | | | 391| 3.74M| }) | | | | ------------------ | | ------------------ | | #define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) | | ------------------ | | | | 83| 3.74M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 3.74M|#define ROR64c(word,i) ({ \ | | | | | | 385| 3.74M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 3.74M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 3.74M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 3.74M| "0" (__ROR64c_tmp), \ | | | | | | 389| 3.74M| "J" (i)); \ | | | | | | 390| 3.74M| __ROR64c_tmp; \ | | | | | | 391| 3.74M| }) | | | | ------------------ | | ------------------ ------------------ t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i]; ------------------ | | 81| 3.74M|#define Ch(x,y,z) (z ^ (x & (y ^ z))) ------------------ 119| 3.74M| t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]); ------------------ | | 85| 3.74M|#define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) | | ------------------ | | | | 83| 3.74M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 3.74M|#define ROR64c(word,i) ({ \ | | | | | | 385| 3.74M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 3.74M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 3.74M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 3.74M| "0" (__ROR64c_tmp), \ | | | | | | 389| 3.74M| "J" (i)); \ | | | | | | 390| 3.74M| __ROR64c_tmp; \ | | | | | | 391| 3.74M| }) | | | | ------------------ | | ------------------ | | #define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) | | ------------------ | | | | 83| 3.74M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 3.74M|#define ROR64c(word,i) ({ \ | | | | | | 385| 3.74M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 3.74M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 3.74M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 3.74M| "0" (__ROR64c_tmp), \ | | | | | | 389| 3.74M| "J" (i)); \ | | | | | | 390| 3.74M| __ROR64c_tmp; \ | | | | | | 391| 3.74M| }) | | | | ------------------ | | ------------------ | | #define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) | | ------------------ | | | | 83| 3.74M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 3.74M|#define ROR64c(word,i) ({ \ | | | | | | 385| 3.74M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 3.74M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 3.74M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 3.74M| "0" (__ROR64c_tmp), \ | | | | | | 389| 3.74M| "J" (i)); \ | | | | | | 390| 3.74M| __ROR64c_tmp; \ | | | | | | 391| 3.74M| }) | | | | ------------------ | | ------------------ ------------------ t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]); ------------------ | | 82| 3.74M|#define Maj(x,y,z) (((x | y) & z) | (x & y)) ------------------ 120| 3.74M| S[7] = S[6]; 121| 3.74M| S[6] = S[5]; 122| 3.74M| S[5] = S[4]; 123| 3.74M| S[4] = S[3] + t0; 124| 3.74M| S[3] = S[2]; 125| 3.74M| S[2] = S[1]; 126| 3.74M| S[1] = S[0]; 127| 3.74M| S[0] = t0 + t1; 128| 3.74M| } 129| |#else 130| |#define RND(a,b,c,d,e,f,g,h,i) \ 131| | t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ 132| | t1 = Sigma0(a) + Maj(a, b, c); \ 133| | d += t0; \ 134| | h = t0 + t1; 135| | 136| | for (i = 0; i < 80; i += 8) { 137| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0); 138| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1); 139| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2); 140| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3); 141| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4); 142| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5); 143| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); 144| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); 145| | } 146| |#endif 147| | 148| | 149| | /* feedback */ 150| 420k| for (i = 0; i < 8; i++) { ------------------ | Branch (150:17): [True: 374k, False: 46.7k] ------------------ 151| 374k| md->sha512.state[i] = md->sha512.state[i] + S[i]; 152| 374k| } 153| | 154| 46.7k| return CRYPT_OK; 155| 46.7k|} sha1_process: 491| 90.0k|int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) \ 492| 90.0k|{ \ 493| 90.0k| unsigned long n; \ 494| 90.0k| int err; \ 495| 90.0k| LTC_ARGCHK(md != NULL); \ ------------------ | | 32| 90.0k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 90.0k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 496| 90.0k| LTC_ARGCHK(in != NULL); \ ------------------ | | 32| 90.0k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 90.0k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 497| 90.0k| if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ ------------------ | Branch (497:9): [True: 0, False: 90.0k] ------------------ 498| 0| return CRYPT_INVALID_ARG; \ 499| 0| } \ 500| 90.0k| if ((md-> state_var .length + inlen) < md-> state_var .length) { \ ------------------ | Branch (500:9): [True: 0, False: 90.0k] ------------------ 501| 0| return CRYPT_HASH_OVERFLOW; \ 502| 0| } \ 503| 250k| while (inlen > 0) { \ ------------------ | Branch (503:12): [True: 160k, False: 90.0k] ------------------ 504| 160k| if (md-> state_var .curlen == 0 && inlen >= block_size) { \ ------------------ | Branch (504:13): [True: 96.4k, False: 63.5k] | Branch (504:44): [True: 63.7k, False: 32.7k] ------------------ 505| 63.7k| if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) { \ ------------------ | Branch (505:16): [True: 0, False: 63.7k] ------------------ 506| 0| return err; \ 507| 0| } \ 508| 63.7k| md-> state_var .length += block_size * 8; \ 509| 63.7k| in += block_size; \ 510| 63.7k| inlen -= block_size; \ 511| 96.3k| } else { \ 512| 96.3k| n = MIN(inlen, (block_size - md-> state_var .curlen)); \ ------------------ | | 425| 96.3k| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 80.6k, False: 15.7k] | | ------------------ ------------------ 513| 96.3k| XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ ------------------ | | 39| 96.3k|#define XMEMCPY memcpy ------------------ 514| 96.3k| md-> state_var .curlen += n; \ 515| 96.3k| in += n; \ 516| 96.3k| inlen -= n; \ 517| 96.3k| if (md-> state_var .curlen == block_size) { \ ------------------ | Branch (517:16): [True: 15.7k, False: 80.6k] ------------------ 518| 15.7k| if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) { \ ------------------ | Branch (518:19): [True: 0, False: 15.7k] ------------------ 519| 0| return err; \ 520| 0| } \ 521| 15.7k| md-> state_var .length += 8*block_size; \ 522| 15.7k| md-> state_var .curlen = 0; \ 523| 15.7k| } \ 524| 96.3k| } \ 525| 160k| } \ 526| 90.0k| return CRYPT_OK; \ 527| 90.0k|} sha256_process: 491| 171k|int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) \ 492| 171k|{ \ 493| 171k| unsigned long n; \ 494| 171k| int err; \ 495| 171k| LTC_ARGCHK(md != NULL); \ ------------------ | | 32| 171k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 171k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 496| 171k| LTC_ARGCHK(in != NULL); \ ------------------ | | 32| 171k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 171k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 497| 171k| if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ ------------------ | Branch (497:9): [True: 0, False: 171k] ------------------ 498| 0| return CRYPT_INVALID_ARG; \ 499| 0| } \ 500| 171k| if ((md-> state_var .length + inlen) < md-> state_var .length) { \ ------------------ | Branch (500:9): [True: 0, False: 171k] ------------------ 501| 0| return CRYPT_HASH_OVERFLOW; \ 502| 0| } \ 503| 395k| while (inlen > 0) { \ ------------------ | Branch (503:12): [True: 224k, False: 171k] ------------------ 504| 224k| if (md-> state_var .curlen == 0 && inlen >= block_size) { \ ------------------ | Branch (504:13): [True: 134k, False: 89.8k] | Branch (504:44): [True: 46.3k, False: 87.9k] ------------------ 505| 46.3k| if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) { \ ------------------ | Branch (505:16): [True: 0, False: 46.3k] ------------------ 506| 0| return err; \ 507| 0| } \ 508| 46.3k| md-> state_var .length += block_size * 8; \ 509| 46.3k| in += block_size; \ 510| 46.3k| inlen -= block_size; \ 511| 177k| } else { \ 512| 177k| n = MIN(inlen, (block_size - md-> state_var .curlen)); \ ------------------ | | 425| 177k| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 163k, False: 13.8k] | | ------------------ ------------------ 513| 177k| XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ ------------------ | | 39| 177k|#define XMEMCPY memcpy ------------------ 514| 177k| md-> state_var .curlen += n; \ 515| 177k| in += n; \ 516| 177k| inlen -= n; \ 517| 177k| if (md-> state_var .curlen == block_size) { \ ------------------ | Branch (517:16): [True: 13.8k, False: 163k] ------------------ 518| 13.8k| if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) { \ ------------------ | Branch (518:19): [True: 0, False: 13.8k] ------------------ 519| 0| return err; \ 520| 0| } \ 521| 13.8k| md-> state_var .length += 8*block_size; \ 522| 13.8k| md-> state_var .curlen = 0; \ 523| 13.8k| } \ 524| 177k| } \ 525| 224k| } \ 526| 171k| return CRYPT_OK; \ 527| 171k|} sha512_process: 491| 37.8k|int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) \ 492| 37.8k|{ \ 493| 37.8k| unsigned long n; \ 494| 37.8k| int err; \ 495| 37.8k| LTC_ARGCHK(md != NULL); \ ------------------ | | 32| 37.8k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 37.8k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 496| 37.8k| LTC_ARGCHK(in != NULL); \ ------------------ | | 32| 37.8k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 37.8k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 497| 37.8k| if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ ------------------ | Branch (497:9): [True: 0, False: 37.8k] ------------------ 498| 0| return CRYPT_INVALID_ARG; \ 499| 0| } \ 500| 37.8k| if ((md-> state_var .length + inlen) < md-> state_var .length) { \ ------------------ | Branch (500:9): [True: 0, False: 37.8k] ------------------ 501| 0| return CRYPT_HASH_OVERFLOW; \ 502| 0| } \ 503| 99.6k| while (inlen > 0) { \ ------------------ | Branch (503:12): [True: 61.7k, False: 37.8k] ------------------ 504| 61.7k| if (md-> state_var .curlen == 0 && inlen >= block_size) { \ ------------------ | Branch (504:13): [True: 29.8k, False: 31.9k] | Branch (504:44): [True: 20.9k, False: 8.89k] ------------------ 505| 20.9k| if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) { \ ------------------ | Branch (505:16): [True: 0, False: 20.9k] ------------------ 506| 0| return err; \ 507| 0| } \ 508| 20.9k| md-> state_var .length += block_size * 8; \ 509| 20.9k| in += block_size; \ 510| 20.9k| inlen -= block_size; \ 511| 40.8k| } else { \ 512| 40.8k| n = MIN(inlen, (block_size - md-> state_var .curlen)); \ ------------------ | | 425| 40.8k| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 37.8k, False: 2.99k] | | ------------------ ------------------ 513| 40.8k| XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ ------------------ | | 39| 40.8k|#define XMEMCPY memcpy ------------------ 514| 40.8k| md-> state_var .curlen += n; \ 515| 40.8k| in += n; \ 516| 40.8k| inlen -= n; \ 517| 40.8k| if (md-> state_var .curlen == block_size) { \ ------------------ | Branch (517:16): [True: 2.99k, False: 37.8k] ------------------ 518| 2.99k| if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) { \ ------------------ | Branch (518:19): [True: 0, False: 2.99k] ------------------ 519| 0| return err; \ 520| 0| } \ 521| 2.99k| md-> state_var .length += 8*block_size; \ 522| 2.99k| md-> state_var .curlen = 0; \ 523| 2.99k| } \ 524| 40.8k| } \ 525| 61.7k| } \ 526| 37.8k| return CRYPT_OK; \ 527| 37.8k|} sha1.c:ROL: 258| 8.47M|{ 259| 8.47M| asm ("roll %%cl,%0" 260| 8.47M| :"=r" (word) 261| 8.47M| :"0" (word),"c" (i)); 262| 8.47M| return word; 263| 8.47M|} chacha_crypt.c:ROL: 258| 32.8M|{ 259| 32.8M| asm ("roll %%cl,%0" 260| 32.8M| :"=r" (word) 261| 32.8M| :"0" (word),"c" (i)); 262| 32.8M| return word; 263| 32.8M|} hmac_done: 28| 8.62k|{ 29| 8.62k| unsigned char buf[MAXBLOCKSIZE], isha[MAXBLOCKSIZE]; 30| 8.62k| unsigned long hashsize, i; 31| 8.62k| int hash, err; 32| | 33| 8.62k| LTC_ARGCHK(hmac != NULL); ------------------ | | 32| 8.62k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 8.62k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 34| 8.62k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 8.62k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 8.62k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 35| | 36| | /* test hash */ 37| 8.62k| hash = hmac->hash; 38| 8.62k| if((err = hash_is_valid(hash)) != CRYPT_OK) { ------------------ | Branch (38:8): [True: 0, False: 8.62k] ------------------ 39| 0| return err; 40| 0| } 41| | 42| | /* get the hash message digest size */ 43| 8.62k| hashsize = hash_descriptor[hash].hashsize; 44| | 45| 8.62k| if ((err = hash_descriptor[hash].done(&hmac->md, isha)) != CRYPT_OK) { ------------------ | Branch (45:9): [True: 0, False: 8.62k] ------------------ 46| 0| goto LBL_ERR; 47| 0| } 48| | 49| | /* Create the second HMAC vector vector for step (3) */ 50| 560k| for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) { ------------------ | | 18| 560k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (50:14): [True: 552k, False: 8.62k] ------------------ 51| 552k| buf[i] = hmac->key[i] ^ 0x5C; 52| 552k| } 53| | 54| | /* Now calculate the "outer" hash for step (5), (6), and (7) */ 55| 8.62k| if ((err = hash_descriptor[hash].init(&hmac->md)) != CRYPT_OK) { ------------------ | Branch (55:9): [True: 0, False: 8.62k] ------------------ 56| 0| goto LBL_ERR; 57| 0| } 58| 8.62k| if ((err = hash_descriptor[hash].process(&hmac->md, buf, LTC_HMAC_BLOCKSIZE)) != CRYPT_OK) { ------------------ | | 18| 8.62k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (58:9): [True: 0, False: 8.62k] ------------------ 59| 0| goto LBL_ERR; 60| 0| } 61| 8.62k| if ((err = hash_descriptor[hash].process(&hmac->md, isha, hashsize)) != CRYPT_OK) { ------------------ | Branch (61:9): [True: 0, False: 8.62k] ------------------ 62| 0| goto LBL_ERR; 63| 0| } 64| 8.62k| if ((err = hash_descriptor[hash].done(&hmac->md, buf)) != CRYPT_OK) { ------------------ | Branch (64:9): [True: 0, False: 8.62k] ------------------ 65| 0| goto LBL_ERR; 66| 0| } 67| | 68| | /* copy to output */ 69| 228k| for (i = 0; i < hashsize && i < *outlen; i++) { ------------------ | Branch (69:17): [True: 219k, False: 8.62k] | Branch (69:33): [True: 219k, False: 0] ------------------ 70| 219k| out[i] = buf[i]; 71| 219k| } 72| 8.62k| *outlen = i; 73| | 74| 8.62k| err = CRYPT_OK; 75| 8.62k|LBL_ERR: 76| 8.62k| XFREE(hmac->key); ------------------ | | 17| 8.62k|#define XFREE m_free_direct ------------------ 77| |#ifdef LTC_CLEAN_STACK 78| | zeromem(isha, hashsize); 79| | zeromem(buf, hashsize); 80| | zeromem(hmac, sizeof(*hmac)); 81| |#endif 82| | 83| 8.62k| return err; 84| 8.62k|} hmac_init: 29| 8.62k|{ 30| 8.62k| unsigned char buf[MAXBLOCKSIZE]; 31| 8.62k| unsigned long hashsize; 32| 8.62k| unsigned long i, z; 33| 8.62k| int err; 34| | 35| 8.62k| LTC_ARGCHK(hmac != NULL); ------------------ | | 32| 8.62k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 8.62k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 36| 8.62k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 8.62k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 8.62k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 37| | 38| | /* valid hash? */ 39| 8.62k| if ((err = hash_is_valid(hash)) != CRYPT_OK) { ------------------ | Branch (39:9): [True: 0, False: 8.62k] ------------------ 40| 0| return err; 41| 0| } 42| 8.62k| hmac->hash = hash; 43| 8.62k| hashsize = hash_descriptor[hash].hashsize; 44| | 45| | /* valid key length? */ 46| 8.62k| if (keylen == 0) { ------------------ | Branch (46:9): [True: 0, False: 8.62k] ------------------ 47| 0| return CRYPT_INVALID_KEYSIZE; 48| 0| } 49| | 50| | /* allocate memory for key */ 51| 8.62k| hmac->key = XMALLOC(LTC_HMAC_BLOCKSIZE); ------------------ | | 16| 8.62k|#define XMALLOC m_malloc ------------------ hmac->key = XMALLOC(LTC_HMAC_BLOCKSIZE); ------------------ | | 18| 8.62k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ 52| 8.62k| if (hmac->key == NULL) { ------------------ | Branch (52:9): [True: 0, False: 8.62k] ------------------ 53| 0| return CRYPT_MEM; 54| 0| } 55| | 56| | /* (1) make sure we have a large enough key */ 57| 8.62k| if(keylen > LTC_HMAC_BLOCKSIZE) { ------------------ | | 18| 8.62k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (57:8): [True: 0, False: 8.62k] ------------------ 58| 0| z = LTC_HMAC_BLOCKSIZE; ------------------ | | 18| 0|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ 59| 0| if ((err = hash_memory(hash, key, keylen, hmac->key, &z)) != CRYPT_OK) { ------------------ | Branch (59:13): [True: 0, False: 0] ------------------ 60| 0| goto LBL_ERR; 61| 0| } 62| 0| keylen = hashsize; 63| 8.62k| } else { 64| 8.62k| XMEMCPY(hmac->key, key, (size_t)keylen); ------------------ | | 39| 8.62k|#define XMEMCPY memcpy ------------------ 65| 8.62k| } 66| | 67| 8.62k| if(keylen < LTC_HMAC_BLOCKSIZE) { ------------------ | | 18| 8.62k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (67:8): [True: 8.62k, False: 0] ------------------ 68| 8.62k| zeromem((hmac->key) + keylen, (size_t)(LTC_HMAC_BLOCKSIZE - keylen)); ------------------ | | 18| 8.62k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ 69| 8.62k| } 70| | 71| | /* Create the initialization vector for step (3) */ 72| 560k| for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) { ------------------ | | 18| 560k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (72:14): [True: 552k, False: 8.62k] ------------------ 73| 552k| buf[i] = hmac->key[i] ^ 0x36; 74| 552k| } 75| | 76| | /* Pre-pend that to the hash data */ 77| 8.62k| if ((err = hash_descriptor[hash].init(&hmac->md)) != CRYPT_OK) { ------------------ | Branch (77:9): [True: 0, False: 8.62k] ------------------ 78| 0| goto LBL_ERR; 79| 0| } 80| | 81| 8.62k| if ((err = hash_descriptor[hash].process(&hmac->md, buf, LTC_HMAC_BLOCKSIZE)) != CRYPT_OK) { ------------------ | | 18| 8.62k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (81:9): [True: 0, False: 8.62k] ------------------ 82| 0| goto LBL_ERR; 83| 0| } 84| 8.62k| goto done; 85| 8.62k|LBL_ERR: 86| | /* free the key since we failed */ 87| 0| XFREE(hmac->key); ------------------ | | 17| 0|#define XFREE m_free_direct ------------------ 88| 8.62k|done: 89| |#ifdef LTC_CLEAN_STACK 90| | zeromem(buf, LTC_HMAC_BLOCKSIZE); 91| |#endif 92| | 93| 8.62k| return err; 94| 0|} hmac_process: 26| 17.2k|{ 27| 17.2k| int err; 28| 17.2k| LTC_ARGCHK(hmac != NULL); ------------------ | | 32| 17.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 29| 17.2k| LTC_ARGCHK(in != NULL); ------------------ | | 32| 17.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 30| 17.2k| if ((err = hash_is_valid(hmac->hash)) != CRYPT_OK) { ------------------ | Branch (30:9): [True: 0, False: 17.2k] ------------------ 31| 0| return err; 32| 0| } 33| 17.2k| return hash_descriptor[hmac->hash].process(&hmac->md, in, inlen); 34| 17.2k|} poly1305_init: 90| 17.2k|{ 91| 17.2k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 17.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 92| 17.2k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 17.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 93| 17.2k| LTC_ARGCHK(keylen == 32); ------------------ | | 32| 17.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 94| | 95| | /* r &= 0xffffffc0ffffffc0ffffffc0fffffff */ 96| 17.2k| LOAD32L(st->r[0], key + 0); st->r[0] = (st->r[0] ) & 0x3ffffff; ------------------ | | 167| 17.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 97| 17.2k| LOAD32L(st->r[1], key + 3); st->r[1] = (st->r[1] >> 2) & 0x3ffff03; ------------------ | | 167| 17.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 98| 17.2k| LOAD32L(st->r[2], key + 6); st->r[2] = (st->r[2] >> 4) & 0x3ffc0ff; ------------------ | | 167| 17.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 99| 17.2k| LOAD32L(st->r[3], key + 9); st->r[3] = (st->r[3] >> 6) & 0x3f03fff; ------------------ | | 167| 17.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 100| 17.2k| LOAD32L(st->r[4], key + 12); st->r[4] = (st->r[4] >> 8) & 0x00fffff; ------------------ | | 167| 17.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 101| | 102| | /* h = 0 */ 103| 17.2k| st->h[0] = 0; 104| 17.2k| st->h[1] = 0; 105| 17.2k| st->h[2] = 0; 106| 17.2k| st->h[3] = 0; 107| 17.2k| st->h[4] = 0; 108| | 109| | /* save pad for later */ 110| 17.2k| LOAD32L(st->pad[0], key + 16); ------------------ | | 167| 17.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 111| 17.2k| LOAD32L(st->pad[1], key + 20); ------------------ | | 167| 17.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 112| 17.2k| LOAD32L(st->pad[2], key + 24); ------------------ | | 167| 17.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 113| 17.2k| LOAD32L(st->pad[3], key + 28); ------------------ | | 167| 17.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 114| | 115| 17.2k| st->leftover = 0; 116| 17.2k| st->final = 0; 117| 17.2k| return CRYPT_OK; 118| 17.2k|} poly1305_process: 128| 17.2k|{ 129| 17.2k| unsigned long i; 130| | 131| 17.2k| if (inlen == 0) return CRYPT_OK; /* nothing to do */ ------------------ | Branch (131:8): [True: 0, False: 17.2k] ------------------ 132| 17.2k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 17.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 133| 17.2k| LTC_ARGCHK(in != NULL); ------------------ | | 32| 17.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 134| | 135| | /* handle leftover */ 136| 17.2k| if (st->leftover) { ------------------ | Branch (136:8): [True: 0, False: 17.2k] ------------------ 137| 0| unsigned long want = (16 - st->leftover); 138| 0| if (want > inlen) want = inlen; ------------------ | Branch (138:11): [True: 0, False: 0] ------------------ 139| 0| for (i = 0; i < want; i++) st->buffer[st->leftover + i] = in[i]; ------------------ | Branch (139:19): [True: 0, False: 0] ------------------ 140| 0| inlen -= want; 141| 0| in += want; 142| 0| st->leftover += want; 143| 0| if (st->leftover < 16) return CRYPT_OK; ------------------ | Branch (143:11): [True: 0, False: 0] ------------------ 144| 0| _poly1305_block(st, st->buffer, 16); 145| 0| st->leftover = 0; 146| 0| } 147| | 148| | /* process full blocks */ 149| 17.2k| if (inlen >= 16) { ------------------ | Branch (149:8): [True: 17.2k, False: 0] ------------------ 150| 17.2k| unsigned long want = (inlen & ~(16 - 1)); 151| 17.2k| _poly1305_block(st, in, want); 152| 17.2k| in += want; 153| 17.2k| inlen -= want; 154| 17.2k| } 155| | 156| | /* store leftover */ 157| 17.2k| if (inlen) { ------------------ | Branch (157:8): [True: 17.2k, False: 0] ------------------ 158| 88.9k| for (i = 0; i < inlen; i++) st->buffer[st->leftover + i] = in[i]; ------------------ | Branch (158:19): [True: 71.7k, False: 17.2k] ------------------ 159| 17.2k| st->leftover += inlen; 160| 17.2k| } 161| 17.2k| return CRYPT_OK; 162| 17.2k|} poly1305_done: 172| 17.2k|{ 173| 17.2k| ulong32 h0,h1,h2,h3,h4,c; 174| 17.2k| ulong32 g0,g1,g2,g3,g4; 175| 17.2k| ulong64 f; 176| 17.2k| ulong32 mask; 177| | 178| 17.2k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 17.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 179| 17.2k| LTC_ARGCHK(mac != NULL); ------------------ | | 32| 17.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 180| 17.2k| LTC_ARGCHK(maclen != NULL); ------------------ | | 32| 17.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 181| 17.2k| LTC_ARGCHK(*maclen >= 16); ------------------ | | 32| 17.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 182| | 183| | /* process the remaining block */ 184| 17.2k| if (st->leftover) { ------------------ | Branch (184:8): [True: 17.2k, False: 0] ------------------ 185| 17.2k| unsigned long i = st->leftover; 186| 17.2k| st->buffer[i++] = 1; 187| 203k| for (; i < 16; i++) st->buffer[i] = 0; ------------------ | Branch (187:14): [True: 186k, False: 17.2k] ------------------ 188| 17.2k| st->final = 1; 189| 17.2k| _poly1305_block(st, st->buffer, 16); 190| 17.2k| } 191| | 192| | /* fully carry h */ 193| 17.2k| h0 = st->h[0]; 194| 17.2k| h1 = st->h[1]; 195| 17.2k| h2 = st->h[2]; 196| 17.2k| h3 = st->h[3]; 197| 17.2k| h4 = st->h[4]; 198| | 199| 17.2k| c = h1 >> 26; h1 = h1 & 0x3ffffff; 200| 17.2k| h2 += c; c = h2 >> 26; h2 = h2 & 0x3ffffff; 201| 17.2k| h3 += c; c = h3 >> 26; h3 = h3 & 0x3ffffff; 202| 17.2k| h4 += c; c = h4 >> 26; h4 = h4 & 0x3ffffff; 203| 17.2k| h0 += c * 5; c = h0 >> 26; h0 = h0 & 0x3ffffff; 204| 17.2k| h1 += c; 205| | 206| | /* compute h + -p */ 207| 17.2k| g0 = h0 + 5; c = g0 >> 26; g0 &= 0x3ffffff; 208| 17.2k| g1 = h1 + c; c = g1 >> 26; g1 &= 0x3ffffff; 209| 17.2k| g2 = h2 + c; c = g2 >> 26; g2 &= 0x3ffffff; 210| 17.2k| g3 = h3 + c; c = g3 >> 26; g3 &= 0x3ffffff; 211| 17.2k| g4 = h4 + c - (1UL << 26); 212| | 213| | /* select h if h < p, or h + -p if h >= p */ 214| 17.2k| mask = (g4 >> 31) - 1; 215| 17.2k| g0 &= mask; 216| 17.2k| g1 &= mask; 217| 17.2k| g2 &= mask; 218| 17.2k| g3 &= mask; 219| 17.2k| g4 &= mask; 220| 17.2k| mask = ~mask; 221| 17.2k| h0 = (h0 & mask) | g0; 222| 17.2k| h1 = (h1 & mask) | g1; 223| 17.2k| h2 = (h2 & mask) | g2; 224| 17.2k| h3 = (h3 & mask) | g3; 225| 17.2k| h4 = (h4 & mask) | g4; 226| | 227| | /* h = h % (2^128) */ 228| 17.2k| h0 = ((h0 ) | (h1 << 26)) & 0xffffffff; 229| 17.2k| h1 = ((h1 >> 6) | (h2 << 20)) & 0xffffffff; 230| 17.2k| h2 = ((h2 >> 12) | (h3 << 14)) & 0xffffffff; 231| 17.2k| h3 = ((h3 >> 18) | (h4 << 8)) & 0xffffffff; 232| | 233| | /* mac = (h + pad) % (2^128) */ 234| 17.2k| f = (ulong64)h0 + st->pad[0] ; h0 = (ulong32)f; 235| 17.2k| f = (ulong64)h1 + st->pad[1] + (f >> 32); h1 = (ulong32)f; 236| 17.2k| f = (ulong64)h2 + st->pad[2] + (f >> 32); h2 = (ulong32)f; 237| 17.2k| f = (ulong64)h3 + st->pad[3] + (f >> 32); h3 = (ulong32)f; 238| | 239| 17.2k| STORE32L(h0, mac + 0); ------------------ | | 164| 17.2k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 240| 17.2k| STORE32L(h1, mac + 4); ------------------ | | 164| 17.2k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 241| 17.2k| STORE32L(h2, mac + 8); ------------------ | | 164| 17.2k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 242| 17.2k| STORE32L(h3, mac + 12); ------------------ | | 164| 17.2k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 243| | 244| | /* zero out the state */ 245| 17.2k| st->h[0] = 0; 246| 17.2k| st->h[1] = 0; 247| 17.2k| st->h[2] = 0; 248| 17.2k| st->h[3] = 0; 249| 17.2k| st->h[4] = 0; 250| 17.2k| st->r[0] = 0; 251| 17.2k| st->r[1] = 0; 252| 17.2k| st->r[2] = 0; 253| 17.2k| st->r[3] = 0; 254| 17.2k| st->r[4] = 0; 255| 17.2k| st->pad[0] = 0; 256| 17.2k| st->pad[1] = 0; 257| 17.2k| st->pad[2] = 0; 258| 17.2k| st->pad[3] = 0; 259| | 260| 17.2k| *maclen = 16; 261| 17.2k| return CRYPT_OK; 262| 17.2k|} poly1305.c:_poly1305_block: 21| 34.4k|{ 22| 34.4k| const unsigned long hibit = (st->final) ? 0 : (1UL << 24); /* 1 << 128 */ ------------------ | Branch (22:32): [True: 17.2k, False: 17.2k] ------------------ 23| 34.4k| ulong32 r0,r1,r2,r3,r4; 24| 34.4k| ulong32 s1,s2,s3,s4; 25| 34.4k| ulong32 h0,h1,h2,h3,h4; 26| 34.4k| ulong32 tmp; 27| 34.4k| ulong64 d0,d1,d2,d3,d4; 28| 34.4k| ulong32 c; 29| | 30| 34.4k| r0 = st->r[0]; 31| 34.4k| r1 = st->r[1]; 32| 34.4k| r2 = st->r[2]; 33| 34.4k| r3 = st->r[3]; 34| 34.4k| r4 = st->r[4]; 35| | 36| 34.4k| s1 = r1 * 5; 37| 34.4k| s2 = r2 * 5; 38| 34.4k| s3 = r3 * 5; 39| 34.4k| s4 = r4 * 5; 40| | 41| 34.4k| h0 = st->h[0]; 42| 34.4k| h1 = st->h[1]; 43| 34.4k| h2 = st->h[2]; 44| 34.4k| h3 = st->h[3]; 45| 34.4k| h4 = st->h[4]; 46| | 47| 293k| while (inlen >= 16) { ------------------ | Branch (47:11): [True: 258k, False: 34.4k] ------------------ 48| | /* h += in[i] */ 49| 258k| LOAD32L(tmp, in+ 0); h0 += (tmp ) & 0x3ffffff; ------------------ | | 167| 258k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 258k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 50| 258k| LOAD32L(tmp, in+ 3); h1 += (tmp >> 2) & 0x3ffffff; ------------------ | | 167| 258k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 258k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 51| 258k| LOAD32L(tmp, in+ 6); h2 += (tmp >> 4) & 0x3ffffff; ------------------ | | 167| 258k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 258k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 52| 258k| LOAD32L(tmp, in+ 9); h3 += (tmp >> 6) & 0x3ffffff; ------------------ | | 167| 258k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 258k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 53| 258k| LOAD32L(tmp, in+12); h4 += (tmp >> 8) | hibit; ------------------ | | 167| 258k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 258k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 54| | 55| | /* h *= r */ 56| 258k| d0 = ((ulong64)h0 * r0) + ((ulong64)h1 * s4) + ((ulong64)h2 * s3) + ((ulong64)h3 * s2) + ((ulong64)h4 * s1); 57| 258k| d1 = ((ulong64)h0 * r1) + ((ulong64)h1 * r0) + ((ulong64)h2 * s4) + ((ulong64)h3 * s3) + ((ulong64)h4 * s2); 58| 258k| d2 = ((ulong64)h0 * r2) + ((ulong64)h1 * r1) + ((ulong64)h2 * r0) + ((ulong64)h3 * s4) + ((ulong64)h4 * s3); 59| 258k| d3 = ((ulong64)h0 * r3) + ((ulong64)h1 * r2) + ((ulong64)h2 * r1) + ((ulong64)h3 * r0) + ((ulong64)h4 * s4); 60| 258k| d4 = ((ulong64)h0 * r4) + ((ulong64)h1 * r3) + ((ulong64)h2 * r2) + ((ulong64)h3 * r1) + ((ulong64)h4 * r0); 61| | 62| | /* (partial) h %= p */ 63| 258k| c = (ulong32)(d0 >> 26); h0 = (ulong32)d0 & 0x3ffffff; 64| 258k| d1 += c; c = (ulong32)(d1 >> 26); h1 = (ulong32)d1 & 0x3ffffff; 65| 258k| d2 += c; c = (ulong32)(d2 >> 26); h2 = (ulong32)d2 & 0x3ffffff; 66| 258k| d3 += c; c = (ulong32)(d3 >> 26); h3 = (ulong32)d3 & 0x3ffffff; 67| 258k| d4 += c; c = (ulong32)(d4 >> 26); h4 = (ulong32)d4 & 0x3ffffff; 68| 258k| h0 += c * 5; c = (h0 >> 26); h0 = h0 & 0x3ffffff; 69| 258k| h1 += c; 70| | 71| 258k| in += 16; 72| 258k| inlen -= 16; 73| 258k| } 74| | 75| 34.4k| st->h[0] = h0; 76| 34.4k| st->h[1] = h1; 77| 34.4k| st->h[2] = h2; 78| 34.4k| st->h[3] = h3; 79| 34.4k| st->h[4] = h4; 80| 34.4k|} cipher_is_valid: 22| 9.91k|{ 23| 9.91k| LTC_MUTEX_LOCK(<c_cipher_mutex); 24| 9.91k| if (idx < 0 || idx >= TAB_SIZE || cipher_descriptor[idx].name == NULL) { ------------------ | | 14| 19.8k|#define TAB_SIZE 5 ------------------ | Branch (24:8): [True: 0, False: 9.91k] | Branch (24:19): [True: 0, False: 9.91k] | Branch (24:38): [True: 0, False: 9.91k] ------------------ 25| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 26| 0| return CRYPT_INVALID_CIPHER; 27| 0| } 28| 9.91k| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 29| 9.91k| return CRYPT_OK; 30| 9.91k|} find_cipher: 22| 2.54k|{ 23| 2.54k| int x; 24| 2.54k| LTC_ARGCHK(name != NULL); ------------------ | | 32| 2.54k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 2.54k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 25| 2.54k| LTC_MUTEX_LOCK(<c_cipher_mutex); 26| 2.54k| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 2.54k|#define TAB_SIZE 5 ------------------ | Branch (26:16): [True: 2.54k, False: 0] ------------------ 27| 2.54k| if (cipher_descriptor[x].name != NULL && !XSTRCMP(cipher_descriptor[x].name, name)) { ------------------ | | 54| 2.54k|#define XSTRCMP strcmp ------------------ | Branch (27:12): [True: 2.54k, False: 0] | Branch (27:49): [True: 2.54k, False: 0] ------------------ 28| 2.54k| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 29| 2.54k| return x; 30| 2.54k| } 31| 2.54k| } 32| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 33| 0| return -1; 34| 2.54k|} find_hash: 22| 1.28k|{ 23| 1.28k| int x; 24| 1.28k| LTC_ARGCHK(name != NULL); ------------------ | | 32| 1.28k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.28k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 25| 1.28k| LTC_MUTEX_LOCK(<c_hash_mutex); 26| 2.34k| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 2.34k|#define TAB_SIZE 5 ------------------ | Branch (26:16): [True: 2.34k, False: 0] ------------------ 27| 2.34k| if (hash_descriptor[x].name != NULL && XSTRCMP(hash_descriptor[x].name, name) == 0) { ------------------ | | 54| 2.34k|#define XSTRCMP strcmp ------------------ | Branch (27:12): [True: 2.34k, False: 0] | Branch (27:47): [True: 1.28k, False: 1.05k] ------------------ 28| 1.28k| LTC_MUTEX_UNLOCK(<c_hash_mutex); 29| 1.28k| return x; 30| 1.28k| } 31| 2.34k| } 32| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 33| 0| return -1; 34| 1.28k|} hash_is_valid: 22| 34.5k|{ 23| 34.5k| LTC_MUTEX_LOCK(<c_hash_mutex); 24| 34.5k| if (idx < 0 || idx >= TAB_SIZE || hash_descriptor[idx].name == NULL) { ------------------ | | 14| 69.0k|#define TAB_SIZE 5 ------------------ | Branch (24:8): [True: 0, False: 34.5k] | Branch (24:19): [True: 0, False: 34.5k] | Branch (24:38): [True: 0, False: 34.5k] ------------------ 25| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 26| 0| return CRYPT_INVALID_HASH; 27| 0| } 28| 34.5k| LTC_MUTEX_UNLOCK(<c_hash_mutex); 29| 34.5k| return CRYPT_OK; 30| 34.5k|} register_cipher: 22| 1|{ 23| 1| int x; 24| | 25| 1| LTC_ARGCHK(cipher != NULL); ------------------ | | 32| 1|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 26| | 27| | /* is it already registered? */ 28| 1| LTC_MUTEX_LOCK(<c_cipher_mutex); 29| 6| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 6|#define TAB_SIZE 5 ------------------ | Branch (29:16): [True: 5, False: 1] ------------------ 30| 5| if (cipher_descriptor[x].name != NULL && cipher_descriptor[x].ID == cipher->ID) { ------------------ | Branch (30:12): [True: 0, False: 5] | Branch (30:49): [True: 0, False: 0] ------------------ 31| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 32| 0| return x; 33| 0| } 34| 5| } 35| | 36| | /* find a blank spot */ 37| 1| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 1|#define TAB_SIZE 5 ------------------ | Branch (37:16): [True: 1, False: 0] ------------------ 38| 1| if (cipher_descriptor[x].name == NULL) { ------------------ | Branch (38:12): [True: 1, False: 0] ------------------ 39| 1| XMEMCPY(&cipher_descriptor[x], cipher, sizeof(struct ltc_cipher_descriptor)); ------------------ | | 39| 1|#define XMEMCPY memcpy ------------------ 40| 1| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 41| 1| return x; 42| 1| } 43| 1| } 44| | 45| | /* no spot */ 46| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 47| 0| return -1; 48| 1|} register_hash: 22| 4|{ 23| 4| int x; 24| | 25| 4| LTC_ARGCHK(hash != NULL); ------------------ | | 32| 4|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 4] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 26| | 27| | /* is it already registered? */ 28| 4| LTC_MUTEX_LOCK(<c_hash_mutex); 29| 24| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 24|#define TAB_SIZE 5 ------------------ | Branch (29:16): [True: 20, False: 4] ------------------ 30| 20| if (XMEMCMP(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)) == 0) { ------------------ | | 45| 20|#define XMEMCMP memcmp ------------------ | Branch (30:12): [True: 0, False: 20] ------------------ 31| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 32| 0| return x; 33| 0| } 34| 20| } 35| | 36| | /* find a blank spot */ 37| 10| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 10|#define TAB_SIZE 5 ------------------ | Branch (37:16): [True: 10, False: 0] ------------------ 38| 10| if (hash_descriptor[x].name == NULL) { ------------------ | Branch (38:12): [True: 4, False: 6] ------------------ 39| 4| XMEMCPY(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)); ------------------ | | 39| 4|#define XMEMCPY memcpy ------------------ 40| 4| LTC_MUTEX_UNLOCK(<c_hash_mutex); 41| 4| return x; 42| 4| } 43| 10| } 44| | 45| | /* no spot */ 46| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 47| 0| return -1; 48| 4|} register_prng: 22| 1|{ 23| 1| int x; 24| | 25| 1| LTC_ARGCHK(prng != NULL); ------------------ | | 32| 1|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 26| | 27| | /* is it already registered? */ 28| 1| LTC_MUTEX_LOCK(<c_prng_mutex); 29| 6| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 6|#define TAB_SIZE 5 ------------------ | Branch (29:16): [True: 5, False: 1] ------------------ 30| 5| if (XMEMCMP(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)) == 0) { ------------------ | | 45| 5|#define XMEMCMP memcmp ------------------ | Branch (30:12): [True: 0, False: 5] ------------------ 31| 0| LTC_MUTEX_UNLOCK(<c_prng_mutex); 32| 0| return x; 33| 0| } 34| 5| } 35| | 36| | /* find a blank spot */ 37| 1| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 1|#define TAB_SIZE 5 ------------------ | Branch (37:16): [True: 1, False: 0] ------------------ 38| 1| if (prng_descriptor[x].name == NULL) { ------------------ | Branch (38:12): [True: 1, False: 0] ------------------ 39| 1| XMEMCPY(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)); ------------------ | | 39| 1|#define XMEMCPY memcpy ------------------ 40| 1| LTC_MUTEX_UNLOCK(<c_prng_mutex); 41| 1| return x; 42| 1| } 43| 1| } 44| | 45| | /* no spot */ 46| 0| LTC_MUTEX_UNLOCK(<c_prng_mutex); 47| 0| return -1; 48| 1|} zeromem: 23| 8.62k|{ 24| 8.62k| m_burn((void*)out, outlen); 25| 8.62k|} ctr_encrypt: 87| 8.62k|{ 88| 8.62k| int err, fr; 89| | 90| 8.62k| LTC_ARGCHK(pt != NULL); ------------------ | | 32| 8.62k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 8.62k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 91| 8.62k| LTC_ARGCHK(ct != NULL); ------------------ | | 32| 8.62k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 8.62k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 92| 8.62k| LTC_ARGCHK(ctr != NULL); ------------------ | | 32| 8.62k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 8.62k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 93| | 94| 8.62k| if ((err = cipher_is_valid(ctr->cipher)) != CRYPT_OK) { ------------------ | Branch (94:8): [True: 0, False: 8.62k] ------------------ 95| 0| return err; 96| 0| } 97| | 98| | /* is blocklen/padlen valid? */ 99| 8.62k| if ((ctr->blocklen < 1) || (ctr->blocklen > (int)sizeof(ctr->ctr)) || ------------------ | Branch (99:8): [True: 0, False: 8.62k] | Branch (99:31): [True: 0, False: 8.62k] ------------------ 100| 8.62k| (ctr->padlen < 0) || (ctr->padlen > (int)sizeof(ctr->pad))) { ------------------ | Branch (100:8): [True: 0, False: 8.62k] | Branch (100:31): [True: 0, False: 8.62k] ------------------ 101| 0| return CRYPT_INVALID_ARG; 102| 0| } 103| | 104| 8.62k|#ifdef LTC_FAST 105| 8.62k| if (ctr->blocklen % sizeof(LTC_FAST_TYPE)) { ------------------ | Branch (105:8): [True: 0, False: 8.62k] ------------------ 106| 0| return CRYPT_INVALID_ARG; 107| 0| } 108| 8.62k|#endif 109| | 110| | /* handle acceleration only if pad is empty, accelerator is present and length is >= a block size */ 111| 8.62k| if ((cipher_descriptor[ctr->cipher].accel_ctr_encrypt != NULL) && (len >= (unsigned long)ctr->blocklen)) { ------------------ | Branch (111:8): [True: 0, False: 8.62k] | Branch (111:70): [True: 0, False: 0] ------------------ 112| 0| if (ctr->padlen < ctr->blocklen) { ------------------ | Branch (112:10): [True: 0, False: 0] ------------------ 113| 0| fr = ctr->blocklen - ctr->padlen; 114| 0| if ((err = _ctr_encrypt(pt, ct, fr, ctr)) != CRYPT_OK) { ------------------ | Branch (114:12): [True: 0, False: 0] ------------------ 115| 0| return err; 116| 0| } 117| 0| pt += fr; 118| 0| ct += fr; 119| 0| len -= fr; 120| 0| } 121| | 122| 0| if (len >= (unsigned long)ctr->blocklen) { ------------------ | Branch (122:10): [True: 0, False: 0] ------------------ 123| 0| if ((err = cipher_descriptor[ctr->cipher].accel_ctr_encrypt(pt, ct, len/ctr->blocklen, ctr->ctr, ctr->mode, &ctr->key)) != CRYPT_OK) { ------------------ | Branch (123:12): [True: 0, False: 0] ------------------ 124| 0| return err; 125| 0| } 126| 0| pt += (len / ctr->blocklen) * ctr->blocklen; 127| 0| ct += (len / ctr->blocklen) * ctr->blocklen; 128| 0| len %= ctr->blocklen; 129| 0| } 130| 0| } 131| | 132| 8.62k| return _ctr_encrypt(pt, ct, len, ctr); 133| 8.62k|} ctr_encrypt.c:_ctr_encrypt: 28| 8.62k|{ 29| 8.62k| int x, err; 30| | 31| 56.4k| while (len) { ------------------ | Branch (31:11): [True: 47.8k, False: 8.62k] ------------------ 32| | /* is the pad empty? */ 33| 47.8k| if (ctr->padlen == ctr->blocklen) { ------------------ | Branch (33:11): [True: 46.6k, False: 1.21k] ------------------ 34| | /* increment counter */ 35| 46.6k| if (ctr->mode == CTR_COUNTER_LITTLE_ENDIAN) { ------------------ | | 859| 46.6k|#define CTR_COUNTER_LITTLE_ENDIAN 0x0000 ------------------ | Branch (35:14): [True: 0, False: 46.6k] ------------------ 36| | /* little-endian */ 37| 0| for (x = 0; x < ctr->ctrlen; x++) { ------------------ | Branch (37:25): [True: 0, False: 0] ------------------ 38| 0| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 39| 0| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (39:20): [True: 0, False: 0] ------------------ 40| 0| break; 41| 0| } 42| 0| } 43| 46.6k| } else { 44| | /* big-endian */ 45| 46.8k| for (x = ctr->blocklen-1; x >= ctr->ctrlen; x--) { ------------------ | Branch (45:39): [True: 46.8k, False: 0] ------------------ 46| 46.8k| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 47| 46.8k| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (47:20): [True: 46.6k, False: 214] ------------------ 48| 46.6k| break; 49| 46.6k| } 50| 46.8k| } 51| 46.6k| } 52| | 53| | /* encrypt it */ 54| 46.6k| if ((err = cipher_descriptor[ctr->cipher].ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key)) != CRYPT_OK) { ------------------ | Branch (54:14): [True: 0, False: 46.6k] ------------------ 55| 0| return err; 56| 0| } 57| 46.6k| ctr->padlen = 0; 58| 46.6k| } 59| 47.8k|#ifdef LTC_FAST 60| 47.8k| if ((ctr->padlen == 0) && (len >= (unsigned long)ctr->blocklen)) { ------------------ | Branch (60:11): [True: 47.8k, False: 0] | Branch (60:33): [True: 47.8k, False: 0] ------------------ 61| 143k| for (x = 0; x < ctr->blocklen; x += sizeof(LTC_FAST_TYPE)) { ------------------ | Branch (61:22): [True: 95.6k, False: 47.8k] ------------------ 62| 95.6k| *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ct + x)) = *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)pt + x)) ^ ------------------ | | 244| 95.6k| #define LTC_FAST_TYPE_PTR_CAST(x) ((LTC_FAST_TYPE*)(void*)(x)) ------------------ *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ct + x)) = *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)pt + x)) ^ ------------------ | | 244| 95.6k| #define LTC_FAST_TYPE_PTR_CAST(x) ((LTC_FAST_TYPE*)(void*)(x)) ------------------ 63| 95.6k| *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ctr->pad + x)); ------------------ | | 244| 95.6k| #define LTC_FAST_TYPE_PTR_CAST(x) ((LTC_FAST_TYPE*)(void*)(x)) ------------------ 64| 95.6k| } 65| 47.8k| pt += ctr->blocklen; 66| 47.8k| ct += ctr->blocklen; 67| 47.8k| len -= ctr->blocklen; 68| 47.8k| ctr->padlen = ctr->blocklen; 69| 47.8k| continue; 70| 47.8k| } 71| 0|#endif 72| 0| *ct++ = *pt++ ^ ctr->pad[ctr->padlen++]; 73| 0| --len; 74| 0| } 75| 8.62k| return CRYPT_OK; 76| 8.62k|} ctr_start: 35| 1.28k|{ 36| 1.28k| int x, err; 37| | 38| 1.28k| LTC_ARGCHK(IV != NULL); ------------------ | | 32| 1.28k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.28k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 39| 1.28k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 1.28k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.28k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 40| 1.28k| LTC_ARGCHK(ctr != NULL); ------------------ | | 32| 1.28k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.28k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 41| | 42| | /* bad param? */ 43| 1.28k| if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { ------------------ | Branch (43:8): [True: 0, False: 1.28k] ------------------ 44| 0| return err; 45| 0| } 46| | 47| | /* ctrlen == counter width */ 48| 1.28k| ctr->ctrlen = (ctr_mode & 255) ? (ctr_mode & 255) : cipher_descriptor[cipher].block_length; ------------------ | Branch (48:20): [True: 0, False: 1.28k] ------------------ 49| 1.28k| if (ctr->ctrlen > cipher_descriptor[cipher].block_length) { ------------------ | Branch (49:8): [True: 0, False: 1.28k] ------------------ 50| 0| return CRYPT_INVALID_ARG; 51| 0| } 52| | 53| 1.28k| if ((ctr_mode & 0x1000) == CTR_COUNTER_BIG_ENDIAN) { ------------------ | | 860| 1.28k|#define CTR_COUNTER_BIG_ENDIAN 0x1000 ------------------ | Branch (53:8): [True: 1.28k, False: 0] ------------------ 54| 1.28k| ctr->ctrlen = cipher_descriptor[cipher].block_length - ctr->ctrlen; 55| 1.28k| } 56| | 57| | /* setup cipher */ 58| 1.28k| if ((err = cipher_descriptor[cipher].setup(key, keylen, num_rounds, &ctr->key)) != CRYPT_OK) { ------------------ | Branch (58:8): [True: 0, False: 1.28k] ------------------ 59| 0| return err; 60| 0| } 61| | 62| | /* copy ctr */ 63| 1.28k| ctr->blocklen = cipher_descriptor[cipher].block_length; 64| 1.28k| ctr->cipher = cipher; 65| 1.28k| ctr->padlen = 0; 66| 1.28k| ctr->mode = ctr_mode & 0x1000; 67| 21.8k| for (x = 0; x < ctr->blocklen; x++) { ------------------ | Branch (67:16): [True: 20.5k, False: 1.28k] ------------------ 68| 20.5k| ctr->ctr[x] = IV[x]; 69| 20.5k| } 70| | 71| 1.28k| if (ctr_mode & LTC_CTR_RFC3686) { ------------------ | | 861| 1.28k|#define LTC_CTR_RFC3686 0x2000 ------------------ | Branch (71:8): [True: 0, False: 1.28k] ------------------ 72| | /* increment the IV as per RFC 3686 */ 73| 0| if (ctr->mode == CTR_COUNTER_LITTLE_ENDIAN) { ------------------ | | 859| 0|#define CTR_COUNTER_LITTLE_ENDIAN 0x0000 ------------------ | Branch (73:11): [True: 0, False: 0] ------------------ 74| | /* little-endian */ 75| 0| for (x = 0; x < ctr->ctrlen; x++) { ------------------ | Branch (75:22): [True: 0, False: 0] ------------------ 76| 0| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 77| 0| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (77:18): [True: 0, False: 0] ------------------ 78| 0| break; 79| 0| } 80| 0| } 81| 0| } else { 82| | /* big-endian */ 83| 0| for (x = ctr->blocklen-1; x >= ctr->ctrlen; x--) { ------------------ | Branch (83:36): [True: 0, False: 0] ------------------ 84| 0| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 85| 0| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (85:18): [True: 0, False: 0] ------------------ 86| 0| break; 87| 0| } 88| 0| } 89| 0| } 90| 0| } 91| | 92| 1.28k| return cipher_descriptor[ctr->cipher].ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key); 93| 1.28k|} chacha_crypt: 55| 51.6k|{ 56| 51.6k| unsigned char buf[64]; 57| 51.6k| unsigned long i, j; 58| | 59| 51.6k| if (inlen == 0) return CRYPT_OK; /* nothing to do */ ------------------ | Branch (59:8): [True: 0, False: 51.6k] ------------------ 60| | 61| 51.6k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 51.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 51.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 62| 51.6k| LTC_ARGCHK(in != NULL); ------------------ | | 32| 51.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 51.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 63| 51.6k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 51.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 51.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 64| 51.6k| LTC_ARGCHK(st->ivlen != 0); ------------------ | | 32| 51.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 51.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 65| | 66| 51.6k| if (st->ksleft > 0) { ------------------ | Branch (66:8): [True: 0, False: 51.6k] ------------------ 67| 0| j = MIN(st->ksleft, inlen); ------------------ | | 425| 0| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 0, False: 0] | | ------------------ ------------------ 68| 0| for (i = 0; i < j; ++i, st->ksleft--) out[i] = in[i] ^ st->kstream[64 - st->ksleft]; ------------------ | Branch (68:19): [True: 0, False: 0] ------------------ 69| 0| inlen -= j; 70| 0| if (inlen == 0) return CRYPT_OK; ------------------ | Branch (70:11): [True: 0, False: 0] ------------------ 71| 0| out += j; 72| 0| in += j; 73| 0| } 74| 102k| for (;;) { 75| 102k| _chacha_block(buf, st->input, st->rounds); 76| 102k| if (st->ivlen == 8) { ------------------ | Branch (76:10): [True: 102k, False: 0] ------------------ 77| | /* IV-64bit, increment 64bit counter */ 78| 102k| if (0 == ++st->input[12] && 0 == ++st->input[13]) return CRYPT_OVERFLOW; ------------------ | Branch (78:12): [True: 0, False: 102k] | Branch (78:36): [True: 0, False: 0] ------------------ 79| 102k| } 80| 0| else { 81| | /* IV-96bit, increment 32bit counter */ 82| 0| if (0 == ++st->input[12]) return CRYPT_OVERFLOW; ------------------ | Branch (82:12): [True: 0, False: 0] ------------------ 83| 0| } 84| 102k| if (inlen <= 64) { ------------------ | Branch (84:10): [True: 51.6k, False: 50.8k] ------------------ 85| 1.28M| for (i = 0; i < inlen; ++i) out[i] = in[i] ^ buf[i]; ------------------ | Branch (85:20): [True: 1.23M, False: 51.6k] ------------------ 86| 51.6k| st->ksleft = 64 - inlen; 87| 2.12M| for (i = inlen; i < 64; ++i) st->kstream[i] = buf[i]; ------------------ | Branch (87:24): [True: 2.07M, False: 51.6k] ------------------ 88| 51.6k| return CRYPT_OK; 89| 51.6k| } 90| 3.30M| for (i = 0; i < 64; ++i) out[i] = in[i] ^ buf[i]; ------------------ | Branch (90:18): [True: 3.25M, False: 50.8k] ------------------ 91| 50.8k| inlen -= 64; 92| 50.8k| out += 64; 93| 50.8k| in += 64; 94| 50.8k| } 95| 51.6k|} chacha_crypt.c:_chacha_block: 26| 102k|{ 27| 102k| ulong32 x[16]; 28| 102k| int i; 29| 102k| XMEMCPY(x, input, sizeof(x)); ------------------ | | 39| 102k|#define XMEMCPY memcpy ------------------ 30| 1.12M| for (i = rounds; i > 0; i -= 2) { ------------------ | Branch (30:21): [True: 1.02M, False: 102k] ------------------ 31| 1.02M| QUARTERROUND(0, 4, 8,12) ------------------ | | 20| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 32| 1.02M| QUARTERROUND(1, 5, 9,13) ------------------ | | 20| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 33| 1.02M| QUARTERROUND(2, 6,10,14) ------------------ | | 20| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 34| 1.02M| QUARTERROUND(3, 7,11,15) ------------------ | | 20| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 35| 1.02M| QUARTERROUND(0, 5,10,15) ------------------ | | 20| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 36| 1.02M| QUARTERROUND(1, 6,11,12) ------------------ | | 20| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 37| 1.02M| QUARTERROUND(2, 7, 8,13) ------------------ | | 20| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 38| 1.02M| QUARTERROUND(3, 4, 9,14) ------------------ | | 20| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 1.02M| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 1.02M| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 39| 1.02M| } 40| 1.74M| for (i = 0; i < 16; ++i) { ------------------ | Branch (40:16): [True: 1.64M, False: 102k] ------------------ 41| 1.64M| x[i] += input[i]; 42| 1.64M| STORE32L(x[i], output + 4 * i); ------------------ | | 164| 1.64M| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 1.64M|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded - Ignored] | | ------------------ ------------------ 43| 1.64M| } 44| 102k|} chacha_ivctr64: 28| 51.6k|{ 29| 51.6k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 51.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 51.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 30| 51.6k| LTC_ARGCHK(iv != NULL); ------------------ | | 32| 51.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 51.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 31| | /* 64bit IV + 64bit counter */ 32| 51.6k| LTC_ARGCHK(ivlen == 8); ------------------ | | 32| 51.6k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 51.6k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 33| | 34| 51.6k| st->input[12] = (ulong32)(counter & 0xFFFFFFFF); 35| 51.6k| st->input[13] = (ulong32)(counter >> 32); 36| 51.6k| LOAD32L(st->input[14], iv + 0); ------------------ | | 167| 51.6k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 51.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 37| 51.6k| LOAD32L(st->input[15], iv + 4); ------------------ | | 167| 51.6k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 51.6k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 38| 51.6k| st->ksleft = 0; 39| 51.6k| st->ivlen = ivlen; 40| 51.6k| return CRYPT_OK; 41| 51.6k|} chacha_keystream: 27| 17.2k|{ 28| 17.2k| if (outlen == 0) return CRYPT_OK; /* nothing to do */ ------------------ | Branch (28:8): [True: 0, False: 17.2k] ------------------ 29| 17.2k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 17.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 17.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 30| 17.2k| XMEMSET(out, 0, outlen); ------------------ | | 36| 17.2k|#define XMEMSET memset ------------------ 31| 17.2k| return chacha_crypt(st, out, outlen, out); 32| 17.2k|} chacha_setup: 31| 15.2k|{ 32| 15.2k| const char *constants; 33| | 34| 15.2k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 15.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 15.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 35| 15.2k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 15.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 15.2k] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 36| 15.2k| LTC_ARGCHK(keylen == 32 || keylen == 16); ------------------ | | 32| 15.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:34): [True: 15.2k, False: 0] | | | Branch (32:34): [True: 0, False: 0] | | | Branch (32:87): [Folded - Ignored] | | ------------------ ------------------ 37| | 38| 15.2k| if (rounds == 0) rounds = 20; ------------------ | Branch (38:8): [True: 0, False: 15.2k] ------------------ 39| | 40| 15.2k| LOAD32L(st->input[4], key + 0); ------------------ | | 167| 15.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 15.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 41| 15.2k| LOAD32L(st->input[5], key + 4); ------------------ | | 167| 15.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 15.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 42| 15.2k| LOAD32L(st->input[6], key + 8); ------------------ | | 167| 15.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 15.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 43| 15.2k| LOAD32L(st->input[7], key + 12); ------------------ | | 167| 15.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 15.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 44| 15.2k| if (keylen == 32) { /* 256bit */ ------------------ | Branch (44:8): [True: 15.2k, False: 0] ------------------ 45| 15.2k| key += 16; 46| 15.2k| constants = sigma; 47| 15.2k| } else { /* 128bit */ 48| 0| constants = tau; 49| 0| } 50| 15.2k| LOAD32L(st->input[8], key + 0); ------------------ | | 167| 15.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 15.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 51| 15.2k| LOAD32L(st->input[9], key + 4); ------------------ | | 167| 15.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 15.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 52| 15.2k| LOAD32L(st->input[10], key + 8); ------------------ | | 167| 15.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 15.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 53| 15.2k| LOAD32L(st->input[11], key + 12); ------------------ | | 167| 15.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 15.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 54| 15.2k| LOAD32L(st->input[0], constants + 0); ------------------ | | 167| 15.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 15.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 55| 15.2k| LOAD32L(st->input[1], constants + 4); ------------------ | | 167| 15.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 15.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 56| 15.2k| LOAD32L(st->input[2], constants + 8); ------------------ | | 167| 15.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 15.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 57| 15.2k| LOAD32L(st->input[3], constants + 12); ------------------ | | 167| 15.2k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 15.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded - Ignored] | | ------------------ ------------------ 58| 15.2k| st->rounds = rounds; /* e.g. 20 for chacha20 */ 59| 15.2k| st->ivlen = 0; /* will be set later by chacha_ivctr(32|64) */ 60| 15.2k| return CRYPT_OK; 61| 15.2k|} mp_add: 8| 3|{ 9| 3| mp_sign sa, sb; 10| 3| mp_err err; 11| | 12| | /* get sign of both inputs */ 13| 3| sa = a->sign; 14| 3| sb = b->sign; 15| | 16| | /* handle two cases, not four */ 17| 3| if (sa == sb) { ------------------ | Branch (17:8): [True: 3, False: 0] ------------------ 18| | /* both positive or both negative */ 19| | /* add their magnitudes, copy the sign */ 20| 3| c->sign = sa; 21| 3| err = s_mp_add(a, b, c); 22| 3| } else { 23| | /* one positive, the other negative */ 24| | /* subtract the one with the greater magnitude from */ 25| | /* the one of the lesser magnitude. The result gets */ 26| | /* the sign of the one with the greater magnitude. */ 27| 0| if (mp_cmp_mag(a, b) == MP_LT) { ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ | Branch (27:11): [True: 0, False: 0] ------------------ 28| 0| c->sign = sb; 29| 0| err = s_mp_sub(b, a, c); 30| 0| } else { 31| 0| c->sign = sa; 32| 0| err = s_mp_sub(a, b, c); 33| 0| } 34| 0| } 35| 3| return err; 36| 3|} mp_add_d: 8| 128|{ 9| 128| mp_err err; 10| 128| int ix, oldused; 11| 128| mp_digit *tmpa, *tmpc; 12| | 13| | /* grow c as required */ 14| 128| if (c->alloc < (a->used + 1)) { ------------------ | Branch (14:8): [True: 0, False: 128] ------------------ 15| 0| if ((err = mp_grow(c, a->used + 1)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (15:11): [True: 0, False: 0] ------------------ 16| 0| return err; 17| 0| } 18| 0| } 19| | 20| | /* if a is negative and |a| >= b, call c = |a| - b */ 21| 128| if ((a->sign == MP_NEG) && ((a->used > 1) || (a->dp[0] >= b))) { ------------------ | | 152| 128|#define MP_NEG 1 /* negative */ ------------------ | Branch (21:8): [True: 0, False: 128] | Branch (21:32): [True: 0, False: 0] | Branch (21:49): [True: 0, False: 0] ------------------ 22| 0| mp_int a_ = *a; 23| | /* temporarily fix sign of a */ 24| 0| a_.sign = MP_ZPOS; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ 25| | 26| | /* c = |a| - b */ 27| 0| err = mp_sub_d(&a_, b, c); 28| | 29| | /* fix sign */ 30| 0| c->sign = MP_NEG; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ 31| | 32| | /* clamp */ 33| 0| mp_clamp(c); 34| | 35| 0| return err; 36| 0| } 37| | 38| | /* old number of used digits in c */ 39| 128| oldused = c->used; 40| | 41| | /* source alias */ 42| 128| tmpa = a->dp; 43| | 44| | /* destination alias */ 45| 128| tmpc = c->dp; 46| | 47| | /* if a is positive */ 48| 128| if (a->sign == MP_ZPOS) { ------------------ | | 151| 128|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (48:8): [True: 128, False: 0] ------------------ 49| | /* add digits, mu is carry */ 50| 128| mp_digit mu = b; 51| 466| for (ix = 0; ix < a->used; ix++) { ------------------ | Branch (51:20): [True: 338, False: 128] ------------------ 52| 338| *tmpc = *tmpa++ + mu; 53| 338| mu = *tmpc >> MP_DIGIT_BIT; ------------------ | | 82| 338|# define MP_DIGIT_BIT 60 ------------------ 54| 338| *tmpc++ &= MP_MASK; ------------------ | | 106| 338|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 338|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 55| 338| } 56| | /* set final carry */ 57| 128| ix++; 58| 128| *tmpc++ = mu; 59| | 60| | /* setup size */ 61| 128| c->used = a->used + 1; 62| 128| } else { 63| | /* a was negative and |a| < b */ 64| 0| c->used = 1; 65| | 66| | /* the result is a single digit */ 67| 0| if (a->used == 1) { ------------------ | Branch (67:11): [True: 0, False: 0] ------------------ 68| 0| *tmpc++ = b - a->dp[0]; 69| 0| } else { 70| 0| *tmpc++ = b; 71| 0| } 72| | 73| | /* setup count so the clearing of oldused 74| | * can fall through correctly 75| | */ 76| 0| ix = 1; 77| 0| } 78| | 79| | /* sign always positive */ 80| 128| c->sign = MP_ZPOS; ------------------ | | 151| 128|#define MP_ZPOS 0 /* positive integer */ ------------------ 81| | 82| | /* now zero to oldused */ 83| 128| MP_ZERO_DIGITS(tmpc, oldused - ix); ------------------ | | 89| 128|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 128|do { \ | | 91| 128| int zd_ = (digits); \ | | 92| 128| mp_digit* zm_ = (mem); \ | | 93| 128| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 128] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 128|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 84| 128| mp_clamp(c); 85| | 86| 128| return MP_OKAY; ------------------ | | 161| 128|#define MP_OKAY 0 /* no error */ ------------------ 87| 128|} mp_clamp: 14| 60.5k|{ 15| | /* decrease used while the most significant digit is 16| | * zero. 17| | */ 18| 93.5k| while ((a->used > 0) && (a->dp[a->used - 1] == 0u)) { ------------------ | Branch (18:11): [True: 80.9k, False: 12.5k] | Branch (18:28): [True: 33.0k, False: 47.9k] ------------------ 19| 33.0k| --(a->used); 20| 33.0k| } 21| | 22| | /* reset the sign flag if used == 0 */ 23| 60.5k| if (a->used == 0) { ------------------ | Branch (23:8): [True: 12.5k, False: 47.9k] ------------------ 24| 12.5k| a->sign = MP_ZPOS; ------------------ | | 151| 12.5k|#define MP_ZPOS 0 /* positive integer */ ------------------ 25| 12.5k| } 26| 60.5k|} mp_clear: 8| 26.8k|{ 9| | /* only do anything if a hasn't been freed previously */ 10| 26.8k| if (a->dp != NULL) { ------------------ | Branch (10:8): [True: 21.7k, False: 5.09k] ------------------ 11| | /* free ram */ 12| 21.7k| MP_FREE_DIGITS(a->dp, a->alloc); ------------------ | | 58| 21.7k|# define MP_FREE_DIGITS(mem, digits) \ | | 59| 21.7k|do { \ | | 60| 21.7k| int fd_ = (digits); \ | | 61| 21.7k| void* fm_ = (mem); \ | | 62| 21.7k| if (fm_ != NULL) { \ | | ------------------ | | | Branch (62:8): [True: 21.7k, False: 0] | | ------------------ | | 63| 21.7k| size_t fs_ = sizeof (mp_digit) * (size_t)fd_; \ | | 64| 21.7k| MP_ZERO_BUFFER(fm_, fs_); \ | | ------------------ | | | | 81| 21.7k|# define MP_ZERO_BUFFER(mem, size) \ | | | | 82| 21.7k|do { \ | | | | 83| 21.7k| size_t zs_ = (size); \ | | | | 84| 21.7k| char* zm_ = (char*)(mem); \ | | | | 85| 3.44M| while (zs_-- > 0u) { \ | | | | ------------------ | | | | | Branch (85:11): [True: 3.41M, False: 21.7k] | | | | ------------------ | | | | 86| 3.41M| *zm_++ = '\0'; \ | | | | 87| 3.41M| } \ | | | | 88| 21.7k|} while (0) | | | | ------------------ | | | | | Branch (88:10): [Folded - Ignored] | | | | ------------------ | | ------------------ | | 65| 21.7k| MP_FREE(fm_, fs_); \ | | ------------------ | | | | 1324| 21.7k|#define MP_FREE m_free_ltm | | ------------------ | | 66| 21.7k| } \ | | 67| 21.7k|} while (0) | | ------------------ | | | Branch (67:10): [Folded - Ignored] | | ------------------ ------------------ 13| | 14| | /* reset members to make debugging easier */ 15| 21.7k| a->dp = NULL; 16| 21.7k| a->alloc = a->used = 0; 17| 21.7k| a->sign = MP_ZPOS; ------------------ | | 151| 21.7k|#define MP_ZPOS 0 /* positive integer */ ------------------ 18| 21.7k| } 19| 26.8k|} mp_clear_multi: 9| 1|{ 10| 1| mp_int *next_mp = mp; 11| 1| va_list args; 12| 1| va_start(args, mp); 13| 5| while (next_mp != NULL) { ------------------ | Branch (13:11): [True: 4, False: 1] ------------------ 14| 4| mp_clear(next_mp); 15| 4| next_mp = va_arg(args, mp_int *); 16| 4| } 17| 1| va_end(args); 18| 1|} mp_cmp: 8| 5|{ 9| | /* compare based on sign */ 10| 5| if (a->sign != b->sign) { ------------------ | Branch (10:8): [True: 0, False: 5] ------------------ 11| 0| if (a->sign == MP_NEG) { ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ | Branch (11:11): [True: 0, False: 0] ------------------ 12| 0| return MP_LT; ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ 13| 0| } else { 14| 0| return MP_GT; ------------------ | | 156| 0|#define MP_GT 1 /* greater than */ ------------------ 15| 0| } 16| 0| } 17| | 18| | /* compare digits */ 19| 5| if (a->sign == MP_NEG) { ------------------ | | 152| 5|#define MP_NEG 1 /* negative */ ------------------ | Branch (19:8): [True: 0, False: 5] ------------------ 20| | /* if negative compare opposite direction */ 21| 0| return mp_cmp_mag(b, a); 22| 5| } else { 23| 5| return mp_cmp_mag(a, b); 24| 5| } 25| 5|} mp_cmp_d: 8| 4|{ 9| | /* compare based on sign */ 10| 4| if (a->sign == MP_NEG) { ------------------ | | 152| 4|#define MP_NEG 1 /* negative */ ------------------ | Branch (10:8): [True: 0, False: 4] ------------------ 11| 0| return MP_LT; ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ 12| 0| } 13| | 14| | /* compare based on magnitude */ 15| 4| if (a->used > 1) { ------------------ | Branch (15:8): [True: 4, False: 0] ------------------ 16| 4| return MP_GT; ------------------ | | 156| 4|#define MP_GT 1 /* greater than */ ------------------ 17| 4| } 18| | 19| | /* compare the only digit of a to b */ 20| 0| if (a->dp[0] > b) { ------------------ | Branch (20:8): [True: 0, False: 0] ------------------ 21| 0| return MP_GT; ------------------ | | 156| 0|#define MP_GT 1 /* greater than */ ------------------ 22| 0| } else if (a->dp[0] < b) { ------------------ | Branch (22:15): [True: 0, False: 0] ------------------ 23| 0| return MP_LT; ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ 24| 0| } else { 25| 0| return MP_EQ; ------------------ | | 155| 0|#define MP_EQ 0 /* equal to */ ------------------ 26| 0| } 27| 0|} mp_cmp_mag: 8| 28|{ 9| 28| int n; 10| 28| const mp_digit *tmpa, *tmpb; 11| | 12| | /* compare based on # of non-zero digits */ 13| 28| if (a->used > b->used) { ------------------ | Branch (13:8): [True: 2, False: 26] ------------------ 14| 2| return MP_GT; ------------------ | | 156| 2|#define MP_GT 1 /* greater than */ ------------------ 15| 2| } 16| | 17| 26| if (a->used < b->used) { ------------------ | Branch (17:8): [True: 0, False: 26] ------------------ 18| 0| return MP_LT; ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ 19| 0| } 20| | 21| | /* alias for a */ 22| 26| tmpa = a->dp + (a->used - 1); 23| | 24| | /* alias for b */ 25| 26| tmpb = b->dp + (a->used - 1); 26| | 27| | /* compare based on digits */ 28| 43| for (n = 0; n < a->used; ++n, --tmpa, --tmpb) { ------------------ | Branch (28:16): [True: 42, False: 1] ------------------ 29| 42| if (*tmpa > *tmpb) { ------------------ | Branch (29:11): [True: 11, False: 31] ------------------ 30| 11| return MP_GT; ------------------ | | 156| 11|#define MP_GT 1 /* greater than */ ------------------ 31| 11| } 32| | 33| 31| if (*tmpa < *tmpb) { ------------------ | Branch (33:11): [True: 14, False: 17] ------------------ 34| 14| return MP_LT; ------------------ | | 154| 14|#define MP_LT -1 /* less than */ ------------------ 35| 14| } 36| 31| } 37| 1| return MP_EQ; ------------------ | | 155| 1|#define MP_EQ 0 /* equal to */ ------------------ 38| 26|} mp_copy: 8| 35.7k|{ 9| 35.7k| int n; 10| 35.7k| mp_digit *tmpa, *tmpb; 11| 35.7k| mp_err err; 12| | 13| | /* if dst == src do nothing */ 14| 35.7k| if (a == b) { ------------------ | Branch (14:8): [True: 26.8k, False: 8.93k] ------------------ 15| 26.8k| return MP_OKAY; ------------------ | | 161| 26.8k|#define MP_OKAY 0 /* no error */ ------------------ 16| 26.8k| } 17| | 18| | /* grow dest */ 19| 8.93k| if (b->alloc < a->used) { ------------------ | Branch (19:8): [True: 0, False: 8.93k] ------------------ 20| 0| if ((err = mp_grow(b, a->used)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (20:11): [True: 0, False: 0] ------------------ 21| 0| return err; 22| 0| } 23| 0| } 24| | 25| | /* zero b and copy the parameters over */ 26| | /* pointer aliases */ 27| | 28| | /* source */ 29| 8.93k| tmpa = a->dp; 30| | 31| | /* destination */ 32| 8.93k| tmpb = b->dp; 33| | 34| | /* copy all the digits */ 35| 17.9k| for (n = 0; n < a->used; n++) { ------------------ | Branch (35:16): [True: 8.96k, False: 8.93k] ------------------ 36| 8.96k| *tmpb++ = *tmpa++; 37| 8.96k| } 38| | 39| | /* clear high digits */ 40| 8.93k| MP_ZERO_DIGITS(tmpb, b->used - n); ------------------ | | 89| 8.93k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 8.93k|do { \ | | 91| 8.93k| int zd_ = (digits); \ | | 92| 8.93k| mp_digit* zm_ = (mem); \ | | 93| 8.93k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 8.93k] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 8.93k|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 41| | 42| | /* copy used count and sign */ 43| 8.93k| b->used = a->used; 44| 8.93k| b->sign = a->sign; 45| 8.93k| return MP_OKAY; ------------------ | | 161| 8.93k|#define MP_OKAY 0 /* no error */ ------------------ 46| 8.93k|} mp_count_bits: 8| 17.8k|{ 9| 17.8k| int r; 10| 17.8k| mp_digit q; 11| | 12| | /* shortcut */ 13| 17.8k| if (MP_IS_ZERO(a)) { ------------------ | | 163| 17.8k|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 17.8k] | | ------------------ ------------------ 14| 0| return 0; 15| 0| } 16| | 17| | /* get number of digits and add that */ 18| 17.8k| r = (a->used - 1) * MP_DIGIT_BIT; ------------------ | | 82| 17.8k|# define MP_DIGIT_BIT 60 ------------------ 19| | 20| | /* take the last digit and count the bits in it */ 21| 17.8k| q = a->dp[a->used - 1]; 22| 446k| while (q > 0u) { ------------------ | Branch (22:11): [True: 428k, False: 17.8k] ------------------ 23| 428k| ++r; 24| 428k| q >>= 1u; 25| 428k| } 26| 17.8k| return r; 27| 17.8k|} mp_div: 87| 2|{ 88| 2| mp_int q, x, y, t1, t2; 89| 2| int n, t, i, norm; 90| 2| mp_sign neg; 91| 2| mp_err err; 92| | 93| | /* is divisor zero ? */ 94| 2| if (MP_IS_ZERO(b)) { ------------------ | | 163| 2|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 2] | | ------------------ ------------------ 95| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 96| 0| } 97| | 98| | /* if a < b then q=0, r = a */ 99| 2| if (mp_cmp_mag(a, b) == MP_LT) { ------------------ | | 154| 2|#define MP_LT -1 /* less than */ ------------------ | Branch (99:8): [True: 0, False: 2] ------------------ 100| 0| if (d != NULL) { ------------------ | Branch (100:11): [True: 0, False: 0] ------------------ 101| 0| err = mp_copy(a, d); 102| 0| } else { 103| 0| err = MP_OKAY; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ 104| 0| } 105| 0| if (c != NULL) { ------------------ | Branch (105:11): [True: 0, False: 0] ------------------ 106| 0| mp_zero(c); 107| 0| } 108| 0| return err; 109| 0| } 110| | 111| 2| if ((err = mp_init_size(&q, a->used + 2)) != MP_OKAY) { ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (111:8): [True: 0, False: 2] ------------------ 112| 0| return err; 113| 0| } 114| 2| q.used = a->used + 2; 115| | 116| 2| if ((err = mp_init(&t1)) != MP_OKAY) goto LBL_Q; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (116:8): [True: 0, False: 2] ------------------ 117| | 118| 2| if ((err = mp_init(&t2)) != MP_OKAY) goto LBL_T1; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (118:8): [True: 0, False: 2] ------------------ 119| | 120| 2| if ((err = mp_init_copy(&x, a)) != MP_OKAY) goto LBL_T2; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (120:8): [True: 0, False: 2] ------------------ 121| | 122| 2| if ((err = mp_init_copy(&y, b)) != MP_OKAY) goto LBL_X; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (122:8): [True: 0, False: 2] ------------------ 123| | 124| | /* fix the sign */ 125| 2| neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 151| 2|#define MP_ZPOS 0 /* positive integer */ ------------------ neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 152| 2|#define MP_NEG 1 /* negative */ ------------------ | Branch (125:10): [True: 2, False: 0] ------------------ 126| 2| x.sign = y.sign = MP_ZPOS; ------------------ | | 151| 2|#define MP_ZPOS 0 /* positive integer */ ------------------ 127| | 128| | /* normalize both x and y, ensure that y >= b/2, [b == 2**MP_DIGIT_BIT] */ 129| 2| norm = mp_count_bits(&y) % MP_DIGIT_BIT; ------------------ | | 82| 2|# define MP_DIGIT_BIT 60 ------------------ 130| 2| if (norm < (MP_DIGIT_BIT - 1)) { ------------------ | | 82| 2|# define MP_DIGIT_BIT 60 ------------------ | Branch (130:8): [True: 2, False: 0] ------------------ 131| 2| norm = (MP_DIGIT_BIT - 1) - norm; ------------------ | | 82| 2|# define MP_DIGIT_BIT 60 ------------------ 132| 2| if ((err = mp_mul_2d(&x, norm, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (132:11): [True: 0, False: 2] ------------------ 133| 2| if ((err = mp_mul_2d(&y, norm, &y)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (133:11): [True: 0, False: 2] ------------------ 134| 2| } else { 135| 0| norm = 0; 136| 0| } 137| | 138| | /* note hac does 0 based, so if used==5 then its 0,1,2,3,4, e.g. use 4 */ 139| 2| n = x.used - 1; 140| 2| t = y.used - 1; 141| | 142| | /* while (x >= y*b**n-t) do { q[n-t] += 1; x -= y*b**{n-t} } */ 143| | /* y = y*b**{n-t} */ 144| 2| if ((err = mp_lshd(&y, n - t)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (144:8): [True: 0, False: 2] ------------------ 145| | 146| 2| while (mp_cmp(&x, &y) != MP_LT) { ------------------ | | 154| 2|#define MP_LT -1 /* less than */ ------------------ | Branch (146:11): [True: 0, False: 2] ------------------ 147| 0| ++(q.dp[n - t]); 148| 0| if ((err = mp_sub(&x, &y, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (148:11): [True: 0, False: 0] ------------------ 149| 0| } 150| | 151| | /* reset y by shifting it back down */ 152| 2| mp_rshd(&y, n - t); 153| | 154| | /* step 3. for i from n down to (t + 1) */ 155| 12| for (i = n; i >= (t + 1); i--) { ------------------ | Branch (155:16): [True: 10, False: 2] ------------------ 156| 10| if (i > x.used) { ------------------ | Branch (156:11): [True: 0, False: 10] ------------------ 157| 0| continue; 158| 0| } 159| | 160| | /* step 3.1 if xi == yt then set q{i-t-1} to b-1, 161| | * otherwise set q{i-t-1} to (xi*b + x{i-1})/yt */ 162| 10| if (x.dp[i] == y.dp[t]) { ------------------ | Branch (162:11): [True: 0, False: 10] ------------------ 163| 0| q.dp[(i - t) - 1] = ((mp_digit)1 << (mp_digit)MP_DIGIT_BIT) - (mp_digit)1; ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ 164| 10| } else { 165| 10| mp_word tmp; 166| 10| tmp = (mp_word)x.dp[i] << (mp_word)MP_DIGIT_BIT; ------------------ | | 82| 10|# define MP_DIGIT_BIT 60 ------------------ 167| 10| tmp |= (mp_word)x.dp[i - 1]; 168| 10| tmp /= (mp_word)y.dp[t]; 169| 10| if (tmp > (mp_word)MP_MASK) { ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (169:14): [True: 0, False: 10] ------------------ 170| 0| tmp = MP_MASK; ------------------ | | 106| 0|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 0|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 171| 0| } 172| 10| q.dp[(i - t) - 1] = (mp_digit)(tmp & (mp_word)MP_MASK); ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 173| 10| } 174| | 175| | /* while (q{i-t-1} * (yt * b + y{t-1})) > 176| | xi * b**2 + xi-1 * b + xi-2 177| | 178| | do q{i-t-1} -= 1; 179| | */ 180| 10| q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] + 1uL) & (mp_digit)MP_MASK; ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 181| 10| do { 182| 10| q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] - 1uL) & (mp_digit)MP_MASK; ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 183| | 184| | /* find left hand */ 185| 10| mp_zero(&t1); 186| 10| t1.dp[0] = ((t - 1) < 0) ? 0u : y.dp[t - 1]; ------------------ | Branch (186:21): [True: 0, False: 10] ------------------ 187| 10| t1.dp[1] = y.dp[t]; 188| 10| t1.used = 2; 189| 10| if ((err = mp_mul_d(&t1, q.dp[(i - t) - 1], &t1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ | Branch (189:14): [True: 0, False: 10] ------------------ 190| | 191| | /* find right hand */ 192| 10| t2.dp[0] = ((i - 2) < 0) ? 0u : x.dp[i - 2]; ------------------ | Branch (192:21): [True: 0, False: 10] ------------------ 193| 10| t2.dp[1] = x.dp[i - 1]; /* i >= 1 always holds */ 194| 10| t2.dp[2] = x.dp[i]; 195| 10| t2.used = 3; 196| 10| } while (mp_cmp_mag(&t1, &t2) == MP_GT); ------------------ | | 156| 10|#define MP_GT 1 /* greater than */ ------------------ | Branch (196:16): [True: 0, False: 10] ------------------ 197| | 198| | /* step 3.3 x = x - q{i-t-1} * y * b**{i-t-1} */ 199| 10| if ((err = mp_mul_d(&y, q.dp[(i - t) - 1], &t1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ | Branch (199:11): [True: 0, False: 10] ------------------ 200| | 201| 10| if ((err = mp_lshd(&t1, (i - t) - 1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ | Branch (201:11): [True: 0, False: 10] ------------------ 202| | 203| 10| if ((err = mp_sub(&x, &t1, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ | Branch (203:11): [True: 0, False: 10] ------------------ 204| | 205| | /* if x < 0 then { x = x + y*b**{i-t-1}; q{i-t-1} -= 1; } */ 206| 10| if (x.sign == MP_NEG) { ------------------ | | 152| 10|#define MP_NEG 1 /* negative */ ------------------ | Branch (206:11): [True: 0, False: 10] ------------------ 207| 0| if ((err = mp_copy(&y, &t1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (207:14): [True: 0, False: 0] ------------------ 208| 0| if ((err = mp_lshd(&t1, (i - t) - 1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (208:14): [True: 0, False: 0] ------------------ 209| 0| if ((err = mp_add(&x, &t1, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (209:14): [True: 0, False: 0] ------------------ 210| | 211| 0| q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] - 1uL) & MP_MASK; ------------------ | | 106| 0|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 0|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 212| 0| } 213| 10| } 214| | 215| | /* now q is the quotient and x is the remainder 216| | * [which we have to normalize] 217| | */ 218| | 219| | /* get sign before writing to c */ 220| 2| x.sign = (x.used == 0) ? MP_ZPOS : a->sign; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (220:13): [True: 0, False: 2] ------------------ 221| | 222| 2| if (c != NULL) { ------------------ | Branch (222:8): [True: 0, False: 2] ------------------ 223| 0| mp_clamp(&q); 224| 0| mp_exch(&q, c); 225| 0| c->sign = neg; 226| 0| } 227| | 228| 2| if (d != NULL) { ------------------ | Branch (228:8): [True: 2, False: 0] ------------------ 229| 2| if ((err = mp_div_2d(&x, norm, &x, NULL)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (229:11): [True: 0, False: 2] ------------------ 230| 2| mp_exch(&x, d); 231| 2| } 232| | 233| 2| err = MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 234| | 235| 2|LBL_Y: 236| 2| mp_clear(&y); 237| 2|LBL_X: 238| 2| mp_clear(&x); 239| 2|LBL_T2: 240| 2| mp_clear(&t2); 241| 2|LBL_T1: 242| 2| mp_clear(&t1); 243| 2|LBL_Q: 244| 2| mp_clear(&q); 245| 2| return err; 246| 2|} mp_div_2d: 8| 26.8k|{ 9| 26.8k| mp_digit D, r, rr; 10| 26.8k| int x; 11| 26.8k| mp_err err; 12| | 13| | /* if the shift count is <= 0 then we do no work */ 14| 26.8k| if (b <= 0) { ------------------ | Branch (14:8): [True: 0, False: 26.8k] ------------------ 15| 0| err = mp_copy(a, c); 16| 0| if (d != NULL) { ------------------ | Branch (16:11): [True: 0, False: 0] ------------------ 17| 0| mp_zero(d); 18| 0| } 19| 0| return err; 20| 0| } 21| | 22| | /* copy */ 23| 26.8k| if ((err = mp_copy(a, c)) != MP_OKAY) { ------------------ | | 161| 26.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (23:8): [True: 0, False: 26.8k] ------------------ 24| 0| return err; 25| 0| } 26| | /* 'a' should not be used after here - it might be the same as d */ 27| | 28| | /* get the remainder */ 29| 26.8k| if (d != NULL) { ------------------ | Branch (29:8): [True: 0, False: 26.8k] ------------------ 30| 0| if ((err = mp_mod_2d(a, b, d)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (30:11): [True: 0, False: 0] ------------------ 31| 0| return err; 32| 0| } 33| 0| } 34| | 35| | /* shift by as many digits in the bit count */ 36| 26.8k| if (b >= MP_DIGIT_BIT) { ------------------ | | 82| 26.8k|# define MP_DIGIT_BIT 60 ------------------ | Branch (36:8): [True: 0, False: 26.8k] ------------------ 37| 0| mp_rshd(c, b / MP_DIGIT_BIT); ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ 38| 0| } 39| | 40| | /* shift any bit count < MP_DIGIT_BIT */ 41| 26.8k| D = (mp_digit)(b % MP_DIGIT_BIT); ------------------ | | 82| 26.8k|# define MP_DIGIT_BIT 60 ------------------ 42| 26.8k| if (D != 0u) { ------------------ | Branch (42:8): [True: 26.8k, False: 0] ------------------ 43| 26.8k| mp_digit *tmpc, mask, shift; 44| | 45| | /* mask */ 46| 26.8k| mask = ((mp_digit)1 << D) - 1uL; 47| | 48| | /* shift for lsb */ 49| 26.8k| shift = (mp_digit)MP_DIGIT_BIT - D; ------------------ | | 82| 26.8k|# define MP_DIGIT_BIT 60 ------------------ 50| | 51| | /* alias */ 52| 26.8k| tmpc = c->dp + (c->used - 1); 53| | 54| | /* carry */ 55| 26.8k| r = 0; 56| 53.6k| for (x = c->used - 1; x >= 0; x--) { ------------------ | Branch (56:29): [True: 26.8k, False: 26.8k] ------------------ 57| | /* get the lower bits of this word in a temp */ 58| 26.8k| rr = *tmpc & mask; 59| | 60| | /* shift the current word and mix in the carry bits from the previous word */ 61| 26.8k| *tmpc = (*tmpc >> D) | (r << shift); 62| 26.8k| --tmpc; 63| | 64| | /* set the carry to the carry bits of the current word found above */ 65| 26.8k| r = rr; 66| 26.8k| } 67| 26.8k| } 68| 26.8k| mp_clamp(c); 69| 26.8k| return MP_OKAY; ------------------ | | 161| 26.8k|#define MP_OKAY 0 /* no error */ ------------------ 70| 26.8k|} mp_exch: 10| 4|{ 11| 4| mp_int t; 12| | 13| 4| t = *a; 14| 4| *a = *b; 15| 4| *b = t; 16| 4|} mp_from_ubin: 8| 3.30k|{ 9| 3.30k| mp_err err; 10| | 11| | /* make sure there are at least two digits */ 12| 3.30k| if (a->alloc < 2) { ------------------ | Branch (12:8): [True: 0, False: 3.30k] ------------------ 13| 0| if ((err = mp_grow(a, 2)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (13:11): [True: 0, False: 0] ------------------ 14| 0| return err; 15| 0| } 16| 0| } 17| | 18| | /* zero the int */ 19| 3.30k| mp_zero(a); 20| | 21| | /* read the bytes in */ 22| 33.4k| while (size-- > 0u) { ------------------ | Branch (22:11): [True: 30.1k, False: 3.30k] ------------------ 23| 30.1k| if ((err = mp_mul_2d(a, 8, a)) != MP_OKAY) { ------------------ | | 161| 30.1k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (23:11): [True: 0, False: 30.1k] ------------------ 24| 0| return err; 25| 0| } 26| | 27| 30.1k|#ifndef MP_8BIT 28| 30.1k| a->dp[0] |= *buf++; 29| 30.1k| a->used += 1; 30| |#else 31| | a->dp[0] = (*buf & MP_MASK); 32| | a->dp[1] |= ((*buf++ >> 7) & 1u); 33| | a->used += 2; 34| |#endif 35| 30.1k| } 36| 3.30k| mp_clamp(a); 37| 3.30k| return MP_OKAY; ------------------ | | 161| 3.30k|#define MP_OKAY 0 /* no error */ ------------------ 38| 3.30k|} mp_grow: 8| 1.71k|{ 9| 1.71k| int i; 10| 1.71k| mp_digit *tmp; 11| | 12| | /* if the alloc size is smaller alloc more ram */ 13| 1.71k| if (a->alloc < size) { ------------------ | Branch (13:8): [True: 1.71k, False: 0] ------------------ 14| | /* reallocate the array a->dp 15| | * 16| | * We store the return in a temporary variable 17| | * in case the operation failed we don't want 18| | * to overwrite the dp member of a. 19| | */ 20| 1.71k| tmp = (mp_digit *) MP_REALLOC(a->dp, ------------------ | | 1325| 1.71k|#define MP_REALLOC m_realloc_ltm ------------------ 21| 1.71k| (size_t)a->alloc * sizeof(mp_digit), 22| 1.71k| (size_t)size * sizeof(mp_digit)); 23| 1.71k| if (tmp == NULL) { ------------------ | Branch (23:11): [True: 0, False: 1.71k] ------------------ 24| | /* reallocation failed but "a" is still valid [can be freed] */ 25| 0| return MP_MEM; ------------------ | | 163| 0|#define MP_MEM -2 /* out of mem */ ------------------ 26| 0| } 27| | 28| | /* reallocation succeeded so set a->dp */ 29| 1.71k| a->dp = tmp; 30| | 31| | /* zero excess digits */ 32| 1.71k| i = a->alloc; 33| 1.71k| a->alloc = size; 34| 1.71k| MP_ZERO_DIGITS(a->dp + i, a->alloc - i); ------------------ | | 89| 1.71k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 1.71k|do { \ | | 91| 1.71k| int zd_ = (digits); \ | | 92| 1.71k| mp_digit* zm_ = (mem); \ | | 93| 3.44k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 1.72k, False: 1.71k] | | ------------------ | | 94| 1.72k| *zm_++ = 0; \ | | 95| 1.72k| } \ | | 96| 1.71k|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 35| 1.71k| } 36| 1.71k| return MP_OKAY; ------------------ | | 161| 1.71k|#define MP_OKAY 0 /* no error */ ------------------ 37| 1.71k|} mp_init: 8| 12.9k|{ 9| | /* allocate memory required and clear it */ 10| 12.9k| a->dp = (mp_digit *) MP_CALLOC((size_t)MP_PREC, sizeof(mp_digit)); ------------------ | | 1326| 12.9k|#define MP_CALLOC m_calloc ------------------ a->dp = (mp_digit *) MP_CALLOC((size_t)MP_PREC, sizeof(mp_digit)); ------------------ | | 177| 12.9k|# define MP_PREC PRIVATE_MP_PREC | | ------------------ | | | | 193| 12.9k|# define PRIVATE_MP_PREC 32 /* default digits of precision */ | | ------------------ ------------------ 11| 12.9k| if (a->dp == NULL) { ------------------ | Branch (11:8): [True: 0, False: 12.9k] ------------------ 12| 0| return MP_MEM; ------------------ | | 163| 0|#define MP_MEM -2 /* out of mem */ ------------------ 13| 0| } 14| | 15| | /* set the used to zero, allocated digits to the default precision 16| | * and sign to positive */ 17| 12.9k| a->used = 0; 18| 12.9k| a->alloc = MP_PREC; ------------------ | | 177| 12.9k|# define MP_PREC PRIVATE_MP_PREC | | ------------------ | | | | 193| 12.9k|# define PRIVATE_MP_PREC 32 /* default digits of precision */ | | ------------------ ------------------ 19| 12.9k| a->sign = MP_ZPOS; ------------------ | | 151| 12.9k|#define MP_ZPOS 0 /* positive integer */ ------------------ 20| | 21| 12.9k| return MP_OKAY; ------------------ | | 161| 12.9k|#define MP_OKAY 0 /* no error */ ------------------ 22| 12.9k|} mp_init_copy: 8| 8.93k|{ 9| 8.93k| mp_err err; 10| | 11| 8.93k| if ((err = mp_init_size(a, b->used)) != MP_OKAY) { ------------------ | | 161| 8.93k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (11:8): [True: 0, False: 8.93k] ------------------ 12| 0| return err; 13| 0| } 14| | 15| 8.93k| if ((err = mp_copy(b, a)) != MP_OKAY) { ------------------ | | 161| 8.93k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (15:8): [True: 0, False: 8.93k] ------------------ 16| 0| mp_clear(a); 17| 0| } 18| | 19| 8.93k| return err; 20| 8.93k|} mp_init_size: 8| 8.94k|{ 9| 8.94k| size = MP_MAX(MP_MIN_PREC, size); ------------------ | | 157| 8.94k|#define MP_MAX(x, y) (((x) > (y)) ? (x) : (y)) | | ------------------ | | | Branch (157:23): [True: 8.93k, False: 8] | | ------------------ ------------------ 10| | 11| | /* alloc mem */ 12| 8.94k| a->dp = (mp_digit *) MP_CALLOC((size_t)size, sizeof(mp_digit)); ------------------ | | 1326| 8.94k|#define MP_CALLOC m_calloc ------------------ 13| 8.94k| if (a->dp == NULL) { ------------------ | Branch (13:8): [True: 0, False: 8.94k] ------------------ 14| 0| return MP_MEM; ------------------ | | 163| 0|#define MP_MEM -2 /* out of mem */ ------------------ 15| 0| } 16| | 17| | /* set the members */ 18| 8.94k| a->used = 0; 19| 8.94k| a->alloc = size; 20| 8.94k| a->sign = MP_ZPOS; ------------------ | | 151| 8.94k|#define MP_ZPOS 0 /* positive integer */ ------------------ 21| | 22| 8.94k| return MP_OKAY; ------------------ | | 161| 8.94k|#define MP_OKAY 0 /* no error */ ------------------ 23| 8.94k|} mp_lshd: 8| 12|{ 9| 12| int x; 10| 12| mp_err err; 11| 12| mp_digit *top, *bottom; 12| | 13| | /* if its less than zero return */ 14| 12| if (b <= 0) { ------------------ | Branch (14:8): [True: 2, False: 10] ------------------ 15| 2| return MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 16| 2| } 17| | /* no need to shift 0 around */ 18| 10| if (MP_IS_ZERO(a)) { ------------------ | | 163| 10|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 10] | | ------------------ ------------------ 19| 0| return MP_OKAY; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ 20| 0| } 21| | 22| | /* grow to fit the new digits */ 23| 10| if (a->alloc < (a->used + b)) { ------------------ | Branch (23:8): [True: 2, False: 8] ------------------ 24| 2| if ((err = mp_grow(a, a->used + b)) != MP_OKAY) { ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (24:11): [True: 0, False: 2] ------------------ 25| 0| return err; 26| 0| } 27| 2| } 28| | 29| | /* increment the used by the shift amount then copy upwards */ 30| 10| a->used += b; 31| | 32| | /* top */ 33| 10| top = a->dp + a->used - 1; 34| | 35| | /* base */ 36| 10| bottom = (a->dp + a->used - 1) - b; 37| | 38| | /* much like mp_rshd this is implemented using a sliding window 39| | * except the window goes the otherway around. Copying from 40| | * the bottom to the top. see bn_mp_rshd.c for more info. 41| | */ 42| 68| for (x = a->used - 1; x >= b; x--) { ------------------ | Branch (42:26): [True: 58, False: 10] ------------------ 43| 58| *top-- = *bottom--; 44| 58| } 45| | 46| | /* zero the lower digits */ 47| 10| MP_ZERO_DIGITS(a->dp, b); ------------------ | | 89| 10|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 10|do { \ | | 91| 10| int zd_ = (digits); \ | | 92| 10| mp_digit* zm_ = (mem); \ | | 93| 40| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 30, False: 10] | | ------------------ | | 94| 30| *zm_++ = 0; \ | | 95| 30| } \ | | 96| 10|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 48| | 49| 10| return MP_OKAY; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ 50| 10|} mp_mod: 8| 2|{ 9| 2| mp_int t; 10| 2| mp_err err; 11| | 12| 2| if ((err = mp_init_size(&t, b->used)) != MP_OKAY) { ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (12:8): [True: 0, False: 2] ------------------ 13| 0| return err; 14| 0| } 15| | 16| 2| if ((err = mp_div(a, b, NULL, &t)) != MP_OKAY) { ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (16:8): [True: 0, False: 2] ------------------ 17| 0| goto LBL_ERR; 18| 0| } 19| | 20| 2| if (MP_IS_ZERO(&t) || (t.sign == b->sign)) { ------------------ | | 163| 4|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 2] | | ------------------ ------------------ | Branch (20:26): [True: 2, False: 0] ------------------ 21| 2| err = MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 22| 2| mp_exch(&t, c); 23| 2| } else { 24| 0| err = mp_add(b, &t, c); 25| 0| } 26| | 27| 2|LBL_ERR: 28| 2| mp_clear(&t); 29| 2| return err; 30| 2|} mp_mul: 8| 1|{ 9| 1| mp_err err; 10| 1| int min_len = MP_MIN(a->used, b->used), ------------------ | | 156| 1|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 0, False: 1] | | ------------------ ------------------ 11| 1| max_len = MP_MAX(a->used, b->used), ------------------ | | 157| 1|#define MP_MAX(x, y) (((x) > (y)) ? (x) : (y)) | | ------------------ | | | Branch (157:23): [True: 0, False: 1] | | ------------------ ------------------ 12| 1| digs = a->used + b->used + 1; 13| 1| mp_sign neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 151| 1|#define MP_ZPOS 0 /* positive integer */ ------------------ mp_sign neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ | Branch (13:18): [True: 1, False: 0] ------------------ 14| | 15| 1| if (MP_HAS(S_MP_BALANCE_MUL) && ------------------ | | 150| 2|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 1|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 1|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 16| | /* Check sizes. The smaller one needs to be larger than the Karatsuba cut-off. 17| | * The bigger one needs to be at least about one MP_KARATSUBA_MUL_CUTOFF bigger 18| | * to make some sense, but it depends on architecture, OS, position of the 19| | * stars... so YMMV. 20| | * Using it to cut the input into slices small enough for fast_s_mp_mul_digs 21| | * was actually slower on the author's machine, but YMMV. 22| | */ 23| 1| (min_len >= MP_KARATSUBA_MUL_CUTOFF) && ------------------ | | 121| 1|# define MP_KARATSUBA_MUL_CUTOFF KARATSUBA_MUL_CUTOFF ------------------ | Branch (23:8): [True: 0, False: 1] ------------------ 24| 1| ((max_len / 2) >= MP_KARATSUBA_MUL_CUTOFF) && ------------------ | | 121| 0|# define MP_KARATSUBA_MUL_CUTOFF KARATSUBA_MUL_CUTOFF ------------------ | Branch (24:8): [True: 0, False: 0] ------------------ 25| | /* Not much effect was observed below a ratio of 1:2, but again: YMMV. */ 26| 1| (max_len >= (2 * min_len))) { ------------------ | Branch (26:8): [True: 0, False: 0] ------------------ 27| 0| err = s_mp_balance_mul(a,b,c); 28| 1| } else if (MP_HAS(S_MP_TOOM_MUL) && ------------------ | | 150| 2|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 1|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 1|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 29| 1| (min_len >= MP_TOOM_MUL_CUTOFF)) { ------------------ | | 123| 0|# define MP_TOOM_MUL_CUTOFF TOOM_MUL_CUTOFF ------------------ | Branch (29:15): [True: 0, False: 0] ------------------ 30| 0| err = s_mp_toom_mul(a, b, c); 31| 1| } else if (MP_HAS(S_MP_KARATSUBA_MUL) && ------------------ | | 150| 2|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 1|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 1|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 32| 1| (min_len >= MP_KARATSUBA_MUL_CUTOFF)) { ------------------ | | 121| 0|# define MP_KARATSUBA_MUL_CUTOFF KARATSUBA_MUL_CUTOFF ------------------ | Branch (32:15): [True: 0, False: 0] ------------------ 33| 0| err = s_mp_karatsuba_mul(a, b, c); 34| 1| } else if (MP_HAS(S_MP_MUL_DIGS_FAST) && ------------------ | | 150| 2|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 1|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 1|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 35| | /* can we use the fast multiplier? 36| | * 37| | * The fast multiplier can be used if the output will 38| | * have less than MP_WARRAY digits and the number of 39| | * digits won't affect carry propagation 40| | */ 41| 1| (digs < MP_WARRAY) && ------------------ | | 172| 1|#define MP_WARRAY PRIVATE_MP_WARRAY | | ------------------ | | | | 203| 1|#define PRIVATE_MP_WARRAY (int)(1uLL << (((CHAR_BIT * sizeof(private_mp_word)) - (2 * MP_DIGIT_BIT)) + 1)) | | | | ------------------ | | | | | | 82| 1|# define MP_DIGIT_BIT 60 | | | | ------------------ | | ------------------ ------------------ | Branch (41:15): [True: 1, False: 0] ------------------ 42| 1| (min_len <= MP_MAXFAST)) { ------------------ | | 168| 1|#define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 167| 1|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) | | ------------------ | | #define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 82| 1|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (42:15): [True: 1, False: 0] ------------------ 43| 1| err = s_mp_mul_digs_fast(a, b, c, digs); 44| 1| } else if (MP_HAS(S_MP_MUL_DIGS)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 45| 0| err = s_mp_mul_digs(a, b, c, digs); 46| 0| } else { 47| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 48| 0| } 49| 1| c->sign = (c->used > 0) ? neg : MP_ZPOS; ------------------ | | 151| 1|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (49:14): [True: 1, False: 0] ------------------ 50| 1| return err; 51| 1|} mp_mul_2d: 8| 30.1k|{ 9| 30.1k| mp_digit d; 10| 30.1k| mp_err err; 11| | 12| | /* copy */ 13| 30.1k| if (a != c) { ------------------ | Branch (13:8): [True: 0, False: 30.1k] ------------------ 14| 0| if ((err = mp_copy(a, c)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (14:11): [True: 0, False: 0] ------------------ 15| 0| return err; 16| 0| } 17| 0| } 18| | 19| 30.1k| if (c->alloc < (c->used + (b / MP_DIGIT_BIT) + 1)) { ------------------ | | 82| 30.1k|# define MP_DIGIT_BIT 60 ------------------ | Branch (19:8): [True: 1.71k, False: 28.4k] ------------------ 20| 1.71k| if ((err = mp_grow(c, c->used + (b / MP_DIGIT_BIT) + 1)) != MP_OKAY) { ------------------ | | 82| 1.71k|# define MP_DIGIT_BIT 60 ------------------ if ((err = mp_grow(c, c->used + (b / MP_DIGIT_BIT) + 1)) != MP_OKAY) { ------------------ | | 161| 1.71k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (20:11): [True: 0, False: 1.71k] ------------------ 21| 0| return err; 22| 0| } 23| 1.71k| } 24| | 25| | /* shift by as many digits in the bit count */ 26| 30.1k| if (b >= MP_DIGIT_BIT) { ------------------ | | 82| 30.1k|# define MP_DIGIT_BIT 60 ------------------ | Branch (26:8): [True: 0, False: 30.1k] ------------------ 27| 0| if ((err = mp_lshd(c, b / MP_DIGIT_BIT)) != MP_OKAY) { ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ if ((err = mp_lshd(c, b / MP_DIGIT_BIT)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (27:11): [True: 0, False: 0] ------------------ 28| 0| return err; 29| 0| } 30| 0| } 31| | 32| | /* shift any bit count < MP_DIGIT_BIT */ 33| 30.1k| d = (mp_digit)(b % MP_DIGIT_BIT); ------------------ | | 82| 30.1k|# define MP_DIGIT_BIT 60 ------------------ 34| 30.1k| if (d != 0u) { ------------------ | Branch (34:8): [True: 30.1k, False: 0] ------------------ 35| 30.1k| mp_digit *tmpc, shift, mask, r, rr; 36| 30.1k| int x; 37| | 38| | /* bitmask for carries */ 39| 30.1k| mask = ((mp_digit)1 << d) - (mp_digit)1; 40| | 41| | /* shift for msbs */ 42| 30.1k| shift = (mp_digit)MP_DIGIT_BIT - d; ------------------ | | 82| 30.1k|# define MP_DIGIT_BIT 60 ------------------ 43| | 44| | /* alias */ 45| 30.1k| tmpc = c->dp; 46| | 47| | /* carry */ 48| 30.1k| r = 0; 49| 1.10M| for (x = 0; x < c->used; x++) { ------------------ | Branch (49:19): [True: 1.07M, False: 30.1k] ------------------ 50| | /* get the higher bits of the current word */ 51| 1.07M| rr = (*tmpc >> shift) & mask; 52| | 53| | /* shift the current word and OR in the carry */ 54| 1.07M| *tmpc = ((*tmpc << d) | r) & MP_MASK; ------------------ | | 106| 1.07M|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 1.07M|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 55| 1.07M| ++tmpc; 56| | 57| | /* set the carry to the carry bits of the current word */ 58| 1.07M| r = rr; 59| 1.07M| } 60| | 61| | /* set final carry */ 62| 30.1k| if (r != 0u) { ------------------ | Branch (62:11): [True: 2, False: 30.1k] ------------------ 63| 2| c->dp[(c->used)++] = r; 64| 2| } 65| 30.1k| } 66| 30.1k| mp_clamp(c); 67| 30.1k| return MP_OKAY; ------------------ | | 161| 30.1k|#define MP_OKAY 0 /* no error */ ------------------ 68| 30.1k|} mp_mul_d: 8| 148|{ 9| 148| mp_digit u, *tmpa, *tmpc; 10| 148| mp_word r; 11| 148| mp_err err; 12| 148| int ix, olduse; 13| | 14| | /* make sure c is big enough to hold a*b */ 15| 148| if (c->alloc < (a->used + 1)) { ------------------ | Branch (15:8): [True: 0, False: 148] ------------------ 16| 0| if ((err = mp_grow(c, a->used + 1)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (16:11): [True: 0, False: 0] ------------------ 17| 0| return err; 18| 0| } 19| 0| } 20| | 21| | /* get the original destinations used count */ 22| 148| olduse = c->used; 23| | 24| | /* set the sign */ 25| 148| c->sign = a->sign; 26| | 27| | /* alias for a->dp [source] */ 28| 148| tmpa = a->dp; 29| | 30| | /* alias for c->dp [dest] */ 31| 148| tmpc = c->dp; 32| | 33| | /* zero carry */ 34| 148| u = 0; 35| | 36| | /* compute columns */ 37| 548| for (ix = 0; ix < a->used; ix++) { ------------------ | Branch (37:17): [True: 400, False: 148] ------------------ 38| | /* compute product and carry sum for this term */ 39| 400| r = (mp_word)u + ((mp_word)*tmpa++ * (mp_word)b); 40| | 41| | /* mask off higher bits to get a single digit */ 42| 400| *tmpc++ = (mp_digit)(r & (mp_word)MP_MASK); ------------------ | | 106| 400|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 400|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 43| | 44| | /* send carry into next iteration */ 45| 400| u = (mp_digit)(r >> (mp_word)MP_DIGIT_BIT); ------------------ | | 82| 400|# define MP_DIGIT_BIT 60 ------------------ 46| 400| } 47| | 48| | /* store final carry [if any] and increment ix offset */ 49| 148| *tmpc++ = u; 50| 148| ++ix; 51| | 52| | /* now zero digits above the top */ 53| 148| MP_ZERO_DIGITS(tmpc, olduse - ix); ------------------ | | 89| 148|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 148|do { \ | | 91| 148| int zd_ = (digits); \ | | 92| 148| mp_digit* zm_ = (mem); \ | | 93| 148| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 148] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 148|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 54| | 55| | /* set used count */ 56| 148| c->used = a->used + 1; 57| 148| mp_clamp(c); 58| | 59| 148| return MP_OKAY; ------------------ | | 161| 148|#define MP_OKAY 0 /* no error */ ------------------ 60| 148|} mp_rand_source: 10| 1|{ 11| | /* Dropbear, don't reset to platform if source==NULL */ 12| 1| s_mp_rand_source = source; 13| 1|} mp_read_radix: 10| 2|{ 11| 2| mp_err err; 12| 2| int y; 13| 2| mp_sign neg; 14| 2| unsigned pos; 15| 2| char ch; 16| | 17| | /* zero the digit bignum */ 18| 2| mp_zero(a); 19| | 20| | /* make sure the radix is ok */ 21| 2| if ((radix < 2) || (radix > 64)) { ------------------ | Branch (21:8): [True: 0, False: 2] | Branch (21:23): [True: 0, False: 2] ------------------ 22| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 23| 0| } 24| | 25| | /* if the leading digit is a 26| | * minus set the sign to negative. 27| | */ 28| 2| if (*str == '-') { ------------------ | Branch (28:8): [True: 0, False: 2] ------------------ 29| 0| ++str; 30| 0| neg = MP_NEG; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ 31| 2| } else { 32| 2| neg = MP_ZPOS; ------------------ | | 151| 2|#define MP_ZPOS 0 /* positive integer */ ------------------ 33| 2| } 34| | 35| | /* set the integer to the default of zero */ 36| 2| mp_zero(a); 37| | 38| | /* process each digit of the string */ 39| 130| while (*str != '\0') { ------------------ | Branch (39:11): [True: 128, False: 2] ------------------ 40| | /* if the radix <= 36 the conversion is case insensitive 41| | * this allows numbers like 1AB and 1ab to represent the same value 42| | * [e.g. in hex] 43| | */ 44| 128| ch = (radix <= 36) ? (char)MP_TOUPPER((int)*str) : *str; ------------------ | | 6| 128|#define MP_TOUPPER(c) ((((c) >= 'a') && ((c) <= 'z')) ? (((c) + 'A') - 'a') : (c)) | | ------------------ | | | Branch (6:25): [True: 0, False: 128] | | | Branch (6:41): [True: 0, False: 0] | | ------------------ ------------------ | Branch (44:12): [True: 128, False: 0] ------------------ 45| 128| pos = (unsigned)(ch - '('); 46| 128| if (mp_s_rmap_reverse_sz < pos) { ------------------ | Branch (46:11): [True: 0, False: 128] ------------------ 47| 0| break; 48| 0| } 49| 128| y = (int)mp_s_rmap_reverse[pos]; 50| | 51| | /* if the char was found in the map 52| | * and is less than the given radix add it 53| | * to the number, otherwise exit the loop. 54| | */ 55| 128| if ((y == 0xff) || (y >= radix)) { ------------------ | Branch (55:11): [True: 0, False: 128] | Branch (55:26): [True: 0, False: 128] ------------------ 56| 0| break; 57| 0| } 58| 128| if ((err = mp_mul_d(a, (mp_digit)radix, a)) != MP_OKAY) { ------------------ | | 161| 128|#define MP_OKAY 0 /* no error */ ------------------ | Branch (58:11): [True: 0, False: 128] ------------------ 59| 0| return err; 60| 0| } 61| 128| if ((err = mp_add_d(a, (mp_digit)y, a)) != MP_OKAY) { ------------------ | | 161| 128|#define MP_OKAY 0 /* no error */ ------------------ | Branch (61:11): [True: 0, False: 128] ------------------ 62| 0| return err; 63| 0| } 64| 128| ++str; 65| 128| } 66| | 67| | /* if an illegal character was found, fail. */ 68| 2| if (!((*str == '\0') || (*str == '\r') || (*str == '\n'))) { ------------------ | Branch (68:10): [True: 2, False: 0] | Branch (68:28): [True: 0, False: 0] | Branch (68:46): [True: 0, False: 0] ------------------ 69| 0| mp_zero(a); 70| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 71| 0| } 72| | 73| | /* set the sign only if a != 0 */ 74| 2| if (!MP_IS_ZERO(a)) { ------------------ | | 163| 2|#define MP_IS_ZERO(a) ((a)->used == 0) ------------------ | Branch (74:8): [True: 2, False: 0] ------------------ 75| 2| a->sign = neg; 76| 2| } 77| 2| return MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 78| 2|} mp_rshd: 8| 2|{ 9| 2| int x; 10| 2| mp_digit *bottom, *top; 11| | 12| | /* if b <= 0 then ignore it */ 13| 2| if (b <= 0) { ------------------ | Branch (13:8): [True: 0, False: 2] ------------------ 14| 0| return; 15| 0| } 16| | 17| | /* if b > used then simply zero it and return */ 18| 2| if (a->used <= b) { ------------------ | Branch (18:8): [True: 0, False: 2] ------------------ 19| 0| mp_zero(a); 20| 0| return; 21| 0| } 22| | 23| | /* shift the digits down */ 24| | 25| | /* bottom */ 26| 2| bottom = a->dp; 27| | 28| | /* top [offset into digits] */ 29| 2| top = a->dp + b; 30| | 31| | /* this is implemented as a sliding window where 32| | * the window is b-digits long and digits from 33| | * the top of the window are copied to the bottom 34| | * 35| | * e.g. 36| | 37| | b-2 | b-1 | b0 | b1 | b2 | ... | bb | ----> 38| | /\ | ----> 39| | \-------------------/ ----> 40| | */ 41| 12| for (x = 0; x < (a->used - b); x++) { ------------------ | Branch (41:16): [True: 10, False: 2] ------------------ 42| 10| *bottom++ = *top++; 43| 10| } 44| | 45| | /* zero the top digits */ 46| 2| MP_ZERO_DIGITS(bottom, a->used - x); ------------------ | | 89| 2|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 2|do { \ | | 91| 2| int zd_ = (digits); \ | | 92| 2| mp_digit* zm_ = (mem); \ | | 93| 12| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 10, False: 2] | | ------------------ | | 94| 10| *zm_++ = 0; \ | | 95| 10| } \ | | 96| 2|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 47| | 48| | /* remove excess digits */ 49| 2| a->used -= b; 50| 2|} mp_set: 8| 1|{ 9| 1| a->dp[0] = b & MP_MASK; ------------------ | | 106| 1|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 1|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 10| 1| a->sign = MP_ZPOS; ------------------ | | 151| 1|#define MP_ZPOS 0 /* positive integer */ ------------------ 11| 1| a->used = (a->dp[0] != 0u) ? 1 : 0; ------------------ | Branch (11:15): [True: 1, False: 0] ------------------ 12| 1| MP_ZERO_DIGITS(a->dp + a->used, a->alloc - a->used); ------------------ | | 89| 1|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 1|do { \ | | 91| 1| int zd_ = (digits); \ | | 92| 1| mp_digit* zm_ = (mem); \ | | 93| 32| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 31, False: 1] | | ------------------ | | 94| 31| *zm_++ = 0; \ | | 95| 31| } \ | | 96| 1|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 13| 1|} mp_sqr: 8| 2|{ 9| 2| mp_err err; 10| 2| if (MP_HAS(S_MP_TOOM_SQR) && /* use Toom-Cook? */ ------------------ | | 150| 4|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 2|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 2|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 11| 2| (a->used >= MP_TOOM_SQR_CUTOFF)) { ------------------ | | 124| 0|# define MP_TOOM_SQR_CUTOFF TOOM_SQR_CUTOFF ------------------ | Branch (11:8): [True: 0, False: 0] ------------------ 12| 0| err = s_mp_toom_sqr(a, b); 13| 2| } else if (MP_HAS(S_MP_KARATSUBA_SQR) && /* Karatsuba? */ ------------------ | | 150| 4|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 2|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 2|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 14| 2| (a->used >= MP_KARATSUBA_SQR_CUTOFF)) { ------------------ | | 122| 0|# define MP_KARATSUBA_SQR_CUTOFF KARATSUBA_SQR_CUTOFF ------------------ | Branch (14:15): [True: 0, False: 0] ------------------ 15| 0| err = s_mp_karatsuba_sqr(a, b); 16| 2| } else if (MP_HAS(S_MP_SQR_FAST) && /* can we use the fast comba multiplier? */ ------------------ | | 150| 4|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 2|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 2|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 17| 2| (((a->used * 2) + 1) < MP_WARRAY) && ------------------ | | 172| 2|#define MP_WARRAY PRIVATE_MP_WARRAY | | ------------------ | | | | 203| 2|#define PRIVATE_MP_WARRAY (int)(1uLL << (((CHAR_BIT * sizeof(private_mp_word)) - (2 * MP_DIGIT_BIT)) + 1)) | | | | ------------------ | | | | | | 82| 2|# define MP_DIGIT_BIT 60 | | | | ------------------ | | ------------------ ------------------ | Branch (17:15): [True: 2, False: 0] ------------------ 18| 2| (a->used < (MP_MAXFAST / 2))) { ------------------ | | 168| 2|#define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 167| 2|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) | | ------------------ | | #define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 82| 2|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (18:15): [True: 2, False: 0] ------------------ 19| 2| err = s_mp_sqr_fast(a, b); 20| 2| } else if (MP_HAS(S_MP_SQR)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded - Ignored] | | ------------------ ------------------ 21| 0| err = s_mp_sqr(a, b); 22| 0| } else { 23| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 24| 0| } 25| 2| b->sign = MP_ZPOS; ------------------ | | 151| 2|#define MP_ZPOS 0 /* positive integer */ ------------------ 26| 2| return err; 27| 2|} mp_sub: 8| 11|{ 9| 11| mp_sign sa = a->sign, sb = b->sign; 10| 11| mp_err err; 11| | 12| 11| if (sa != sb) { ------------------ | Branch (12:8): [True: 0, False: 11] ------------------ 13| | /* subtract a negative from a positive, OR */ 14| | /* subtract a positive from a negative. */ 15| | /* In either case, ADD their magnitudes, */ 16| | /* and use the sign of the first number. */ 17| 0| c->sign = sa; 18| 0| err = s_mp_add(a, b, c); 19| 11| } else { 20| | /* subtract a positive from a positive, OR */ 21| | /* subtract a negative from a negative. */ 22| | /* First, take the difference between their */ 23| | /* magnitudes, then... */ 24| 11| if (mp_cmp_mag(a, b) != MP_LT) { ------------------ | | 154| 11|#define MP_LT -1 /* less than */ ------------------ | Branch (24:11): [True: 11, False: 0] ------------------ 25| | /* Copy the sign from the first */ 26| 11| c->sign = sa; 27| | /* The first has a larger or equal magnitude */ 28| 11| err = s_mp_sub(a, b, c); 29| 11| } else { 30| | /* The result has the *opposite* sign from */ 31| | /* the first number. */ 32| 0| c->sign = (sa == MP_ZPOS) ? MP_NEG : MP_ZPOS; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ c->sign = (sa == MP_ZPOS) ? MP_NEG : MP_ZPOS; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ c->sign = (sa == MP_ZPOS) ? MP_NEG : MP_ZPOS; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (32:20): [True: 0, False: 0] ------------------ 33| | /* The second has a larger magnitude */ 34| 0| err = s_mp_sub(b, a, c); 35| 0| } 36| 11| } 37| 11| return err; 38| 11|} mp_to_ubin: 8| 8.93k|{ 9| 8.93k| size_t x, count; 10| 8.93k| mp_err err; 11| 8.93k| mp_int t; 12| | 13| 8.93k| count = mp_ubin_size(a); 14| 8.93k| if (count > maxlen) { ------------------ | Branch (14:8): [True: 0, False: 8.93k] ------------------ 15| 0| return MP_BUF; ------------------ | | 167| 0|#define MP_BUF -5 /* buffer overflow, supplied buffer too small */ ------------------ 16| 0| } 17| | 18| 8.93k| if ((err = mp_init_copy(&t, a)) != MP_OKAY) { ------------------ | | 161| 8.93k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (18:8): [True: 0, False: 8.93k] ------------------ 19| 0| return err; 20| 0| } 21| | 22| 35.7k| for (x = count; x --> 0u;) { ------------------ | Branch (22:20): [True: 26.8k, False: 8.93k] ------------------ 23| 26.8k|#ifndef MP_8BIT 24| 26.8k| buf[x] = (unsigned char)(t.dp[0] & 255u); 25| |#else 26| | buf[x] = (unsigned char)(t.dp[0] | ((t.dp[1] & 1u) << 7)); 27| |#endif 28| 26.8k| if ((err = mp_div_2d(&t, 8, &t, NULL)) != MP_OKAY) { ------------------ | | 161| 26.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (28:11): [True: 0, False: 26.8k] ------------------ 29| 0| goto LBL_ERR; 30| 0| } 31| 26.8k| } 32| | 33| 8.93k| if (written != NULL) { ------------------ | Branch (33:8): [True: 8.93k, False: 0] ------------------ 34| 8.93k| *written = count; 35| 8.93k| } 36| | 37| 8.93k|LBL_ERR: 38| 8.93k| mp_clear(&t); 39| 8.93k| return err; 40| 8.93k|} mp_ubin_size: 8| 8.93k|{ 9| 8.93k| size_t size = (size_t)mp_count_bits(a); 10| 8.93k| return (size / 8u) + (((size & 7u) != 0u) ? 1u : 0u); ------------------ | Branch (10:26): [True: 0, False: 8.93k] ------------------ 11| 8.93k|} mp_zero: 8| 3.93k|{ 9| 3.93k| a->sign = MP_ZPOS; ------------------ | | 151| 3.93k|#define MP_ZPOS 0 /* positive integer */ ------------------ 10| 3.93k| a->used = 0; 11| 3.93k| MP_ZERO_DIGITS(a->dp, a->alloc); ------------------ | | 89| 3.93k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 3.93k|do { \ | | 91| 3.93k| int zd_ = (digits); \ | | 92| 3.93k| mp_digit* zm_ = (mem); \ | | 93| 129k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 125k, False: 3.93k] | | ------------------ | | 94| 125k| *zm_++ = 0; \ | | 95| 125k| } \ | | 96| 3.93k|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 12| 3.93k|} s_mp_add: 8| 3|{ 9| 3| const mp_int *x; 10| 3| mp_err err; 11| 3| int olduse, min, max; 12| | 13| | /* find sizes, we let |a| <= |b| which means we have to sort 14| | * them. "x" will point to the input with the most digits 15| | */ 16| 3| if (a->used > b->used) { ------------------ | Branch (16:8): [True: 3, False: 0] ------------------ 17| 3| min = b->used; 18| 3| max = a->used; 19| 3| x = a; 20| 3| } else { 21| 0| min = a->used; 22| 0| max = b->used; 23| 0| x = b; 24| 0| } 25| | 26| | /* init result */ 27| 3| if (c->alloc < (max + 1)) { ------------------ | Branch (27:8): [True: 0, False: 3] ------------------ 28| 0| if ((err = mp_grow(c, max + 1)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (28:11): [True: 0, False: 0] ------------------ 29| 0| return err; 30| 0| } 31| 0| } 32| | 33| | /* get old used digit count and set new one */ 34| 3| olduse = c->used; 35| 3| c->used = max + 1; 36| | 37| 3| { 38| 3| mp_digit u, *tmpa, *tmpb, *tmpc; 39| 3| int i; 40| | 41| | /* alias for digit pointers */ 42| | 43| | /* first input */ 44| 3| tmpa = a->dp; 45| | 46| | /* second input */ 47| 3| tmpb = b->dp; 48| | 49| | /* destination */ 50| 3| tmpc = c->dp; 51| | 52| | /* zero the carry */ 53| 3| u = 0; 54| 18| for (i = 0; i < min; i++) { ------------------ | Branch (54:19): [True: 15, False: 3] ------------------ 55| | /* Compute the sum at one digit, T[i] = A[i] + B[i] + U */ 56| 15| *tmpc = *tmpa++ + *tmpb++ + u; 57| | 58| | /* U = carry bit of T[i] */ 59| 15| u = *tmpc >> (mp_digit)MP_DIGIT_BIT; ------------------ | | 82| 15|# define MP_DIGIT_BIT 60 ------------------ 60| | 61| | /* take away carry bit from T[i] */ 62| 15| *tmpc++ &= MP_MASK; ------------------ | | 106| 15|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 15|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 63| 15| } 64| | 65| | /* now copy higher words if any, that is in A+B 66| | * if A or B has more digits add those in 67| | */ 68| 3| if (min != max) { ------------------ | Branch (68:11): [True: 3, False: 0] ------------------ 69| 15| for (; i < max; i++) { ------------------ | Branch (69:17): [True: 12, False: 3] ------------------ 70| | /* T[i] = X[i] + U */ 71| 12| *tmpc = x->dp[i] + u; 72| | 73| | /* U = carry bit of T[i] */ 74| 12| u = *tmpc >> (mp_digit)MP_DIGIT_BIT; ------------------ | | 82| 12|# define MP_DIGIT_BIT 60 ------------------ 75| | 76| | /* take away carry bit from T[i] */ 77| 12| *tmpc++ &= MP_MASK; ------------------ | | 106| 12|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 12|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 78| 12| } 79| 3| } 80| | 81| | /* add carry */ 82| 3| *tmpc++ = u; 83| | 84| | /* clear digits above oldused */ 85| 3| MP_ZERO_DIGITS(tmpc, olduse - c->used); ------------------ | | 89| 3|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 3|do { \ | | 91| 3| int zd_ = (digits); \ | | 92| 3| mp_digit* zm_ = (mem); \ | | 93| 3| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 3] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 3|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 86| 3| } 87| | 88| 3| mp_clamp(c); 89| 3| return MP_OKAY; ------------------ | | 161| 3|#define MP_OKAY 0 /* no error */ ------------------ 90| 3|} s_mp_mul_digs_fast: 23| 1|{ 24| 1| int olduse, pa, ix, iz; 25| 1| mp_err err; 26| 1| mp_digit W[MP_WARRAY]; 27| 1| mp_word _W; 28| | 29| | /* grow the destination as required */ 30| 1| if (c->alloc < digs) { ------------------ | Branch (30:8): [True: 1, False: 0] ------------------ 31| 1| if ((err = mp_grow(c, digs)) != MP_OKAY) { ------------------ | | 161| 1|#define MP_OKAY 0 /* no error */ ------------------ | Branch (31:11): [True: 0, False: 1] ------------------ 32| 0| return err; 33| 0| } 34| 1| } 35| | 36| | /* number of output digits to produce */ 37| 1| pa = MP_MIN(digs, a->used + b->used); ------------------ | | 156| 1|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 0, False: 1] | | ------------------ ------------------ 38| | 39| | /* clear the carry */ 40| 1| _W = 0; 41| 11| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (41:17): [True: 10, False: 1] ------------------ 42| 10| int tx, ty; 43| 10| int iy; 44| 10| mp_digit *tmpx, *tmpy; 45| | 46| | /* get offsets into the two bignums */ 47| 10| ty = MP_MIN(b->used-1, ix); ------------------ | | 156| 10|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 5, False: 5] | | ------------------ ------------------ 48| 10| tx = ix - ty; 49| | 50| | /* setup temp aliases */ 51| 10| tmpx = a->dp + tx; 52| 10| tmpy = b->dp + ty; 53| | 54| | /* this is the number of times the loop will iterrate, essentially 55| | while (tx++ < a->used && ty-- >= 0) { ... } 56| | */ 57| 10| iy = MP_MIN(a->used-tx, ty+1); ------------------ | | 156| 10|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 5, False: 5] | | ------------------ ------------------ 58| | 59| | /* execute loop */ 60| 35| for (iz = 0; iz < iy; ++iz) { ------------------ | Branch (60:20): [True: 25, False: 10] ------------------ 61| 25| _W += (mp_word)*tmpx++ * (mp_word)*tmpy--; 62| | 63| 25| } 64| | 65| | /* store term */ 66| 10| W[ix] = (mp_digit)_W & MP_MASK; ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 67| | 68| | /* make next carry */ 69| 10| _W = _W >> (mp_word)MP_DIGIT_BIT; ------------------ | | 82| 10|# define MP_DIGIT_BIT 60 ------------------ 70| 10| } 71| | 72| | /* setup dest */ 73| 1| olduse = c->used; 74| 1| c->used = pa; 75| | 76| 1| { 77| 1| mp_digit *tmpc; 78| 1| tmpc = c->dp; 79| 11| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (79:20): [True: 10, False: 1] ------------------ 80| | /* now extract the previous digit [below the carry] */ 81| 10| *tmpc++ = W[ix]; 82| 10| } 83| | 84| | /* clear unused digits [that existed in the old copy of c] */ 85| 1| MP_ZERO_DIGITS(tmpc, olduse - ix); ------------------ | | 89| 1|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 1|do { \ | | 91| 1| int zd_ = (digits); \ | | 92| 1| mp_digit* zm_ = (mem); \ | | 93| 1| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 1] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 1|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 86| 1| } 87| 1| mp_clamp(c); 88| 1| return MP_OKAY; ------------------ | | 161| 1|#define MP_OKAY 0 /* no error */ ------------------ 89| 1|} s_mp_sqr_fast: 17| 2|{ 18| 2| int olduse, pa, ix, iz; 19| 2| mp_digit W[MP_WARRAY], *tmpx; 20| 2| mp_word W1; 21| 2| mp_err err; 22| | 23| | /* grow the destination as required */ 24| 2| pa = a->used + a->used; 25| 2| if (b->alloc < pa) { ------------------ | Branch (25:8): [True: 0, False: 2] ------------------ 26| 0| if ((err = mp_grow(b, pa)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (26:11): [True: 0, False: 0] ------------------ 27| 0| return err; 28| 0| } 29| 0| } 30| | 31| | /* number of output digits to produce */ 32| 2| W1 = 0; 33| 22| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (33:17): [True: 20, False: 2] ------------------ 34| 20| int tx, ty, iy; 35| 20| mp_word _W; 36| 20| mp_digit *tmpy; 37| | 38| | /* clear counter */ 39| 20| _W = 0; 40| | 41| | /* get offsets into the two bignums */ 42| 20| ty = MP_MIN(a->used-1, ix); ------------------ | | 156| 20|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 10, False: 10] | | ------------------ ------------------ 43| 20| tx = ix - ty; 44| | 45| | /* setup temp aliases */ 46| 20| tmpx = a->dp + tx; 47| 20| tmpy = a->dp + ty; 48| | 49| | /* this is the number of times the loop will iterrate, essentially 50| | while (tx++ < a->used && ty-- >= 0) { ... } 51| | */ 52| 20| iy = MP_MIN(a->used-tx, ty+1); ------------------ | | 156| 20|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 10, False: 10] | | ------------------ ------------------ 53| | 54| | /* now for squaring tx can never equal ty 55| | * we halve the distance since they approach at a rate of 2x 56| | * and we have to round because odd cases need to be executed 57| | */ 58| 20| iy = MP_MIN(iy, ((ty-tx)+1)>>1); ------------------ | | 156| 20|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 0, False: 20] | | ------------------ ------------------ 59| | 60| | /* execute loop */ 61| 40| for (iz = 0; iz < iy; iz++) { ------------------ | Branch (61:20): [True: 20, False: 20] ------------------ 62| 20| _W += (mp_word)*tmpx++ * (mp_word)*tmpy--; 63| 20| } 64| | 65| | /* double the inner product and add carry */ 66| 20| _W = _W + _W + W1; 67| | 68| | /* even columns have the square term in them */ 69| 20| if (((unsigned)ix & 1u) == 0u) { ------------------ | Branch (69:11): [True: 10, False: 10] ------------------ 70| 10| _W += (mp_word)a->dp[ix>>1] * (mp_word)a->dp[ix>>1]; 71| 10| } 72| | 73| | /* store it */ 74| 20| W[ix] = (mp_digit)_W & MP_MASK; ------------------ | | 106| 20|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 20|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 75| | 76| | /* make next carry */ 77| 20| W1 = _W >> (mp_word)MP_DIGIT_BIT; ------------------ | | 82| 20|# define MP_DIGIT_BIT 60 ------------------ 78| 20| } 79| | 80| | /* setup dest */ 81| 2| olduse = b->used; 82| 2| b->used = a->used+a->used; 83| | 84| 2| { 85| 2| mp_digit *tmpb; 86| 2| tmpb = b->dp; 87| 22| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (87:20): [True: 20, False: 2] ------------------ 88| 20| *tmpb++ = W[ix] & MP_MASK; ------------------ | | 106| 20|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 20|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 89| 20| } 90| | 91| | /* clear unused digits [that existed in the old copy of c] */ 92| 2| MP_ZERO_DIGITS(tmpb, olduse - ix); ------------------ | | 89| 2|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 2|do { \ | | 91| 2| int zd_ = (digits); \ | | 92| 2| mp_digit* zm_ = (mem); \ | | 93| 2| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 2] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 2|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 93| 2| } 94| 2| mp_clamp(b); 95| 2| return MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 96| 2|} s_mp_sub: 8| 11|{ 9| 11| int olduse, min, max; 10| 11| mp_err err; 11| | 12| | /* find sizes */ 13| 11| min = b->used; 14| 11| max = a->used; 15| | 16| | /* init result */ 17| 11| if (c->alloc < max) { ------------------ | Branch (17:8): [True: 0, False: 11] ------------------ 18| 0| if ((err = mp_grow(c, max)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (18:11): [True: 0, False: 0] ------------------ 19| 0| return err; 20| 0| } 21| 0| } 22| 11| olduse = c->used; 23| 11| c->used = max; 24| | 25| 11| { 26| 11| mp_digit u, *tmpa, *tmpb, *tmpc; 27| 11| int i; 28| | 29| | /* alias for digit pointers */ 30| 11| tmpa = a->dp; 31| 11| tmpb = b->dp; 32| 11| tmpc = c->dp; 33| | 34| | /* set carry to zero */ 35| 11| u = 0; 36| 100| for (i = 0; i < min; i++) { ------------------ | Branch (36:19): [True: 89, False: 11] ------------------ 37| | /* T[i] = A[i] - B[i] - U */ 38| 89| *tmpc = (*tmpa++ - *tmpb++) - u; 39| | 40| | /* U = carry bit of T[i] 41| | * Note this saves performing an AND operation since 42| | * if a carry does occur it will propagate all the way to the 43| | * MSB. As a result a single shift is enough to get the carry 44| | */ 45| 89| u = *tmpc >> (MP_SIZEOF_BITS(mp_digit) - 1u); ------------------ | | 167| 89|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ 46| | 47| | /* Clear carry from T[i] */ 48| 89| *tmpc++ &= MP_MASK; ------------------ | | 106| 89|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 89|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 49| 89| } 50| | 51| | /* now copy higher words if any, e.g. if A has more digits than B */ 52| 11| for (; i < max; i++) { ------------------ | Branch (52:14): [True: 0, False: 11] ------------------ 53| | /* T[i] = A[i] - U */ 54| 0| *tmpc = *tmpa++ - u; 55| | 56| | /* U = carry bit of T[i] */ 57| 0| u = *tmpc >> (MP_SIZEOF_BITS(mp_digit) - 1u); ------------------ | | 167| 0|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ 58| | 59| | /* Clear carry from T[i] */ 60| 0| *tmpc++ &= MP_MASK; ------------------ | | 106| 0|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 0|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 61| 0| } 62| | 63| | /* clear digits above used (since we may not have grown result above) */ 64| 11| MP_ZERO_DIGITS(tmpc, olduse - c->used); ------------------ | | 89| 11|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 11|do { \ | | 91| 11| int zd_ = (digits); \ | | 92| 11| mp_digit* zm_ = (mem); \ | | 93| 11| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 11] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 11|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 65| 11| } 66| | 67| 11| mp_clamp(c); 68| 11| return MP_OKAY; ------------------ | | 161| 11|#define MP_OKAY 0 /* no error */ ------------------ 69| 11|} mp_set_ul: 253| 8.93k| { \ 254| 8.93k| int i = 0; \ 255| 17.8k| while (b != 0u) { \ ------------------ | Branch (255:16): [True: 8.93k, False: 8.93k] ------------------ 256| 8.93k| a->dp[i++] = ((mp_digit)b & MP_MASK); \ ------------------ | | 106| 8.93k|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 8.93k|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 257| 8.93k| if (MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) { break; } \ ------------------ | | 167| 8.93k|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ if (MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) { break; } \ ------------------ | | 82| 8.93k|# define MP_DIGIT_BIT 60 ------------------ | Branch (257:17): [Folded - Ignored] ------------------ 258| 8.93k| b >>= ((MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) ? 0 : MP_DIGIT_BIT); \ ------------------ | | 167| 8.93k|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ b >>= ((MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) ? 0 : MP_DIGIT_BIT); \ ------------------ | | 82| 8.93k|# define MP_DIGIT_BIT 60 ------------------ b >>= ((MP_SIZEOF_BITS(type) <= MP_DIGIT_BIT) ? 0 : MP_DIGIT_BIT); \ ------------------ | | 82| 8.93k|# define MP_DIGIT_BIT 60 ------------------ | Branch (258:20): [Folded - Ignored] ------------------ 259| 8.93k| } \ 260| 8.93k| a->used = i; \ 261| 8.93k| a->sign = MP_ZPOS; \ ------------------ | | 151| 8.93k|#define MP_ZPOS 0 /* positive integer */ ------------------ 262| 8.93k| MP_ZERO_DIGITS(a->dp + a->used, a->alloc - a->used); \ ------------------ | | 89| 8.93k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 8.93k|do { \ | | 91| 8.93k| int zd_ = (digits); \ | | 92| 8.93k| mp_digit* zm_ = (mem); \ | | 93| 285k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 276k, False: 8.93k] | | ------------------ | | 94| 276k| *zm_++ = 0; \ | | 95| 276k| } \ | | 96| 8.93k|} while (0) | | ------------------ | | | Branch (96:10): [Folded - Ignored] | | ------------------ ------------------ 263| 8.93k| } m_mp_init: 31| 3.99k|void m_mp_init(mp_int *mp) { 32| | 33| 3.99k| if (mp_init(mp) != MP_OKAY) { ------------------ | | 161| 3.99k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (33:6): [True: 0, False: 3.99k] ------------------ 34| 0| dropbear_exit("Mem alloc error"); 35| 0| } 36| 3.99k|} m_mp_alloc_init_multi: 56| 8.94k|{ 57| 8.94k| mp_int** cur_arg = mp; 58| 8.94k| va_list args; 59| | 60| 8.94k| va_start(args, mp); /* init args to next argument from caller */ 61| 17.8k| while (cur_arg != NULL) { ------------------ | Branch (61:9): [True: 8.95k, False: 8.94k] ------------------ 62| 8.95k| *cur_arg = m_malloc(sizeof(mp_int)); 63| 8.95k| if (mp_init(*cur_arg) != MP_OKAY) { ------------------ | | 161| 8.95k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (63:7): [True: 0, False: 8.95k] ------------------ 64| 0| dropbear_exit("Mem alloc error"); 65| 0| } 66| 8.95k| cur_arg = va_arg(args, mp_int**); 67| 8.95k| } 68| 8.94k| va_end(args); 69| 8.94k|} hash_process_mp: 96| 8.93k| hash_state *hs, const mp_int *mp) { 97| 8.93k| buffer * buf; 98| | 99| 8.93k| buf = buf_new(512 + 20); /* max buffer is a 4096 bit key, 100| | plus header + some leeway*/ 101| 8.93k| buf_putmpint(buf, mp); 102| 8.93k| hash_desc->process(hs, buf->data, buf->len); 103| 8.93k| buf_burn_free(buf); 104| 8.93k|} buf_new: 41| 155k|buffer* buf_new(unsigned int size) { 42| 155k| buffer* buf; 43| 155k| if (size > BUF_MAX_SIZE) { ------------------ | | 35| 155k|#define BUF_MAX_SIZE 1000000000 ------------------ | Branch (43:6): [True: 0, False: 155k] ------------------ 44| 0| dropbear_exit("buf->size too big"); 45| 0| } 46| | 47| 155k| buf = (buffer*)m_malloc(sizeof(buffer)+size); 48| 155k| buf->data = (unsigned char*)buf + sizeof(buffer); 49| 155k| buf->size = size; 50| 155k| return buf; 51| 155k|} buf_free: 54| 116k|void buf_free(buffer* buf) { 55| 116k| m_free(buf); ------------------ | | 24| 116k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 56| 116k|} buf_burn_free: 59| 36.8k|void buf_burn_free(buffer* buf) { 60| 36.8k| m_burn(buf->data, buf->size); 61| 36.8k| m_free(buf); ------------------ | | 24| 36.8k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 62| 36.8k|} buf_resize: 67| 10.1k|buffer* buf_resize(buffer *buf, unsigned int newsize) { 68| 10.1k| if (newsize > BUF_MAX_SIZE) { ------------------ | | 35| 10.1k|#define BUF_MAX_SIZE 1000000000 ------------------ | Branch (68:6): [True: 0, False: 10.1k] ------------------ 69| 0| dropbear_exit("buf->size too big"); 70| 0| } 71| | 72| 10.1k| buf = m_realloc(buf, sizeof(buffer)+newsize); 73| 10.1k| buf->data = (unsigned char*)buf + sizeof(buffer); 74| 10.1k| buf->size = newsize; 75| 10.1k| buf->len = MIN(newsize, buf->len); 76| 10.1k| buf->pos = MIN(newsize, buf->pos); 77| 10.1k| return buf; 78| 10.1k|} buf_newcopy: 82| 12.2k|buffer* buf_newcopy(const buffer* buf) { 83| | 84| 12.2k| buffer* ret; 85| | 86| 12.2k| ret = buf_new(buf->len); 87| 12.2k| ret->len = buf->len; 88| 12.2k| if (buf->len > 0) { ------------------ | Branch (88:6): [True: 12.2k, False: 0] ------------------ 89| 12.2k| memcpy(ret->data, buf->data, buf->len); 90| 12.2k| } 91| 12.2k| return ret; 92| 12.2k|} buf_setlen: 95| 206k|void buf_setlen(buffer* buf, unsigned int len) { 96| 206k| if (len > buf->size) { ------------------ | Branch (96:6): [True: 0, False: 206k] ------------------ 97| 0| dropbear_exit("Bad buf_setlen"); 98| 0| } 99| 206k| buf->len = len; 100| 206k| buf->pos = MIN(buf->pos, buf->len); 101| 206k|} buf_incrlen: 104| 357k|void buf_incrlen(buffer* buf, unsigned int incr) { 105| 357k| if (incr > BUF_MAX_INCR || buf->len + incr > buf->size) { ------------------ | | 34| 715k|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (105:6): [True: 0, False: 357k] | Branch (105:29): [True: 0, False: 357k] ------------------ 106| 0| dropbear_exit("Bad buf_incrlen"); 107| 0| } 108| 357k| buf->len += incr; 109| 357k|} buf_setpos: 111| 812k|void buf_setpos(buffer* buf, unsigned int pos) { 112| | 113| 812k| if (pos > buf->len) { ------------------ | Branch (113:6): [True: 0, False: 812k] ------------------ 114| 0| dropbear_exit("Bad buf_setpos"); 115| 0| } 116| 812k| buf->pos = pos; 117| 812k|} buf_incrwritepos: 120| 1.01M|void buf_incrwritepos(buffer* buf, unsigned int incr) { 121| 1.01M| if (incr > BUF_MAX_INCR || buf->pos + incr > buf->size) { ------------------ | | 34| 2.03M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (121:6): [True: 0, False: 1.01M] | Branch (121:29): [True: 0, False: 1.01M] ------------------ 122| 0| dropbear_exit("Bad buf_incrwritepos"); 123| 0| } 124| 1.01M| buf->pos += incr; 125| 1.01M| if (buf->pos > buf->len) { ------------------ | Branch (125:6): [True: 763k, False: 253k] ------------------ 126| 763k| buf->len = buf->pos; 127| 763k| } 128| 1.01M|} buf_incrpos: 131| 906k|void buf_incrpos(buffer* buf, unsigned int incr) { 132| 906k| if (incr > BUF_MAX_INCR ------------------ | | 34| 1.81M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (132:6): [True: 7, False: 906k] ------------------ 133| 906k| || (buf->pos + incr) > buf->len) { ------------------ | Branch (133:6): [True: 134, False: 906k] ------------------ 134| 141| dropbear_exit("Bad buf_incrpos"); 135| 141| } 136| 906k| buf->pos += incr; 137| 906k|} buf_decrpos: 140| 4|void buf_decrpos(buffer* buf, unsigned int decr) { 141| 4| if (decr > buf->pos) { ------------------ | Branch (141:6): [True: 0, False: 4] ------------------ 142| 0| dropbear_exit("Bad buf_decrpos"); 143| 0| } 144| 4| buf->pos -= decr; 145| 4|} buf_getbyte: 148| 163k|unsigned char buf_getbyte(buffer* buf) { 149| | 150| | /* This check is really just ==, but the >= allows us to check for the 151| | * bad case of pos > len, which should _never_ happen. */ 152| 163k| if (buf->pos >= buf->len) { ------------------ | Branch (152:6): [True: 3, False: 163k] ------------------ 153| 3| dropbear_exit("Bad buf_getbyte"); 154| 3| } 155| 163k| return buf->data[buf->pos++]; 156| 163k|} buf_getbool: 159| 10.5k|unsigned char buf_getbool(buffer* buf) { 160| | 161| 10.5k| unsigned char b; 162| 10.5k| b = buf_getbyte(buf); 163| 10.5k| if (b != 0) ------------------ | Branch (163:6): [True: 1.49k, False: 9.03k] ------------------ 164| 1.49k| b = 1; 165| 10.5k| return b; 166| 10.5k|} buf_putbyte: 169| 335k|void buf_putbyte(buffer* buf, unsigned char val) { 170| | 171| 335k| if (buf->pos >= buf->len) { ------------------ | Branch (171:6): [True: 291k, False: 44.4k] ------------------ 172| 291k| buf_incrlen(buf, 1); 173| 291k| } 174| 335k| buf->data[buf->pos] = val; 175| 335k| buf->pos++; 176| 335k|} buf_getptr: 180| 1.10M|unsigned char* buf_getptr(const buffer* buf, unsigned int len) { 181| | 182| 1.10M| if (len > BUF_MAX_INCR || buf->pos + len > buf->len) { ------------------ | | 34| 2.20M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (182:6): [True: 6, False: 1.10M] | Branch (182:28): [True: 269, False: 1.10M] ------------------ 183| 275| dropbear_exit("Bad buf_getptr"); 184| 275| } 185| 1.10M| return &buf->data[buf->pos]; 186| 1.10M|} buf_getwriteptr: 190| 1.10M|unsigned char* buf_getwriteptr(const buffer* buf, unsigned int len) { 191| | 192| 1.10M| if (len > BUF_MAX_INCR || buf->pos + len > buf->size) { ------------------ | | 34| 2.20M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (192:6): [True: 0, False: 1.10M] | Branch (192:28): [True: 0, False: 1.10M] ------------------ 193| 0| dropbear_exit("Bad buf_getwriteptr"); 194| 0| } 195| 1.10M| return &buf->data[buf->pos]; 196| 1.10M|} buf_getstring: 201| 97.1k|char* buf_getstring(buffer* buf, unsigned int *retlen) { 202| | 203| 97.1k| unsigned int len; 204| 97.1k| char* ret; 205| 97.1k| void* src = NULL; 206| 97.1k| len = buf_getint(buf); 207| 97.1k| if (len > MAX_STRING_LEN) { ------------------ | | 228| 97.1k|#define MAX_STRING_LEN (MAX(MAX_CMD_LEN, 2400)) /* Sun SSH needs 2400 for algos, ------------------ | Branch (207:6): [True: 68, False: 97.0k] ------------------ 208| 68| dropbear_exit("String too long"); 209| 68| } 210| | 211| 97.0k| if (retlen != NULL) { ------------------ | Branch (211:6): [True: 96.9k, False: 70] ------------------ 212| 96.9k| *retlen = len; 213| 96.9k| } 214| 97.0k| src = buf_getptr(buf, len); 215| 97.0k| ret = m_malloc(len+1); 216| 97.0k| memcpy(ret, src, len); 217| 97.0k| buf_incrpos(buf, len); 218| 97.0k| ret[len] = '\0'; 219| | 220| 97.0k| return ret; 221| 97.1k|} buf_getstringbuf: 246| 5.19k|buffer * buf_getstringbuf(buffer *buf) { 247| 5.19k| return buf_getstringbuf_int(buf, 0); 248| 5.19k|} buf_eatstring: 257| 18.7k|void buf_eatstring(buffer *buf) { 258| | 259| 18.7k| buf_incrpos( buf, buf_getint(buf) ); 260| 18.7k|} buf_getint: 263| 189k|unsigned int buf_getint(buffer* buf) { 264| 189k| unsigned int ret; 265| | 266| 189k| LOAD32H(ret, buf_getptr(buf, 4)); ------------------ | | 66| 189k|#define LOAD32H(x, y) \ | | 67| 189k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 189k|#define XMEMCPY memcpy | | ------------------ | | 68| 189k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded - Ignored] | | ------------------ ------------------ 267| 189k| buf_incrpos(buf, 4); 268| 189k| return ret; 269| 189k|} buf_putint: 272| 316k|void buf_putint(buffer* buf, int unsigned val) { 273| | 274| 316k| STORE32H(val, buf_getwriteptr(buf, 4)); ------------------ | | 62| 316k|#define STORE32H(x, y) \ | | 63| 316k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 316k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 316k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 275| 316k| buf_incrwritepos(buf, 4); 276| | 277| 316k|} buf_putstring: 280| 60.7k|void buf_putstring(buffer* buf, const char* str, unsigned int len) { 281| | 282| 60.7k| buf_putint(buf, len); 283| 60.7k| buf_putbytes(buf, (const unsigned char*)str, len); 284| | 285| 60.7k|} buf_putbufstring: 288| 1.96k|void buf_putbufstring(buffer *buf, const buffer* buf_str) { 289| 1.96k| buf_putstring(buf, (const char*)buf_str->data, buf_str->len); 290| 1.96k|} buf_putbytes: 294| 402k|void buf_putbytes(buffer *buf, const unsigned char *bytes, unsigned int len) { 295| 402k| memcpy(buf_getwriteptr(buf, len), bytes, len); 296| 402k| buf_incrwritepos(buf, len); 297| 402k|} buf_putmpint: 302| 8.93k|void buf_putmpint(buffer* buf, const mp_int * mp) { 303| 8.93k| size_t written; 304| 8.93k| unsigned int len, pad = 0; 305| 8.93k| TRACE2(("enter buf_putmpint")) 306| | 307| 8.93k| dropbear_assert(mp != NULL); ------------------ | | 83| 8.93k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 8.93k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 308| | 309| 8.93k| if (mp_isneg(mp)) { ------------------ | | 295| 8.93k|#define mp_isneg(a) (((a)->sign != MP_ZPOS) ? MP_YES : MP_NO) | | ------------------ | | | | 151| 8.93k|#define MP_ZPOS 0 /* positive integer */ | | ------------------ | | #define mp_isneg(a) (((a)->sign != MP_ZPOS) ? MP_YES : MP_NO) | | ------------------ | | | | 158| 0|#define MP_YES 1 | | ------------------ | | #define mp_isneg(a) (((a)->sign != MP_ZPOS) ? MP_YES : MP_NO) | | ------------------ | | | | 159| 8.93k|#define MP_NO 0 | | ------------------ | | | Branch (295:22): [True: 0, False: 8.93k] | | | Branch (295:23): [True: 0, False: 8.93k] | | ------------------ ------------------ 310| 0| dropbear_exit("negative bignum"); 311| 0| } 312| | 313| | /* zero check */ 314| 8.93k| if (mp_iszero(mp)) { ------------------ | | 292| 8.93k|#define mp_iszero(a) (((a)->used == 0) ? MP_YES : MP_NO) | | ------------------ | | | | 158| 0|#define MP_YES 1 | | ------------------ | | #define mp_iszero(a) (((a)->used == 0) ? MP_YES : MP_NO) | | ------------------ | | | | 159| 8.93k|#define MP_NO 0 | | ------------------ | | | Branch (292:22): [True: 0, False: 8.93k] | | | Branch (292:23): [True: 0, False: 8.93k] | | ------------------ ------------------ 315| 0| len = 0; 316| 8.93k| } else { 317| | /* SSH spec requires padding for mpints with the MSB set, this code 318| | * implements it */ 319| 8.93k| len = mp_count_bits(mp); 320| | /* if the top bit of MSB is set, we need to pad */ 321| 8.93k| pad = (len%8 == 0) ? 1 : 0; ------------------ | Branch (321:9): [True: 8.93k, False: 0] ------------------ 322| 8.93k| len = len / 8 + 1; /* don't worry about rounding, we need it for 323| | padding anyway when len%8 == 0 */ 324| | 325| 8.93k| } 326| | 327| | /* store the length */ 328| 8.93k| buf_putint(buf, len); 329| | 330| | /* store the actual value */ 331| 8.93k| if (len > 0) { ------------------ | Branch (331:6): [True: 8.93k, False: 0] ------------------ 332| 8.93k| if (pad) { ------------------ | Branch (332:7): [True: 8.93k, False: 0] ------------------ 333| 8.93k| buf_putbyte(buf, 0x00); 334| 8.93k| } 335| 8.93k| if (mp_to_ubin(mp, buf_getwriteptr(buf, len-pad), len-pad, &written) != MP_OKAY) { ------------------ | | 161| 8.93k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (335:7): [True: 0, False: 8.93k] ------------------ 336| 0| dropbear_exit("mpint error"); 337| 0| } 338| 8.93k| buf_incrwritepos(buf, written); 339| 8.93k| } 340| | 341| 8.93k| TRACE2(("leave buf_putmpint")) 342| 8.93k|} buf_getmpint: 347| 4.00k|int buf_getmpint(buffer* buf, mp_int* mp) { 348| | 349| 4.00k| unsigned int len; 350| 4.00k| len = buf_getint(buf); 351| | 352| 4.00k| if (len == 0) { ------------------ | Branch (352:6): [True: 616, False: 3.39k] ------------------ 353| 616| mp_zero(mp); 354| 616| return DROPBEAR_SUCCESS; ------------------ | | 102| 616|#define DROPBEAR_SUCCESS 0 ------------------ 355| 616| } 356| | 357| 3.39k| if (len > BUF_MAX_MPINT) { ------------------ | | 38| 3.39k|#define BUF_MAX_MPINT (8240 / 8) ------------------ | Branch (357:6): [True: 53, False: 3.33k] ------------------ 358| 53| return DROPBEAR_FAILURE; ------------------ | | 103| 53|#define DROPBEAR_FAILURE -1 ------------------ 359| 53| } 360| | 361| | /* check for negative */ 362| 3.33k| if (*buf_getptr(buf, 1) & (1 << (CHAR_BIT-1))) { ------------------ | Branch (362:6): [True: 11, False: 3.32k] ------------------ 363| 11| return DROPBEAR_FAILURE; ------------------ | | 103| 11|#define DROPBEAR_FAILURE -1 ------------------ 364| 11| } 365| | 366| 3.32k| if (mp_from_ubin(mp, buf_getptr(buf, len), len) != MP_OKAY) { ------------------ | | 161| 3.32k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (366:6): [True: 0, False: 3.32k] ------------------ 367| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 368| 0| } 369| | 370| 3.32k| buf_incrpos(buf, len); 371| 3.32k| return DROPBEAR_SUCCESS; ------------------ | | 102| 3.32k|#define DROPBEAR_SUCCESS 0 ------------------ 372| 3.32k|} buffer.c:buf_getstringbuf_int: 224| 5.19k|static buffer * buf_getstringbuf_int(buffer *buf, int incllen) { 225| 5.19k| buffer *ret = NULL; 226| 5.19k| unsigned int len = buf_getint(buf); 227| 5.19k| int extra = 0; 228| 5.19k| if (len > MAX_STRING_LEN) { ------------------ | | 228| 5.19k|#define MAX_STRING_LEN (MAX(MAX_CMD_LEN, 2400)) /* Sun SSH needs 2400 for algos, ------------------ | Branch (228:6): [True: 34, False: 5.15k] ------------------ 229| 34| dropbear_exit("String too long"); 230| 34| } 231| 5.15k| if (incllen) { ------------------ | Branch (231:6): [True: 0, False: 5.15k] ------------------ 232| 0| extra = 4; 233| 0| } 234| 5.15k| ret = buf_new(len+extra); 235| 5.15k| if (incllen) { ------------------ | Branch (235:6): [True: 0, False: 5.15k] ------------------ 236| 0| buf_putint(ret, len); 237| 0| } 238| 5.15k| memcpy(buf_getwriteptr(ret, len), buf_getptr(buf, len), len); 239| 5.15k| buf_incrpos(buf, len); 240| 5.15k| buf_incrlen(ret, len); 241| 5.15k| buf_setpos(ret, 0); 242| 5.15k| return ret; 243| 5.19k|} chachapoly.c:dropbear_chachapoly_start: 48| 7.64k| int UNUSED(num_rounds), dropbear_chachapoly_state *state) { 49| 7.64k| int err; 50| | 51| 7.64k| TRACE2(("enter dropbear_chachapoly_start")) 52| | 53| 7.64k| if (keylen != CHACHA20_KEY_LEN*2) { ------------------ | | 33| 7.64k|#define CHACHA20_KEY_LEN 32 ------------------ | Branch (53:6): [True: 0, False: 7.64k] ------------------ 54| 0| return CRYPT_ERROR; 55| 0| } 56| | 57| 7.64k| if ((err = chacha_setup(&state->chacha, key, ------------------ | Branch (57:6): [True: 0, False: 7.64k] ------------------ 58| 7.64k| CHACHA20_KEY_LEN, 20)) != CRYPT_OK) { ------------------ | | 33| 7.64k|#define CHACHA20_KEY_LEN 32 ------------------ 59| 0| return err; 60| 0| } 61| | 62| 7.64k| if ((err = chacha_setup(&state->header, key + CHACHA20_KEY_LEN, ------------------ | | 33| 7.64k|#define CHACHA20_KEY_LEN 32 ------------------ | Branch (62:6): [True: 0, False: 7.64k] ------------------ 63| 7.64k| CHACHA20_KEY_LEN, 20) != CRYPT_OK)) { ------------------ | | 33| 7.64k|#define CHACHA20_KEY_LEN 32 ------------------ 64| 0| return err; 65| 0| } 66| | 67| 7.64k| TRACE2(("leave dropbear_chachapoly_start")) 68| 7.64k| return CRYPT_OK; 69| 7.64k|} chachapoly.c:dropbear_chachapoly_crypt: 74| 17.2k| dropbear_chachapoly_state *state, int direction) { 75| 17.2k| poly1305_state poly; 76| 17.2k| unsigned char seqbuf[8], key[POLY1305_KEY_LEN], tag[POLY1305_TAG_LEN]; 77| 17.2k| int err; 78| | 79| 17.2k| TRACE2(("enter dropbear_chachapoly_crypt")) 80| | 81| 17.2k| if (len < 4 || taglen != POLY1305_TAG_LEN) { ------------------ | | 36| 17.2k|#define POLY1305_TAG_LEN 16 ------------------ | Branch (81:6): [True: 0, False: 17.2k] | Branch (81:17): [True: 0, False: 17.2k] ------------------ 82| 0| return CRYPT_ERROR; 83| 0| } 84| | 85| 17.2k| STORE64H((uint64_t)seq, seqbuf); ------------------ | | 101| 17.2k|#define STORE64H(x, y) \ | | 102| 17.2k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 17.2k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 17.2k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded - Ignored] | | ------------------ ------------------ 86| 17.2k| chacha_ivctr64(&state->chacha, seqbuf, sizeof(seqbuf), 0); 87| 17.2k| if ((err = chacha_keystream(&state->chacha, key, sizeof(key))) != CRYPT_OK) { ------------------ | Branch (87:6): [True: 0, False: 17.2k] ------------------ 88| 0| return err; 89| 0| } 90| | 91| 17.2k| poly1305_init(&poly, key, sizeof(key)); 92| 17.2k| if (direction == LTC_DECRYPT) { ------------------ | | 70| 17.2k|#define LTC_DECRYPT 1 ------------------ | Branch (92:6): [True: 0, False: 17.2k] ------------------ 93| 0| poly1305_process(&poly, in, len); 94| 0| poly1305_done(&poly, tag, &taglen); 95| 0| if (constant_time_memcmp(in + len, tag, taglen) != 0) { ------------------ | Branch (95:7): [True: 0, False: 0] ------------------ 96| 0| return CRYPT_ERROR; 97| 0| } 98| 0| } 99| | 100| 17.2k| chacha_ivctr64(&state->header, seqbuf, sizeof(seqbuf), 0); 101| 17.2k| if ((err = chacha_crypt(&state->header, in, 4, out)) != CRYPT_OK) { ------------------ | Branch (101:6): [True: 0, False: 17.2k] ------------------ 102| 0| return err; 103| 0| } 104| | 105| 17.2k| chacha_ivctr64(&state->chacha, seqbuf, sizeof(seqbuf), 1); 106| 17.2k| if ((err = chacha_crypt(&state->chacha, in + 4, len - 4, out + 4)) != CRYPT_OK) { ------------------ | Branch (106:6): [True: 0, False: 17.2k] ------------------ 107| 0| return err; 108| 0| } 109| | 110| 17.2k| if (direction == LTC_ENCRYPT) { ------------------ | | 68| 17.2k|#define LTC_ENCRYPT 0 ------------------ | Branch (110:6): [True: 17.2k, False: 0] ------------------ 111| 17.2k| poly1305_process(&poly, out, len); 112| 17.2k| poly1305_done(&poly, out + len, &taglen); 113| 17.2k| } 114| | 115| 17.2k| TRACE2(("leave dropbear_chachapoly_crypt")) 116| 17.2k| return CRYPT_OK; 117| 17.2k|} buf_put_algolist_all: 315| 84.4k|void buf_put_algolist_all(buffer * buf, const algo_type localalgos[], int useall) { 316| 84.4k| unsigned int i, len; 317| 84.4k| unsigned int donefirst = 0; 318| 84.4k| unsigned int startpos; 319| | 320| 84.4k| startpos = buf->pos; 321| | /* Placeholder for length */ 322| 84.4k| buf_putint(buf, 0); 323| 402k| for (i = 0; localalgos[i].name != NULL; i++) { ------------------ | Branch (323:14): [True: 318k, False: 84.4k] ------------------ 324| 318k| if (localalgos[i].usable || useall) { ------------------ | Branch (324:7): [True: 307k, False: 10.5k] | Branch (324:31): [True: 0, False: 10.5k] ------------------ 325| 307k| if (donefirst) { ------------------ | Branch (325:8): [True: 223k, False: 84.4k] ------------------ 326| 223k| buf_putbyte(buf, ','); 327| 223k| } 328| 307k| donefirst = 1; 329| 307k| len = strlen(localalgos[i].name); 330| 307k| buf_putbytes(buf, (const unsigned char *) localalgos[i].name, len); 331| 307k| } 332| 318k| } 333| | /* Fill out the length */ 334| 84.4k| len = buf->pos - startpos - 4; 335| 84.4k| buf_setpos(buf, startpos); 336| 84.4k| buf_putint(buf, len); 337| 84.4k| TRACE(("algolist add %d '%.*s'", len, len, buf_getptr(buf, len))) 338| 84.4k| buf_incrwritepos(buf, len); 339| 84.4k|} buf_put_algolist: 341| 84.2k|void buf_put_algolist(buffer * buf, const algo_type localalgos[]) { 342| 84.2k| buf_put_algolist_all(buf, localalgos, 0); 343| 84.2k|} buf_has_algo: 387| 12.2k|int buf_has_algo(buffer *buf, const char *algo) { 388| 12.2k| unsigned char* algolist = NULL; 389| 12.2k| unsigned int orig_pos = buf->pos; 390| 12.2k| unsigned int len, remotecount, i; 391| 12.2k| const char *remotenames[MAX_PROPOSED_ALGO]; 392| 12.2k| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 12.2k|#define DROPBEAR_FAILURE -1 ------------------ 393| | 394| 12.2k| algolist = buf_getstring(buf, &len); 395| 12.2k| remotecount = MAX_PROPOSED_ALGO; ------------------ | | 209| 12.2k|#define MAX_PROPOSED_ALGO 50 ------------------ 396| 12.2k| get_algolist(algolist, len, remotenames, &remotecount); 397| 82.9k| for (i = 0; i < remotecount; i++) ------------------ | Branch (397:14): [True: 71.1k, False: 11.8k] ------------------ 398| 71.1k| { 399| 71.1k| if (strcmp(remotenames[i], algo) == 0) { ------------------ | Branch (399:7): [True: 486, False: 70.6k] ------------------ 400| 486| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 486|#define DROPBEAR_SUCCESS 0 ------------------ 401| 486| break; 402| 486| } 403| 71.1k| } 404| 12.2k| if (algolist) { ------------------ | Branch (404:6): [True: 12.2k, False: 71] ------------------ 405| 12.2k| m_free(algolist); ------------------ | | 24| 12.2k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 406| 12.2k| } 407| 12.2k| buf_setpos(buf, orig_pos); 408| 12.2k| return ret; 409| 12.2k|} buf_match_algo: 427| 76.1k| int kexguess2, int *goodguess) { 428| 76.1k| char * algolist = NULL; 429| 76.1k| const char *remotenames[MAX_PROPOSED_ALGO], *localnames[MAX_PROPOSED_ALGO]; 430| 76.1k| unsigned int len; 431| 76.1k| unsigned int remotecount, localcount, clicount, servcount, i, j; 432| 76.1k| algo_type * ret = NULL; 433| 76.1k| const char **clinames, **servnames; 434| | 435| 76.1k| if (goodguess) { ------------------ | Branch (435:6): [True: 19.3k, False: 56.8k] ------------------ 436| 19.3k| *goodguess = 0; 437| 19.3k| } 438| | 439| | /* get the comma-separated list from the buffer ie "algo1,algo2,algo3" */ 440| 76.1k| algolist = buf_getstring(buf, &len); 441| 76.1k| DEBUG3(("buf_match_algo: %s", algolist)) 442| 76.1k| remotecount = MAX_PROPOSED_ALGO; ------------------ | | 209| 76.1k|#define MAX_PROPOSED_ALGO 50 ------------------ 443| 76.1k| get_algolist(algolist, len, remotenames, &remotecount); 444| | 445| 363k| for (i = 0; localalgos[i].name != NULL; i++) { ------------------ | Branch (445:14): [True: 287k, False: 76.1k] ------------------ 446| 287k| if (localalgos[i].usable) { ------------------ | Branch (446:7): [True: 277k, False: 9.77k] ------------------ 447| 277k| localnames[i] = localalgos[i].name; 448| 277k| } else { 449| 9.77k| localnames[i] = NULL; 450| 9.77k| } 451| 287k| } 452| 76.1k| localcount = i; 453| | 454| 76.1k| if (IS_DROPBEAR_SERVER) { ------------------ | | 319| 76.1k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 76.0k, False: 96] | | ------------------ ------------------ 455| 76.0k| clinames = remotenames; 456| 76.0k| clicount = remotecount; 457| 76.0k| servnames = localnames; 458| 76.0k| servcount = localcount; 459| 76.0k| } else { 460| 96| clinames = localnames; 461| 96| clicount = localcount; 462| 96| servnames = remotenames; 463| 96| servcount = remotecount; 464| 96| } 465| | 466| | /* iterate and find the first match */ 467| 134k| for (i = 0; i < clicount; i++) { ------------------ | Branch (467:14): [True: 117k, False: 16.6k] ------------------ 468| 557k| for (j = 0; j < servcount; j++) { ------------------ | Branch (468:15): [True: 499k, False: 58.1k] ------------------ 469| 499k| if (!(servnames[j] && clinames[i])) { ------------------ | Branch (469:10): [True: 463k, False: 36.3k] | Branch (469:26): [True: 463k, False: 0] ------------------ 470| | /* unusable algos are NULL */ 471| 36.3k| continue; 472| 36.3k| } 473| 463k| if (strcmp(servnames[j], clinames[i]) == 0) { ------------------ | Branch (473:8): [True: 59.5k, False: 403k] ------------------ 474| | /* set if it was a good guess */ 475| 59.5k| if (goodguess != NULL) { ------------------ | Branch (475:9): [True: 19.1k, False: 40.4k] ------------------ 476| 19.1k| if (kexguess2) { ------------------ | Branch (476:10): [True: 365, False: 18.7k] ------------------ 477| 365| if (i == 0) { ------------------ | Branch (477:11): [True: 281, False: 84] ------------------ 478| 281| *goodguess = 1; 479| 281| } 480| 18.7k| } else { 481| 18.7k| if (i == 0 && j == 0) { ------------------ | Branch (481:11): [True: 8.97k, False: 9.77k] | Branch (481:21): [True: 110, False: 8.86k] ------------------ 482| 110| *goodguess = 1; 483| 110| } 484| 18.7k| } 485| 19.1k| } 486| | /* set the algo to return */ 487| 59.5k| if (IS_DROPBEAR_SERVER) { ------------------ | | 319| 59.5k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 59.5k, False: 0] | | ------------------ ------------------ 488| 59.5k| ret = &localalgos[j]; 489| 59.5k| } else { 490| 0| ret = &localalgos[i]; 491| 0| } 492| 59.5k| goto out; 493| 59.5k| } 494| 463k| } 495| 117k| } 496| | 497| 76.0k|out: 498| 76.0k| m_free(algolist); ------------------ | | 24| 76.0k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 499| 76.0k| return ret; 500| 76.1k|} common-algo.c:void_start: 50| 8.93k| int UNUSED(keylen), int UNUSED(num_rounds), void* UNUSED(cipher_state)) { 51| 8.93k| return CRYPT_OK; 52| 8.93k|} common-algo.c:void_cipher: 41| 127k| unsigned long len, void* UNUSED(cipher_state)) { 42| 127k| if (in != out) { ------------------ | Branch (42:6): [True: 0, False: 127k] ------------------ 43| 0| memmove(out, in, len); 44| 0| } 45| 127k| return CRYPT_OK; 46| 127k|} common-algo.c:dropbear_big_endian_ctr_start: 91| 1.28k| int num_rounds, symmetric_CTR *ctr) { 92| 1.28k| return ctr_start(cipher, IV, key, keylen, num_rounds, CTR_COUNTER_BIG_ENDIAN, ctr); ------------------ | | 860| 1.28k|#define CTR_COUNTER_BIG_ENDIAN 0x1000 ------------------ 93| 1.28k|} common-algo.c:get_algolist: 350| 88.3k| const char* *ret_list, unsigned int *ret_count) { 351| 88.3k| unsigned int max_count = *ret_count; 352| 88.3k| unsigned int i; 353| | 354| 88.3k| if (*ret_count == 0) { ------------------ | Branch (354:6): [True: 0, False: 88.3k] ------------------ 355| 0| return; 356| 0| } 357| 88.3k| if (algolist_len > MAX_PROPOSED_ALGO*(MAX_NAME_LEN+1)) { ------------------ | | 209| 88.3k|#define MAX_PROPOSED_ALGO 50 ------------------ if (algolist_len > MAX_PROPOSED_ALGO*(MAX_NAME_LEN+1)) { ------------------ | | 205| 88.3k|#define MAX_NAME_LEN 64 /* maximum length of a protocol name, isn't ------------------ | Branch (357:6): [True: 12, False: 88.2k] ------------------ 358| 12| *ret_count = 0; 359| 12| } 360| | 361| | /* ret_list will contain a list of the strings parsed out. 362| | We will have at least one string (even if it's just "") */ 363| 88.3k| ret_list[0] = algolist; 364| 88.3k| *ret_count = 1; 365| 2.44M| for (i = 0; i < algolist_len; i++) { ------------------ | Branch (365:14): [True: 2.36M, False: 88.1k] ------------------ 366| 2.36M| if (algolist[i] == '\0') { ------------------ | Branch (366:7): [True: 179, False: 2.36M] ------------------ 367| | /* someone is trying something strange */ 368| 179| *ret_count = 0; 369| 179| return; 370| 179| } 371| | 372| 2.36M| if (algolist[i] == ',') { ------------------ | Branch (372:7): [True: 140k, False: 2.22M] ------------------ 373| 140k| if (*ret_count >= max_count) { ------------------ | Branch (373:8): [True: 6, False: 140k] ------------------ 374| 6| dropbear_exit("Too many remote algorithms"); 375| 0| *ret_count = 0; 376| 0| return; 377| 6| } 378| 140k| algolist[i] = '\0'; 379| 140k| ret_list[*ret_count] = &algolist[i+1]; 380| 140k| (*ret_count)++; 381| 140k| } 382| 2.36M| } 383| 88.3k|} chaninitialise: 70| 3.14k|void chaninitialise(const struct ChanType *chantypes[]) { 71| | 72| | /* may as well create space for a single channel */ 73| 3.14k| ses.channels = (struct Channel**)m_malloc(sizeof(struct Channel*)); 74| 3.14k| ses.chansize = 1; 75| 3.14k| ses.channels[0] = NULL; 76| 3.14k| ses.chancount = 0; 77| | 78| 3.14k| ses.chantypes = chantypes; 79| | 80| 3.14k|#if DROPBEAR_LISTENERS 81| 3.14k| listeners_initialise(); 82| 3.14k|#endif 83| | 84| 3.14k|} chancleanup: 87| 3.14k|void chancleanup() { 88| | 89| 3.14k| unsigned int i; 90| | 91| 3.14k| TRACE(("enter chancleanup")) 92| 6.29k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (92:14): [True: 3.14k, False: 3.14k] ------------------ 93| 3.14k| if (ses.channels[i] != NULL) { ------------------ | Branch (93:7): [True: 0, False: 3.14k] ------------------ 94| 0| TRACE(("channel %d closing", i)) 95| 0| remove_channel(ses.channels[i]); 96| 0| } 97| 3.14k| } 98| 3.14k| m_free(ses.channels); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 99| 3.14k| TRACE(("leave chancleanup")) 100| 3.14k|} channelio: 199| 269k|void channelio(const fd_set *readfds, const fd_set *writefds) { 200| | 201| | /* Listeners such as TCP, X11, agent-auth */ 202| 269k| struct Channel *channel; 203| 269k| unsigned int i; 204| | 205| | /* foreach channel */ 206| 539k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (206:14): [True: 269k, False: 269k] ------------------ 207| | /* Close checking only needs to occur for channels that had IO events */ 208| 269k| int do_check_close = 0; 209| | 210| 269k| channel = ses.channels[i]; 211| 269k| if (channel == NULL) { ------------------ | Branch (211:7): [True: 269k, False: 0] ------------------ 212| | /* only process in-use channels */ 213| 269k| continue; 214| 269k| } 215| | 216| | /* read data and send it over the wire */ 217| 0| if (channel->readfd >= 0 && FD_ISSET(channel->readfd, readfds)) { ------------------ | Branch (217:7): [True: 0, False: 0] ------------------ 218| 0| TRACE(("send normal readfd")) 219| 0| send_msg_channel_data(channel, 0); 220| 0| do_check_close = 1; 221| 0| } 222| | 223| | /* read stderr data and send it over the wire */ 224| 0| if (ERRFD_IS_READ(channel) && channel->errfd >= 0 ------------------ | | 59| 0|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (59:32): [True: 0, False: 0] | | ------------------ ------------------ | Branch (224:33): [True: 0, False: 0] ------------------ 225| 0| && FD_ISSET(channel->errfd, readfds)) { 226| 0| TRACE(("send normal errfd")) 227| 0| send_msg_channel_data(channel, 1); 228| 0| do_check_close = 1; 229| 0| } 230| | 231| | /* write to program/pipe stdin */ 232| 0| if (channel->writefd >= 0 && FD_ISSET(channel->writefd, writefds)) { ------------------ | Branch (232:7): [True: 0, False: 0] ------------------ 233| 0| writechannel(channel, channel->writefd, channel->writebuf, NULL, NULL); 234| 0| do_check_close = 1; 235| 0| } 236| | 237| | /* stderr for client mode */ 238| 0| if (ERRFD_IS_WRITE(channel) ------------------ | | 60| 0|#define ERRFD_IS_WRITE(channel) (!ERRFD_IS_READ(channel)) | | ------------------ | | | | 59| 0|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (60:33): [True: 0, False: 0] | | ------------------ ------------------ 239| 0| && channel->errfd >= 0 && FD_ISSET(channel->errfd, writefds)) { ------------------ | Branch (239:8): [True: 0, False: 0] ------------------ 240| 0| writechannel(channel, channel->errfd, channel->extrabuf, NULL, NULL); 241| 0| do_check_close = 1; 242| 0| } 243| | 244| 0| if (ses.channel_signal_pending) { ------------------ | Branch (244:7): [True: 0, False: 0] ------------------ 245| | /* SIGCHLD can change channel state for server sessions */ 246| 0| do_check_close = 1; 247| 0| } 248| | 249| | /* handle any channel closing etc */ 250| 0| if (do_check_close) { ------------------ | Branch (250:7): [True: 0, False: 0] ------------------ 251| 0| check_close(channel); 252| 0| } 253| 0| } 254| | 255| 269k|#if DROPBEAR_LISTENERS 256| 269k| handle_listeners(readfds); 257| 269k|#endif 258| 269k|} setchannelfds: 541| 272k|void setchannelfds(fd_set *readfds, fd_set *writefds, int allow_reads) { 542| | 543| 272k| unsigned int i; 544| 272k| struct Channel * channel; 545| | 546| 545k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (546:14): [True: 272k, False: 272k] ------------------ 547| | 548| 272k| channel = ses.channels[i]; 549| 272k| if (channel == NULL) { ------------------ | Branch (549:7): [True: 272k, False: 0] ------------------ 550| 272k| continue; 551| 272k| } 552| | 553| | /* Stuff to put over the wire. 554| | Avoid queueing data to send if we're in the middle of a 555| | key re-exchange (!dataallowed), but still read from the 556| | FD if there's the possibility of "~."" to kill an 557| | interactive session (the read_mangler) */ 558| 0| if (channel->transwindow > 0 ------------------ | Branch (558:7): [True: 0, False: 0] ------------------ 559| 0| && ((ses.dataallowed && allow_reads) || channel->read_mangler)) { ------------------ | Branch (559:11): [True: 0, False: 0] | Branch (559:30): [True: 0, False: 0] | Branch (559:46): [True: 0, False: 0] ------------------ 560| | 561| 0| if (channel->readfd >= 0) { ------------------ | Branch (561:8): [True: 0, False: 0] ------------------ 562| 0| FD_SET(channel->readfd, readfds); 563| 0| } 564| | 565| 0| if (ERRFD_IS_READ(channel) && channel->errfd >= 0) { ------------------ | | 59| 0|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (59:32): [True: 0, False: 0] | | ------------------ ------------------ | Branch (565:34): [True: 0, False: 0] ------------------ 566| 0| FD_SET(channel->errfd, readfds); 567| 0| } 568| 0| } 569| | 570| | /* Stuff from the wire */ 571| 0| if (channel->writefd >= 0 && cbuf_getused(channel->writebuf) > 0) { ------------------ | Branch (571:7): [True: 0, False: 0] | Branch (571:32): [True: 0, False: 0] ------------------ 572| 0| FD_SET(channel->writefd, writefds); 573| 0| } 574| | 575| 0| if (ERRFD_IS_WRITE(channel) && channel->errfd >= 0 ------------------ | | 60| 0|#define ERRFD_IS_WRITE(channel) (!ERRFD_IS_READ(channel)) | | ------------------ | | | | 59| 0|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (60:33): [True: 0, False: 0] | | ------------------ ------------------ | Branch (575:34): [True: 0, False: 0] ------------------ 576| 0| && cbuf_getused(channel->extrabuf) > 0) { ------------------ | Branch (576:8): [True: 0, False: 0] ------------------ 577| 0| FD_SET(channel->errfd, writefds); 578| 0| } 579| | 580| 0| } /* foreach channel */ 581| | 582| 272k|#if DROPBEAR_LISTENERS 583| 272k| set_listener_fds(readfds); 584| 272k|#endif 585| | 586| 272k|} send_msg_kexinit: 55| 10.5k|void send_msg_kexinit() { 56| | 57| 10.5k| CHECKCLEARTOWRITE(); 58| 10.5k| buf_putbyte(ses.writepayload, SSH_MSG_KEXINIT); ------------------ | | 36| 10.5k|#define SSH_MSG_KEXINIT 20 ------------------ 59| | 60| | /* cookie */ 61| 10.5k| genrandom(buf_getwriteptr(ses.writepayload, 16), 16); 62| 10.5k| buf_incrwritepos(ses.writepayload, 16); 63| | 64| | /* kex algos */ 65| 10.5k| buf_put_algolist(ses.writepayload, sshkex); 66| | 67| | /* server_host_key_algorithms */ 68| 10.5k| buf_put_algolist(ses.writepayload, sigalgs); 69| | 70| | /* encryption_algorithms_client_to_server */ 71| 10.5k| buf_put_algolist(ses.writepayload, sshciphers); 72| | 73| | /* encryption_algorithms_server_to_client */ 74| 10.5k| buf_put_algolist(ses.writepayload, sshciphers); 75| | 76| | /* mac_algorithms_client_to_server */ 77| 10.5k| buf_put_algolist(ses.writepayload, sshhashes); 78| | 79| | /* mac_algorithms_server_to_client */ 80| 10.5k| buf_put_algolist(ses.writepayload, sshhashes); 81| | 82| | 83| | /* compression_algorithms_client_to_server */ 84| 10.5k| buf_put_algolist(ses.writepayload, ses.compress_algos); 85| | 86| | /* compression_algorithms_server_to_client */ 87| 10.5k| buf_put_algolist(ses.writepayload, ses.compress_algos); 88| | 89| | /* languages_client_to_server */ 90| 10.5k| buf_putstring(ses.writepayload, "", 0); 91| | 92| | /* languages_server_to_client */ 93| 10.5k| buf_putstring(ses.writepayload, "", 0); 94| | 95| | /* first_kex_packet_follows */ 96| 10.5k| buf_putbyte(ses.writepayload, (ses.send_kex_first_guess != NULL)); 97| | 98| | /* reserved unit32 */ 99| 10.5k| buf_putint(ses.writepayload, 0); 100| | 101| | /* set up transmitted kex packet buffer for hashing. 102| | * This is freed after the end of the kex */ 103| 10.5k| ses.transkexinit = buf_newcopy(ses.writepayload); 104| | 105| 10.5k| encrypt_packet(); 106| 10.5k| ses.dataallowed = 0; /* don't send other packets during kex */ 107| | 108| 10.5k| ses.kexstate.sentkexinit = 1; 109| | 110| 10.5k| ses.newkeys = (struct key_context*)m_malloc(sizeof(struct key_context)); 111| | 112| 10.5k| if (ses.send_kex_first_guess) { ------------------ | Branch (112:6): [True: 0, False: 10.5k] ------------------ 113| 0| ses.newkeys->algo_kex = first_usable_algo(sshkex)->data; 114| 0| ses.newkeys->algo_signature = first_usable_algo(sigalgs)->val; 115| 0| ses.newkeys->algo_hostkey = signkey_type_from_signature(ses.newkeys->algo_signature); 116| 0| ses.send_kex_first_guess(); 117| 0| } 118| | 119| 10.5k| TRACE(("DATAALLOWED=0")) 120| 10.5k| TRACE(("-> KEXINIT")) 121| | 122| 10.5k|} send_msg_newkeys: 166| 8.93k|void send_msg_newkeys() { 167| | 168| 8.93k| TRACE(("enter send_msg_newkeys")) 169| | 170| | /* generate the kexinit request */ 171| 8.93k| CHECKCLEARTOWRITE(); 172| 8.93k| buf_putbyte(ses.writepayload, SSH_MSG_NEWKEYS); ------------------ | | 37| 8.93k|#define SSH_MSG_NEWKEYS 21 ------------------ 173| 8.93k| encrypt_packet(); 174| | 175| | 176| | /* set up our state */ 177| 8.93k| ses.kexstate.sentnewkeys = 1; 178| 8.93k| if (ses.kexstate.donefirstkex) { ------------------ | Branch (178:6): [True: 7.16k, False: 1.77k] ------------------ 179| 7.16k| ses.kexstate.donesecondkex = 1; 180| 7.16k| } 181| 8.93k| ses.kexstate.donefirstkex = 1; 182| 8.93k| ses.dataallowed = 1; /* we can send other packets again now */ 183| 8.93k| gen_new_keys(); 184| 8.93k| switch_keys(); 185| | 186| 8.93k| TRACE(("leave send_msg_newkeys")) 187| 8.93k|} recv_msg_newkeys: 190| 8.49k|void recv_msg_newkeys() { 191| | 192| 8.49k| TRACE(("enter recv_msg_newkeys")) 193| | 194| 8.49k| ses.kexstate.recvnewkeys = 1; 195| 8.49k| switch_keys(); 196| | 197| 8.49k| TRACE(("leave recv_msg_newkeys")) 198| 8.49k|} kexfirstinitialise: 202| 3.14k|void kexfirstinitialise() { 203| 3.14k|#ifdef DISABLE_ZLIB 204| 3.14k| ses.compress_algos = ssh_nocompress; 205| |#else 206| | switch (opts.compress_mode) 207| | { 208| | case DROPBEAR_COMPRESS_DELAYED: 209| | ses.compress_algos = ssh_delaycompress; 210| | break; 211| | 212| | case DROPBEAR_COMPRESS_ON: 213| | ses.compress_algos = ssh_compress; 214| | break; 215| | 216| | case DROPBEAR_COMPRESS_OFF: 217| | ses.compress_algos = ssh_nocompress; 218| | break; 219| | } 220| |#endif 221| 3.14k| kexinitialise(); 222| 3.14k|} recv_msg_kexinit: 474| 9.90k|void recv_msg_kexinit() { 475| | 476| 9.90k| unsigned int kexhashbuf_len = 0; 477| 9.90k| unsigned int remote_ident_len = 0; 478| 9.90k| unsigned int local_ident_len = 0; 479| | 480| 9.90k| TRACE(("<- KEXINIT")) 481| 9.90k| TRACE(("enter recv_msg_kexinit")) 482| | 483| 9.90k| if (!ses.kexstate.sentkexinit) { ------------------ | Branch (483:6): [True: 7.38k, False: 2.52k] ------------------ 484| | /* we need to send a kex packet */ 485| 7.38k| send_msg_kexinit(); 486| 7.38k| TRACE(("continue recv_msg_kexinit: sent kexinit")) 487| 7.38k| } 488| | 489| | /* "Once a party has sent a SSH_MSG_KEXINIT message ... 490| | further SSH_MSG_KEXINIT messages MUST NOT be sent" */ 491| 9.90k| if (ses.kexstate.recvkexinit) { ------------------ | Branch (491:6): [True: 0, False: 9.90k] ------------------ 492| 0| dropbear_exit("Unexpected KEXINIT"); 493| 0| } 494| | 495| | /* start the kex hash */ 496| 9.90k| local_ident_len = strlen(LOCAL_IDENT); ------------------ | | 10| 9.90k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION | | ------------------ | | | | 7| 9.90k|#define DROPBEAR_VERSION "2022.83" | | ------------------ ------------------ 497| 9.90k| remote_ident_len = strlen(ses.remoteident); 498| | 499| 9.90k| kexhashbuf_len = local_ident_len + remote_ident_len 500| 9.90k| + ses.transkexinit->len + ses.payload->len 501| 9.90k| + KEXHASHBUF_MAX_INTS; ------------------ | | 240| 9.90k|#define KEXHASHBUF_MAX_INTS (1700 + 130 + 130 + 130) ------------------ 502| | 503| 9.90k| ses.kexhashbuf = buf_new(kexhashbuf_len); 504| | 505| 9.90k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 320| 9.90k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 9.90k] | | ------------------ ------------------ 506| | 507| | /* read the peer's choice of algos */ 508| 0| read_kex_algos(); 509| | 510| | /* V_C, the client's version string (CR and NL excluded) */ 511| 0| buf_putstring(ses.kexhashbuf, LOCAL_IDENT, local_ident_len); ------------------ | | 10| 0|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION | | ------------------ | | | | 7| 0|#define DROPBEAR_VERSION "2022.83" | | ------------------ ------------------ 512| | /* V_S, the server's version string (CR and NL excluded) */ 513| 0| buf_putstring(ses.kexhashbuf, ses.remoteident, remote_ident_len); 514| | 515| | /* I_C, the payload of the client's SSH_MSG_KEXINIT */ 516| 0| buf_putstring(ses.kexhashbuf, 517| 0| (const char*)ses.transkexinit->data, ses.transkexinit->len); 518| | /* I_S, the payload of the server's SSH_MSG_KEXINIT */ 519| 0| buf_setpos(ses.payload, ses.payload_beginning); 520| 0| buf_putstring(ses.kexhashbuf, 521| 0| (const char*)buf_getptr(ses.payload, ses.payload->len-ses.payload->pos), 522| 0| ses.payload->len-ses.payload->pos); 523| 0| ses.requirenext = SSH_MSG_KEXDH_REPLY; ------------------ | | 39| 0|#define SSH_MSG_KEXDH_REPLY 31 ------------------ 524| 9.90k| } else { 525| | /* SERVER */ 526| | 527| | /* read the peer's choice of algos */ 528| 9.90k| read_kex_algos(); 529| | /* V_C, the client's version string (CR and NL excluded) */ 530| 9.90k| buf_putstring(ses.kexhashbuf, ses.remoteident, remote_ident_len); 531| | /* V_S, the server's version string (CR and NL excluded) */ 532| 9.90k| buf_putstring(ses.kexhashbuf, LOCAL_IDENT, local_ident_len); ------------------ | | 10| 9.90k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION | | ------------------ | | | | 7| 9.90k|#define DROPBEAR_VERSION "2022.83" | | ------------------ ------------------ 533| | 534| | /* I_C, the payload of the client's SSH_MSG_KEXINIT */ 535| 9.90k| buf_setpos(ses.payload, ses.payload_beginning); 536| 9.90k| buf_putstring(ses.kexhashbuf, 537| 9.90k| (const char*)buf_getptr(ses.payload, ses.payload->len-ses.payload->pos), 538| 9.90k| ses.payload->len-ses.payload->pos); 539| | 540| | /* I_S, the payload of the server's SSH_MSG_KEXINIT */ 541| 9.90k| buf_putstring(ses.kexhashbuf, 542| 9.90k| (const char*)ses.transkexinit->data, ses.transkexinit->len); 543| | 544| 9.90k| ses.requirenext = SSH_MSG_KEXDH_INIT; ------------------ | | 38| 9.90k|#define SSH_MSG_KEXDH_INIT 30 ------------------ 545| 9.90k| } 546| | 547| 9.90k| buf_free(ses.transkexinit); 548| 9.90k| ses.transkexinit = NULL; 549| | /* the rest of ses.kexhashbuf will be done after DH exchange */ 550| | 551| 9.90k| ses.kexstate.recvkexinit = 1; 552| | 553| 9.90k| TRACE(("leave recv_msg_kexinit")) 554| 9.90k|} finish_kexhashbuf: 786| 8.93k|void finish_kexhashbuf(void) { 787| 8.93k| hash_state hs; 788| 8.93k| const struct ltc_hash_descriptor *hash_desc = ses.newkeys->algo_kex->hash_desc; 789| | 790| 8.93k| hash_desc->init(&hs); 791| 8.93k| buf_setpos(ses.kexhashbuf, 0); 792| 8.93k| hash_desc->process(&hs, buf_getptr(ses.kexhashbuf, ses.kexhashbuf->len), 793| 8.93k| ses.kexhashbuf->len); 794| 8.93k| ses.hash = buf_new(hash_desc->hashsize); 795| 8.93k| hash_desc->done(&hs, buf_getwriteptr(ses.hash, hash_desc->hashsize)); 796| 8.93k| buf_setlen(ses.hash, hash_desc->hashsize); 797| | 798| |#if defined(DEBUG_KEXHASH) && DEBUG_TRACE 799| | if (!debug_trace) { 800| | printhex("kexhashbuf", ses.kexhashbuf->data, ses.kexhashbuf->len); 801| | printhex("kexhash", ses.hash->data, ses.hash->len); 802| | } 803| |#endif 804| | 805| 8.93k| buf_burn_free(ses.kexhashbuf); 806| 8.93k| m_burn(&hs, sizeof(hash_state)); 807| 8.93k| ses.kexhashbuf = NULL; 808| | 809| | /* first time around, we set the session_id to H */ 810| 8.93k| if (ses.session_id == NULL) { ------------------ | Branch (810:6): [True: 1.77k, False: 7.16k] ------------------ 811| | /* create the session_id, this never needs freeing */ 812| 1.77k| ses.session_id = buf_newcopy(ses.hash); 813| 1.77k| } 814| 8.93k|} common-kex.c:switch_keys: 124| 17.4k|static void switch_keys() { 125| 17.4k| TRACE2(("enter switch_keys")) 126| 17.4k| if (!(ses.kexstate.sentkexinit && ses.kexstate.recvkexinit)) { ------------------ | Branch (126:8): [True: 17.4k, False: 6] | Branch (126:36): [True: 17.4k, False: 0] ------------------ 127| 6| dropbear_exit("Unexpected newkeys message"); 128| 6| } 129| | 130| 17.4k| if (!ses.keys) { ------------------ | Branch (130:6): [True: 0, False: 17.4k] ------------------ 131| 0| ses.keys = m_malloc(sizeof(*ses.newkeys)); 132| 0| } 133| 17.4k| if (ses.kexstate.recvnewkeys && ses.newkeys->recv.valid) { ------------------ | Branch (133:6): [True: 8.48k, False: 8.93k] | Branch (133:34): [True: 8.48k, False: 0] ------------------ 134| 8.48k| TRACE(("switch_keys recv")) 135| |#ifndef DISABLE_ZLIB 136| | gen_new_zstream_recv(); 137| |#endif 138| 8.48k| ses.keys->recv = ses.newkeys->recv; 139| 8.48k| m_burn(&ses.newkeys->recv, sizeof(ses.newkeys->recv)); 140| 8.48k| ses.newkeys->recv.valid = 0; 141| 8.48k| } 142| 17.4k| if (ses.kexstate.sentnewkeys && ses.newkeys->trans.valid) { ------------------ | Branch (142:6): [True: 17.4k, False: 0] | Branch (142:34): [True: 8.93k, False: 8.48k] ------------------ 143| 8.93k| TRACE(("switch_keys trans")) 144| |#ifndef DISABLE_ZLIB 145| | gen_new_zstream_trans(); 146| |#endif 147| 8.93k| ses.keys->trans = ses.newkeys->trans; 148| 8.93k| m_burn(&ses.newkeys->trans, sizeof(ses.newkeys->trans)); 149| 8.93k| ses.newkeys->trans.valid = 0; 150| 8.93k| } 151| 17.4k| if (ses.kexstate.sentnewkeys && ses.kexstate.recvnewkeys) ------------------ | Branch (151:6): [True: 17.4k, False: 0] | Branch (151:34): [True: 8.48k, False: 8.93k] ------------------ 152| 8.48k| { 153| 8.48k| TRACE(("switch_keys done")) 154| 8.48k| ses.keys->algo_kex = ses.newkeys->algo_kex; 155| 8.48k| ses.keys->algo_hostkey = ses.newkeys->algo_hostkey; 156| 8.48k| ses.keys->algo_signature = ses.newkeys->algo_signature; 157| 8.48k| ses.keys->allow_compress = 0; 158| 8.48k| m_free(ses.newkeys); ------------------ | | 24| 8.48k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 159| 8.48k| ses.newkeys = NULL; 160| 8.48k| kexinitialise(); 161| 8.48k| } 162| 17.4k| TRACE2(("leave switch_keys")) 163| 17.4k|} common-kex.c:kexinitialise: 225| 11.6k|static void kexinitialise() { 226| | 227| 11.6k| TRACE(("kexinitialise()")) 228| | 229| | /* sent/recv'd MSG_KEXINIT */ 230| 11.6k| ses.kexstate.sentkexinit = 0; 231| 11.6k| ses.kexstate.recvkexinit = 0; 232| | 233| | /* sent/recv'd MSG_NEWKEYS */ 234| 11.6k| ses.kexstate.recvnewkeys = 0; 235| 11.6k| ses.kexstate.sentnewkeys = 0; 236| | 237| | /* first_packet_follows */ 238| 11.6k| ses.kexstate.them_firstfollows = 0; 239| | 240| 11.6k| ses.kexstate.datatrans = 0; 241| 11.6k| ses.kexstate.datarecv = 0; 242| | 243| 11.6k| ses.kexstate.our_first_follows_matches = 0; 244| | 245| 11.6k| ses.kexstate.lastkextime = monotonic_now(); 246| | 247| 11.6k|} common-kex.c:gen_new_keys: 288| 8.93k|static void gen_new_keys() { 289| | 290| 8.93k| unsigned char C2S_IV[MAX_IV_LEN]; 291| 8.93k| unsigned char C2S_key[MAX_KEY_LEN]; 292| 8.93k| unsigned char S2C_IV[MAX_IV_LEN]; 293| 8.93k| unsigned char S2C_key[MAX_KEY_LEN]; 294| | /* unsigned char key[MAX_KEY_LEN]; */ 295| 8.93k| unsigned char *trans_IV, *trans_key, *recv_IV, *recv_key; 296| | 297| 8.93k| hash_state hs; 298| 8.93k| const struct ltc_hash_descriptor *hash_desc = ses.newkeys->algo_kex->hash_desc; 299| 8.93k| char mactransletter, macrecvletter; /* Client or server specific */ 300| | 301| 8.93k| TRACE(("enter gen_new_keys")) 302| | /* the dh_K and hash are the start of all hashes, we make use of that */ 303| | 304| 8.93k| hash_desc->init(&hs); 305| 8.93k| hash_process_mp(hash_desc, &hs, ses.dh_K); 306| 8.93k| mp_clear(ses.dh_K); 307| 8.93k| m_free(ses.dh_K); ------------------ | | 24| 8.93k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 308| 8.93k| hash_desc->process(&hs, ses.hash->data, ses.hash->len); 309| 8.93k| buf_burn_free(ses.hash); 310| 8.93k| ses.hash = NULL; 311| | 312| 8.93k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 320| 8.93k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 8.93k] | | ------------------ ------------------ 313| 0| trans_IV = C2S_IV; 314| 0| recv_IV = S2C_IV; 315| 0| trans_key = C2S_key; 316| 0| recv_key = S2C_key; 317| 0| mactransletter = 'E'; 318| 0| macrecvletter = 'F'; 319| 8.93k| } else { 320| 8.93k| trans_IV = S2C_IV; 321| 8.93k| recv_IV = C2S_IV; 322| 8.93k| trans_key = S2C_key; 323| 8.93k| recv_key = C2S_key; 324| 8.93k| mactransletter = 'F'; 325| 8.93k| macrecvletter = 'E'; 326| 8.93k| } 327| | 328| 8.93k| hashkeys(C2S_IV, sizeof(C2S_IV), &hs, 'A'); 329| 8.93k| hashkeys(S2C_IV, sizeof(S2C_IV), &hs, 'B'); 330| 8.93k| hashkeys(C2S_key, sizeof(C2S_key), &hs, 'C'); 331| 8.93k| hashkeys(S2C_key, sizeof(S2C_key), &hs, 'D'); 332| | 333| 8.93k| if (ses.newkeys->recv.algo_crypt->cipherdesc != NULL) { ------------------ | Branch (333:6): [True: 8.93k, False: 0] ------------------ 334| 8.93k| int recv_cipher = -1; 335| 8.93k| if (ses.newkeys->recv.algo_crypt->cipherdesc->name != NULL) { ------------------ | Branch (335:7): [True: 1.25k, False: 7.67k] ------------------ 336| 1.25k| recv_cipher = find_cipher(ses.newkeys->recv.algo_crypt->cipherdesc->name); 337| 1.25k| if (recv_cipher < 0) { ------------------ | Branch (337:8): [True: 0, False: 1.25k] ------------------ 338| 0| dropbear_exit("Crypto error"); 339| 0| } 340| 1.25k| } 341| 8.93k| if (ses.newkeys->recv.crypt_mode->start(recv_cipher, ------------------ | Branch (341:7): [True: 0, False: 8.93k] ------------------ 342| 8.93k| recv_IV, recv_key, 343| 8.93k| ses.newkeys->recv.algo_crypt->keysize, 0, 344| 8.93k| &ses.newkeys->recv.cipher_state) != CRYPT_OK) { 345| 0| dropbear_exit("Crypto error"); 346| 0| } 347| 8.93k| } 348| | 349| 8.93k| if (ses.newkeys->trans.algo_crypt->cipherdesc != NULL) { ------------------ | Branch (349:6): [True: 8.93k, False: 0] ------------------ 350| 8.93k| int trans_cipher = -1; 351| 8.93k| if (ses.newkeys->trans.algo_crypt->cipherdesc->name != NULL) { ------------------ | Branch (351:7): [True: 1.28k, False: 7.64k] ------------------ 352| 1.28k| trans_cipher = find_cipher(ses.newkeys->trans.algo_crypt->cipherdesc->name); 353| 1.28k| if (trans_cipher < 0) { ------------------ | Branch (353:8): [True: 0, False: 1.28k] ------------------ 354| 0| dropbear_exit("Crypto error"); 355| 0| } 356| 1.28k| } 357| 8.93k| if (ses.newkeys->trans.crypt_mode->start(trans_cipher, ------------------ | Branch (357:7): [True: 0, False: 8.93k] ------------------ 358| 8.93k| trans_IV, trans_key, 359| 8.93k| ses.newkeys->trans.algo_crypt->keysize, 0, 360| 8.93k| &ses.newkeys->trans.cipher_state) != CRYPT_OK) { 361| 0| dropbear_exit("Crypto error"); 362| 0| } 363| 8.93k| } 364| | 365| 8.93k| if (ses.newkeys->trans.algo_mac->hash_desc != NULL) { ------------------ | Branch (365:6): [True: 1.28k, False: 7.64k] ------------------ 366| 1.28k| hashkeys(ses.newkeys->trans.mackey, 367| 1.28k| ses.newkeys->trans.algo_mac->keysize, &hs, mactransletter); 368| 1.28k| ses.newkeys->trans.hash_index = find_hash(ses.newkeys->trans.algo_mac->hash_desc->name); 369| 1.28k| } 370| | 371| 8.93k| if (ses.newkeys->recv.algo_mac->hash_desc != NULL) { ------------------ | Branch (371:6): [True: 0, False: 8.93k] ------------------ 372| 0| hashkeys(ses.newkeys->recv.mackey, 373| 0| ses.newkeys->recv.algo_mac->keysize, &hs, macrecvletter); 374| 0| ses.newkeys->recv.hash_index = find_hash(ses.newkeys->recv.algo_mac->hash_desc->name); 375| 0| } 376| | 377| | /* Ready to switch over */ 378| 8.93k| ses.newkeys->trans.valid = 1; 379| 8.93k| ses.newkeys->recv.valid = 1; 380| | 381| 8.93k| m_burn(C2S_IV, sizeof(C2S_IV)); 382| 8.93k| m_burn(C2S_key, sizeof(C2S_key)); 383| 8.93k| m_burn(S2C_IV, sizeof(S2C_IV)); 384| 8.93k| m_burn(S2C_key, sizeof(S2C_key)); 385| 8.93k| m_burn(&hs, sizeof(hash_state)); 386| | 387| 8.93k| TRACE(("leave gen_new_keys")) 388| 8.93k|} common-kex.c:hashkeys: 256| 37.0k| const hash_state * hs, const unsigned char X) { 257| | 258| 37.0k| const struct ltc_hash_descriptor *hash_desc = ses.newkeys->algo_kex->hash_desc; 259| 37.0k| hash_state hs2; 260| 37.0k| unsigned int offset; 261| 37.0k| unsigned char tmpout[MAX_HASH_SIZE]; 262| | 263| 37.0k| memcpy(&hs2, hs, sizeof(hash_state)); 264| 37.0k| hash_desc->process(&hs2, &X, 1); 265| 37.0k| hash_desc->process(&hs2, ses.session_id->data, ses.session_id->len); 266| 37.0k| hash_desc->done(&hs2, tmpout); 267| 37.0k| memcpy(out, tmpout, MIN(hash_desc->hashsize, outlen)); 268| 37.0k| for (offset = hash_desc->hashsize; 269| 68.8k| offset < outlen; ------------------ | Branch (269:4): [True: 31.8k, False: 37.0k] ------------------ 270| 37.0k| offset += hash_desc->hashsize) 271| 31.8k| { 272| | /* need to extend */ 273| 31.8k| memcpy(&hs2, hs, sizeof(hash_state)); 274| 31.8k| hash_desc->process(&hs2, out, offset); 275| 31.8k| hash_desc->done(&hs2, tmpout); 276| 31.8k| memcpy(&out[offset], tmpout, MIN(outlen - offset, hash_desc->hashsize)); 277| 31.8k| } 278| 37.0k| m_burn(&hs2, sizeof(hash_state)); 279| 37.0k|} common-kex.c:read_kex_algos: 818| 9.90k|static void read_kex_algos() { 819| | 820| | /* for asymmetry */ 821| 9.90k| algo_type * c2s_hash_algo = NULL; 822| 9.90k| algo_type * s2c_hash_algo = NULL; 823| 9.90k| algo_type * c2s_cipher_algo = NULL; 824| 9.90k| algo_type * s2c_cipher_algo = NULL; 825| 9.90k| algo_type * c2s_comp_algo = NULL; 826| 9.90k| algo_type * s2c_comp_algo = NULL; 827| | /* the generic one */ 828| 9.90k| algo_type * algo = NULL; 829| | 830| | /* which algo couldn't match */ 831| 9.90k| char * erralgo = NULL; 832| | 833| 9.90k| int goodguess = 0; 834| 9.90k| int allgood = 1; /* we AND this with each goodguess and see if its still 835| | true after */ 836| 9.90k| int kexguess2 = 0; 837| | 838| 9.90k| buf_incrpos(ses.payload, 16); /* start after the cookie */ 839| | 840| 9.90k| memset(ses.newkeys, 0x0, sizeof(*ses.newkeys)); 841| | 842| | /* kex_algorithms */ 843| 9.90k|#if DROPBEAR_KEXGUESS2 844| 9.90k| if (buf_has_algo(ses.payload, KEXGUESS2_ALGO_NAME) == DROPBEAR_SUCCESS) { ------------------ | | 128| 9.90k|#define KEXGUESS2_ALGO_NAME "kexguess2@matt.ucc.asn.au" ------------------ if (buf_has_algo(ses.payload, KEXGUESS2_ALGO_NAME) == DROPBEAR_SUCCESS) { ------------------ | | 102| 9.90k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (844:6): [True: 190, False: 9.71k] ------------------ 845| 190| kexguess2 = 1; 846| 190| } 847| 9.90k|#endif 848| | 849| 9.90k|#if DROPBEAR_EXT_INFO 850| | /* Determine if SSH_MSG_EXT_INFO messages should be sent. 851| | Should be done for the first key exchange. Only required on server side 852| | for server-sig-algs */ 853| 9.90k| if (IS_DROPBEAR_SERVER) { ------------------ | | 319| 9.90k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 9.77k, False: 126] | | ------------------ ------------------ 854| 9.77k| if (!ses.kexstate.donefirstkex) { ------------------ | Branch (854:7): [True: 2.44k, False: 7.33k] ------------------ 855| 2.44k| if (buf_has_algo(ses.payload, SSH_EXT_INFO_C) == DROPBEAR_SUCCESS) { ------------------ | | 100| 2.44k|#define SSH_EXT_INFO_C "ext-info-c" ------------------ if (buf_has_algo(ses.payload, SSH_EXT_INFO_C) == DROPBEAR_SUCCESS) { ------------------ | | 102| 2.44k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (855:8): [True: 296, False: 2.14k] ------------------ 856| 296| ses.allow_ext_info = 1; 857| 296| } 858| 2.44k| } 859| 9.77k| } 860| 9.90k|#endif 861| | 862| 9.90k| algo = buf_match_algo(ses.payload, sshkex, kexguess2, &goodguess); 863| 9.90k| allgood &= goodguess; 864| 9.90k| if (algo == NULL || algo->data == NULL) { ------------------ | Branch (864:6): [True: 321, False: 9.58k] | Branch (864:22): [True: 15, False: 9.56k] ------------------ 865| | /* kexguess2, ext-info-c, ext-info-s should not match negotiation */ 866| 210| erralgo = "kex"; 867| 210| goto error; 868| 210| } 869| 9.69k| TRACE(("kexguess2 %d", kexguess2)) 870| 9.69k| DEBUG3(("kex algo %s", algo->name)) 871| 9.69k| ses.newkeys->algo_kex = algo->data; 872| | 873| | /* server_host_key_algorithms */ 874| 9.69k| algo = buf_match_algo(ses.payload, sigalgs, kexguess2, &goodguess); 875| 9.69k| allgood &= goodguess; 876| 9.69k| if (algo == NULL) { ------------------ | Branch (876:6): [True: 7, False: 9.68k] ------------------ 877| 7| erralgo = "hostkey"; 878| 7| goto error; 879| 7| } 880| 9.68k| DEBUG2(("hostkey algo %s", algo->name)) 881| 9.68k| ses.newkeys->algo_signature = algo->val; 882| 9.68k| ses.newkeys->algo_hostkey = signkey_type_from_signature(ses.newkeys->algo_signature); 883| | 884| | /* encryption_algorithms_client_to_server */ 885| 9.68k| c2s_cipher_algo = buf_match_algo(ses.payload, sshciphers, 0, NULL); 886| 9.68k| if (c2s_cipher_algo == NULL) { ------------------ | Branch (886:6): [True: 15, False: 9.67k] ------------------ 887| 15| erralgo = "enc c->s"; 888| 15| goto error; 889| 15| } 890| 9.67k| DEBUG2(("enc c2s is %s", c2s_cipher_algo->name)) 891| | 892| | /* encryption_algorithms_server_to_client */ 893| 9.67k| s2c_cipher_algo = buf_match_algo(ses.payload, sshciphers, 0, NULL); 894| 9.67k| if (s2c_cipher_algo == NULL) { ------------------ | Branch (894:6): [True: 7, False: 9.66k] ------------------ 895| 7| erralgo = "enc s->c"; 896| 7| goto error; 897| 7| } 898| 9.66k| DEBUG2(("enc s2c is %s", s2c_cipher_algo->name)) 899| | 900| | /* mac_algorithms_client_to_server */ 901| 9.66k| c2s_hash_algo = buf_match_algo(ses.payload, sshhashes, 0, NULL); 902| 9.66k|#if DROPBEAR_AEAD_MODE 903| 9.66k| if (((struct dropbear_cipher_mode*)c2s_cipher_algo->mode)->aead_crypt != NULL) { ------------------ | Branch (903:6): [True: 8.15k, False: 1.50k] ------------------ 904| 8.15k| c2s_hash_algo = NULL; 905| 8.15k| } else 906| 1.50k|#endif 907| 1.50k| if (c2s_hash_algo == NULL) { ------------------ | Branch (907:6): [True: 3, False: 1.50k] ------------------ 908| 3| erralgo = "mac c->s"; 909| 3| goto error; 910| 3| } 911| 9.66k| DEBUG2(("hmac c2s is %s", c2s_hash_algo ? c2s_hash_algo->name : "")) 912| | 913| | /* mac_algorithms_server_to_client */ 914| 9.66k| s2c_hash_algo = buf_match_algo(ses.payload, sshhashes, 0, NULL); 915| 9.66k|#if DROPBEAR_AEAD_MODE 916| 9.66k| if (((struct dropbear_cipher_mode*)s2c_cipher_algo->mode)->aead_crypt != NULL) { ------------------ | Branch (916:6): [True: 8.12k, False: 1.53k] ------------------ 917| 8.12k| s2c_hash_algo = NULL; 918| 8.12k| } else 919| 1.53k|#endif 920| 1.53k| if (s2c_hash_algo == NULL) { ------------------ | Branch (920:6): [True: 3, False: 1.53k] ------------------ 921| 3| erralgo = "mac s->c"; 922| 3| goto error; 923| 3| } 924| 9.65k| DEBUG2(("hmac s2c is %s", s2c_hash_algo ? s2c_hash_algo->name : "")) 925| | 926| | /* compression_algorithms_client_to_server */ 927| 9.65k| c2s_comp_algo = buf_match_algo(ses.payload, ses.compress_algos, 0, NULL); 928| 9.65k| if (c2s_comp_algo == NULL) { ------------------ | Branch (928:6): [True: 12, False: 9.64k] ------------------ 929| 12| erralgo = "comp c->s"; 930| 12| goto error; 931| 12| } 932| 9.64k| DEBUG2(("comp c2s is %s", c2s_comp_algo->name)) 933| | 934| | /* compression_algorithms_server_to_client */ 935| 9.64k| s2c_comp_algo = buf_match_algo(ses.payload, ses.compress_algos, 0, NULL); 936| 9.64k| if (s2c_comp_algo == NULL) { ------------------ | Branch (936:6): [True: 8, False: 9.63k] ------------------ 937| 8| erralgo = "comp s->c"; 938| 8| goto error; 939| 8| } 940| 9.63k| DEBUG2(("comp s2c is %s", s2c_comp_algo->name)) 941| | 942| | /* languages_client_to_server */ 943| 9.63k| buf_eatstring(ses.payload); 944| | 945| | /* languages_server_to_client */ 946| 9.63k| buf_eatstring(ses.payload); 947| | 948| | /* their first_kex_packet_follows */ 949| 9.63k| if (buf_getbool(ses.payload)) { ------------------ | Branch (949:6): [True: 403, False: 9.23k] ------------------ 950| 403| TRACE(("them kex firstfollows. allgood %d", allgood)) 951| 403| ses.kexstate.them_firstfollows = 1; 952| | /* if the guess wasn't good, we ignore the packet sent */ 953| 403| if (!allgood) { ------------------ | Branch (953:7): [True: 274, False: 129] ------------------ 954| 274| ses.ignorenext = 1; 955| 274| } 956| 403| } 957| | 958| | /* Handle the asymmetry */ 959| 9.63k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 320| 9.63k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 9.63k] | | ------------------ ------------------ 960| 0| ses.newkeys->recv.algo_crypt = 961| 0| (struct dropbear_cipher*)s2c_cipher_algo->data; 962| 0| ses.newkeys->trans.algo_crypt = 963| 0| (struct dropbear_cipher*)c2s_cipher_algo->data; 964| 0| ses.newkeys->recv.crypt_mode = 965| 0| (struct dropbear_cipher_mode*)s2c_cipher_algo->mode; 966| 0| ses.newkeys->trans.crypt_mode = 967| 0| (struct dropbear_cipher_mode*)c2s_cipher_algo->mode; 968| 0| ses.newkeys->recv.algo_mac = 969| 0|#if DROPBEAR_AEAD_MODE 970| 0| s2c_hash_algo == NULL ? ses.newkeys->recv.crypt_mode->aead_mac : ------------------ | Branch (970:4): [True: 0, False: 0] ------------------ 971| 0|#endif 972| 0| (struct dropbear_hash*)s2c_hash_algo->data; 973| 0| ses.newkeys->trans.algo_mac = 974| 0|#if DROPBEAR_AEAD_MODE 975| 0| c2s_hash_algo == NULL ? ses.newkeys->trans.crypt_mode->aead_mac : ------------------ | Branch (975:4): [True: 0, False: 0] ------------------ 976| 0|#endif 977| 0| (struct dropbear_hash*)c2s_hash_algo->data; 978| 0| ses.newkeys->recv.algo_comp = s2c_comp_algo->val; 979| 0| ses.newkeys->trans.algo_comp = c2s_comp_algo->val; 980| 9.63k| } else { 981| | /* SERVER */ 982| 9.63k| ses.newkeys->recv.algo_crypt = 983| 9.63k| (struct dropbear_cipher*)c2s_cipher_algo->data; 984| 9.63k| ses.newkeys->trans.algo_crypt = 985| 9.63k| (struct dropbear_cipher*)s2c_cipher_algo->data; 986| 9.63k| ses.newkeys->recv.crypt_mode = 987| 9.63k| (struct dropbear_cipher_mode*)c2s_cipher_algo->mode; 988| 9.63k| ses.newkeys->trans.crypt_mode = 989| 9.63k| (struct dropbear_cipher_mode*)s2c_cipher_algo->mode; 990| 9.63k| ses.newkeys->recv.algo_mac = 991| 9.63k|#if DROPBEAR_AEAD_MODE 992| 9.63k| c2s_hash_algo == NULL ? ses.newkeys->recv.crypt_mode->aead_mac : ------------------ | Branch (992:4): [True: 8.02k, False: 1.60k] ------------------ 993| 9.63k|#endif 994| 9.63k| (struct dropbear_hash*)c2s_hash_algo->data; 995| 9.63k| ses.newkeys->trans.algo_mac = 996| 9.63k|#if DROPBEAR_AEAD_MODE 997| 9.63k| s2c_hash_algo == NULL ? ses.newkeys->trans.crypt_mode->aead_mac : ------------------ | Branch (997:4): [True: 8.00k, False: 1.63k] ------------------ 998| 9.63k|#endif 999| 9.63k| (struct dropbear_hash*)s2c_hash_algo->data; 1000| 9.63k| ses.newkeys->recv.algo_comp = c2s_comp_algo->val; 1001| 9.63k| ses.newkeys->trans.algo_comp = s2c_comp_algo->val; 1002| 9.63k| } 1003| | 1004| 9.63k|#if DROPBEAR_FUZZ 1005| 9.63k| if (fuzz.fuzzing) { ------------------ | Branch (1005:6): [True: 9.32k, False: 317] ------------------ 1006| 9.32k| fuzz_kex_fakealgos(); 1007| 9.32k| } 1008| 9.63k|#endif 1009| | 1010| | /* reserved for future extensions */ 1011| 9.63k| buf_getint(ses.payload); 1012| | 1013| 9.63k| if (ses.send_kex_first_guess && allgood) { ------------------ | Branch (1013:6): [True: 0, False: 9.63k] | Branch (1013:34): [True: 0, False: 0] ------------------ 1014| 0| TRACE(("our_first_follows_matches 1")) 1015| 0| ses.kexstate.our_first_follows_matches = 1; 1016| 0| } 1017| 9.63k| return; 1018| | 1019| 265|error: 1020| 265| dropbear_exit("No matching algo %s", erralgo); 1021| 9.64k|} common_session_init: 47| 3.14k|void common_session_init(int sock_in, int sock_out) { 48| 3.14k| time_t now; 49| | 50| |#if DEBUG_TRACE 51| | debug_start_net(); 52| |#endif 53| | 54| 3.14k| TRACE(("enter session_init")) 55| | 56| 3.14k| ses.sock_in = sock_in; 57| 3.14k| ses.sock_out = sock_out; 58| 3.14k| ses.maxfd = MAX(sock_in, sock_out); 59| | 60| 3.14k| if (sock_in >= 0) { ------------------ | Branch (60:6): [True: 3.14k, False: 0] ------------------ 61| 3.14k| setnonblocking(sock_in); 62| 3.14k| } 63| 3.14k| if (sock_out >= 0) { ------------------ | Branch (63:6): [True: 3.14k, False: 0] ------------------ 64| 3.14k| setnonblocking(sock_out); 65| 3.14k| } 66| | 67| 3.14k| ses.socket_prio = DROPBEAR_PRIO_NORMAL; 68| | /* Sets it to lowdelay */ 69| 3.14k| update_channel_prio(); 70| | 71| |#if !DROPBEAR_SVR_MULTIUSER 72| | /* A sanity check to prevent an accidental configuration option 73| | leaving multiuser systems exposed */ 74| | errno = 0; 75| | getuid(); 76| | if (errno != ENOSYS) { 77| | dropbear_exit("Non-multiuser Dropbear requires a non-multiuser kernel"); 78| | } 79| |#endif 80| | 81| 3.14k| now = monotonic_now(); 82| 3.14k| ses.connect_time = now; 83| 3.14k| ses.last_packet_time_keepalive_recv = now; 84| 3.14k| ses.last_packet_time_idle = now; 85| 3.14k| ses.last_packet_time_any_sent = 0; 86| 3.14k| ses.last_packet_time_keepalive_sent = 0; 87| | 88| 3.14k|#if DROPBEAR_FUZZ 89| 3.14k| if (!fuzz.fuzzing) ------------------ | Branch (89:6): [True: 0, False: 3.14k] ------------------ 90| 0|#endif 91| 0| { 92| 0| if (pipe(ses.signal_pipe) < 0) { ------------------ | Branch (92:6): [True: 0, False: 0] ------------------ 93| 0| dropbear_exit("Signal pipe failed"); 94| 0| } 95| 0| setnonblocking(ses.signal_pipe[0]); 96| 0| setnonblocking(ses.signal_pipe[1]); 97| 0| ses.maxfd = MAX(ses.maxfd, ses.signal_pipe[0]); 98| 0| ses.maxfd = MAX(ses.maxfd, ses.signal_pipe[1]); 99| 0| } 100| | 101| 3.14k| ses.writepayload = buf_new(TRANS_MAX_PAYLOAD_LEN); ------------------ | | 497| 3.14k|#define TRANS_MAX_PAYLOAD_LEN 16384 ------------------ 102| 3.14k| ses.transseq = 0; 103| | 104| 3.14k| ses.readbuf = NULL; 105| 3.14k| ses.payload = NULL; 106| 3.14k| ses.recvseq = 0; 107| | 108| 3.14k| initqueue(&ses.writequeue); 109| | 110| 3.14k| ses.requirenext = SSH_MSG_KEXINIT; ------------------ | | 36| 3.14k|#define SSH_MSG_KEXINIT 20 ------------------ 111| 3.14k| ses.dataallowed = 1; /* we can send data until we actually 112| | send the SSH_MSG_KEXINIT */ 113| 3.14k| ses.ignorenext = 0; 114| 3.14k| ses.lastpacket = 0; 115| 3.14k| ses.reply_queue_head = NULL; 116| 3.14k| ses.reply_queue_tail = NULL; 117| | 118| | /* set all the algos to none */ 119| 3.14k| ses.keys = (struct key_context*)m_malloc(sizeof(struct key_context)); 120| 3.14k| ses.newkeys = NULL; 121| 3.14k| ses.keys->recv.algo_crypt = &dropbear_nocipher; 122| 3.14k| ses.keys->trans.algo_crypt = &dropbear_nocipher; 123| 3.14k| ses.keys->recv.crypt_mode = &dropbear_mode_none; 124| 3.14k| ses.keys->trans.crypt_mode = &dropbear_mode_none; 125| | 126| 3.14k| ses.keys->recv.algo_mac = &dropbear_nohash; 127| 3.14k| ses.keys->trans.algo_mac = &dropbear_nohash; 128| | 129| 3.14k| ses.keys->algo_kex = NULL; 130| 3.14k| ses.keys->algo_hostkey = -1; 131| 3.14k| ses.keys->recv.algo_comp = DROPBEAR_COMP_NONE; 132| 3.14k| ses.keys->trans.algo_comp = DROPBEAR_COMP_NONE; 133| | 134| |#ifndef DISABLE_ZLIB 135| | ses.keys->recv.zstream = NULL; 136| | ses.keys->trans.zstream = NULL; 137| |#endif 138| | 139| | /* key exchange buffers */ 140| 3.14k| ses.session_id = NULL; 141| 3.14k| ses.kexhashbuf = NULL; 142| 3.14k| ses.transkexinit = NULL; 143| 3.14k| ses.dh_K = NULL; 144| 3.14k| ses.remoteident = NULL; 145| | 146| 3.14k| ses.chantypes = NULL; 147| | 148| 3.14k| ses.allowprivport = 0; 149| | 150| |#if DROPBEAR_PLUGIN 151| | ses.plugin_session = NULL; 152| |#endif 153| | 154| 3.14k| TRACE(("leave session_init")) 155| 3.14k|} session_loop: 157| 3.14k|void session_loop(void(*loophandler)(void)) { 158| | 159| 3.14k| fd_set readfd, writefd; 160| 3.14k| struct timeval timeout; 161| 3.14k| int val; 162| | 163| | /* main loop, select()s for all sockets in use */ 164| 272k| for(;;) { 165| 272k| const int writequeue_has_space = (ses.writequeue_len <= 2*TRANS_MAX_PAYLOAD_LEN); ------------------ | | 497| 272k|#define TRANS_MAX_PAYLOAD_LEN 16384 ------------------ 166| | 167| 272k| timeout.tv_sec = select_timeout(); 168| 272k| timeout.tv_usec = 0; 169| 272k| DROPBEAR_FD_ZERO(&writefd); ------------------ | | 104| 272k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 170| 272k| DROPBEAR_FD_ZERO(&readfd); ------------------ | | 104| 272k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 171| | 172| 272k| dropbear_assert(ses.payload == NULL); ------------------ | | 83| 272k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 272k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 173| | 174| | /* We get woken up when signal handlers write to this pipe. 175| | SIGCHLD in svr-chansession is the only one currently. */ 176| 272k|#if DROPBEAR_FUZZ 177| 272k| if (!fuzz.fuzzing) ------------------ | Branch (177:7): [True: 0, False: 272k] ------------------ 178| 0|#endif 179| 0| { 180| 0| FD_SET(ses.signal_pipe[0], &readfd); 181| 0| } 182| | 183| | /* set up for channels which can be read/written */ 184| 272k| setchannelfds(&readfd, &writefd, writequeue_has_space); 185| | 186| | /* Pending connections to test */ 187| 272k| set_connect_fds(&writefd); 188| | 189| | /* We delay reading from the input socket during initial setup until 190| | after we have written out our initial KEXINIT packet (empty writequeue). 191| | This means our initial packet can be in-flight while we're doing a blocking 192| | read for the remote ident. 193| | We also avoid reading from the socket if the writequeue is full, that avoids 194| | replies backing up */ 195| 272k| if (ses.sock_in != -1 ------------------ | Branch (195:7): [True: 272k, False: 0] ------------------ 196| 272k| && (ses.remoteident || isempty(&ses.writequeue)) ------------------ | Branch (196:8): [True: 263k, False: 9.60k] | Branch (196:27): [True: 3.31k, False: 6.29k] ------------------ 197| 272k| && writequeue_has_space) { ------------------ | Branch (197:7): [True: 266k, False: 0] ------------------ 198| 266k| FD_SET(ses.sock_in, &readfd); 199| 266k| } 200| | 201| | /* Ordering is important, this test must occur after any other function 202| | might have queued packets (such as connection handlers) */ 203| 272k| if (ses.sock_out != -1 && !isempty(&ses.writequeue)) { ------------------ | Branch (203:7): [True: 272k, False: 0] | Branch (203:29): [True: 6.60k, False: 266k] ------------------ 204| 6.60k| FD_SET(ses.sock_out, &writefd); 205| 6.60k| } 206| | 207| 272k| val = select(ses.maxfd+1, &readfd, &writefd, NULL, &timeout); ------------------ | | 53| 272k| wrapfd_select(nfds, readfds, writefds, exceptfds, timeout) ------------------ 208| | 209| 272k| if (ses.exitflag) { ------------------ | Branch (209:7): [True: 0, False: 272k] ------------------ 210| 0| dropbear_exit("Terminated by signal"); 211| 0| } 212| | 213| 272k| if (val < 0 && errno != EINTR) { ------------------ | Branch (213:7): [True: 301, False: 272k] | Branch (213:18): [True: 0, False: 301] ------------------ 214| 0| dropbear_exit("Error in select"); 215| 0| } 216| | 217| 272k| if (val <= 0) { ------------------ | Branch (217:7): [True: 14.3k, False: 258k] ------------------ 218| | /* If we were interrupted or the select timed out, we still 219| | * want to iterate over channels etc for reading, to handle 220| | * server processes exiting etc. 221| | * We don't want to read/write FDs. */ 222| 14.3k| DROPBEAR_FD_ZERO(&writefd); ------------------ | | 104| 14.3k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 223| 14.3k| DROPBEAR_FD_ZERO(&readfd); ------------------ | | 104| 14.3k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 224| 14.3k| } 225| | 226| | /* We'll just empty out the pipe if required. We don't do 227| | any thing with the data, since the pipe's purpose is purely to 228| | wake up the select() above. */ 229| 272k| ses.channel_signal_pending = 0; 230| 272k| if (FD_ISSET(ses.signal_pipe[0], &readfd)) { 231| 0| char x; 232| 0| TRACE(("signal pipe set")) 233| 0| while (read(ses.signal_pipe[0], &x, 1) > 0) {} ------------------ | | 55| 0|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ | Branch (233:11): [True: 0, False: 0] ------------------ 234| 0| ses.channel_signal_pending = 1; 235| 0| } 236| | 237| | /* check for auth timeout, rekeying required etc */ 238| 272k| checktimeouts(); 239| | 240| | /* process session socket's incoming data */ 241| 272k| if (ses.sock_in != -1) { ------------------ | Branch (241:7): [True: 272k, False: 0] ------------------ 242| 272k| if (FD_ISSET(ses.sock_in, &readfd)) { 243| 252k| if (!ses.remoteident) { ------------------ | Branch (243:9): [True: 3.14k, False: 249k] ------------------ 244| | /* blocking read of the version string */ 245| 3.14k| read_session_identification(); 246| 249k| } else { 247| 249k| read_packet(); 248| 249k| } 249| 252k| } 250| | 251| | /* Process the decrypted packet. After this, the read buffer 252| | * will be ready for a new packet */ 253| 272k| if (ses.payload != NULL) { ------------------ | Branch (253:8): [True: 54.1k, False: 218k] ------------------ 254| 54.1k| process_packet(); 255| 54.1k| } 256| 272k| } 257| | 258| | /* if required, flush out any queued reply packets that 259| | were being held up during a KEX */ 260| 272k| maybe_flush_reply_queue(); 261| | 262| 272k| handle_connect_fds(&writefd); 263| | 264| | /* loop handler prior to channelio, in case the server loophandler closes 265| | channels on process exit */ 266| 272k| loophandler(); 267| | 268| | /* process pipes etc for the channels, ses.dataallowed == 0 269| | * during rekeying ) */ 270| 272k| channelio(&readfd, &writefd); 271| | 272| | /* process session socket's outgoing data */ 273| 272k| if (ses.sock_out != -1) { ------------------ | Branch (273:7): [True: 269k, False: 3.14k] ------------------ 274| 269k| if (!isempty(&ses.writequeue)) { ------------------ | Branch (274:8): [True: 47.3k, False: 222k] ------------------ 275| 47.3k| write_packet(); 276| 47.3k| } 277| 269k| } 278| | 279| 272k| } /* for(;;) */ 280| | 281| | /* Not reached */ 282| 3.14k|} session_cleanup: 293| 3.14k|void session_cleanup() { 294| | 295| 3.14k| TRACE(("enter session_cleanup")) 296| | 297| | /* we can't cleanup if we don't know the session state */ 298| 3.14k| if (!ses.init_done) { ------------------ | Branch (298:6): [True: 0, False: 3.14k] ------------------ 299| 0| TRACE(("leave session_cleanup: !ses.init_done")) 300| 0| return; 301| 0| } 302| | 303| | /* BEWARE of changing order of functions here. */ 304| | 305| | /* Must be before extra_session_cleanup() */ 306| 3.14k| chancleanup(); 307| | 308| 3.14k| if (ses.extra_session_cleanup) { ------------------ | Branch (308:6): [True: 3.14k, False: 0] ------------------ 309| 3.14k| ses.extra_session_cleanup(); 310| 3.14k| } 311| | 312| | /* After these are freed most functions will fail */ 313| 3.14k|#if DROPBEAR_CLEANUP 314| | /* listeners call cleanup functions, this should occur before 315| | other session state is freed. */ 316| 3.14k| remove_all_listeners(); 317| | 318| 3.14k| remove_connect_pending(); 319| | 320| 3.34k| while (!isempty(&ses.writequeue)) { ------------------ | Branch (320:9): [True: 203, False: 3.14k] ------------------ 321| 203| buf_free(dequeue(&ses.writequeue)); 322| 203| } 323| | 324| 3.14k| m_free(ses.newkeys); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 325| |#ifndef DISABLE_ZLIB 326| | if (ses.keys->recv.zstream != NULL) { 327| | if (inflateEnd(ses.keys->recv.zstream) == Z_STREAM_ERROR) { 328| | dropbear_exit("Crypto error"); 329| | } 330| | m_free(ses.keys->recv.zstream); 331| | } 332| |#endif 333| | 334| 3.14k| m_free(ses.remoteident); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 335| 3.14k| m_free(ses.authstate.pw_dir); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 336| 3.14k| m_free(ses.authstate.pw_name); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 337| 3.14k| m_free(ses.authstate.pw_shell); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 338| 3.14k| m_free(ses.authstate.pw_passwd); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 339| 3.14k| m_free(ses.authstate.username); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 340| 3.14k|#endif 341| | 342| 3.14k| cleanup_buf(&ses.session_id); 343| 3.14k| cleanup_buf(&ses.hash); 344| 3.14k| cleanup_buf(&ses.payload); 345| 3.14k| cleanup_buf(&ses.readbuf); 346| 3.14k| cleanup_buf(&ses.writepayload); 347| 3.14k| cleanup_buf(&ses.kexhashbuf); 348| 3.14k| cleanup_buf(&ses.transkexinit); 349| 3.14k| if (ses.dh_K) { ------------------ | Branch (349:6): [True: 0, False: 3.14k] ------------------ 350| 0| mp_clear(ses.dh_K); 351| 0| } 352| 3.14k| m_free(ses.dh_K); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 353| | 354| 3.14k| m_burn(ses.keys, sizeof(struct key_context)); 355| 3.14k| m_free(ses.keys); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 356| | 357| 3.14k| TRACE(("leave session_cleanup")) 358| 3.14k|} send_session_identification: 360| 3.14k|void send_session_identification() { 361| 3.14k| buffer *writebuf = buf_new(strlen(LOCAL_IDENT "\r\n") + 1); ------------------ | | 10| 3.14k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION ------------------ 362| 3.14k| buf_putbytes(writebuf, (const unsigned char *) LOCAL_IDENT "\r\n", strlen(LOCAL_IDENT "\r\n")); ------------------ | | 10| 3.14k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION ------------------ buf_putbytes(writebuf, (const unsigned char *) LOCAL_IDENT "\r\n", strlen(LOCAL_IDENT "\r\n")); ------------------ | | 10| 3.14k|#define LOCAL_IDENT "SSH-2.0-dropbear_" DROPBEAR_VERSION ------------------ 363| 3.14k| writebuf_enqueue(writebuf); 364| 3.14k|} fill_passwd: 630| 582|void fill_passwd(const char* username) { 631| 582| struct passwd *pw = NULL; 632| 582| if (ses.authstate.pw_name) ------------------ | Branch (632:6): [True: 0, False: 582] ------------------ 633| 0| m_free(ses.authstate.pw_name); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 634| 582| if (ses.authstate.pw_dir) ------------------ | Branch (634:6): [True: 0, False: 582] ------------------ 635| 0| m_free(ses.authstate.pw_dir); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 636| 582| if (ses.authstate.pw_shell) ------------------ | Branch (636:6): [True: 0, False: 582] ------------------ 637| 0| m_free(ses.authstate.pw_shell); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 638| 582| if (ses.authstate.pw_passwd) ------------------ | Branch (638:6): [True: 0, False: 582] ------------------ 639| 0| m_free(ses.authstate.pw_passwd); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 640| | 641| 582| pw = getpwnam(username); ------------------ | | 108| 582|#define getpwnam(x) fuzz_getpwnam(x) ------------------ 642| 582| if (!pw) { ------------------ | Branch (642:6): [True: 559, False: 23] ------------------ 643| 559| return; 644| 559| } 645| 23| ses.authstate.pw_uid = pw->pw_uid; 646| 23| ses.authstate.pw_gid = pw->pw_gid; 647| 23| ses.authstate.pw_name = m_strdup(pw->pw_name); 648| 23| ses.authstate.pw_dir = m_strdup(pw->pw_dir); 649| 23| ses.authstate.pw_shell = m_strdup(pw->pw_shell); 650| 23| { 651| 23| char *passwd_crypt = pw->pw_passwd; 652| 23|#ifdef HAVE_SHADOW_H 653| | /* get the shadow password if possible */ 654| 23| struct spwd *spasswd = getspnam(ses.authstate.pw_name); 655| 23| if (spasswd && spasswd->sp_pwdp) { ------------------ | Branch (655:7): [True: 23, False: 0] | Branch (655:18): [True: 23, False: 0] ------------------ 656| 23| passwd_crypt = spasswd->sp_pwdp; 657| 23| } 658| 23|#endif 659| 23| if (!passwd_crypt) { ------------------ | Branch (659:7): [True: 0, False: 23] ------------------ 660| | /* android supposedly returns NULL */ 661| 0| passwd_crypt = "!!"; 662| 0| } 663| 23| ses.authstate.pw_passwd = m_strdup(passwd_crypt); 664| 23| } 665| 23|} update_channel_prio: 668| 3.14k|void update_channel_prio() { 669| 3.14k| enum dropbear_prio new_prio; 670| 3.14k| int any = 0; 671| 3.14k| unsigned int i; 672| | 673| 3.14k| TRACE(("update_channel_prio")) 674| | 675| 3.14k| if (ses.sock_out < 0) { ------------------ | Branch (675:6): [True: 0, False: 3.14k] ------------------ 676| 0| TRACE(("leave update_channel_prio: no socket")) 677| 0| return; 678| 0| } 679| | 680| 3.14k| new_prio = DROPBEAR_PRIO_NORMAL; 681| 3.14k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (681:14): [True: 0, False: 3.14k] ------------------ 682| 0| struct Channel *channel = ses.channels[i]; 683| 0| if (!channel) { ------------------ | Branch (683:7): [True: 0, False: 0] ------------------ 684| 0| continue; 685| 0| } 686| 0| any = 1; 687| 0| if (channel->prio == DROPBEAR_PRIO_LOWDELAY) { ------------------ | Branch (687:7): [True: 0, False: 0] ------------------ 688| 0| new_prio = DROPBEAR_PRIO_LOWDELAY; 689| 0| break; 690| 0| } 691| 0| } 692| | 693| 3.14k| if (any == 0) { ------------------ | Branch (693:6): [True: 3.14k, False: 0] ------------------ 694| | /* lowdelay during setup */ 695| 3.14k| TRACE(("update_channel_prio: not any")) 696| 3.14k| new_prio = DROPBEAR_PRIO_LOWDELAY; 697| 3.14k| } 698| | 699| 3.14k| if (new_prio != ses.socket_prio) { ------------------ | Branch (699:6): [True: 3.14k, False: 0] ------------------ 700| 3.14k| TRACE(("Dropbear priority transitioning %d -> %d", ses.socket_prio, new_prio)) 701| 3.14k| set_sock_priority(ses.sock_out, new_prio); 702| 3.14k| ses.socket_prio = new_prio; 703| 3.14k| } 704| 3.14k|} common-session.c:cleanup_buf: 284| 22.0k|static void cleanup_buf(buffer **buf) { 285| 22.0k| if (!*buf) { ------------------ | Branch (285:6): [True: 11.9k, False: 10.0k] ------------------ 286| 11.9k| return; 287| 11.9k| } 288| 10.0k| buf_burn_free(*buf); 289| 10.0k| *buf = NULL; 290| 10.0k|} common-session.c:read_session_identification: 366| 3.14k|static void read_session_identification() { 367| | /* max length of 255 chars */ 368| 3.14k| char linebuf[256]; 369| 3.14k| int len = 0; 370| 3.14k| char done = 0; 371| 3.14k| int i; 372| | 373| | /* Servers may send other lines of data before sending the 374| | * version string, client must be able to process such lines. 375| | * If they send more than 50 lines, something is wrong */ 376| 3.28k| for (i = IS_DROPBEAR_CLIENT ? 50 : 1; i > 0; i--) { ------------------ | | 320| 3.14k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (320:28): [True: 0, False: 3.14k] | | ------------------ ------------------ | Branch (376:40): [True: 3.14k, False: 143] ------------------ 377| 3.14k| len = ident_readln(ses.sock_in, linebuf, sizeof(linebuf)); 378| | 379| 3.14k| if (len < 0 && errno != EINTR) { ------------------ | Branch (379:7): [True: 101, False: 3.04k] | Branch (379:18): [True: 5, False: 96] ------------------ 380| | /* It failed */ 381| 5| break; 382| 5| } 383| | 384| 3.14k| if (len >= 4 && memcmp(linebuf, "SSH-", 4) == 0) { ------------------ | Branch (384:7): [True: 3.03k, False: 102] | Branch (384:19): [True: 2.99k, False: 41] ------------------ 385| | /* start of line matches */ 386| 2.99k| done = 1; 387| 2.99k| break; 388| 2.99k| } 389| 3.14k| } 390| | 391| 3.14k| if (!done) { ------------------ | Branch (391:6): [True: 148, False: 2.99k] ------------------ 392| 148| TRACE(("error reading remote ident: %s\n", strerror(errno))) 393| 148| ses.remoteclosed(); 394| 2.99k| } else { 395| | /* linebuf is already null terminated */ 396| 2.99k| ses.remoteident = m_malloc(len); 397| 2.99k| memcpy(ses.remoteident, linebuf, len); 398| 2.99k| } 399| | 400| | /* Shall assume that 2.x will be backwards compatible. */ 401| 3.14k| if (strncmp(ses.remoteident, "SSH-2.", 6) != 0 ------------------ | Branch (401:6): [True: 60, False: 3.08k] ------------------ 402| 3.14k| && strncmp(ses.remoteident, "SSH-1.99-", 9) != 0) { ------------------ | Branch (402:7): [True: 59, False: 1] ------------------ 403| 59| dropbear_exit("Incompatible remote version '%s'", ses.remoteident); 404| 59| } 405| | 406| 3.14k| DEBUG1(("remoteident: %s", ses.remoteident)) 407| | 408| 3.14k|} common-session.c:ident_readln: 412| 3.14k|static int ident_readln(int fd, char* buf, int count) { 413| | 414| 3.14k| char in; 415| 3.14k| int pos = 0; 416| 3.14k| int num = 0; 417| 3.14k| fd_set fds; 418| 3.14k| struct timeval timeout; 419| | 420| 3.14k| TRACE(("enter ident_readln")) 421| | 422| 3.14k| if (count < 1) { ------------------ | Branch (422:6): [True: 0, False: 3.14k] ------------------ 423| 0| return -1; 424| 0| } 425| | 426| 3.14k| DROPBEAR_FD_ZERO(&fds); ------------------ | | 104| 3.14k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ 427| | 428| | /* select since it's a non-blocking fd */ 429| | 430| | /* leave space to null-terminate */ 431| 72.2k| while (pos < count-1) { ------------------ | Branch (431:9): [True: 72.2k, False: 4] ------------------ 432| | 433| 72.2k| FD_SET(fd, &fds); 434| | 435| 72.2k| timeout.tv_sec = 1; 436| 72.2k| timeout.tv_usec = 0; 437| 72.2k| if (select(fd+1, &fds, NULL, NULL, &timeout) < 0) { ------------------ | | 53| 72.2k| wrapfd_select(nfds, readfds, writefds, exceptfds, timeout) ------------------ | Branch (437:7): [True: 68, False: 72.1k] ------------------ 438| 68| if (errno == EINTR) { ------------------ | Branch (438:8): [True: 68, False: 0] ------------------ 439| 68| continue; 440| 68| } 441| 0| TRACE(("leave ident_readln: select error")) 442| 0| return -1; 443| 68| } 444| | 445| 72.1k| checktimeouts(); 446| | 447| | /* Have to go one byte at a time, since we don't want to read past 448| | * the end, and have to somehow shove bytes back into the normal 449| | * packet reader */ 450| 72.1k| if (FD_ISSET(fd, &fds)) { 451| 72.1k| num = read(fd, &in, 1); ------------------ | | 55| 72.1k|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ 452| | /* a "\n" is a newline, "\r" we want to read in and keep going 453| | * so that it won't be read as part of the next line */ 454| 72.1k| if (num < 0) { ------------------ | Branch (454:8): [True: 123, False: 72.0k] ------------------ 455| | /* error */ 456| 123| if (errno == EINTR) { ------------------ | Branch (456:9): [True: 122, False: 1] ------------------ 457| 122| continue; /* not a real error */ 458| 122| } 459| 1| TRACE(("leave ident_readln: read error")) 460| 1| return -1; 461| 123| } 462| 72.0k| if (num == 0) { ------------------ | Branch (462:8): [True: 100, False: 71.9k] ------------------ 463| | /* EOF */ 464| 100| TRACE(("leave ident_readln: EOF")) 465| 100| return -1; 466| 100| } 467| | 468| 71.9k|#if DROPBEAR_FUZZ 469| 71.9k| fuzz_dump(&in, 1); 470| 71.9k|#endif 471| | 472| 71.9k| if (in == '\n') { ------------------ | Branch (472:8): [True: 3.04k, False: 68.8k] ------------------ 473| | /* end of ident string */ 474| 3.04k| break; 475| 3.04k| } 476| | /* we don't want to include '\r's */ 477| 68.8k| if (in != '\r') { ------------------ | Branch (477:8): [True: 51.4k, False: 17.4k] ------------------ 478| 51.4k| buf[pos] = in; 479| 51.4k| pos++; 480| 51.4k| } 481| 68.8k| } 482| 72.1k| } 483| | 484| 3.04k| buf[pos] = '\0'; 485| 3.04k| TRACE(("leave ident_readln: return %d", pos+1)) 486| 3.04k| return pos+1; 487| 3.14k|} common-session.c:checktimeouts: 533| 344k|static void checktimeouts() { 534| | 535| 344k| time_t now; 536| 344k| now = monotonic_now(); 537| | 538| 344k| if (IS_DROPBEAR_SERVER && ses.connect_time != 0 ------------------ | | 319| 689k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 344k, False: 0] | | ------------------ ------------------ | Branch (538:28): [True: 344k, False: 0] ------------------ 539| 344k| && elapsed(now, ses.connect_time) >= AUTH_TIMEOUT) { ------------------ | | 31| 344k|#define AUTH_TIMEOUT 300 /* we choose 5 minutes */ ------------------ | Branch (539:6): [True: 0, False: 344k] ------------------ 540| 0| dropbear_close("Timeout before auth"); 541| 0| } 542| | 543| | /* we can't rekey if we haven't done remote ident exchange yet */ 544| 344k| if (ses.remoteident == NULL) { ------------------ | Branch (544:6): [True: 81.7k, False: 263k] ------------------ 545| 81.7k| return; 546| 81.7k| } 547| | 548| 263k| if (!ses.kexstate.sentkexinit ------------------ | Branch (548:6): [True: 85.2k, False: 177k] ------------------ 549| 263k| && (elapsed(now, ses.kexstate.lastkextime) >= KEX_REKEY_TIMEOUT ------------------ | | 24| 170k|#define KEX_REKEY_TIMEOUT (3600 * 8) ------------------ | Branch (549:8): [True: 0, False: 85.2k] ------------------ 550| 85.2k| || ses.kexstate.datarecv+ses.kexstate.datatrans >= KEX_REKEY_DATA)) { ------------------ | | 27| 85.2k|#define KEX_REKEY_DATA (1<<30) /* 2^30 == 1GB, this value must be < INT_MAX */ ------------------ | Branch (550:7): [True: 0, False: 85.2k] ------------------ 551| 0| TRACE(("rekeying after timeout or max data reached")) 552| 0| send_msg_kexinit(); 553| 0| } 554| | 555| 263k| if (opts.keepalive_secs > 0 && ses.authstate.authdone) { ------------------ | Branch (555:6): [True: 0, False: 263k] | Branch (555:33): [True: 0, False: 0] ------------------ 556| | /* Avoid sending keepalives prior to auth - those are 557| | not valid pre-auth packet types */ 558| | 559| | /* Send keepalives if we've been idle */ 560| 0| if (elapsed(now, ses.last_packet_time_any_sent) >= opts.keepalive_secs) { ------------------ | Branch (560:7): [True: 0, False: 0] ------------------ 561| 0| send_msg_keepalive(); 562| 0| } 563| | 564| | /* Also send an explicit keepalive message to trigger a response 565| | if the remote end hasn't sent us anything */ 566| 0| if (elapsed(now, ses.last_packet_time_keepalive_recv) >= opts.keepalive_secs ------------------ | Branch (566:7): [True: 0, False: 0] ------------------ 567| 0| && elapsed(now, ses.last_packet_time_keepalive_sent) >= opts.keepalive_secs) { ------------------ | Branch (567:7): [True: 0, False: 0] ------------------ 568| 0| send_msg_keepalive(); 569| 0| } 570| | 571| 0| if (elapsed(now, ses.last_packet_time_keepalive_recv) ------------------ | Branch (571:7): [True: 0, False: 0] ------------------ 572| 0| >= opts.keepalive_secs * DEFAULT_KEEPALIVE_LIMIT) { ------------------ | | 510| 0|#define DEFAULT_KEEPALIVE_LIMIT 3 ------------------ 573| 0| dropbear_exit("Keepalive timeout"); 574| 0| } 575| 0| } 576| | 577| 263k| if (opts.idle_timeout_secs > 0 ------------------ | Branch (577:6): [True: 0, False: 263k] ------------------ 578| 263k| && elapsed(now, ses.last_packet_time_idle) >= opts.idle_timeout_secs) { ------------------ | Branch (578:7): [True: 0, False: 0] ------------------ 579| 0| dropbear_close("Idle timeout"); 580| 0| } 581| 263k|} common-session.c:elapsed: 523| 1.14M|static long elapsed(time_t now, time_t prev) { 524| 1.14M| time_t del = now - prev; 525| 1.14M| if (del > LONG_MAX) { ------------------ | Branch (525:6): [True: 0, False: 1.14M] ------------------ 526| 0| return LONG_MAX; 527| 0| } 528| 1.14M| return (long)del; 529| 1.14M|} common-session.c:select_timeout: 594| 272k|static long select_timeout() { 595| | /* determine the minimum timeout that might be required, so 596| | as to avoid waking when unneccessary */ 597| 272k| long timeout = KEX_REKEY_TIMEOUT; ------------------ | | 24| 272k|#define KEX_REKEY_TIMEOUT (3600 * 8) ------------------ 598| 272k| time_t now = monotonic_now(); 599| | 600| 272k| if (!ses.kexstate.sentkexinit) { ------------------ | Branch (600:6): [True: 85.2k, False: 187k] ------------------ 601| 85.2k| update_timeout(KEX_REKEY_TIMEOUT, now, ses.kexstate.lastkextime, &timeout); ------------------ | | 24| 85.2k|#define KEX_REKEY_TIMEOUT (3600 * 8) ------------------ 602| 85.2k| } 603| | 604| 272k| if (ses.authstate.authdone != 1 && IS_DROPBEAR_SERVER) { ------------------ | | 319| 272k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (319:28): [True: 272k, False: 0] | | ------------------ ------------------ | Branch (604:6): [True: 272k, False: 0] ------------------ 605| | /* AUTH_TIMEOUT is only relevant before authdone */ 606| 272k| update_timeout(AUTH_TIMEOUT, now, ses.connect_time, &timeout); ------------------ | | 31| 272k|#define AUTH_TIMEOUT 300 /* we choose 5 minutes */ ------------------ 607| 272k| } 608| | 609| 272k| if (ses.authstate.authdone) { ------------------ | Branch (609:6): [True: 0, False: 272k] ------------------ 610| 0| update_timeout(opts.keepalive_secs, now, 611| 0| MAX(ses.last_packet_time_keepalive_recv, ses.last_packet_time_keepalive_sent), 612| 0| &timeout); 613| 0| } 614| | 615| 272k| update_timeout(opts.idle_timeout_secs, now, ses.last_packet_time_idle, 616| 272k| &timeout); 617| | 618| | /* clamp negative timeouts to zero - event has already triggered */ 619| 272k| return MAX(timeout, 0); 620| 272k|} common-session.c:update_timeout: 583| 630k|static void update_timeout(long limit, time_t now, time_t last_event, long * timeout) { 584| 630k| TRACE2(("update_timeout limit %ld, now %llu, last %llu, timeout %ld", 585| 630k| limit, 586| 630k| (unsigned long long)now, 587| 630k| (unsigned long long)last_event, *timeout)) 588| 630k| if (last_event > 0 && limit > 0) { ------------------ | Branch (588:6): [True: 630k, False: 0] | Branch (588:24): [True: 357k, False: 272k] ------------------ 589| 357k| *timeout = MIN(*timeout, elapsed(now, last_event) + limit); 590| 357k| TRACE2(("new timeout %ld", *timeout)) 591| 357k| } 592| 630k|} crypto_init: 21| 1|void crypto_init() { 22| | 23| 1| const struct ltc_cipher_descriptor *regciphers[] = { 24| 1|#if DROPBEAR_AES 25| 1| &aes_desc, 26| 1|#endif 27| |#if DROPBEAR_3DES 28| | &des3_desc, 29| |#endif 30| 1| NULL 31| 1| }; 32| | 33| 1| const struct ltc_hash_descriptor *reghashes[] = { 34| 1|#if DROPBEAR_SHA1_HMAC 35| 1| &sha1_desc, 36| 1|#endif 37| 1|#if DROPBEAR_SHA256 38| 1| &sha256_desc, 39| 1|#endif 40| 1|#if DROPBEAR_SHA384 41| 1| &sha384_desc, 42| 1|#endif 43| 1|#if DROPBEAR_SHA512 44| 1| &sha512_desc, 45| 1|#endif 46| 1| NULL 47| 1| }; 48| 1| int i; 49| | 50| 2| for (i = 0; regciphers[i] != NULL; i++) { ------------------ | Branch (50:14): [True: 1, False: 1] ------------------ 51| 1| if (register_cipher(regciphers[i]) == -1) { ------------------ | Branch (51:7): [True: 0, False: 1] ------------------ 52| 0| dropbear_exit("Error registering crypto"); 53| 0| } 54| 1| } 55| | 56| 5| for (i = 0; reghashes[i] != NULL; i++) { ------------------ | Branch (56:14): [True: 4, False: 1] ------------------ 57| 4| if (register_hash(reghashes[i]) == -1) { ------------------ | Branch (57:7): [True: 0, False: 4] ------------------ 58| 0| dropbear_exit("Error registering crypto"); 59| 0| } 60| 4| } 61| | 62| 1|#if DROPBEAR_LTC_PRNG 63| 1| dropbear_ltc_prng = register_prng(&dropbear_prng_desc); 64| 1| if (dropbear_ltc_prng == -1) { ------------------ | Branch (64:6): [True: 0, False: 1] ------------------ 65| 0| dropbear_exit("Error registering crypto"); 66| 0| } 67| 1|#endif 68| | 69| 1| mp_rand_source(dropbear_rand_source); 70| | 71| 1|#if DROPBEAR_ECC 72| 1| ltc_mp = ltm_desc; 73| 1| dropbear_ecc_fill_dp(); 74| 1|#endif 75| 1|} m_burn: 5| 215k|void m_burn(void *data, unsigned int len) { 6| | 7| |#if defined(HAVE_MEMSET_S) 8| | memset_s(data, len, 0x0, len); 9| |#elif defined(HAVE_EXPLICIT_BZERO) 10| 215k| explicit_bzero(data, len); 11| |#else 12| | /* This must be volatile to avoid compiler optimisation */ 13| | volatile void *p = data; 14| | memset((void*)p, 0x0, len); 15| |#endif 16| 215k|} m_calloc: 5| 21.8k|void * m_calloc(size_t nmemb, size_t size) { 6| 21.8k| if (SIZE_T_MAX / nmemb < size) { ------------------ | | 166| 21.8k|#define SIZE_T_MAX ULONG_MAX ------------------ | Branch (6:9): [True: 0, False: 21.8k] ------------------ 7| 0| dropbear_exit("m_calloc failed"); 8| 0| } 9| 21.8k| return m_malloc(nmemb*size); 10| 21.8k|} m_strdup: 12| 10.1k|void * m_strdup(const char * str) { 13| 10.1k| char* ret; 14| 10.1k| unsigned int len; 15| 10.1k| len = strlen(str); 16| | 17| 10.1k| ret = m_malloc(len+1); 18| 10.1k| if (ret == NULL) { ------------------ | Branch (18:9): [True: 0, False: 10.1k] ------------------ 19| 0| dropbear_exit("m_strdup failed"); 20| 0| } 21| 10.1k| memcpy(ret, str, len+1); 22| 10.1k| return ret; 23| 10.1k|} m_malloc_set_epoch: 76| 3.14k|void m_malloc_set_epoch(unsigned int epoch) { 77| 3.14k| current_epoch = epoch; 78| 3.14k|} m_malloc_free_epoch: 80| 3.14k|void m_malloc_free_epoch(unsigned int epoch, int dofree) { 81| 3.14k| struct dbmalloc_header* header; 82| 3.14k| struct dbmalloc_header* nextheader = NULL; 83| 3.14k| struct dbmalloc_header* oldstaple = staple; 84| 3.14k| staple = NULL; 85| | /* free allocations from this epoch, create a new staple-anchored list from 86| | the remainder */ 87| 3.27M| for (header = oldstaple; header; header = nextheader) ------------------ | Branch (87:30): [True: 3.27M, False: 3.14k] ------------------ 88| 3.27M| { 89| 3.27M| nextheader = header->next; 90| 3.27M| if (header->epoch == epoch) { ------------------ | Branch (90:13): [True: 986, False: 3.27M] ------------------ 91| 986| if (dofree) { ------------------ | Branch (91:17): [True: 986, False: 0] ------------------ 92| 986| free(header); 93| 986| } 94| 3.27M| } else { 95| 3.27M| header->prev = NULL; 96| 3.27M| header->next = NULL; 97| 3.27M| put_alloc(header); 98| 3.27M| } 99| 3.27M| } 100| 3.14k|} m_malloc: 131| 378k|void * m_malloc(size_t size) { 132| 378k| char* mem = NULL; 133| 378k| struct dbmalloc_header* header = NULL; 134| | 135| 378k| if (size == 0 || size > 1e9) { ------------------ | Branch (135:9): [True: 0, False: 378k] | Branch (135:22): [True: 0, False: 378k] ------------------ 136| 0| dropbear_exit("m_malloc failed"); 137| 0| } 138| | 139| 378k| size = size + sizeof(struct dbmalloc_header); 140| | 141| 378k| mem = calloc(1, size); 142| 378k| if (mem == NULL) { ------------------ | Branch (142:9): [True: 0, False: 378k] ------------------ 143| 0| dropbear_exit("m_malloc failed"); 144| 0| } 145| 378k| header = (struct dbmalloc_header*)mem; 146| 378k| put_alloc(header); 147| 378k| header->epoch = current_epoch; 148| 378k| return &mem[sizeof(struct dbmalloc_header)]; 149| 378k|} m_realloc: 151| 11.8k|void * m_realloc(void* ptr, size_t size) { 152| 11.8k| char* mem = NULL; 153| 11.8k| struct dbmalloc_header* header = NULL; 154| 11.8k| if (size == 0 || size > 1e9) { ------------------ | Branch (154:9): [True: 0, False: 11.8k] | Branch (154:22): [True: 0, False: 11.8k] ------------------ 155| 0| dropbear_exit("m_realloc failed"); 156| 0| } 157| | 158| 11.8k| header = get_header(ptr); 159| 11.8k| remove_alloc(header); 160| | 161| 11.8k| size = size + sizeof(struct dbmalloc_header); 162| 11.8k| mem = realloc(header, size); 163| 11.8k| if (mem == NULL) { ------------------ | Branch (163:9): [True: 0, False: 11.8k] ------------------ 164| 0| dropbear_exit("m_realloc failed"); 165| 0| } 166| | 167| 11.8k| header = (struct dbmalloc_header*)mem; 168| 11.8k| put_alloc(header); 169| 11.8k| return &mem[sizeof(struct dbmalloc_header)]; 170| 11.8k|} m_free_direct: 172| 395k|void m_free_direct(void* ptr) { 173| 395k| struct dbmalloc_header* header = NULL; 174| 395k| if (!ptr) { ------------------ | Branch (174:9): [True: 19.4k, False: 375k] ------------------ 175| 19.4k| return; 176| 19.4k| } 177| 375k| header = get_header(ptr); 178| 375k| remove_alloc(header); 179| 375k| free(header); 180| 375k|} m_realloc_ltm: 184| 1.71k|void * m_realloc_ltm(void* ptr, size_t oldsize, size_t newsize) { 185| 1.71k| (void)oldsize; 186| 1.71k| return m_realloc(ptr, newsize); 187| 1.71k|} m_free_ltm: 189| 21.7k|void m_free_ltm(void *mem, size_t size) { 190| 21.7k| (void)size; 191| 21.7k| m_free_direct(mem); 192| 21.7k|} dbmalloc.c:put_alloc: 102| 3.66M|static void put_alloc(struct dbmalloc_header *header) { 103| 3.66M| assert(header->next == NULL); 104| 3.66M| assert(header->prev == NULL); 105| 3.66M| if (staple) { ------------------ | Branch (105:9): [True: 3.65M, False: 3.14k] ------------------ 106| 3.65M| staple->prev = header; 107| 3.65M| } 108| 3.66M| header->next = staple; 109| 3.66M| staple = header; 110| 3.66M|} dbmalloc.c:get_header: 126| 387k|static struct dbmalloc_header* get_header(void* ptr) { 127| 387k| char* bptr = ptr; 128| 387k| return (struct dbmalloc_header*)&bptr[-sizeof(struct dbmalloc_header)]; 129| 387k|} dbmalloc.c:remove_alloc: 112| 387k|static void remove_alloc(struct dbmalloc_header *header) { 113| 387k| if (header->prev) { ------------------ | Branch (113:9): [True: 175k, False: 212k] ------------------ 114| 175k| header->prev->next = header->next; 115| 175k| } 116| 387k| if (header->next) { ------------------ | Branch (116:9): [True: 387k, False: 0] ------------------ 117| 387k| header->next->prev = header->prev; 118| 387k| } 119| 387k| if (staple == header) { ------------------ | Branch (119:9): [True: 212k, False: 175k] ------------------ 120| 212k| staple = header->next; 121| 212k| } 122| 387k| header->prev = NULL; 123| 387k| header->next = NULL; 124| 387k|} fuzz_seed: 153| 3.14k|void fuzz_seed(const unsigned char* dat, unsigned int len) { 154| 3.14k| hash_state hs; 155| 3.14k| sha256_init(&hs); 156| 3.14k| sha256_process(&hs, "fuzzfuzzfuzz", strlen("fuzzfuzzfuzz")); 157| 3.14k| sha256_process(&hs, dat, len); 158| 3.14k| sha256_done(&hs, hashpool); 159| 3.14k| counter = 0; 160| 3.14k| donerandinit = 1; 161| 3.14k|} genrandom: 316| 58.7k|void genrandom(unsigned char* buf, unsigned int len) { 317| | 318| 58.7k| hash_state hs; 319| 58.7k| unsigned char hash[SHA256_HASH_SIZE]; 320| 58.7k| unsigned int copylen; 321| | 322| 58.7k| if (!donerandinit) { ------------------ | Branch (322:6): [True: 0, False: 58.7k] ------------------ 323| 0| dropbear_exit("seedrandom not done"); 324| 0| } 325| | 326| 117k| while (len > 0) { ------------------ | Branch (326:9): [True: 58.7k, False: 58.7k] ------------------ 327| 58.7k| sha256_init(&hs); 328| 58.7k| sha256_process(&hs, (void*)hashpool, sizeof(hashpool)); 329| 58.7k| sha256_process(&hs, (void*)&counter, sizeof(counter)); 330| 58.7k| sha256_done(&hs, hash); 331| | 332| 58.7k| counter++; 333| 58.7k| if (counter > MAX_COUNTER) { ------------------ | | 35| 58.7k|#define MAX_COUNTER (1<<30) ------------------ | Branch (333:7): [True: 0, False: 58.7k] ------------------ 334| 0| seedrandom(); 335| 0| } 336| | 337| 58.7k| copylen = MIN(len, SHA256_HASH_SIZE); 338| 58.7k| memcpy(buf, hash, copylen); 339| 58.7k| len -= copylen; 340| 58.7k| buf += copylen; 341| 58.7k| } 342| 58.7k| m_burn(hash, sizeof(hash)); 343| 58.7k|} dropbear_close: 95| 1.44k|void dropbear_close(const char* format, ...) { 96| | 97| 1.44k| va_list param; 98| | 99| 1.44k| va_start(param, format); 100| 1.44k| _dropbear_exit(EXIT_SUCCESS, format, param); 101| 0| va_end(param); 102| | 103| 0|} dropbear_exit: 105| 1.70k|void dropbear_exit(const char* format, ...) { 106| | 107| 1.70k| va_list param; 108| | 109| 1.70k| va_start(param, format); 110| 1.70k| _dropbear_exit(EXIT_FAILURE, format, param); 111| 0| va_end(param); 112| 0|} dropbear_log: 148| 3.70k|void dropbear_log(int priority, const char* format, ...) { 149| | 150| 3.70k| va_list param; 151| | 152| 3.70k| va_start(param, format); 153| 3.70k| _dropbear_log(priority, format, param); 154| 3.70k| va_end(param); 155| 3.70k|} m_close: 560| 1.43k|void m_close(int fd) { 561| 1.43k| int val; 562| | 563| 1.43k| if (fd < 0) { ------------------ | Branch (563:6): [True: 0, False: 1.43k] ------------------ 564| 0| return; 565| 0| } 566| | 567| 1.43k| do { 568| 1.43k| val = close(fd); ------------------ | | 56| 1.43k|#define close(fd) wrapfd_close(fd) ------------------ 569| 1.43k| } while (val < 0 && errno == EINTR); ------------------ | Branch (569:11): [True: 0, False: 1.43k] | Branch (569:22): [True: 0, False: 0] ------------------ 570| | 571| 1.43k| if (val < 0 && errno != EBADF) { ------------------ | Branch (571:6): [True: 0, False: 1.43k] | Branch (571:17): [True: 0, False: 0] ------------------ 572| | /* Linux says EIO can happen */ 573| 0| dropbear_exit("Error closing fd %d, %s", fd, strerror(errno)); 574| 0| } 575| 1.43k|} setnonblocking: 577| 6.29k|void setnonblocking(int fd) { 578| | 579| 6.29k| TRACE(("setnonblocking: %d", fd)) 580| | 581| 6.29k|#if DROPBEAR_FUZZ 582| 6.29k| if (fuzz.fuzzing) { ------------------ | Branch (582:6): [True: 6.29k, False: 0] ------------------ 583| 6.29k| return; 584| 6.29k| } 585| 0|#endif 586| | 587| 0| if (fcntl(fd, F_SETFL, O_NONBLOCK) < 0) { ------------------ | Branch (587:6): [True: 0, False: 0] ------------------ 588| 0| if (errno == ENODEV) { ------------------ | Branch (588:7): [True: 0, False: 0] ------------------ 589| | /* Some devices (like /dev/null redirected in) 590| | * can't be set to non-blocking */ 591| 0| TRACE(("ignoring ENODEV for setnonblocking")) 592| 0| } else { 593| 0| { 594| 0| dropbear_exit("Couldn't set nonblocking"); 595| 0| } 596| 0| } 597| 0| } 598| 0| TRACE(("leave setnonblocking")) 599| 0|} disallow_core: 601| 1|void disallow_core() { 602| 1| struct rlimit lim = {0}; 603| 1| if (getrlimit(RLIMIT_CORE, &lim) < 0) { ------------------ | Branch (603:6): [True: 0, False: 1] ------------------ 604| 0| TRACE(("getrlimit(RLIMIT_CORE) failed")); 605| 0| } 606| 1| lim.rlim_cur = 0; 607| 1| if (setrlimit(RLIMIT_CORE, &lim) < 0) { ------------------ | Branch (607:6): [True: 0, False: 1] ------------------ 608| 0| TRACE(("setrlimit(RLIMIT_CORE) failed")); 609| 0| } 610| 1|} expand_homedir_path: 638| 1|char * expand_homedir_path(const char *inpath) { 639| 1| struct passwd *pw = NULL; 640| 1| if (strncmp(inpath, "~/", 2) == 0) { ------------------ | Branch (640:6): [True: 0, False: 1] ------------------ 641| 0| char *homedir = getenv("HOME"); 642| | 643| 0| if (!homedir) { ------------------ | Branch (643:7): [True: 0, False: 0] ------------------ 644| 0| pw = getpwuid(getuid()); ------------------ | | 109| 0|#define getpwuid(x) fuzz_getpwuid(x) ------------------ 645| 0| if (pw) { ------------------ | Branch (645:8): [True: 0, False: 0] ------------------ 646| 0| homedir = pw->pw_dir; 647| 0| } 648| 0| } 649| | 650| 0| if (homedir) { ------------------ | Branch (650:7): [True: 0, False: 0] ------------------ 651| 0| int len = strlen(inpath)-2 + strlen(homedir) + 2; 652| 0| char *buf = m_malloc(len); 653| 0| snprintf(buf, len, "%s/%s", homedir, inpath+2); 654| 0| return buf; 655| 0| } 656| 0| } 657| | 658| | /* Fallback */ 659| 1| return m_strdup(inpath); 660| 1|} gettime_wrapper: 675| 733k|void gettime_wrapper(struct timespec *now) { 676| 733k| struct timeval tv; 677| 733k|#if DROPBEAR_FUZZ 678| 733k| if (fuzz.fuzzing) { ------------------ | Branch (678:6): [True: 733k, False: 0] ------------------ 679| | /* time stands still when fuzzing */ 680| 733k| now->tv_sec = 5; 681| 733k| now->tv_nsec = 0; 682| 733k| } 683| 733k|#endif 684| | 685| 733k|#if defined(HAVE_CLOCK_GETTIME) && defined(CLOCK_MONOTONIC) 686| | /* POSIX monotonic clock. Newer Linux, BSD, MacOSX >10.12 */ 687| 733k| if (clock_gettime(CLOCK_MONOTONIC, now) == 0) { ------------------ | Branch (687:6): [True: 733k, False: 0] ------------------ 688| 733k| return; 689| 733k| } 690| 0|#endif 691| | 692| 0|#if defined(__linux__) && defined(SYS_clock_gettime) 693| 0| { 694| | /* Old linux toolchain - kernel might support it but not the build headers */ 695| | /* Also glibc <2.17 requires -lrt which we neglect to add */ 696| 0| static int linux_monotonic_failed = 0; 697| 0| if (!linux_monotonic_failed) { ------------------ | Branch (697:6): [True: 0, False: 0] ------------------ 698| | /* CLOCK_MONOTONIC isn't in some headers */ 699| 0| int clock_source_monotonic = 1; 700| 0| if (syscall(SYS_clock_gettime, clock_source_monotonic, now) == 0) { ------------------ | Branch (700:7): [True: 0, False: 0] ------------------ 701| 0| return; 702| 0| } else { 703| | /* Don't try again */ 704| 0| linux_monotonic_failed = 1; 705| 0| } 706| 0| } 707| 0| } 708| 0|#endif /* linux fallback clock_gettime */ 709| | 710| |#if defined(HAVE_MACH_ABSOLUTE_TIME) 711| | { 712| | /* OS X pre 10.12, see https://developer.apple.com/library/mac/qa/qa1398/_index.html */ 713| | static mach_timebase_info_data_t timebase_info; 714| | uint64_t scaled_time; 715| | if (timebase_info.denom == 0) { 716| | mach_timebase_info(&timebase_info); 717| | } 718| | scaled_time = mach_absolute_time() * timebase_info.numer / timebase_info.denom; 719| | now->tv_sec = scaled_time / 1000000000; 720| | now->tv_nsec = scaled_time % 1000000000; 721| | } 722| |#endif /* osx mach_absolute_time */ 723| | 724| | /* Fallback for everything else - this will sometimes go backwards */ 725| 0| gettimeofday(&tv, NULL); 726| 0| now->tv_sec = tv.tv_sec; 727| 0| now->tv_nsec = 1000*(long)tv.tv_usec; 728| 0|} monotonic_now: 731| 730k|time_t monotonic_now() { 732| 730k| struct timespec ts; 733| 730k| gettime_wrapper(&ts); 734| 730k| return ts.tv_sec; 735| 730k|} buf_get_dss_pub_key: 46| 1|int buf_get_dss_pub_key(buffer* buf, dropbear_dss_key *key) { 47| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 48| | 49| 1| TRACE(("enter buf_get_dss_pub_key")) 50| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 51| 1| m_mp_alloc_init_multi(&key->p, &key->q, &key->g, &key->y, NULL); 52| 1| key->x = NULL; 53| | 54| 1| buf_incrpos(buf, 4+SSH_SIGNKEY_DSS_LEN); /* int + "ssh-dss" */ ------------------ | | 111| 1|#define SSH_SIGNKEY_DSS_LEN 7 ------------------ 55| 1| if (buf_getmpint(buf, key->p) == DROPBEAR_FAILURE ------------------ | | 103| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (55:6): [True: 0, False: 1] ------------------ 56| 1| || buf_getmpint(buf, key->q) == DROPBEAR_FAILURE ------------------ | | 103| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (56:6): [True: 0, False: 1] ------------------ 57| 1| || buf_getmpint(buf, key->g) == DROPBEAR_FAILURE ------------------ | | 103| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (57:6): [True: 0, False: 1] ------------------ 58| 1| || buf_getmpint(buf, key->y) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (58:6): [True: 0, False: 1] ------------------ 59| 0| TRACE(("leave buf_get_dss_pub_key: failed reading mpints")) 60| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 61| 0| goto out; 62| 0| } 63| | 64| 1| if (mp_count_bits(key->p) != DSS_P_BITS) { ------------------ | | 44| 1|#define DSS_P_BITS 1024 ------------------ | Branch (64:6): [True: 0, False: 1] ------------------ 65| 0| dropbear_log(LOG_WARNING, "Bad DSS p"); 66| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 67| 0| goto out; 68| 0| } 69| | 70| 1| if (mp_count_bits(key->q) != DSS_Q_BITS) { ------------------ | | 45| 1|#define DSS_Q_BITS 160 ------------------ | Branch (70:6): [True: 0, False: 1] ------------------ 71| 0| dropbear_log(LOG_WARNING, "Bad DSS q"); 72| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 73| 0| goto out; 74| 0| } 75| | 76| | /* test 1 < g < p */ 77| 1| if (mp_cmp_d(key->g, 1) != MP_GT) { ------------------ | | 156| 1|#define MP_GT 1 /* greater than */ ------------------ | Branch (77:6): [True: 0, False: 1] ------------------ 78| 0| dropbear_log(LOG_WARNING, "Bad DSS g"); 79| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 80| 0| goto out; 81| 0| } 82| 1| if (mp_cmp(key->g, key->p) != MP_LT) { ------------------ | | 154| 1|#define MP_LT -1 /* less than */ ------------------ | Branch (82:6): [True: 0, False: 1] ------------------ 83| 0| dropbear_log(LOG_WARNING, "Bad DSS g"); 84| 0| ret = DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 85| 0| goto out; 86| 0| } 87| | 88| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 89| 1| TRACE(("leave buf_get_dss_pub_key: success")) 90| 1|out: 91| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (91:6): [True: 0, False: 1] ------------------ 92| 0| m_mp_free_multi(&key->p, &key->q, &key->g, &key->y, NULL); 93| 0| } 94| 1| return ret; 95| 1|} buf_get_dss_priv_key: 100| 1|int buf_get_dss_priv_key(buffer* buf, dropbear_dss_key *key) { 101| | 102| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 103| | 104| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 105| | 106| 1| ret = buf_get_dss_pub_key(buf, key); 107| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (107:6): [True: 0, False: 1] ------------------ 108| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 109| 0| } 110| | 111| 1| m_mp_alloc_init_multi(&key->x, NULL); 112| 1| ret = buf_getmpint(buf, key->x); 113| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (113:6): [True: 0, False: 1] ------------------ 114| 0| m_mp_free_multi(&key->x, NULL); 115| 0| } 116| | 117| 1| return ret; 118| 1|} dss_key_free: 122| 1|void dss_key_free(dropbear_dss_key *key) { 123| | 124| 1| TRACE2(("enter dsa_key_free")) 125| 1| if (key == NULL) { ------------------ | Branch (125:6): [True: 1, False: 0] ------------------ 126| 1| TRACE2(("enter dsa_key_free: key == NULL")) 127| 1| return; 128| 1| } 129| 0| m_mp_free_multi(&key->p, &key->q, &key->g, &key->y, &key->x, NULL); 130| 0| m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 131| 0| TRACE2(("leave dsa_key_free")) 132| 0|} dropbear_ecc_fill_dp: 47| 1|void dropbear_ecc_fill_dp() { 48| 1| struct dropbear_ecc_curve **curve; 49| | /* libtomcrypt guarantees they're ordered by size */ 50| 1| const ltc_ecc_set_type *dp = ltc_ecc_sets; 51| 4| for (curve = dropbear_ecc_curves; *curve; curve++) { ------------------ | Branch (51:36): [True: 3, False: 1] ------------------ 52| 10| for (;dp->size > 0; dp++) { ------------------ | Branch (52:9): [True: 10, False: 0] ------------------ 53| 10| if (dp->size == (*curve)->ltc_size) { ------------------ | Branch (53:8): [True: 3, False: 7] ------------------ 54| 3| (*curve)->dp = dp; 55| 3| break; 56| 3| } 57| 10| } 58| 3| if (!(*curve)->dp) { ------------------ | Branch (58:7): [True: 0, False: 3] ------------------ 59| 0| dropbear_exit("Missing ECC params %s", (*curve)->name); 60| 0| } 61| 3| } 62| 1|} new_ecc_key: 75| 1|ecc_key * new_ecc_key(void) { 76| 1| ecc_key *key = m_malloc(sizeof(*key)); 77| 1| m_mp_alloc_init_multi((mp_int**)&key->pubkey.x, (mp_int**)&key->pubkey.y, 78| 1| (mp_int**)&key->pubkey.z, (mp_int**)&key->k, NULL); 79| 1| return key; 80| 1|} buf_get_ecc_raw_pubkey: 147| 1|ecc_key * buf_get_ecc_raw_pubkey(buffer *buf, const struct dropbear_ecc_curve *curve) { 148| 1| ecc_key *key = NULL; 149| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 150| 1| const unsigned int size = curve->dp->size; 151| 1| unsigned char first; 152| | 153| 1| TRACE(("enter buf_get_ecc_raw_pubkey")) 154| | 155| 1| buf_setpos(buf, 0); 156| 1| first = buf_getbyte(buf); 157| 1| if (first == 2 || first == 3) { ------------------ | Branch (157:6): [True: 0, False: 1] | Branch (157:20): [True: 0, False: 1] ------------------ 158| 0| dropbear_log(LOG_WARNING, "Dropbear doesn't support ECC point compression"); 159| 0| return NULL; 160| 0| } 161| 1| if (first != 4 || buf->len != 1+2*size) { ------------------ | Branch (161:6): [True: 0, False: 1] | Branch (161:20): [True: 0, False: 1] ------------------ 162| 0| TRACE(("leave, wrong size")) 163| 0| return NULL; 164| 0| } 165| | 166| 1| key = new_ecc_key(); 167| 1| key->dp = curve->dp; 168| | 169| 1| if (mp_from_ubin(key->pubkey.x, buf_getptr(buf, size), size) != MP_OKAY) { ------------------ | | 161| 1|#define MP_OKAY 0 /* no error */ ------------------ | Branch (169:6): [True: 0, False: 1] ------------------ 170| 0| TRACE(("failed to read x")) 171| 0| goto out; 172| 0| } 173| 1| buf_incrpos(buf, size); 174| | 175| 1| if (mp_from_ubin(key->pubkey.y, buf_getptr(buf, size), size) != MP_OKAY) { ------------------ | | 161| 1|#define MP_OKAY 0 /* no error */ ------------------ | Branch (175:6): [True: 0, False: 1] ------------------ 176| 0| TRACE(("failed to read y")) 177| 0| goto out; 178| 0| } 179| 1| buf_incrpos(buf, size); 180| | 181| 1| mp_set(key->pubkey.z, 1); 182| | 183| 1| if (ecc_is_point(key) != CRYPT_OK) { ------------------ | Branch (183:6): [True: 0, False: 1] ------------------ 184| 0| TRACE(("failed, not a point")) 185| 0| goto out; 186| 0| } 187| | 188| | /* SEC1 3.2.3.1 Check that Q != 0 */ 189| 1| if (mp_cmp_d(key->pubkey.x, 0) == LTC_MP_EQ) { ------------------ | | 13| 1|#define LTC_MP_EQ 0 ------------------ | Branch (189:6): [True: 0, False: 1] ------------------ 190| 0| TRACE(("failed, x == 0")) 191| 0| goto out; 192| 0| } 193| 1| if (mp_cmp_d(key->pubkey.y, 0) == LTC_MP_EQ) { ------------------ | | 13| 1|#define LTC_MP_EQ 0 ------------------ | Branch (193:6): [True: 0, False: 1] ------------------ 194| 0| TRACE(("failed, y == 0")) 195| 0| goto out; 196| 0| } 197| | 198| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 199| | 200| 1| out: 201| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (201:6): [True: 0, False: 1] ------------------ 202| 0| if (key) { ------------------ | Branch (202:7): [True: 0, False: 0] ------------------ 203| 0| ecc_free(key); 204| 0| m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 205| 0| key = NULL; 206| 0| } 207| 0| } 208| | 209| 1| return key; 210| | 211| 1|} ecc.c:ecc_is_point: 85| 1|{ 86| 1| mp_int *prime, *b, *t1, *t2; 87| 1| int err; 88| | 89| 1| m_mp_alloc_init_multi(&prime, &b, &t1, &t2, NULL); 90| | 91| | /* load prime and b */ 92| 1| if ((err = mp_read_radix(prime, key->dp->prime, 16)) != CRYPT_OK) { goto error; } ------------------ | Branch (92:6): [True: 0, False: 1] ------------------ 93| 1| if ((err = mp_read_radix(b, key->dp->B, 16)) != CRYPT_OK) { goto error; } ------------------ | Branch (93:6): [True: 0, False: 1] ------------------ 94| | 95| | /* compute y^2 */ 96| 1| if ((err = mp_sqr(key->pubkey.y, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (96:6): [True: 0, False: 1] ------------------ 97| | 98| | /* compute x^3 */ 99| 1| if ((err = mp_sqr(key->pubkey.x, t2)) != CRYPT_OK) { goto error; } ------------------ | Branch (99:6): [True: 0, False: 1] ------------------ 100| 1| if ((err = mp_mod(t2, prime, t2)) != CRYPT_OK) { goto error; } ------------------ | Branch (100:6): [True: 0, False: 1] ------------------ 101| 1| if ((err = mp_mul(key->pubkey.x, t2, t2)) != CRYPT_OK) { goto error; } ------------------ | Branch (101:6): [True: 0, False: 1] ------------------ 102| | 103| | /* compute y^2 - x^3 */ 104| 1| if ((err = mp_sub(t1, t2, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (104:6): [True: 0, False: 1] ------------------ 105| | 106| | /* compute y^2 - x^3 + 3x */ 107| 1| if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (107:6): [True: 0, False: 1] ------------------ 108| 1| if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (108:6): [True: 0, False: 1] ------------------ 109| 1| if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (109:6): [True: 0, False: 1] ------------------ 110| 1| if ((err = mp_mod(t1, prime, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (110:6): [True: 0, False: 1] ------------------ 111| 1| while (mp_cmp_d(t1, 0) == LTC_MP_LT) { ------------------ | | 12| 1|#define LTC_MP_LT -1 ------------------ | Branch (111:9): [True: 0, False: 1] ------------------ 112| 0| if ((err = mp_add(t1, prime, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (112:7): [True: 0, False: 0] ------------------ 113| 0| } 114| 1| while (mp_cmp(t1, prime) != LTC_MP_LT) { ------------------ | | 12| 1|#define LTC_MP_LT -1 ------------------ | Branch (114:9): [True: 0, False: 1] ------------------ 115| 0| if ((err = mp_sub(t1, prime, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (115:7): [True: 0, False: 0] ------------------ 116| 0| } 117| | 118| | /* compare to b */ 119| 1| if (mp_cmp(t1, b) != LTC_MP_EQ) { ------------------ | | 13| 1|#define LTC_MP_EQ 0 ------------------ | Branch (119:6): [True: 0, False: 1] ------------------ 120| 0| err = CRYPT_INVALID_PACKET; 121| 1| } else { 122| 1| err = CRYPT_OK; 123| 1| } 124| | 125| 1| error: 126| 1| mp_clear_multi(prime, b, t1, t2, NULL); 127| 1| m_free(prime); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 128| 1| m_free(b); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 129| 1| m_free(t1); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 130| 1| m_free(t2); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 131| 1| return err; 132| 1|} signkey_is_ecdsa: 11| 4|{ 12| 4| return type == DROPBEAR_SIGNKEY_ECDSA_NISTP256 ------------------ | Branch (12:9): [True: 1, False: 3] ------------------ 13| 4| || type == DROPBEAR_SIGNKEY_ECDSA_NISTP384 ------------------ | Branch (13:6): [True: 0, False: 3] ------------------ 14| 4| || type == DROPBEAR_SIGNKEY_ECDSA_NISTP521; ------------------ | Branch (14:6): [True: 0, False: 3] ------------------ 15| 4|} buf_get_ecdsa_pub_key: 77| 1|ecc_key *buf_get_ecdsa_pub_key(buffer* buf) { 78| 1| unsigned char *key_ident = NULL, *identifier = NULL; 79| 1| unsigned int key_ident_len, identifier_len; 80| 1| buffer *q_buf = NULL; 81| 1| struct dropbear_ecc_curve **curve; 82| 1| ecc_key *new_key = NULL; 83| | 84| | /* string "ecdsa-sha2-[identifier]" or "sk-ecdsa-sha2-nistp256@openssh.com" */ 85| 1| key_ident = (unsigned char*)buf_getstring(buf, &key_ident_len); 86| | /* string "[identifier]" */ 87| 1| identifier = (unsigned char*)buf_getstring(buf, &identifier_len); 88| | 89| 1| if (strcmp (key_ident, "sk-ecdsa-sha2-nistp256@openssh.com") == 0) { ------------------ | Branch (89:6): [True: 0, False: 1] ------------------ 90| 0| if (strcmp (identifier, "nistp256") != 0) { ------------------ | Branch (90:7): [True: 0, False: 0] ------------------ 91| 0| TRACE(("mismatching identifiers")) 92| 0| goto out; 93| 0| } 94| 1| } else { 95| 1| if (key_ident_len != identifier_len + strlen ("ecdsa-sha2-")) { ------------------ | Branch (95:7): [True: 0, False: 1] ------------------ 96| 0| TRACE(("Bad identifier lengths")) 97| 0| goto out; 98| 0| } 99| 1| if (memcmp(&key_ident[strlen ("ecdsa-sha2-")], identifier, identifier_len) != 0) { ------------------ | Branch (99:7): [True: 0, False: 1] ------------------ 100| 0| TRACE(("mismatching identifiers")) 101| 0| goto out; 102| 0| } 103| 1| } 104| | 105| 1| for (curve = dropbear_ecc_curves; *curve; curve++) { ------------------ | Branch (105:36): [True: 1, False: 0] ------------------ 106| 1| if (memcmp(identifier, (char*)(*curve)->name, strlen((char*)(*curve)->name)) == 0) { ------------------ | Branch (106:7): [True: 1, False: 0] ------------------ 107| 1| break; 108| 1| } 109| 1| } 110| 1| if (!*curve) { ------------------ | Branch (110:6): [True: 0, False: 1] ------------------ 111| 0| TRACE(("couldn't match ecc curve")) 112| 0| goto out; 113| 0| } 114| | 115| | /* string Q */ 116| 1| q_buf = buf_getstringbuf(buf); 117| 1| new_key = buf_get_ecc_raw_pubkey(q_buf, *curve); 118| | 119| 1|out: 120| 1| m_free(key_ident); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 121| 1| m_free(identifier); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 122| 1| if (q_buf) { ------------------ | Branch (122:6): [True: 1, False: 0] ------------------ 123| 1| buf_free(q_buf); 124| 1| q_buf = NULL; 125| 1| } 126| 1| TRACE(("leave buf_get_ecdsa_pub_key")) 127| 1| return new_key; 128| 1|} buf_get_ecdsa_priv_key: 130| 1|ecc_key *buf_get_ecdsa_priv_key(buffer *buf) { 131| 1| ecc_key *new_key = NULL; 132| 1| TRACE(("enter buf_get_ecdsa_priv_key")) 133| 1| new_key = buf_get_ecdsa_pub_key(buf); 134| 1| if (!new_key) { ------------------ | Branch (134:6): [True: 0, False: 1] ------------------ 135| 0| return NULL; 136| 0| } 137| | 138| 1| if (buf_getmpint(buf, new_key->k) != DROPBEAR_SUCCESS) { ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (138:6): [True: 0, False: 1] ------------------ 139| 0| ecc_free(new_key); 140| 0| m_free(new_key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 141| 0| return NULL; 142| 0| } 143| | 144| 1| return new_key; 145| 1|} buf_get_ed25519_priv_key: 78| 1|int buf_get_ed25519_priv_key(buffer *buf, dropbear_ed25519_key *key) { 79| | 80| 1| unsigned int len; 81| | 82| 1| TRACE(("enter buf_get_ed25519_priv_key")) 83| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 84| | 85| 1| buf_incrpos(buf, 4+SSH_SIGNKEY_ED25519_LEN); /* int + "ssh-ed25519" */ ------------------ | | 115| 1|#define SSH_SIGNKEY_ED25519_LEN 11 ------------------ 86| | 87| 1| len = buf_getint(buf); 88| 1| if (len != CURVE25519_LEN*2 || buf->len - buf->pos < len) { ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ | Branch (88:6): [True: 0, False: 1] | Branch (88:33): [True: 0, False: 1] ------------------ 89| 0| TRACE(("leave buf_get_ed25519_priv_key: failure")) 90| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 91| 0| } 92| | 93| 1| memcpy(key->priv, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ memcpy(key->priv, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 94| 1| buf_incrpos(buf, CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 95| 1| memcpy(key->pub, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ memcpy(key->pub, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 96| 1| buf_incrpos(buf, CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 97| | 98| 1| TRACE(("leave buf_get_ed25519_priv_key: success")) 99| 1| return DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 100| 1|} ed25519_key_free: 103| 1|void ed25519_key_free(dropbear_ed25519_key *key) { 104| | 105| 1| TRACE2(("enter ed25519_key_free")) 106| | 107| 1| if (key == NULL) { ------------------ | Branch (107:6): [True: 1, False: 0] ------------------ 108| 1| TRACE2(("leave ed25519_key_free: key == NULL")) 109| 1| return; 110| 1| } 111| 0| m_burn(key->priv, CURVE25519_LEN); ------------------ | | 34| 0|#define CURVE25519_LEN 32 ------------------ 112| 0| m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 113| | 114| 0| TRACE2(("leave ed25519_key_free")) 115| 0|} listeners_initialise: 30| 3.14k|void listeners_initialise() { 31| | 32| | /* just one slot to start with */ 33| 3.14k| ses.listeners = (struct Listener**)m_malloc(sizeof(struct Listener*)); 34| 3.14k| ses.listensize = 1; 35| 3.14k| ses.listeners[0] = NULL; 36| | 37| 3.14k|} set_listener_fds: 39| 272k|void set_listener_fds(fd_set * readfds) { 40| | 41| 272k| unsigned int i, j; 42| 272k| struct Listener *listener; 43| | 44| | /* check each in turn */ 45| 545k| for (i = 0; i < ses.listensize; i++) { ------------------ | Branch (45:14): [True: 272k, False: 272k] ------------------ 46| 272k| listener = ses.listeners[i]; 47| 272k| if (listener != NULL) { ------------------ | Branch (47:7): [True: 0, False: 272k] ------------------ 48| 0| for (j = 0; j < listener->nsocks; j++) { ------------------ | Branch (48:16): [True: 0, False: 0] ------------------ 49| 0| FD_SET(listener->socks[j], readfds); 50| 0| } 51| 0| } 52| 272k| } 53| 272k|} handle_listeners: 56| 269k|void handle_listeners(const fd_set * readfds) { 57| | 58| 269k| unsigned int i, j; 59| 269k| struct Listener *listener; 60| 269k| int sock; 61| | 62| | /* check each in turn */ 63| 539k| for (i = 0; i < ses.listensize; i++) { ------------------ | Branch (63:14): [True: 269k, False: 269k] ------------------ 64| 269k| listener = ses.listeners[i]; 65| 269k| if (listener != NULL) { ------------------ | Branch (65:7): [True: 0, False: 269k] ------------------ 66| 0| for (j = 0; j < listener->nsocks; j++) { ------------------ | Branch (66:16): [True: 0, False: 0] ------------------ 67| 0| sock = listener->socks[j]; 68| 0| if (FD_ISSET(sock, readfds)) { 69| 0| listener->acceptor(listener, sock); 70| 0| } 71| 0| } 72| 0| } 73| 269k| } 74| 269k|} /* Woo brace matching */ remove_all_listeners: 166| 3.14k|void remove_all_listeners(void) { 167| 3.14k| unsigned int i; 168| 6.29k| for (i = 0; i < ses.listensize; i++) { ------------------ | Branch (168:14): [True: 3.14k, False: 3.14k] ------------------ 169| 3.14k| if (ses.listeners[i]) { ------------------ | Branch (169:7): [True: 0, False: 3.14k] ------------------ 170| 0| remove_listener(ses.listeners[i]); 171| 0| } 172| 3.14k| } 173| 3.14k| m_free(ses.listeners); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 174| 3.14k|} remove_connect_pending: 228| 3.14k|void remove_connect_pending() { 229| 3.14k| while (ses.conn_pending.first) { ------------------ | Branch (229:9): [True: 0, False: 3.14k] ------------------ 230| 0| struct dropbear_progress_connection *c = ses.conn_pending.first->item; 231| 0| remove_connect(c, ses.conn_pending.first); 232| 0| } 233| 3.14k|} set_connect_fds: 236| 272k|void set_connect_fds(fd_set *writefd) { 237| 272k| m_list_elem *iter; 238| 272k| iter = ses.conn_pending.first; 239| 272k| while (iter) { ------------------ | Branch (239:9): [True: 0, False: 272k] ------------------ 240| 0| m_list_elem *next_iter = iter->next; 241| 0| struct dropbear_progress_connection *c = iter->item; 242| | /* Set one going */ 243| 0| while (c->res_iter && c->sock < 0) { ------------------ | Branch (243:10): [True: 0, False: 0] | Branch (243:25): [True: 0, False: 0] ------------------ 244| 0| connect_try_next(c); 245| 0| } 246| 0| if (c->sock >= 0) { ------------------ | Branch (246:7): [True: 0, False: 0] ------------------ 247| 0| FD_SET(c->sock, writefd); 248| 0| } else { 249| | /* Final failure */ 250| 0| if (!c->errstring) { ------------------ | Branch (250:8): [True: 0, False: 0] ------------------ 251| 0| c->errstring = m_strdup("unexpected failure"); 252| 0| } 253| 0| c->cb(DROPBEAR_FAILURE, -1, c->cb_data, c->errstring); ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 254| 0| remove_connect(c, iter); 255| 0| } 256| 0| iter = next_iter; 257| 0| } 258| 272k|} handle_connect_fds: 260| 269k|void handle_connect_fds(const fd_set *writefd) { 261| 269k| m_list_elem *iter; 262| 269k| for (iter = ses.conn_pending.first; iter; iter = iter->next) { ------------------ | Branch (262:38): [True: 0, False: 269k] ------------------ 263| 0| int val; 264| 0| socklen_t vallen = sizeof(val); 265| 0| struct dropbear_progress_connection *c = iter->item; 266| | 267| 0| if (c->sock < 0 || !FD_ISSET(c->sock, writefd)) { ------------------ | Branch (267:7): [True: 0, False: 0] | Branch (267:22): [True: 0, False: 0] ------------------ 268| 0| continue; 269| 0| } 270| | 271| 0| TRACE(("handling %s port %s socket %d", c->remotehost, c->remoteport, c->sock)); 272| | 273| 0| if (getsockopt(c->sock, SOL_SOCKET, SO_ERROR, &val, &vallen) != 0) { ------------------ | Branch (273:7): [True: 0, False: 0] ------------------ 274| 0| TRACE(("handle_connect_fds getsockopt(%d) SO_ERROR failed: %s", c->sock, strerror(errno))) 275| | /* This isn't expected to happen - Unix has surprises though, continue gracefully. */ 276| 0| m_close(c->sock); 277| 0| c->sock = -1; 278| 0| } else if (val != 0) { ------------------ | Branch (278:14): [True: 0, False: 0] ------------------ 279| | /* Connect failed */ 280| 0| TRACE(("connect to %s port %s failed.", c->remotehost, c->remoteport)) 281| 0| m_close(c->sock); 282| 0| c->sock = -1; 283| | 284| 0| m_free(c->errstring); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 285| 0| c->errstring = m_strdup(strerror(val)); 286| 0| } else { 287| | /* New connection has been established */ 288| 0| c->cb(DROPBEAR_SUCCESS, c->sock, c->cb_data, NULL); ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ 289| 0| remove_connect(c, iter); 290| 0| TRACE(("leave handle_connect_fds - success")) 291| | /* Must return here - remove_connect() invalidates iter */ 292| 0| return; 293| 0| } 294| 0| } 295| 269k|} packet_queue_to_iovec: 301| 47.3k|void packet_queue_to_iovec(const struct Queue *queue, struct iovec *iov, unsigned int *iov_count) { 302| 47.3k| struct Link *l; 303| 47.3k| unsigned int i; 304| 47.3k| int len; 305| 47.3k| buffer *writebuf; 306| | 307| |#ifndef IOV_MAX 308| | #if defined(__CYGWIN__) && !defined(UIO_MAXIOV) 309| | #define IOV_MAX 1024 310| | #elif defined(__sgi) 311| | #define IOV_MAX 512 312| | #else 313| | #define IOV_MAX UIO_MAXIOV 314| | #endif 315| |#endif 316| | 317| 47.3k| *iov_count = MIN(MIN(queue->count, IOV_MAX), *iov_count); 318| | 319| 98.1k| for (l = queue->head, i = 0; i < *iov_count; l = l->link, i++) ------------------ | Branch (319:31): [True: 50.8k, False: 47.3k] ------------------ 320| 50.8k| { 321| 50.8k| writebuf = (buffer*)l->item; 322| 50.8k| len = writebuf->len - writebuf->pos; 323| 50.8k| dropbear_assert(len > 0); ------------------ | | 83| 50.8k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 50.8k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 324| 50.8k| TRACE2(("write_packet writev #%d len %d/%d", i, 325| 50.8k| len, writebuf->len)) 326| 50.8k| iov[i].iov_base = buf_getptr(writebuf, len); 327| 50.8k| iov[i].iov_len = len; 328| 50.8k| } 329| 47.3k|} packet_queue_consume: 331| 47.3k|void packet_queue_consume(struct Queue *queue, ssize_t written) { 332| 47.3k| buffer *writebuf; 333| 47.3k| int len; 334| 94.7k| while (written > 0) { ------------------ | Branch (334:9): [True: 47.3k, False: 47.3k] ------------------ 335| 47.3k| writebuf = (buffer*)examine(queue); 336| 47.3k| len = writebuf->len - writebuf->pos; 337| 47.3k| if (len > written) { ------------------ | Branch (337:7): [True: 0, False: 47.3k] ------------------ 338| | /* partial buffer write */ 339| 0| buf_incrpos(writebuf, written); 340| 0| written = 0; 341| 47.3k| } else { 342| 47.3k| written -= len; 343| 47.3k| dequeue(queue); 344| 47.3k| buf_free(writebuf); 345| 47.3k| } 346| 47.3k| } 347| 47.3k|} set_sock_priority: 367| 3.14k|void set_sock_priority(int sock, enum dropbear_prio prio) { 368| | 369| 3.14k| int rc; 370| 3.14k| int val; 371| | 372| 3.14k|#if DROPBEAR_FUZZ 373| 3.14k| if (fuzz.fuzzing) { ------------------ | Branch (373:6): [True: 3.14k, False: 0] ------------------ 374| 3.14k| TRACE(("fuzzing skips set_sock_prio")) 375| 3.14k| return; 376| 3.14k| } 377| 0|#endif 378| | /* Don't log ENOTSOCK errors so that this can harmlessly be called 379| | * on a client '-J' proxy pipe */ 380| | 381| 0| if (opts.disable_ip_tos == 0) { ------------------ | Branch (381:6): [True: 0, False: 0] ------------------ 382| 0|#ifdef IP_TOS 383| | /* Set the DSCP field for outbound IP packet priority. 384| | rfc4594 has some guidance to meanings. 385| | 386| | We set AF21 as "Low-Latency" class for interactive (tty session, 387| | also handshake/setup packets). Other traffic is left at the default. 388| | 389| | OpenSSH at present uses AF21/CS1, rationale 390| | https://cvsweb.openbsd.org/src/usr.bin/ssh/readconf.c#rev1.284 391| | 392| | Old Dropbear/OpenSSH and Debian/Ubuntu OpenSSH (at Jan 2022) use 393| | IPTOS_LOWDELAY/IPTOS_THROUGHPUT 394| | 395| | DSCP constants are from Linux headers, applicable to other platforms 396| | such as macos. 397| | */ 398| 0| if (prio == DROPBEAR_PRIO_LOWDELAY) { ------------------ | Branch (398:6): [True: 0, False: 0] ------------------ 399| 0| val = 0x48; /* IPTOS_DSCP_AF21 */ 400| 0| } else { 401| 0| val = 0; /* default */ 402| 0| } 403| 0|#if defined(IPPROTO_IPV6) && defined(IPV6_TCLASS) 404| 0| rc = setsockopt(sock, IPPROTO_IPV6, IPV6_TCLASS, (void*)&val, sizeof(val)); 405| 0| if (rc < 0 && errno != ENOTSOCK) { ------------------ | Branch (405:6): [True: 0, False: 0] | Branch (405:16): [True: 0, False: 0] ------------------ 406| 0| TRACE(("Couldn't set IPV6_TCLASS (%s)", strerror(errno))); 407| 0| } 408| 0|#endif 409| 0| rc = setsockopt(sock, IPPROTO_IP, IP_TOS, (void*)&val, sizeof(val)); 410| 0| if (rc < 0 && errno != ENOTSOCK) { ------------------ | Branch (410:6): [True: 0, False: 0] | Branch (410:16): [True: 0, False: 0] ------------------ 411| 0| TRACE(("Couldn't set IP_TOS (%s)", strerror(errno))); 412| 0| } 413| 0|#endif /* IP_TOS */ 414| 0| } 415| | 416| 0|#ifdef HAVE_LINUX_PKT_SCHED_H 417| | /* Set scheduling priority within the local Linux network stack */ 418| 0| if (prio == DROPBEAR_PRIO_LOWDELAY) { ------------------ | Branch (418:6): [True: 0, False: 0] ------------------ 419| 0| val = TC_PRIO_INTERACTIVE; 420| 0| } else { 421| 0| val = 0; 422| 0| } 423| | /* linux specific, sets QoS class. see tc-prio(8) */ 424| 0| rc = setsockopt(sock, SOL_SOCKET, SO_PRIORITY, (void*) &val, sizeof(val)); 425| 0| if (rc < 0 && errno != ENOTSOCK) { ------------------ | Branch (425:6): [True: 0, False: 0] | Branch (425:16): [True: 0, False: 0] ------------------ 426| 0| TRACE(("Couldn't set SO_PRIORITY (%s)", strerror(errno))) 427| 0| } 428| 0|#endif 429| | 430| 0|} get_socket_address: 613| 6.29k|{ 614| 6.29k| struct sockaddr_storage addr; 615| 6.29k| socklen_t addrlen; 616| | 617| 6.29k|#if DROPBEAR_FUZZ 618| 6.29k| if (fuzz.fuzzing) { ------------------ | Branch (618:6): [True: 6.29k, False: 0] ------------------ 619| 6.29k| fuzz_get_socket_address(fd, local_host, local_port, remote_host, remote_port, host_lookup); 620| 6.29k| return; 621| 6.29k| } 622| 0|#endif 623| | 624| 0| if (local_host || local_port) { ------------------ | Branch (624:6): [True: 0, False: 0] | Branch (624:20): [True: 0, False: 0] ------------------ 625| 0| addrlen = sizeof(addr); 626| 0| if (getsockname(fd, (struct sockaddr*)&addr, &addrlen) < 0) { ------------------ | Branch (626:7): [True: 0, False: 0] ------------------ 627| 0| dropbear_exit("Failed socket address: %s", strerror(errno)); 628| 0| } 629| 0| getaddrstring(&addr, local_host, local_port, host_lookup); 630| 0| } 631| 0| if (remote_host || remote_port) { ------------------ | Branch (631:6): [True: 0, False: 0] | Branch (631:21): [True: 0, False: 0] ------------------ 632| 0| addrlen = sizeof(addr); 633| 0| if (getpeername(fd, (struct sockaddr*)&addr, &addrlen) < 0) { ------------------ | Branch (633:7): [True: 0, False: 0] ------------------ 634| 0| dropbear_exit("Failed socket address: %s", strerror(errno)); 635| 0| } 636| 0| getaddrstring(&addr, remote_host, remote_port, host_lookup); 637| 0| } 638| 0|} write_packet: 58| 47.3k|void write_packet() { 59| | 60| 47.3k| ssize_t written; 61| 47.3k|#if defined(HAVE_WRITEV) && (defined(IOV_MAX) || defined(UIO_MAXIOV)) 62| | /* 50 is somewhat arbitrary */ 63| 47.3k| unsigned int iov_count = 50; 64| 47.3k| struct iovec iov[50]; 65| |#else 66| | int len; 67| | buffer* writebuf; 68| |#endif 69| | 70| 47.3k| TRACE2(("enter write_packet")) 71| 47.3k| dropbear_assert(!isempty(&ses.writequeue)); ------------------ | | 83| 47.3k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 47.3k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 72| | 73| 47.3k|#if defined(HAVE_WRITEV) && (defined(IOV_MAX) || defined(UIO_MAXIOV)) 74| | 75| 47.3k| packet_queue_to_iovec(&ses.writequeue, iov, &iov_count); 76| | /* This may return EAGAIN. The main loop sometimes 77| | calls write_packet() without bothering to test with select() since 78| | it's likely to be necessary */ 79| 47.3k|#if DROPBEAR_FUZZ 80| 47.3k| if (fuzz.fuzzing) { ------------------ | Branch (80:6): [True: 47.3k, False: 0] ------------------ 81| | /* pretend to write one packet at a time */ 82| | /* TODO(fuzz): randomise amount written based on the fuzz input */ 83| 47.3k| written = iov[0].iov_len; 84| 47.3k| } 85| 0| else 86| 0|#endif 87| 0| { 88| 0| written = writev(ses.sock_out, iov, iov_count); 89| 0| if (written < 0) { ------------------ | Branch (89:6): [True: 0, False: 0] ------------------ 90| 0| if (errno == EINTR || errno == EAGAIN) { ------------------ | Branch (90:7): [True: 0, False: 0] | Branch (90:25): [True: 0, False: 0] ------------------ 91| 0| TRACE2(("leave write_packet: EINTR")) 92| 0| return; 93| 0| } else { 94| 0| dropbear_exit("Error writing: %s", strerror(errno)); 95| 0| } 96| 0| } 97| 0| } 98| | 99| 47.3k| packet_queue_consume(&ses.writequeue, written); 100| 47.3k| ses.writequeue_len -= written; 101| | 102| 47.3k| if (written == 0) { ------------------ | Branch (102:6): [True: 0, False: 47.3k] ------------------ 103| 0| ses.remoteclosed(); 104| 0| } 105| | 106| |#else /* No writev () */ 107| |#if DROPBEAR_FUZZ 108| | _Static_assert(0, "No fuzzing code for no-writev writes"); 109| |#endif 110| | /* Get the next buffer in the queue of encrypted packets to write*/ 111| | writebuf = (buffer*)examine(&ses.writequeue); 112| | 113| | len = writebuf->len - writebuf->pos; 114| | dropbear_assert(len > 0); 115| | /* Try to write as much as possible */ 116| | written = write(ses.sock_out, buf_getptr(writebuf, len), len); 117| | 118| | if (written < 0) { 119| | if (errno == EINTR || errno == EAGAIN) { 120| | TRACE2(("leave writepacket: EINTR")) 121| | return; 122| | } else { 123| | dropbear_exit("Error writing: %s", strerror(errno)); 124| | } 125| | } 126| | 127| | if (written == 0) { 128| | ses.remoteclosed(); 129| | } 130| | 131| | ses.writequeue_len -= written; 132| | 133| | if (written == len) { 134| | /* We've finished with the packet, free it */ 135| | dequeue(&ses.writequeue); 136| | buf_free(writebuf); 137| | writebuf = NULL; 138| | } else { 139| | /* More packet left to write, leave it in the queue for later */ 140| | buf_incrpos(writebuf, written); 141| | } 142| |#endif /* writev */ 143| | 144| 47.3k| TRACE2(("leave write_packet")) 145| 47.3k|} read_packet: 150| 249k|void read_packet() { 151| | 152| 249k| int len; 153| 249k| unsigned int maxlen; 154| 249k| unsigned char blocksize; 155| | 156| 249k| TRACE2(("enter read_packet")) 157| 249k| blocksize = ses.keys->recv.algo_crypt->blocksize; 158| | 159| 249k| if (ses.readbuf == NULL || ses.readbuf->len < blocksize) { ------------------ | Branch (159:6): [True: 55.5k, False: 193k] | Branch (159:29): [True: 94.4k, False: 99.1k] ------------------ 160| 149k| int ret; 161| | /* In the first blocksize of a packet */ 162| | 163| | /* Read the first blocksize of the packet, so we can decrypt it and 164| | * find the length of the whole packet */ 165| 149k| ret = read_packet_init(); 166| | 167| 149k| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 149k|#define DROPBEAR_FAILURE -1 ------------------ | Branch (167:7): [True: 94.4k, False: 55.5k] ------------------ 168| | /* didn't read enough to determine the length */ 169| 94.4k| TRACE2(("leave read_packet: packetinit done")) 170| 94.4k| return; 171| 94.4k| } 172| 149k| } 173| | 174| | /* Attempt to read the remainder of the packet, note that there 175| | * mightn't be any available (EAGAIN) */ 176| 154k| maxlen = ses.readbuf->len - ses.readbuf->pos; 177| 154k| if (maxlen == 0) { ------------------ | Branch (177:6): [True: 21.8k, False: 132k] ------------------ 178| | /* Occurs when the packet is only a single block long and has all 179| | * been read in read_packet_init(). Usually means that MAC is disabled 180| | */ 181| 21.8k| len = 0; 182| 132k| } else { 183| 132k| len = read(ses.sock_in, buf_getptr(ses.readbuf, maxlen), maxlen); ------------------ | | 55| 132k|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ 184| | 185| 132k| if (len == 0) { ------------------ | Branch (185:7): [True: 126, False: 132k] ------------------ 186| 126| ses.remoteclosed(); 187| 126| } 188| | 189| 132k| if (len < 0) { ------------------ | Branch (189:7): [True: 162, False: 132k] ------------------ 190| 162| if (errno == EINTR || errno == EAGAIN) { ------------------ | Branch (190:8): [True: 161, False: 1] | Branch (190:26): [True: 0, False: 1] ------------------ 191| 161| TRACE2(("leave read_packet: EINTR or EAGAIN")) 192| 161| return; 193| 161| } else { 194| 1| dropbear_exit("Error reading: %s", strerror(errno)); 195| 1| } 196| 162| } 197| | 198| 132k| buf_incrpos(ses.readbuf, len); 199| 132k| } 200| | 201| 154k| if ((unsigned int)len == maxlen) { ------------------ | Branch (201:6): [True: 54.1k, False: 100k] ------------------ 202| | /* The whole packet has been read */ 203| 54.1k| decrypt_packet(); 204| | /* The main select() loop process_packet() to 205| | * handle the packet contents... */ 206| 54.1k| } 207| 154k| TRACE2(("leave read_packet")) 208| 154k|} decrypt_packet: 298| 54.1k|void decrypt_packet() { 299| | 300| 54.1k| unsigned char blocksize; 301| 54.1k| unsigned char macsize; 302| 54.1k| unsigned int padlen; 303| 54.1k| unsigned int len; 304| | 305| 54.1k| TRACE2(("enter decrypt_packet")) 306| 54.1k| blocksize = ses.keys->recv.algo_crypt->blocksize; 307| 54.1k| macsize = ses.keys->recv.algo_mac->hashsize; 308| | 309| 54.1k| ses.kexstate.datarecv += ses.readbuf->len; 310| | 311| 54.1k|#if DROPBEAR_AEAD_MODE 312| 54.1k| if (ses.keys->recv.crypt_mode->aead_crypt) { ------------------ | Branch (312:6): [True: 0, False: 54.1k] ------------------ 313| | /* first blocksize is not decrypted yet */ 314| 0| buf_setpos(ses.readbuf, 0); 315| | 316| | /* decrypt it in-place */ 317| 0| len = ses.readbuf->len - macsize - ses.readbuf->pos; 318| 0| if (ses.keys->recv.crypt_mode->aead_crypt(ses.recvseq, ------------------ | Branch (318:7): [True: 0, False: 0] ------------------ 319| 0| buf_getptr(ses.readbuf, len + macsize), 320| 0| buf_getwriteptr(ses.readbuf, len), 321| 0| len, macsize, 322| 0| &ses.keys->recv.cipher_state, LTC_DECRYPT) != CRYPT_OK) { ------------------ | | 70| 0|#define LTC_DECRYPT 1 ------------------ 323| 0| dropbear_exit("Error decrypting"); 324| 0| } 325| 0| buf_incrpos(ses.readbuf, len); 326| 0| } else 327| 54.1k|#endif 328| 54.1k| { 329| | /* we've already decrypted the first blocksize in read_packet_init */ 330| 54.1k| buf_setpos(ses.readbuf, blocksize); 331| | 332| | /* decrypt it in-place */ 333| 54.1k| len = ses.readbuf->len - macsize - ses.readbuf->pos; 334| 54.1k| if (ses.keys->recv.crypt_mode->decrypt( ------------------ | Branch (334:7): [True: 0, False: 54.1k] ------------------ 335| 54.1k| buf_getptr(ses.readbuf, len), 336| 54.1k| buf_getwriteptr(ses.readbuf, len), 337| 54.1k| len, 338| 54.1k| &ses.keys->recv.cipher_state) != CRYPT_OK) { 339| 0| dropbear_exit("Error decrypting"); 340| 0| } 341| 54.1k| buf_incrpos(ses.readbuf, len); 342| | 343| | /* check the hmac */ 344| 54.1k| if (checkmac() != DROPBEAR_SUCCESS) { ------------------ | | 102| 54.1k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (344:7): [True: 0, False: 54.1k] ------------------ 345| 0| dropbear_exit("Integrity error"); 346| 0| } 347| | 348| 54.1k| } 349| | 350| 54.1k|#if DROPBEAR_FUZZ 351| 54.1k| fuzz_dump(ses.readbuf->data, ses.readbuf->len); 352| 54.1k|#endif 353| | 354| | /* get padding length */ 355| 54.1k| buf_setpos(ses.readbuf, PACKET_PADDING_OFF); ------------------ | | 48| 54.1k|#define PACKET_PADDING_OFF 4 ------------------ 356| 54.1k| padlen = buf_getbyte(ses.readbuf); 357| | 358| | /* payload length */ 359| | /* - 4 - 1 is for LEN and PADLEN values */ 360| 54.1k| len = ses.readbuf->len - padlen - 4 - 1 - macsize; 361| 54.1k| if ((len > RECV_MAX_PAYLOAD_LEN+ZLIB_COMPRESS_EXPANSION) || (len < 1)) { ------------------ | | 492| 54.1k|#define RECV_MAX_PAYLOAD_LEN 32768 ------------------ if ((len > RECV_MAX_PAYLOAD_LEN+ZLIB_COMPRESS_EXPANSION) || (len < 1)) { ------------------ | | 50| 54.1k|#define ZLIB_COMPRESS_EXPANSION (((RECV_MAX_PAYLOAD_LEN/16384)+1)*5 + 6) | | ------------------ | | | | 492| 54.1k|#define RECV_MAX_PAYLOAD_LEN 32768 | | ------------------ ------------------ | Branch (361:6): [True: 15, False: 54.1k] | Branch (361:62): [True: 1, False: 54.1k] ------------------ 362| 16| dropbear_exit("Bad packet size %u", len); 363| 16| } 364| | 365| 54.1k| buf_setpos(ses.readbuf, PACKET_PAYLOAD_OFF); ------------------ | | 49| 54.1k|#define PACKET_PAYLOAD_OFF 5 ------------------ 366| | 367| |#ifndef DISABLE_ZLIB 368| | if (is_compress_recv()) { 369| | /* decompress */ 370| | ses.payload = buf_decompress(ses.readbuf, len); 371| | buf_setpos(ses.payload, 0); 372| | ses.payload_beginning = 0; 373| | buf_free(ses.readbuf); 374| | } else 375| |#endif 376| 54.1k| { 377| 54.1k| ses.payload = ses.readbuf; 378| 54.1k| ses.payload_beginning = ses.payload->pos; 379| 54.1k| buf_setlen(ses.payload, ses.payload->pos + len); 380| 54.1k| } 381| 54.1k| ses.readbuf = NULL; 382| | 383| 54.1k| ses.recvseq++; 384| | 385| 54.1k| TRACE2(("leave decrypt_packet")) 386| 54.1k|} maybe_flush_reply_queue: 495| 269k|void maybe_flush_reply_queue() { 496| 269k| struct packetlist *tmp_item = NULL, *curr_item = NULL; 497| 269k| if (!ses.dataallowed) ------------------ | Branch (497:6): [True: 124k, False: 144k] ------------------ 498| 124k| { 499| 124k| TRACE(("maybe_empty_reply_queue - no data allowed")) 500| 124k| return; 501| 124k| } 502| | 503| 144k| for (curr_item = ses.reply_queue_head; curr_item; ) { ------------------ | Branch (503:41): [True: 0, False: 144k] ------------------ 504| 0| CHECKCLEARTOWRITE(); 505| 0| buf_putbytes(ses.writepayload, 506| 0| curr_item->payload->data, curr_item->payload->len); 507| | 508| 0| buf_free(curr_item->payload); 509| 0| tmp_item = curr_item; 510| 0| curr_item = curr_item->next; 511| 0| m_free(tmp_item); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 512| 0| encrypt_packet(); 513| 0| } 514| 144k| ses.reply_queue_head = ses.reply_queue_tail = NULL; 515| 144k|} encrypt_packet: 519| 44.4k|void encrypt_packet() { 520| | 521| 44.4k| unsigned char padlen; 522| 44.4k| unsigned char blocksize, mac_size; 523| 44.4k| buffer * writebuf; /* the packet which will go on the wire. This is 524| | encrypted in-place. */ 525| 44.4k| unsigned char packet_type; 526| 44.4k| unsigned int len, encrypt_buf_size; 527| 44.4k| unsigned char mac_bytes[MAX_MAC_LEN]; 528| | 529| 44.4k| time_t now; 530| | 531| 44.4k| TRACE2(("enter encrypt_packet()")) 532| | 533| 44.4k| buf_setpos(ses.writepayload, 0); 534| 44.4k| packet_type = buf_getbyte(ses.writepayload); 535| 44.4k| buf_setpos(ses.writepayload, 0); 536| | 537| 44.4k| TRACE2(("encrypt_packet type is %d", packet_type)) 538| | 539| 44.4k| if ((!ses.dataallowed && !packet_is_okay_kex(packet_type))) { ------------------ | Branch (539:7): [True: 22.5k, False: 21.8k] | Branch (539:27): [True: 0, False: 22.5k] ------------------ 540| | /* During key exchange only particular packets are allowed. 541| | Since this packet_type isn't OK we just enqueue it to send 542| | after the KEX, see maybe_flush_reply_queue */ 543| 0| enqueue_reply_packet(); 544| 0| return; 545| 0| } 546| | 547| 44.4k| blocksize = ses.keys->trans.algo_crypt->blocksize; 548| 44.4k| mac_size = ses.keys->trans.algo_mac->hashsize; 549| | 550| | /* Encrypted packet len is payload+5. We need to then make sure 551| | * there is enough space for padding or MIN_PACKET_LEN. 552| | * Add extra 3 since we need at least 4 bytes of padding */ 553| 44.4k| encrypt_buf_size = (ses.writepayload->len+4+1) 554| 44.4k| + MAX(MIN_PACKET_LEN, blocksize) + 3 555| | /* add space for the MAC at the end */ 556| 44.4k| + mac_size 557| |#ifndef DISABLE_ZLIB 558| | /* some extra in case 'compression' makes it larger */ 559| | + ZLIB_COMPRESS_EXPANSION 560| |#endif 561| | /* and an extra cleartext (stripped before transmission) byte for the 562| | * packet type */ 563| 44.4k| + 1; 564| | 565| 44.4k| writebuf = buf_new(encrypt_buf_size); 566| 44.4k| buf_setlen(writebuf, PACKET_PAYLOAD_OFF); ------------------ | | 49| 44.4k|#define PACKET_PAYLOAD_OFF 5 ------------------ 567| 44.4k| buf_setpos(writebuf, PACKET_PAYLOAD_OFF); ------------------ | | 49| 44.4k|#define PACKET_PAYLOAD_OFF 5 ------------------ 568| | 569| |#ifndef DISABLE_ZLIB 570| | /* compression */ 571| | if (is_compress_trans()) { 572| | buf_compress(writebuf, ses.writepayload, ses.writepayload->len); 573| | } else 574| |#endif 575| 44.4k| { 576| 44.4k| memcpy(buf_getwriteptr(writebuf, ses.writepayload->len), 577| 44.4k| buf_getptr(ses.writepayload, ses.writepayload->len), 578| 44.4k| ses.writepayload->len); 579| 44.4k| buf_incrwritepos(writebuf, ses.writepayload->len); 580| 44.4k| } 581| | 582| | /* finished with payload */ 583| 44.4k| buf_setpos(ses.writepayload, 0); 584| 44.4k| buf_setlen(ses.writepayload, 0); 585| | 586| | /* length of padding - packet length excluding the packetlength uint32 587| | * field in aead mode must be a multiple of blocksize, with a minimum of 588| | * 4 bytes of padding */ 589| 44.4k| len = writebuf->len; 590| 44.4k|#if DROPBEAR_AEAD_MODE 591| 44.4k| if (ses.keys->trans.crypt_mode->aead_crypt) { ------------------ | Branch (591:6): [True: 17.2k, False: 27.1k] ------------------ 592| 17.2k| len -= 4; 593| 17.2k| } 594| 44.4k|#endif 595| 44.4k| padlen = blocksize - len % blocksize; 596| 44.4k| if (padlen < 4) { ------------------ | Branch (596:6): [True: 4.36k, False: 40.0k] ------------------ 597| 4.36k| padlen += blocksize; 598| 4.36k| } 599| | /* check for min packet length */ 600| 44.4k| if (writebuf->len + padlen < MIN_PACKET_LEN) { ------------------ | | 213| 44.4k|#define MIN_PACKET_LEN 16 ------------------ | Branch (600:6): [True: 6.13k, False: 38.2k] ------------------ 601| 6.13k| padlen += blocksize; 602| 6.13k| } 603| | 604| 44.4k| buf_setpos(writebuf, 0); 605| | /* packet length excluding the packetlength uint32 */ 606| 44.4k| buf_putint(writebuf, writebuf->len + padlen - 4); 607| | 608| | /* padding len */ 609| 44.4k| buf_putbyte(writebuf, padlen); 610| | /* actual padding */ 611| 44.4k| buf_setpos(writebuf, writebuf->len); 612| 44.4k| buf_incrlen(writebuf, padlen); 613| 44.4k| genrandom(buf_getptr(writebuf, padlen), padlen); 614| | 615| 44.4k|#if DROPBEAR_AEAD_MODE 616| 44.4k| if (ses.keys->trans.crypt_mode->aead_crypt) { ------------------ | Branch (616:6): [True: 17.2k, False: 27.1k] ------------------ 617| | /* do the actual encryption, in-place */ 618| 17.2k| buf_setpos(writebuf, 0); 619| | /* encrypt it in-place*/ 620| 17.2k| len = writebuf->len; 621| 17.2k| buf_incrlen(writebuf, mac_size); 622| 17.2k| if (ses.keys->trans.crypt_mode->aead_crypt(ses.transseq, ------------------ | Branch (622:7): [True: 0, False: 17.2k] ------------------ 623| 17.2k| buf_getptr(writebuf, len), 624| 17.2k| buf_getwriteptr(writebuf, len + mac_size), 625| 17.2k| len, mac_size, 626| 17.2k| &ses.keys->trans.cipher_state, LTC_ENCRYPT) != CRYPT_OK) { ------------------ | | 68| 17.2k|#define LTC_ENCRYPT 0 ------------------ 627| 0| dropbear_exit("Error encrypting"); 628| 0| } 629| 17.2k| buf_incrpos(writebuf, len + mac_size); 630| 17.2k| } else 631| 27.1k|#endif 632| 27.1k| { 633| 27.1k| make_mac(ses.transseq, &ses.keys->trans, writebuf, writebuf->len, mac_bytes); 634| | 635| | /* do the actual encryption, in-place */ 636| 27.1k| buf_setpos(writebuf, 0); 637| | /* encrypt it in-place*/ 638| 27.1k| len = writebuf->len; 639| 27.1k| if (ses.keys->trans.crypt_mode->encrypt( ------------------ | Branch (639:7): [True: 0, False: 27.1k] ------------------ 640| 27.1k| buf_getptr(writebuf, len), 641| 27.1k| buf_getwriteptr(writebuf, len), 642| 27.1k| len, 643| 27.1k| &ses.keys->trans.cipher_state) != CRYPT_OK) { 644| 0| dropbear_exit("Error encrypting"); 645| 0| } 646| 27.1k| buf_incrpos(writebuf, len); 647| | 648| | /* stick the MAC on it */ 649| 27.1k| buf_putbytes(writebuf, mac_bytes, mac_size); 650| 27.1k| } 651| | 652| | /* Update counts */ 653| 44.4k| ses.kexstate.datatrans += writebuf->len; 654| | 655| 44.4k| writebuf_enqueue(writebuf); 656| | 657| | /* Update counts */ 658| 44.4k| ses.transseq++; 659| | 660| 44.4k| now = monotonic_now(); 661| 44.4k| ses.last_packet_time_any_sent = now; 662| | /* idle timeout shouldn't be affected by responses to keepalives. 663| | send_msg_keepalive() itself also does tricks with 664| | ses.last_packet_idle_time - read that if modifying this code */ 665| 44.4k| if (packet_type != SSH_MSG_REQUEST_FAILURE ------------------ | | 65| 88.8k|#define SSH_MSG_REQUEST_FAILURE 82 ------------------ | Branch (665:6): [True: 44.4k, False: 0] ------------------ 666| 44.4k| && packet_type != SSH_MSG_UNIMPLEMENTED ------------------ | | 31| 88.8k|#define SSH_MSG_UNIMPLEMENTED 3 ------------------ | Branch (666:6): [True: 21.9k, False: 22.4k] ------------------ 667| 44.4k| && packet_type != SSH_MSG_IGNORE) { ------------------ | | 30| 21.9k|#define SSH_MSG_IGNORE 2 ------------------ | Branch (667:6): [True: 21.9k, False: 0] ------------------ 668| 21.9k| ses.last_packet_time_idle = now; 669| | 670| 21.9k| } 671| | 672| 44.4k| TRACE2(("leave encrypt_packet()")) 673| 44.4k|} writebuf_enqueue: 675| 47.5k|void writebuf_enqueue(buffer * writebuf) { 676| | /* enqueue the packet for sending. It will get freed after transmission. */ 677| 47.5k| buf_setpos(writebuf, 0); 678| 47.5k| enqueue(&ses.writequeue, (void*)writebuf); 679| 47.5k| ses.writequeue_len += writebuf->len; 680| 47.5k|} packet.c:read_packet_init: 214| 149k|static int read_packet_init() { 215| | 216| 149k| unsigned int maxlen; 217| 149k| int slen; 218| 149k| unsigned int len, plen; 219| 149k| unsigned int blocksize; 220| 149k| unsigned int macsize; 221| | 222| | 223| 149k| blocksize = ses.keys->recv.algo_crypt->blocksize; 224| 149k| macsize = ses.keys->recv.algo_mac->hashsize; 225| | 226| 149k| if (ses.readbuf == NULL) { ------------------ | Branch (226:6): [True: 55.5k, False: 94.4k] ------------------ 227| | /* start of a new packet */ 228| 55.5k| ses.readbuf = buf_new(INIT_READBUF); ------------------ | | 51| 55.5k|#define INIT_READBUF 128 ------------------ 229| 55.5k| } 230| | 231| 149k| maxlen = blocksize - ses.readbuf->pos; 232| | 233| | /* read the rest of the packet if possible */ 234| 149k| slen = read(ses.sock_in, buf_getwriteptr(ses.readbuf, maxlen), ------------------ | | 55| 149k|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ 235| 149k| maxlen); 236| 149k| if (slen == 0) { ------------------ | Branch (236:6): [True: 1.16k, False: 148k] ------------------ 237| 1.16k| ses.remoteclosed(); 238| 1.16k| } 239| 149k| if (slen < 0) { ------------------ | Branch (239:6): [True: 163, False: 149k] ------------------ 240| 163| if (errno == EINTR || errno == EAGAIN) { ------------------ | Branch (240:7): [True: 160, False: 3] | Branch (240:25): [True: 0, False: 3] ------------------ 241| 160| TRACE2(("leave read_packet_init: EINTR")) 242| 160| return DROPBEAR_FAILURE; ------------------ | | 103| 160|#define DROPBEAR_FAILURE -1 ------------------ 243| 160| } 244| 3| dropbear_exit("Error reading: %s", strerror(errno)); 245| 163| } 246| | 247| 149k| buf_incrwritepos(ses.readbuf, slen); 248| | 249| 149k| if ((unsigned int)slen != maxlen) { ------------------ | Branch (249:6): [True: 94.2k, False: 55.5k] ------------------ 250| | /* don't have enough bytes to determine length, get next time */ 251| 94.2k| return DROPBEAR_FAILURE; ------------------ | | 103| 94.2k|#define DROPBEAR_FAILURE -1 ------------------ 252| 94.2k| } 253| | 254| | /* now we have the first block, need to get packet length, so we decrypt 255| | * the first block (only need first 4 bytes) */ 256| 55.5k| buf_setpos(ses.readbuf, 0); 257| 55.5k|#if DROPBEAR_AEAD_MODE 258| 55.5k| if (ses.keys->recv.crypt_mode->aead_crypt) { ------------------ | Branch (258:6): [True: 0, False: 55.5k] ------------------ 259| 0| if (ses.keys->recv.crypt_mode->aead_getlength(ses.recvseq, ------------------ | Branch (259:7): [True: 0, False: 0] ------------------ 260| 0| buf_getptr(ses.readbuf, blocksize), &plen, 261| 0| blocksize, 262| 0| &ses.keys->recv.cipher_state) != CRYPT_OK) { 263| 0| dropbear_exit("Error decrypting"); 264| 0| } 265| 0| len = plen + 4 + macsize; 266| 0| } else 267| 55.5k|#endif 268| 55.5k| { 269| 55.5k| if (ses.keys->recv.crypt_mode->decrypt(buf_getptr(ses.readbuf, blocksize), ------------------ | Branch (269:7): [True: 0, False: 55.5k] ------------------ 270| 55.5k| buf_getwriteptr(ses.readbuf, blocksize), 271| 55.5k| blocksize, 272| 55.5k| &ses.keys->recv.cipher_state) != CRYPT_OK) { 273| 0| dropbear_exit("Error decrypting"); 274| 0| } 275| 55.5k| plen = buf_getint(ses.readbuf) + 4; 276| 55.5k| len = plen + macsize; 277| 55.5k| } 278| | 279| 55.5k| TRACE2(("packet size is %u, block %u mac %u", len, blocksize, macsize)) 280| | 281| | 282| | /* check packet length */ 283| 55.5k| if ((len > RECV_MAX_PACKET_LEN) || ------------------ | | 215| 55.5k|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ | Branch (283:6): [True: 1.21k, False: 54.2k] ------------------ 284| 55.5k| (plen < blocksize) || ------------------ | Branch (284:3): [True: 4, False: 54.2k] ------------------ 285| 55.5k| (plen % blocksize != 0)) { ------------------ | Branch (285:3): [True: 26, False: 54.2k] ------------------ 286| 82| dropbear_exit("Integrity error (bad packet size %u)", len); 287| 82| } 288| | 289| 55.4k| if (len > ses.readbuf->size) { ------------------ | Branch (289:6): [True: 10.1k, False: 45.3k] ------------------ 290| 10.1k| ses.readbuf = buf_resize(ses.readbuf, len); 291| 10.1k| } 292| 55.4k| buf_setlen(ses.readbuf, len); 293| 55.4k| buf_setpos(ses.readbuf, blocksize); 294| 55.4k| return DROPBEAR_SUCCESS; ------------------ | | 102| 55.4k|#define DROPBEAR_SUCCESS 0 ------------------ 295| 55.5k|} packet.c:checkmac: 390| 54.1k|static int checkmac() { 391| | 392| 54.1k| unsigned char mac_bytes[MAX_MAC_LEN]; 393| 54.1k| unsigned int mac_size, contents_len; 394| | 395| 54.1k| mac_size = ses.keys->recv.algo_mac->hashsize; 396| 54.1k| contents_len = ses.readbuf->len - mac_size; 397| | 398| 54.1k| buf_setpos(ses.readbuf, 0); 399| 54.1k| make_mac(ses.recvseq, &ses.keys->recv, ses.readbuf, contents_len, mac_bytes); 400| | 401| 54.1k|#if DROPBEAR_FUZZ 402| 54.1k| if (fuzz.fuzzing) { ------------------ | Branch (402:6): [True: 54.1k, False: 0] ------------------ 403| | /* fail 1 in 2000 times to test error path. */ 404| 54.1k| unsigned int value = 0; 405| 54.1k| if (mac_size > sizeof(value)) { ------------------ | Branch (405:7): [True: 0, False: 54.1k] ------------------ 406| 0| memcpy(&value, mac_bytes, sizeof(value)); 407| 0| } 408| 54.1k| if (value % 2000 == 99) { ------------------ | Branch (408:7): [True: 0, False: 54.1k] ------------------ 409| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 410| 0| } 411| 54.1k| return DROPBEAR_SUCCESS; ------------------ | | 102| 54.1k|#define DROPBEAR_SUCCESS 0 ------------------ 412| 54.1k| } 413| 0|#endif 414| | 415| | /* compare the hash */ 416| 0| buf_setpos(ses.readbuf, contents_len); 417| 0| if (constant_time_memcmp(mac_bytes, buf_getptr(ses.readbuf, mac_size), mac_size) != 0) { ------------------ | Branch (417:6): [True: 0, False: 0] ------------------ 418| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 419| 0| } else { 420| 0| return DROPBEAR_SUCCESS; ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ 421| 0| } 422| 0|} packet.c:packet_is_okay_kex: 464| 22.5k|static int packet_is_okay_kex(unsigned char type) { 465| 22.5k| if (type >= SSH_MSG_USERAUTH_REQUEST) { ------------------ | | 42| 22.5k|#define SSH_MSG_USERAUTH_REQUEST 50 ------------------ | Branch (465:6): [True: 0, False: 22.5k] ------------------ 466| 0| return 0; 467| 0| } 468| 22.5k| if (type == SSH_MSG_SERVICE_REQUEST || type == SSH_MSG_SERVICE_ACCEPT) { ------------------ | | 33| 45.1k|#define SSH_MSG_SERVICE_REQUEST 5 ------------------ if (type == SSH_MSG_SERVICE_REQUEST || type == SSH_MSG_SERVICE_ACCEPT) { ------------------ | | 34| 22.5k|#define SSH_MSG_SERVICE_ACCEPT 6 ------------------ | Branch (468:6): [True: 0, False: 22.5k] | Branch (468:41): [True: 0, False: 22.5k] ------------------ 469| 0| return 0; 470| 0| } 471| 22.5k| if (type == SSH_MSG_KEXINIT) { ------------------ | | 36| 22.5k|#define SSH_MSG_KEXINIT 20 ------------------ | Branch (471:6): [True: 0, False: 22.5k] ------------------ 472| | /* XXX should this die horribly if !dataallowed ?? */ 473| 0| return 0; 474| 0| } 475| 22.5k| return 1; 476| 22.5k|} packet.c:make_mac: 687| 81.3k| unsigned char *output_mac) { 688| 81.3k| unsigned char seqbuf[4]; 689| 81.3k| unsigned long bufsize; 690| 81.3k| hmac_state hmac; 691| | 692| 81.3k| if (key_state->algo_mac->hashsize > 0) { ------------------ | Branch (692:6): [True: 8.62k, False: 72.7k] ------------------ 693| | /* calculate the mac */ 694| 8.62k| if (hmac_init(&hmac, ------------------ | Branch (694:7): [True: 0, False: 8.62k] ------------------ 695| 8.62k| key_state->hash_index, 696| 8.62k| key_state->mackey, 697| 8.62k| key_state->algo_mac->keysize) != CRYPT_OK) { 698| 0| dropbear_exit("HMAC error"); 699| 0| } 700| | 701| | /* sequence number */ 702| 8.62k| STORE32H(seqno, seqbuf); ------------------ | | 62| 8.62k|#define STORE32H(x, y) \ | | 63| 8.62k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 8.62k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 8.62k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded - Ignored] | | ------------------ ------------------ 703| 8.62k| if (hmac_process(&hmac, seqbuf, 4) != CRYPT_OK) { ------------------ | Branch (703:7): [True: 0, False: 8.62k] ------------------ 704| 0| dropbear_exit("HMAC error"); 705| 0| } 706| | 707| | /* the actual contents */ 708| 8.62k| buf_setpos(clear_buf, 0); 709| 8.62k| if (hmac_process(&hmac, ------------------ | Branch (709:7): [True: 0, False: 8.62k] ------------------ 710| 8.62k| buf_getptr(clear_buf, clear_len), 711| 8.62k| clear_len) != CRYPT_OK) { 712| 0| dropbear_exit("HMAC error"); 713| 0| } 714| | 715| 8.62k| bufsize = MAX_MAC_LEN; ------------------ | | 134| 8.62k|#define MAX_MAC_LEN 32 ------------------ 716| 8.62k| if (hmac_done(&hmac, output_mac, &bufsize) != CRYPT_OK) { ------------------ | Branch (716:7): [True: 0, False: 8.62k] ------------------ 717| 0| dropbear_exit("HMAC error"); 718| 0| } 719| 8.62k| } 720| 81.3k| TRACE2(("leave writemac")) 721| 81.3k|} process_packet: 43| 54.1k|void process_packet() { 44| | 45| 54.1k| unsigned char type; 46| 54.1k| unsigned int i; 47| 54.1k| time_t now; 48| | 49| 54.1k| TRACE2(("enter process_packet")) 50| | 51| 54.1k| type = buf_getbyte(ses.payload); 52| 54.1k| TRACE(("process_packet: packet type = %d, len %d", type, ses.payload->len)) 53| | 54| 54.1k| now = monotonic_now(); 55| 54.1k| ses.last_packet_time_keepalive_recv = now; 56| | 57| | /* These packets we can receive at any time */ 58| 54.1k| switch(type) { ------------------ | Branch (58:9): [True: 53.1k, False: 927] ------------------ 59| | 60| 391| case SSH_MSG_IGNORE: ------------------ | | 30| 391|#define SSH_MSG_IGNORE 2 ------------------ | Branch (60:3): [True: 391, False: 53.7k] ------------------ 61| 391| goto out; 62| 287| case SSH_MSG_DEBUG: ------------------ | | 32| 287|#define SSH_MSG_DEBUG 4 ------------------ | Branch (62:3): [True: 287, False: 53.8k] ------------------ 63| 287| goto out; 64| | 65| 246| case SSH_MSG_UNIMPLEMENTED: ------------------ | | 31| 246|#define SSH_MSG_UNIMPLEMENTED 3 ------------------ | Branch (65:3): [True: 246, False: 53.8k] ------------------ 66| | /* debugging XXX */ 67| 246| TRACE(("SSH_MSG_UNIMPLEMENTED")) 68| 246| goto out; 69| | 70| 3| case SSH_MSG_DISCONNECT: ------------------ | | 29| 3|#define SSH_MSG_DISCONNECT 1 ------------------ | Branch (70:3): [True: 3, False: 54.1k] ------------------ 71| | /* TODO cleanup? */ 72| 3| dropbear_close("Disconnect received"); 73| 54.1k| } 74| | 75| | /* Ignore these packet types so that keepalives don't interfere with 76| | idle detection. This is slightly incorrect since a tcp forwarded 77| | global request with failure won't trigger the idle timeout, 78| | but that's probably acceptable */ 79| 53.1k| if (!(type == SSH_MSG_GLOBAL_REQUEST ------------------ | | 63| 106k|#define SSH_MSG_GLOBAL_REQUEST 80 ------------------ | Branch (79:8): [True: 1, False: 53.1k] ------------------ 80| 53.1k| || type == SSH_MSG_REQUEST_FAILURE ------------------ | | 65| 106k|#define SSH_MSG_REQUEST_FAILURE 82 ------------------ | Branch (80:6): [True: 1, False: 53.1k] ------------------ 81| 53.1k| || type == SSH_MSG_CHANNEL_FAILURE)) { ------------------ | | 76| 53.1k|#define SSH_MSG_CHANNEL_FAILURE 100 ------------------ | Branch (81:6): [True: 1, False: 53.1k] ------------------ 82| 53.1k| ses.last_packet_time_idle = now; 83| 53.1k| } 84| | 85| | /* This applies for KEX, where the spec says the next packet MUST be 86| | * NEWKEYS */ 87| 53.1k| if (ses.requirenext != 0) { ------------------ | Branch (87:6): [True: 40.6k, False: 12.5k] ------------------ 88| 40.6k| if (ses.requirenext == type) ------------------ | Branch (88:7): [True: 20.4k, False: 20.1k] ------------------ 89| 20.4k| { 90| | /* Got what we expected */ 91| 20.4k| TRACE(("got expected packet %d during kexinit", type)) 92| 20.4k| } 93| 20.1k| else 94| 20.1k| { 95| | /* RFC4253 7.1 - various messages are allowed at this point. 96| | The only ones we know about have already been handled though, 97| | so just return "unimplemented" */ 98| 20.1k| if (type >= 1 && type <= 49 ------------------ | Branch (98:8): [True: 20.1k, False: 14] | Branch (98:21): [True: 20.1k, False: 38] ------------------ 99| 20.1k| && type != SSH_MSG_SERVICE_REQUEST ------------------ | | 33| 40.3k|#define SSH_MSG_SERVICE_REQUEST 5 ------------------ | Branch (99:8): [True: 20.1k, False: 1] ------------------ 100| 20.1k| && type != SSH_MSG_SERVICE_ACCEPT ------------------ | | 34| 40.3k|#define SSH_MSG_SERVICE_ACCEPT 6 ------------------ | Branch (100:8): [True: 20.1k, False: 1] ------------------ 101| 20.1k| && type != SSH_MSG_KEXINIT) ------------------ | | 36| 20.1k|#define SSH_MSG_KEXINIT 20 ------------------ | Branch (101:8): [True: 20.1k, False: 1] ------------------ 102| 20.1k| { 103| 20.1k| TRACE(("unknown allowed packet during kexinit")) 104| 20.1k| recv_unimplemented(); 105| 20.1k| goto out; 106| 20.1k| } 107| 55| else 108| 55| { 109| 55| TRACE(("disallowed packet during kexinit")) 110| 55| dropbear_exit("Unexpected packet type %d, expected %d", type, 111| 55| ses.requirenext); 112| 55| } 113| 20.1k| } 114| 40.6k| } 115| | 116| | /* Check if we should ignore this packet. Used currently only for 117| | * KEX code, with first_kex_packet_follows */ 118| 33.0k| if (ses.ignorenext) { ------------------ | Branch (118:6): [True: 239, False: 32.7k] ------------------ 119| 239| TRACE(("Ignoring packet, type = %d", type)) 120| 239| ses.ignorenext = 0; 121| 239| goto out; 122| 239| } 123| | 124| | /* Only clear the flag after we have checked ignorenext */ 125| 32.7k| if (ses.requirenext != 0 && ses.requirenext == type) ------------------ | Branch (125:6): [True: 20.1k, False: 12.5k] | Branch (125:30): [True: 20.1k, False: 0] ------------------ 126| 20.1k| { 127| 20.1k| ses.requirenext = 0; 128| 20.1k| } 129| | 130| | 131| | /* Kindly the protocol authors gave all the preauth packets type values 132| | * less-than-or-equal-to 60 ( == MAX_UNAUTH_PACKET_TYPE ). 133| | * NOTE: if the protocol changes and new types are added, revisit this 134| | * assumption */ 135| 32.7k| if ( !ses.authstate.authdone && type > MAX_UNAUTH_PACKET_TYPE ) { ------------------ | | 38| 32.7k|#define MAX_UNAUTH_PACKET_TYPE SSH_MSG_USERAUTH_PK_OK | | ------------------ | | | | 52| 32.7k|#define SSH_MSG_USERAUTH_PK_OK 60 | | ------------------ ------------------ | Branch (135:7): [True: 32.7k, False: 0] | Branch (135:34): [True: 4, False: 32.7k] ------------------ 136| 4| dropbear_exit("Received message %d before userauth", type); 137| 4| } 138| | 139| 217k| for (i = 0; ; i++) { 140| 217k| if (ses.packettypes[i].type == 0) { ------------------ | Branch (140:7): [True: 2.34k, False: 215k] ------------------ 141| | /* end of list */ 142| 2.34k| break; 143| 2.34k| } 144| | 145| 215k| if (ses.packettypes[i].type == type) { ------------------ | Branch (145:7): [True: 30.4k, False: 184k] ------------------ 146| 30.4k| ses.packettypes[i].handler(); 147| 30.4k| goto out; 148| 30.4k| } 149| 215k| } 150| | 151| | 152| | /* TODO do something more here? */ 153| 2.34k| TRACE(("preauth unknown packet")) 154| 2.34k| recv_unimplemented(); 155| | 156| 52.5k|out: 157| 52.5k| ses.lastpacket = type; 158| 52.5k| buf_free(ses.payload); 159| 52.5k| ses.payload = NULL; 160| | 161| 52.5k| TRACE2(("leave process_packet")) 162| 52.5k|} process-packet.c:recv_unimplemented: 170| 22.4k|static void recv_unimplemented() { 171| | 172| 22.4k| CHECKCLEARTOWRITE(); 173| | 174| 22.4k| buf_putbyte(ses.writepayload, SSH_MSG_UNIMPLEMENTED); ------------------ | | 31| 22.4k|#define SSH_MSG_UNIMPLEMENTED 3 ------------------ 175| | /* the decryption routine increments the sequence number, we must 176| | * decrement */ 177| 22.4k| buf_putint(ses.writepayload, ses.recvseq - 1); 178| | 179| 22.4k| encrypt_packet(); 180| 22.4k|} initqueue: 29| 3.14k|void initqueue(struct Queue* queue) { 30| | 31| 3.14k| queue->head = NULL; 32| 3.14k| queue->tail = NULL; 33| 3.14k| queue->count = 0; 34| 3.14k|} isempty: 36| 697k|int isempty(const struct Queue* queue) { 37| | 38| 697k| return (queue->head == NULL); 39| 697k|} dequeue: 41| 47.5k|void* dequeue(struct Queue* queue) { 42| | 43| 47.5k| void* ret; 44| 47.5k| struct Link* oldhead; 45| 47.5k| dropbear_assert(!isempty(queue)); ------------------ | | 83| 47.5k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 47.5k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 46| | 47| 47.5k| ret = queue->head->item; 48| 47.5k| oldhead = queue->head; 49| | 50| 47.5k| if (oldhead->link != NULL) { ------------------ | Branch (50:6): [True: 3.45k, False: 44.1k] ------------------ 51| 3.45k| queue->head = oldhead->link; 52| 44.1k| } else { 53| 44.1k| queue->head = NULL; 54| 44.1k| queue->tail = NULL; 55| 44.1k| TRACE(("empty queue dequeing")) 56| 44.1k| } 57| | 58| 47.5k| m_free(oldhead); ------------------ | | 24| 47.5k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 59| 47.5k| queue->count--; 60| 47.5k| return ret; 61| 47.5k|} examine: 63| 47.3k|void *examine(const struct Queue* queue) { 64| | 65| 47.3k| dropbear_assert(!isempty(queue)); ------------------ | | 83| 47.3k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 47.3k] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 66| 47.3k| return queue->head->item; 67| 47.3k|} enqueue: 69| 47.5k|void enqueue(struct Queue* queue, void* item) { 70| | 71| 47.5k| struct Link* newlink; 72| | 73| 47.5k| newlink = (struct Link*)m_malloc(sizeof(struct Link)); 74| | 75| 47.5k| newlink->item = item; 76| 47.5k| newlink->link = NULL; 77| | 78| 47.5k| if (queue->tail != NULL) { ------------------ | Branch (78:6): [True: 3.45k, False: 44.1k] ------------------ 79| 3.45k| queue->tail->link = newlink; 80| 3.45k| } 81| 47.5k| queue->tail = newlink; 82| | 83| 47.5k| if (queue->head == NULL) { ------------------ | Branch (83:6): [True: 44.1k, False: 3.45k] ------------------ 84| 44.1k| queue->head = newlink; 85| 44.1k| } 86| 47.5k| queue->count++; 87| 47.5k|} buf_get_rsa_pub_key: 53| 1|int buf_get_rsa_pub_key(buffer* buf, dropbear_rsa_key *key) { 54| | 55| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 56| 1| TRACE(("enter buf_get_rsa_pub_key")) 57| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 58| 1| m_mp_alloc_init_multi(&key->e, &key->n, NULL); 59| 1| key->d = NULL; 60| 1| key->p = NULL; 61| 1| key->q = NULL; 62| | 63| 1| buf_incrpos(buf, 4+SSH_SIGNKEY_RSA_LEN); /* int + "ssh-rsa" */ ------------------ | | 113| 1|#define SSH_SIGNKEY_RSA_LEN 7 ------------------ 64| | 65| 1| if (buf_getmpint(buf, key->e) == DROPBEAR_FAILURE ------------------ | | 103| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (65:6): [True: 0, False: 1] ------------------ 66| 1| || buf_getmpint(buf, key->n) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (66:6): [True: 0, False: 1] ------------------ 67| 0| TRACE(("leave buf_get_rsa_pub_key: failure")) 68| 0| goto out; 69| 0| } 70| | 71| 1| if (mp_count_bits(key->n) < MIN_RSA_KEYLEN) { ------------------ | | 65| 1|#define MIN_RSA_KEYLEN 1024 ------------------ | Branch (71:6): [True: 0, False: 1] ------------------ 72| 0| dropbear_log(LOG_WARNING, "RSA key too short"); 73| 0| goto out; 74| 0| } 75| | 76| | /* 64 bit is limit used by openssl, so we won't block any keys in the wild */ 77| 1| if (mp_count_bits(key->e) > 64) { ------------------ | Branch (77:6): [True: 0, False: 1] ------------------ 78| 0| dropbear_log(LOG_WARNING, "RSA key bad e"); 79| 0| goto out; 80| 0| } 81| | 82| 1| TRACE(("leave buf_get_rsa_pub_key: success")) 83| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 84| 1|out: 85| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (85:6): [True: 0, False: 1] ------------------ 86| 0| m_mp_free_multi(&key->e, &key->n, NULL); 87| 0| } 88| 1| return ret; 89| 1|} buf_get_rsa_priv_key: 94| 1|int buf_get_rsa_priv_key(buffer* buf, dropbear_rsa_key *key) { 95| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ 96| | 97| 1| TRACE(("enter buf_get_rsa_priv_key")) 98| 1| dropbear_assert(key != NULL); ------------------ | | 83| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (83:37): [True: 0, False: 1] | | | Branch (83:93): [Folded - Ignored] | | ------------------ ------------------ 99| | 100| 1| if (buf_get_rsa_pub_key(buf, key) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (100:6): [True: 0, False: 1] ------------------ 101| 0| TRACE(("leave buf_get_rsa_priv_key: pub: ret == DROPBEAR_FAILURE")) 102| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 103| 0| } 104| | 105| 1| key->d = NULL; 106| 1| key->p = NULL; 107| 1| key->q = NULL; 108| | 109| 1| m_mp_alloc_init_multi(&key->d, NULL); 110| 1| if (buf_getmpint(buf, key->d) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (110:6): [True: 0, False: 1] ------------------ 111| 0| TRACE(("leave buf_get_rsa_priv_key: d: ret == DROPBEAR_FAILURE")) 112| 0| goto out; 113| 0| } 114| | 115| 1| if (buf->pos == buf->len) { ------------------ | Branch (115:6): [True: 0, False: 1] ------------------ 116| | /* old Dropbear private keys didn't keep p and q, so we will ignore them*/ 117| 1| } else { 118| 1| m_mp_alloc_init_multi(&key->p, &key->q, NULL); 119| | 120| 1| if (buf_getmpint(buf, key->p) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (120:7): [True: 0, False: 1] ------------------ 121| 0| TRACE(("leave buf_get_rsa_priv_key: p: ret == DROPBEAR_FAILURE")) 122| 0| goto out; 123| 0| } 124| | 125| 1| if (buf_getmpint(buf, key->q) == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (125:7): [True: 0, False: 1] ------------------ 126| 0| TRACE(("leave buf_get_rsa_priv_key: q: ret == DROPBEAR_FAILURE")) 127| 0| goto out; 128| 0| } 129| 1| } 130| | 131| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 132| 1|out: 133| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (133:6): [True: 0, False: 1] ------------------ 134| 0| m_mp_free_multi(&key->d, &key->p, &key->q, NULL); 135| 0| } 136| 1| TRACE(("leave buf_get_rsa_priv_key")) 137| 1| return ret; 138| 1|} rsa_key_free: 142| 1|void rsa_key_free(dropbear_rsa_key *key) { 143| | 144| 1| TRACE2(("enter rsa_key_free")) 145| | 146| 1| if (key == NULL) { ------------------ | Branch (146:6): [True: 1, False: 0] ------------------ 147| 1| TRACE2(("leave rsa_key_free: key == NULL")) 148| 1| return; 149| 1| } 150| 0| m_mp_free_multi(&key->d, &key->e, &key->p, &key->q, &key->n, NULL); 151| 0| m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 152| 0| TRACE2(("leave rsa_key_free")) 153| 0|} new_sign_key: 62| 1|sign_key * new_sign_key() { 63| | 64| 1| sign_key * ret; 65| | 66| 1| ret = (sign_key*)m_malloc(sizeof(sign_key)); 67| 1| ret->type = DROPBEAR_SIGNKEY_NONE; 68| 1| ret->source = SIGNKEY_SOURCE_INVALID; 69| 1| return ret; 70| 1|} signkey_type_from_name: 86| 996|enum signkey_type signkey_type_from_name(const char* name, unsigned int namelen) { 87| 996| int i; 88| 8.94k| for (i = 0; i < DROPBEAR_SIGNKEY_NUM_NAMED; i++) { ------------------ | Branch (88:14): [True: 7.94k, False: 992] ------------------ 89| 7.94k| const char *fixed_name = signkey_names[i]; 90| 7.94k| if (namelen == strlen(fixed_name) ------------------ | Branch (90:7): [True: 5, False: 7.94k] ------------------ 91| 7.94k| && memcmp(fixed_name, name, namelen) == 0) { ------------------ | Branch (91:7): [True: 4, False: 1] ------------------ 92| | 93| 4|#if DROPBEAR_ECDSA 94| | /* Some of the ECDSA key sizes are defined even if they're not compiled in */ 95| 4| if (0 ------------------ | Branch (95:8): [Folded - Ignored] ------------------ 96| |#if !DROPBEAR_ECC_256 97| | || i == DROPBEAR_SIGNKEY_ECDSA_NISTP256 98| |#endif 99| |#if !DROPBEAR_ECC_384 100| | || i == DROPBEAR_SIGNKEY_ECDSA_NISTP384 101| |#endif 102| |#if !DROPBEAR_ECC_521 103| | || i == DROPBEAR_SIGNKEY_ECDSA_NISTP521 104| |#endif 105| 4| ) { 106| 0| TRACE(("attempt to use ecdsa type %d not compiled in", i)) 107| 0| return DROPBEAR_SIGNKEY_NONE; 108| 0| } 109| 4|#endif 110| | 111| 4| return (enum signkey_type)i; 112| 4| } 113| 7.94k| } 114| | 115| 992| TRACE(("signkey_type_from_name unexpected key type.")) 116| | 117| 992| return DROPBEAR_SIGNKEY_NONE; 118| 996|} signature_type_from_name: 145| 992|enum signature_type signature_type_from_name(const char* name, unsigned int namelen) { 146| 992|#if DROPBEAR_RSA 147| 992|#if DROPBEAR_RSA_SHA256 148| 992| if (namelen == strlen(SSH_SIGNATURE_RSA_SHA256) ------------------ | | 117| 992|#define SSH_SIGNATURE_RSA_SHA256 "rsa-sha2-256" ------------------ | Branch (148:6): [True: 0, False: 992] ------------------ 149| 992| && memcmp(name, SSH_SIGNATURE_RSA_SHA256, namelen) == 0) { ------------------ | | 117| 0|#define SSH_SIGNATURE_RSA_SHA256 "rsa-sha2-256" ------------------ | Branch (149:6): [True: 0, False: 0] ------------------ 150| 0| return DROPBEAR_SIGNATURE_RSA_SHA256; 151| 0| } 152| 992|#endif 153| 992|#if DROPBEAR_RSA_SHA1 154| 992| if (namelen == strlen(SSH_SIGNKEY_RSA) ------------------ | | 112| 992|#define SSH_SIGNKEY_RSA "ssh-rsa" ------------------ | Branch (154:6): [True: 0, False: 992] ------------------ 155| 992| && memcmp(name, SSH_SIGNKEY_RSA, namelen) == 0) { ------------------ | | 112| 0|#define SSH_SIGNKEY_RSA "ssh-rsa" ------------------ | Branch (155:6): [True: 0, False: 0] ------------------ 156| 0| return DROPBEAR_SIGNATURE_RSA_SHA1; 157| 0| } 158| 992|#endif 159| 992|#endif /* DROPBEAR_RSA */ 160| 992| return (enum signature_type)signkey_type_from_name(name, namelen); 161| 992|} signkey_type_from_signature: 173| 9.54k|enum signkey_type signkey_type_from_signature(enum signature_type sigtype) { 174| 9.54k|#if DROPBEAR_RSA 175| 9.54k|#if DROPBEAR_RSA_SHA256 176| 9.54k| if (sigtype == DROPBEAR_SIGNATURE_RSA_SHA256) { ------------------ | Branch (176:6): [True: 38, False: 9.50k] ------------------ 177| 38| return DROPBEAR_SIGNKEY_RSA; 178| 38| } 179| 9.50k|#endif 180| 9.50k|#if DROPBEAR_RSA_SHA1 181| 9.50k| if (sigtype == DROPBEAR_SIGNATURE_RSA_SHA1) { ------------------ | Branch (181:6): [True: 566, False: 8.93k] ------------------ 182| 566| return DROPBEAR_SIGNKEY_RSA; 183| 566| } 184| 8.93k|#endif 185| 8.93k|#endif /* DROPBEAR_RSA */ 186| 8.93k| assert((int)sigtype < (int)DROPBEAR_SIGNKEY_NUM_NAMED); 187| 8.93k| return (enum signkey_type)sigtype; 188| 8.93k|} signkey_key_ptr: 193| 1|signkey_key_ptr(sign_key *key, enum signkey_type type) { 194| 1| switch (type) { 195| 0|#if DROPBEAR_ED25519 196| 0| case DROPBEAR_SIGNKEY_ED25519: ------------------ | Branch (196:3): [True: 0, False: 1] ------------------ 197| 0|#if DROPBEAR_SK_ED25519 198| 0| case DROPBEAR_SIGNKEY_SK_ED25519: ------------------ | Branch (198:3): [True: 0, False: 1] ------------------ 199| 0|#endif 200| 0| return (void**)&key->ed25519key; 201| 0|#endif 202| 0|#if DROPBEAR_ECDSA 203| 0|#if DROPBEAR_ECC_256 204| 1| case DROPBEAR_SIGNKEY_ECDSA_NISTP256: ------------------ | Branch (204:3): [True: 1, False: 0] ------------------ 205| 1|#if DROPBEAR_SK_ECDSA 206| 1| case DROPBEAR_SIGNKEY_SK_ECDSA_NISTP256: ------------------ | Branch (206:3): [True: 0, False: 1] ------------------ 207| 1|#endif 208| 1| return (void**)&key->ecckey256; 209| 0|#endif 210| 0|#if DROPBEAR_ECC_384 211| 0| case DROPBEAR_SIGNKEY_ECDSA_NISTP384: ------------------ | Branch (211:3): [True: 0, False: 1] ------------------ 212| 0| return (void**)&key->ecckey384; 213| 0|#endif 214| 0|#if DROPBEAR_ECC_521 215| 0| case DROPBEAR_SIGNKEY_ECDSA_NISTP521: ------------------ | Branch (215:3): [True: 0, False: 1] ------------------ 216| 0| return (void**)&key->ecckey521; 217| 0|#endif 218| 0|#endif /* DROPBEAR_ECDSA */ 219| 0|#if DROPBEAR_RSA 220| 0| case DROPBEAR_SIGNKEY_RSA: ------------------ | Branch (220:3): [True: 0, False: 1] ------------------ 221| 0| return (void**)&key->rsakey; 222| 0|#endif 223| 0|#if DROPBEAR_DSS 224| 0| case DROPBEAR_SIGNKEY_DSS: ------------------ | Branch (224:3): [True: 0, False: 1] ------------------ 225| 0| return (void**)&key->dsskey; 226| 0|#endif 227| 0| default: ------------------ | Branch (227:3): [True: 0, False: 1] ------------------ 228| 0| return NULL; 229| 1| } 230| 1|} buf_get_priv_key: 339| 4|int buf_get_priv_key(buffer *buf, sign_key *key, enum signkey_type *type) { 340| | 341| 4| char *ident; 342| 4| unsigned int len; 343| 4| enum signkey_type keytype; 344| 4| int ret = DROPBEAR_FAILURE; ------------------ | | 103| 4|#define DROPBEAR_FAILURE -1 ------------------ 345| | 346| 4| TRACE2(("enter buf_get_priv_key")) 347| | 348| 4| ident = buf_getstring(buf, &len); 349| 4| keytype = signkey_type_from_name(ident, len); 350| 4| m_free(ident); ------------------ | | 24| 4|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 351| | 352| 4| if (*type != DROPBEAR_SIGNKEY_ANY && *type != keytype) { ------------------ | Branch (352:6): [True: 4, False: 0] | Branch (352:39): [True: 0, False: 4] ------------------ 353| 0| TRACE(("wrong key type: %d %d", *type, keytype)) 354| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 355| 0| } 356| | 357| 4| *type = keytype; 358| | 359| | /* Rewind the buffer back before "ssh-rsa" etc */ 360| 4| buf_decrpos(buf, len + 4); 361| | 362| 4|#if DROPBEAR_DSS 363| 4| if (keytype == DROPBEAR_SIGNKEY_DSS) { ------------------ | Branch (363:6): [True: 1, False: 3] ------------------ 364| 1| dss_key_free(key->dsskey); 365| 1| key->dsskey = m_malloc(sizeof(*key->dsskey)); 366| 1| ret = buf_get_dss_priv_key(buf, key->dsskey); 367| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (367:7): [True: 0, False: 1] ------------------ 368| 0| dss_key_free(key->dsskey); 369| 0| key->dsskey = NULL; 370| 0| } 371| 1| } 372| 4|#endif 373| 4|#if DROPBEAR_RSA 374| 4| if (keytype == DROPBEAR_SIGNKEY_RSA) { ------------------ | Branch (374:6): [True: 1, False: 3] ------------------ 375| 1| rsa_key_free(key->rsakey); 376| 1| key->rsakey = m_malloc(sizeof(*key->rsakey)); 377| 1| ret = buf_get_rsa_priv_key(buf, key->rsakey); 378| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (378:7): [True: 0, False: 1] ------------------ 379| 0| rsa_key_free(key->rsakey); 380| 0| key->rsakey = NULL; 381| 0| } 382| 1| } 383| 4|#endif 384| 4|#if DROPBEAR_ECDSA 385| 4| if (signkey_is_ecdsa(keytype)) { ------------------ | Branch (385:6): [True: 1, False: 3] ------------------ 386| 1| ecc_key **eck = (ecc_key**)signkey_key_ptr(key, keytype); 387| 1| if (eck) { ------------------ | Branch (387:7): [True: 1, False: 0] ------------------ 388| 1| if (*eck) { ------------------ | Branch (388:8): [True: 0, False: 1] ------------------ 389| 0| ecc_free(*eck); 390| 0| m_free(*eck); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 391| 0| *eck = NULL; 392| 0| } 393| 1| *eck = buf_get_ecdsa_priv_key(buf); 394| 1| if (*eck) { ------------------ | Branch (394:8): [True: 1, False: 0] ------------------ 395| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 102| 1|#define DROPBEAR_SUCCESS 0 ------------------ 396| 1| } 397| 1| } 398| 1| } 399| 4|#endif 400| 4|#if DROPBEAR_ED25519 401| 4| if (keytype == DROPBEAR_SIGNKEY_ED25519) { ------------------ | Branch (401:6): [True: 1, False: 3] ------------------ 402| 1| ed25519_key_free(key->ed25519key); 403| 1| key->ed25519key = m_malloc(sizeof(*key->ed25519key)); 404| 1| ret = buf_get_ed25519_priv_key(buf, key->ed25519key); 405| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 103| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (405:7): [True: 0, False: 1] ------------------ 406| 0| m_free(key->ed25519key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 407| 0| key->ed25519key = NULL; 408| 0| } 409| 1| } 410| 4|#endif 411| | 412| 4| TRACE2(("leave buf_get_priv_key")) 413| | 414| 4| return ret; 415| | 416| 4|} svr_authinitialise: 42| 3.14k|void svr_authinitialise() { 43| 3.14k| memset(&ses.authstate, 0, sizeof(ses.authstate)); 44| 3.14k|#if DROPBEAR_SVR_PUBKEY_AUTH 45| 3.14k| ses.authstate.authtypes |= AUTH_TYPE_PUBKEY; ------------------ | | 88| 3.14k|#define AUTH_TYPE_PUBKEY (1 << 1) ------------------ 46| 3.14k|#endif 47| 3.14k|#if DROPBEAR_SVR_PASSWORD_AUTH || DROPBEAR_SVR_PAM_AUTH 48| 3.14k| if (!svr_opts.noauthpass) { ------------------ | Branch (48:6): [True: 3.14k, False: 0] ------------------ 49| 3.14k| ses.authstate.authtypes |= AUTH_TYPE_PASSWORD; ------------------ | | 89| 3.14k|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ 50| 3.14k| } 51| 3.14k|#endif 52| 3.14k|} recv_msg_userauth_request: 73| 2.33k|void recv_msg_userauth_request() { 74| | 75| 2.33k| char *username = NULL, *servicename = NULL, *methodname = NULL; 76| 2.33k| unsigned int userlen, servicelen, methodlen; 77| 2.33k| int valid_user = 0; 78| | 79| 2.33k| TRACE(("enter recv_msg_userauth_request")) 80| | 81| | /* for compensating failure delay */ 82| 2.33k| gettime_wrapper(&ses.authstate.auth_starttime); 83| | 84| | /* ignore packets if auth is already done */ 85| 2.33k| if (ses.authstate.authdone == 1) { ------------------ | Branch (85:6): [True: 0, False: 2.33k] ------------------ 86| 0| TRACE(("leave recv_msg_userauth_request: authdone already")) 87| 0| return; 88| 0| } 89| | 90| | /* send the banner if it exists, it will only exist once */ 91| 2.33k| if (svr_opts.banner) { ------------------ | Branch (91:6): [True: 0, False: 2.33k] ------------------ 92| 0| send_msg_userauth_banner(svr_opts.banner); 93| 0| buf_free(svr_opts.banner); 94| 0| svr_opts.banner = NULL; 95| 0| } 96| | 97| 2.33k| username = buf_getstring(ses.payload, &userlen); 98| 2.33k| servicename = buf_getstring(ses.payload, &servicelen); 99| 2.33k| methodname = buf_getstring(ses.payload, &methodlen); 100| | 101| | /* only handle 'ssh-connection' currently */ 102| 2.33k| if (servicelen != SSH_SERVICE_CONNECTION_LEN ------------------ | | 107| 4.67k|#define SSH_SERVICE_CONNECTION_LEN 14 ------------------ | Branch (102:6): [True: 152, False: 2.18k] ------------------ 103| 2.33k| && (strncmp(servicename, SSH_SERVICE_CONNECTION, ------------------ | | 106| 152|#define SSH_SERVICE_CONNECTION "ssh-connection" ------------------ | Branch (103:7): [True: 134, False: 18] ------------------ 104| 152| SSH_SERVICE_CONNECTION_LEN) != 0)) { ------------------ | | 107| 152|#define SSH_SERVICE_CONNECTION_LEN 14 ------------------ 105| | 106| | /* TODO - disconnect here */ 107| 134| m_free(username); ------------------ | | 24| 134|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 108| 134| m_free(servicename); ------------------ | | 24| 134|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 109| 134| m_free(methodname); ------------------ | | 24| 134|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 110| 134| dropbear_exit("unknown service in auth"); 111| 134| } 112| | 113| | /* check username is good before continuing. 114| | * the 'incrfail' varies depending on the auth method to 115| | * avoid giving away which users exist on the system through 116| | * the time delay. */ 117| 2.20k| if (checkusername(username, userlen) == DROPBEAR_SUCCESS) { ------------------ | | 102| 2.20k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (117:6): [True: 1.04k, False: 1.16k] ------------------ 118| 1.04k| valid_user = 1; 119| 1.04k| } 120| | 121| | /* user wants to know what methods are supported */ 122| 2.20k| if (methodlen == AUTH_METHOD_NONE_LEN && ------------------ | | 93| 4.40k|#define AUTH_METHOD_NONE_LEN 4 ------------------ | Branch (122:6): [True: 377, False: 1.82k] ------------------ 123| 2.20k| strncmp(methodname, AUTH_METHOD_NONE, ------------------ | | 92| 377|#define AUTH_METHOD_NONE "none" ------------------ | Branch (123:4): [True: 230, False: 147] ------------------ 124| 377| AUTH_METHOD_NONE_LEN) == 0) { ------------------ | | 93| 377|#define AUTH_METHOD_NONE_LEN 4 ------------------ 125| 230| TRACE(("recv_msg_userauth_request: 'none' request")) 126| 230| if (valid_user ------------------ | Branch (126:7): [True: 0, False: 230] ------------------ 127| 230| && svr_opts.allowblankpass ------------------ | Branch (127:8): [True: 0, False: 0] ------------------ 128| 230| && !svr_opts.noauthpass ------------------ | Branch (128:8): [True: 0, False: 0] ------------------ 129| 230| && !(svr_opts.norootpass && ses.authstate.pw_uid == 0) ------------------ | Branch (129:10): [True: 0, False: 0] | Branch (129:33): [True: 0, False: 0] ------------------ 130| 230| && ses.authstate.pw_passwd[0] == '\0') ------------------ | Branch (130:8): [True: 0, False: 0] ------------------ 131| 0| { 132| 0| dropbear_log(LOG_NOTICE, 133| 0| "Auth succeeded with blank password for '%s' from %s", 134| 0| ses.authstate.pw_name, 135| 0| svr_ses.addrstring); 136| 0| send_msg_userauth_success(); 137| 0| goto out; 138| 0| } 139| 230| else 140| 230| { 141| | /* 'none' has no failure delay */ 142| 230| send_msg_userauth_failure(0, 0); 143| 230| goto out; 144| 230| } 145| 230| } 146| | 147| 1.97k|#if DROPBEAR_SVR_PASSWORD_AUTH 148| 1.97k| if (!svr_opts.noauthpass && ------------------ | Branch (148:6): [True: 1.82k, False: 151] ------------------ 149| 1.97k| !(svr_opts.norootpass && ses.authstate.pw_uid == 0) ) { ------------------ | Branch (149:6): [True: 0, False: 1.82k] | Branch (149:29): [True: 0, False: 0] ------------------ 150| | /* user wants to try password auth */ 151| 1.82k| if (methodlen == AUTH_METHOD_PASSWORD_LEN && ------------------ | | 97| 3.64k|#define AUTH_METHOD_PASSWORD_LEN 8 ------------------ | Branch (151:7): [True: 160, False: 1.66k] ------------------ 152| 1.82k| strncmp(methodname, AUTH_METHOD_PASSWORD, ------------------ | | 96| 160|#define AUTH_METHOD_PASSWORD "password" ------------------ | Branch (152:5): [True: 70, False: 90] ------------------ 153| 160| AUTH_METHOD_PASSWORD_LEN) == 0) { ------------------ | | 97| 160|#define AUTH_METHOD_PASSWORD_LEN 8 ------------------ 154| 70| svr_auth_password(valid_user); 155| 70| goto out; 156| 70| } 157| 1.82k| } 158| 1.90k|#endif 159| | 160| |#if DROPBEAR_SVR_PAM_AUTH 161| | if (!svr_opts.noauthpass && 162| | !(svr_opts.norootpass && ses.authstate.pw_uid == 0) ) { 163| | /* user wants to try password auth */ 164| | if (methodlen == AUTH_METHOD_PASSWORD_LEN && 165| | strncmp(methodname, AUTH_METHOD_PASSWORD, 166| | AUTH_METHOD_PASSWORD_LEN) == 0) { 167| | svr_auth_pam(valid_user); 168| | goto out; 169| | } 170| | } 171| |#endif 172| | 173| 1.90k|#if DROPBEAR_SVR_PUBKEY_AUTH 174| | /* user wants to try pubkey auth */ 175| 1.90k| if (methodlen == AUTH_METHOD_PUBKEY_LEN && ------------------ | | 95| 3.80k|#define AUTH_METHOD_PUBKEY_LEN 9 ------------------ | Branch (175:6): [True: 1.25k, False: 651] ------------------ 176| 1.90k| strncmp(methodname, AUTH_METHOD_PUBKEY, ------------------ | | 94| 1.25k|#define AUTH_METHOD_PUBKEY "publickey" ------------------ | Branch (176:4): [True: 1.13k, False: 116] ------------------ 177| 1.25k| AUTH_METHOD_PUBKEY_LEN) == 0) { ------------------ | | 95| 1.25k|#define AUTH_METHOD_PUBKEY_LEN 9 ------------------ 178| 1.13k| svr_auth_pubkey(valid_user); 179| 1.13k| goto out; 180| 1.13k| } 181| 767|#endif 182| | 183| | /* nothing matched, we just fail with a delay */ 184| 767| send_msg_userauth_failure(0, 1); 185| | 186| 1.96k|out: 187| | 188| 1.96k| m_free(username); ------------------ | | 24| 1.96k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 189| 1.96k| m_free(servicename); ------------------ | | 24| 1.96k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 190| 1.96k| m_free(methodname); ------------------ | | 24| 1.96k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 191| 1.96k|} send_msg_userauth_failure: 348| 1.96k|void send_msg_userauth_failure(int partial, int incrfail) { 349| | 350| 1.96k| buffer *typebuf = NULL; 351| | 352| 1.96k| TRACE(("enter send_msg_userauth_failure")) 353| | 354| 1.96k| CHECKCLEARTOWRITE(); 355| | 356| 1.96k| buf_putbyte(ses.writepayload, SSH_MSG_USERAUTH_FAILURE); ------------------ | | 43| 1.96k|#define SSH_MSG_USERAUTH_FAILURE 51 ------------------ 357| | 358| | /* put a list of allowed types */ 359| 1.96k| typebuf = buf_new(30); /* long enough for PUBKEY and PASSWORD */ 360| | 361| 1.96k| if (ses.authstate.authtypes & AUTH_TYPE_PUBKEY) { ------------------ | | 88| 1.96k|#define AUTH_TYPE_PUBKEY (1 << 1) ------------------ | Branch (361:6): [True: 1.96k, False: 0] ------------------ 362| 1.96k| buf_putbytes(typebuf, (const unsigned char *)AUTH_METHOD_PUBKEY, AUTH_METHOD_PUBKEY_LEN); ------------------ | | 94| 1.96k|#define AUTH_METHOD_PUBKEY "publickey" ------------------ buf_putbytes(typebuf, (const unsigned char *)AUTH_METHOD_PUBKEY, AUTH_METHOD_PUBKEY_LEN); ------------------ | | 95| 1.96k|#define AUTH_METHOD_PUBKEY_LEN 9 ------------------ 363| 1.96k| if (ses.authstate.authtypes & AUTH_TYPE_PASSWORD) { ------------------ | | 89| 1.96k|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ | Branch (363:7): [True: 1.96k, False: 0] ------------------ 364| 1.96k| buf_putbyte(typebuf, ','); 365| 1.96k| } 366| 1.96k| } 367| | 368| 1.96k| if (ses.authstate.authtypes & AUTH_TYPE_PASSWORD) { ------------------ | | 89| 1.96k|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ | Branch (368:6): [True: 1.96k, False: 0] ------------------ 369| 1.96k| buf_putbytes(typebuf, (const unsigned char *)AUTH_METHOD_PASSWORD, AUTH_METHOD_PASSWORD_LEN); ------------------ | | 96| 1.96k|#define AUTH_METHOD_PASSWORD "password" ------------------ buf_putbytes(typebuf, (const unsigned char *)AUTH_METHOD_PASSWORD, AUTH_METHOD_PASSWORD_LEN); ------------------ | | 97| 1.96k|#define AUTH_METHOD_PASSWORD_LEN 8 ------------------ 370| 1.96k| } 371| | 372| 1.96k| buf_putbufstring(ses.writepayload, typebuf); 373| | 374| 1.96k| TRACE(("auth fail: methods %d, '%.*s'", ses.authstate.authtypes, 375| 1.96k| typebuf->len, typebuf->data)) 376| | 377| 1.96k| buf_free(typebuf); 378| | 379| 1.96k| buf_putbyte(ses.writepayload, partial ? 1 : 0); ------------------ | Branch (379:32): [True: 0, False: 1.96k] ------------------ 380| 1.96k| encrypt_packet(); 381| | 382| 1.96k| if (incrfail) { ------------------ | Branch (382:6): [True: 685, False: 1.28k] ------------------ 383| | /* The SSH_MSG_AUTH_FAILURE response is delayed to attempt to 384| | avoid user enumeration and slow brute force attempts. 385| | The delay is adjusted by the time already spent in processing 386| | authentication (ses.authstate.auth_starttime timestamp). */ 387| | 388| | /* Desired total delay 300ms +-50ms (in nanoseconds). 389| | Beware of integer overflow if increasing these values */ 390| 685| const unsigned int mindelay = 250000000; 391| 685| const unsigned int vardelay = 100000000; 392| 685| suseconds_t rand_delay; 393| 685| struct timespec delay; 394| | 395| 685| gettime_wrapper(&delay); 396| 685| delay.tv_sec -= ses.authstate.auth_starttime.tv_sec; 397| 685| delay.tv_nsec -= ses.authstate.auth_starttime.tv_nsec; 398| | 399| | /* carry */ 400| 685| if (delay.tv_nsec < 0) { ------------------ | Branch (400:7): [True: 0, False: 685] ------------------ 401| 0| delay.tv_nsec += 1000000000; 402| 0| delay.tv_sec -= 1; 403| 0| } 404| | 405| 685| genrandom((unsigned char*)&rand_delay, sizeof(rand_delay)); 406| 685| rand_delay = mindelay + (rand_delay % vardelay); 407| | 408| 685| if (delay.tv_sec == 0 && delay.tv_nsec <= mindelay) { ------------------ | Branch (408:7): [True: 685, False: 0] | Branch (408:28): [True: 685, False: 0] ------------------ 409| | /* Compensate for elapsed time */ 410| 685| delay.tv_nsec = rand_delay - delay.tv_nsec; 411| 685| } else { 412| | /* No time left or time went backwards, just delay anyway */ 413| 0| delay.tv_sec = 0; 414| 0| delay.tv_nsec = rand_delay; 415| 0| } 416| | 417| | 418| 685|#if DROPBEAR_FUZZ 419| 685| if (!fuzz.fuzzing) ------------------ | Branch (419:7): [True: 0, False: 685] ------------------ 420| 0|#endif 421| 0| { 422| 0| while (nanosleep(&delay, &delay) == -1 && errno == EINTR) { /* Go back to sleep */ } ------------------ | Branch (422:11): [True: 0, False: 0] | Branch (422:46): [True: 0, False: 0] ------------------ 423| 0| } 424| | 425| 685| ses.authstate.failcount++; 426| 685| } 427| | 428| 1.96k| if (ses.authstate.failcount >= svr_opts.maxauthtries) { ------------------ | Branch (428:6): [True: 2, False: 1.96k] ------------------ 429| 2| char * userstr; 430| | /* XXX - send disconnect ? */ 431| 2| TRACE(("Max auth tries reached, exiting")) 432| | 433| 2| if (ses.authstate.pw_name == NULL) { ------------------ | Branch (433:7): [True: 1, False: 1] ------------------ 434| 1| userstr = "is invalid"; 435| 1| } else { 436| 1| userstr = ses.authstate.pw_name; 437| 1| } 438| 2| dropbear_exit("Max auth tries reached - user '%s'", 439| 2| userstr); 440| 2| } 441| | 442| 1.96k| TRACE(("leave send_msg_userauth_failure")) 443| 1.96k|} svr-auth.c:checkusername: 231| 2.19k|static int checkusername(const char *username, unsigned int userlen) { 232| | 233| 2.19k| char* listshell = NULL; 234| 2.19k| char* usershell = NULL; 235| 2.19k| uid_t uid; 236| | 237| 2.19k| TRACE(("enter checkusername")) 238| 2.19k| if (userlen > MAX_USERNAME_LEN) { ------------------ | | 85| 2.19k|#define MAX_USERNAME_LEN 100 /* arbitrary for the moment */ ------------------ | Branch (238:6): [True: 66, False: 2.12k] ------------------ 239| 66| return DROPBEAR_FAILURE; ------------------ | | 103| 66|#define DROPBEAR_FAILURE -1 ------------------ 240| 66| } 241| | 242| 2.12k| if (strlen(username) != userlen) { ------------------ | Branch (242:6): [True: 12, False: 2.11k] ------------------ 243| 12| dropbear_exit("Attempted username with a null byte"); 244| 12| } 245| | 246| 2.11k| if (ses.authstate.username == NULL) { ------------------ | Branch (246:6): [True: 582, False: 1.53k] ------------------ 247| | /* first request */ 248| 582| fill_passwd(username); 249| 582| ses.authstate.username = m_strdup(username); 250| 1.53k| } else { 251| | /* check username hasn't changed */ 252| 1.53k| if (strcmp(username, ses.authstate.username) != 0) { ------------------ | Branch (252:7): [True: 131, False: 1.40k] ------------------ 253| 131| dropbear_exit("Client trying multiple usernames"); 254| 131| } 255| 1.53k| } 256| | 257| | /* avoids cluttering logs with repeated failure messages from 258| | consecutive authentication requests in a sesssion */ 259| 1.98k| if (ses.authstate.checkusername_failed) { ------------------ | Branch (259:6): [True: 385, False: 1.59k] ------------------ 260| 385| TRACE(("checkusername: returning cached failure")) 261| 385| return DROPBEAR_FAILURE; ------------------ | | 103| 385|#define DROPBEAR_FAILURE -1 ------------------ 262| 385| } 263| | 264| | /* check that user exists */ 265| 1.59k| if (!ses.authstate.pw_name) { ------------------ | Branch (265:6): [True: 559, False: 1.04k] ------------------ 266| 559| TRACE(("leave checkusername: user '%s' doesn't exist", username)) 267| 559| dropbear_log(LOG_WARNING, 268| 559| "Login attempt for nonexistent user"); 269| 559| ses.authstate.checkusername_failed = 1; 270| 559| return DROPBEAR_FAILURE; ------------------ | | 103| 559|#define DROPBEAR_FAILURE -1 ------------------ 271| 559| } 272| | 273| | /* check if we are running as non-root, and login user is different from the server */ 274| 1.04k| uid = geteuid(); 275| 1.04k| if (!(DROPBEAR_SVR_MULTIUSER && uid == 0) && uid != ses.authstate.pw_uid) { ------------------ | | 364| 2.08k|#define DROPBEAR_SVR_MULTIUSER 1 | | ------------------ | | | Branch (364:32): [Folded - Ignored] | | ------------------ ------------------ | Branch (275:34): [True: 1.04k, False: 0] | Branch (275:47): [True: 0, False: 0] ------------------ 276| 0| TRACE(("running as nonroot, only server uid is allowed")) 277| 0| dropbear_log(LOG_WARNING, 278| 0| "Login attempt with wrong user %s", 279| 0| ses.authstate.pw_name); 280| 0| ses.authstate.checkusername_failed = 1; 281| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 282| 0| } 283| | 284| | /* check for non-root if desired */ 285| 1.04k| if (svr_opts.norootlogin && ses.authstate.pw_uid == 0) { ------------------ | Branch (285:6): [True: 0, False: 1.04k] | Branch (285:30): [True: 0, False: 0] ------------------ 286| 0| TRACE(("leave checkusername: root login disabled")) 287| 0| dropbear_log(LOG_WARNING, "root login rejected"); 288| 0| ses.authstate.checkusername_failed = 1; 289| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 290| 0| } 291| | 292| | /* check for login restricted to certain group if desired */ 293| 1.04k|#ifdef HAVE_GETGROUPLIST 294| 1.04k| if (svr_opts.restrict_group) { ------------------ | Branch (294:6): [True: 0, False: 1.04k] ------------------ 295| 0| if (check_group_membership(svr_opts.restrict_group_gid, ------------------ | Branch (295:7): [True: 0, False: 0] ------------------ 296| 0| ses.authstate.pw_name, ses.authstate.pw_gid) == DROPBEAR_FAILURE) { ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 297| 0| dropbear_log(LOG_WARNING, 298| 0| "Logins are restricted to the group %s but user '%s' is not a member", 299| 0| svr_opts.restrict_group, ses.authstate.pw_name); 300| 0| ses.authstate.checkusername_failed = 1; 301| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 302| 0| } 303| 0| } 304| 1.04k|#endif /* HAVE_GETGROUPLIST */ 305| | 306| 1.04k| TRACE(("shell is %s", ses.authstate.pw_shell)) 307| | 308| | /* check that the shell is set */ 309| 1.04k| usershell = ses.authstate.pw_shell; 310| 1.04k| if (usershell[0] == '\0') { ------------------ | Branch (310:6): [True: 0, False: 1.04k] ------------------ 311| | /* empty shell in /etc/passwd means /bin/sh according to passwd(5) */ 312| 0| usershell = "/bin/sh"; 313| 0| } 314| | 315| | /* check the shell is valid. If /etc/shells doesn't exist, getusershell() 316| | * should return some standard shells like "/bin/sh" and "/bin/csh" (this 317| | * is platform-specific) */ 318| 1.04k| setusershell(); 319| 1.04k| while ((listshell = getusershell()) != NULL) { ------------------ | Branch (319:9): [True: 1.04k, False: 0] ------------------ 320| 1.04k| TRACE(("test shell is '%s'", listshell)) 321| 1.04k| if (strcmp(listshell, usershell) == 0) { ------------------ | Branch (321:7): [True: 1.04k, False: 0] ------------------ 322| | /* have a match */ 323| 1.04k| goto goodshell; 324| 1.04k| } 325| 1.04k| } 326| | /* no matching shell */ 327| 0| endusershell(); 328| 0| TRACE(("no matching shell")) 329| 0| ses.authstate.checkusername_failed = 1; 330| 0| dropbear_log(LOG_WARNING, "User '%s' has invalid shell, rejected", 331| 0| ses.authstate.pw_name); 332| 0| return DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 333| | 334| 1.04k|goodshell: 335| 1.04k| endusershell(); 336| 1.04k| TRACE(("matching shell")) 337| | 338| 1.04k| TRACE(("uid = %d", ses.authstate.pw_uid)) 339| 1.04k| TRACE(("leave checkusername")) 340| 1.04k| return DROPBEAR_SUCCESS; ------------------ | | 102| 1.04k|#define DROPBEAR_SUCCESS 0 ------------------ 341| 1.04k|} svr_auth_password: 51| 70|void svr_auth_password(int valid_user) { 52| | 53| 70| char * passwdcrypt = NULL; /* the crypt from /etc/passwd or /etc/shadow */ 54| 70| char * testcrypt = NULL; /* crypt generated from the user's password sent */ 55| 70| char * password = NULL; 56| 70| unsigned int passwordlen; 57| 70| unsigned int changepw; 58| | 59| | /* check if client wants to change password */ 60| 70| changepw = buf_getbool(ses.payload); 61| 70| if (changepw) { ------------------ | Branch (61:6): [True: 35, False: 35] ------------------ 62| | /* not implemented by this server */ 63| 35| send_msg_userauth_failure(0, 1); 64| 35| return; 65| 35| } 66| | 67| 35| password = buf_getstring(ses.payload, &passwordlen); 68| 35| if (valid_user && passwordlen <= DROPBEAR_MAX_PASSWORD_LEN) { ------------------ | | 118| 0|#define DROPBEAR_MAX_PASSWORD_LEN 100 ------------------ | Branch (68:6): [True: 0, False: 35] | Branch (68:20): [True: 0, False: 0] ------------------ 69| | /* the first bytes of passwdcrypt are the salt */ 70| 0| passwdcrypt = ses.authstate.pw_passwd; 71| 0| testcrypt = crypt(password, passwdcrypt); 72| 0| } 73| 35| m_burn(password, passwordlen); 74| 35| m_free(password); ------------------ | | 24| 35|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 75| | 76| | /* After we have got the payload contents we can exit if the username 77| | is invalid. Invalid users have already been logged. */ 78| 35| if (!valid_user) { ------------------ | Branch (78:6): [True: 34, False: 1] ------------------ 79| 34| send_msg_userauth_failure(0, 1); 80| 34| return; 81| 34| } 82| | 83| 1| if (passwordlen > DROPBEAR_MAX_PASSWORD_LEN) { ------------------ | | 118| 1|#define DROPBEAR_MAX_PASSWORD_LEN 100 ------------------ | Branch (83:6): [True: 0, False: 1] ------------------ 84| 0| dropbear_log(LOG_WARNING, 85| 0| "Too-long password attempt for '%s' from %s", 86| 0| ses.authstate.pw_name, 87| 0| svr_ses.addrstring); 88| 0| send_msg_userauth_failure(0, 1); 89| 0| return; 90| 0| } 91| | 92| 1| if (testcrypt == NULL) { ------------------ | Branch (92:6): [True: 0, False: 1] ------------------ 93| | /* crypt() with an invalid salt like "!!" */ 94| 0| dropbear_log(LOG_WARNING, "User account '%s' is locked", 95| 0| ses.authstate.pw_name); 96| 0| send_msg_userauth_failure(0, 1); 97| 0| return; 98| 0| } 99| | 100| | /* check for empty password */ 101| 1| if (passwdcrypt[0] == '\0') { ------------------ | Branch (101:6): [True: 0, False: 1] ------------------ 102| 0| dropbear_log(LOG_WARNING, "User '%s' has blank password, rejected", 103| 0| ses.authstate.pw_name); 104| 0| send_msg_userauth_failure(0, 1); 105| 0| return; 106| 0| } 107| | 108| 1| if (constant_time_strcmp(testcrypt, passwdcrypt) == 0) { ------------------ | Branch (108:6): [True: 0, False: 1] ------------------ 109| 0| if (svr_opts.multiauthmethod && (ses.authstate.authtypes & ~AUTH_TYPE_PASSWORD)) { ------------------ | | 89| 0|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ | Branch (109:7): [True: 0, False: 0] | Branch (109:35): [True: 0, False: 0] ------------------ 110| | /* successful password authentication, but extra auth required */ 111| 0| dropbear_log(LOG_NOTICE, 112| 0| "Password auth succeeded for '%s' from %s, extra auth required", 113| 0| ses.authstate.pw_name, 114| 0| svr_ses.addrstring); 115| 0| ses.authstate.authtypes &= ~AUTH_TYPE_PASSWORD; /* password auth ok, delete the method flag */ ------------------ | | 89| 0|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ 116| 0| send_msg_userauth_failure(1, 0); /* Send partial success */ 117| 0| } else { 118| | /* successful authentication */ 119| 0| dropbear_log(LOG_NOTICE, 120| 0| "Password auth succeeded for '%s' from %s", 121| 0| ses.authstate.pw_name, 122| 0| svr_ses.addrstring); 123| 0| send_msg_userauth_success(); 124| 0| } 125| 1| } else { 126| 1| dropbear_log(LOG_WARNING, 127| 1| "Bad password attempt for '%s' from %s", 128| 1| ses.authstate.pw_name, 129| 1| svr_ses.addrstring); 130| 1| send_msg_userauth_failure(0, 1); 131| 1| } 132| 1|} svr_auth_pubkey: 83| 1.13k|void svr_auth_pubkey(int valid_user) { 84| | 85| 1.13k| unsigned char testkey; /* whether we're just checking if a key is usable */ 86| 1.13k| char* sigalgo = NULL; 87| 1.13k| unsigned int sigalgolen; 88| 1.13k| const char* keyalgo; 89| 1.13k| unsigned int keyalgolen; 90| 1.13k| unsigned char* keyblob = NULL; 91| 1.13k| unsigned int keybloblen; 92| 1.13k| unsigned int sign_payload_length; 93| 1.13k| buffer * signbuf = NULL; 94| 1.13k| sign_key * key = NULL; 95| 1.13k| char* fp = NULL; 96| 1.13k| enum signature_type sigtype; 97| 1.13k| enum signkey_type keytype; 98| 1.13k| int auth_failure = 1; 99| | 100| 1.13k| TRACE(("enter pubkeyauth")) 101| | 102| | /* 0 indicates user just wants to check if key can be used, 1 is an 103| | * actual attempt*/ 104| 1.13k| testkey = (buf_getbool(ses.payload) == 0); 105| | 106| 1.13k| sigalgo = buf_getstring(ses.payload, &sigalgolen); 107| 1.13k| keybloblen = buf_getint(ses.payload); 108| 1.13k| keyblob = buf_getptr(ses.payload, keybloblen); 109| | 110| 1.13k| if (!valid_user) { ------------------ | Branch (110:6): [True: 61, False: 1.07k] ------------------ 111| | /* Return failure once we have read the contents of the packet 112| | required to validate a public key. 113| | Avoids blind user enumeration though it isn't possible to prevent 114| | testing for user existence if the public key is known */ 115| 61| send_msg_userauth_failure(0, 0); 116| 61| goto out; 117| 61| } 118| | 119| 1.07k| sigtype = signature_type_from_name(sigalgo, sigalgolen); 120| 1.07k| if (sigtype == DROPBEAR_SIGNATURE_NONE) { ------------------ | Branch (120:6): [True: 992, False: 81] ------------------ 121| 992| send_msg_userauth_failure(0, 0); 122| 992| goto out; 123| 992| } 124| | 125| 81| keytype = signkey_type_from_signature(sigtype); 126| 81| keyalgo = signkey_name_from_type(keytype, &keyalgolen); 127| | 128| |#if DROPBEAR_PLUGIN 129| | if (svr_ses.plugin_instance != NULL) { 130| | char *options_buf; 131| | if (svr_ses.plugin_instance->checkpubkey( 132| | svr_ses.plugin_instance, 133| | &ses.plugin_session, 134| | keyalgo, 135| | keyalgolen, 136| | keyblob, 137| | keybloblen, 138| | ses.authstate.username) == DROPBEAR_SUCCESS) { 139| | /* Success */ 140| | auth_failure = 0; 141| | 142| | /* Options provided? */ 143| | options_buf = ses.plugin_session->get_options(ses.plugin_session); 144| | if (options_buf) { 145| | struct buf temp_buf = { 146| | .data = (unsigned char *)options_buf, 147| | .len = strlen(options_buf), 148| | .pos = 0, 149| | .size = 0 150| | }; 151| | int ret = svr_add_pubkey_options(&temp_buf, 0, "N/A"); 152| | if (ret == DROPBEAR_FAILURE) { 153| | /* Fail immediately as the plugin provided wrong options */ 154| | send_msg_userauth_failure(0, 0); 155| | goto out; 156| | } 157| | } 158| | } 159| | } 160| |#endif 161| | /* check if the key is valid */ 162| 81| if (auth_failure) { ------------------ | Branch (162:13): [True: 0, False: 81] ------------------ 163| 0| auth_failure = checkpubkey(keyalgo, keyalgolen, keyblob, keybloblen) == DROPBEAR_FAILURE; ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ 164| 0| } 165| | 166| 81| if (auth_failure) { ------------------ | Branch (166:13): [True: 0, False: 81] ------------------ 167| 0| send_msg_userauth_failure(0, 0); 168| 0| goto out; 169| 0| } 170| | 171| | /* let them know that the key is ok to use */ 172| 81| if (testkey) { ------------------ | Branch (172:6): [True: 0, False: 81] ------------------ 173| 0| send_msg_userauth_pk_ok(sigalgo, sigalgolen, keyblob, keybloblen); 174| 0| goto out; 175| 0| } 176| | 177| | /* now we can actually verify the signature */ 178| | 179| | /* get the key */ 180| 81| key = new_sign_key(); 181| 81| if (buf_get_pub_key(ses.payload, key, &keytype) == DROPBEAR_FAILURE) { ------------------ | | 103| 81|#define DROPBEAR_FAILURE -1 ------------------ | Branch (181:6): [True: 0, False: 81] ------------------ 182| 0| send_msg_userauth_failure(0, 1); 183| 0| goto out; 184| 0| } 185| | 186| 81|#if DROPBEAR_SK_ECDSA || DROPBEAR_SK_ED25519 187| 81| key->sk_flags_mask = SSH_SK_USER_PRESENCE_REQD; ------------------ | | 131| 81|#define SSH_SK_USER_PRESENCE_REQD 0x01 ------------------ 188| 81| if (ses.authstate.pubkey_options && ses.authstate.pubkey_options->no_touch_required_flag) { ------------------ | Branch (188:6): [True: 0, False: 81] | Branch (188:38): [True: 0, False: 0] ------------------ 189| 0| key->sk_flags_mask &= ~SSH_SK_USER_PRESENCE_REQD; ------------------ | | 131| 0|#define SSH_SK_USER_PRESENCE_REQD 0x01 ------------------ 190| 0| } 191| 81| if (ses.authstate.pubkey_options && ses.authstate.pubkey_options->verify_required_flag) { ------------------ | Branch (191:6): [True: 0, False: 81] | Branch (191:38): [True: 0, False: 0] ------------------ 192| 0| key->sk_flags_mask |= SSH_SK_USER_VERIFICATION_REQD; ------------------ | | 132| 0|#define SSH_SK_USER_VERIFICATION_REQD 0x04 ------------------ 193| 0| } 194| 81|#endif 195| | 196| | /* create the data which has been signed - this a string containing 197| | * session_id, concatenated with the payload packet up to the signature */ 198| 81| assert(ses.payload_beginning <= ses.payload->pos); 199| 0| sign_payload_length = ses.payload->pos - ses.payload_beginning; 200| 0| signbuf = buf_new(ses.payload->pos + 4 + ses.session_id->len); 201| 0| buf_putbufstring(signbuf, ses.session_id); 202| | 203| | /* The entire contents of the payload prior. */ 204| 0| buf_setpos(ses.payload, ses.payload_beginning); 205| 0| buf_putbytes(signbuf, 206| 0| buf_getptr(ses.payload, sign_payload_length), 207| 0| sign_payload_length); 208| 0| buf_incrpos(ses.payload, sign_payload_length); 209| | 210| 0| buf_setpos(signbuf, 0); 211| | 212| | /* ... and finally verify the signature */ 213| 0| fp = sign_key_fingerprint(keyblob, keybloblen); 214| 0| if (buf_verify(ses.payload, key, sigtype, signbuf) == DROPBEAR_SUCCESS) { ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (214:6): [True: 0, False: 0] ------------------ 215| 0| if (svr_opts.multiauthmethod && (ses.authstate.authtypes & ~AUTH_TYPE_PUBKEY)) { ------------------ | | 88| 0|#define AUTH_TYPE_PUBKEY (1 << 1) ------------------ | Branch (215:7): [True: 0, False: 0] | Branch (215:35): [True: 0, False: 0] ------------------ 216| | /* successful pubkey authentication, but extra auth required */ 217| 0| dropbear_log(LOG_NOTICE, 218| 0| "Pubkey auth succeeded for '%s' with %s key %s from %s, extra auth required", 219| 0| ses.authstate.pw_name, 220| 0| signkey_name_from_type(keytype, NULL), fp, 221| 0| svr_ses.addrstring); 222| 0| ses.authstate.authtypes &= ~AUTH_TYPE_PUBKEY; /* pubkey auth ok, delete the method flag */ ------------------ | | 88| 0|#define AUTH_TYPE_PUBKEY (1 << 1) ------------------ 223| 0| send_msg_userauth_failure(1, 0); /* Send partial success */ 224| 0| } else { 225| | /* successful authentication */ 226| 0| dropbear_log(LOG_NOTICE, 227| 0| "Pubkey auth succeeded for '%s' with %s key %s from %s", 228| 0| ses.authstate.pw_name, 229| 0| signkey_name_from_type(keytype, NULL), fp, 230| 0| svr_ses.addrstring); 231| 0| send_msg_userauth_success(); 232| 0| } 233| |#if DROPBEAR_PLUGIN 234| | if ((ses.plugin_session != NULL) && (svr_ses.plugin_instance->auth_success != NULL)) { 235| | /* Was authenticated through the external plugin. tell plugin that signature verification was ok */ 236| | svr_ses.plugin_instance->auth_success(ses.plugin_session); 237| | } 238| |#endif 239| 0| } else { 240| 0| dropbear_log(LOG_WARNING, 241| 0| "Pubkey auth bad signature for '%s' with key %s from %s", 242| 0| ses.authstate.pw_name, fp, svr_ses.addrstring); 243| 0| send_msg_userauth_failure(0, 1); 244| 0| } 245| 0| m_free(fp); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 246| | 247| 1.05k|out: 248| | /* cleanup stuff */ 249| 1.05k| if (signbuf) { ------------------ | Branch (249:6): [True: 0, False: 1.05k] ------------------ 250| 0| buf_free(signbuf); 251| 0| } 252| 1.05k| if (sigalgo) { ------------------ | Branch (252:6): [True: 1.05k, False: 0] ------------------ 253| 1.05k| m_free(sigalgo); ------------------ | | 24| 1.05k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 254| 1.05k| } 255| 1.05k| if (key) { ------------------ | Branch (255:6): [True: 0, False: 1.05k] ------------------ 256| 0| sign_key_free(key); 257| 0| key = NULL; 258| 0| } 259| | /* Retain pubkey options only if auth succeeded */ 260| 1.05k| if (!ses.authstate.authdone) { ------------------ | Branch (260:6): [True: 1.05k, False: 0] ------------------ 261| 1.05k| svr_pubkey_options_cleanup(); 262| 1.05k| } 263| 1.05k| TRACE(("leave pubkeyauth")) 264| 1.05k|} svr_pubkey_options_cleanup: 135| 4.19k|void svr_pubkey_options_cleanup() { 136| 4.19k| if (ses.authstate.pubkey_options) { ------------------ | Branch (136:6): [True: 0, False: 4.19k] ------------------ 137| 0| if (ses.authstate.pubkey_options->forced_command) { ------------------ | Branch (137:7): [True: 0, False: 0] ------------------ 138| 0| m_free(ses.authstate.pubkey_options->forced_command); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 139| 0| } 140| 0| if (ses.authstate.pubkey_options->permit_open_destinations) { ------------------ | Branch (140:7): [True: 0, False: 0] ------------------ 141| 0| m_list_elem *iter = ses.authstate.pubkey_options->permit_open_destinations->first; 142| 0| while (iter) { ------------------ | Branch (142:11): [True: 0, False: 0] ------------------ 143| 0| struct PermitTCPFwdEntry *entry = (struct PermitTCPFwdEntry*)list_remove(iter); 144| 0| m_free(entry->host); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 145| 0| m_free(entry); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 146| 0| iter = ses.authstate.pubkey_options->permit_open_destinations->first; 147| 0| } 148| 0| m_free(ses.authstate.pubkey_options->permit_open_destinations); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 149| 0| } 150| 0| m_free(ses.authstate.pubkey_options); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 151| 0| } 152| 4.19k| if (ses.authstate.pubkey_info) { ------------------ | Branch (152:6): [True: 0, False: 4.19k] ------------------ 153| 0| m_free(ses.authstate.pubkey_info); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 154| 0| } 155| 4.19k|} svr_chansess_checksignal: 95| 269k|void svr_chansess_checksignal(void) { 96| 269k| int status; 97| 269k| pid_t pid; 98| | 99| 269k| if (!ses.channel_signal_pending) { ------------------ | Branch (99:6): [True: 269k, False: 0] ------------------ 100| 269k| return; 101| 269k| } 102| | 103| 0| while ((pid = waitpid(-1, &status, WNOHANG)) > 0) { ------------------ | Branch (103:9): [True: 0, False: 0] ------------------ 104| 0| unsigned int i; 105| 0| struct exitinfo *ex = NULL; 106| 0| TRACE(("svr_chansess_checksignal : pid %d", pid)) 107| | 108| 0| ex = NULL; 109| | /* find the corresponding chansess */ 110| 0| for (i = 0; i < svr_ses.childpidsize; i++) { ------------------ | Branch (110:15): [True: 0, False: 0] ------------------ 111| 0| if (svr_ses.childpids[i].pid == pid) { ------------------ | Branch (111:8): [True: 0, False: 0] ------------------ 112| 0| TRACE(("found match session")); 113| 0| ex = &svr_ses.childpids[i].chansess->exit; 114| 0| break; 115| 0| } 116| 0| } 117| | 118| | /* If the pid wasn't matched, then we might have hit the race mentioned 119| | * above. So we just store the info for the parent to deal with */ 120| 0| if (ex == NULL) { ------------------ | Branch (120:7): [True: 0, False: 0] ------------------ 121| 0| TRACE(("using lastexit")); 122| 0| ex = &svr_ses.lastexit; 123| 0| } 124| | 125| 0| ex->exitpid = pid; 126| 0| if (WIFEXITED(status)) { 127| 0| ex->exitstatus = WEXITSTATUS(status); 128| 0| } 129| 0| if (WIFSIGNALED(status)) { 130| 0| ex->exitsignal = WTERMSIG(status); 131| 0|#if !defined(AIX) && defined(WCOREDUMP) 132| 0| ex->exitcore = WCOREDUMP(status); 133| |#else 134| | ex->exitcore = 0; 135| |#endif 136| 0| } else { 137| | /* we use this to determine how pid exited */ 138| 0| ex->exitsignal = -1; 139| 0| } 140| 0| } 141| 0|} svr_chansessinitialise: 1077| 3.14k|void svr_chansessinitialise() { 1078| | 1079| 3.14k| struct sigaction sa_chld; 1080| | 1081| | /* single child process intially */ 1082| 3.14k| svr_ses.childpids = (struct ChildPid*)m_malloc(sizeof(struct ChildPid)); 1083| 3.14k| svr_ses.childpids[0].pid = -1; /* unused */ 1084| 3.14k| svr_ses.childpids[0].chansess = NULL; 1085| 3.14k| svr_ses.childpidsize = 1; 1086| 3.14k| svr_ses.lastexit.exitpid = -1; /* Nothing has exited yet */ 1087| 3.14k| sa_chld.sa_handler = sesssigchild_handler; 1088| 3.14k| sa_chld.sa_flags = SA_NOCLDSTOP; 1089| 3.14k| sigemptyset(&sa_chld.sa_mask); 1090| 3.14k| if (sigaction(SIGCHLD, &sa_chld, NULL) < 0) { ------------------ | Branch (1090:6): [True: 0, False: 3.14k] ------------------ 1091| 0| dropbear_exit("signal() error"); 1092| 0| } 1093| | 1094| 3.14k|} recv_msg_kexdh_init: 49| 9.19k|void recv_msg_kexdh_init() { 50| 9.19k| DEF_MP_INT(dh_e); ------------------ | | 80| 9.19k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 51| 9.19k| buffer *ecdh_qs = NULL; 52| | 53| 9.19k| TRACE(("enter recv_msg_kexdh_init")) 54| 9.19k| if (!ses.kexstate.recvkexinit) { ------------------ | Branch (54:6): [True: 6, False: 9.18k] ------------------ 55| 6| dropbear_exit("Premature kexdh_init message received"); 56| 6| } 57| | 58| 9.18k| switch (ses.newkeys->algo_kex->mode) { ------------------ | Branch (58:10): [True: 0, False: 9.18k] ------------------ 59| 0|#if DROPBEAR_NORMAL_DH 60| 3.99k| case DROPBEAR_KEX_NORMAL_DH: ------------------ | Branch (60:3): [True: 3.99k, False: 5.19k] ------------------ 61| 3.99k| m_mp_init(&dh_e); 62| 3.99k| if (buf_getmpint(ses.payload, &dh_e) != DROPBEAR_SUCCESS) { ------------------ | | 102| 3.99k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (62:8): [True: 64, False: 3.93k] ------------------ 63| 64| dropbear_exit("Bad kex value"); 64| 64| } 65| 3.93k| break; 66| 3.93k|#endif 67| 3.93k|#if DROPBEAR_ECDH 68| 3.93k| case DROPBEAR_KEX_ECDH: ------------------ | Branch (68:3): [True: 3.06k, False: 6.12k] ------------------ 69| 3.06k|#endif 70| 3.06k|#if DROPBEAR_CURVE25519 71| 5.19k| case DROPBEAR_KEX_CURVE25519: ------------------ | Branch (71:3): [True: 2.13k, False: 7.05k] ------------------ 72| 5.19k|#endif 73| 5.19k|#if DROPBEAR_ECDH || DROPBEAR_CURVE25519 74| 5.19k| ecdh_qs = buf_getstringbuf(ses.payload); 75| 5.19k| break; 76| 9.18k|#endif 77| 9.18k| } 78| 9.02k| if (ses.payload->pos != ses.payload->len) { ------------------ | Branch (78:6): [True: 91, False: 8.93k] ------------------ 79| 91| dropbear_exit("Bad kex value"); 80| 91| } 81| | 82| 8.93k| send_msg_kexdh_reply(&dh_e, ecdh_qs); 83| | 84| 8.93k| mp_clear(&dh_e); 85| 8.93k| if (ecdh_qs) { ------------------ | Branch (85:6): [True: 5.09k, False: 3.83k] ------------------ 86| 5.09k| buf_free(ecdh_qs); 87| 5.09k| ecdh_qs = NULL; 88| 5.09k| } 89| | 90| 8.93k| send_msg_newkeys(); 91| | 92| 8.93k|#if DROPBEAR_EXT_INFO 93| | /* Only send it following the first newkeys */ 94| 8.93k| if (!ses.kexstate.donesecondkex && ses.allow_ext_info) { ------------------ | Branch (94:6): [True: 1.77k, False: 7.16k] | Branch (94:37): [True: 275, False: 1.49k] ------------------ 95| 275| send_msg_ext_info(); 96| 275| } 97| 8.93k|#endif 98| | 99| 8.93k| ses.requirenext = SSH_MSG_NEWKEYS; ------------------ | | 37| 8.93k|#define SSH_MSG_NEWKEYS 21 ------------------ 100| 8.93k| TRACE(("leave recv_msg_kexdh_init")) 101| 8.93k|} svr-kex.c:send_msg_kexdh_reply: 189| 8.93k|static void send_msg_kexdh_reply(mp_int *dh_e, buffer *ecdh_qs) { 190| 8.93k| TRACE(("enter send_msg_kexdh_reply")) 191| | 192| | /* we can start creating the kexdh_reply packet */ 193| 8.93k| CHECKCLEARTOWRITE(); 194| | 195| 8.93k|#if DROPBEAR_DELAY_HOSTKEY 196| 8.93k| if (svr_opts.delay_hostkey) ------------------ | Branch (196:6): [True: 0, False: 8.93k] ------------------ 197| 0| { 198| 0| svr_ensure_hostkey(); 199| 0| } 200| 8.93k|#endif 201| | 202| 8.93k|#if DROPBEAR_FUZZ 203| 8.93k| if (fuzz.fuzzing && fuzz.skip_kexmaths) { ------------------ | Branch (203:6): [True: 8.93k, False: 0] | Branch (203:22): [True: 8.93k, False: 0] ------------------ 204| 8.93k| fuzz_fake_send_kexdh_reply(); 205| 8.93k| return; 206| 8.93k| } 207| 0|#endif 208| | 209| 0| buf_putbyte(ses.writepayload, SSH_MSG_KEXDH_REPLY); ------------------ | | 39| 0|#define SSH_MSG_KEXDH_REPLY 31 ------------------ 210| 0| buf_put_pub_key(ses.writepayload, svr_opts.hostkey, 211| 0| ses.newkeys->algo_hostkey); 212| | 213| 0| switch (ses.newkeys->algo_kex->mode) { ------------------ | Branch (213:10): [True: 0, False: 0] ------------------ 214| 0|#if DROPBEAR_NORMAL_DH 215| 0| case DROPBEAR_KEX_NORMAL_DH: ------------------ | Branch (215:3): [True: 0, False: 0] ------------------ 216| 0| { 217| 0| struct kex_dh_param * dh_param = gen_kexdh_param(); 218| 0| kexdh_comb_key(dh_param, dh_e, svr_opts.hostkey); 219| | 220| | /* put f */ 221| 0| buf_putmpint(ses.writepayload, &dh_param->pub); 222| 0| free_kexdh_param(dh_param); 223| 0| } 224| 0| break; 225| 0|#endif 226| 0|#if DROPBEAR_ECDH 227| 0| case DROPBEAR_KEX_ECDH: ------------------ | Branch (227:3): [True: 0, False: 0] ------------------ 228| 0| { 229| 0| struct kex_ecdh_param *ecdh_param = gen_kexecdh_param(); 230| 0| kexecdh_comb_key(ecdh_param, ecdh_qs, svr_opts.hostkey); 231| | 232| 0| buf_put_ecc_raw_pubkey_string(ses.writepayload, &ecdh_param->key); 233| 0| free_kexecdh_param(ecdh_param); 234| 0| } 235| 0| break; 236| 0|#endif 237| 0|#if DROPBEAR_CURVE25519 238| 0| case DROPBEAR_KEX_CURVE25519: ------------------ | Branch (238:3): [True: 0, False: 0] ------------------ 239| 0| { 240| 0| struct kex_curve25519_param *param = gen_kexcurve25519_param(); 241| 0| kexcurve25519_comb_key(param, ecdh_qs, svr_opts.hostkey); 242| | 243| 0| buf_putstring(ses.writepayload, param->pub, CURVE25519_LEN); ------------------ | | 106| 0|#define CURVE25519_LEN 32 ------------------ 244| 0| free_kexcurve25519_param(param); 245| 0| } 246| 0| break; 247| 0|#endif 248| 0| } 249| | 250| | /* calc the signature */ 251| 0| buf_put_sign(ses.writepayload, svr_opts.hostkey, 252| 0| ses.newkeys->algo_signature, ses.hash); 253| | 254| | /* the SSH_MSG_KEXDH_REPLY is done */ 255| 0| encrypt_packet(); 256| | 257| 0| TRACE(("leave send_msg_kexdh_reply")) 258| 0|} svr-kex.c:send_msg_ext_info: 262| 275|static void send_msg_ext_info(void) { 263| 275| TRACE(("enter send_msg_ext_info")) 264| | 265| 275| buf_putbyte(ses.writepayload, SSH_MSG_EXT_INFO); ------------------ | | 35| 275|#define SSH_MSG_EXT_INFO 7 ------------------ 266| | /* nr-extensions */ 267| 275| buf_putint(ses.writepayload, 1); 268| | 269| 275| buf_putstring(ses.writepayload, SSH_SERVER_SIG_ALGS, strlen(SSH_SERVER_SIG_ALGS)); ------------------ | | 101| 275|#define SSH_SERVER_SIG_ALGS "server-sig-algs" ------------------ buf_putstring(ses.writepayload, SSH_SERVER_SIG_ALGS, strlen(SSH_SERVER_SIG_ALGS)); ------------------ | | 101| 275|#define SSH_SERVER_SIG_ALGS "server-sig-algs" ------------------ 270| 275| buf_put_algolist_all(ses.writepayload, sigalgs, 1); 271| | 272| 275| encrypt_packet(); 273| | 274| 275| TRACE(("leave send_msg_ext_info")) 275| 275|} svr_getopts: 134| 1|void svr_getopts(int argc, char ** argv) { 135| | 136| 1| unsigned int i, j; 137| 1| char ** next = NULL; 138| 1| int nextisport = 0; 139| 1| char* recv_window_arg = NULL; 140| 1| char* keepalive_arg = NULL; 141| 1| char* idle_timeout_arg = NULL; 142| 1| char* maxauthtries_arg = NULL; 143| 1| char* reexec_fd_arg = NULL; 144| 1| char* keyfile = NULL; 145| 1| char c; 146| |#if DROPBEAR_PLUGIN 147| | char* pubkey_plugin = NULL; 148| |#endif 149| | 150| | 151| | /* see printhelp() for options */ 152| 1| svr_opts.bannerfile = NULL; 153| 1| svr_opts.banner = NULL; 154| 1| svr_opts.forced_command = NULL; 155| 1| svr_opts.forkbg = 1; 156| 1| svr_opts.norootlogin = 0; 157| 1|#ifdef HAVE_GETGROUPLIST 158| 1| svr_opts.restrict_group = NULL; 159| 1| svr_opts.restrict_group_gid = 0; 160| 1|#endif 161| 1| svr_opts.noauthpass = 0; 162| 1| svr_opts.norootpass = 0; 163| 1| svr_opts.allowblankpass = 0; 164| 1| svr_opts.multiauthmethod = 0; 165| 1| svr_opts.maxauthtries = MAX_AUTH_TRIES; ------------------ | | 428| 1|#define MAX_AUTH_TRIES 10 ------------------ 166| 1| svr_opts.inetdmode = 0; 167| 1| svr_opts.portcount = 0; 168| 1| svr_opts.hostkey = NULL; 169| 1| svr_opts.delay_hostkey = 0; 170| 1| svr_opts.pidfile = expand_homedir_path(DROPBEAR_PIDFILE); ------------------ | | 444| 1|#define DROPBEAR_PIDFILE "/var/run/dropbear.pid" ------------------ 171| 1|#if DROPBEAR_SVR_LOCALTCPFWD 172| 1| svr_opts.nolocaltcp = 0; 173| 1|#endif 174| 1|#if DROPBEAR_SVR_REMOTETCPFWD 175| 1| svr_opts.noremotetcp = 0; 176| 1|#endif 177| |#if DROPBEAR_PLUGIN 178| | svr_opts.pubkey_plugin = NULL; 179| | svr_opts.pubkey_plugin_options = NULL; 180| |#endif 181| 1| svr_opts.pass_on_env = 0; 182| 1| svr_opts.reexec_childpipe = -1; 183| | 184| |#ifndef DISABLE_ZLIB 185| | opts.compress_mode = DROPBEAR_COMPRESS_DELAYED; 186| |#endif 187| | 188| | /* not yet 189| | opts.ipv4 = 1; 190| | opts.ipv6 = 1; 191| | */ 192| 1|#if DO_MOTD 193| 1| svr_opts.domotd = 1; 194| 1|#endif 195| 1|#ifndef DISABLE_SYSLOG 196| 1| opts.usingsyslog = 1; 197| 1|#endif 198| 1| opts.recv_window = DEFAULT_RECV_WINDOW; ------------------ | | 487| 1|#define DEFAULT_RECV_WINDOW 24576 ------------------ 199| 1| opts.keepalive_secs = DEFAULT_KEEPALIVE; ------------------ | | 503| 1|#define DEFAULT_KEEPALIVE 0 ------------------ 200| 1| opts.idle_timeout_secs = DEFAULT_IDLE_TIMEOUT; ------------------ | | 516| 1|#define DEFAULT_IDLE_TIMEOUT 0 ------------------ 201| | 202| 1|#if DROPBEAR_SVR_REMOTETCPFWD 203| 1| opts.listen_fwd_all = 0; 204| 1|#endif 205| 1| opts.disable_ip_tos = 0; 206| | 207| 2| for (i = 1; i < (unsigned int)argc; i++) { ------------------ | Branch (207:14): [True: 1, False: 1] ------------------ 208| 1| if (argv[i][0] != '-' || argv[i][1] == '\0') ------------------ | Branch (208:7): [True: 0, False: 1] | Branch (208:28): [True: 0, False: 1] ------------------ 209| 0| dropbear_exit("Invalid argument: %s", argv[i]); 210| | 211| 2| for (j = 1; (c = argv[i][j]) != '\0' && !next && !nextisport; j++) { ------------------ | Branch (211:15): [True: 1, False: 1] | Branch (211:43): [True: 1, False: 0] | Branch (211:52): [True: 1, False: 0] ------------------ 212| 1| switch (c) { 213| 0| case 'b': ------------------ | Branch (213:5): [True: 0, False: 1] ------------------ 214| 0| next = &svr_opts.bannerfile; 215| 0| break; 216| 0| case 'c': ------------------ | Branch (216:5): [True: 0, False: 1] ------------------ 217| 0| next = &svr_opts.forced_command; 218| 0| break; 219| 0| case 'd': ------------------ | Branch (219:5): [True: 0, False: 1] ------------------ 220| 0| case 'r': ------------------ | Branch (220:5): [True: 0, False: 1] ------------------ 221| 0| next = &keyfile; 222| 0| break; 223| 0| case 'R': ------------------ | Branch (223:5): [True: 0, False: 1] ------------------ 224| 0| svr_opts.delay_hostkey = 1; 225| 0| break; 226| 0| case 'F': ------------------ | Branch (226:5): [True: 0, False: 1] ------------------ 227| 0| svr_opts.forkbg = 0; 228| 0| break; 229| 0|#ifndef DISABLE_SYSLOG 230| 1| case 'E': ------------------ | Branch (230:5): [True: 1, False: 0] ------------------ 231| 1| opts.usingsyslog = 0; 232| 1| break; 233| 0|#endif 234| 0| case 'e': ------------------ | Branch (234:5): [True: 0, False: 1] ------------------ 235| 0| svr_opts.pass_on_env = 1; 236| 0| break; 237| | 238| 0|#if DROPBEAR_SVR_LOCALTCPFWD 239| 0| case 'j': ------------------ | Branch (239:5): [True: 0, False: 1] ------------------ 240| 0| svr_opts.nolocaltcp = 1; 241| 0| break; 242| 0|#endif 243| 0|#if DROPBEAR_SVR_REMOTETCPFWD 244| 0| case 'k': ------------------ | Branch (244:5): [True: 0, False: 1] ------------------ 245| 0| svr_opts.noremotetcp = 1; 246| 0| break; 247| 0| case 'a': ------------------ | Branch (247:5): [True: 0, False: 1] ------------------ 248| 0| opts.listen_fwd_all = 1; 249| 0| break; 250| 0|#endif 251| 0|#if INETD_MODE 252| 0| case 'i': ------------------ | Branch (252:5): [True: 0, False: 1] ------------------ 253| 0| svr_opts.inetdmode = 1; 254| 0| break; 255| 0|#endif 256| 0|#if DROPBEAR_DO_REEXEC && NON_INETD_MODE 257| | /* For internal use by re-exec */ 258| 0| case '2': ------------------ | Branch (258:5): [True: 0, False: 1] ------------------ 259| 0| next = &reexec_fd_arg; 260| 0| break; 261| 0|#endif 262| 0| case 'p': ------------------ | Branch (262:5): [True: 0, False: 1] ------------------ 263| 0| nextisport = 1; 264| 0| break; 265| 0| case 'P': ------------------ | Branch (265:5): [True: 0, False: 1] ------------------ 266| 0| next = &svr_opts.pidfile; 267| 0| break; 268| 0|#if DO_MOTD 269| | /* motd is displayed by default, -m turns it off */ 270| 0| case 'm': ------------------ | Branch (270:5): [True: 0, False: 1] ------------------ 271| 0| svr_opts.domotd = 0; 272| 0| break; 273| 0|#endif 274| 0| case 'w': ------------------ | Branch (274:5): [True: 0, False: 1] ------------------ 275| 0| svr_opts.norootlogin = 1; 276| 0| break; 277| 0|#ifdef HAVE_GETGROUPLIST 278| 0| case 'G': ------------------ | Branch (278:5): [True: 0, False: 1] ------------------ 279| 0| next = &svr_opts.restrict_group; 280| 0| break; 281| 0|#endif 282| 0| case 'W': ------------------ | Branch (282:5): [True: 0, False: 1] ------------------ 283| 0| next = &recv_window_arg; 284| 0| break; 285| 0| case 'K': ------------------ | Branch (285:5): [True: 0, False: 1] ------------------ 286| 0| next = &keepalive_arg; 287| 0| break; 288| 0| case 'I': ------------------ | Branch (288:5): [True: 0, False: 1] ------------------ 289| 0| next = &idle_timeout_arg; 290| 0| break; 291| 0| case 'T': ------------------ | Branch (291:5): [True: 0, False: 1] ------------------ 292| 0| next = &maxauthtries_arg; 293| 0| break; 294| 0|#if DROPBEAR_SVR_PASSWORD_AUTH || DROPBEAR_SVR_PAM_AUTH 295| 0| case 's': ------------------ | Branch (295:5): [True: 0, False: 1] ------------------ 296| 0| svr_opts.noauthpass = 1; 297| 0| break; 298| 0| case 'g': ------------------ | Branch (298:5): [True: 0, False: 1] ------------------ 299| 0| svr_opts.norootpass = 1; 300| 0| break; 301| 0| case 'B': ------------------ | Branch (301:5): [True: 0, False: 1] ------------------ 302| 0| svr_opts.allowblankpass = 1; 303| 0| break; 304| 0| case 't': ------------------ | Branch (304:5): [True: 0, False: 1] ------------------ 305| 0| svr_opts.multiauthmethod = 1; 306| 0| break; 307| 0|#endif 308| 0| case 'h': ------------------ | Branch (308:5): [True: 0, False: 1] ------------------ 309| 0| printhelp(argv[0]); 310| 0| exit(EXIT_SUCCESS); 311| 0| break; 312| 0| case 'u': ------------------ | Branch (312:5): [True: 0, False: 1] ------------------ 313| | /* backwards compatibility with old urandom option */ 314| 0| break; 315| |#if DROPBEAR_PLUGIN 316| | case 'A': 317| | next = &pubkey_plugin; 318| | break; 319| |#endif 320| |#if DEBUG_TRACE 321| | case 'v': 322| | debug_trace++; 323| | break; 324| |#endif 325| 0| case 'V': ------------------ | Branch (325:5): [True: 0, False: 1] ------------------ 326| 0| print_version(); 327| 0| exit(EXIT_SUCCESS); 328| 0| break; 329| 0| case 'z': ------------------ | Branch (329:5): [True: 0, False: 1] ------------------ 330| 0| opts.disable_ip_tos = 1; 331| 0| break; 332| 0| default: ------------------ | Branch (332:5): [True: 0, False: 1] ------------------ 333| 0| fprintf(stderr, "Invalid option -%c\n", c); ------------------ | | 100| 0|#define stderr (fuzz.fake_stderr) ------------------ 334| 0| printhelp(argv[0]); 335| 0| exit(EXIT_FAILURE); 336| 0| break; 337| 1| } 338| 1| } 339| | 340| 1| if (!next && !nextisport) ------------------ | Branch (340:7): [True: 1, False: 0] | Branch (340:16): [True: 1, False: 0] ------------------ 341| 1| continue; 342| | 343| 0| if (c == '\0') { ------------------ | Branch (343:7): [True: 0, False: 0] ------------------ 344| 0| i++; 345| 0| j = 0; 346| 0| if (!argv[i]) { ------------------ | Branch (346:8): [True: 0, False: 0] ------------------ 347| 0| dropbear_exit("Missing argument"); 348| 0| } 349| 0| } 350| | 351| 0| if (nextisport) { ------------------ | Branch (351:7): [True: 0, False: 0] ------------------ 352| 0| addportandaddress(&argv[i][j]); 353| 0| nextisport = 0; 354| 0| } else if (next) { ------------------ | Branch (354:14): [True: 0, False: 0] ------------------ 355| 0| *next = &argv[i][j]; 356| 0| if (*next == NULL) { ------------------ | Branch (356:8): [True: 0, False: 0] ------------------ 357| 0| dropbear_exit("Invalid null argument"); 358| 0| } 359| 0| next = NULL; 360| | 361| 0| if (keyfile) { ------------------ | Branch (361:8): [True: 0, False: 0] ------------------ 362| 0| addhostkey(keyfile); 363| 0| keyfile = NULL; 364| 0| } 365| 0| } 366| 0| } 367| | 368| | /* Set up listening ports */ 369| 1| if (svr_opts.portcount == 0) { ------------------ | Branch (369:6): [True: 1, False: 0] ------------------ 370| 1| svr_opts.ports[0] = m_strdup(DROPBEAR_DEFPORT); ------------------ | | 23| 1|#define DROPBEAR_DEFPORT "22" ------------------ 371| 1| svr_opts.addresses[0] = m_strdup(DROPBEAR_DEFADDRESS); ------------------ | | 28| 1|#define DROPBEAR_DEFADDRESS "" ------------------ 372| 1| svr_opts.portcount = 1; 373| 1| } 374| | 375| 1| if (svr_opts.bannerfile) { ------------------ | Branch (375:6): [True: 0, False: 1] ------------------ 376| 0| struct stat buf; 377| 0| if (stat(svr_opts.bannerfile, &buf) != 0) { ------------------ | Branch (377:7): [True: 0, False: 0] ------------------ 378| 0| dropbear_exit("Error opening banner file '%s'", 379| 0| svr_opts.bannerfile); 380| 0| } 381| | 382| 0| if (buf.st_size > MAX_BANNER_SIZE) { ------------------ | | 68| 0|#define MAX_BANNER_SIZE 2050 /* this is 25*80 chars, any more is foolish */ ------------------ | Branch (382:7): [True: 0, False: 0] ------------------ 383| 0| dropbear_exit("Banner file too large, max is %d bytes", 384| 0| MAX_BANNER_SIZE); ------------------ | | 68| 0|#define MAX_BANNER_SIZE 2050 /* this is 25*80 chars, any more is foolish */ ------------------ 385| 0| } 386| | 387| 0| svr_opts.banner = buf_new(buf.st_size); 388| 0| if (buf_readfile(svr_opts.banner, svr_opts.bannerfile)!=DROPBEAR_SUCCESS) { ------------------ | | 102| 0|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (388:7): [True: 0, False: 0] ------------------ 389| 0| dropbear_exit("Error reading banner file '%s'", 390| 0| svr_opts.bannerfile); 391| 0| } 392| 0| buf_setpos(svr_opts.banner, 0); 393| 0| } 394| | 395| 1|#ifdef HAVE_GETGROUPLIST 396| 1| if (svr_opts.restrict_group) { ------------------ | Branch (396:6): [True: 0, False: 1] ------------------ 397| 0| struct group *restrictedgroup = getgrnam(svr_opts.restrict_group); 398| | 399| 0| if (restrictedgroup){ ------------------ | Branch (399:7): [True: 0, False: 0] ------------------ 400| 0| svr_opts.restrict_group_gid = restrictedgroup->gr_gid; 401| 0| } else { 402| 0| dropbear_exit("Cannot restrict logins to group '%s' as the group does not exist", svr_opts.restrict_group); 403| 0| } 404| 0| } 405| 1|#endif 406| | 407| 1| if (recv_window_arg) { ------------------ | Branch (407:6): [True: 0, False: 1] ------------------ 408| 0| parse_recv_window(recv_window_arg); 409| 0| } 410| | 411| 1| if (maxauthtries_arg) { ------------------ | Branch (411:6): [True: 0, False: 1] ------------------ 412| 0| unsigned int val = 0; 413| 0| if (m_str_to_uint(maxauthtries_arg, &val) == DROPBEAR_FAILURE ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (413:7): [True: 0, False: 0] ------------------ 414| 0| || val == 0) { ------------------ | Branch (414:7): [True: 0, False: 0] ------------------ 415| 0| dropbear_exit("Bad maxauthtries '%s'", maxauthtries_arg); 416| 0| } 417| 0| svr_opts.maxauthtries = val; 418| 0| } 419| | 420| | 421| 1| if (keepalive_arg) { ------------------ | Branch (421:6): [True: 0, False: 1] ------------------ 422| 0| unsigned int val; 423| 0| if (m_str_to_uint(keepalive_arg, &val) == DROPBEAR_FAILURE) { ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (423:7): [True: 0, False: 0] ------------------ 424| 0| dropbear_exit("Bad keepalive '%s'", keepalive_arg); 425| 0| } 426| 0| opts.keepalive_secs = val; 427| 0| } 428| | 429| 1| if (idle_timeout_arg) { ------------------ | Branch (429:6): [True: 0, False: 1] ------------------ 430| 0| unsigned int val; 431| 0| if (m_str_to_uint(idle_timeout_arg, &val) == DROPBEAR_FAILURE) { ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (431:7): [True: 0, False: 0] ------------------ 432| 0| dropbear_exit("Bad idle_timeout '%s'", idle_timeout_arg); 433| 0| } 434| 0| opts.idle_timeout_secs = val; 435| 0| } 436| | 437| 1| if (svr_opts.forced_command) { ------------------ | Branch (437:6): [True: 0, False: 1] ------------------ 438| 0| dropbear_log(LOG_INFO, "Forced command set to '%s'", svr_opts.forced_command); 439| 0| } 440| | 441| 1| if (reexec_fd_arg) { ------------------ | Branch (441:6): [True: 0, False: 1] ------------------ 442| 0| if (m_str_to_uint(reexec_fd_arg, &svr_opts.reexec_childpipe) == DROPBEAR_FAILURE ------------------ | | 103| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (442:7): [True: 0, False: 0] ------------------ 443| 0| || svr_opts.reexec_childpipe < 0) { ------------------ | Branch (443:7): [True: 0, False: 0] ------------------ 444| 0| dropbear_exit("Bad -2"); 445| 0| } 446| 0| } 447| | 448| 1|#if INETD_MODE 449| 1| if (svr_opts.inetdmode && ( ------------------ | Branch (449:6): [True: 0, False: 1] | Branch (449:28): [True: 0, False: 0] ------------------ 450| 0| opts.usingsyslog == 0 451| |#if DEBUG_TRACE 452| | || debug_trace 453| |#endif 454| 0| )) { 455| | /* log output goes to stderr which would get sent over the inetd network socket */ 456| 0| dropbear_exit("Dropbear inetd mode is incompatible with debug -v or non-syslog"); 457| 0| } 458| 1|#endif 459| | 460| 1| if (svr_opts.multiauthmethod && svr_opts.noauthpass) { ------------------ | Branch (460:6): [True: 0, False: 1] | Branch (460:34): [True: 0, False: 0] ------------------ 461| 0| dropbear_exit("-t and -s are incompatible"); 462| 0| } 463| | 464| |#if DROPBEAR_PLUGIN 465| | if (pubkey_plugin) { 466| | svr_opts.pubkey_plugin = m_strdup(pubkey_plugin); 467| | char *args = strchr(svr_opts.pubkey_plugin, ','); 468| | if (args) { 469| | *args='\0'; 470| | ++args; 471| | } 472| | svr_opts.pubkey_plugin_options = args; 473| | } 474| |#endif 475| 1|} recv_msg_service_request: 37| 487|void recv_msg_service_request() { 38| | 39| 487| char * name; 40| 487| unsigned int len; 41| | 42| 487| TRACE(("enter recv_msg_service_request")) 43| | 44| 487| name = buf_getstring(ses.payload, &len); 45| | 46| | /* ssh-userauth */ 47| 487| if (len == SSH_SERVICE_USERAUTH_LEN && ------------------ | | 105| 974|#define SSH_SERVICE_USERAUTH_LEN 12 ------------------ | Branch (47:6): [True: 339, False: 148] ------------------ 48| 487| strncmp(SSH_SERVICE_USERAUTH, name, len) == 0) { ------------------ | | 104| 339|#define SSH_SERVICE_USERAUTH "ssh-userauth" ------------------ | Branch (48:4): [True: 233, False: 106] ------------------ 49| | 50| 233| send_msg_service_accept(name, len); 51| 233| m_free(name); ------------------ | | 24| 233|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 52| 233| TRACE(("leave recv_msg_service_request: done ssh-userauth")) 53| 233| return; 54| 233| } 55| | 56| | /* ssh-connection */ 57| 254| if (len == SSH_SERVICE_CONNECTION_LEN && ------------------ | | 107| 508|#define SSH_SERVICE_CONNECTION_LEN 14 ------------------ | Branch (57:6): [True: 116, False: 138] ------------------ 58| 254| (strncmp(SSH_SERVICE_CONNECTION, name, len) == 0)) { ------------------ | | 106| 116|#define SSH_SERVICE_CONNECTION "ssh-connection" ------------------ | Branch (58:4): [True: 1, False: 115] ------------------ 59| 1| if (ses.authstate.authdone != 1) { ------------------ | Branch (59:7): [True: 1, False: 0] ------------------ 60| 1| dropbear_exit("Request for connection before auth"); 61| 1| } 62| | 63| 0| send_msg_service_accept(name, len); 64| 0| m_free(name); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 65| 0| TRACE(("leave recv_msg_service_request: done ssh-connection")) 66| 0| return; 67| 1| } 68| | 69| 253| m_free(name); ------------------ | | 24| 253|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 70| | /* TODO this should be a MSG_DISCONNECT */ 71| 253| dropbear_exit("Unrecognised SSH_MSG_SERVICE_REQUEST"); 72| | 73| | 74| 254|} svr-service.c:send_msg_service_accept: 76| 233|static void send_msg_service_accept(const char *name, int len) { 77| | 78| 233| TRACE(("accepting service %s", name)) 79| | 80| 233| CHECKCLEARTOWRITE(); 81| | 82| 233| buf_putbyte(ses.writepayload, SSH_MSG_SERVICE_ACCEPT); ------------------ | | 34| 233|#define SSH_MSG_SERVICE_ACCEPT 6 ------------------ 83| 233| buf_putstring(ses.writepayload, name, len); 84| | 85| 233| encrypt_packet(); 86| | 87| 233|} svr_session: 105| 3.14k|void svr_session(int sock, int childpipe) { 106| 3.14k| char *host, *port; 107| 3.14k| size_t len; 108| | 109| 3.14k| common_session_init(sock, sock); 110| | 111| | /* Initialise server specific parts of the session */ 112| 3.14k| svr_ses.childpipe = childpipe; 113| |#if DROPBEAR_VFORK 114| | svr_ses.server_pid = getpid(); 115| |#endif 116| | 117| | /* for logging the remote address */ 118| 3.14k| get_socket_address(ses.sock_in, NULL, NULL, &host, &port, 0); 119| 3.14k| len = strlen(host) + strlen(port) + 2; 120| 3.14k| svr_ses.addrstring = m_malloc(len); 121| 3.14k| snprintf(svr_ses.addrstring, len, "%s:%s", host, port); 122| 3.14k| m_free(host); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 123| 3.14k| m_free(port); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 124| | 125| |#if DROPBEAR_PLUGIN 126| | /* Initializes the PLUGIN Plugin */ 127| | svr_ses.plugin_handle = NULL; 128| | svr_ses.plugin_instance = NULL; 129| | if (svr_opts.pubkey_plugin) { 130| |#if DEBUG_TRACE 131| | const int verbose = debug_trace; 132| |#else 133| | const int verbose = 0; 134| |#endif 135| | PubkeyExtPlugin_newFn pluginConstructor; 136| | 137| | /* RTLD_NOW: fails if not all the symbols are resolved now. Better fail now than at run-time */ 138| | svr_ses.plugin_handle = dlopen(svr_opts.pubkey_plugin, RTLD_NOW); 139| | if (svr_ses.plugin_handle == NULL) { 140| | dropbear_exit("failed to load external pubkey plugin '%s': %s", svr_opts.pubkey_plugin, dlerror()); 141| | } 142| | pluginConstructor = (PubkeyExtPlugin_newFn)dlsym(svr_ses.plugin_handle, DROPBEAR_PUBKEY_PLUGIN_FNNAME_NEW); 143| | if (!pluginConstructor) { 144| | dropbear_exit("plugin constructor method not found in external pubkey plugin"); 145| | } 146| | 147| | /* Create an instance of the plugin */ 148| | svr_ses.plugin_instance = pluginConstructor(verbose, svr_opts.pubkey_plugin_options, svr_ses.addrstring); 149| | if (svr_ses.plugin_instance == NULL) { 150| | dropbear_exit("external plugin initialization failed"); 151| | } 152| | /* Check if the plugin is compatible */ 153| | if ( (svr_ses.plugin_instance->api_version[0] != DROPBEAR_PLUGIN_VERSION_MAJOR) || 154| | (svr_ses.plugin_instance->api_version[1] < DROPBEAR_PLUGIN_VERSION_MINOR) ) { 155| | dropbear_exit("plugin version check failed: " 156| | "Dropbear=%d.%d, plugin=%d.%d", 157| | DROPBEAR_PLUGIN_VERSION_MAJOR, DROPBEAR_PLUGIN_VERSION_MINOR, 158| | svr_ses.plugin_instance->api_version[0], svr_ses.plugin_instance->api_version[1]); 159| | } 160| | if (svr_ses.plugin_instance->api_version[1] > DROPBEAR_PLUGIN_VERSION_MINOR) { 161| | dropbear_log(LOG_WARNING, "plugin API newer than dropbear API: " 162| | "Dropbear=%d.%d, plugin=%d.%d", 163| | DROPBEAR_PLUGIN_VERSION_MAJOR, DROPBEAR_PLUGIN_VERSION_MINOR, 164| | svr_ses.plugin_instance->api_version[0], svr_ses.plugin_instance->api_version[1]); 165| | } 166| | dropbear_log(LOG_INFO, "successfully loaded and initialized pubkey plugin '%s'", svr_opts.pubkey_plugin); 167| | } 168| |#endif 169| | 170| 3.14k| svr_authinitialise(); 171| 3.14k| chaninitialise(svr_chantypes); 172| 3.14k| svr_chansessinitialise(); 173| 3.14k| svr_algos_initialise(); 174| | 175| 3.14k| get_socket_address(ses.sock_in, NULL, NULL, 176| 3.14k| &svr_ses.remotehost, NULL, 1); 177| | 178| | /* set up messages etc */ 179| 3.14k| ses.remoteclosed = svr_remoteclosed; 180| 3.14k| ses.extra_session_cleanup = svr_session_cleanup; 181| | 182| | /* packet handlers */ 183| 3.14k| ses.packettypes = svr_packettypes; 184| | 185| 3.14k| ses.isserver = 1; 186| | 187| | /* We're ready to go now */ 188| 3.14k| ses.init_done = 1; 189| | 190| | /* exchange identification, version etc */ 191| 3.14k| send_session_identification(); 192| | 193| 3.14k| kexfirstinitialise(); /* initialise the kex state */ 194| | 195| | /* start off with key exchange */ 196| 3.14k| send_msg_kexinit(); 197| | 198| 3.14k|#if DROPBEAR_FUZZ 199| 3.14k| if (fuzz.fuzzing) { ------------------ | Branch (199:9): [True: 3.14k, False: 0] ------------------ 200| 3.14k| fuzz_svr_hook_preloop(); 201| 3.14k| } 202| 3.14k|#endif 203| | 204| | /* Run the main for-loop. */ 205| 3.14k| session_loop(svr_chansess_checksignal); 206| | 207| | /* Not reached */ 208| | 209| 3.14k|} svr_dropbear_exit: 212| 3.14k|void svr_dropbear_exit(int exitcode, const char* format, va_list param) { 213| 3.14k| char exitmsg[150]; 214| 3.14k| char fullmsg[300]; 215| 3.14k| char fromaddr[60]; 216| 3.14k| int i; 217| 3.14k| int add_delay = 0; 218| | 219| |#if DROPBEAR_PLUGIN 220| | if ((ses.plugin_session != NULL)) { 221| | svr_ses.plugin_instance->delete_session(ses.plugin_session); 222| | } 223| | ses.plugin_session = NULL; 224| | svr_opts.pubkey_plugin_options = NULL; 225| | m_free(svr_opts.pubkey_plugin); 226| |#endif 227| | 228| | /* Render the formatted exit message */ 229| 3.14k| vsnprintf(exitmsg, sizeof(exitmsg), format, param); 230| | 231| | /* svr_ses.addrstring may not be set for some early exits, or for 232| | the listener process */ 233| 3.14k| fromaddr[0] = '\0'; 234| 3.14k| if (svr_ses.addrstring) { ------------------ | Branch (234:6): [True: 3.14k, False: 0] ------------------ 235| 3.14k| snprintf(fromaddr, sizeof(fromaddr), " from <%s>", svr_ses.addrstring); 236| 3.14k| } 237| | 238| | /* Add the prefix depending on session/auth state */ 239| 3.14k| if (!ses.init_done) { ------------------ | Branch (239:6): [True: 0, False: 3.14k] ------------------ 240| | /* before session init */ 241| 0| snprintf(fullmsg, sizeof(fullmsg), "Early exit%s: %s", fromaddr, exitmsg); 242| 3.14k| } else if (ses.authstate.authdone) { ------------------ | Branch (242:13): [True: 0, False: 3.14k] ------------------ 243| | /* user has authenticated */ 244| 0| snprintf(fullmsg, sizeof(fullmsg), 245| 0| "Exit (%s)%s: %s", 246| 0| ses.authstate.pw_name, fromaddr, exitmsg); 247| 3.14k| } else if (ses.authstate.pw_name) { ------------------ | Branch (247:13): [True: 23, False: 3.12k] ------------------ 248| | /* we have a potential user */ 249| 23| snprintf(fullmsg, sizeof(fullmsg), 250| 23| "Exit before auth%s: (user '%s', %u fails): %s", 251| 23| fromaddr, ses.authstate.pw_name, ses.authstate.failcount, exitmsg); 252| 23| add_delay = 1; 253| 3.12k| } else { 254| | /* before userauth */ 255| 3.12k| snprintf(fullmsg, sizeof(fullmsg), "Exit before auth%s: %s", fromaddr, exitmsg); 256| 3.12k| add_delay = 1; 257| 3.12k| } 258| | 259| 3.14k| dropbear_log(LOG_INFO, "%s", fullmsg); 260| | 261| | /* To make it harder for attackers, introduce a delay to keep an 262| | * unauthenticated session open a bit longer, thus blocking a connection 263| | * slot until after the delay. Without this, while there is a limit on 264| | * the amount of attempts an attacker can make at the same time 265| | * (MAX_UNAUTH_PER_IP), the time taken by dropbear to handle one attempt 266| | * is still short and thus for each of the allowed parallel attempts 267| | * many attempts can be chained one after the other. The attempt rate is 268| | * then: 269| | * "MAX_UNAUTH_PER_IP / ". 270| | * With the delay, this rate becomes: 271| | * "MAX_UNAUTH_PER_IP / UNAUTH_CLOSE_DELAY". 272| | */ 273| 3.14k| if ((add_delay != 0) && (UNAUTH_CLOSE_DELAY > 0)) { ------------------ | | 436| 3.14k|#define UNAUTH_CLOSE_DELAY 0 ------------------ | Branch (273:6): [True: 3.14k, False: 0] | Branch (273:26): [Folded - Ignored] ------------------ 274| 0| TRACE(("svr_dropbear_exit: start delay of %d seconds", UNAUTH_CLOSE_DELAY)); 275| 0| sleep(UNAUTH_CLOSE_DELAY); ------------------ | | 436| 0|#define UNAUTH_CLOSE_DELAY 0 ------------------ 276| 0| TRACE(("svr_dropbear_exit: end delay of %d seconds", UNAUTH_CLOSE_DELAY)); 277| 0| } 278| | 279| |#if DROPBEAR_VFORK 280| | /* For uclinux only the main server process should cleanup - we don't want 281| | * forked children doing that */ 282| | if (svr_ses.server_pid == getpid()) 283| |#endif 284| 3.14k| { 285| | /* must be after we've done with username etc */ 286| 3.14k| session_cleanup(); 287| 3.14k| } 288| | 289| 3.14k|#if DROPBEAR_FUZZ 290| | /* longjmp before cleaning up svr_opts */ 291| 3.14k| if (fuzz.do_jmp) { ------------------ | Branch (291:9): [True: 3.14k, False: 0] ------------------ 292| 3.14k| longjmp(fuzz.jmp, 1); 293| 3.14k| } 294| 0|#endif 295| | 296| 0| if (svr_opts.hostkey) { ------------------ | Branch (296:6): [True: 0, False: 0] ------------------ 297| 0| sign_key_free(svr_opts.hostkey); 298| 0| svr_opts.hostkey = NULL; 299| 0| } 300| 0| for (i = 0; i < DROPBEAR_MAX_PORTS; i++) { ------------------ | | 80| 0|#define DROPBEAR_MAX_PORTS 10 /* max number of ports which can be specified, ------------------ | Branch (300:14): [True: 0, False: 0] ------------------ 301| 0| m_free(svr_opts.addresses[i]); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 302| 0| m_free(svr_opts.ports[i]); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 303| 0| } 304| | 305| | 306| 0| exit(exitcode); 307| | 308| 3.14k|} svr-session.c:svr_session_cleanup: 83| 3.14k|svr_session_cleanup(void) { 84| | /* free potential public key options */ 85| 3.14k| svr_pubkey_options_cleanup(); 86| | 87| 3.14k| m_free(svr_ses.addrstring); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 88| 3.14k| m_free(svr_ses.remotehost); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 89| 3.14k| m_free(svr_ses.childpids); ------------------ | | 24| 3.14k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded - Ignored] | | ------------------ ------------------ 90| 3.14k| svr_ses.childpidsize = 0; 91| | 92| |#if DROPBEAR_PLUGIN 93| | if (svr_ses.plugin_handle != NULL) { 94| | if (svr_ses.plugin_instance) { 95| | svr_ses.plugin_instance->delete_plugin(svr_ses.plugin_instance); 96| | svr_ses.plugin_instance = NULL; 97| | } 98| | 99| | dlclose(svr_ses.plugin_handle); 100| | svr_ses.plugin_handle = NULL; 101| | } 102| |#endif 103| 3.14k|} svr-session.c:svr_remoteclosed: 348| 1.43k|static void svr_remoteclosed() { 349| | 350| 1.43k| m_close(ses.sock_in); 351| 1.43k| if (ses.sock_in != ses.sock_out) { ------------------ | Branch (351:6): [True: 0, False: 1.43k] ------------------ 352| 0| m_close(ses.sock_out); 353| 0| } 354| 1.43k| ses.sock_in = -1; 355| 1.43k| ses.sock_out = -1; 356| 1.43k| dropbear_close("Exited normally"); 357| | 358| 1.43k|} svr-session.c:svr_algos_initialise: 360| 3.14k|static void svr_algos_initialise(void) { 361| 3.14k| algo_type *algo; 362| 31.4k| for (algo = sshkex; algo->name; algo++) { ------------------ | Branch (362:22): [True: 28.3k, False: 3.14k] ------------------ 363| |#if DROPBEAR_DH_GROUP1 && DROPBEAR_DH_GROUP1_CLIENTONLY 364| | if (strcmp(algo->name, "diffie-hellman-group1-sha1") == 0) { 365| | algo->usable = 0; 366| | } 367| |#endif 368| 28.3k|#if DROPBEAR_EXT_INFO 369| 28.3k| if (strcmp(algo->name, SSH_EXT_INFO_C) == 0) { ------------------ | | 100| 28.3k|#define SSH_EXT_INFO_C "ext-info-c" ------------------ | Branch (369:7): [True: 3.14k, False: 25.1k] ------------------ 370| 3.14k| algo->usable = 0; 371| 3.14k| } 372| 28.3k|#endif 373| 28.3k| } 374| 3.14k|}