fuzz_early_setup: 23| 2|void fuzz_early_setup(void) { 24| | /* Set stderr to point to normal stderr by default */ 25| | fuzz.fake_stderr = stderr; 26| 2|} fuzz_common_setup: 28| 1|void fuzz_common_setup(void) { 29| 1| disallow_core(); 30| 1| fuzz.fuzzing = 1; 31| 1| fuzz.wrapfds = 1; 32| 1| fuzz.do_jmp = 1; 33| 1| fuzz.input = m_malloc(sizeof(buffer)); 34| 1| _dropbear_log = fuzz_dropbear_log; 35| 1| crypto_init(); 36| 1| fuzz_seed("start", 5); 37| | /* let any messages get flushed */ 38| 1| setlinebuf(stdout); 39| |#if DEBUG_TRACE 40| | if (debug_trace) 41| | { 42| | fprintf(stderr, "Dropbear fuzzer: -v specified, not disabling stderr output\n"); 43| | } 44| | else 45| |#endif 46| 1| if (getenv("DROPBEAR_KEEP_STDERR")) { ------------------ | Branch (46:9): [True: 0, False: 1] ------------------ 47| 0| fprintf(stderr, "Dropbear fuzzer: DROPBEAR_KEEP_STDERR, not disabling stderr output\n"); 48| 0| } 49| 1| else 50| 1| { 51| 1| fprintf(stderr, "Dropbear fuzzer: Disabling stderr output\n"); 52| 1| fuzz.fake_stderr = fopen("/dev/null", "w"); 53| | assert(fuzz.fake_stderr); ------------------ | Branch (53:9): [True: 0, False: 1] | Branch (53:9): [True: 1, False: 0] ------------------ 54| 1| } 55| 1|} fuzz_set_input: 57| 2.84k|int fuzz_set_input(const uint8_t *Data, size_t Size) { 58| | 59| 2.84k| fuzz.input->data = (unsigned char*)Data; 60| 2.84k| fuzz.input->size = Size; 61| 2.84k| fuzz.input->len = Size; 62| 2.84k| fuzz.input->pos = 0; 63| | 64| 2.84k| memset(&ses, 0x0, sizeof(ses)); 65| 2.84k| memset(&svr_ses, 0x0, sizeof(svr_ses)); 66| 2.84k| memset(&cli_ses, 0x0, sizeof(cli_ses)); 67| 2.84k| wrapfd_setup(fuzz.input); 68| | // printhex("input", fuzz.input->data, fuzz.input->len); 69| | 70| 2.84k| fuzz_seed(fuzz.input->data, MIN(fuzz.input->len, 16)); ------------------ | Branch (70:33): [True: 269, False: 2.57k] ------------------ 71| | 72| 2.84k| return DROPBEAR_SUCCESS; ------------------ | | 111| 2.84k|#define DROPBEAR_SUCCESS 0 ------------------ 73| 2.84k|} fuzz_svr_setup: 89| 1|void fuzz_svr_setup(void) { 90| 1| fuzz_common_setup(); 91| | 92| 1| _dropbear_exit = svr_dropbear_exit; 93| | 94| 1| char *argv[] = { 95| 1| "dropbear", 96| 1| "-E", 97| 1| }; 98| | 99| 1| int argc = sizeof(argv) / sizeof(*argv); 100| 1| svr_getopts(argc, argv); 101| | 102| 1| load_fixed_hostkeys(); 103| 1|} fuzz_svr_hook_preloop: 105| 2.84k|void fuzz_svr_hook_preloop() { 106| 2.84k| if (fuzz.svr_postauth) { ------------------ | Branch (106:9): [True: 0, False: 2.84k] ------------------ 107| 0| ses.authstate.authdone = 1; 108| 0| fill_passwd("root"); 109| 0| } 110| 2.84k|} fuzz_kex_fakealgos: 197| 6.53k|void fuzz_kex_fakealgos(void) { 198| 6.53k| ses.newkeys->recv.crypt_mode = &dropbear_mode_none; 199| 6.53k| ses.newkeys->recv.algo_mac = &dropbear_nohash; 200| 6.53k|} fuzz_get_socket_address: 203| 5.68k| char **remote_host, char **remote_port, int UNUSED(host_lookup)) { 204| 5.68k| if (local_host) { ------------------ | Branch (204:9): [True: 0, False: 5.68k] ------------------ 205| 0| *local_host = m_strdup("fuzzlocalhost"); 206| 0| } 207| 5.68k| if (local_port) { ------------------ | Branch (207:9): [True: 0, False: 5.68k] ------------------ 208| 0| *local_port = m_strdup("1234"); 209| 0| } 210| 5.68k| if (remote_host) { ------------------ | Branch (210:9): [True: 5.68k, False: 0] ------------------ 211| 5.68k| *remote_host = m_strdup("fuzzremotehost"); 212| 5.68k| } 213| 5.68k| if (remote_port) { ------------------ | Branch (213:9): [True: 2.84k, False: 2.84k] ------------------ 214| 2.84k| *remote_port = m_strdup("9876"); 215| 2.84k| } 216| 5.68k|} fuzz_fake_send_kexdh_reply: 219| 6.16k|void fuzz_fake_send_kexdh_reply(void) { 220| 6.16k| assert(!ses.dh_K); ------------------ | Branch (220:5): [True: 0, False: 6.16k] | Branch (220:5): [True: 6.16k, False: 0] ------------------ 221| 6.16k| m_mp_alloc_init_multi(&ses.dh_K, NULL); 222| 6.16k| mp_set_ul(ses.dh_K, 12345678uL); 223| 6.16k| finish_kexhashbuf(); 224| 6.16k|} fuzz_run_server: 264| 2.84k|int fuzz_run_server(const uint8_t *Data, size_t Size, int skip_kexmaths, int postauth) { 265| 2.84k| static int once = 0; 266| 2.84k| if (!once) { ------------------ | Branch (266:9): [True: 1, False: 2.84k] ------------------ 267| 1| fuzz_svr_setup(); 268| 1| fuzz.skip_kexmaths = skip_kexmaths; 269| 1| once = 1; 270| 1| } 271| | 272| 2.84k| fuzz.svr_postauth = postauth; 273| | 274| 2.84k| if (fuzz_set_input(Data, Size) == DROPBEAR_FAILURE) { ------------------ | | 112| 2.84k|#define DROPBEAR_FAILURE -1 ------------------ | Branch (274:9): [True: 0, False: 2.84k] ------------------ 275| 0| return 0; 276| 0| } 277| | 278| 2.84k| uint32_t wrapseed; 279| 2.84k| genrandom((void*)&wrapseed, sizeof(wrapseed)); 280| 2.84k| wrapfd_setseed(wrapseed); 281| | 282| 2.84k| int fakesock = wrapfd_new_fuzzinput(); 283| | 284| 2.84k| m_malloc_set_epoch(1); 285| 2.84k| fuzz.do_jmp = 1; 286| 2.84k| if (setjmp(fuzz.jmp) == 0) { ------------------ | Branch (286:9): [True: 2.84k, False: 0] ------------------ 287| 2.84k| svr_session(fakesock, fakesock); 288| 0| m_malloc_free_epoch(1, 0); 289| 0| } else { 290| 0| fuzz.do_jmp = 0; 291| 0| m_malloc_free_epoch(1, 1); 292| 0| TRACE(("dropbear_exit longjmped")) 293| | /* dropbear_exit jumped here */ 294| 0| } 295| | 296| 0| return 0; 297| 2.84k|} fuzz_dump: 345| 103k|void fuzz_dump(const unsigned char* data, size_t len) { 346| 103k| if (fuzz.dumping) { ------------------ | Branch (346:9): [True: 0, False: 103k] ------------------ 347| 0| TRACE(("dump %zu", len)) 348| | assert(atomicio(vwrite, fuzz.recv_dumpfd, (void*)data, len) == len); ------------------ | Branch (348:9): [True: 0, False: 0] | Branch (348:9): [True: 0, False: 0] ------------------ 349| 0| } 350| 103k|} fuzz_getpwnam: 373| 483|struct passwd* fuzz_getpwnam(const char *login) { 374| 483| if (!fuzz.fuzzing) { ------------------ | Branch (374:9): [True: 0, False: 483] ------------------ 375| 0| return getpwnam(login); 376| 0| } 377| 483| if (strcmp(login, pwd_other.pw_name) == 0) { ------------------ | Branch (377:9): [True: 0, False: 483] ------------------ 378| 0| return &pwd_other; 379| 0| } 380| 483| if (strcmp(login, pwd_root.pw_name) == 0) { ------------------ | Branch (380:9): [True: 5, False: 478] ------------------ 381| 5| return &pwd_root; 382| 5| } 383| 478| return NULL; 384| 483|} fuzz-common.c:fuzz_dropbear_log: 84| 3.32k|static void fuzz_dropbear_log(int UNUSED(priority), const char* UNUSED(format), va_list UNUSED(param)) { 85| | /* No print */ 86| 3.32k|} fuzz-common.c:load_fixed_hostkeys: 153| 1|static void load_fixed_hostkeys(void) { 154| | 155| 1| buffer *b = buf_new(3000); 156| 1| enum signkey_type type; 157| | 158| 1| TRACE(("load fixed hostkeys")) 159| | 160| 1| svr_opts.hostkey = new_sign_key(); 161| | 162| 1| buf_setlen(b, 0); 163| 1| buf_putbytes(b, keyr, keyr_len); 164| 1| buf_setpos(b, 0); 165| 1| type = DROPBEAR_SIGNKEY_RSA; 166| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (166:9): [True: 0, False: 1] ------------------ 167| 0| dropbear_exit("failed fixed rsa hostkey"); 168| 0| } 169| | 170| 1| buf_setlen(b, 0); 171| 1| buf_putbytes(b, keyd, keyd_len); 172| 1| buf_setpos(b, 0); 173| 1| type = DROPBEAR_SIGNKEY_DSS; 174| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (174:9): [True: 0, False: 1] ------------------ 175| 0| dropbear_exit("failed fixed dss hostkey"); 176| 0| } 177| | 178| 1| buf_setlen(b, 0); 179| 1| buf_putbytes(b, keye, keye_len); 180| 1| buf_setpos(b, 0); 181| 1| type = DROPBEAR_SIGNKEY_ECDSA_NISTP256; 182| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (182:9): [True: 0, False: 1] ------------------ 183| 0| dropbear_exit("failed fixed ecdsa hostkey"); 184| 0| } 185| | 186| 1| buf_setlen(b, 0); 187| 1| buf_putbytes(b, keyed25519, keyed25519_len); 188| 1| buf_setpos(b, 0); 189| 1| type = DROPBEAR_SIGNKEY_ED25519; 190| 1| if (buf_get_priv_key(b, svr_opts.hostkey, &type) == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (190:9): [True: 0, False: 1] ------------------ 191| 0| dropbear_exit("failed fixed ed25519 hostkey"); 192| 0| } 193| | 194| 1| buf_free(b); 195| 1|} fuzz-sshpacketmutator.c:alloc_static_buffers: 126| 2|static void alloc_static_buffers() { 127| | 128| 2| int i; 129| 2| oup = buf_new(MAX_OUT_SIZE); 130| 2| alloc_packetA = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 243| 2|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ | Branch (130:29): [True: 2, Folded] ------------------ 131| 2| alloc_packetB = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 243| 2|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ | Branch (131:29): [True: 2, Folded] ------------------ 132| | 133| 1.00k| for (i = 0; i < MAX_FUZZ_PACKETS; i++) { ------------------ | | 20| 1.00k|#define MAX_FUZZ_PACKETS 500 ------------------ | Branch (133:17): [True: 1.00k, False: 2] ------------------ 134| 1.00k| packets1[i] = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 243| 1.00k|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ | Branch (134:31): [True: 1.00k, Folded] ------------------ 135| 1.00k| } 136| 1.00k| for (i = 0; i < MAX_FUZZ_PACKETS; i++) { ------------------ | | 20| 1.00k|#define MAX_FUZZ_PACKETS 500 ------------------ | Branch (136:17): [True: 1.00k, False: 2] ------------------ 137| | packets2[i] = buf_new(RECV_MAX_PACKET_LEN); ------------------ | | 243| 1.00k|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ | Branch (137:31): [True: 1.00k, Folded] ------------------ 138| 1.00k| } 139| 2|} wrapfd_setup: 32| 2.84k|void wrapfd_setup(buffer *buf) { 33| 2.84k| TRACE(("wrapfd_setup")) 34| | 35| | // clean old ones 36| 2.84k| int i; 37| 22.7k| for (i = 0; i <= wrapfd_maxfd; i++) { ------------------ | Branch (37:14): [True: 19.9k, False: 2.84k] ------------------ 38| 19.9k| if (wrap_fds[i].mode != UNUSED) { ------------------ | Branch (38:7): [True: 1.60k, False: 18.2k] ------------------ 39| 1.60k| wrapfd_remove(i); 40| 1.60k| } 41| 19.9k| } 42| 2.84k| wrapfd_maxfd = -1; 43| | 44| 2.84k| memset(rand_state, 0x0, sizeof(rand_state)); 45| 2.84k| wrapfd_setseed(50); 46| 2.84k| input_buf = buf; 47| 2.84k|} wrapfd_setseed: 49| 5.68k|void wrapfd_setseed(uint32_t seed) { 50| 5.68k| memcpy(rand_state, &seed, sizeof(seed)); 51| 5.68k| nrand48(rand_state); 52| 5.68k|} wrapfd_new_fuzzinput: 54| 2.84k|int wrapfd_new_fuzzinput() { 55| 2.84k| if (devnull_fd == -1) { ------------------ | Branch (55:6): [True: 1, False: 2.84k] ------------------ 56| 1| devnull_fd = open("/dev/null", O_RDONLY); 57| 1| assert(devnull_fd != -1); ------------------ | Branch (57:3): [True: 0, False: 1] | Branch (57:3): [True: 1, False: 0] ------------------ 58| 1| } 59| | 60| 2.84k| int fd = dup(devnull_fd); 61| 2.84k| assert(fd != -1); ------------------ | Branch (61:2): [True: 0, False: 2.84k] | Branch (61:2): [True: 2.84k, False: 0] ------------------ 62| 2.84k| assert(wrap_fds[fd].mode == UNUSED); ------------------ | Branch (62:2): [True: 0, False: 2.84k] | Branch (62:2): [True: 2.84k, False: 0] ------------------ 63| 2.84k| wrap_fds[fd].mode = COMMONBUF; 64| 2.84k| wrap_fds[fd].closein = 0; 65| 2.84k| wrap_fds[fd].closeout = 0; 66| 2.84k| wrapfd_maxfd = MAX(fd, wrapfd_maxfd); ------------------ | Branch (66:17): [True: 2.84k, False: 0] ------------------ 67| | 68| 2.84k| return fd; 69| 2.84k|} wrapfd_close: 105| 1.24k|int wrapfd_close(int fd) { 106| 1.24k| if (fd >= 0 && fd <= IOWRAP_MAXFD && wrap_fds[fd].mode != UNUSED) { ------------------ | | 9| 2.48k|#define IOWRAP_MAXFD (FD_SETSIZE-1) ------------------ | Branch (106:6): [True: 1.24k, False: 0] | Branch (106:17): [True: 1.24k, False: 0] | Branch (106:39): [True: 1.24k, False: 0] ------------------ 107| 1.24k| wrapfd_remove(fd); 108| 1.24k| return 0; 109| 1.24k| } else { 110| 0| return close(fd); 111| 0| } 112| 1.24k|} wrapfd_read: 114| 274k|int wrapfd_read(int fd, void *out, size_t count) { 115| 274k| size_t maxread; 116| | 117| 274k| if (!fuzz.wrapfds) { ------------------ | Branch (117:6): [True: 0, False: 274k] ------------------ 118| 0| return read(fd, out, count); 119| 0| } 120| | 121| 274k| if (fd < 0 || fd > IOWRAP_MAXFD || wrap_fds[fd].mode == UNUSED) { ------------------ | | 9| 548k|#define IOWRAP_MAXFD (FD_SETSIZE-1) ------------------ | Branch (121:6): [True: 0, False: 274k] | Branch (121:16): [True: 0, False: 274k] | Branch (121:37): [True: 0, False: 274k] ------------------ 122| | /* XXX - assertion failure? */ 123| 0| TRACE(("Bad read descriptor %d\n", fd)) 124| 0| errno = EBADF; 125| 0| return -1; 126| 0| } 127| | 128| 274k| assert(count != 0); ------------------ | Branch (128:2): [True: 0, False: 274k] | Branch (128:2): [True: 274k, False: 0] ------------------ 129| | 130| 274k| if (wrap_fds[fd].closein || erand48(rand_state) < CHANCE_CLOSE) { ------------------ | Branch (130:6): [True: 0, False: 274k] | Branch (130:30): [True: 8, False: 274k] ------------------ 131| 8| wrap_fds[fd].closein = 1; 132| 8| errno = ECONNRESET; 133| 8| return -1; 134| 8| } 135| | 136| 274k| if (erand48(rand_state) < CHANCE_INTR) { ------------------ | Branch (136:6): [True: 327, False: 273k] ------------------ 137| 327| errno = EINTR; 138| 327| return -1; 139| 327| } 140| | 141| 273k| if (input_buf && wrap_fds[fd].mode == COMMONBUF) { ------------------ | Branch (141:6): [True: 273k, False: 0] | Branch (141:19): [True: 273k, False: 0] ------------------ 142| 273k| maxread = MIN(input_buf->len - input_buf->pos, count); ------------------ | Branch (142:13): [True: 1.76k, False: 272k] ------------------ 143| | /* returns 0 if buf is EOF, as intended */ 144| 273k| if (maxread > 0) { ------------------ | Branch (144:7): [True: 272k, False: 1.19k] ------------------ 145| 272k| maxread = nrand48(rand_state) % maxread + 1; 146| 272k| } 147| 273k| memcpy(out, buf_getptr(input_buf, maxread), maxread); 148| 273k| buf_incrpos(input_buf, maxread); 149| 273k| return maxread; 150| 273k| } 151| | 152| | // return fixed output, of random length 153| 0| maxread = MIN(MAX_RANDOM_IN, count); ------------------ | Branch (153:12): [True: 0, False: 0] ------------------ 154| 0| maxread = nrand48(rand_state) % maxread + 1; 155| 0| memset(out, 0xef, maxread); 156| 0| return maxread; 157| 273k|} wrapfd_select: 196| 273k| fd_set *exceptfds, struct timeval *timeout) { 197| 273k| int i, nset, sel; 198| 273k| int ret = 0; 199| 273k| int fdlist[IOWRAP_MAXFD+1]; 200| | 201| 273k| if (!fuzz.wrapfds) { ------------------ | Branch (201:6): [True: 0, False: 273k] ------------------ 202| 0| return select(nfds, readfds, writefds, exceptfds, timeout); 203| 0| } 204| | 205| 273k| assert(nfds <= IOWRAP_MAXFD+1); ------------------ | Branch (205:2): [True: 0, False: 273k] | Branch (205:2): [True: 273k, False: 0] ------------------ 206| | 207| 273k| if (erand48(rand_state) < CHANCE_INTR) { ------------------ | Branch (207:6): [True: 318, False: 273k] ------------------ 208| 318| errno = EINTR; 209| 318| return -1; 210| 318| } 211| | 212| | /* read */ 213| 273k| if (readfds != NULL && erand48(rand_state) < CHANCE_READ1) { ------------------ | Branch (213:6): [True: 273k, False: 0] | Branch (213:25): [True: 255k, False: 17.7k] ------------------ 214| 2.04M| for (i = 0, nset = 0; i < nfds; i++) { ------------------ | Branch (214:25): [True: 1.78M, False: 255k] ------------------ 215| 1.78M| if (FD_ISSET(i, readfds)) { ------------------ | Branch (215:8): [True: 249k, False: 1.53M] ------------------ 216| 249k| assert(wrap_fds[i].mode != UNUSED); ------------------ | Branch (216:5): [True: 0, False: 249k] | Branch (216:5): [True: 249k, False: 0] ------------------ 217| 249k| fdlist[nset] = i; 218| 249k| nset++; 219| 249k| } 220| 1.78M| } 221| 255k| DROPBEAR_FD_ZERO(readfds); ------------------ | | 106| 255k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ | Branch (221:3): [Folded, False: 255k] ------------------ 222| | 223| 255k| if (nset > 0) { ------------------ | Branch (223:7): [True: 249k, False: 5.59k] ------------------ 224| | /* set one */ 225| 249k| sel = fdlist[nrand48(rand_state) % nset]; 226| 249k| FD_SET(sel, readfds); 227| 249k| ret++; 228| | 229| 249k| if (erand48(rand_state) < CHANCE_READ2) { ------------------ | Branch (229:8): [True: 122k, False: 127k] ------------------ 230| 122k| sel = fdlist[nrand48(rand_state) % nset]; 231| 122k| if (!FD_ISSET(sel, readfds)) { ------------------ | Branch (231:9): [True: 0, False: 122k] ------------------ 232| 0| FD_SET(sel, readfds); 233| 0| ret++; 234| 0| } 235| 122k| } 236| 249k| } 237| 255k| } 238| | 239| | /* write */ 240| 273k| if (writefds != NULL && erand48(rand_state) < CHANCE_WRITE1) { ------------------ | Branch (240:6): [True: 212k, False: 61.1k] | Branch (240:26): [True: 201k, False: 10.2k] ------------------ 241| 1.61M| for (i = 0, nset = 0; i < nfds; i++) { ------------------ | Branch (241:25): [True: 1.41M, False: 201k] ------------------ 242| 1.41M| if (FD_ISSET(i, writefds)) { ------------------ | Branch (242:8): [True: 5.69k, False: 1.40M] ------------------ 243| 5.69k| assert(wrap_fds[i].mode != UNUSED); ------------------ | Branch (243:5): [True: 0, False: 5.69k] | Branch (243:5): [True: 5.69k, False: 0] ------------------ 244| 5.69k| fdlist[nset] = i; 245| 5.69k| nset++; 246| 5.69k| } 247| 1.41M| } 248| 201k| DROPBEAR_FD_ZERO(writefds); ------------------ | | 106| 201k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ | Branch (248:3): [Folded, False: 201k] ------------------ 249| | 250| | /* set one */ 251| 201k| if (nset > 0) { ------------------ | Branch (251:7): [True: 5.69k, False: 196k] ------------------ 252| 5.69k| sel = fdlist[nrand48(rand_state) % nset]; 253| 5.69k| FD_SET(sel, writefds); 254| 5.69k| ret++; 255| | 256| 5.69k| if (erand48(rand_state) < CHANCE_WRITE2) { ------------------ | Branch (256:8): [True: 1.19k, False: 4.50k] ------------------ 257| 1.19k| sel = fdlist[nrand48(rand_state) % nset]; 258| 1.19k| if (!FD_ISSET(sel, writefds)) { ------------------ | Branch (258:9): [True: 0, False: 1.19k] ------------------ 259| 0| FD_SET(sel, writefds); 260| 0| ret++; 261| 0| } 262| 1.19k| } 263| 5.69k| } 264| 201k| } 265| 273k| return ret; 266| 273k|} fuzz-wrapfd.c:wrapfd_remove: 96| 2.84k|static void wrapfd_remove(int fd) { 97| 2.84k| TRACE(("wrapfd_remove %d", fd)) 98| 2.84k| assert(fd >= 0); ------------------ | Branch (98:2): [True: 0, False: 2.84k] | Branch (98:2): [True: 2.84k, False: 0] ------------------ 99| 2.84k| assert(fd <= IOWRAP_MAXFD); ------------------ | Branch (99:2): [True: 0, False: 2.84k] | Branch (99:2): [True: 2.84k, False: 0] ------------------ 100| 2.84k| assert(wrap_fds[fd].mode != UNUSED); ------------------ | Branch (100:2): [True: 0, False: 2.84k] | Branch (100:2): [True: 2.84k, False: 0] ------------------ 101| 2.84k| wrap_fds[fd].mode = UNUSED; 102| 2.84k| close(fd); 103| 2.84k|} LLVMFuzzerTestOneInput: 3| 2.84k|int LLVMFuzzerTestOneInput(const uint8_t *Data, size_t Size) { 4| 2.84k| return fuzz_run_server(Data, Size, 1, 0); 5| 2.84k|} rijndael_setup: 123| 5.49k|{ 124| 5.49k| int i; 125| 5.49k| ulong32 temp, *rk; 126| 5.49k|#ifndef ENCRYPT_ONLY 127| 5.49k| ulong32 *rrk; 128| 5.49k|#endif 129| 5.49k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 5.49k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 5.49k] | | | Branch (32:87): [Folded, False: 5.49k] | | ------------------ ------------------ 130| 5.49k| LTC_ARGCHK(skey != NULL); ------------------ | | 32| 5.49k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 5.49k] | | | Branch (32:87): [Folded, False: 5.49k] | | ------------------ ------------------ 131| | 132| 5.49k| if (keylen != 16 && keylen != 24 && keylen != 32) { ------------------ | Branch (132:9): [True: 3.12k, False: 2.37k] | Branch (132:25): [True: 3.12k, False: 0] | Branch (132:41): [True: 0, False: 3.12k] ------------------ 133| 0| return CRYPT_INVALID_KEYSIZE; 134| 0| } 135| | 136| 5.49k| if (num_rounds != 0 && num_rounds != (10 + ((keylen/8)-2)*2)) { ------------------ | Branch (136:9): [True: 0, False: 5.49k] | Branch (136:28): [True: 0, False: 0] ------------------ 137| 0| return CRYPT_INVALID_ROUNDS; 138| 0| } 139| | 140| 5.49k| skey->rijndael.Nr = 10 + ((keylen/8)-2)*2; 141| | 142| | /* setup the forward key */ 143| 5.49k| i = 0; 144| 5.49k| rk = skey->rijndael.eK; 145| 5.49k| LOAD32H(rk[0], key ); ------------------ | | 66| 5.49k|#define LOAD32H(x, y) \ | | 67| 5.49k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 5.49k|#define XMEMCPY memcpy | | ------------------ | | 68| 5.49k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 5.49k] | | ------------------ ------------------ 146| 5.49k| LOAD32H(rk[1], key + 4); ------------------ | | 66| 5.49k|#define LOAD32H(x, y) \ | | 67| 5.49k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 5.49k|#define XMEMCPY memcpy | | ------------------ | | 68| 5.49k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 5.49k] | | ------------------ ------------------ 147| 5.49k| LOAD32H(rk[2], key + 8); ------------------ | | 66| 5.49k|#define LOAD32H(x, y) \ | | 67| 5.49k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 5.49k|#define XMEMCPY memcpy | | ------------------ | | 68| 5.49k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 5.49k] | | ------------------ ------------------ 148| 5.49k| LOAD32H(rk[3], key + 12); ------------------ | | 66| 5.49k|#define LOAD32H(x, y) \ | | 67| 5.49k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 5.49k|#define XMEMCPY memcpy | | ------------------ | | 68| 5.49k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 5.49k] | | ------------------ ------------------ 149| 5.49k| if (keylen == 16) { ------------------ | Branch (149:9): [True: 2.37k, False: 3.12k] ------------------ 150| 23.7k| for (;;) { 151| 23.7k| temp = rk[3]; 152| 23.7k| rk[4] = rk[0] ^ setup_mix(temp) ^ rcon[i]; 153| 23.7k| rk[5] = rk[1] ^ rk[4]; 154| 23.7k| rk[6] = rk[2] ^ rk[5]; 155| 23.7k| rk[7] = rk[3] ^ rk[6]; 156| 23.7k| if (++i == 10) { ------------------ | Branch (156:17): [True: 2.37k, False: 21.3k] ------------------ 157| 2.37k| break; 158| 2.37k| } 159| 21.3k| rk += 4; 160| 21.3k| } 161| 3.12k| } else if (keylen == 24) { ------------------ | Branch (161:16): [True: 0, False: 3.12k] ------------------ 162| 0| LOAD32H(rk[4], key + 16); ------------------ | | 66| 0|#define LOAD32H(x, y) \ | | 67| 0|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 0|#define XMEMCPY memcpy | | ------------------ | | 68| 0| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 0] | | ------------------ ------------------ 163| 0| LOAD32H(rk[5], key + 20); ------------------ | | 66| 0|#define LOAD32H(x, y) \ | | 67| 0|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 0|#define XMEMCPY memcpy | | ------------------ | | 68| 0| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 0] | | ------------------ ------------------ 164| 0| for (;;) { 165| | #ifdef _MSC_VER 166| | temp = skey->rijndael.eK[rk - skey->rijndael.eK + 5]; 167| | #else 168| 0| temp = rk[5]; 169| 0| #endif 170| 0| rk[ 6] = rk[ 0] ^ setup_mix(temp) ^ rcon[i]; 171| 0| rk[ 7] = rk[ 1] ^ rk[ 6]; 172| 0| rk[ 8] = rk[ 2] ^ rk[ 7]; 173| 0| rk[ 9] = rk[ 3] ^ rk[ 8]; 174| 0| if (++i == 8) { ------------------ | Branch (174:17): [True: 0, False: 0] ------------------ 175| 0| break; 176| 0| } 177| 0| rk[10] = rk[ 4] ^ rk[ 9]; 178| 0| rk[11] = rk[ 5] ^ rk[10]; 179| 0| rk += 6; 180| 0| } 181| 3.12k| } else if (keylen == 32) { ------------------ | Branch (181:16): [True: 3.12k, False: 0] ------------------ 182| 3.12k| LOAD32H(rk[4], key + 16); ------------------ | | 66| 3.12k|#define LOAD32H(x, y) \ | | 67| 3.12k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 3.12k|#define XMEMCPY memcpy | | ------------------ | | 68| 3.12k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 3.12k] | | ------------------ ------------------ 183| 3.12k| LOAD32H(rk[5], key + 20); ------------------ | | 66| 3.12k|#define LOAD32H(x, y) \ | | 67| 3.12k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 3.12k|#define XMEMCPY memcpy | | ------------------ | | 68| 3.12k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 3.12k] | | ------------------ ------------------ 184| 3.12k| LOAD32H(rk[6], key + 24); ------------------ | | 66| 3.12k|#define LOAD32H(x, y) \ | | 67| 3.12k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 3.12k|#define XMEMCPY memcpy | | ------------------ | | 68| 3.12k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 3.12k] | | ------------------ ------------------ 185| 3.12k| LOAD32H(rk[7], key + 28); ------------------ | | 66| 3.12k|#define LOAD32H(x, y) \ | | 67| 3.12k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 3.12k|#define XMEMCPY memcpy | | ------------------ | | 68| 3.12k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 3.12k] | | ------------------ ------------------ 186| 21.8k| for (;;) { 187| | #ifdef _MSC_VER 188| | temp = skey->rijndael.eK[rk - skey->rijndael.eK + 7]; 189| | #else 190| 21.8k| temp = rk[7]; 191| 21.8k| #endif 192| 21.8k| rk[ 8] = rk[ 0] ^ setup_mix(temp) ^ rcon[i]; 193| 21.8k| rk[ 9] = rk[ 1] ^ rk[ 8]; 194| 21.8k| rk[10] = rk[ 2] ^ rk[ 9]; 195| 21.8k| rk[11] = rk[ 3] ^ rk[10]; 196| 21.8k| if (++i == 7) { ------------------ | Branch (196:17): [True: 3.12k, False: 18.7k] ------------------ 197| 3.12k| break; 198| 3.12k| } 199| 18.7k| temp = rk[11]; 200| 18.7k| rk[12] = rk[ 4] ^ setup_mix(RORc(temp, 8)); ------------------ | | 283| 18.7k|#define RORc(word,i) ({ \ | | 284| 18.7k| ulong32 __RORc_tmp = (word); \ | | 285| 18.7k| __asm__ ("rorl %2, %0" : \ | | 286| 18.7k| "=r" (__RORc_tmp) : \ | | 287| 18.7k| "0" (__RORc_tmp), \ | | 288| 18.7k| "I" (i)); \ | | 289| 18.7k| __RORc_tmp; \ | | 290| 18.7k| }) ------------------ 201| 18.7k| rk[13] = rk[ 5] ^ rk[12]; 202| 18.7k| rk[14] = rk[ 6] ^ rk[13]; 203| 18.7k| rk[15] = rk[ 7] ^ rk[14]; 204| 18.7k| rk += 8; 205| 18.7k| } 206| 3.12k| } else { 207| | /* this can't happen */ 208| | /* coverity[dead_error_line] */ 209| 0| return CRYPT_ERROR; 210| 0| } 211| | 212| 5.49k|#ifndef ENCRYPT_ONLY 213| | /* setup the inverse key now */ 214| 5.49k| rk = skey->rijndael.dK; 215| 5.49k| rrk = skey->rijndael.eK + (28 + keylen) - 4; 216| | 217| | /* apply the inverse MixColumn transform to all round keys but the first and the last: */ 218| | /* copy first */ 219| 5.49k| *rk++ = *rrk++; 220| 5.49k| *rk++ = *rrk++; 221| 5.49k| *rk++ = *rrk++; 222| 5.49k| *rk = *rrk; 223| 5.49k| rk -= 3; rrk -= 3; 224| | 225| 67.4k| for (i = 1; i < skey->rijndael.Nr; i++) { ------------------ | Branch (225:17): [True: 61.9k, False: 5.49k] ------------------ 226| 61.9k| rrk -= 4; 227| 61.9k| rk += 4; 228| 61.9k| #ifdef LTC_SMALL_CODE 229| 61.9k| temp = rrk[0]; 230| 61.9k| rk[0] = setup_mix2(temp); 231| 61.9k| temp = rrk[1]; 232| 61.9k| rk[1] = setup_mix2(temp); 233| 61.9k| temp = rrk[2]; 234| 61.9k| rk[2] = setup_mix2(temp); 235| 61.9k| temp = rrk[3]; 236| 61.9k| rk[3] = setup_mix2(temp); 237| | #else 238| | temp = rrk[0]; 239| | rk[0] = 240| | Tks0[byte(temp, 3)] ^ 241| | Tks1[byte(temp, 2)] ^ 242| | Tks2[byte(temp, 1)] ^ 243| | Tks3[byte(temp, 0)]; 244| | temp = rrk[1]; 245| | rk[1] = 246| | Tks0[byte(temp, 3)] ^ 247| | Tks1[byte(temp, 2)] ^ 248| | Tks2[byte(temp, 1)] ^ 249| | Tks3[byte(temp, 0)]; 250| | temp = rrk[2]; 251| | rk[2] = 252| | Tks0[byte(temp, 3)] ^ 253| | Tks1[byte(temp, 2)] ^ 254| | Tks2[byte(temp, 1)] ^ 255| | Tks3[byte(temp, 0)]; 256| | temp = rrk[3]; 257| | rk[3] = 258| | Tks0[byte(temp, 3)] ^ 259| | Tks1[byte(temp, 2)] ^ 260| | Tks2[byte(temp, 1)] ^ 261| | Tks3[byte(temp, 0)]; 262| | #endif 263| | 264| 61.9k| } 265| | 266| | /* copy last */ 267| 5.49k| rrk -= 4; 268| 5.49k| rk += 4; 269| 5.49k| *rk++ = *rrk++; 270| 5.49k| *rk++ = *rrk++; 271| 5.49k| *rk++ = *rrk++; 272| 5.49k| *rk = *rrk; 273| 5.49k|#endif /* ENCRYPT_ONLY */ 274| | 275| 5.49k| return CRYPT_OK; 276| 5.49k|} rijndael_ecb_encrypt: 290| 146k|{ 291| 146k| ulong32 s0, s1, s2, s3, t0, t1, t2, t3, *rk; 292| 146k| int Nr, r; 293| | 294| 146k| LTC_ARGCHK(pt != NULL); ------------------ | | 32| 146k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 146k] | | | Branch (32:87): [Folded, False: 146k] | | ------------------ ------------------ 295| 146k| LTC_ARGCHK(ct != NULL); ------------------ | | 32| 146k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 146k] | | | Branch (32:87): [Folded, False: 146k] | | ------------------ ------------------ 296| 146k| LTC_ARGCHK(skey != NULL); ------------------ | | 32| 146k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 146k] | | | Branch (32:87): [Folded, False: 146k] | | ------------------ ------------------ 297| | 298| 146k| Nr = skey->rijndael.Nr; 299| 146k| rk = skey->rijndael.eK; 300| | 301| | /* 302| | * map byte array block to cipher state 303| | * and add initial round key: 304| | */ 305| 146k| LOAD32H(s0, pt ); s0 ^= rk[0]; ------------------ | | 66| 146k|#define LOAD32H(x, y) \ | | 67| 146k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 146k|#define XMEMCPY memcpy | | ------------------ | | 68| 146k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 146k] | | ------------------ ------------------ 306| 146k| LOAD32H(s1, pt + 4); s1 ^= rk[1]; ------------------ | | 66| 146k|#define LOAD32H(x, y) \ | | 67| 146k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 146k|#define XMEMCPY memcpy | | ------------------ | | 68| 146k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 146k] | | ------------------ ------------------ 307| 146k| LOAD32H(s2, pt + 8); s2 ^= rk[2]; ------------------ | | 66| 146k|#define LOAD32H(x, y) \ | | 67| 146k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 146k|#define XMEMCPY memcpy | | ------------------ | | 68| 146k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 146k] | | ------------------ ------------------ 308| 146k| LOAD32H(s3, pt + 12); s3 ^= rk[3]; ------------------ | | 66| 146k|#define LOAD32H(x, y) \ | | 67| 146k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 146k|#define XMEMCPY memcpy | | ------------------ | | 68| 146k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 146k] | | ------------------ ------------------ 309| | 310| 146k|#ifdef LTC_SMALL_CODE 311| | 312| 1.69M| for (r = 0; ; r++) { 313| 1.69M| rk += 4; 314| 1.69M| t0 = 315| 1.69M| Te0(byte(s0, 3)) ^ ------------------ | | 306| 1.69M|#define Te0(x) TE0[x] ------------------ 316| 1.69M| Te1(byte(s1, 2)) ^ ------------------ | | 307| 1.69M|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 1.69M|#define RORc(word,i) ({ \ | | | | 284| 1.69M| ulong32 __RORc_tmp = (word); \ | | | | 285| 1.69M| __asm__ ("rorl %2, %0" : \ | | | | 286| 1.69M| "=r" (__RORc_tmp) : \ | | | | 287| 1.69M| "0" (__RORc_tmp), \ | | | | 288| 1.69M| "I" (i)); \ | | | | 289| 1.69M| __RORc_tmp; \ | | | | 290| 1.69M| }) | | ------------------ ------------------ 317| 1.69M| Te2(byte(s2, 1)) ^ ------------------ | | 308| 1.69M|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 1.69M|#define RORc(word,i) ({ \ | | | | 284| 1.69M| ulong32 __RORc_tmp = (word); \ | | | | 285| 1.69M| __asm__ ("rorl %2, %0" : \ | | | | 286| 1.69M| "=r" (__RORc_tmp) : \ | | | | 287| 1.69M| "0" (__RORc_tmp), \ | | | | 288| 1.69M| "I" (i)); \ | | | | 289| 1.69M| __RORc_tmp; \ | | | | 290| 1.69M| }) | | ------------------ ------------------ 318| 1.69M| Te3(byte(s3, 0)) ^ ------------------ | | 309| 1.69M|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 1.69M|#define RORc(word,i) ({ \ | | | | 284| 1.69M| ulong32 __RORc_tmp = (word); \ | | | | 285| 1.69M| __asm__ ("rorl %2, %0" : \ | | | | 286| 1.69M| "=r" (__RORc_tmp) : \ | | | | 287| 1.69M| "0" (__RORc_tmp), \ | | | | 288| 1.69M| "I" (i)); \ | | | | 289| 1.69M| __RORc_tmp; \ | | | | 290| 1.69M| }) | | ------------------ ------------------ 319| 1.69M| rk[0]; 320| 1.69M| t1 = 321| 1.69M| Te0(byte(s1, 3)) ^ ------------------ | | 306| 1.69M|#define Te0(x) TE0[x] ------------------ 322| 1.69M| Te1(byte(s2, 2)) ^ ------------------ | | 307| 1.69M|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 1.69M|#define RORc(word,i) ({ \ | | | | 284| 1.69M| ulong32 __RORc_tmp = (word); \ | | | | 285| 1.69M| __asm__ ("rorl %2, %0" : \ | | | | 286| 1.69M| "=r" (__RORc_tmp) : \ | | | | 287| 1.69M| "0" (__RORc_tmp), \ | | | | 288| 1.69M| "I" (i)); \ | | | | 289| 1.69M| __RORc_tmp; \ | | | | 290| 1.69M| }) | | ------------------ ------------------ 323| 1.69M| Te2(byte(s3, 1)) ^ ------------------ | | 308| 1.69M|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 1.69M|#define RORc(word,i) ({ \ | | | | 284| 1.69M| ulong32 __RORc_tmp = (word); \ | | | | 285| 1.69M| __asm__ ("rorl %2, %0" : \ | | | | 286| 1.69M| "=r" (__RORc_tmp) : \ | | | | 287| 1.69M| "0" (__RORc_tmp), \ | | | | 288| 1.69M| "I" (i)); \ | | | | 289| 1.69M| __RORc_tmp; \ | | | | 290| 1.69M| }) | | ------------------ ------------------ 324| 1.69M| Te3(byte(s0, 0)) ^ ------------------ | | 309| 1.69M|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 1.69M|#define RORc(word,i) ({ \ | | | | 284| 1.69M| ulong32 __RORc_tmp = (word); \ | | | | 285| 1.69M| __asm__ ("rorl %2, %0" : \ | | | | 286| 1.69M| "=r" (__RORc_tmp) : \ | | | | 287| 1.69M| "0" (__RORc_tmp), \ | | | | 288| 1.69M| "I" (i)); \ | | | | 289| 1.69M| __RORc_tmp; \ | | | | 290| 1.69M| }) | | ------------------ ------------------ 325| 1.69M| rk[1]; 326| 1.69M| t2 = 327| 1.69M| Te0(byte(s2, 3)) ^ ------------------ | | 306| 1.69M|#define Te0(x) TE0[x] ------------------ 328| 1.69M| Te1(byte(s3, 2)) ^ ------------------ | | 307| 1.69M|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 1.69M|#define RORc(word,i) ({ \ | | | | 284| 1.69M| ulong32 __RORc_tmp = (word); \ | | | | 285| 1.69M| __asm__ ("rorl %2, %0" : \ | | | | 286| 1.69M| "=r" (__RORc_tmp) : \ | | | | 287| 1.69M| "0" (__RORc_tmp), \ | | | | 288| 1.69M| "I" (i)); \ | | | | 289| 1.69M| __RORc_tmp; \ | | | | 290| 1.69M| }) | | ------------------ ------------------ 329| 1.69M| Te2(byte(s0, 1)) ^ ------------------ | | 308| 1.69M|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 1.69M|#define RORc(word,i) ({ \ | | | | 284| 1.69M| ulong32 __RORc_tmp = (word); \ | | | | 285| 1.69M| __asm__ ("rorl %2, %0" : \ | | | | 286| 1.69M| "=r" (__RORc_tmp) : \ | | | | 287| 1.69M| "0" (__RORc_tmp), \ | | | | 288| 1.69M| "I" (i)); \ | | | | 289| 1.69M| __RORc_tmp; \ | | | | 290| 1.69M| }) | | ------------------ ------------------ 330| 1.69M| Te3(byte(s1, 0)) ^ ------------------ | | 309| 1.69M|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 1.69M|#define RORc(word,i) ({ \ | | | | 284| 1.69M| ulong32 __RORc_tmp = (word); \ | | | | 285| 1.69M| __asm__ ("rorl %2, %0" : \ | | | | 286| 1.69M| "=r" (__RORc_tmp) : \ | | | | 287| 1.69M| "0" (__RORc_tmp), \ | | | | 288| 1.69M| "I" (i)); \ | | | | 289| 1.69M| __RORc_tmp; \ | | | | 290| 1.69M| }) | | ------------------ ------------------ 331| 1.69M| rk[2]; 332| 1.69M| t3 = 333| 1.69M| Te0(byte(s3, 3)) ^ ------------------ | | 306| 1.69M|#define Te0(x) TE0[x] ------------------ 334| 1.69M| Te1(byte(s0, 2)) ^ ------------------ | | 307| 1.69M|#define Te1(x) RORc(TE0[x], 8) | | ------------------ | | | | 283| 1.69M|#define RORc(word,i) ({ \ | | | | 284| 1.69M| ulong32 __RORc_tmp = (word); \ | | | | 285| 1.69M| __asm__ ("rorl %2, %0" : \ | | | | 286| 1.69M| "=r" (__RORc_tmp) : \ | | | | 287| 1.69M| "0" (__RORc_tmp), \ | | | | 288| 1.69M| "I" (i)); \ | | | | 289| 1.69M| __RORc_tmp; \ | | | | 290| 1.69M| }) | | ------------------ ------------------ 335| 1.69M| Te2(byte(s1, 1)) ^ ------------------ | | 308| 1.69M|#define Te2(x) RORc(TE0[x], 16) | | ------------------ | | | | 283| 1.69M|#define RORc(word,i) ({ \ | | | | 284| 1.69M| ulong32 __RORc_tmp = (word); \ | | | | 285| 1.69M| __asm__ ("rorl %2, %0" : \ | | | | 286| 1.69M| "=r" (__RORc_tmp) : \ | | | | 287| 1.69M| "0" (__RORc_tmp), \ | | | | 288| 1.69M| "I" (i)); \ | | | | 289| 1.69M| __RORc_tmp; \ | | | | 290| 1.69M| }) | | ------------------ ------------------ 336| 1.69M| Te3(byte(s2, 0)) ^ ------------------ | | 309| 1.69M|#define Te3(x) RORc(TE0[x], 24) | | ------------------ | | | | 283| 1.69M|#define RORc(word,i) ({ \ | | | | 284| 1.69M| ulong32 __RORc_tmp = (word); \ | | | | 285| 1.69M| __asm__ ("rorl %2, %0" : \ | | | | 286| 1.69M| "=r" (__RORc_tmp) : \ | | | | 287| 1.69M| "0" (__RORc_tmp), \ | | | | 288| 1.69M| "I" (i)); \ | | | | 289| 1.69M| __RORc_tmp; \ | | | | 290| 1.69M| }) | | ------------------ ------------------ 337| 1.69M| rk[3]; 338| 1.69M| if (r == Nr-2) { ------------------ | Branch (338:13): [True: 146k, False: 1.55M] ------------------ 339| 146k| break; 340| 146k| } 341| 1.55M| s0 = t0; s1 = t1; s2 = t2; s3 = t3; 342| 1.55M| } 343| 146k| rk += 4; 344| | 345| |#else 346| | 347| | /* 348| | * Nr - 1 full rounds: 349| | */ 350| | r = Nr >> 1; 351| | for (;;) { 352| | t0 = 353| | Te0(byte(s0, 3)) ^ 354| | Te1(byte(s1, 2)) ^ 355| | Te2(byte(s2, 1)) ^ 356| | Te3(byte(s3, 0)) ^ 357| | rk[4]; 358| | t1 = 359| | Te0(byte(s1, 3)) ^ 360| | Te1(byte(s2, 2)) ^ 361| | Te2(byte(s3, 1)) ^ 362| | Te3(byte(s0, 0)) ^ 363| | rk[5]; 364| | t2 = 365| | Te0(byte(s2, 3)) ^ 366| | Te1(byte(s3, 2)) ^ 367| | Te2(byte(s0, 1)) ^ 368| | Te3(byte(s1, 0)) ^ 369| | rk[6]; 370| | t3 = 371| | Te0(byte(s3, 3)) ^ 372| | Te1(byte(s0, 2)) ^ 373| | Te2(byte(s1, 1)) ^ 374| | Te3(byte(s2, 0)) ^ 375| | rk[7]; 376| | 377| | rk += 8; 378| | if (--r == 0) { 379| | break; 380| | } 381| | 382| | s0 = 383| | Te0(byte(t0, 3)) ^ 384| | Te1(byte(t1, 2)) ^ 385| | Te2(byte(t2, 1)) ^ 386| | Te3(byte(t3, 0)) ^ 387| | rk[0]; 388| | s1 = 389| | Te0(byte(t1, 3)) ^ 390| | Te1(byte(t2, 2)) ^ 391| | Te2(byte(t3, 1)) ^ 392| | Te3(byte(t0, 0)) ^ 393| | rk[1]; 394| | s2 = 395| | Te0(byte(t2, 3)) ^ 396| | Te1(byte(t3, 2)) ^ 397| | Te2(byte(t0, 1)) ^ 398| | Te3(byte(t1, 0)) ^ 399| | rk[2]; 400| | s3 = 401| | Te0(byte(t3, 3)) ^ 402| | Te1(byte(t0, 2)) ^ 403| | Te2(byte(t1, 1)) ^ 404| | Te3(byte(t2, 0)) ^ 405| | rk[3]; 406| | } 407| | 408| |#endif 409| | 410| | /* 411| | * apply last round and 412| | * map cipher state to byte array block: 413| | */ 414| 146k| s0 = 415| 146k| (Te4_3[byte(t0, 3)]) ^ ------------------ | | 319| 146k|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t0, 3)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 416| 146k| (Te4_2[byte(t1, 2)]) ^ ------------------ | | 318| 146k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t1, 2)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 417| 146k| (Te4_1[byte(t2, 1)]) ^ ------------------ | | 317| 146k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t2, 1)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 418| 146k| (Te4_0[byte(t3, 0)]) ^ ------------------ | | 316| 146k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t3, 0)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 419| 146k| rk[0]; 420| 146k| STORE32H(s0, ct); ------------------ | | 62| 146k|#define STORE32H(x, y) \ | | 63| 146k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 146k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 146k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded, False: 146k] | | ------------------ ------------------ 421| 146k| s1 = 422| 146k| (Te4_3[byte(t1, 3)]) ^ ------------------ | | 319| 146k|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t1, 3)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 423| 146k| (Te4_2[byte(t2, 2)]) ^ ------------------ | | 318| 146k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t2, 2)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 424| 146k| (Te4_1[byte(t3, 1)]) ^ ------------------ | | 317| 146k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t3, 1)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 425| 146k| (Te4_0[byte(t0, 0)]) ^ ------------------ | | 316| 146k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t0, 0)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 426| 146k| rk[1]; 427| 146k| STORE32H(s1, ct+4); ------------------ | | 62| 146k|#define STORE32H(x, y) \ | | 63| 146k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 146k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 146k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded, False: 146k] | | ------------------ ------------------ 428| 146k| s2 = 429| 146k| (Te4_3[byte(t2, 3)]) ^ ------------------ | | 319| 146k|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t2, 3)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 430| 146k| (Te4_2[byte(t3, 2)]) ^ ------------------ | | 318| 146k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t3, 2)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 431| 146k| (Te4_1[byte(t0, 1)]) ^ ------------------ | | 317| 146k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t0, 1)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 432| 146k| (Te4_0[byte(t1, 0)]) ^ ------------------ | | 316| 146k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t1, 0)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 433| 146k| rk[2]; 434| 146k| STORE32H(s2, ct+8); ------------------ | | 62| 146k|#define STORE32H(x, y) \ | | 63| 146k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 146k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 146k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded, False: 146k] | | ------------------ ------------------ 435| 146k| s3 = 436| 146k| (Te4_3[byte(t3, 3)]) ^ ------------------ | | 319| 146k|#define Te4_3 0xFF000000 & Te4 ------------------ (Te4_3[byte(t3, 3)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 437| 146k| (Te4_2[byte(t0, 2)]) ^ ------------------ | | 318| 146k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(t0, 2)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 438| 146k| (Te4_1[byte(t1, 1)]) ^ ------------------ | | 317| 146k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(t1, 1)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 439| 146k| (Te4_0[byte(t2, 0)]) ^ ------------------ | | 316| 146k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(t2, 0)]) ^ ------------------ | | 436| 146k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 440| 146k| rk[3]; 441| 146k| STORE32H(s3, ct+12); ------------------ | | 62| 146k|#define STORE32H(x, y) \ | | 63| 146k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 146k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 146k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded, False: 146k] | | ------------------ ------------------ 442| | 443| 146k| return CRYPT_OK; 444| 146k|} aes.c:setup_mix: 95| 64.3k|{ 96| 64.3k| return (Te4_3[byte(temp, 2)]) ^ ------------------ | | 319| 64.3k|#define Te4_3 0xFF000000 & Te4 ------------------ return (Te4_3[byte(temp, 2)]) ^ ------------------ | | 436| 64.3k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 97| 64.3k| (Te4_2[byte(temp, 1)]) ^ ------------------ | | 318| 64.3k|#define Te4_2 0x00FF0000 & Te4 ------------------ (Te4_2[byte(temp, 1)]) ^ ------------------ | | 436| 64.3k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 98| 64.3k| (Te4_1[byte(temp, 0)]) ^ ------------------ | | 317| 64.3k|#define Te4_1 0x0000FF00 & Te4 ------------------ (Te4_1[byte(temp, 0)]) ^ ------------------ | | 436| 64.3k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 99| 64.3k| (Te4_0[byte(temp, 3)]); ------------------ | | 316| 64.3k|#define Te4_0 0x000000FF & Te4 ------------------ (Te4_0[byte(temp, 3)]); ------------------ | | 436| 64.3k| #define byte(x, n) (((x) >> (8 * (n))) & 255) ------------------ 100| 64.3k|} aes.c:setup_mix2: 105| 247k|{ 106| 247k| return Td0(255 & Te4[byte(temp, 3)]) ^ ------------------ | | 311| 247k|#define Td0(x) TD0[x] ------------------ 107| 247k| Td1(255 & Te4[byte(temp, 2)]) ^ ------------------ | | 312| 247k|#define Td1(x) RORc(TD0[x], 8) | | ------------------ | | | | 283| 247k|#define RORc(word,i) ({ \ | | | | 284| 247k| ulong32 __RORc_tmp = (word); \ | | | | 285| 247k| __asm__ ("rorl %2, %0" : \ | | | | 286| 247k| "=r" (__RORc_tmp) : \ | | | | 287| 247k| "0" (__RORc_tmp), \ | | | | 288| 247k| "I" (i)); \ | | | | 289| 247k| __RORc_tmp; \ | | | | 290| 247k| }) | | ------------------ ------------------ 108| 247k| Td2(255 & Te4[byte(temp, 1)]) ^ ------------------ | | 313| 247k|#define Td2(x) RORc(TD0[x], 16) | | ------------------ | | | | 283| 247k|#define RORc(word,i) ({ \ | | | | 284| 247k| ulong32 __RORc_tmp = (word); \ | | | | 285| 247k| __asm__ ("rorl %2, %0" : \ | | | | 286| 247k| "=r" (__RORc_tmp) : \ | | | | 287| 247k| "0" (__RORc_tmp), \ | | | | 288| 247k| "I" (i)); \ | | | | 289| 247k| __RORc_tmp; \ | | | | 290| 247k| }) | | ------------------ ------------------ 109| 247k| Td3(255 & Te4[byte(temp, 0)]); ------------------ | | 314| 247k|#define Td3(x) RORc(TD0[x], 24) | | ------------------ | | | | 283| 247k|#define RORc(word,i) ({ \ | | | | 284| 247k| ulong32 __RORc_tmp = (word); \ | | | | 285| 247k| __asm__ ("rorl %2, %0" : \ | | | | 286| 247k| "=r" (__RORc_tmp) : \ | | | | 287| 247k| "0" (__RORc_tmp), \ | | | | 288| 247k| "I" (i)); \ | | | | 289| 247k| __RORc_tmp; \ | | | | 290| 247k| }) | | ------------------ ------------------ 110| 247k|} sha256_init: 205| 87.5k|{ 206| 87.5k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 87.5k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 87.5k] | | | Branch (32:87): [Folded, False: 87.5k] | | ------------------ ------------------ 207| | 208| 87.5k| md->sha256.curlen = 0; 209| 87.5k| md->sha256.length = 0; 210| 87.5k| md->sha256.state[0] = 0x6A09E667UL; 211| 87.5k| md->sha256.state[1] = 0xBB67AE85UL; 212| 87.5k| md->sha256.state[2] = 0x3C6EF372UL; 213| 87.5k| md->sha256.state[3] = 0xA54FF53AUL; 214| 87.5k| md->sha256.state[4] = 0x510E527FUL; 215| 87.5k| md->sha256.state[5] = 0x9B05688CUL; 216| 87.5k| md->sha256.state[6] = 0x1F83D9ABUL; 217| 87.5k| md->sha256.state[7] = 0x5BE0CD19UL; 218| 87.5k| return CRYPT_OK; 219| 87.5k|} sha256_done: 237| 117k|{ 238| 117k| int i; 239| | 240| 117k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 117k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 117k] | | | Branch (32:87): [Folded, False: 117k] | | ------------------ ------------------ 241| 117k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 117k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 117k] | | | Branch (32:87): [Folded, False: 117k] | | ------------------ ------------------ 242| | 243| 117k| if (md->sha256.curlen >= sizeof(md->sha256.buf)) { ------------------ | Branch (243:9): [True: 0, False: 117k] ------------------ 244| 0| return CRYPT_INVALID_ARG; 245| 0| } 246| | 247| | 248| | /* increase the length of the message */ 249| 117k| md->sha256.length += md->sha256.curlen * 8; 250| | 251| | /* append the '1' bit */ 252| 117k| md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80; 253| | 254| | /* if the length is currently above 56 bytes we append zeros 255| | * then compress. Then we can fall back to padding zeros and length 256| | * encoding like normal. 257| | */ 258| 117k| if (md->sha256.curlen > 56) { ------------------ | Branch (258:9): [True: 1.52k, False: 115k] ------------------ 259| 2.37k| while (md->sha256.curlen < 64) { ------------------ | Branch (259:16): [True: 841, False: 1.52k] ------------------ 260| 841| md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; 261| 841| } 262| 1.52k| sha256_compress(md, md->sha256.buf); 263| 1.52k| md->sha256.curlen = 0; 264| 1.52k| } 265| | 266| | /* pad upto 56 bytes of zeroes */ 267| 3.47M| while (md->sha256.curlen < 56) { ------------------ | Branch (267:12): [True: 3.35M, False: 117k] ------------------ 268| 3.35M| md->sha256.buf[md->sha256.curlen++] = (unsigned char)0; 269| 3.35M| } 270| | 271| | /* store length */ 272| 117k| STORE64H(md->sha256.length, md->sha256.buf+56); ------------------ | | 101| 117k|#define STORE64H(x, y) \ | | 102| 117k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 117k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 117k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded, False: 117k] | | ------------------ ------------------ 273| 117k| sha256_compress(md, md->sha256.buf); 274| | 275| | /* copy output */ 276| 1.05M| for (i = 0; i < 8; i++) { ------------------ | Branch (276:17): [True: 936k, False: 117k] ------------------ 277| 936k| STORE32H(md->sha256.state[i], out+(4*i)); ------------------ | | 62| 936k|#define STORE32H(x, y) \ | | 63| 936k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 936k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 936k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded, False: 936k] | | ------------------ ------------------ 278| 936k| } 279| |#ifdef LTC_CLEAN_STACK 280| | zeromem(md, sizeof(hash_state)); 281| |#endif 282| 117k| return CRYPT_OK; 283| 117k|} sha256.c:sha256_compress: 71| 266k|{ 72| 266k| ulong32 S[8], W[64], t0, t1; 73| 266k|#ifdef LTC_SMALL_CODE 74| 266k| ulong32 t; 75| 266k|#endif 76| 266k| int i; 77| | 78| | /* copy state into S */ 79| 2.39M| for (i = 0; i < 8; i++) { ------------------ | Branch (79:17): [True: 2.12M, False: 266k] ------------------ 80| 2.12M| S[i] = md->sha256.state[i]; 81| 2.12M| } 82| | 83| | /* copy the state into 512-bits into W[0..15] */ 84| 4.52M| for (i = 0; i < 16; i++) { ------------------ | Branch (84:17): [True: 4.25M, False: 266k] ------------------ 85| 4.25M| LOAD32H(W[i], buf + (4*i)); ------------------ | | 66| 4.25M|#define LOAD32H(x, y) \ | | 67| 4.25M|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 4.25M|#define XMEMCPY memcpy | | ------------------ | | 68| 4.25M| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 4.25M] | | ------------------ ------------------ 86| 4.25M| } 87| | 88| | /* fill W[16..63] */ 89| 13.0M| for (i = 16; i < 64; i++) { ------------------ | Branch (89:18): [True: 12.7M, False: 266k] ------------------ 90| 12.7M| W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 63| 12.7M|#define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) | | ------------------ | | | | 58| 12.7M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 12.7M|#define RORc(word,i) ({ \ | | | | | | 284| 12.7M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 12.7M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 12.7M| "=r" (__RORc_tmp) : \ | | | | | | 287| 12.7M| "0" (__RORc_tmp), \ | | | | | | 288| 12.7M| "I" (i)); \ | | | | | | 289| 12.7M| __RORc_tmp; \ | | | | | | 290| 12.7M| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) | | ------------------ | | | | 58| 12.7M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 12.7M|#define RORc(word,i) ({ \ | | | | | | 284| 12.7M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 12.7M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 12.7M| "=r" (__RORc_tmp) : \ | | | | | | 287| 12.7M| "0" (__RORc_tmp), \ | | | | | | 288| 12.7M| "I" (i)); \ | | | | | | 289| 12.7M| __RORc_tmp; \ | | | | | | 290| 12.7M| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 17) ^ S(x, 19) ^ R(x, 10)) | | ------------------ | | | | 59| 12.7M|#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) | | ------------------ ------------------ W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 62| 12.7M|#define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) | | ------------------ | | | | 58| 12.7M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 12.7M|#define RORc(word,i) ({ \ | | | | | | 284| 12.7M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 12.7M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 12.7M| "=r" (__RORc_tmp) : \ | | | | | | 287| 12.7M| "0" (__RORc_tmp), \ | | | | | | 288| 12.7M| "I" (i)); \ | | | | | | 289| 12.7M| __RORc_tmp; \ | | | | | | 290| 12.7M| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) | | ------------------ | | | | 58| 12.7M|#define S(x, n) RORc((x),(n)) | | | | ------------------ | | | | | | 283| 12.7M|#define RORc(word,i) ({ \ | | | | | | 284| 12.7M| ulong32 __RORc_tmp = (word); \ | | | | | | 285| 12.7M| __asm__ ("rorl %2, %0" : \ | | | | | | 286| 12.7M| "=r" (__RORc_tmp) : \ | | | | | | 287| 12.7M| "0" (__RORc_tmp), \ | | | | | | 288| 12.7M| "I" (i)); \ | | | | | | 289| 12.7M| __RORc_tmp; \ | | | | | | 290| 12.7M| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 7) ^ S(x, 18) ^ R(x, 3)) | | ------------------ | | | | 59| 12.7M|#define R(x, n) (((x)&0xFFFFFFFFUL)>>(n)) | | ------------------ ------------------ 91| 12.7M| } 92| | 93| | /* Compress */ 94| 266k|#ifdef LTC_SMALL_CODE 95| 266k|#define RND(a,b,c,d,e,f,g,h,i) \ 96| 266k| t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ 97| 266k| t1 = Sigma0(a) + Maj(a, b, c); \ 98| 266k| d += t0; \ 99| 266k| h = t0 + t1; 100| | 101| 17.2M| for (i = 0; i < 64; ++i) { ------------------ | Branch (101:18): [True: 17.0M, False: 266k] ------------------ 102| 17.0M| RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i); ------------------ | | 96| 17.0M| t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ | | ------------------ | | | | 61| 17.0M|#define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) | | | | ------------------ | | | | | | 58| 17.0M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 17.0M|#define RORc(word,i) ({ \ | | | | | | | | 284| 17.0M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 17.0M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 17.0M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 17.0M| "0" (__RORc_tmp), \ | | | | | | | | 288| 17.0M| "I" (i)); \ | | | | | | | | 289| 17.0M| __RORc_tmp; \ | | | | | | | | 290| 17.0M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) | | | | ------------------ | | | | | | 58| 17.0M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 17.0M|#define RORc(word,i) ({ \ | | | | | | | | 284| 17.0M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 17.0M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 17.0M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 17.0M| "0" (__RORc_tmp), \ | | | | | | | | 288| 17.0M| "I" (i)); \ | | | | | | | | 289| 17.0M| __RORc_tmp; \ | | | | | | | | 290| 17.0M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma1(x) (S(x, 6) ^ S(x, 11) ^ S(x, 25)) | | | | ------------------ | | | | | | 58| 17.0M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 17.0M|#define RORc(word,i) ({ \ | | | | | | | | 284| 17.0M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 17.0M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 17.0M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 17.0M| "0" (__RORc_tmp), \ | | | | | | | | 288| 17.0M| "I" (i)); \ | | | | | | | | 289| 17.0M| __RORc_tmp; \ | | | | | | | | 290| 17.0M| }) | | | | | | ------------------ | | | | ------------------ | | ------------------ | | t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ | | ------------------ | | | | 56| 17.0M|#define Ch(x,y,z) (z ^ (x & (y ^ z))) | | ------------------ | | 97| 17.0M| t1 = Sigma0(a) + Maj(a, b, c); \ | | ------------------ | | | | 60| 17.0M|#define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) | | | | ------------------ | | | | | | 58| 17.0M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 17.0M|#define RORc(word,i) ({ \ | | | | | | | | 284| 17.0M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 17.0M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 17.0M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 17.0M| "0" (__RORc_tmp), \ | | | | | | | | 288| 17.0M| "I" (i)); \ | | | | | | | | 289| 17.0M| __RORc_tmp; \ | | | | | | | | 290| 17.0M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) | | | | ------------------ | | | | | | 58| 17.0M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 17.0M|#define RORc(word,i) ({ \ | | | | | | | | 284| 17.0M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 17.0M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 17.0M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 17.0M| "0" (__RORc_tmp), \ | | | | | | | | 288| 17.0M| "I" (i)); \ | | | | | | | | 289| 17.0M| __RORc_tmp; \ | | | | | | | | 290| 17.0M| }) | | | | | | ------------------ | | | | ------------------ | | | | #define Sigma0(x) (S(x, 2) ^ S(x, 13) ^ S(x, 22)) | | | | ------------------ | | | | | | 58| 17.0M|#define S(x, n) RORc((x),(n)) | | | | | | ------------------ | | | | | | | | 283| 17.0M|#define RORc(word,i) ({ \ | | | | | | | | 284| 17.0M| ulong32 __RORc_tmp = (word); \ | | | | | | | | 285| 17.0M| __asm__ ("rorl %2, %0" : \ | | | | | | | | 286| 17.0M| "=r" (__RORc_tmp) : \ | | | | | | | | 287| 17.0M| "0" (__RORc_tmp), \ | | | | | | | | 288| 17.0M| "I" (i)); \ | | | | | | | | 289| 17.0M| __RORc_tmp; \ | | | | | | | | 290| 17.0M| }) | | | | | | ------------------ | | | | ------------------ | | ------------------ | | t1 = Sigma0(a) + Maj(a, b, c); \ | | ------------------ | | | | 57| 17.0M|#define Maj(x,y,z) (((x | y) & z) | (x & y)) | | ------------------ | | 98| 17.0M| d += t0; \ | | 99| 17.0M| h = t0 + t1; ------------------ 103| 17.0M| t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4]; 104| 17.0M| S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t; 105| 17.0M| } 106| |#else 107| |#define RND(a,b,c,d,e,f,g,h,i,ki) \ 108| | t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i]; \ 109| | t1 = Sigma0(a) + Maj(a, b, c); \ 110| | d += t0; \ 111| | h = t0 + t1; 112| | 113| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],0,0x428a2f98); 114| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],1,0x71374491); 115| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],2,0xb5c0fbcf); 116| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],3,0xe9b5dba5); 117| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],4,0x3956c25b); 118| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],5,0x59f111f1); 119| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],6,0x923f82a4); 120| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],7,0xab1c5ed5); 121| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],8,0xd807aa98); 122| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],9,0x12835b01); 123| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],10,0x243185be); 124| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],11,0x550c7dc3); 125| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],12,0x72be5d74); 126| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],13,0x80deb1fe); 127| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],14,0x9bdc06a7); 128| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],15,0xc19bf174); 129| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],16,0xe49b69c1); 130| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],17,0xefbe4786); 131| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],18,0x0fc19dc6); 132| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],19,0x240ca1cc); 133| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],20,0x2de92c6f); 134| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],21,0x4a7484aa); 135| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],22,0x5cb0a9dc); 136| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],23,0x76f988da); 137| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],24,0x983e5152); 138| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],25,0xa831c66d); 139| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],26,0xb00327c8); 140| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],27,0xbf597fc7); 141| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],28,0xc6e00bf3); 142| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],29,0xd5a79147); 143| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],30,0x06ca6351); 144| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],31,0x14292967); 145| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],32,0x27b70a85); 146| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],33,0x2e1b2138); 147| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],34,0x4d2c6dfc); 148| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],35,0x53380d13); 149| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],36,0x650a7354); 150| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],37,0x766a0abb); 151| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],38,0x81c2c92e); 152| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],39,0x92722c85); 153| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],40,0xa2bfe8a1); 154| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],41,0xa81a664b); 155| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],42,0xc24b8b70); 156| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],43,0xc76c51a3); 157| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],44,0xd192e819); 158| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],45,0xd6990624); 159| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],46,0xf40e3585); 160| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],47,0x106aa070); 161| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],48,0x19a4c116); 162| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],49,0x1e376c08); 163| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],50,0x2748774c); 164| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],51,0x34b0bcb5); 165| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],52,0x391c0cb3); 166| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],53,0x4ed8aa4a); 167| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],54,0x5b9cca4f); 168| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],55,0x682e6ff3); 169| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],56,0x748f82ee); 170| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],57,0x78a5636f); 171| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],58,0x84c87814); 172| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],59,0x8cc70208); 173| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],60,0x90befffa); 174| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],61,0xa4506ceb); 175| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7); 176| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2); 177| | 178| |#undef RND 179| | 180| |#endif 181| | 182| | /* feedback */ 183| 2.39M| for (i = 0; i < 8; i++) { ------------------ | Branch (183:17): [True: 2.12M, False: 266k] ------------------ 184| 2.12M| md->sha256.state[i] = md->sha256.state[i] + S[i]; 185| 2.12M| } 186| 266k| return CRYPT_OK; 187| 266k|} sha384_init: 42| 812|{ 43| 812| LTC_ARGCHK(md != NULL); ------------------ | | 32| 812|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 812] | | | Branch (32:87): [Folded, False: 812] | | ------------------ ------------------ 44| | 45| 812| md->sha512.curlen = 0; 46| 812| md->sha512.length = 0; 47| 812| md->sha512.state[0] = CONST64(0xcbbb9d5dc1059ed8); ------------------ | | 200| 812| #define CONST64(n) n ## ULL ------------------ 48| 812| md->sha512.state[1] = CONST64(0x629a292a367cd507); ------------------ | | 200| 812| #define CONST64(n) n ## ULL ------------------ 49| 812| md->sha512.state[2] = CONST64(0x9159015a3070dd17); ------------------ | | 200| 812| #define CONST64(n) n ## ULL ------------------ 50| 812| md->sha512.state[3] = CONST64(0x152fecd8f70e5939); ------------------ | | 200| 812| #define CONST64(n) n ## ULL ------------------ 51| 812| md->sha512.state[4] = CONST64(0x67332667ffc00b31); ------------------ | | 200| 812| #define CONST64(n) n ## ULL ------------------ 52| 812| md->sha512.state[5] = CONST64(0x8eb44a8768581511); ------------------ | | 200| 812| #define CONST64(n) n ## ULL ------------------ 53| 812| md->sha512.state[6] = CONST64(0xdb0c2e0d64f98fa7); ------------------ | | 200| 812| #define CONST64(n) n ## ULL ------------------ 54| 812| md->sha512.state[7] = CONST64(0x47b5481dbefa4fa4); ------------------ | | 200| 812| #define CONST64(n) n ## ULL ------------------ 55| 812| return CRYPT_OK; 56| 812|} sha384_done: 65| 3.24k|{ 66| 3.24k| unsigned char buf[64]; 67| | 68| 3.24k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 3.24k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.24k] | | | Branch (32:87): [Folded, False: 3.24k] | | ------------------ ------------------ 69| 3.24k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 3.24k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.24k] | | | Branch (32:87): [Folded, False: 3.24k] | | ------------------ ------------------ 70| | 71| 3.24k| if (md->sha512.curlen >= sizeof(md->sha512.buf)) { ------------------ | Branch (71:9): [True: 0, False: 3.24k] ------------------ 72| 0| return CRYPT_INVALID_ARG; 73| 0| } 74| | 75| 3.24k| sha512_done(md, buf); 76| 3.24k| XMEMCPY(out, buf, 48); ------------------ | | 39| 3.24k|#define XMEMCPY memcpy ------------------ 77| |#ifdef LTC_CLEAN_STACK 78| | zeromem(buf, sizeof(buf)); 79| |#endif 80| 3.24k| return CRYPT_OK; 81| 3.24k|} sha512_init: 174| 1.57k|{ 175| 1.57k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 1.57k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.57k] | | | Branch (32:87): [Folded, False: 1.57k] | | ------------------ ------------------ 176| 1.57k| md->sha512.curlen = 0; 177| 1.57k| md->sha512.length = 0; 178| 1.57k| md->sha512.state[0] = CONST64(0x6a09e667f3bcc908); ------------------ | | 200| 1.57k| #define CONST64(n) n ## ULL ------------------ 179| 1.57k| md->sha512.state[1] = CONST64(0xbb67ae8584caa73b); ------------------ | | 200| 1.57k| #define CONST64(n) n ## ULL ------------------ 180| 1.57k| md->sha512.state[2] = CONST64(0x3c6ef372fe94f82b); ------------------ | | 200| 1.57k| #define CONST64(n) n ## ULL ------------------ 181| 1.57k| md->sha512.state[3] = CONST64(0xa54ff53a5f1d36f1); ------------------ | | 200| 1.57k| #define CONST64(n) n ## ULL ------------------ 182| 1.57k| md->sha512.state[4] = CONST64(0x510e527fade682d1); ------------------ | | 200| 1.57k| #define CONST64(n) n ## ULL ------------------ 183| 1.57k| md->sha512.state[5] = CONST64(0x9b05688c2b3e6c1f); ------------------ | | 200| 1.57k| #define CONST64(n) n ## ULL ------------------ 184| 1.57k| md->sha512.state[6] = CONST64(0x1f83d9abfb41bd6b); ------------------ | | 200| 1.57k| #define CONST64(n) n ## ULL ------------------ 185| 1.57k| md->sha512.state[7] = CONST64(0x5be0cd19137e2179); ------------------ | | 200| 1.57k| #define CONST64(n) n ## ULL ------------------ 186| 1.57k| return CRYPT_OK; 187| 1.57k|} sha512_done: 205| 7.67k|{ 206| 7.67k| int i; 207| | 208| 7.67k| LTC_ARGCHK(md != NULL); ------------------ | | 32| 7.67k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 7.67k] | | | Branch (32:87): [Folded, False: 7.67k] | | ------------------ ------------------ 209| 7.67k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 7.67k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 7.67k] | | | Branch (32:87): [Folded, False: 7.67k] | | ------------------ ------------------ 210| | 211| 7.67k| if (md->sha512.curlen >= sizeof(md->sha512.buf)) { ------------------ | Branch (211:9): [True: 0, False: 7.67k] ------------------ 212| 0| return CRYPT_INVALID_ARG; 213| 0| } 214| | 215| | /* increase the length of the message */ 216| 7.67k| md->sha512.length += md->sha512.curlen * CONST64(8); ------------------ | | 200| 7.67k| #define CONST64(n) n ## ULL ------------------ 217| | 218| | /* append the '1' bit */ 219| 7.67k| md->sha512.buf[md->sha512.curlen++] = (unsigned char)0x80; 220| | 221| | /* if the length is currently above 112 bytes we append zeros 222| | * then compress. Then we can fall back to padding zeros and length 223| | * encoding like normal. 224| | */ 225| 7.67k| if (md->sha512.curlen > 112) { ------------------ | Branch (225:9): [True: 1.48k, False: 6.18k] ------------------ 226| 9.83k| while (md->sha512.curlen < 128) { ------------------ | Branch (226:16): [True: 8.35k, False: 1.48k] ------------------ 227| 8.35k| md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; 228| 8.35k| } 229| 1.48k| sha512_compress(md, md->sha512.buf); 230| 1.48k| md->sha512.curlen = 0; 231| 1.48k| } 232| | 233| | /* pad upto 120 bytes of zeroes 234| | * note: that from 112 to 120 is the 64 MSB of the length. We assume that you won't hash 235| | * > 2^64 bits of data... :-) 236| | */ 237| 689k| while (md->sha512.curlen < 120) { ------------------ | Branch (237:12): [True: 681k, False: 7.67k] ------------------ 238| 681k| md->sha512.buf[md->sha512.curlen++] = (unsigned char)0; 239| 681k| } 240| | 241| | /* store length */ 242| 7.67k| STORE64H(md->sha512.length, md->sha512.buf+120); ------------------ | | 101| 7.67k|#define STORE64H(x, y) \ | | 102| 7.67k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 7.67k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 7.67k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded, False: 7.67k] | | ------------------ ------------------ 243| 7.67k| sha512_compress(md, md->sha512.buf); 244| | 245| | /* copy output */ 246| 69.0k| for (i = 0; i < 8; i++) { ------------------ | Branch (246:17): [True: 61.3k, False: 7.67k] ------------------ 247| 61.3k| STORE64H(md->sha512.state[i], out+(8*i)); ------------------ | | 101| 61.3k|#define STORE64H(x, y) \ | | 102| 61.3k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 61.3k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 61.3k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded, False: 61.3k] | | ------------------ ------------------ 248| 61.3k| } 249| |#ifdef LTC_CLEAN_STACK 250| | zeromem(md, sizeof(hash_state)); 251| |#endif 252| 7.67k| return CRYPT_OK; 253| 7.67k|} sha512.c:sha512_compress: 96| 22.2k|{ 97| 22.2k| ulong64 S[8], W[80], t0, t1; 98| 22.2k| int i; 99| | 100| | /* copy state into S */ 101| 199k| for (i = 0; i < 8; i++) { ------------------ | Branch (101:17): [True: 177k, False: 22.2k] ------------------ 102| 177k| S[i] = md->sha512.state[i]; 103| 177k| } 104| | 105| | /* copy the state into 1024-bits into W[0..15] */ 106| 377k| for (i = 0; i < 16; i++) { ------------------ | Branch (106:17): [True: 355k, False: 22.2k] ------------------ 107| 355k| LOAD64H(W[i], buf + (8*i)); ------------------ | | 105| 355k|#define LOAD64H(x, y) \ | | 106| 355k|do { XMEMCPY (&(x), (y), 8); \ | | ------------------ | | | | 39| 355k|#define XMEMCPY memcpy | | ------------------ | | 107| 355k| (x) = __builtin_bswap64 ((x)); } while(0) | | ------------------ | | | Branch (107:46): [Folded, False: 355k] | | ------------------ ------------------ 108| 355k| } 109| | 110| | /* fill W[16..79] */ 111| 1.44M| for (i = 16; i < 80; i++) { ------------------ | Branch (111:18): [True: 1.42M, False: 22.2k] ------------------ 112| 1.42M| W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 88| 1.42M|#define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) | | ------------------ | | | | 83| 1.42M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 1.42M|#define ROR64c(word,i) ({ \ | | | | | | 385| 1.42M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 1.42M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 1.42M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 1.42M| "0" (__ROR64c_tmp), \ | | | | | | 389| 1.42M| "J" (i)); \ | | | | | | 390| 1.42M| __ROR64c_tmp; \ | | | | | | 391| 1.42M| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) | | ------------------ | | | | 83| 1.42M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 1.42M|#define ROR64c(word,i) ({ \ | | | | | | 385| 1.42M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 1.42M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 1.42M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 1.42M| "0" (__ROR64c_tmp), \ | | | | | | 389| 1.42M| "J" (i)); \ | | | | | | 390| 1.42M| __ROR64c_tmp; \ | | | | | | 391| 1.42M| }) | | | | ------------------ | | ------------------ | | #define Gamma1(x) (S(x, 19) ^ S(x, 61) ^ R(x, 6)) | | ------------------ | | | | 84| 1.42M|#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) | | | | ------------------ | | | | | | 200| 1.42M| #define CONST64(n) n ## ULL | | | | ------------------ | | ------------------ ------------------ W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16]; ------------------ | | 87| 1.42M|#define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) | | ------------------ | | | | 83| 1.42M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 1.42M|#define ROR64c(word,i) ({ \ | | | | | | 385| 1.42M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 1.42M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 1.42M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 1.42M| "0" (__ROR64c_tmp), \ | | | | | | 389| 1.42M| "J" (i)); \ | | | | | | 390| 1.42M| __ROR64c_tmp; \ | | | | | | 391| 1.42M| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) | | ------------------ | | | | 83| 1.42M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 1.42M|#define ROR64c(word,i) ({ \ | | | | | | 385| 1.42M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 1.42M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 1.42M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 1.42M| "0" (__ROR64c_tmp), \ | | | | | | 389| 1.42M| "J" (i)); \ | | | | | | 390| 1.42M| __ROR64c_tmp; \ | | | | | | 391| 1.42M| }) | | | | ------------------ | | ------------------ | | #define Gamma0(x) (S(x, 1) ^ S(x, 8) ^ R(x, 7)) | | ------------------ | | | | 84| 1.42M|#define R(x, n) (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n)) | | | | ------------------ | | | | | | 200| 1.42M| #define CONST64(n) n ## ULL | | | | ------------------ | | ------------------ ------------------ 113| 1.42M| } 114| | 115| | /* Compress */ 116| 22.2k|#ifdef LTC_SMALL_CODE 117| 1.79M| for (i = 0; i < 80; i++) { ------------------ | Branch (117:17): [True: 1.77M, False: 22.2k] ------------------ 118| 1.77M| t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i]; ------------------ | | 86| 1.77M|#define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) | | ------------------ | | | | 83| 1.77M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 1.77M|#define ROR64c(word,i) ({ \ | | | | | | 385| 1.77M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 1.77M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 1.77M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 1.77M| "0" (__ROR64c_tmp), \ | | | | | | 389| 1.77M| "J" (i)); \ | | | | | | 390| 1.77M| __ROR64c_tmp; \ | | | | | | 391| 1.77M| }) | | | | ------------------ | | ------------------ | | #define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) | | ------------------ | | | | 83| 1.77M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 1.77M|#define ROR64c(word,i) ({ \ | | | | | | 385| 1.77M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 1.77M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 1.77M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 1.77M| "0" (__ROR64c_tmp), \ | | | | | | 389| 1.77M| "J" (i)); \ | | | | | | 390| 1.77M| __ROR64c_tmp; \ | | | | | | 391| 1.77M| }) | | | | ------------------ | | ------------------ | | #define Sigma1(x) (S(x, 14) ^ S(x, 18) ^ S(x, 41)) | | ------------------ | | | | 83| 1.77M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 1.77M|#define ROR64c(word,i) ({ \ | | | | | | 385| 1.77M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 1.77M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 1.77M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 1.77M| "0" (__ROR64c_tmp), \ | | | | | | 389| 1.77M| "J" (i)); \ | | | | | | 390| 1.77M| __ROR64c_tmp; \ | | | | | | 391| 1.77M| }) | | | | ------------------ | | ------------------ ------------------ t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i]; ------------------ | | 81| 1.77M|#define Ch(x,y,z) (z ^ (x & (y ^ z))) ------------------ 119| 1.77M| t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]); ------------------ | | 85| 1.77M|#define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) | | ------------------ | | | | 83| 1.77M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 1.77M|#define ROR64c(word,i) ({ \ | | | | | | 385| 1.77M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 1.77M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 1.77M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 1.77M| "0" (__ROR64c_tmp), \ | | | | | | 389| 1.77M| "J" (i)); \ | | | | | | 390| 1.77M| __ROR64c_tmp; \ | | | | | | 391| 1.77M| }) | | | | ------------------ | | ------------------ | | #define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) | | ------------------ | | | | 83| 1.77M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 1.77M|#define ROR64c(word,i) ({ \ | | | | | | 385| 1.77M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 1.77M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 1.77M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 1.77M| "0" (__ROR64c_tmp), \ | | | | | | 389| 1.77M| "J" (i)); \ | | | | | | 390| 1.77M| __ROR64c_tmp; \ | | | | | | 391| 1.77M| }) | | | | ------------------ | | ------------------ | | #define Sigma0(x) (S(x, 28) ^ S(x, 34) ^ S(x, 39)) | | ------------------ | | | | 83| 1.77M|#define S(x, n) ROR64c(x, n) | | | | ------------------ | | | | | | 384| 1.77M|#define ROR64c(word,i) ({ \ | | | | | | 385| 1.77M| ulong64 __ROR64c_tmp = word; \ | | | | | | 386| 1.77M| __asm__ ("rorq %2, %0" : \ | | | | | | 387| 1.77M| "=r" (__ROR64c_tmp) : \ | | | | | | 388| 1.77M| "0" (__ROR64c_tmp), \ | | | | | | 389| 1.77M| "J" (i)); \ | | | | | | 390| 1.77M| __ROR64c_tmp; \ | | | | | | 391| 1.77M| }) | | | | ------------------ | | ------------------ ------------------ t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]); ------------------ | | 82| 1.77M|#define Maj(x,y,z) (((x | y) & z) | (x & y)) ------------------ 120| 1.77M| S[7] = S[6]; 121| 1.77M| S[6] = S[5]; 122| 1.77M| S[5] = S[4]; 123| 1.77M| S[4] = S[3] + t0; 124| 1.77M| S[3] = S[2]; 125| 1.77M| S[2] = S[1]; 126| 1.77M| S[1] = S[0]; 127| 1.77M| S[0] = t0 + t1; 128| 1.77M| } 129| |#else 130| |#define RND(a,b,c,d,e,f,g,h,i) \ 131| | t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i]; \ 132| | t1 = Sigma0(a) + Maj(a, b, c); \ 133| | d += t0; \ 134| | h = t0 + t1; 135| | 136| | for (i = 0; i < 80; i += 8) { 137| | RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0); 138| | RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1); 139| | RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2); 140| | RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3); 141| | RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4); 142| | RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5); 143| | RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6); 144| | RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7); 145| | } 146| |#endif 147| | 148| | 149| | /* feedback */ 150| 199k| for (i = 0; i < 8; i++) { ------------------ | Branch (150:17): [True: 177k, False: 22.2k] ------------------ 151| 177k| md->sha512.state[i] = md->sha512.state[i] + S[i]; 152| 177k| } 153| | 154| 22.2k| return CRYPT_OK; 155| 22.2k|} sha256_process: 491| 243k|int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) \ 492| 243k|{ \ 493| 243k| unsigned long n; \ 494| 243k| int err; \ 495| 243k| LTC_ARGCHK(md != NULL); \ ------------------ | | 32| 243k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 243k] | | | Branch (32:87): [Folded, False: 243k] | | ------------------ ------------------ 496| 243k| LTC_ARGCHK(in != NULL); \ ------------------ | | 32| 243k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 243k] | | | Branch (32:87): [Folded, False: 243k] | | ------------------ ------------------ 497| 243k| if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ ------------------ | Branch (497:9): [True: 0, False: 243k] ------------------ 498| 0| return CRYPT_INVALID_ARG; \ 499| 0| } \ 500| 243k| if ((md-> state_var .length + inlen) < md-> state_var .length) { \ ------------------ | Branch (500:9): [True: 0, False: 243k] ------------------ 501| 0| return CRYPT_HASH_OVERFLOW; \ 502| 0| } \ 503| 605k| while (inlen > 0) { \ ------------------ | Branch (503:12): [True: 362k, False: 243k] ------------------ 504| 362k| if (md-> state_var .curlen == 0 && inlen >= block_size) { \ ------------------ | Branch (504:13): [True: 235k, False: 127k] | Branch (504:44): [True: 108k, False: 126k] ------------------ 505| 108k| if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) { \ ------------------ | Branch (505:16): [True: 0, False: 108k] ------------------ 506| 0| return err; \ 507| 0| } \ 508| 108k| md-> state_var .length += block_size * 8; \ 509| 108k| in += block_size; \ 510| 108k| inlen -= block_size; \ 511| 253k| } else { \ 512| 253k| n = MIN(inlen, (block_size - md-> state_var .curlen)); \ ------------------ | | 425| 253k| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 214k, False: 38.7k] | | ------------------ ------------------ 513| 253k| XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ ------------------ | | 39| 253k|#define XMEMCPY memcpy ------------------ 514| 253k| md-> state_var .curlen += n; \ 515| 253k| in += n; \ 516| 253k| inlen -= n; \ 517| 253k| if (md-> state_var .curlen == block_size) { \ ------------------ | Branch (517:16): [True: 38.7k, False: 214k] ------------------ 518| 38.7k| if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) { \ ------------------ | Branch (518:19): [True: 0, False: 38.7k] ------------------ 519| 0| return err; \ 520| 0| } \ 521| 38.7k| md-> state_var .length += 8*block_size; \ 522| 38.7k| md-> state_var .curlen = 0; \ 523| 38.7k| } \ 524| 253k| } \ 525| 362k| } \ 526| 243k| return CRYPT_OK; \ 527| 243k|} sha512_process: 491| 15.7k|int func_name (hash_state * md, const unsigned char *in, unsigned long inlen) \ 492| 15.7k|{ \ 493| 15.7k| unsigned long n; \ 494| 15.7k| int err; \ 495| 15.7k| LTC_ARGCHK(md != NULL); \ ------------------ | | 32| 15.7k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 15.7k] | | | Branch (32:87): [Folded, False: 15.7k] | | ------------------ ------------------ 496| 15.7k| LTC_ARGCHK(in != NULL); \ ------------------ | | 32| 15.7k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 15.7k] | | | Branch (32:87): [Folded, False: 15.7k] | | ------------------ ------------------ 497| 15.7k| if (md-> state_var .curlen > sizeof(md-> state_var .buf)) { \ ------------------ | Branch (497:9): [True: 0, False: 15.7k] ------------------ 498| 0| return CRYPT_INVALID_ARG; \ 499| 0| } \ 500| 15.7k| if ((md-> state_var .length + inlen) < md-> state_var .length) { \ ------------------ | Branch (500:9): [True: 0, False: 15.7k] ------------------ 501| 0| return CRYPT_HASH_OVERFLOW; \ 502| 0| } \ 503| 44.4k| while (inlen > 0) { \ ------------------ | Branch (503:12): [True: 28.7k, False: 15.7k] ------------------ 504| 28.7k| if (md-> state_var .curlen == 0 && inlen >= block_size) { \ ------------------ | Branch (504:13): [True: 15.4k, False: 13.3k] | Branch (504:44): [True: 9.53k, False: 5.90k] ------------------ 505| 9.53k| if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) { \ ------------------ | Branch (505:16): [True: 0, False: 9.53k] ------------------ 506| 0| return err; \ 507| 0| } \ 508| 9.53k| md-> state_var .length += block_size * 8; \ 509| 9.53k| in += block_size; \ 510| 9.53k| inlen -= block_size; \ 511| 19.2k| } else { \ 512| 19.2k| n = MIN(inlen, (block_size - md-> state_var .curlen)); \ ------------------ | | 425| 19.2k| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 15.7k, False: 3.52k] | | ------------------ ------------------ 513| 19.2k| XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n); \ ------------------ | | 39| 19.2k|#define XMEMCPY memcpy ------------------ 514| 19.2k| md-> state_var .curlen += n; \ 515| 19.2k| in += n; \ 516| 19.2k| inlen -= n; \ 517| 19.2k| if (md-> state_var .curlen == block_size) { \ ------------------ | Branch (517:16): [True: 3.52k, False: 15.7k] ------------------ 518| 3.52k| if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) { \ ------------------ | Branch (518:19): [True: 0, False: 3.52k] ------------------ 519| 0| return err; \ 520| 0| } \ 521| 3.52k| md-> state_var .length += 8*block_size; \ 522| 3.52k| md-> state_var .curlen = 0; \ 523| 3.52k| } \ 524| 19.2k| } \ 525| 28.7k| } \ 526| 15.7k| return CRYPT_OK; \ 527| 15.7k|} chacha_crypt.c:ROL: 258| 4.64M|{ 259| 4.64M| asm ("roll %%cl,%0" 260| 4.64M| :"=r" (word) 261| 4.64M| :"0" (word),"c" (i)); 262| 4.64M| return word; 263| 4.64M|} hmac_done: 28| 14.1k|{ 29| 14.1k| unsigned char buf[MAXBLOCKSIZE], isha[MAXBLOCKSIZE]; 30| 14.1k| unsigned long hashsize, i; 31| 14.1k| int hash, err; 32| | 33| 14.1k| LTC_ARGCHK(hmac != NULL); ------------------ | | 32| 14.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 14.1k] | | | Branch (32:87): [Folded, False: 14.1k] | | ------------------ ------------------ 34| 14.1k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 14.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 14.1k] | | | Branch (32:87): [Folded, False: 14.1k] | | ------------------ ------------------ 35| | 36| | /* test hash */ 37| 14.1k| hash = hmac->hash; 38| 14.1k| if((err = hash_is_valid(hash)) != CRYPT_OK) { ------------------ | Branch (38:8): [True: 0, False: 14.1k] ------------------ 39| 0| return err; 40| 0| } 41| | 42| | /* get the hash message digest size */ 43| 14.1k| hashsize = hash_descriptor[hash].hashsize; 44| | 45| 14.1k| if ((err = hash_descriptor[hash].done(&hmac->md, isha)) != CRYPT_OK) { ------------------ | Branch (45:9): [True: 0, False: 14.1k] ------------------ 46| 0| goto LBL_ERR; 47| 0| } 48| | 49| | /* Create the second HMAC vector vector for step (3) */ 50| 917k| for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) { ------------------ | | 18| 917k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (50:14): [True: 903k, False: 14.1k] ------------------ 51| 903k| buf[i] = hmac->key[i] ^ 0x5C; 52| 903k| } 53| | 54| | /* Now calculate the "outer" hash for step (5), (6), and (7) */ 55| 14.1k| if ((err = hash_descriptor[hash].init(&hmac->md)) != CRYPT_OK) { ------------------ | Branch (55:9): [True: 0, False: 14.1k] ------------------ 56| 0| goto LBL_ERR; 57| 0| } 58| 14.1k| if ((err = hash_descriptor[hash].process(&hmac->md, buf, LTC_HMAC_BLOCKSIZE)) != CRYPT_OK) { ------------------ | | 18| 14.1k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (58:9): [True: 0, False: 14.1k] ------------------ 59| 0| goto LBL_ERR; 60| 0| } 61| 14.1k| if ((err = hash_descriptor[hash].process(&hmac->md, isha, hashsize)) != CRYPT_OK) { ------------------ | Branch (61:9): [True: 0, False: 14.1k] ------------------ 62| 0| goto LBL_ERR; 63| 0| } 64| 14.1k| if ((err = hash_descriptor[hash].done(&hmac->md, buf)) != CRYPT_OK) { ------------------ | Branch (64:9): [True: 0, False: 14.1k] ------------------ 65| 0| goto LBL_ERR; 66| 0| } 67| | 68| | /* copy to output */ 69| 465k| for (i = 0; i < hashsize && i < *outlen; i++) { ------------------ | Branch (69:17): [True: 451k, False: 14.1k] | Branch (69:33): [True: 451k, False: 0] ------------------ 70| 451k| out[i] = buf[i]; 71| 451k| } 72| 14.1k| *outlen = i; 73| | 74| 14.1k| err = CRYPT_OK; 75| 14.1k|LBL_ERR: 76| 14.1k| XFREE(hmac->key); ------------------ | | 17| 14.1k|#define XFREE m_free_direct ------------------ 77| |#ifdef LTC_CLEAN_STACK 78| | zeromem(isha, hashsize); 79| | zeromem(buf, hashsize); 80| | zeromem(hmac, sizeof(*hmac)); 81| |#endif 82| | 83| 14.1k| return err; 84| 14.1k|} hmac_init: 29| 14.1k|{ 30| 14.1k| unsigned char buf[MAXBLOCKSIZE]; 31| 14.1k| unsigned long hashsize; 32| 14.1k| unsigned long i, z; 33| 14.1k| int err; 34| | 35| 14.1k| LTC_ARGCHK(hmac != NULL); ------------------ | | 32| 14.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 14.1k] | | | Branch (32:87): [Folded, False: 14.1k] | | ------------------ ------------------ 36| 14.1k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 14.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 14.1k] | | | Branch (32:87): [Folded, False: 14.1k] | | ------------------ ------------------ 37| | 38| | /* valid hash? */ 39| 14.1k| if ((err = hash_is_valid(hash)) != CRYPT_OK) { ------------------ | Branch (39:9): [True: 0, False: 14.1k] ------------------ 40| 0| return err; 41| 0| } 42| 14.1k| hmac->hash = hash; 43| 14.1k| hashsize = hash_descriptor[hash].hashsize; 44| | 45| | /* valid key length? */ 46| 14.1k| if (keylen == 0) { ------------------ | Branch (46:9): [True: 0, False: 14.1k] ------------------ 47| 0| return CRYPT_INVALID_KEYSIZE; 48| 0| } 49| | 50| | /* allocate memory for key */ 51| 14.1k| hmac->key = XMALLOC(LTC_HMAC_BLOCKSIZE); ------------------ | | 16| 14.1k|#define XMALLOC m_malloc ------------------ hmac->key = XMALLOC(LTC_HMAC_BLOCKSIZE); ------------------ | | 18| 14.1k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ 52| 14.1k| if (hmac->key == NULL) { ------------------ | Branch (52:9): [True: 0, False: 14.1k] ------------------ 53| 0| return CRYPT_MEM; 54| 0| } 55| | 56| | /* (1) make sure we have a large enough key */ 57| 14.1k| if(keylen > LTC_HMAC_BLOCKSIZE) { ------------------ | | 18| 14.1k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (57:8): [True: 0, False: 14.1k] ------------------ 58| 0| z = LTC_HMAC_BLOCKSIZE; ------------------ | | 18| 0|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ 59| 0| if ((err = hash_memory(hash, key, keylen, hmac->key, &z)) != CRYPT_OK) { ------------------ | Branch (59:13): [True: 0, False: 0] ------------------ 60| 0| goto LBL_ERR; 61| 0| } 62| 0| keylen = hashsize; 63| 14.1k| } else { 64| 14.1k| XMEMCPY(hmac->key, key, (size_t)keylen); ------------------ | | 39| 14.1k|#define XMEMCPY memcpy ------------------ 65| 14.1k| } 66| | 67| 14.1k| if(keylen < LTC_HMAC_BLOCKSIZE) { ------------------ | | 18| 14.1k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (67:8): [True: 14.1k, False: 0] ------------------ 68| 14.1k| zeromem((hmac->key) + keylen, (size_t)(LTC_HMAC_BLOCKSIZE - keylen)); ------------------ | | 18| 14.1k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ 69| 14.1k| } 70| | 71| | /* Create the initialization vector for step (3) */ 72| 917k| for(i=0; i < LTC_HMAC_BLOCKSIZE; i++) { ------------------ | | 18| 917k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (72:14): [True: 903k, False: 14.1k] ------------------ 73| 903k| buf[i] = hmac->key[i] ^ 0x36; 74| 903k| } 75| | 76| | /* Pre-pend that to the hash data */ 77| 14.1k| if ((err = hash_descriptor[hash].init(&hmac->md)) != CRYPT_OK) { ------------------ | Branch (77:9): [True: 0, False: 14.1k] ------------------ 78| 0| goto LBL_ERR; 79| 0| } 80| | 81| 14.1k| if ((err = hash_descriptor[hash].process(&hmac->md, buf, LTC_HMAC_BLOCKSIZE)) != CRYPT_OK) { ------------------ | | 18| 14.1k|#define LTC_HMAC_BLOCKSIZE hash_descriptor[hash].blocksize ------------------ | Branch (81:9): [True: 0, False: 14.1k] ------------------ 82| 0| goto LBL_ERR; 83| 0| } 84| 14.1k| goto done; 85| 14.1k|LBL_ERR: 86| | /* free the key since we failed */ 87| 0| XFREE(hmac->key); ------------------ | | 17| 0|#define XFREE m_free_direct ------------------ 88| 14.1k|done: 89| |#ifdef LTC_CLEAN_STACK 90| | zeromem(buf, LTC_HMAC_BLOCKSIZE); 91| |#endif 92| | 93| 14.1k| return err; 94| 0|} hmac_process: 26| 28.2k|{ 27| 28.2k| int err; 28| 28.2k| LTC_ARGCHK(hmac != NULL); ------------------ | | 32| 28.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 28.2k] | | | Branch (32:87): [Folded, False: 28.2k] | | ------------------ ------------------ 29| 28.2k| LTC_ARGCHK(in != NULL); ------------------ | | 32| 28.2k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 28.2k] | | | Branch (32:87): [Folded, False: 28.2k] | | ------------------ ------------------ 30| 28.2k| if ((err = hash_is_valid(hmac->hash)) != CRYPT_OK) { ------------------ | Branch (30:9): [True: 0, False: 28.2k] ------------------ 31| 0| return err; 32| 0| } 33| 28.2k| return hash_descriptor[hmac->hash].process(&hmac->md, in, inlen); 34| 28.2k|} poly1305_init: 90| 3.51k|{ 91| 3.51k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 3.51k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.51k] | | | Branch (32:87): [Folded, False: 3.51k] | | ------------------ ------------------ 92| 3.51k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 3.51k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.51k] | | | Branch (32:87): [Folded, False: 3.51k] | | ------------------ ------------------ 93| 3.51k| LTC_ARGCHK(keylen == 32); ------------------ | | 32| 3.51k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.51k] | | | Branch (32:87): [Folded, False: 3.51k] | | ------------------ ------------------ 94| | 95| | /* r &= 0xffffffc0ffffffc0ffffffc0fffffff */ 96| 3.51k| LOAD32L(st->r[0], key + 0); st->r[0] = (st->r[0] ) & 0x3ffffff; ------------------ | | 167| 3.51k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 3.51k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 3.51k] | | ------------------ ------------------ 97| 3.51k| LOAD32L(st->r[1], key + 3); st->r[1] = (st->r[1] >> 2) & 0x3ffff03; ------------------ | | 167| 3.51k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 3.51k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 3.51k] | | ------------------ ------------------ 98| 3.51k| LOAD32L(st->r[2], key + 6); st->r[2] = (st->r[2] >> 4) & 0x3ffc0ff; ------------------ | | 167| 3.51k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 3.51k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 3.51k] | | ------------------ ------------------ 99| 3.51k| LOAD32L(st->r[3], key + 9); st->r[3] = (st->r[3] >> 6) & 0x3f03fff; ------------------ | | 167| 3.51k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 3.51k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 3.51k] | | ------------------ ------------------ 100| 3.51k| LOAD32L(st->r[4], key + 12); st->r[4] = (st->r[4] >> 8) & 0x00fffff; ------------------ | | 167| 3.51k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 3.51k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 3.51k] | | ------------------ ------------------ 101| | 102| | /* h = 0 */ 103| 3.51k| st->h[0] = 0; 104| 3.51k| st->h[1] = 0; 105| 3.51k| st->h[2] = 0; 106| 3.51k| st->h[3] = 0; 107| 3.51k| st->h[4] = 0; 108| | 109| | /* save pad for later */ 110| 3.51k| LOAD32L(st->pad[0], key + 16); ------------------ | | 167| 3.51k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 3.51k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 3.51k] | | ------------------ ------------------ 111| 3.51k| LOAD32L(st->pad[1], key + 20); ------------------ | | 167| 3.51k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 3.51k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 3.51k] | | ------------------ ------------------ 112| 3.51k| LOAD32L(st->pad[2], key + 24); ------------------ | | 167| 3.51k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 3.51k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 3.51k] | | ------------------ ------------------ 113| 3.51k| LOAD32L(st->pad[3], key + 28); ------------------ | | 167| 3.51k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 3.51k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 3.51k] | | ------------------ ------------------ 114| | 115| 3.51k| st->leftover = 0; 116| 3.51k| st->final = 0; 117| 3.51k| return CRYPT_OK; 118| 3.51k|} poly1305_process: 128| 3.51k|{ 129| 3.51k| unsigned long i; 130| | 131| 3.51k| if (inlen == 0) return CRYPT_OK; /* nothing to do */ ------------------ | Branch (131:8): [True: 0, False: 3.51k] ------------------ 132| 3.51k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 3.51k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.51k] | | | Branch (32:87): [Folded, False: 3.51k] | | ------------------ ------------------ 133| 3.51k| LTC_ARGCHK(in != NULL); ------------------ | | 32| 3.51k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.51k] | | | Branch (32:87): [Folded, False: 3.51k] | | ------------------ ------------------ 134| | 135| | /* handle leftover */ 136| 3.51k| if (st->leftover) { ------------------ | Branch (136:8): [True: 0, False: 3.51k] ------------------ 137| 0| unsigned long want = (16 - st->leftover); 138| 0| if (want > inlen) want = inlen; ------------------ | Branch (138:11): [True: 0, False: 0] ------------------ 139| 0| for (i = 0; i < want; i++) st->buffer[st->leftover + i] = in[i]; ------------------ | Branch (139:19): [True: 0, False: 0] ------------------ 140| 0| inlen -= want; 141| 0| in += want; 142| 0| st->leftover += want; 143| 0| if (st->leftover < 16) return CRYPT_OK; ------------------ | Branch (143:11): [True: 0, False: 0] ------------------ 144| 0| _poly1305_block(st, st->buffer, 16); 145| 0| st->leftover = 0; 146| 0| } 147| | 148| | /* process full blocks */ 149| 3.51k| if (inlen >= 16) { ------------------ | Branch (149:8): [True: 3.51k, False: 0] ------------------ 150| 3.51k| unsigned long want = (inlen & ~(16 - 1)); 151| 3.51k| _poly1305_block(st, in, want); 152| 3.51k| in += want; 153| 3.51k| inlen -= want; 154| 3.51k| } 155| | 156| | /* store leftover */ 157| 3.51k| if (inlen) { ------------------ | Branch (157:8): [True: 3.51k, False: 0] ------------------ 158| 17.9k| for (i = 0; i < inlen; i++) st->buffer[st->leftover + i] = in[i]; ------------------ | Branch (158:19): [True: 14.4k, False: 3.51k] ------------------ 159| 3.51k| st->leftover += inlen; 160| 3.51k| } 161| 3.51k| return CRYPT_OK; 162| 3.51k|} poly1305_done: 172| 3.51k|{ 173| 3.51k| ulong32 h0,h1,h2,h3,h4,c; 174| 3.51k| ulong32 g0,g1,g2,g3,g4; 175| 3.51k| ulong64 f; 176| 3.51k| ulong32 mask; 177| | 178| 3.51k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 3.51k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.51k] | | | Branch (32:87): [Folded, False: 3.51k] | | ------------------ ------------------ 179| 3.51k| LTC_ARGCHK(mac != NULL); ------------------ | | 32| 3.51k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.51k] | | | Branch (32:87): [Folded, False: 3.51k] | | ------------------ ------------------ 180| 3.51k| LTC_ARGCHK(maclen != NULL); ------------------ | | 32| 3.51k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.51k] | | | Branch (32:87): [Folded, False: 3.51k] | | ------------------ ------------------ 181| 3.51k| LTC_ARGCHK(*maclen >= 16); ------------------ | | 32| 3.51k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.51k] | | | Branch (32:87): [Folded, False: 3.51k] | | ------------------ ------------------ 182| | 183| | /* process the remaining block */ 184| 3.51k| if (st->leftover) { ------------------ | Branch (184:8): [True: 3.51k, False: 0] ------------------ 185| 3.51k| unsigned long i = st->leftover; 186| 3.51k| st->buffer[i++] = 1; 187| 41.7k| for (; i < 16; i++) st->buffer[i] = 0; ------------------ | Branch (187:14): [True: 38.2k, False: 3.51k] ------------------ 188| 3.51k| st->final = 1; 189| 3.51k| _poly1305_block(st, st->buffer, 16); 190| 3.51k| } 191| | 192| | /* fully carry h */ 193| 3.51k| h0 = st->h[0]; 194| 3.51k| h1 = st->h[1]; 195| 3.51k| h2 = st->h[2]; 196| 3.51k| h3 = st->h[3]; 197| 3.51k| h4 = st->h[4]; 198| | 199| 3.51k| c = h1 >> 26; h1 = h1 & 0x3ffffff; 200| 3.51k| h2 += c; c = h2 >> 26; h2 = h2 & 0x3ffffff; 201| 3.51k| h3 += c; c = h3 >> 26; h3 = h3 & 0x3ffffff; 202| 3.51k| h4 += c; c = h4 >> 26; h4 = h4 & 0x3ffffff; 203| 3.51k| h0 += c * 5; c = h0 >> 26; h0 = h0 & 0x3ffffff; 204| 3.51k| h1 += c; 205| | 206| | /* compute h + -p */ 207| 3.51k| g0 = h0 + 5; c = g0 >> 26; g0 &= 0x3ffffff; 208| 3.51k| g1 = h1 + c; c = g1 >> 26; g1 &= 0x3ffffff; 209| 3.51k| g2 = h2 + c; c = g2 >> 26; g2 &= 0x3ffffff; 210| 3.51k| g3 = h3 + c; c = g3 >> 26; g3 &= 0x3ffffff; 211| 3.51k| g4 = h4 + c - (1UL << 26); 212| | 213| | /* select h if h < p, or h + -p if h >= p */ 214| 3.51k| mask = (g4 >> 31) - 1; 215| 3.51k| g0 &= mask; 216| 3.51k| g1 &= mask; 217| 3.51k| g2 &= mask; 218| 3.51k| g3 &= mask; 219| 3.51k| g4 &= mask; 220| 3.51k| mask = ~mask; 221| 3.51k| h0 = (h0 & mask) | g0; 222| 3.51k| h1 = (h1 & mask) | g1; 223| 3.51k| h2 = (h2 & mask) | g2; 224| 3.51k| h3 = (h3 & mask) | g3; 225| 3.51k| h4 = (h4 & mask) | g4; 226| | 227| | /* h = h % (2^128) */ 228| 3.51k| h0 = ((h0 ) | (h1 << 26)) & 0xffffffff; 229| 3.51k| h1 = ((h1 >> 6) | (h2 << 20)) & 0xffffffff; 230| 3.51k| h2 = ((h2 >> 12) | (h3 << 14)) & 0xffffffff; 231| 3.51k| h3 = ((h3 >> 18) | (h4 << 8)) & 0xffffffff; 232| | 233| | /* mac = (h + pad) % (2^128) */ 234| 3.51k| f = (ulong64)h0 + st->pad[0] ; h0 = (ulong32)f; 235| 3.51k| f = (ulong64)h1 + st->pad[1] + (f >> 32); h1 = (ulong32)f; 236| 3.51k| f = (ulong64)h2 + st->pad[2] + (f >> 32); h2 = (ulong32)f; 237| 3.51k| f = (ulong64)h3 + st->pad[3] + (f >> 32); h3 = (ulong32)f; 238| | 239| 3.51k| STORE32L(h0, mac + 0); ------------------ | | 164| 3.51k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 3.51k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded, False: 3.51k] | | ------------------ ------------------ 240| 3.51k| STORE32L(h1, mac + 4); ------------------ | | 164| 3.51k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 3.51k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded, False: 3.51k] | | ------------------ ------------------ 241| 3.51k| STORE32L(h2, mac + 8); ------------------ | | 164| 3.51k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 3.51k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded, False: 3.51k] | | ------------------ ------------------ 242| 3.51k| STORE32L(h3, mac + 12); ------------------ | | 164| 3.51k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 3.51k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded, False: 3.51k] | | ------------------ ------------------ 243| | 244| | /* zero out the state */ 245| 3.51k| st->h[0] = 0; 246| 3.51k| st->h[1] = 0; 247| 3.51k| st->h[2] = 0; 248| 3.51k| st->h[3] = 0; 249| 3.51k| st->h[4] = 0; 250| 3.51k| st->r[0] = 0; 251| 3.51k| st->r[1] = 0; 252| 3.51k| st->r[2] = 0; 253| 3.51k| st->r[3] = 0; 254| 3.51k| st->r[4] = 0; 255| 3.51k| st->pad[0] = 0; 256| 3.51k| st->pad[1] = 0; 257| 3.51k| st->pad[2] = 0; 258| 3.51k| st->pad[3] = 0; 259| | 260| 3.51k| *maclen = 16; 261| 3.51k| return CRYPT_OK; 262| 3.51k|} poly1305.c:_poly1305_block: 21| 7.02k|{ 22| 7.02k| const unsigned long hibit = (st->final) ? 0 : (1UL << 24); /* 1 << 128 */ ------------------ | Branch (22:32): [True: 3.51k, False: 3.51k] ------------------ 23| 7.02k| ulong32 r0,r1,r2,r3,r4; 24| 7.02k| ulong32 s1,s2,s3,s4; 25| 7.02k| ulong32 h0,h1,h2,h3,h4; 26| 7.02k| ulong32 tmp; 27| 7.02k| ulong64 d0,d1,d2,d3,d4; 28| 7.02k| ulong32 c; 29| | 30| 7.02k| r0 = st->r[0]; 31| 7.02k| r1 = st->r[1]; 32| 7.02k| r2 = st->r[2]; 33| 7.02k| r3 = st->r[3]; 34| 7.02k| r4 = st->r[4]; 35| | 36| 7.02k| s1 = r1 * 5; 37| 7.02k| s2 = r2 * 5; 38| 7.02k| s3 = r3 * 5; 39| 7.02k| s4 = r4 * 5; 40| | 41| 7.02k| h0 = st->h[0]; 42| 7.02k| h1 = st->h[1]; 43| 7.02k| h2 = st->h[2]; 44| 7.02k| h3 = st->h[3]; 45| 7.02k| h4 = st->h[4]; 46| | 47| 30.5k| while (inlen >= 16) { ------------------ | Branch (47:11): [True: 23.4k, False: 7.02k] ------------------ 48| | /* h += in[i] */ 49| 23.4k| LOAD32L(tmp, in+ 0); h0 += (tmp ) & 0x3ffffff; ------------------ | | 167| 23.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 23.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 23.4k] | | ------------------ ------------------ 50| 23.4k| LOAD32L(tmp, in+ 3); h1 += (tmp >> 2) & 0x3ffffff; ------------------ | | 167| 23.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 23.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 23.4k] | | ------------------ ------------------ 51| 23.4k| LOAD32L(tmp, in+ 6); h2 += (tmp >> 4) & 0x3ffffff; ------------------ | | 167| 23.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 23.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 23.4k] | | ------------------ ------------------ 52| 23.4k| LOAD32L(tmp, in+ 9); h3 += (tmp >> 6) & 0x3ffffff; ------------------ | | 167| 23.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 23.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 23.4k] | | ------------------ ------------------ 53| 23.4k| LOAD32L(tmp, in+12); h4 += (tmp >> 8) | hibit; ------------------ | | 167| 23.4k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 23.4k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 23.4k] | | ------------------ ------------------ 54| | 55| | /* h *= r */ 56| 23.4k| d0 = ((ulong64)h0 * r0) + ((ulong64)h1 * s4) + ((ulong64)h2 * s3) + ((ulong64)h3 * s2) + ((ulong64)h4 * s1); 57| 23.4k| d1 = ((ulong64)h0 * r1) + ((ulong64)h1 * r0) + ((ulong64)h2 * s4) + ((ulong64)h3 * s3) + ((ulong64)h4 * s2); 58| 23.4k| d2 = ((ulong64)h0 * r2) + ((ulong64)h1 * r1) + ((ulong64)h2 * r0) + ((ulong64)h3 * s4) + ((ulong64)h4 * s3); 59| 23.4k| d3 = ((ulong64)h0 * r3) + ((ulong64)h1 * r2) + ((ulong64)h2 * r1) + ((ulong64)h3 * r0) + ((ulong64)h4 * s4); 60| 23.4k| d4 = ((ulong64)h0 * r4) + ((ulong64)h1 * r3) + ((ulong64)h2 * r2) + ((ulong64)h3 * r1) + ((ulong64)h4 * r0); 61| | 62| | /* (partial) h %= p */ 63| 23.4k| c = (ulong32)(d0 >> 26); h0 = (ulong32)d0 & 0x3ffffff; 64| 23.4k| d1 += c; c = (ulong32)(d1 >> 26); h1 = (ulong32)d1 & 0x3ffffff; 65| 23.4k| d2 += c; c = (ulong32)(d2 >> 26); h2 = (ulong32)d2 & 0x3ffffff; 66| 23.4k| d3 += c; c = (ulong32)(d3 >> 26); h3 = (ulong32)d3 & 0x3ffffff; 67| 23.4k| d4 += c; c = (ulong32)(d4 >> 26); h4 = (ulong32)d4 & 0x3ffffff; 68| 23.4k| h0 += c * 5; c = (h0 >> 26); h0 = h0 & 0x3ffffff; 69| 23.4k| h1 += c; 70| | 71| 23.4k| in += 16; 72| 23.4k| inlen -= 16; 73| 23.4k| } 74| | 75| 7.02k| st->h[0] = h0; 76| 7.02k| st->h[1] = h1; 77| 7.02k| st->h[2] = h2; 78| 7.02k| st->h[3] = h3; 79| 7.02k| st->h[4] = h4; 80| 7.02k|} cipher_is_valid: 22| 19.6k|{ 23| 19.6k| LTC_MUTEX_LOCK(<c_cipher_mutex); 24| 19.6k| if (idx < 0 || idx >= TAB_SIZE || cipher_descriptor[idx].name == NULL) { ------------------ | | 14| 39.2k|#define TAB_SIZE 5 ------------------ | Branch (24:8): [True: 0, False: 19.6k] | Branch (24:19): [True: 0, False: 19.6k] | Branch (24:38): [True: 0, False: 19.6k] ------------------ 25| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 26| 0| return CRYPT_INVALID_CIPHER; 27| 0| } 28| 19.6k| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 29| 19.6k| return CRYPT_OK; 30| 19.6k|} find_cipher: 22| 10.8k|{ 23| 10.8k| int x; 24| 10.8k| LTC_ARGCHK(name != NULL); ------------------ | | 32| 10.8k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 10.8k] | | | Branch (32:87): [Folded, False: 10.8k] | | ------------------ ------------------ 25| 10.8k| LTC_MUTEX_LOCK(<c_cipher_mutex); 26| 10.8k| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 10.8k|#define TAB_SIZE 5 ------------------ | Branch (26:16): [True: 10.8k, False: 0] ------------------ 27| 10.8k| if (cipher_descriptor[x].name != NULL && !XSTRCMP(cipher_descriptor[x].name, name)) { ------------------ | | 54| 10.8k|#define XSTRCMP strcmp ------------------ | Branch (27:12): [True: 10.8k, False: 0] | Branch (27:49): [True: 10.8k, False: 0] ------------------ 28| 10.8k| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 29| 10.8k| return x; 30| 10.8k| } 31| 10.8k| } 32| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 33| 0| return -1; 34| 10.8k|} find_hash: 22| 5.49k|{ 23| 5.49k| int x; 24| 5.49k| LTC_ARGCHK(name != NULL); ------------------ | | 32| 5.49k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 5.49k] | | | Branch (32:87): [Folded, False: 5.49k] | | ------------------ ------------------ 25| 5.49k| LTC_MUTEX_LOCK(<c_hash_mutex); 26| 5.49k| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 5.49k|#define TAB_SIZE 5 ------------------ | Branch (26:16): [True: 5.49k, False: 0] ------------------ 27| 5.49k| if (hash_descriptor[x].name != NULL && XSTRCMP(hash_descriptor[x].name, name) == 0) { ------------------ | | 54| 5.49k|#define XSTRCMP strcmp ------------------ | Branch (27:12): [True: 5.49k, False: 0] | Branch (27:47): [True: 5.49k, False: 0] ------------------ 28| 5.49k| LTC_MUTEX_UNLOCK(<c_hash_mutex); 29| 5.49k| return x; 30| 5.49k| } 31| 5.49k| } 32| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 33| 0| return -1; 34| 5.49k|} hash_is_valid: 22| 56.4k|{ 23| 56.4k| LTC_MUTEX_LOCK(<c_hash_mutex); 24| 56.4k| if (idx < 0 || idx >= TAB_SIZE || hash_descriptor[idx].name == NULL) { ------------------ | | 14| 112k|#define TAB_SIZE 5 ------------------ | Branch (24:8): [True: 0, False: 56.4k] | Branch (24:19): [True: 0, False: 56.4k] | Branch (24:38): [True: 0, False: 56.4k] ------------------ 25| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 26| 0| return CRYPT_INVALID_HASH; 27| 0| } 28| 56.4k| LTC_MUTEX_UNLOCK(<c_hash_mutex); 29| 56.4k| return CRYPT_OK; 30| 56.4k|} register_cipher: 22| 1|{ 23| 1| int x; 24| | 25| 1| LTC_ARGCHK(cipher != NULL); ------------------ | | 32| 1|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1] | | | Branch (32:87): [Folded, False: 1] | | ------------------ ------------------ 26| | 27| | /* is it already registered? */ 28| 1| LTC_MUTEX_LOCK(<c_cipher_mutex); 29| 6| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 6|#define TAB_SIZE 5 ------------------ | Branch (29:16): [True: 5, False: 1] ------------------ 30| 5| if (cipher_descriptor[x].name != NULL && cipher_descriptor[x].ID == cipher->ID) { ------------------ | Branch (30:12): [True: 0, False: 5] | Branch (30:49): [True: 0, False: 0] ------------------ 31| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 32| 0| return x; 33| 0| } 34| 5| } 35| | 36| | /* find a blank spot */ 37| 1| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 1|#define TAB_SIZE 5 ------------------ | Branch (37:16): [True: 1, False: 0] ------------------ 38| 1| if (cipher_descriptor[x].name == NULL) { ------------------ | Branch (38:12): [True: 1, False: 0] ------------------ 39| 1| XMEMCPY(&cipher_descriptor[x], cipher, sizeof(struct ltc_cipher_descriptor)); ------------------ | | 39| 1|#define XMEMCPY memcpy ------------------ 40| 1| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 41| 1| return x; 42| 1| } 43| 1| } 44| | 45| | /* no spot */ 46| 0| LTC_MUTEX_UNLOCK(<c_cipher_mutex); 47| 0| return -1; 48| 1|} register_hash: 22| 3|{ 23| 3| int x; 24| | 25| 3| LTC_ARGCHK(hash != NULL); ------------------ | | 32| 3|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3] | | | Branch (32:87): [Folded, False: 3] | | ------------------ ------------------ 26| | 27| | /* is it already registered? */ 28| 3| LTC_MUTEX_LOCK(<c_hash_mutex); 29| 18| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 18|#define TAB_SIZE 5 ------------------ | Branch (29:16): [True: 15, False: 3] ------------------ 30| 15| if (XMEMCMP(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)) == 0) { ------------------ | | 45| 15|#define XMEMCMP memcmp ------------------ | Branch (30:12): [True: 0, False: 15] ------------------ 31| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 32| 0| return x; 33| 0| } 34| 15| } 35| | 36| | /* find a blank spot */ 37| 6| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 6|#define TAB_SIZE 5 ------------------ | Branch (37:16): [True: 6, False: 0] ------------------ 38| 6| if (hash_descriptor[x].name == NULL) { ------------------ | Branch (38:12): [True: 3, False: 3] ------------------ 39| 3| XMEMCPY(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)); ------------------ | | 39| 3|#define XMEMCPY memcpy ------------------ 40| 3| LTC_MUTEX_UNLOCK(<c_hash_mutex); 41| 3| return x; 42| 3| } 43| 6| } 44| | 45| | /* no spot */ 46| 0| LTC_MUTEX_UNLOCK(<c_hash_mutex); 47| 0| return -1; 48| 3|} register_prng: 22| 1|{ 23| 1| int x; 24| | 25| 1| LTC_ARGCHK(prng != NULL); ------------------ | | 32| 1|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1] | | | Branch (32:87): [Folded, False: 1] | | ------------------ ------------------ 26| | 27| | /* is it already registered? */ 28| 1| LTC_MUTEX_LOCK(<c_prng_mutex); 29| 6| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 6|#define TAB_SIZE 5 ------------------ | Branch (29:16): [True: 5, False: 1] ------------------ 30| 5| if (XMEMCMP(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)) == 0) { ------------------ | | 45| 5|#define XMEMCMP memcmp ------------------ | Branch (30:12): [True: 0, False: 5] ------------------ 31| 0| LTC_MUTEX_UNLOCK(<c_prng_mutex); 32| 0| return x; 33| 0| } 34| 5| } 35| | 36| | /* find a blank spot */ 37| 1| for (x = 0; x < TAB_SIZE; x++) { ------------------ | | 14| 1|#define TAB_SIZE 5 ------------------ | Branch (37:16): [True: 1, False: 0] ------------------ 38| 1| if (prng_descriptor[x].name == NULL) { ------------------ | Branch (38:12): [True: 1, False: 0] ------------------ 39| 1| XMEMCPY(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)); ------------------ | | 39| 1|#define XMEMCPY memcpy ------------------ 40| 1| LTC_MUTEX_UNLOCK(<c_prng_mutex); 41| 1| return x; 42| 1| } 43| 1| } 44| | 45| | /* no spot */ 46| 0| LTC_MUTEX_UNLOCK(<c_prng_mutex); 47| 0| return -1; 48| 1|} zeromem: 23| 14.1k|{ 24| 14.1k| m_burn((void*)out, outlen); 25| 14.1k|} ctr_encrypt: 87| 14.1k|{ 88| 14.1k| int err, fr; 89| | 90| 14.1k| LTC_ARGCHK(pt != NULL); ------------------ | | 32| 14.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 14.1k] | | | Branch (32:87): [Folded, False: 14.1k] | | ------------------ ------------------ 91| 14.1k| LTC_ARGCHK(ct != NULL); ------------------ | | 32| 14.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 14.1k] | | | Branch (32:87): [Folded, False: 14.1k] | | ------------------ ------------------ 92| 14.1k| LTC_ARGCHK(ctr != NULL); ------------------ | | 32| 14.1k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 14.1k] | | | Branch (32:87): [Folded, False: 14.1k] | | ------------------ ------------------ 93| | 94| 14.1k| if ((err = cipher_is_valid(ctr->cipher)) != CRYPT_OK) { ------------------ | Branch (94:8): [True: 0, False: 14.1k] ------------------ 95| 0| return err; 96| 0| } 97| | 98| | /* is blocklen/padlen valid? */ 99| 14.1k| if ((ctr->blocklen < 1) || (ctr->blocklen > (int)sizeof(ctr->ctr)) || ------------------ | Branch (99:8): [True: 0, False: 14.1k] | Branch (99:31): [True: 0, False: 14.1k] ------------------ 100| 14.1k| (ctr->padlen < 0) || (ctr->padlen > (int)sizeof(ctr->pad))) { ------------------ | Branch (100:8): [True: 0, False: 14.1k] | Branch (100:31): [True: 0, False: 14.1k] ------------------ 101| 0| return CRYPT_INVALID_ARG; 102| 0| } 103| | 104| 14.1k|#ifdef LTC_FAST 105| 14.1k| if (ctr->blocklen % sizeof(LTC_FAST_TYPE)) { ------------------ | Branch (105:8): [True: 0, False: 14.1k] ------------------ 106| 0| return CRYPT_INVALID_ARG; 107| 0| } 108| 14.1k|#endif 109| | 110| | /* handle acceleration only if pad is empty, accelerator is present and length is >= a block size */ 111| 14.1k| if ((cipher_descriptor[ctr->cipher].accel_ctr_encrypt != NULL) && (len >= (unsigned long)ctr->blocklen)) { ------------------ | Branch (111:8): [True: 0, False: 14.1k] | Branch (111:70): [True: 0, False: 0] ------------------ 112| 0| if (ctr->padlen < ctr->blocklen) { ------------------ | Branch (112:10): [True: 0, False: 0] ------------------ 113| 0| fr = ctr->blocklen - ctr->padlen; 114| 0| if ((err = _ctr_encrypt(pt, ct, fr, ctr)) != CRYPT_OK) { ------------------ | Branch (114:12): [True: 0, False: 0] ------------------ 115| 0| return err; 116| 0| } 117| 0| pt += fr; 118| 0| ct += fr; 119| 0| len -= fr; 120| 0| } 121| | 122| 0| if (len >= (unsigned long)ctr->blocklen) { ------------------ | Branch (122:10): [True: 0, False: 0] ------------------ 123| 0| if ((err = cipher_descriptor[ctr->cipher].accel_ctr_encrypt(pt, ct, len/ctr->blocklen, ctr->ctr, ctr->mode, &ctr->key)) != CRYPT_OK) { ------------------ | Branch (123:12): [True: 0, False: 0] ------------------ 124| 0| return err; 125| 0| } 126| 0| pt += (len / ctr->blocklen) * ctr->blocklen; 127| 0| ct += (len / ctr->blocklen) * ctr->blocklen; 128| 0| len %= ctr->blocklen; 129| 0| } 130| 0| } 131| | 132| 14.1k| return _ctr_encrypt(pt, ct, len, ctr); 133| 14.1k|} ctr_encrypt.c:_ctr_encrypt: 28| 14.1k|{ 29| 14.1k| int x, err; 30| | 31| 159k| while (len) { ------------------ | Branch (31:11): [True: 145k, False: 14.1k] ------------------ 32| | /* is the pad empty? */ 33| 145k| if (ctr->padlen == ctr->blocklen) { ------------------ | Branch (33:11): [True: 140k, False: 4.81k] ------------------ 34| | /* increment counter */ 35| 140k| if (ctr->mode == CTR_COUNTER_LITTLE_ENDIAN) { ------------------ | | 859| 140k|#define CTR_COUNTER_LITTLE_ENDIAN 0x0000 ------------------ | Branch (35:14): [True: 0, False: 140k] ------------------ 36| | /* little-endian */ 37| 0| for (x = 0; x < ctr->ctrlen; x++) { ------------------ | Branch (37:25): [True: 0, False: 0] ------------------ 38| 0| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 39| 0| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (39:20): [True: 0, False: 0] ------------------ 40| 0| break; 41| 0| } 42| 0| } 43| 140k| } else { 44| | /* big-endian */ 45| 141k| for (x = ctr->blocklen-1; x >= ctr->ctrlen; x--) { ------------------ | Branch (45:39): [True: 141k, False: 0] ------------------ 46| 141k| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 47| 141k| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (47:20): [True: 140k, False: 545] ------------------ 48| 140k| break; 49| 140k| } 50| 141k| } 51| 140k| } 52| | 53| | /* encrypt it */ 54| 140k| if ((err = cipher_descriptor[ctr->cipher].ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key)) != CRYPT_OK) { ------------------ | Branch (54:14): [True: 0, False: 140k] ------------------ 55| 0| return err; 56| 0| } 57| 140k| ctr->padlen = 0; 58| 140k| } 59| 145k|#ifdef LTC_FAST 60| 145k| if ((ctr->padlen == 0) && (len >= (unsigned long)ctr->blocklen)) { ------------------ | Branch (60:11): [True: 145k, False: 0] | Branch (60:33): [True: 145k, False: 0] ------------------ 61| 436k| for (x = 0; x < ctr->blocklen; x += sizeof(LTC_FAST_TYPE)) { ------------------ | Branch (61:22): [True: 290k, False: 145k] ------------------ 62| 290k| *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ct + x)) = *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)pt + x)) ^ ------------------ | | 244| 290k| #define LTC_FAST_TYPE_PTR_CAST(x) ((LTC_FAST_TYPE*)(void*)(x)) ------------------ *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ct + x)) = *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)pt + x)) ^ ------------------ | | 244| 290k| #define LTC_FAST_TYPE_PTR_CAST(x) ((LTC_FAST_TYPE*)(void*)(x)) ------------------ 63| 290k| *(LTC_FAST_TYPE_PTR_CAST((unsigned char *)ctr->pad + x)); ------------------ | | 244| 290k| #define LTC_FAST_TYPE_PTR_CAST(x) ((LTC_FAST_TYPE*)(void*)(x)) ------------------ 64| 290k| } 65| 145k| pt += ctr->blocklen; 66| 145k| ct += ctr->blocklen; 67| 145k| len -= ctr->blocklen; 68| 145k| ctr->padlen = ctr->blocklen; 69| 145k| continue; 70| 145k| } 71| 0|#endif 72| 0| *ct++ = *pt++ ^ ctr->pad[ctr->padlen++]; 73| 0| --len; 74| 0| } 75| 14.1k| return CRYPT_OK; 76| 14.1k|} ctr_start: 35| 5.49k|{ 36| 5.49k| int x, err; 37| | 38| 5.49k| LTC_ARGCHK(IV != NULL); ------------------ | | 32| 5.49k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 5.49k] | | | Branch (32:87): [Folded, False: 5.49k] | | ------------------ ------------------ 39| 5.49k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 5.49k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 5.49k] | | | Branch (32:87): [Folded, False: 5.49k] | | ------------------ ------------------ 40| 5.49k| LTC_ARGCHK(ctr != NULL); ------------------ | | 32| 5.49k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 5.49k] | | | Branch (32:87): [Folded, False: 5.49k] | | ------------------ ------------------ 41| | 42| | /* bad param? */ 43| 5.49k| if ((err = cipher_is_valid(cipher)) != CRYPT_OK) { ------------------ | Branch (43:8): [True: 0, False: 5.49k] ------------------ 44| 0| return err; 45| 0| } 46| | 47| | /* ctrlen == counter width */ 48| 5.49k| ctr->ctrlen = (ctr_mode & 255) ? (ctr_mode & 255) : cipher_descriptor[cipher].block_length; ------------------ | Branch (48:20): [True: 0, False: 5.49k] ------------------ 49| 5.49k| if (ctr->ctrlen > cipher_descriptor[cipher].block_length) { ------------------ | Branch (49:8): [True: 0, False: 5.49k] ------------------ 50| 0| return CRYPT_INVALID_ARG; 51| 0| } 52| | 53| 5.49k| if ((ctr_mode & 0x1000) == CTR_COUNTER_BIG_ENDIAN) { ------------------ | | 860| 5.49k|#define CTR_COUNTER_BIG_ENDIAN 0x1000 ------------------ | Branch (53:8): [True: 5.49k, False: 0] ------------------ 54| 5.49k| ctr->ctrlen = cipher_descriptor[cipher].block_length - ctr->ctrlen; 55| 5.49k| } 56| | 57| | /* setup cipher */ 58| 5.49k| if ((err = cipher_descriptor[cipher].setup(key, keylen, num_rounds, &ctr->key)) != CRYPT_OK) { ------------------ | Branch (58:8): [True: 0, False: 5.49k] ------------------ 59| 0| return err; 60| 0| } 61| | 62| | /* copy ctr */ 63| 5.49k| ctr->blocklen = cipher_descriptor[cipher].block_length; 64| 5.49k| ctr->cipher = cipher; 65| 5.49k| ctr->padlen = 0; 66| 5.49k| ctr->mode = ctr_mode & 0x1000; 67| 93.3k| for (x = 0; x < ctr->blocklen; x++) { ------------------ | Branch (67:16): [True: 87.9k, False: 5.49k] ------------------ 68| 87.9k| ctr->ctr[x] = IV[x]; 69| 87.9k| } 70| | 71| 5.49k| if (ctr_mode & LTC_CTR_RFC3686) { ------------------ | | 861| 5.49k|#define LTC_CTR_RFC3686 0x2000 ------------------ | Branch (71:8): [True: 0, False: 5.49k] ------------------ 72| | /* increment the IV as per RFC 3686 */ 73| 0| if (ctr->mode == CTR_COUNTER_LITTLE_ENDIAN) { ------------------ | | 859| 0|#define CTR_COUNTER_LITTLE_ENDIAN 0x0000 ------------------ | Branch (73:11): [True: 0, False: 0] ------------------ 74| | /* little-endian */ 75| 0| for (x = 0; x < ctr->ctrlen; x++) { ------------------ | Branch (75:22): [True: 0, False: 0] ------------------ 76| 0| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 77| 0| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (77:18): [True: 0, False: 0] ------------------ 78| 0| break; 79| 0| } 80| 0| } 81| 0| } else { 82| | /* big-endian */ 83| 0| for (x = ctr->blocklen-1; x >= ctr->ctrlen; x--) { ------------------ | Branch (83:36): [True: 0, False: 0] ------------------ 84| 0| ctr->ctr[x] = (ctr->ctr[x] + (unsigned char)1) & (unsigned char)255; 85| 0| if (ctr->ctr[x] != (unsigned char)0) { ------------------ | Branch (85:18): [True: 0, False: 0] ------------------ 86| 0| break; 87| 0| } 88| 0| } 89| 0| } 90| 0| } 91| | 92| 5.49k| return cipher_descriptor[ctr->cipher].ecb_encrypt(ctr->ctr, ctr->pad, &ctr->key); 93| 5.49k|} chacha_crypt: 55| 10.5k|{ 56| 10.5k| unsigned char buf[64]; 57| 10.5k| unsigned long i, j; 58| | 59| 10.5k| if (inlen == 0) return CRYPT_OK; /* nothing to do */ ------------------ | Branch (59:8): [True: 0, False: 10.5k] ------------------ 60| | 61| 10.5k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 10.5k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 10.5k] | | | Branch (32:87): [Folded, False: 10.5k] | | ------------------ ------------------ 62| 10.5k| LTC_ARGCHK(in != NULL); ------------------ | | 32| 10.5k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 10.5k] | | | Branch (32:87): [Folded, False: 10.5k] | | ------------------ ------------------ 63| 10.5k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 10.5k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 10.5k] | | | Branch (32:87): [Folded, False: 10.5k] | | ------------------ ------------------ 64| 10.5k| LTC_ARGCHK(st->ivlen != 0); ------------------ | | 32| 10.5k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 10.5k] | | | Branch (32:87): [Folded, False: 10.5k] | | ------------------ ------------------ 65| | 66| 10.5k| if (st->ksleft > 0) { ------------------ | Branch (66:8): [True: 0, False: 10.5k] ------------------ 67| 0| j = MIN(st->ksleft, inlen); ------------------ | | 425| 0| #define MIN(x, y) ( ((x)<(y))?(x):(y) ) | | ------------------ | | | Branch (425:24): [True: 0, False: 0] | | ------------------ ------------------ 68| 0| for (i = 0; i < j; ++i, st->ksleft--) out[i] = in[i] ^ st->kstream[64 - st->ksleft]; ------------------ | Branch (68:19): [True: 0, False: 0] ------------------ 69| 0| inlen -= j; 70| 0| if (inlen == 0) return CRYPT_OK; ------------------ | Branch (70:11): [True: 0, False: 0] ------------------ 71| 0| out += j; 72| 0| in += j; 73| 0| } 74| 14.5k| for (;;) { 75| 14.5k| _chacha_block(buf, st->input, st->rounds); 76| 14.5k| if (st->ivlen == 8) { ------------------ | Branch (76:10): [True: 14.5k, False: 0] ------------------ 77| | /* IV-64bit, increment 64bit counter */ 78| 14.5k| if (0 == ++st->input[12] && 0 == ++st->input[13]) return CRYPT_OVERFLOW; ------------------ | Branch (78:12): [True: 0, False: 14.5k] | Branch (78:36): [True: 0, False: 0] ------------------ 79| 14.5k| } 80| 0| else { 81| | /* IV-96bit, increment 32bit counter */ 82| 0| if (0 == ++st->input[12]) return CRYPT_OVERFLOW; ------------------ | Branch (82:12): [True: 0, False: 0] ------------------ 83| 0| } 84| 14.5k| if (inlen <= 64) { ------------------ | Branch (84:10): [True: 10.5k, False: 3.98k] ------------------ 85| 201k| for (i = 0; i < inlen; ++i) out[i] = in[i] ^ buf[i]; ------------------ | Branch (85:20): [True: 191k, False: 10.5k] ------------------ 86| 10.5k| st->ksleft = 64 - inlen; 87| 493k| for (i = inlen; i < 64; ++i) st->kstream[i] = buf[i]; ------------------ | Branch (87:24): [True: 482k, False: 10.5k] ------------------ 88| 10.5k| return CRYPT_OK; 89| 10.5k| } 90| 259k| for (i = 0; i < 64; ++i) out[i] = in[i] ^ buf[i]; ------------------ | Branch (90:18): [True: 255k, False: 3.98k] ------------------ 91| 3.98k| inlen -= 64; 92| 3.98k| out += 64; 93| 3.98k| in += 64; 94| 3.98k| } 95| 10.5k|} chacha_crypt.c:_chacha_block: 26| 14.5k|{ 27| 14.5k| ulong32 x[16]; 28| 14.5k| int i; 29| 14.5k| XMEMCPY(x, input, sizeof(x)); ------------------ | | 39| 14.5k|#define XMEMCPY memcpy ------------------ 30| 159k| for (i = rounds; i > 0; i -= 2) { ------------------ | Branch (30:21): [True: 145k, False: 14.5k] ------------------ 31| 145k| QUARTERROUND(0, 4, 8,12) ------------------ | | 20| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 32| 145k| QUARTERROUND(1, 5, 9,13) ------------------ | | 20| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 33| 145k| QUARTERROUND(2, 6,10,14) ------------------ | | 20| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 34| 145k| QUARTERROUND(3, 7,11,15) ------------------ | | 20| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 35| 145k| QUARTERROUND(0, 5,10,15) ------------------ | | 20| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 36| 145k| QUARTERROUND(1, 6,11,12) ------------------ | | 20| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 37| 145k| QUARTERROUND(2, 7, 8,13) ------------------ | | 20| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 38| 145k| QUARTERROUND(3, 4, 9,14) ------------------ | | 20| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 16); \ | | 21| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 12); \ | | 22| 145k| x[a] += x[b]; x[d] = ROL(x[d] ^ x[a], 8); \ | | 23| 145k| x[c] += x[d]; x[b] = ROL(x[b] ^ x[c], 7); ------------------ 39| 145k| } 40| 246k| for (i = 0; i < 16; ++i) { ------------------ | Branch (40:16): [True: 232k, False: 14.5k] ------------------ 41| 232k| x[i] += input[i]; 42| 232k| STORE32L(x[i], output + 4 * i); ------------------ | | 164| 232k| do { ulong32 __t = (x); XMEMCPY(y, &__t, 4); } while(0) | | ------------------ | | | | 39| 232k|#define XMEMCPY memcpy | | ------------------ | | | Branch (164:56): [Folded, False: 232k] | | ------------------ ------------------ 43| 232k| } 44| 14.5k|} chacha_ivctr64: 28| 10.5k|{ 29| 10.5k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 10.5k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 10.5k] | | | Branch (32:87): [Folded, False: 10.5k] | | ------------------ ------------------ 30| 10.5k| LTC_ARGCHK(iv != NULL); ------------------ | | 32| 10.5k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 10.5k] | | | Branch (32:87): [Folded, False: 10.5k] | | ------------------ ------------------ 31| | /* 64bit IV + 64bit counter */ 32| 10.5k| LTC_ARGCHK(ivlen == 8); ------------------ | | 32| 10.5k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 10.5k] | | | Branch (32:87): [Folded, False: 10.5k] | | ------------------ ------------------ 33| | 34| 10.5k| st->input[12] = (ulong32)(counter & 0xFFFFFFFF); 35| 10.5k| st->input[13] = (ulong32)(counter >> 32); 36| 10.5k| LOAD32L(st->input[14], iv + 0); ------------------ | | 167| 10.5k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 10.5k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 10.5k] | | ------------------ ------------------ 37| 10.5k| LOAD32L(st->input[15], iv + 4); ------------------ | | 167| 10.5k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 10.5k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 10.5k] | | ------------------ ------------------ 38| 10.5k| st->ksleft = 0; 39| 10.5k| st->ivlen = ivlen; 40| 10.5k| return CRYPT_OK; 41| 10.5k|} chacha_keystream: 27| 3.51k|{ 28| 3.51k| if (outlen == 0) return CRYPT_OK; /* nothing to do */ ------------------ | Branch (28:8): [True: 0, False: 3.51k] ------------------ 29| 3.51k| LTC_ARGCHK(out != NULL); ------------------ | | 32| 3.51k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 3.51k] | | | Branch (32:87): [Folded, False: 3.51k] | | ------------------ ------------------ 30| 3.51k| XMEMSET(out, 0, outlen); ------------------ | | 36| 3.51k|#define XMEMSET memset ------------------ 31| 3.51k| return chacha_crypt(st, out, outlen, out); 32| 3.51k|} chacha_setup: 31| 1.35k|{ 32| 1.35k| const char *constants; 33| | 34| 1.35k| LTC_ARGCHK(st != NULL); ------------------ | | 32| 1.35k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.35k] | | | Branch (32:87): [Folded, False: 1.35k] | | ------------------ ------------------ 35| 1.35k| LTC_ARGCHK(key != NULL); ------------------ | | 32| 1.35k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:32): [True: 0, False: 1.35k] | | | Branch (32:87): [Folded, False: 1.35k] | | ------------------ ------------------ 36| 1.35k| LTC_ARGCHK(keylen == 32 || keylen == 16); ------------------ | | 32| 1.35k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0) | | ------------------ | | | Branch (32:34): [True: 1.35k, False: 0] | | | Branch (32:34): [True: 0, False: 0] | | | Branch (32:87): [Folded, False: 1.35k] | | ------------------ ------------------ 37| | 38| 1.35k| if (rounds == 0) rounds = 20; ------------------ | Branch (38:8): [True: 0, False: 1.35k] ------------------ 39| | 40| 1.35k| LOAD32L(st->input[4], key + 0); ------------------ | | 167| 1.35k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 1.35k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 1.35k] | | ------------------ ------------------ 41| 1.35k| LOAD32L(st->input[5], key + 4); ------------------ | | 167| 1.35k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 1.35k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 1.35k] | | ------------------ ------------------ 42| 1.35k| LOAD32L(st->input[6], key + 8); ------------------ | | 167| 1.35k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 1.35k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 1.35k] | | ------------------ ------------------ 43| 1.35k| LOAD32L(st->input[7], key + 12); ------------------ | | 167| 1.35k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 1.35k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 1.35k] | | ------------------ ------------------ 44| 1.35k| if (keylen == 32) { /* 256bit */ ------------------ | Branch (44:8): [True: 1.35k, False: 0] ------------------ 45| 1.35k| key += 16; 46| 1.35k| constants = sigma; 47| 1.35k| } else { /* 128bit */ 48| 0| constants = tau; 49| 0| } 50| 1.35k| LOAD32L(st->input[8], key + 0); ------------------ | | 167| 1.35k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 1.35k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 1.35k] | | ------------------ ------------------ 51| 1.35k| LOAD32L(st->input[9], key + 4); ------------------ | | 167| 1.35k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 1.35k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 1.35k] | | ------------------ ------------------ 52| 1.35k| LOAD32L(st->input[10], key + 8); ------------------ | | 167| 1.35k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 1.35k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 1.35k] | | ------------------ ------------------ 53| 1.35k| LOAD32L(st->input[11], key + 12); ------------------ | | 167| 1.35k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 1.35k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 1.35k] | | ------------------ ------------------ 54| 1.35k| LOAD32L(st->input[0], constants + 0); ------------------ | | 167| 1.35k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 1.35k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 1.35k] | | ------------------ ------------------ 55| 1.35k| LOAD32L(st->input[1], constants + 4); ------------------ | | 167| 1.35k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 1.35k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 1.35k] | | ------------------ ------------------ 56| 1.35k| LOAD32L(st->input[2], constants + 8); ------------------ | | 167| 1.35k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 1.35k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 1.35k] | | ------------------ ------------------ 57| 1.35k| LOAD32L(st->input[3], constants + 12); ------------------ | | 167| 1.35k| do { XMEMCPY(&(x), y, 4); x &= 0xFFFFFFFF; } while(0) | | ------------------ | | | | 39| 1.35k|#define XMEMCPY memcpy | | ------------------ | | | Branch (167:54): [Folded, False: 1.35k] | | ------------------ ------------------ 58| 1.35k| st->rounds = rounds; /* e.g. 20 for chacha20 */ 59| 1.35k| st->ivlen = 0; /* will be set later by chacha_ivctr(32|64) */ 60| 1.35k| return CRYPT_OK; 61| 1.35k|} mp_add: 8| 3|{ 9| 3| mp_sign sa, sb; 10| 3| mp_err err; 11| | 12| | /* get sign of both inputs */ 13| 3| sa = a->sign; 14| 3| sb = b->sign; 15| | 16| | /* handle two cases, not four */ 17| 3| if (sa == sb) { ------------------ | Branch (17:8): [True: 3, False: 0] ------------------ 18| | /* both positive or both negative */ 19| | /* add their magnitudes, copy the sign */ 20| 3| c->sign = sa; 21| 3| err = s_mp_add(a, b, c); 22| 3| } else { 23| | /* one positive, the other negative */ 24| | /* subtract the one with the greater magnitude from */ 25| | /* the one of the lesser magnitude. The result gets */ 26| | /* the sign of the one with the greater magnitude. */ 27| 0| if (mp_cmp_mag(a, b) == MP_LT) { ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ | Branch (27:11): [True: 0, False: 0] ------------------ 28| 0| c->sign = sb; 29| 0| err = s_mp_sub(b, a, c); 30| 0| } else { 31| 0| c->sign = sa; 32| 0| err = s_mp_sub(a, b, c); 33| 0| } 34| 0| } 35| 3| return err; 36| 3|} mp_add_d: 8| 128|{ 9| 128| mp_err err; 10| 128| int ix, oldused; 11| 128| mp_digit *tmpa, *tmpc; 12| | 13| | /* grow c as required */ 14| 128| if (c->alloc < (a->used + 1)) { ------------------ | Branch (14:8): [True: 0, False: 128] ------------------ 15| 0| if ((err = mp_grow(c, a->used + 1)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (15:11): [True: 0, False: 0] ------------------ 16| 0| return err; 17| 0| } 18| 0| } 19| | 20| | /* if a is negative and |a| >= b, call c = |a| - b */ 21| 128| if ((a->sign == MP_NEG) && ((a->used > 1) || (a->dp[0] >= b))) { ------------------ | | 152| 128|#define MP_NEG 1 /* negative */ ------------------ | Branch (21:8): [True: 0, False: 128] | Branch (21:32): [True: 0, False: 0] | Branch (21:49): [True: 0, False: 0] ------------------ 22| 0| mp_int a_ = *a; 23| | /* temporarily fix sign of a */ 24| 0| a_.sign = MP_ZPOS; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ 25| | 26| | /* c = |a| - b */ 27| 0| err = mp_sub_d(&a_, b, c); 28| | 29| | /* fix sign */ 30| 0| c->sign = MP_NEG; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ 31| | 32| | /* clamp */ 33| 0| mp_clamp(c); 34| | 35| 0| return err; 36| 0| } 37| | 38| | /* old number of used digits in c */ 39| 128| oldused = c->used; 40| | 41| | /* source alias */ 42| 128| tmpa = a->dp; 43| | 44| | /* destination alias */ 45| 128| tmpc = c->dp; 46| | 47| | /* if a is positive */ 48| 128| if (a->sign == MP_ZPOS) { ------------------ | | 151| 128|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (48:8): [True: 128, False: 0] ------------------ 49| | /* add digits, mu is carry */ 50| 128| mp_digit mu = b; 51| 466| for (ix = 0; ix < a->used; ix++) { ------------------ | Branch (51:20): [True: 338, False: 128] ------------------ 52| 338| *tmpc = *tmpa++ + mu; 53| 338| mu = *tmpc >> MP_DIGIT_BIT; ------------------ | | 82| 338|# define MP_DIGIT_BIT 60 ------------------ 54| 338| *tmpc++ &= MP_MASK; ------------------ | | 106| 338|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 338|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 55| 338| } 56| | /* set final carry */ 57| 128| ix++; 58| 128| *tmpc++ = mu; 59| | 60| | /* setup size */ 61| 128| c->used = a->used + 1; 62| 128| } else { 63| | /* a was negative and |a| < b */ 64| 0| c->used = 1; 65| | 66| | /* the result is a single digit */ 67| 0| if (a->used == 1) { ------------------ | Branch (67:11): [True: 0, False: 0] ------------------ 68| 0| *tmpc++ = b - a->dp[0]; 69| 0| } else { 70| 0| *tmpc++ = b; 71| 0| } 72| | 73| | /* setup count so the clearing of oldused 74| | * can fall through correctly 75| | */ 76| 0| ix = 1; 77| 0| } 78| | 79| | /* sign always positive */ 80| 128| c->sign = MP_ZPOS; ------------------ | | 151| 128|#define MP_ZPOS 0 /* positive integer */ ------------------ 81| | 82| | /* now zero to oldused */ 83| 128| MP_ZERO_DIGITS(tmpc, oldused - ix); ------------------ | | 89| 128|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 128|do { \ | | 91| 128| int zd_ = (digits); \ | | 92| 128| mp_digit* zm_ = (mem); \ | | 93| 128| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 128] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 128|} while (0) | | ------------------ | | | Branch (96:10): [Folded, False: 128] | | ------------------ ------------------ 84| 128| mp_clamp(c); 85| | 86| 128| return MP_OKAY; ------------------ | | 161| 128|#define MP_OKAY 0 /* no error */ ------------------ 87| 128|} mp_clamp: 14| 35.7k|{ 15| | /* decrease used while the most significant digit is 16| | * zero. 17| | */ 18| 56.7k| while ((a->used > 0) && (a->dp[a->used - 1] == 0u)) { ------------------ | Branch (18:11): [True: 50.1k, False: 6.60k] | Branch (18:28): [True: 20.9k, False: 29.1k] ------------------ 19| 20.9k| --(a->used); 20| 20.9k| } 21| | 22| | /* reset the sign flag if used == 0 */ 23| 35.7k| if (a->used == 0) { ------------------ | Branch (23:8): [True: 6.60k, False: 29.1k] ------------------ 24| 6.60k| a->sign = MP_ZPOS; ------------------ | | 151| 6.60k|#define MP_ZPOS 0 /* positive integer */ ------------------ 25| 6.60k| } 26| 35.7k|} mp_clear: 8| 18.5k|{ 9| | /* only do anything if a hasn't been freed previously */ 10| 18.5k| if (a->dp != NULL) { ------------------ | Branch (10:8): [True: 13.9k, False: 4.54k] ------------------ 11| | /* free ram */ 12| 13.9k| MP_FREE_DIGITS(a->dp, a->alloc); ------------------ | | 58| 13.9k|# define MP_FREE_DIGITS(mem, digits) \ | | 59| 13.9k|do { \ | | 60| 13.9k| int fd_ = (digits); \ | | 61| 13.9k| void* fm_ = (mem); \ | | 62| 13.9k| if (fm_ != NULL) { \ | | ------------------ | | | Branch (62:8): [True: 13.9k, False: 0] | | ------------------ | | 63| 13.9k| size_t fs_ = sizeof (mp_digit) * (size_t)fd_; \ | | 64| 13.9k| MP_ZERO_BUFFER(fm_, fs_); \ | | ------------------ | | | | 81| 13.9k|# define MP_ZERO_BUFFER(mem, size) \ | | | | 82| 13.9k|do { \ | | | | 83| 13.9k| size_t zs_ = (size); \ | | | | 84| 13.9k| char* zm_ = (char*)(mem); \ | | | | 85| 2.11M| while (zs_-- > 0u) { \ | | | | ------------------ | | | | | Branch (85:11): [True: 2.09M, False: 13.9k] | | | | ------------------ | | | | 86| 2.09M| *zm_++ = '\0'; \ | | | | 87| 2.09M| } \ | | | | 88| 13.9k|} while (0) | | | | ------------------ | | | | | Branch (88:10): [Folded, False: 13.9k] | | | | ------------------ | | ------------------ | | 65| 13.9k| MP_FREE(fm_, fs_); \ | | ------------------ | | | | 1324| 13.9k|#define MP_FREE m_free_ltm | | ------------------ | | 66| 13.9k| } \ | | 67| 13.9k|} while (0) | | ------------------ | | | Branch (67:10): [Folded, False: 13.9k] | | ------------------ ------------------ 13| | 14| | /* reset members to make debugging easier */ 15| 13.9k| a->dp = NULL; 16| 13.9k| a->alloc = a->used = 0; 17| 13.9k| a->sign = MP_ZPOS; ------------------ | | 151| 13.9k|#define MP_ZPOS 0 /* positive integer */ ------------------ 18| 13.9k| } 19| 18.5k|} mp_clear_multi: 9| 1|{ 10| 1| mp_int *next_mp = mp; 11| 1| va_list args; 12| 1| va_start(args, mp); 13| 5| while (next_mp != NULL) { ------------------ | Branch (13:11): [True: 4, False: 1] ------------------ 14| 4| mp_clear(next_mp); 15| 4| next_mp = va_arg(args, mp_int *); 16| 4| } 17| | va_end(args); 18| 1|} mp_cmp: 8| 5|{ 9| | /* compare based on sign */ 10| 5| if (a->sign != b->sign) { ------------------ | Branch (10:8): [True: 0, False: 5] ------------------ 11| 0| if (a->sign == MP_NEG) { ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ | Branch (11:11): [True: 0, False: 0] ------------------ 12| 0| return MP_LT; ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ 13| 0| } else { 14| 0| return MP_GT; ------------------ | | 156| 0|#define MP_GT 1 /* greater than */ ------------------ 15| 0| } 16| 0| } 17| | 18| | /* compare digits */ 19| 5| if (a->sign == MP_NEG) { ------------------ | | 152| 5|#define MP_NEG 1 /* negative */ ------------------ | Branch (19:8): [True: 0, False: 5] ------------------ 20| | /* if negative compare opposite direction */ 21| 0| return mp_cmp_mag(b, a); 22| 5| } else { 23| 5| return mp_cmp_mag(a, b); 24| 5| } 25| 5|} mp_cmp_d: 8| 4|{ 9| | /* compare based on sign */ 10| 4| if (a->sign == MP_NEG) { ------------------ | | 152| 4|#define MP_NEG 1 /* negative */ ------------------ | Branch (10:8): [True: 0, False: 4] ------------------ 11| 0| return MP_LT; ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ 12| 0| } 13| | 14| | /* compare based on magnitude */ 15| 4| if (a->used > 1) { ------------------ | Branch (15:8): [True: 4, False: 0] ------------------ 16| 4| return MP_GT; ------------------ | | 156| 4|#define MP_GT 1 /* greater than */ ------------------ 17| 4| } 18| | 19| | /* compare the only digit of a to b */ 20| 0| if (a->dp[0] > b) { ------------------ | Branch (20:8): [True: 0, False: 0] ------------------ 21| 0| return MP_GT; ------------------ | | 156| 0|#define MP_GT 1 /* greater than */ ------------------ 22| 0| } else if (a->dp[0] < b) { ------------------ | Branch (22:15): [True: 0, False: 0] ------------------ 23| 0| return MP_LT; ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ 24| 0| } else { 25| 0| return MP_EQ; ------------------ | | 155| 0|#define MP_EQ 0 /* equal to */ ------------------ 26| 0| } 27| 0|} mp_cmp_mag: 8| 28|{ 9| 28| int n; 10| 28| const mp_digit *tmpa, *tmpb; 11| | 12| | /* compare based on # of non-zero digits */ 13| 28| if (a->used > b->used) { ------------------ | Branch (13:8): [True: 2, False: 26] ------------------ 14| 2| return MP_GT; ------------------ | | 156| 2|#define MP_GT 1 /* greater than */ ------------------ 15| 2| } 16| | 17| 26| if (a->used < b->used) { ------------------ | Branch (17:8): [True: 0, False: 26] ------------------ 18| 0| return MP_LT; ------------------ | | 154| 0|#define MP_LT -1 /* less than */ ------------------ 19| 0| } 20| | 21| | /* alias for a */ 22| 26| tmpa = a->dp + (a->used - 1); 23| | 24| | /* alias for b */ 25| 26| tmpb = b->dp + (a->used - 1); 26| | 27| | /* compare based on digits */ 28| 43| for (n = 0; n < a->used; ++n, --tmpa, --tmpb) { ------------------ | Branch (28:16): [True: 42, False: 1] ------------------ 29| 42| if (*tmpa > *tmpb) { ------------------ | Branch (29:11): [True: 11, False: 31] ------------------ 30| 11| return MP_GT; ------------------ | | 156| 11|#define MP_GT 1 /* greater than */ ------------------ 31| 11| } 32| | 33| 31| if (*tmpa < *tmpb) { ------------------ | Branch (33:11): [True: 14, False: 17] ------------------ 34| 14| return MP_LT; ------------------ | | 154| 14|#define MP_LT -1 /* less than */ ------------------ 35| 14| } 36| 31| } 37| 1| return MP_EQ; ------------------ | | 155| 1|#define MP_EQ 0 /* equal to */ ------------------ 38| 26|} mp_copy: 8| 24.6k|{ 9| 24.6k| int n; 10| 24.6k| mp_digit *tmpa, *tmpb; 11| 24.6k| mp_err err; 12| | 13| | /* if dst == src do nothing */ 14| 24.6k| if (a == b) { ------------------ | Branch (14:8): [True: 18.5k, False: 6.17k] ------------------ 15| 18.5k| return MP_OKAY; ------------------ | | 161| 18.5k|#define MP_OKAY 0 /* no error */ ------------------ 16| 18.5k| } 17| | 18| | /* grow dest */ 19| 6.17k| if (b->alloc < a->used) { ------------------ | Branch (19:8): [True: 0, False: 6.17k] ------------------ 20| 0| if ((err = mp_grow(b, a->used)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (20:11): [True: 0, False: 0] ------------------ 21| 0| return err; 22| 0| } 23| 0| } 24| | 25| | /* zero b and copy the parameters over */ 26| | /* pointer aliases */ 27| | 28| | /* source */ 29| 6.17k| tmpa = a->dp; 30| | 31| | /* destination */ 32| 6.17k| tmpb = b->dp; 33| | 34| | /* copy all the digits */ 35| 12.3k| for (n = 0; n < a->used; n++) { ------------------ | Branch (35:16): [True: 6.19k, False: 6.17k] ------------------ 36| 6.19k| *tmpb++ = *tmpa++; 37| 6.19k| } 38| | 39| | /* clear high digits */ 40| 6.17k| MP_ZERO_DIGITS(tmpb, b->used - n); ------------------ | | 89| 6.17k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 6.17k|do { \ | | 91| 6.17k| int zd_ = (digits); \ | | 92| 6.17k| mp_digit* zm_ = (mem); \ | | 93| 6.17k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 6.17k] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 6.17k|} while (0) | | ------------------ | | | Branch (96:10): [Folded, False: 6.17k] | | ------------------ ------------------ 41| | 42| | /* copy used count and sign */ 43| 6.17k| b->used = a->used; 44| 6.17k| b->sign = a->sign; 45| 6.17k| return MP_OKAY; ------------------ | | 161| 6.17k|#define MP_OKAY 0 /* no error */ ------------------ 46| 6.17k|} mp_count_bits: 8| 12.3k|{ 9| 12.3k| int r; 10| 12.3k| mp_digit q; 11| | 12| | /* shortcut */ 13| 12.3k| if (MP_IS_ZERO(a)) { ------------------ | | 163| 12.3k|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 12.3k] | | ------------------ ------------------ 14| 0| return 0; 15| 0| } 16| | 17| | /* get number of digits and add that */ 18| 12.3k| r = (a->used - 1) * MP_DIGIT_BIT; ------------------ | | 82| 12.3k|# define MP_DIGIT_BIT 60 ------------------ 19| | 20| | /* take the last digit and count the bits in it */ 21| 12.3k| q = a->dp[a->used - 1]; 22| 308k| while (q > 0u) { ------------------ | Branch (22:11): [True: 296k, False: 12.3k] ------------------ 23| 296k| ++r; 24| 296k| q >>= 1u; 25| 296k| } 26| 12.3k| return r; 27| 12.3k|} mp_div: 87| 2|{ 88| 2| mp_int q, x, y, t1, t2; 89| 2| int n, t, i, norm; 90| 2| mp_sign neg; 91| 2| mp_err err; 92| | 93| | /* is divisor zero ? */ 94| 2| if (MP_IS_ZERO(b)) { ------------------ | | 163| 2|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 2] | | ------------------ ------------------ 95| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 96| 0| } 97| | 98| | /* if a < b then q=0, r = a */ 99| 2| if (mp_cmp_mag(a, b) == MP_LT) { ------------------ | | 154| 2|#define MP_LT -1 /* less than */ ------------------ | Branch (99:8): [True: 0, False: 2] ------------------ 100| 0| if (d != NULL) { ------------------ | Branch (100:11): [True: 0, False: 0] ------------------ 101| 0| err = mp_copy(a, d); 102| 0| } else { 103| 0| err = MP_OKAY; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ 104| 0| } 105| 0| if (c != NULL) { ------------------ | Branch (105:11): [True: 0, False: 0] ------------------ 106| 0| mp_zero(c); 107| 0| } 108| 0| return err; 109| 0| } 110| | 111| 2| if ((err = mp_init_size(&q, a->used + 2)) != MP_OKAY) { ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (111:8): [True: 0, False: 2] ------------------ 112| 0| return err; 113| 0| } 114| 2| q.used = a->used + 2; 115| | 116| 2| if ((err = mp_init(&t1)) != MP_OKAY) goto LBL_Q; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (116:8): [True: 0, False: 2] ------------------ 117| | 118| 2| if ((err = mp_init(&t2)) != MP_OKAY) goto LBL_T1; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (118:8): [True: 0, False: 2] ------------------ 119| | 120| 2| if ((err = mp_init_copy(&x, a)) != MP_OKAY) goto LBL_T2; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (120:8): [True: 0, False: 2] ------------------ 121| | 122| 2| if ((err = mp_init_copy(&y, b)) != MP_OKAY) goto LBL_X; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (122:8): [True: 0, False: 2] ------------------ 123| | 124| | /* fix the sign */ 125| 2| neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 151| 2|#define MP_ZPOS 0 /* positive integer */ ------------------ neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 152| 2|#define MP_NEG 1 /* negative */ ------------------ | Branch (125:10): [True: 2, False: 0] ------------------ 126| 2| x.sign = y.sign = MP_ZPOS; ------------------ | | 151| 2|#define MP_ZPOS 0 /* positive integer */ ------------------ 127| | 128| | /* normalize both x and y, ensure that y >= b/2, [b == 2**MP_DIGIT_BIT] */ 129| 2| norm = mp_count_bits(&y) % MP_DIGIT_BIT; ------------------ | | 82| 2|# define MP_DIGIT_BIT 60 ------------------ 130| 2| if (norm < (MP_DIGIT_BIT - 1)) { ------------------ | | 82| 2|# define MP_DIGIT_BIT 60 ------------------ | Branch (130:8): [True: 2, False: 0] ------------------ 131| 2| norm = (MP_DIGIT_BIT - 1) - norm; ------------------ | | 82| 2|# define MP_DIGIT_BIT 60 ------------------ 132| 2| if ((err = mp_mul_2d(&x, norm, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (132:11): [True: 0, False: 2] ------------------ 133| 2| if ((err = mp_mul_2d(&y, norm, &y)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (133:11): [True: 0, False: 2] ------------------ 134| 2| } else { 135| 0| norm = 0; 136| 0| } 137| | 138| | /* note hac does 0 based, so if used==5 then its 0,1,2,3,4, e.g. use 4 */ 139| 2| n = x.used - 1; 140| 2| t = y.used - 1; 141| | 142| | /* while (x >= y*b**n-t) do { q[n-t] += 1; x -= y*b**{n-t} } */ 143| | /* y = y*b**{n-t} */ 144| 2| if ((err = mp_lshd(&y, n - t)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (144:8): [True: 0, False: 2] ------------------ 145| | 146| 2| while (mp_cmp(&x, &y) != MP_LT) { ------------------ | | 154| 2|#define MP_LT -1 /* less than */ ------------------ | Branch (146:11): [True: 0, False: 2] ------------------ 147| 0| ++(q.dp[n - t]); 148| 0| if ((err = mp_sub(&x, &y, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (148:11): [True: 0, False: 0] ------------------ 149| 0| } 150| | 151| | /* reset y by shifting it back down */ 152| 2| mp_rshd(&y, n - t); 153| | 154| | /* step 3. for i from n down to (t + 1) */ 155| 12| for (i = n; i >= (t + 1); i--) { ------------------ | Branch (155:16): [True: 10, False: 2] ------------------ 156| 10| if (i > x.used) { ------------------ | Branch (156:11): [True: 0, False: 10] ------------------ 157| 0| continue; 158| 0| } 159| | 160| | /* step 3.1 if xi == yt then set q{i-t-1} to b-1, 161| | * otherwise set q{i-t-1} to (xi*b + x{i-1})/yt */ 162| 10| if (x.dp[i] == y.dp[t]) { ------------------ | Branch (162:11): [True: 0, False: 10] ------------------ 163| 0| q.dp[(i - t) - 1] = ((mp_digit)1 << (mp_digit)MP_DIGIT_BIT) - (mp_digit)1; ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ 164| 10| } else { 165| 10| mp_word tmp; 166| 10| tmp = (mp_word)x.dp[i] << (mp_word)MP_DIGIT_BIT; ------------------ | | 82| 10|# define MP_DIGIT_BIT 60 ------------------ 167| 10| tmp |= (mp_word)x.dp[i - 1]; 168| 10| tmp /= (mp_word)y.dp[t]; 169| 10| if (tmp > (mp_word)MP_MASK) { ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (169:14): [True: 0, False: 10] ------------------ 170| 0| tmp = MP_MASK; ------------------ | | 106| 0|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 0|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 171| 0| } 172| 10| q.dp[(i - t) - 1] = (mp_digit)(tmp & (mp_word)MP_MASK); ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 173| 10| } 174| | 175| | /* while (q{i-t-1} * (yt * b + y{t-1})) > 176| | xi * b**2 + xi-1 * b + xi-2 177| | 178| | do q{i-t-1} -= 1; 179| | */ 180| 10| q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] + 1uL) & (mp_digit)MP_MASK; ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 181| 10| do { 182| 10| q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] - 1uL) & (mp_digit)MP_MASK; ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 183| | 184| | /* find left hand */ 185| 10| mp_zero(&t1); 186| 10| t1.dp[0] = ((t - 1) < 0) ? 0u : y.dp[t - 1]; ------------------ | Branch (186:21): [True: 0, False: 10] ------------------ 187| 10| t1.dp[1] = y.dp[t]; 188| 10| t1.used = 2; 189| 10| if ((err = mp_mul_d(&t1, q.dp[(i - t) - 1], &t1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ | Branch (189:14): [True: 0, False: 10] ------------------ 190| | 191| | /* find right hand */ 192| 10| t2.dp[0] = ((i - 2) < 0) ? 0u : x.dp[i - 2]; ------------------ | Branch (192:21): [True: 0, False: 10] ------------------ 193| 10| t2.dp[1] = x.dp[i - 1]; /* i >= 1 always holds */ 194| 10| t2.dp[2] = x.dp[i]; 195| 10| t2.used = 3; 196| 10| } while (mp_cmp_mag(&t1, &t2) == MP_GT); ------------------ | | 156| 10|#define MP_GT 1 /* greater than */ ------------------ | Branch (196:16): [True: 0, False: 10] ------------------ 197| | 198| | /* step 3.3 x = x - q{i-t-1} * y * b**{i-t-1} */ 199| 10| if ((err = mp_mul_d(&y, q.dp[(i - t) - 1], &t1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ | Branch (199:11): [True: 0, False: 10] ------------------ 200| | 201| 10| if ((err = mp_lshd(&t1, (i - t) - 1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ | Branch (201:11): [True: 0, False: 10] ------------------ 202| | 203| 10| if ((err = mp_sub(&x, &t1, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ | Branch (203:11): [True: 0, False: 10] ------------------ 204| | 205| | /* if x < 0 then { x = x + y*b**{i-t-1}; q{i-t-1} -= 1; } */ 206| 10| if (x.sign == MP_NEG) { ------------------ | | 152| 10|#define MP_NEG 1 /* negative */ ------------------ | Branch (206:11): [True: 0, False: 10] ------------------ 207| 0| if ((err = mp_copy(&y, &t1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (207:14): [True: 0, False: 0] ------------------ 208| 0| if ((err = mp_lshd(&t1, (i - t) - 1)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (208:14): [True: 0, False: 0] ------------------ 209| 0| if ((err = mp_add(&x, &t1, &x)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (209:14): [True: 0, False: 0] ------------------ 210| | 211| 0| q.dp[(i - t) - 1] = (q.dp[(i - t) - 1] - 1uL) & MP_MASK; ------------------ | | 106| 0|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 0|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 212| 0| } 213| 10| } 214| | 215| | /* now q is the quotient and x is the remainder 216| | * [which we have to normalize] 217| | */ 218| | 219| | /* get sign before writing to c */ 220| 2| x.sign = (x.used == 0) ? MP_ZPOS : a->sign; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (220:13): [True: 0, False: 2] ------------------ 221| | 222| 2| if (c != NULL) { ------------------ | Branch (222:8): [True: 0, False: 2] ------------------ 223| 0| mp_clamp(&q); 224| 0| mp_exch(&q, c); 225| 0| c->sign = neg; 226| 0| } 227| | 228| 2| if (d != NULL) { ------------------ | Branch (228:8): [True: 2, False: 0] ------------------ 229| 2| if ((err = mp_div_2d(&x, norm, &x, NULL)) != MP_OKAY) goto LBL_Y; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (229:11): [True: 0, False: 2] ------------------ 230| 2| mp_exch(&x, d); 231| 2| } 232| | 233| 2| err = MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 234| | 235| 2|LBL_Y: 236| 2| mp_clear(&y); 237| 2|LBL_X: 238| 2| mp_clear(&x); 239| 2|LBL_T2: 240| 2| mp_clear(&t2); 241| 2|LBL_T1: 242| 2| mp_clear(&t1); 243| 2|LBL_Q: 244| 2| mp_clear(&q); 245| 2| return err; 246| 2|} mp_div_2d: 8| 18.5k|{ 9| 18.5k| mp_digit D, r, rr; 10| 18.5k| int x; 11| 18.5k| mp_err err; 12| | 13| | /* if the shift count is <= 0 then we do no work */ 14| 18.5k| if (b <= 0) { ------------------ | Branch (14:8): [True: 0, False: 18.5k] ------------------ 15| 0| err = mp_copy(a, c); 16| 0| if (d != NULL) { ------------------ | Branch (16:11): [True: 0, False: 0] ------------------ 17| 0| mp_zero(d); 18| 0| } 19| 0| return err; 20| 0| } 21| | 22| | /* copy */ 23| 18.5k| if ((err = mp_copy(a, c)) != MP_OKAY) { ------------------ | | 161| 18.5k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (23:8): [True: 0, False: 18.5k] ------------------ 24| 0| return err; 25| 0| } 26| | /* 'a' should not be used after here - it might be the same as d */ 27| | 28| | /* get the remainder */ 29| 18.5k| if (d != NULL) { ------------------ | Branch (29:8): [True: 0, False: 18.5k] ------------------ 30| 0| if ((err = mp_mod_2d(a, b, d)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (30:11): [True: 0, False: 0] ------------------ 31| 0| return err; 32| 0| } 33| 0| } 34| | 35| | /* shift by as many digits in the bit count */ 36| 18.5k| if (b >= MP_DIGIT_BIT) { ------------------ | | 82| 18.5k|# define MP_DIGIT_BIT 60 ------------------ | Branch (36:8): [True: 0, False: 18.5k] ------------------ 37| 0| mp_rshd(c, b / MP_DIGIT_BIT); ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ 38| 0| } 39| | 40| | /* shift any bit count < MP_DIGIT_BIT */ 41| 18.5k| D = (mp_digit)(b % MP_DIGIT_BIT); ------------------ | | 82| 18.5k|# define MP_DIGIT_BIT 60 ------------------ 42| 18.5k| if (D != 0u) { ------------------ | Branch (42:8): [True: 18.5k, False: 0] ------------------ 43| 18.5k| mp_digit *tmpc, mask, shift; 44| | 45| | /* mask */ 46| 18.5k| mask = ((mp_digit)1 << D) - 1uL; 47| | 48| | /* shift for lsb */ 49| 18.5k| shift = (mp_digit)MP_DIGIT_BIT - D; ------------------ | | 82| 18.5k|# define MP_DIGIT_BIT 60 ------------------ 50| | 51| | /* alias */ 52| 18.5k| tmpc = c->dp + (c->used - 1); 53| | 54| | /* carry */ 55| 18.5k| r = 0; 56| 37.0k| for (x = c->used - 1; x >= 0; x--) { ------------------ | Branch (56:29): [True: 18.5k, False: 18.5k] ------------------ 57| | /* get the lower bits of this word in a temp */ 58| 18.5k| rr = *tmpc & mask; 59| | 60| | /* shift the current word and mix in the carry bits from the previous word */ 61| 18.5k| *tmpc = (*tmpc >> D) | (r << shift); 62| 18.5k| --tmpc; 63| | 64| | /* set the carry to the carry bits of the current word found above */ 65| 18.5k| r = rr; 66| 18.5k| } 67| 18.5k| } 68| 18.5k| mp_clamp(c); 69| 18.5k| return MP_OKAY; ------------------ | | 161| 18.5k|#define MP_OKAY 0 /* no error */ ------------------ 70| 18.5k|} mp_exch: 10| 4|{ 11| 4| mp_int t; 12| | 13| 4| t = *a; 14| 4| *a = *b; 15| 4| *b = t; 16| 4|} mp_from_ubin: 8| 125|{ 9| 125| mp_err err; 10| | 11| | /* make sure there are at least two digits */ 12| 125| if (a->alloc < 2) { ------------------ | Branch (12:8): [True: 0, False: 125] ------------------ 13| 0| if ((err = mp_grow(a, 2)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (13:11): [True: 0, False: 0] ------------------ 14| 0| return err; 15| 0| } 16| 0| } 17| | 18| | /* zero the int */ 19| 125| mp_zero(a); 20| | 21| | /* read the bytes in */ 22| 16.9k| while (size-- > 0u) { ------------------ | Branch (22:11): [True: 16.8k, False: 125] ------------------ 23| 16.8k| if ((err = mp_mul_2d(a, 8, a)) != MP_OKAY) { ------------------ | | 161| 16.8k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (23:11): [True: 0, False: 16.8k] ------------------ 24| 0| return err; 25| 0| } 26| | 27| 16.8k|#ifndef MP_8BIT 28| 16.8k| a->dp[0] |= *buf++; 29| 16.8k| a->used += 1; 30| |#else 31| | a->dp[0] = (*buf & MP_MASK); 32| | a->dp[1] |= ((*buf++ >> 7) & 1u); 33| | a->used += 2; 34| |#endif 35| 16.8k| } 36| 125| mp_clamp(a); 37| 125| return MP_OKAY; ------------------ | | 161| 125|#define MP_OKAY 0 /* no error */ ------------------ 38| 125|} mp_grow: 8| 1.02k|{ 9| 1.02k| int i; 10| 1.02k| mp_digit *tmp; 11| | 12| 1.02k| if (size < 0) { ------------------ | Branch (12:8): [True: 0, False: 1.02k] ------------------ 13| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 14| 0| } 15| | 16| | /* if the alloc size is smaller alloc more ram */ 17| 1.02k| if (a->alloc < size) { ------------------ | Branch (17:8): [True: 1.02k, False: 0] ------------------ 18| | /* reallocate the array a->dp 19| | * 20| | * We store the return in a temporary variable 21| | * in case the operation failed we don't want 22| | * to overwrite the dp member of a. 23| | */ 24| 1.02k| tmp = (mp_digit *) MP_REALLOC(a->dp, ------------------ | | 1325| 1.02k|#define MP_REALLOC m_realloc_ltm ------------------ 25| 1.02k| (size_t)a->alloc * sizeof(mp_digit), 26| 1.02k| (size_t)size * sizeof(mp_digit)); 27| 1.02k| if (tmp == NULL) { ------------------ | Branch (27:11): [True: 0, False: 1.02k] ------------------ 28| | /* reallocation failed but "a" is still valid [can be freed] */ 29| 0| return MP_MEM; ------------------ | | 163| 0|#define MP_MEM -2 /* out of mem */ ------------------ 30| 0| } 31| | 32| | /* reallocation succeeded so set a->dp */ 33| 1.02k| a->dp = tmp; 34| | 35| | /* zero excess digits */ 36| 1.02k| i = a->alloc; 37| 1.02k| a->alloc = size; 38| 1.02k| MP_ZERO_DIGITS(a->dp + i, a->alloc - i); ------------------ | | 89| 1.02k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 1.02k|do { \ | | 91| 1.02k| int zd_ = (digits); \ | | 92| 1.02k| mp_digit* zm_ = (mem); \ | | 93| 2.05k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 1.03k, False: 1.02k] | | ------------------ | | 94| 1.03k| *zm_++ = 0; \ | | 95| 1.03k| } \ | | 96| 1.02k|} while (0) | | ------------------ | | | Branch (96:10): [Folded, False: 1.02k] | | ------------------ ------------------ 39| 1.02k| } 40| 1.02k| return MP_OKAY; ------------------ | | 161| 1.02k|#define MP_OKAY 0 /* no error */ ------------------ 41| 1.02k|} mp_init: 8| 7.94k|{ 9| | /* allocate memory required and clear it */ 10| 7.94k| a->dp = (mp_digit *) MP_CALLOC((size_t)MP_PREC, sizeof(mp_digit)); ------------------ | | 1326| 7.94k|#define MP_CALLOC m_calloc ------------------ a->dp = (mp_digit *) MP_CALLOC((size_t)MP_PREC, sizeof(mp_digit)); ------------------ | | 177| 7.94k|# define MP_PREC PRIVATE_MP_PREC | | ------------------ | | | | 193| 7.94k|# define PRIVATE_MP_PREC 32 /* default digits of precision */ | | ------------------ ------------------ 11| 7.94k| if (a->dp == NULL) { ------------------ | Branch (11:8): [True: 0, False: 7.94k] ------------------ 12| 0| return MP_MEM; ------------------ | | 163| 0|#define MP_MEM -2 /* out of mem */ ------------------ 13| 0| } 14| | 15| | /* set the used to zero, allocated digits to the default precision 16| | * and sign to positive */ 17| 7.94k| a->used = 0; 18| 7.94k| a->alloc = MP_PREC; ------------------ | | 177| 7.94k|# define MP_PREC PRIVATE_MP_PREC | | ------------------ | | | | 193| 7.94k|# define PRIVATE_MP_PREC 32 /* default digits of precision */ | | ------------------ ------------------ 19| 7.94k| a->sign = MP_ZPOS; ------------------ | | 151| 7.94k|#define MP_ZPOS 0 /* positive integer */ ------------------ 20| | 21| 7.94k| return MP_OKAY; ------------------ | | 161| 7.94k|#define MP_OKAY 0 /* no error */ ------------------ 22| 7.94k|} mp_init_copy: 8| 6.17k|{ 9| 6.17k| mp_err err; 10| | 11| 6.17k| if ((err = mp_init_size(a, b->used)) != MP_OKAY) { ------------------ | | 161| 6.17k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (11:8): [True: 0, False: 6.17k] ------------------ 12| 0| return err; 13| 0| } 14| | 15| 6.17k| if ((err = mp_copy(b, a)) != MP_OKAY) { ------------------ | | 161| 6.17k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (15:8): [True: 0, False: 6.17k] ------------------ 16| 0| mp_clear(a); 17| 0| } 18| | 19| 6.17k| return err; 20| 6.17k|} mp_init_size: 8| 6.17k|{ 9| | 10| 6.17k| if (size < 0) { ------------------ | Branch (10:8): [True: 0, False: 6.17k] ------------------ 11| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 12| 0| } 13| | 14| 6.17k| size = MP_MAX(MP_MIN_PREC, size); ------------------ | | 157| 6.17k|#define MP_MAX(x, y) (((x) > (y)) ? (x) : (y)) | | ------------------ | | | Branch (157:23): [True: 6.16k, False: 8] | | ------------------ ------------------ 15| | 16| | /* alloc mem */ 17| 6.17k| a->dp = (mp_digit *) MP_CALLOC((size_t)size, sizeof(mp_digit)); ------------------ | | 1326| 6.17k|#define MP_CALLOC m_calloc ------------------ 18| 6.17k| if (a->dp == NULL) { ------------------ | Branch (18:8): [True: 0, False: 6.17k] ------------------ 19| 0| return MP_MEM; ------------------ | | 163| 0|#define MP_MEM -2 /* out of mem */ ------------------ 20| 0| } 21| | 22| | /* set the members */ 23| 6.17k| a->used = 0; 24| 6.17k| a->alloc = size; 25| 6.17k| a->sign = MP_ZPOS; ------------------ | | 151| 6.17k|#define MP_ZPOS 0 /* positive integer */ ------------------ 26| | 27| 6.17k| return MP_OKAY; ------------------ | | 161| 6.17k|#define MP_OKAY 0 /* no error */ ------------------ 28| 6.17k|} mp_lshd: 8| 12|{ 9| 12| int x; 10| 12| mp_err err; 11| 12| mp_digit *top, *bottom; 12| | 13| | /* if its less than zero return */ 14| 12| if (b <= 0) { ------------------ | Branch (14:8): [True: 2, False: 10] ------------------ 15| 2| return MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 16| 2| } 17| | /* no need to shift 0 around */ 18| 10| if (MP_IS_ZERO(a)) { ------------------ | | 163| 10|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 10] | | ------------------ ------------------ 19| 0| return MP_OKAY; ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ 20| 0| } 21| | 22| | /* grow to fit the new digits */ 23| 10| if (a->alloc < (a->used + b)) { ------------------ | Branch (23:8): [True: 2, False: 8] ------------------ 24| 2| if ((err = mp_grow(a, a->used + b)) != MP_OKAY) { ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (24:11): [True: 0, False: 2] ------------------ 25| 0| return err; 26| 0| } 27| 2| } 28| | 29| | /* increment the used by the shift amount then copy upwards */ 30| 10| a->used += b; 31| | 32| | /* top */ 33| 10| top = a->dp + a->used - 1; 34| | 35| | /* base */ 36| 10| bottom = (a->dp + a->used - 1) - b; 37| | 38| | /* much like mp_rshd this is implemented using a sliding window 39| | * except the window goes the otherway around. Copying from 40| | * the bottom to the top. see bn_mp_rshd.c for more info. 41| | */ 42| 68| for (x = a->used - 1; x >= b; x--) { ------------------ | Branch (42:26): [True: 58, False: 10] ------------------ 43| 58| *top-- = *bottom--; 44| 58| } 45| | 46| | /* zero the lower digits */ 47| 10| MP_ZERO_DIGITS(a->dp, b); ------------------ | | 89| 10|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 10|do { \ | | 91| 10| int zd_ = (digits); \ | | 92| 10| mp_digit* zm_ = (mem); \ | | 93| 40| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 30, False: 10] | | ------------------ | | 94| 30| *zm_++ = 0; \ | | 95| 30| } \ | | 96| 10|} while (0) | | ------------------ | | | Branch (96:10): [Folded, False: 10] | | ------------------ ------------------ 48| | 49| 10| return MP_OKAY; ------------------ | | 161| 10|#define MP_OKAY 0 /* no error */ ------------------ 50| 10|} mp_mod: 8| 2|{ 9| 2| mp_int t; 10| 2| mp_err err; 11| | 12| 2| if ((err = mp_init_size(&t, b->used)) != MP_OKAY) { ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (12:8): [True: 0, False: 2] ------------------ 13| 0| return err; 14| 0| } 15| | 16| 2| if ((err = mp_div(a, b, NULL, &t)) != MP_OKAY) { ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ | Branch (16:8): [True: 0, False: 2] ------------------ 17| 0| goto LBL_ERR; 18| 0| } 19| | 20| 2| if (MP_IS_ZERO(&t) || (t.sign == b->sign)) { ------------------ | | 163| 4|#define MP_IS_ZERO(a) ((a)->used == 0) | | ------------------ | | | Branch (163:23): [True: 0, False: 2] | | ------------------ ------------------ | Branch (20:26): [True: 2, False: 0] ------------------ 21| 2| err = MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 22| 2| mp_exch(&t, c); 23| 2| } else { 24| 0| err = mp_add(b, &t, c); 25| 0| } 26| | 27| 2|LBL_ERR: 28| 2| mp_clear(&t); 29| 2| return err; 30| 2|} mp_mul: 8| 1|{ 9| 1| mp_err err; 10| 1| int min_len = MP_MIN(a->used, b->used), ------------------ | | 156| 1|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 0, False: 1] | | ------------------ ------------------ 11| 1| max_len = MP_MAX(a->used, b->used), ------------------ | | 157| 1|#define MP_MAX(x, y) (((x) > (y)) ? (x) : (y)) | | ------------------ | | | Branch (157:23): [True: 0, False: 1] | | ------------------ ------------------ 12| 1| digs = a->used + b->used + 1; 13| 1| mp_sign neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 151| 1|#define MP_ZPOS 0 /* positive integer */ ------------------ mp_sign neg = (a->sign == b->sign) ? MP_ZPOS : MP_NEG; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ | Branch (13:18): [True: 1, False: 0] ------------------ 14| | 15| 1| if (MP_HAS(S_MP_BALANCE_MUL) && ------------------ | | 150| 2|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 1|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 1|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [True: 1, Folded] | | ------------------ ------------------ 16| | /* Check sizes. The smaller one needs to be larger than the Karatsuba cut-off. 17| | * The bigger one needs to be at least about one MP_KARATSUBA_MUL_CUTOFF bigger 18| | * to make some sense, but it depends on architecture, OS, position of the 19| | * stars... so YMMV. 20| | * Using it to cut the input into slices small enough for fast_s_mp_mul_digs 21| | * was actually slower on the author's machine, but YMMV. 22| | */ 23| 1| (min_len >= MP_KARATSUBA_MUL_CUTOFF) && ------------------ | | 121| 1|# define MP_KARATSUBA_MUL_CUTOFF KARATSUBA_MUL_CUTOFF ------------------ | Branch (23:8): [True: 0, False: 1] ------------------ 24| 0| ((max_len / 2) >= MP_KARATSUBA_MUL_CUTOFF) && ------------------ | | 121| 0|# define MP_KARATSUBA_MUL_CUTOFF KARATSUBA_MUL_CUTOFF ------------------ | Branch (24:8): [True: 0, False: 0] ------------------ 25| | /* Not much effect was observed below a ratio of 1:2, but again: YMMV. */ 26| 0| (max_len >= (2 * min_len))) { ------------------ | Branch (26:8): [True: 0, False: 0] ------------------ 27| 0| err = s_mp_balance_mul(a,b,c); 28| 1| } else if (MP_HAS(S_MP_TOOM_MUL) && ------------------ | | 150| 2|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 1|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 1|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded, False: 1] | | ------------------ ------------------ 29| 0| (min_len >= MP_TOOM_MUL_CUTOFF)) { ------------------ | | 123| 0|# define MP_TOOM_MUL_CUTOFF TOOM_MUL_CUTOFF ------------------ | Branch (29:15): [True: 0, False: 0] ------------------ 30| 0| err = s_mp_toom_mul(a, b, c); 31| 1| } else if (MP_HAS(S_MP_KARATSUBA_MUL) && ------------------ | | 150| 2|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 1|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 1|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded, False: 1] | | ------------------ ------------------ 32| 0| (min_len >= MP_KARATSUBA_MUL_CUTOFF)) { ------------------ | | 121| 0|# define MP_KARATSUBA_MUL_CUTOFF KARATSUBA_MUL_CUTOFF ------------------ | Branch (32:15): [True: 0, False: 0] ------------------ 33| 0| err = s_mp_karatsuba_mul(a, b, c); 34| 1| } else if (MP_HAS(S_MP_MUL_DIGS_FAST) && ------------------ | | 150| 2|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 1|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 1|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [True: 1, Folded] | | ------------------ ------------------ 35| | /* can we use the fast multiplier? 36| | * 37| | * The fast multiplier can be used if the output will 38| | * have less than MP_WARRAY digits and the number of 39| | * digits won't affect carry propagation 40| | */ 41| 1| (digs < MP_WARRAY) && ------------------ | | 172| 1|#define MP_WARRAY PRIVATE_MP_WARRAY | | ------------------ | | | | 203| 1|#define PRIVATE_MP_WARRAY (int)(1uLL << (((CHAR_BIT * sizeof(private_mp_word)) - (2 * MP_DIGIT_BIT)) + 1)) | | | | ------------------ | | | | | | 82| 1|# define MP_DIGIT_BIT 60 | | | | ------------------ | | ------------------ ------------------ | Branch (41:15): [True: 1, False: 0] ------------------ 42| 1| (min_len <= MP_MAXFAST)) { ------------------ | | 168| 1|#define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 167| 1|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) | | ------------------ | | #define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 82| 1|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (42:15): [True: 1, False: 0] ------------------ 43| 1| err = s_mp_mul_digs_fast(a, b, c, digs); 44| 1| } else if (MP_HAS(S_MP_MUL_DIGS)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [True: 0, Folded] | | ------------------ ------------------ 45| 0| err = s_mp_mul_digs(a, b, c, digs); 46| 0| } else { 47| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 48| 0| } 49| 1| c->sign = (c->used > 0) ? neg : MP_ZPOS; ------------------ | | 151| 1|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (49:14): [True: 1, False: 0] ------------------ 50| 1| return err; 51| 1|} mp_mul_2d: 8| 16.8k|{ 9| 16.8k| mp_digit d; 10| 16.8k| mp_err err; 11| | 12| 16.8k| if (b < 0) { ------------------ | Branch (12:8): [True: 0, False: 16.8k] ------------------ 13| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 14| 0| } 15| | 16| | /* copy */ 17| 16.8k| if (a != c) { ------------------ | Branch (17:8): [True: 0, False: 16.8k] ------------------ 18| 0| if ((err = mp_copy(a, c)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (18:11): [True: 0, False: 0] ------------------ 19| 0| return err; 20| 0| } 21| 0| } 22| | 23| 16.8k| if (c->alloc < (c->used + (b / MP_DIGIT_BIT) + 1)) { ------------------ | | 82| 16.8k|# define MP_DIGIT_BIT 60 ------------------ | Branch (23:8): [True: 1.02k, False: 15.8k] ------------------ 24| 1.02k| if ((err = mp_grow(c, c->used + (b / MP_DIGIT_BIT) + 1)) != MP_OKAY) { ------------------ | | 82| 1.02k|# define MP_DIGIT_BIT 60 ------------------ if ((err = mp_grow(c, c->used + (b / MP_DIGIT_BIT) + 1)) != MP_OKAY) { ------------------ | | 161| 1.02k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (24:11): [True: 0, False: 1.02k] ------------------ 25| 0| return err; 26| 0| } 27| 1.02k| } 28| | 29| | /* shift by as many digits in the bit count */ 30| 16.8k| if (b >= MP_DIGIT_BIT) { ------------------ | | 82| 16.8k|# define MP_DIGIT_BIT 60 ------------------ | Branch (30:8): [True: 0, False: 16.8k] ------------------ 31| 0| if ((err = mp_lshd(c, b / MP_DIGIT_BIT)) != MP_OKAY) { ------------------ | | 82| 0|# define MP_DIGIT_BIT 60 ------------------ if ((err = mp_lshd(c, b / MP_DIGIT_BIT)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (31:11): [True: 0, False: 0] ------------------ 32| 0| return err; 33| 0| } 34| 0| } 35| | 36| | /* shift any bit count < MP_DIGIT_BIT */ 37| 16.8k| d = (mp_digit)(b % MP_DIGIT_BIT); ------------------ | | 82| 16.8k|# define MP_DIGIT_BIT 60 ------------------ 38| 16.8k| if (d != 0u) { ------------------ | Branch (38:8): [True: 16.8k, False: 0] ------------------ 39| 16.8k| mp_digit *tmpc, shift, mask, r, rr; 40| 16.8k| int x; 41| | 42| | /* bitmask for carries */ 43| 16.8k| mask = ((mp_digit)1 << d) - (mp_digit)1; 44| | 45| | /* shift for msbs */ 46| 16.8k| shift = (mp_digit)MP_DIGIT_BIT - d; ------------------ | | 82| 16.8k|# define MP_DIGIT_BIT 60 ------------------ 47| | 48| | /* alias */ 49| 16.8k| tmpc = c->dp; 50| | 51| | /* carry */ 52| 16.8k| r = 0; 53| 675k| for (x = 0; x < c->used; x++) { ------------------ | Branch (53:19): [True: 659k, False: 16.8k] ------------------ 54| | /* get the higher bits of the current word */ 55| 659k| rr = (*tmpc >> shift) & mask; 56| | 57| | /* shift the current word and OR in the carry */ 58| 659k| *tmpc = ((*tmpc << d) | r) & MP_MASK; ------------------ | | 106| 659k|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 659k|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 59| 659k| ++tmpc; 60| | 61| | /* set the carry to the carry bits of the current word */ 62| 659k| r = rr; 63| 659k| } 64| | 65| | /* set final carry */ 66| 16.8k| if (r != 0u) { ------------------ | Branch (66:11): [True: 2, False: 16.8k] ------------------ 67| 2| c->dp[(c->used)++] = r; 68| 2| } 69| 16.8k| } 70| 16.8k| mp_clamp(c); 71| 16.8k| return MP_OKAY; ------------------ | | 161| 16.8k|#define MP_OKAY 0 /* no error */ ------------------ 72| 16.8k|} mp_mul_d: 8| 148|{ 9| 148| mp_digit u, *tmpa, *tmpc; 10| 148| mp_word r; 11| 148| mp_err err; 12| 148| int ix, olduse; 13| | 14| | /* make sure c is big enough to hold a*b */ 15| 148| if (c->alloc < (a->used + 1)) { ------------------ | Branch (15:8): [True: 0, False: 148] ------------------ 16| 0| if ((err = mp_grow(c, a->used + 1)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (16:11): [True: 0, False: 0] ------------------ 17| 0| return err; 18| 0| } 19| 0| } 20| | 21| | /* get the original destinations used count */ 22| 148| olduse = c->used; 23| | 24| | /* set the sign */ 25| 148| c->sign = a->sign; 26| | 27| | /* alias for a->dp [source] */ 28| 148| tmpa = a->dp; 29| | 30| | /* alias for c->dp [dest] */ 31| 148| tmpc = c->dp; 32| | 33| | /* zero carry */ 34| 148| u = 0; 35| | 36| | /* compute columns */ 37| 548| for (ix = 0; ix < a->used; ix++) { ------------------ | Branch (37:17): [True: 400, False: 148] ------------------ 38| | /* compute product and carry sum for this term */ 39| 400| r = (mp_word)u + ((mp_word)*tmpa++ * (mp_word)b); 40| | 41| | /* mask off higher bits to get a single digit */ 42| 400| *tmpc++ = (mp_digit)(r & (mp_word)MP_MASK); ------------------ | | 106| 400|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 400|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 43| | 44| | /* send carry into next iteration */ 45| 400| u = (mp_digit)(r >> (mp_word)MP_DIGIT_BIT); ------------------ | | 82| 400|# define MP_DIGIT_BIT 60 ------------------ 46| 400| } 47| | 48| | /* store final carry [if any] and increment ix offset */ 49| 148| *tmpc++ = u; 50| 148| ++ix; 51| | 52| | /* now zero digits above the top */ 53| 148| MP_ZERO_DIGITS(tmpc, olduse - ix); ------------------ | | 89| 148|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 148|do { \ | | 91| 148| int zd_ = (digits); \ | | 92| 148| mp_digit* zm_ = (mem); \ | | 93| 148| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 148] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 148|} while (0) | | ------------------ | | | Branch (96:10): [Folded, False: 148] | | ------------------ ------------------ 54| | 55| | /* set used count */ 56| 148| c->used = a->used + 1; 57| 148| mp_clamp(c); 58| | 59| 148| return MP_OKAY; ------------------ | | 161| 148|#define MP_OKAY 0 /* no error */ ------------------ 60| 148|} mp_rand_source: 10| 1|{ 11| | /* Dropbear, don't reset to platform if source==NULL */ 12| 1| s_mp_rand_source = source; 13| 1|} mp_read_radix: 10| 2|{ 11| 2| mp_err err; 12| 2| int y; 13| 2| mp_sign neg; 14| 2| unsigned pos; 15| 2| char ch; 16| | 17| | /* zero the digit bignum */ 18| 2| mp_zero(a); 19| | 20| | /* make sure the radix is ok */ 21| 2| if ((radix < 2) || (radix > 64)) { ------------------ | Branch (21:8): [True: 0, False: 2] | Branch (21:23): [True: 0, False: 2] ------------------ 22| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 23| 0| } 24| | 25| | /* if the leading digit is a 26| | * minus set the sign to negative. 27| | */ 28| 2| if (*str == '-') { ------------------ | Branch (28:8): [True: 0, False: 2] ------------------ 29| 0| ++str; 30| 0| neg = MP_NEG; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ 31| 2| } else { 32| 2| neg = MP_ZPOS; ------------------ | | 151| 2|#define MP_ZPOS 0 /* positive integer */ ------------------ 33| 2| } 34| | 35| | /* set the integer to the default of zero */ 36| 2| mp_zero(a); 37| | 38| | /* process each digit of the string */ 39| 130| while (*str != '\0') { ------------------ | Branch (39:11): [True: 128, False: 2] ------------------ 40| | /* if the radix <= 36 the conversion is case insensitive 41| | * this allows numbers like 1AB and 1ab to represent the same value 42| | * [e.g. in hex] 43| | */ 44| 128| ch = (radix <= 36) ? (char)MP_TOUPPER((int)*str) : *str; ------------------ | | 6| 128|#define MP_TOUPPER(c) ((((c) >= 'a') && ((c) <= 'z')) ? (((c) + 'A') - 'a') : (c)) | | ------------------ | | | Branch (6:25): [True: 0, False: 128] | | | Branch (6:41): [True: 0, False: 0] | | ------------------ ------------------ | Branch (44:12): [True: 128, False: 0] ------------------ 45| 128| pos = (unsigned)(ch - '('); 46| 128| if (mp_s_rmap_reverse_sz < pos) { ------------------ | Branch (46:11): [True: 0, False: 128] ------------------ 47| 0| break; 48| 0| } 49| 128| y = (int)mp_s_rmap_reverse[pos]; 50| | 51| | /* if the char was found in the map 52| | * and is less than the given radix add it 53| | * to the number, otherwise exit the loop. 54| | */ 55| 128| if ((y == 0xff) || (y >= radix)) { ------------------ | Branch (55:11): [True: 0, False: 128] | Branch (55:26): [True: 0, False: 128] ------------------ 56| 0| break; 57| 0| } 58| 128| if ((err = mp_mul_d(a, (mp_digit)radix, a)) != MP_OKAY) { ------------------ | | 161| 128|#define MP_OKAY 0 /* no error */ ------------------ | Branch (58:11): [True: 0, False: 128] ------------------ 59| 0| return err; 60| 0| } 61| 128| if ((err = mp_add_d(a, (mp_digit)y, a)) != MP_OKAY) { ------------------ | | 161| 128|#define MP_OKAY 0 /* no error */ ------------------ | Branch (61:11): [True: 0, False: 128] ------------------ 62| 0| return err; 63| 0| } 64| 128| ++str; 65| 128| } 66| | 67| | /* if an illegal character was found, fail. */ 68| 2| if (!((*str == '\0') || (*str == '\r') || (*str == '\n'))) { ------------------ | Branch (68:10): [True: 2, False: 0] | Branch (68:28): [True: 0, False: 0] | Branch (68:46): [True: 0, False: 0] ------------------ 69| 0| mp_zero(a); 70| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 71| 0| } 72| | 73| | /* set the sign only if a != 0 */ 74| 2| if (!MP_IS_ZERO(a)) { ------------------ | | 163| 2|#define MP_IS_ZERO(a) ((a)->used == 0) ------------------ | Branch (74:8): [True: 2, False: 0] ------------------ 75| 2| a->sign = neg; 76| 2| } 77| 2| return MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 78| 2|} mp_rshd: 8| 2|{ 9| 2| int x; 10| 2| mp_digit *bottom, *top; 11| | 12| | /* if b <= 0 then ignore it */ 13| 2| if (b <= 0) { ------------------ | Branch (13:8): [True: 0, False: 2] ------------------ 14| 0| return; 15| 0| } 16| | 17| | /* if b > used then simply zero it and return */ 18| 2| if (a->used <= b) { ------------------ | Branch (18:8): [True: 0, False: 2] ------------------ 19| 0| mp_zero(a); 20| 0| return; 21| 0| } 22| | 23| | /* shift the digits down */ 24| | 25| | /* bottom */ 26| 2| bottom = a->dp; 27| | 28| | /* top [offset into digits] */ 29| 2| top = a->dp + b; 30| | 31| | /* this is implemented as a sliding window where 32| | * the window is b-digits long and digits from 33| | * the top of the window are copied to the bottom 34| | * 35| | * e.g. 36| | 37| | b-2 | b-1 | b0 | b1 | b2 | ... | bb | ----> 38| | /\ | ----> 39| | \-------------------/ ----> 40| | */ 41| 12| for (x = 0; x < (a->used - b); x++) { ------------------ | Branch (41:16): [True: 10, False: 2] ------------------ 42| 10| *bottom++ = *top++; 43| 10| } 44| | 45| | /* zero the top digits */ 46| 2| MP_ZERO_DIGITS(bottom, a->used - x); ------------------ | | 89| 2|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 2|do { \ | | 91| 2| int zd_ = (digits); \ | | 92| 2| mp_digit* zm_ = (mem); \ | | 93| 12| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 10, False: 2] | | ------------------ | | 94| 10| *zm_++ = 0; \ | | 95| 10| } \ | | 96| 2|} while (0) | | ------------------ | | | Branch (96:10): [Folded, False: 2] | | ------------------ ------------------ 47| | 48| | /* remove excess digits */ 49| 2| a->used -= b; 50| 2|} mp_set: 8| 1|{ 9| 1| a->dp[0] = b & MP_MASK; ------------------ | | 106| 1|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 1|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 10| 1| a->sign = MP_ZPOS; ------------------ | | 151| 1|#define MP_ZPOS 0 /* positive integer */ ------------------ 11| 1| a->used = (a->dp[0] != 0u) ? 1 : 0; ------------------ | Branch (11:15): [True: 1, False: 0] ------------------ 12| 1| MP_ZERO_DIGITS(a->dp + a->used, a->alloc - a->used); ------------------ | | 89| 1|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 1|do { \ | | 91| 1| int zd_ = (digits); \ | | 92| 1| mp_digit* zm_ = (mem); \ | | 93| 32| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 31, False: 1] | | ------------------ | | 94| 31| *zm_++ = 0; \ | | 95| 31| } \ | | 96| 1|} while (0) | | ------------------ | | | Branch (96:10): [Folded, False: 1] | | ------------------ ------------------ 13| 1|} mp_sqr: 8| 2|{ 9| 2| mp_err err; 10| 2| if (MP_HAS(S_MP_TOOM_SQR) && /* use Toom-Cook? */ ------------------ | | 150| 4|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 2|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 2|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded, False: 2] | | ------------------ ------------------ 11| 0| (a->used >= MP_TOOM_SQR_CUTOFF)) { ------------------ | | 124| 0|# define MP_TOOM_SQR_CUTOFF TOOM_SQR_CUTOFF ------------------ | Branch (11:8): [True: 0, False: 0] ------------------ 12| 0| err = s_mp_toom_sqr(a, b); 13| 2| } else if (MP_HAS(S_MP_KARATSUBA_SQR) && /* Karatsuba? */ ------------------ | | 150| 4|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 2|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 2|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [Folded, False: 2] | | ------------------ ------------------ 14| 0| (a->used >= MP_KARATSUBA_SQR_CUTOFF)) { ------------------ | | 122| 0|# define MP_KARATSUBA_SQR_CUTOFF KARATSUBA_SQR_CUTOFF ------------------ | Branch (14:15): [True: 0, False: 0] ------------------ 15| 0| err = s_mp_karatsuba_sqr(a, b); 16| 2| } else if (MP_HAS(S_MP_SQR_FAST) && /* can we use the fast comba multiplier? */ ------------------ | | 150| 4|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 2|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 2|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [True: 2, Folded] | | ------------------ ------------------ 17| 2| (((a->used * 2) + 1) < MP_WARRAY) && ------------------ | | 172| 2|#define MP_WARRAY PRIVATE_MP_WARRAY | | ------------------ | | | | 203| 2|#define PRIVATE_MP_WARRAY (int)(1uLL << (((CHAR_BIT * sizeof(private_mp_word)) - (2 * MP_DIGIT_BIT)) + 1)) | | | | ------------------ | | | | | | 82| 2|# define MP_DIGIT_BIT 60 | | | | ------------------ | | ------------------ ------------------ | Branch (17:15): [True: 2, False: 0] ------------------ 18| 2| (a->used < (MP_MAXFAST / 2))) { ------------------ | | 168| 2|#define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 167| 2|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) | | ------------------ | | #define MP_MAXFAST (int)(1uL << (MP_SIZEOF_BITS(mp_word) - (2u * (size_t)MP_DIGIT_BIT))) | | ------------------ | | | | 82| 2|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ | Branch (18:15): [True: 2, False: 0] ------------------ 19| 2| err = s_mp_sqr_fast(a, b); 20| 2| } else if (MP_HAS(S_MP_SQR)) { ------------------ | | 150| 0|#define MP_HAS(x) (sizeof(MP_STRINGIZE(BN_##x##_C)) == 1u) | | ------------------ | | | | 148| 0|#define MP_STRINGIZE(x) MP__STRINGIZE(x) | | | | ------------------ | | | | | | 149| 0|#define MP__STRINGIZE(x) ""#x"" | | | | ------------------ | | ------------------ | | | Branch (150:26): [True: 0, Folded] | | ------------------ ------------------ 21| 0| err = s_mp_sqr(a, b); 22| 0| } else { 23| 0| err = MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 24| 0| } 25| 2| b->sign = MP_ZPOS; ------------------ | | 151| 2|#define MP_ZPOS 0 /* positive integer */ ------------------ 26| 2| return err; 27| 2|} mp_sub: 8| 11|{ 9| 11| mp_sign sa = a->sign, sb = b->sign; 10| 11| mp_err err; 11| | 12| 11| if (sa != sb) { ------------------ | Branch (12:8): [True: 0, False: 11] ------------------ 13| | /* subtract a negative from a positive, OR */ 14| | /* subtract a positive from a negative. */ 15| | /* In either case, ADD their magnitudes, */ 16| | /* and use the sign of the first number. */ 17| 0| c->sign = sa; 18| 0| err = s_mp_add(a, b, c); 19| 11| } else { 20| | /* subtract a positive from a positive, OR */ 21| | /* subtract a negative from a negative. */ 22| | /* First, take the difference between their */ 23| | /* magnitudes, then... */ 24| 11| if (mp_cmp_mag(a, b) != MP_LT) { ------------------ | | 154| 11|#define MP_LT -1 /* less than */ ------------------ | Branch (24:11): [True: 11, False: 0] ------------------ 25| | /* Copy the sign from the first */ 26| 11| c->sign = sa; 27| | /* The first has a larger or equal magnitude */ 28| 11| err = s_mp_sub(a, b, c); 29| 11| } else { 30| | /* The result has the *opposite* sign from */ 31| | /* the first number. */ 32| 0| c->sign = (sa == MP_ZPOS) ? MP_NEG : MP_ZPOS; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ c->sign = (sa == MP_ZPOS) ? MP_NEG : MP_ZPOS; ------------------ | | 152| 0|#define MP_NEG 1 /* negative */ ------------------ c->sign = (sa == MP_ZPOS) ? MP_NEG : MP_ZPOS; ------------------ | | 151| 0|#define MP_ZPOS 0 /* positive integer */ ------------------ | Branch (32:20): [True: 0, False: 0] ------------------ 33| | /* The second has a larger magnitude */ 34| 0| err = s_mp_sub(b, a, c); 35| 0| } 36| 11| } 37| 11| return err; 38| 11|} mp_to_ubin: 8| 6.16k|{ 9| 6.16k| size_t x, count; 10| 6.16k| mp_err err; 11| 6.16k| mp_int t; 12| | 13| 6.16k| count = mp_ubin_size(a); 14| 6.16k| if (count > maxlen) { ------------------ | Branch (14:8): [True: 0, False: 6.16k] ------------------ 15| 0| return MP_BUF; ------------------ | | 167| 0|#define MP_BUF -5 /* buffer overflow, supplied buffer too small */ ------------------ 16| 0| } 17| | 18| 6.16k| if ((err = mp_init_copy(&t, a)) != MP_OKAY) { ------------------ | | 161| 6.16k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (18:8): [True: 0, False: 6.16k] ------------------ 19| 0| return err; 20| 0| } 21| | 22| 24.6k| for (x = count; x --> 0u;) { ------------------ | Branch (22:20): [True: 18.5k, False: 6.16k] ------------------ 23| 18.5k|#ifndef MP_8BIT 24| 18.5k| buf[x] = (unsigned char)(t.dp[0] & 255u); 25| |#else 26| | buf[x] = (unsigned char)(t.dp[0] | ((t.dp[1] & 1u) << 7)); 27| |#endif 28| 18.5k| if ((err = mp_div_2d(&t, 8, &t, NULL)) != MP_OKAY) { ------------------ | | 161| 18.5k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (28:11): [True: 0, False: 18.5k] ------------------ 29| 0| goto LBL_ERR; 30| 0| } 31| 18.5k| } 32| | 33| 6.16k| if (written != NULL) { ------------------ | Branch (33:8): [True: 6.16k, False: 0] ------------------ 34| 6.16k| *written = count; 35| 6.16k| } 36| | 37| 6.16k|LBL_ERR: 38| 6.16k| mp_clear(&t); 39| 6.16k| return err; 40| 6.16k|} mp_ubin_size: 8| 6.16k|{ 9| 6.16k| size_t size = (size_t)mp_count_bits(a); 10| 6.16k| return (size / 8u) + (((size & 7u) != 0u) ? 1u : 0u); ------------------ | Branch (10:26): [True: 0, False: 6.16k] ------------------ 11| 6.16k|} mp_zero: 8| 1.70k|{ 9| 1.70k| a->sign = MP_ZPOS; ------------------ | | 151| 1.70k|#define MP_ZPOS 0 /* positive integer */ ------------------ 10| 1.70k| a->used = 0; 11| 1.70k| MP_ZERO_DIGITS(a->dp, a->alloc); ------------------ | | 89| 1.70k|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 1.70k|do { \ | | 91| 1.70k| int zd_ = (digits); \ | | 92| 1.70k| mp_digit* zm_ = (mem); \ | | 93| 56.1k| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 54.4k, False: 1.70k] | | ------------------ | | 94| 54.4k| *zm_++ = 0; \ | | 95| 54.4k| } \ | | 96| 1.70k|} while (0) | | ------------------ | | | Branch (96:10): [Folded, False: 1.70k] | | ------------------ ------------------ 12| 1.70k|} s_mp_add: 8| 3|{ 9| 3| const mp_int *x; 10| 3| mp_err err; 11| 3| int olduse, min, max; 12| | 13| | /* find sizes, we let |a| <= |b| which means we have to sort 14| | * them. "x" will point to the input with the most digits 15| | */ 16| 3| if (a->used > b->used) { ------------------ | Branch (16:8): [True: 3, False: 0] ------------------ 17| 3| min = b->used; 18| 3| max = a->used; 19| 3| x = a; 20| 3| } else { 21| 0| min = a->used; 22| 0| max = b->used; 23| 0| x = b; 24| 0| } 25| | 26| | /* init result */ 27| 3| if (c->alloc < (max + 1)) { ------------------ | Branch (27:8): [True: 0, False: 3] ------------------ 28| 0| if ((err = mp_grow(c, max + 1)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (28:11): [True: 0, False: 0] ------------------ 29| 0| return err; 30| 0| } 31| 0| } 32| | 33| | /* get old used digit count and set new one */ 34| 3| olduse = c->used; 35| 3| c->used = max + 1; 36| | 37| 3| { 38| 3| mp_digit u, *tmpa, *tmpb, *tmpc; 39| 3| int i; 40| | 41| | /* alias for digit pointers */ 42| | 43| | /* first input */ 44| 3| tmpa = a->dp; 45| | 46| | /* second input */ 47| 3| tmpb = b->dp; 48| | 49| | /* destination */ 50| 3| tmpc = c->dp; 51| | 52| | /* zero the carry */ 53| 3| u = 0; 54| 18| for (i = 0; i < min; i++) { ------------------ | Branch (54:19): [True: 15, False: 3] ------------------ 55| | /* Compute the sum at one digit, T[i] = A[i] + B[i] + U */ 56| 15| *tmpc = *tmpa++ + *tmpb++ + u; 57| | 58| | /* U = carry bit of T[i] */ 59| 15| u = *tmpc >> (mp_digit)MP_DIGIT_BIT; ------------------ | | 82| 15|# define MP_DIGIT_BIT 60 ------------------ 60| | 61| | /* take away carry bit from T[i] */ 62| 15| *tmpc++ &= MP_MASK; ------------------ | | 106| 15|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 15|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 63| 15| } 64| | 65| | /* now copy higher words if any, that is in A+B 66| | * if A or B has more digits add those in 67| | */ 68| 3| if (min != max) { ------------------ | Branch (68:11): [True: 3, False: 0] ------------------ 69| 15| for (; i < max; i++) { ------------------ | Branch (69:17): [True: 12, False: 3] ------------------ 70| | /* T[i] = X[i] + U */ 71| 12| *tmpc = x->dp[i] + u; 72| | 73| | /* U = carry bit of T[i] */ 74| 12| u = *tmpc >> (mp_digit)MP_DIGIT_BIT; ------------------ | | 82| 12|# define MP_DIGIT_BIT 60 ------------------ 75| | 76| | /* take away carry bit from T[i] */ 77| 12| *tmpc++ &= MP_MASK; ------------------ | | 106| 12|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 12|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 78| 12| } 79| 3| } 80| | 81| | /* add carry */ 82| 3| *tmpc++ = u; 83| | 84| | /* clear digits above oldused */ 85| 3| MP_ZERO_DIGITS(tmpc, olduse - c->used); ------------------ | | 89| 3|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 3|do { \ | | 91| 3| int zd_ = (digits); \ | | 92| 3| mp_digit* zm_ = (mem); \ | | 93| 3| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 3] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 3|} while (0) | | ------------------ | | | Branch (96:10): [Folded, False: 3] | | ------------------ ------------------ 86| 3| } 87| | 88| 3| mp_clamp(c); 89| 3| return MP_OKAY; ------------------ | | 161| 3|#define MP_OKAY 0 /* no error */ ------------------ 90| 3|} s_mp_mul_digs_fast: 23| 1|{ 24| 1| int olduse, pa, ix, iz; 25| 1| mp_err err; 26| 1| mp_digit W[MP_WARRAY]; 27| 1| mp_word _W; 28| | 29| 1| if (digs < 0) { ------------------ | Branch (29:8): [True: 0, False: 1] ------------------ 30| 0| return MP_VAL; ------------------ | | 164| 0|#define MP_VAL -3 /* invalid input */ ------------------ 31| 0| } 32| | 33| | /* grow the destination as required */ 34| 1| if (c->alloc < digs) { ------------------ | Branch (34:8): [True: 1, False: 0] ------------------ 35| 1| if ((err = mp_grow(c, digs)) != MP_OKAY) { ------------------ | | 161| 1|#define MP_OKAY 0 /* no error */ ------------------ | Branch (35:11): [True: 0, False: 1] ------------------ 36| 0| return err; 37| 0| } 38| 1| } 39| | 40| | /* number of output digits to produce */ 41| 1| pa = MP_MIN(digs, a->used + b->used); ------------------ | | 156| 1|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 0, False: 1] | | ------------------ ------------------ 42| | 43| | /* clear the carry */ 44| 1| _W = 0; 45| 11| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (45:17): [True: 10, False: 1] ------------------ 46| 10| int tx, ty; 47| 10| int iy; 48| 10| mp_digit *tmpx, *tmpy; 49| | 50| | /* get offsets into the two bignums */ 51| 10| ty = MP_MIN(b->used-1, ix); ------------------ | | 156| 10|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 5, False: 5] | | ------------------ ------------------ 52| 10| tx = ix - ty; 53| | 54| | /* setup temp aliases */ 55| 10| tmpx = a->dp + tx; 56| 10| tmpy = b->dp + ty; 57| | 58| | /* this is the number of times the loop will iterrate, essentially 59| | while (tx++ < a->used && ty-- >= 0) { ... } 60| | */ 61| 10| iy = MP_MIN(a->used-tx, ty+1); ------------------ | | 156| 10|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 5, False: 5] | | ------------------ ------------------ 62| | 63| | /* execute loop */ 64| 35| for (iz = 0; iz < iy; ++iz) { ------------------ | Branch (64:20): [True: 25, False: 10] ------------------ 65| 25| _W += (mp_word)*tmpx++ * (mp_word)*tmpy--; 66| | 67| 25| } 68| | 69| | /* store term */ 70| 10| W[ix] = (mp_digit)_W & MP_MASK; ------------------ | | 106| 10|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 10|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 71| | 72| | /* make next carry */ 73| 10| _W = _W >> (mp_word)MP_DIGIT_BIT; ------------------ | | 82| 10|# define MP_DIGIT_BIT 60 ------------------ 74| 10| } 75| | 76| | /* setup dest */ 77| 1| olduse = c->used; 78| 1| c->used = pa; 79| | 80| 1| { 81| 1| mp_digit *tmpc; 82| 1| tmpc = c->dp; 83| 11| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (83:20): [True: 10, False: 1] ------------------ 84| | /* now extract the previous digit [below the carry] */ 85| 10| *tmpc++ = W[ix]; 86| 10| } 87| | 88| | /* clear unused digits [that existed in the old copy of c] */ 89| 1| MP_ZERO_DIGITS(tmpc, olduse - ix); ------------------ | | 89| 1|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 1|do { \ | | 91| 1| int zd_ = (digits); \ | | 92| 1| mp_digit* zm_ = (mem); \ | | 93| 1| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 1] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 1|} while (0) | | ------------------ | | | Branch (96:10): [Folded, False: 1] | | ------------------ ------------------ 90| 1| } 91| 1| mp_clamp(c); 92| 1| return MP_OKAY; ------------------ | | 161| 1|#define MP_OKAY 0 /* no error */ ------------------ 93| 1|} s_mp_sqr_fast: 17| 2|{ 18| 2| int olduse, pa, ix, iz; 19| 2| mp_digit W[MP_WARRAY], *tmpx; 20| 2| mp_word W1; 21| 2| mp_err err; 22| | 23| | /* grow the destination as required */ 24| 2| pa = a->used + a->used; 25| 2| if (b->alloc < pa) { ------------------ | Branch (25:8): [True: 0, False: 2] ------------------ 26| 0| if ((err = mp_grow(b, pa)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (26:11): [True: 0, False: 0] ------------------ 27| 0| return err; 28| 0| } 29| 0| } 30| | 31| | /* number of output digits to produce */ 32| 2| W1 = 0; 33| 22| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (33:17): [True: 20, False: 2] ------------------ 34| 20| int tx, ty, iy; 35| 20| mp_word _W; 36| 20| mp_digit *tmpy; 37| | 38| | /* clear counter */ 39| 20| _W = 0; 40| | 41| | /* get offsets into the two bignums */ 42| 20| ty = MP_MIN(a->used-1, ix); ------------------ | | 156| 20|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 10, False: 10] | | ------------------ ------------------ 43| 20| tx = ix - ty; 44| | 45| | /* setup temp aliases */ 46| 20| tmpx = a->dp + tx; 47| 20| tmpy = a->dp + ty; 48| | 49| | /* this is the number of times the loop will iterrate, essentially 50| | while (tx++ < a->used && ty-- >= 0) { ... } 51| | */ 52| 20| iy = MP_MIN(a->used-tx, ty+1); ------------------ | | 156| 20|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 10, False: 10] | | ------------------ ------------------ 53| | 54| | /* now for squaring tx can never equal ty 55| | * we halve the distance since they approach at a rate of 2x 56| | * and we have to round because odd cases need to be executed 57| | */ 58| 20| iy = MP_MIN(iy, ((ty-tx)+1)>>1); ------------------ | | 156| 20|#define MP_MIN(x, y) (((x) < (y)) ? (x) : (y)) | | ------------------ | | | Branch (156:23): [True: 0, False: 20] | | ------------------ ------------------ 59| | 60| | /* execute loop */ 61| 40| for (iz = 0; iz < iy; iz++) { ------------------ | Branch (61:20): [True: 20, False: 20] ------------------ 62| 20| _W += (mp_word)*tmpx++ * (mp_word)*tmpy--; 63| 20| } 64| | 65| | /* double the inner product and add carry */ 66| 20| _W = _W + _W + W1; 67| | 68| | /* even columns have the square term in them */ 69| 20| if (((unsigned)ix & 1u) == 0u) { ------------------ | Branch (69:11): [True: 10, False: 10] ------------------ 70| 10| _W += (mp_word)a->dp[ix>>1] * (mp_word)a->dp[ix>>1]; 71| 10| } 72| | 73| | /* store it */ 74| 20| W[ix] = (mp_digit)_W & MP_MASK; ------------------ | | 106| 20|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 20|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 75| | 76| | /* make next carry */ 77| 20| W1 = _W >> (mp_word)MP_DIGIT_BIT; ------------------ | | 82| 20|# define MP_DIGIT_BIT 60 ------------------ 78| 20| } 79| | 80| | /* setup dest */ 81| 2| olduse = b->used; 82| 2| b->used = a->used+a->used; 83| | 84| 2| { 85| 2| mp_digit *tmpb; 86| 2| tmpb = b->dp; 87| 22| for (ix = 0; ix < pa; ix++) { ------------------ | Branch (87:20): [True: 20, False: 2] ------------------ 88| 20| *tmpb++ = W[ix] & MP_MASK; ------------------ | | 106| 20|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 20|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 89| 20| } 90| | 91| | /* clear unused digits [that existed in the old copy of c] */ 92| 2| MP_ZERO_DIGITS(tmpb, olduse - ix); ------------------ | | 89| 2|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 2|do { \ | | 91| 2| int zd_ = (digits); \ | | 92| 2| mp_digit* zm_ = (mem); \ | | 93| 2| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 2] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 2|} while (0) | | ------------------ | | | Branch (96:10): [Folded, False: 2] | | ------------------ ------------------ 93| 2| } 94| 2| mp_clamp(b); 95| 2| return MP_OKAY; ------------------ | | 161| 2|#define MP_OKAY 0 /* no error */ ------------------ 96| 2|} s_mp_sub: 8| 11|{ 9| 11| int olduse, min, max; 10| 11| mp_err err; 11| | 12| | /* find sizes */ 13| 11| min = b->used; 14| 11| max = a->used; 15| | 16| | /* init result */ 17| 11| if (c->alloc < max) { ------------------ | Branch (17:8): [True: 0, False: 11] ------------------ 18| 0| if ((err = mp_grow(c, max)) != MP_OKAY) { ------------------ | | 161| 0|#define MP_OKAY 0 /* no error */ ------------------ | Branch (18:11): [True: 0, False: 0] ------------------ 19| 0| return err; 20| 0| } 21| 0| } 22| 11| olduse = c->used; 23| 11| c->used = max; 24| | 25| 11| { 26| 11| mp_digit u, *tmpa, *tmpb, *tmpc; 27| 11| int i; 28| | 29| | /* alias for digit pointers */ 30| 11| tmpa = a->dp; 31| 11| tmpb = b->dp; 32| 11| tmpc = c->dp; 33| | 34| | /* set carry to zero */ 35| 11| u = 0; 36| 100| for (i = 0; i < min; i++) { ------------------ | Branch (36:19): [True: 89, False: 11] ------------------ 37| | /* T[i] = A[i] - B[i] - U */ 38| 89| *tmpc = (*tmpa++ - *tmpb++) - u; 39| | 40| | /* U = carry bit of T[i] 41| | * Note this saves performing an AND operation since 42| | * if a carry does occur it will propagate all the way to the 43| | * MSB. As a result a single shift is enough to get the carry 44| | */ 45| 89| u = *tmpc >> (MP_SIZEOF_BITS(mp_digit) - 1u); ------------------ | | 167| 89|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ 46| | 47| | /* Clear carry from T[i] */ 48| 89| *tmpc++ &= MP_MASK; ------------------ | | 106| 89|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 89|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 49| 89| } 50| | 51| | /* now copy higher words if any, e.g. if A has more digits than B */ 52| 11| for (; i < max; i++) { ------------------ | Branch (52:14): [True: 0, False: 11] ------------------ 53| | /* T[i] = A[i] - U */ 54| 0| *tmpc = *tmpa++ - u; 55| | 56| | /* U = carry bit of T[i] */ 57| 0| u = *tmpc >> (MP_SIZEOF_BITS(mp_digit) - 1u); ------------------ | | 167| 0|#define MP_SIZEOF_BITS(type) ((size_t)CHAR_BIT * sizeof(type)) ------------------ 58| | 59| | /* Clear carry from T[i] */ 60| 0| *tmpc++ &= MP_MASK; ------------------ | | 106| 0|#define MP_MASK ((((mp_digit)1)<<((mp_digit)MP_DIGIT_BIT))-((mp_digit)1)) | | ------------------ | | | | 82| 0|# define MP_DIGIT_BIT 60 | | ------------------ ------------------ 61| 0| } 62| | 63| | /* clear digits above used (since we may not have grown result above) */ 64| 11| MP_ZERO_DIGITS(tmpc, olduse - c->used); ------------------ | | 89| 11|# define MP_ZERO_DIGITS(mem, digits) \ | | 90| 11|do { \ | | 91| 11| int zd_ = (digits); \ | | 92| 11| mp_digit* zm_ = (mem); \ | | 93| 11| while (zd_-- > 0) { \ | | ------------------ | | | Branch (93:11): [True: 0, False: 11] | | ------------------ | | 94| 0| *zm_++ = 0; \ | | 95| 0| } \ | | 96| 11|} while (0) | | ------------------ | | | Branch (96:10): [Folded, False: 11] | | ------------------ ------------------ 65| 11| } 66| | 67| 11| mp_clamp(c); 68| 11| return MP_OKAY; ------------------ | | 161| 11|#define MP_OKAY 0 /* no error */ ------------------ 69| 11|} m_mp_init: 31| 1.75k|void m_mp_init(mp_int *mp) { 32| | 33| 1.75k| if (mp_init(mp) != MP_OKAY) { ------------------ | | 161| 1.75k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (33:6): [True: 0, False: 1.75k] ------------------ 34| 0| dropbear_exit("Mem alloc error"); 35| 0| } 36| 1.75k|} m_mp_alloc_init_multi: 56| 6.17k|{ 57| 6.17k| mp_int** cur_arg = mp; 58| 6.17k| va_list args; 59| | 60| 6.17k| va_start(args, mp); /* init args to next argument from caller */ 61| 12.3k| while (cur_arg != NULL) { ------------------ | Branch (61:9): [True: 6.18k, False: 6.17k] ------------------ 62| 6.18k| *cur_arg = m_malloc(sizeof(mp_int)); 63| 6.18k| if (mp_init(*cur_arg) != MP_OKAY) { ------------------ | | 161| 6.18k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (63:7): [True: 0, False: 6.18k] ------------------ 64| 0| dropbear_exit("Mem alloc error"); 65| 0| } 66| 6.18k| cur_arg = va_arg(args, mp_int**); 67| 6.18k| } 68| 6.17k| va_end(args); 69| 6.17k|} hash_process_mp: 96| 6.16k| hash_state *hs, const mp_int *mp) { 97| 6.16k| buffer * buf; 98| | 99| 6.16k| buf = buf_new(512 + 20); /* max buffer is a 4096 bit key, 100| | plus header + some leeway*/ 101| 6.16k| buf_putmpint(buf, mp); 102| 6.16k| hash_desc->process(hs, buf->data, buf->len); 103| 6.16k| buf_burn_free(buf); 104| 6.16k|} buf_new: 41| 120k|buffer* buf_new(unsigned int size) { 42| 120k| buffer* buf; 43| 120k| if (size > BUF_MAX_SIZE) { ------------------ | | 35| 120k|#define BUF_MAX_SIZE 1000000000 ------------------ | Branch (43:6): [True: 0, False: 120k] ------------------ 44| 0| dropbear_exit("buf->size too big"); 45| 0| } 46| | 47| 120k| buf = (buffer*)m_malloc(sizeof(buffer)+size); 48| 120k| buf->data = (unsigned char*)buf + sizeof(buffer); 49| 120k| buf->size = size; 50| 120k| return buf; 51| 120k|} buf_free: 54| 91.1k|void buf_free(buffer* buf) { 55| | m_free(buf); ------------------ | | 24| 91.1k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 91.1k] | | ------------------ ------------------ 56| 91.1k|} buf_burn_free: 59| 27.5k|void buf_burn_free(buffer* buf) { 60| 27.5k| m_burn(buf->data, buf->size); 61| | m_free(buf); ------------------ | | 24| 27.5k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 27.5k] | | ------------------ ------------------ 62| 27.5k|} buf_resize: 67| 7.53k|buffer* buf_resize(buffer *buf, unsigned int newsize) { 68| 7.53k| if (newsize > BUF_MAX_SIZE) { ------------------ | | 35| 7.53k|#define BUF_MAX_SIZE 1000000000 ------------------ | Branch (68:6): [True: 0, False: 7.53k] ------------------ 69| 0| dropbear_exit("buf->size too big"); 70| 0| } 71| | 72| 7.53k| buf = m_realloc(buf, sizeof(buffer)+newsize); 73| 7.53k| buf->data = (unsigned char*)buf + sizeof(buffer); 74| 7.53k| buf->size = newsize; 75| 7.53k| buf->len = MIN(newsize, buf->len); ------------------ | Branch (75:13): [True: 0, False: 7.53k] ------------------ 76| | buf->pos = MIN(newsize, buf->pos); ------------------ | Branch (76:13): [True: 0, False: 7.53k] ------------------ 77| 7.53k| return buf; 78| 7.53k|} buf_newcopy: 82| 9.20k|buffer* buf_newcopy(const buffer* buf) { 83| | 84| 9.20k| buffer* ret; 85| | 86| 9.20k| ret = buf_new(buf->len); 87| 9.20k| ret->len = buf->len; 88| 9.20k| if (buf->len > 0) { ------------------ | Branch (88:6): [True: 9.20k, False: 0] ------------------ 89| 9.20k| memcpy(ret->data, buf->data, buf->len); 90| 9.20k| } 91| 9.20k| return ret; 92| 9.20k|} buf_setlen: 95| 161k|void buf_setlen(buffer* buf, unsigned int len) { 96| 161k| if (len > buf->size) { ------------------ | Branch (96:6): [True: 0, False: 161k] ------------------ 97| 0| dropbear_exit("Bad buf_setlen"); 98| 0| } 99| 161k| buf->len = len; 100| | buf->pos = MIN(buf->pos, buf->len); ------------------ | Branch (100:13): [True: 126k, False: 35.3k] ------------------ 101| 161k|} buf_incrlen: 104| 209k|void buf_incrlen(buffer* buf, unsigned int incr) { 105| 209k| if (incr > BUF_MAX_INCR || buf->len + incr > buf->size) { ------------------ | | 34| 418k|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (105:6): [True: 0, False: 209k] | Branch (105:29): [True: 0, False: 209k] ------------------ 106| 0| dropbear_exit("Bad buf_incrlen"); 107| 0| } 108| 209k| buf->len += incr; 109| 209k|} buf_setpos: 111| 644k|void buf_setpos(buffer* buf, unsigned int pos) { 112| | 113| 644k| if (pos > buf->len) { ------------------ | Branch (113:6): [True: 0, False: 644k] ------------------ 114| 0| dropbear_exit("Bad buf_setpos"); 115| 0| } 116| 644k| buf->pos = pos; 117| 644k|} buf_incrwritepos: 120| 726k|void buf_incrwritepos(buffer* buf, unsigned int incr) { 121| 726k| if (incr > BUF_MAX_INCR || buf->pos + incr > buf->size) { ------------------ | | 34| 1.45M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (121:6): [True: 0, False: 726k] | Branch (121:29): [True: 0, False: 726k] ------------------ 122| 0| dropbear_exit("Bad buf_incrwritepos"); 123| 0| } 124| 726k| buf->pos += incr; 125| 726k| if (buf->pos > buf->len) { ------------------ | Branch (125:6): [True: 535k, False: 191k] ------------------ 126| 535k| buf->len = buf->pos; 127| 535k| } 128| 726k|} buf_incrpos: 131| 672k|void buf_incrpos(buffer* buf, unsigned int incr) { 132| 672k| if (incr > BUF_MAX_INCR ------------------ | | 34| 1.34M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (132:6): [True: 17, False: 672k] ------------------ 133| 672k| || (buf->pos + incr) > buf->len) { ------------------ | Branch (133:6): [True: 111, False: 672k] ------------------ 134| 128| dropbear_exit("Bad buf_incrpos"); 135| 128| } 136| 672k| buf->pos += incr; 137| 672k|} buf_decrpos: 140| 4|void buf_decrpos(buffer* buf, unsigned int decr) { 141| 4| if (decr > buf->pos) { ------------------ | Branch (141:6): [True: 0, False: 4] ------------------ 142| 0| dropbear_exit("Bad buf_decrpos"); 143| 0| } 144| 4| buf->pos -= decr; 145| 4|} buf_getbyte: 148| 126k|unsigned char buf_getbyte(buffer* buf) { 149| | 150| | /* This check is really just ==, but the >= allows us to check for the 151| | * bad case of pos > len, which should _never_ happen. */ 152| 126k| if (buf->pos >= buf->len) { ------------------ | Branch (152:6): [True: 3, False: 126k] ------------------ 153| 3| dropbear_exit("Bad buf_getbyte"); 154| 3| } 155| 126k| return buf->data[buf->pos++]; 156| 126k|} buf_getbool: 159| 6.87k|unsigned char buf_getbool(buffer* buf) { 160| | 161| 6.87k| unsigned char b; 162| 6.87k| b = buf_getbyte(buf); 163| 6.87k| if (b != 0) ------------------ | Branch (163:6): [True: 535, False: 6.34k] ------------------ 164| 535| b = 1; 165| 6.87k| return b; 166| 6.87k|} buf_putbyte: 169| 200k|void buf_putbyte(buffer* buf, unsigned char val) { 170| | 171| 200k| if (buf->pos >= buf->len) { ------------------ | Branch (171:6): [True: 165k, False: 35.3k] ------------------ 172| 165k| buf_incrlen(buf, 1); 173| 165k| } 174| 200k| buf->data[buf->pos] = val; 175| 200k| buf->pos++; 176| 200k|} buf_getptr: 180| 834k|unsigned char* buf_getptr(const buffer* buf, unsigned int len) { 181| | 182| 834k| if (len > BUF_MAX_INCR || buf->pos + len > buf->len) { ------------------ | | 34| 1.66M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (182:6): [True: 9, False: 833k] | Branch (182:28): [True: 230, False: 833k] ------------------ 183| 239| dropbear_exit("Bad buf_getptr"); 184| 239| } 185| 833k| return &buf->data[buf->pos]; 186| 834k|} buf_getwriteptr: 190| 797k|unsigned char* buf_getwriteptr(const buffer* buf, unsigned int len) { 191| | 192| 797k| if (len > BUF_MAX_INCR || buf->pos + len > buf->size) { ------------------ | | 34| 1.59M|#define BUF_MAX_INCR 1000000000 ------------------ | Branch (192:6): [True: 0, False: 797k] | Branch (192:28): [True: 0, False: 797k] ------------------ 193| 0| dropbear_exit("Bad buf_getwriteptr"); 194| 0| } 195| 797k| return &buf->data[buf->pos]; 196| 797k|} buf_getstring: 201| 70.2k|char* buf_getstring(buffer* buf, unsigned int *retlen) { 202| | 203| 70.2k| unsigned int len; 204| 70.2k| char* ret; 205| 70.2k| void* src = NULL; 206| 70.2k| len = buf_getint(buf); 207| 70.2k| if (len > MAX_STRING_LEN) { ------------------ | | 253| 70.2k|#define MAX_STRING_LEN (MAX(MAX_CMD_LEN, 2400)) /* Sun SSH needs 2400 for algos, ------------------ | Branch (207:6): [True: 61, False: 70.2k] | Branch (207:12): [True: 70.2k, Folded] ------------------ 208| 61| dropbear_exit("String too long"); 209| 61| } 210| | 211| 70.2k| if (retlen != NULL) { ------------------ | Branch (211:6): [True: 70.1k, False: 40] ------------------ 212| 70.1k| *retlen = len; 213| 70.1k| } 214| 70.2k| src = buf_getptr(buf, len); 215| 70.2k| ret = m_malloc(len+1); 216| 70.2k| memcpy(ret, src, len); 217| 70.2k| buf_incrpos(buf, len); 218| 70.2k| ret[len] = '\0'; 219| | 220| 70.2k| return ret; 221| 70.2k|} buf_getstringbuf: 246| 4.65k|buffer * buf_getstringbuf(buffer *buf) { 247| 4.65k| return buf_getstringbuf_int(buf, 0); 248| 4.65k|} buf_eatstring: 266| 13.1k|void buf_eatstring(buffer *buf) { 267| | 268| 13.1k| buf_incrpos( buf, buf_getint(buf) ); 269| 13.1k|} buf_getint: 272| 139k|unsigned int buf_getint(buffer* buf) { 273| 139k| unsigned int ret; 274| | 275| 139k| LOAD32H(ret, buf_getptr(buf, 4)); ------------------ | | 66| 139k|#define LOAD32H(x, y) \ | | 67| 139k|do { XMEMCPY (&(x), (y), 4); \ | | ------------------ | | | | 39| 139k|#define XMEMCPY memcpy | | ------------------ | | 68| 139k| (x) = __builtin_bswap32 ((x)); } while(0) | | ------------------ | | | Branch (68:46): [Folded, False: 139k] | | ------------------ ------------------ 276| 139k| buf_incrpos(buf, 4); 277| 139k| return ret; 278| 139k|} buf_putint: 281| 235k|void buf_putint(buffer* buf, int unsigned val) { 282| | 283| 235k| STORE32H(val, buf_getwriteptr(buf, 4)); ------------------ | | 62| 235k|#define STORE32H(x, y) \ | | 63| 235k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 235k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 235k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded, False: 235k] | | ------------------ ------------------ 284| 235k| buf_incrwritepos(buf, 4); 285| | 286| 235k|} buf_putstring: 289| 43.1k|void buf_putstring(buffer* buf, const char* str, unsigned int len) { 290| | 291| 43.1k| buf_putint(buf, len); 292| 43.1k| buf_putbytes(buf, (const unsigned char*)str, len); 293| | 294| 43.1k|} buf_putbufstring: 297| 962|void buf_putbufstring(buffer *buf, const buffer* buf_str) { 298| 962| buf_putstring(buf, (const char*)buf_str->data, buf_str->len); 299| 962|} buf_putbytes: 303| 255k|void buf_putbytes(buffer *buf, const unsigned char *bytes, unsigned int len) { 304| 255k| memcpy(buf_getwriteptr(buf, len), bytes, len); 305| 255k| buf_incrwritepos(buf, len); 306| 255k|} buf_putmpint: 311| 6.16k|void buf_putmpint(buffer* buf, const mp_int * mp) { 312| 6.16k| size_t written; 313| 6.16k| unsigned int len, pad = 0; 314| 6.16k| TRACE2(("enter buf_putmpint")) 315| | 316| 6.16k| dropbear_assert(mp != NULL); ------------------ | | 84| 6.16k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (84:37): [True: 0, False: 6.16k] | | | Branch (84:93): [Folded, False: 6.16k] | | ------------------ ------------------ 317| | 318| 6.16k| if (mp_isneg(mp)) { ------------------ | | 295| 6.16k|#define mp_isneg(a) (((a)->sign != MP_ZPOS) ? MP_YES : MP_NO) | | ------------------ | | | | 151| 6.16k|#define MP_ZPOS 0 /* positive integer */ | | ------------------ | | #define mp_isneg(a) (((a)->sign != MP_ZPOS) ? MP_YES : MP_NO) | | ------------------ | | | | 158| 0|#define MP_YES 1 | | ------------------ | | #define mp_isneg(a) (((a)->sign != MP_ZPOS) ? MP_YES : MP_NO) | | ------------------ | | | | 159| 6.16k|#define MP_NO 0 | | ------------------ | | | Branch (295:22): [True: 0, False: 6.16k] | | | Branch (295:23): [True: 0, False: 6.16k] | | ------------------ ------------------ 319| 0| dropbear_exit("negative bignum"); 320| 0| } 321| | 322| | /* zero check */ 323| 6.16k| if (mp_iszero(mp)) { ------------------ | | 292| 6.16k|#define mp_iszero(a) (((a)->used == 0) ? MP_YES : MP_NO) | | ------------------ | | | | 158| 0|#define MP_YES 1 | | ------------------ | | #define mp_iszero(a) (((a)->used == 0) ? MP_YES : MP_NO) | | ------------------ | | | | 159| 6.16k|#define MP_NO 0 | | ------------------ | | | Branch (292:22): [True: 0, False: 6.16k] | | | Branch (292:23): [True: 0, False: 6.16k] | | ------------------ ------------------ 324| 0| len = 0; 325| 6.16k| } else { 326| | /* SSH spec requires padding for mpints with the MSB set, this code 327| | * implements it */ 328| 6.16k| len = mp_count_bits(mp); 329| | /* if the top bit of MSB is set, we need to pad */ 330| 6.16k| pad = (len%8 == 0) ? 1 : 0; ------------------ | Branch (330:9): [True: 6.16k, False: 0] ------------------ 331| 6.16k| len = len / 8 + 1; /* don't worry about rounding, we need it for 332| | padding anyway when len%8 == 0 */ 333| | 334| 6.16k| } 335| | 336| | /* store the length */ 337| 6.16k| buf_putint(buf, len); 338| | 339| | /* store the actual value */ 340| 6.16k| if (len > 0) { ------------------ | Branch (340:6): [True: 6.16k, False: 0] ------------------ 341| 6.16k| if (pad) { ------------------ | Branch (341:7): [True: 6.16k, False: 0] ------------------ 342| 6.16k| buf_putbyte(buf, 0x00); 343| 6.16k| } 344| 6.16k| if (mp_to_ubin(mp, buf_getwriteptr(buf, len-pad), len-pad, &written) != MP_OKAY) { ------------------ | | 161| 6.16k|#define MP_OKAY 0 /* no error */ ------------------ | Branch (344:7): [True: 0, False: 6.16k] ------------------ 345| 0| dropbear_exit("mpint error"); 346| 0| } 347| 6.16k| buf_incrwritepos(buf, written); 348| 6.16k| } 349| | 350| 6.16k| TRACE2(("leave buf_putmpint")) 351| 6.16k|} buf_getmpint: 356| 1.76k|int buf_getmpint(buffer* buf, mp_int* mp) { 357| | 358| 1.76k| unsigned int len; 359| 1.76k| len = buf_getint(buf); 360| | 361| 1.76k| if (len == 0) { ------------------ | Branch (361:6): [True: 1.56k, False: 203] ------------------ 362| 1.56k| mp_zero(mp); 363| 1.56k| return DROPBEAR_SUCCESS; ------------------ | | 111| 1.56k|#define DROPBEAR_SUCCESS 0 ------------------ 364| 1.56k| } 365| | 366| 203| if (len > BUF_MAX_MPINT) { ------------------ | | 38| 203|#define BUF_MAX_MPINT (8240 / 8) ------------------ | Branch (366:6): [True: 48, False: 155] ------------------ 367| 48| return DROPBEAR_FAILURE; ------------------ | | 112| 48|#define DROPBEAR_FAILURE -1 ------------------ 368| 48| } 369| | 370| | /* check for negative */ 371| 155| if (*buf_getptr(buf, 1) & (1 << (CHAR_BIT-1))) { ------------------ | Branch (371:6): [True: 12, False: 143] ------------------ 372| 12| return DROPBEAR_FAILURE; ------------------ | | 112| 12|#define DROPBEAR_FAILURE -1 ------------------ 373| 12| } 374| | 375| 143| if (mp_from_ubin(mp, buf_getptr(buf, len), len) != MP_OKAY) { ------------------ | | 161| 143|#define MP_OKAY 0 /* no error */ ------------------ | Branch (375:6): [True: 0, False: 143] ------------------ 376| 0| return DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 377| 0| } 378| | 379| 143| buf_incrpos(buf, len); 380| 143| return DROPBEAR_SUCCESS; ------------------ | | 111| 143|#define DROPBEAR_SUCCESS 0 ------------------ 381| 143|} buffer.c:buf_getstringbuf_int: 224| 4.65k|static buffer * buf_getstringbuf_int(buffer *buf, int incllen) { 225| 4.65k| buffer *ret = NULL; 226| 4.65k| unsigned int len = buf_getint(buf); 227| 4.65k| int extra = 0; 228| 4.65k| if (len > MAX_STRING_LEN) { ------------------ | | 253| 4.65k|#define MAX_STRING_LEN (MAX(MAX_CMD_LEN, 2400)) /* Sun SSH needs 2400 for algos, ------------------ | Branch (228:6): [True: 36, False: 4.61k] | Branch (228:12): [True: 4.64k, Folded] ------------------ 229| 36| dropbear_exit("String too long"); 230| 36| } 231| 4.61k| if (incllen) { ------------------ | Branch (231:6): [True: 0, False: 4.61k] ------------------ 232| 0| extra = 4; 233| 0| } 234| 4.61k| ret = buf_new(len+extra); 235| 4.61k| if (incllen) { ------------------ | Branch (235:6): [True: 0, False: 4.61k] ------------------ 236| 0| buf_putint(ret, len); 237| 0| } 238| 4.61k| memcpy(buf_getwriteptr(ret, len), buf_getptr(buf, len), len); 239| 4.61k| buf_incrpos(buf, len); 240| 4.61k| buf_incrlen(ret, len); 241| 4.61k| buf_setpos(ret, 0); 242| 4.61k| return ret; 243| 4.65k|} chachapoly.c:dropbear_chachapoly_start: 48| 675| int UNUSED(num_rounds), dropbear_chachapoly_state *state) { 49| 675| int err; 50| | 51| 675| TRACE2(("enter dropbear_chachapoly_start")) 52| | 53| 675| if (keylen != CHACHA20_KEY_LEN*2) { ------------------ | | 33| 675|#define CHACHA20_KEY_LEN 32 ------------------ | Branch (53:6): [True: 0, False: 675] ------------------ 54| 0| return CRYPT_ERROR; 55| 0| } 56| | 57| 675| if ((err = chacha_setup(&state->chacha, key, ------------------ | Branch (57:6): [True: 0, False: 675] ------------------ 58| 675| CHACHA20_KEY_LEN, 20)) != CRYPT_OK) { ------------------ | | 33| 675|#define CHACHA20_KEY_LEN 32 ------------------ 59| 0| return err; 60| 0| } 61| | 62| 675| if ((err = chacha_setup(&state->header, key + CHACHA20_KEY_LEN, ------------------ | | 33| 675|#define CHACHA20_KEY_LEN 32 ------------------ | Branch (62:6): [True: 0, False: 675] ------------------ 63| 675| CHACHA20_KEY_LEN, 20) != CRYPT_OK)) { ------------------ | | 33| 675|#define CHACHA20_KEY_LEN 32 ------------------ 64| 0| return err; 65| 0| } 66| | 67| 675| TRACE2(("leave dropbear_chachapoly_start")) 68| 675| return CRYPT_OK; 69| 675|} chachapoly.c:dropbear_chachapoly_crypt: 74| 3.51k| dropbear_chachapoly_state *state, int direction) { 75| 3.51k| poly1305_state poly; 76| 3.51k| unsigned char seqbuf[8], key[POLY1305_KEY_LEN], tag[POLY1305_TAG_LEN]; 77| 3.51k| int err; 78| | 79| 3.51k| TRACE2(("enter dropbear_chachapoly_crypt")) 80| | 81| 3.51k| if (len < 4 || taglen != POLY1305_TAG_LEN) { ------------------ | | 36| 3.51k|#define POLY1305_TAG_LEN 16 ------------------ | Branch (81:6): [True: 0, False: 3.51k] | Branch (81:17): [True: 0, False: 3.51k] ------------------ 82| 0| return CRYPT_ERROR; 83| 0| } 84| | 85| 3.51k| STORE64H((uint64_t)seq, seqbuf); ------------------ | | 101| 3.51k|#define STORE64H(x, y) \ | | 102| 3.51k|do { ulong64 __t = __builtin_bswap64 ((x)); \ | | 103| 3.51k| XMEMCPY ((y), &__t, 8); } while(0) | | ------------------ | | | | 39| 3.51k|#define XMEMCPY memcpy | | ------------------ | | | Branch (103:39): [Folded, False: 3.51k] | | ------------------ ------------------ 86| 3.51k| chacha_ivctr64(&state->chacha, seqbuf, sizeof(seqbuf), 0); 87| 3.51k| if ((err = chacha_keystream(&state->chacha, key, sizeof(key))) != CRYPT_OK) { ------------------ | Branch (87:6): [True: 0, False: 3.51k] ------------------ 88| 0| return err; 89| 0| } 90| | 91| 3.51k| poly1305_init(&poly, key, sizeof(key)); 92| 3.51k| if (direction == LTC_DECRYPT) { ------------------ | | 70| 3.51k|#define LTC_DECRYPT 1 ------------------ | Branch (92:6): [True: 0, False: 3.51k] ------------------ 93| 0| poly1305_process(&poly, in, len); 94| 0| poly1305_done(&poly, tag, &taglen); 95| 0| if (constant_time_memcmp(in + len, tag, taglen) != 0) { ------------------ | Branch (95:7): [True: 0, False: 0] ------------------ 96| 0| return CRYPT_ERROR; 97| 0| } 98| 0| } 99| | 100| 3.51k| chacha_ivctr64(&state->header, seqbuf, sizeof(seqbuf), 0); 101| 3.51k| if ((err = chacha_crypt(&state->header, in, 4, out)) != CRYPT_OK) { ------------------ | Branch (101:6): [True: 0, False: 3.51k] ------------------ 102| 0| return err; 103| 0| } 104| | 105| 3.51k| chacha_ivctr64(&state->chacha, seqbuf, sizeof(seqbuf), 1); 106| 3.51k| if ((err = chacha_crypt(&state->chacha, in + 4, len - 4, out + 4)) != CRYPT_OK) { ------------------ | Branch (106:6): [True: 0, False: 3.51k] ------------------ 107| 0| return err; 108| 0| } 109| | 110| 3.51k| if (direction == LTC_ENCRYPT) { ------------------ | | 68| 3.51k|#define LTC_ENCRYPT 0 ------------------ | Branch (110:6): [True: 3.51k, False: 0] ------------------ 111| 3.51k| poly1305_process(&poly, out, len); 112| 3.51k| poly1305_done(&poly, out + len, &taglen); 113| 3.51k| } 114| | 115| 3.51k| TRACE2(("leave dropbear_chachapoly_crypt")) 116| 3.51k| return CRYPT_OK; 117| 3.51k|} buf_put_algolist_all: 361| 61.4k|void buf_put_algolist_all(buffer * buf, const algo_type localalgos[], int useall) { 362| 61.4k| unsigned int i, len; 363| 61.4k| unsigned int donefirst = 0; 364| 61.4k| unsigned int startpos; 365| | 366| 61.4k| startpos = buf->pos; 367| | /* Placeholder for length */ 368| 61.4k| buf_putint(buf, 0); 369| 307k| for (i = 0; localalgos[i].name != NULL; i++) { ------------------ | Branch (369:14): [True: 246k, False: 61.4k] ------------------ 370| 246k| if (localalgos[i].usable || useall) { ------------------ | Branch (370:7): [True: 175k, False: 71.1k] | Branch (370:31): [True: 736, False: 70.3k] ------------------ 371| 175k| if (donefirst) { ------------------ | Branch (371:8): [True: 114k, False: 61.4k] ------------------ 372| 114k| buf_putbyte(buf, ','); 373| 114k| } 374| 175k| donefirst = 1; 375| 175k| len = strlen(localalgos[i].name); 376| 175k| buf_putbytes(buf, (const unsigned char *) localalgos[i].name, len); 377| 175k| } 378| 246k| } 379| | /* Fill out the length */ 380| 61.4k| len = buf->pos - startpos - 4; 381| 61.4k| buf_setpos(buf, startpos); 382| 61.4k| buf_putint(buf, len); 383| 61.4k| TRACE(("algolist add %d '%.*s'", len, len, buf_getptr(buf, len))) 384| 61.4k| buf_incrwritepos(buf, len); 385| 61.4k|} buf_put_algolist: 387| 61.3k|void buf_put_algolist(buffer * buf, const algo_type localalgos[]) { 388| 61.3k| buf_put_algolist_all(buf, localalgos, 0); 389| 61.3k|} buf_has_algo: 433| 11.4k|int buf_has_algo(buffer *buf, const char *algo) { 434| 11.4k| unsigned char* algolist = NULL; 435| 11.4k| unsigned int orig_pos = buf->pos; 436| 11.4k| unsigned int len, remotecount, i; 437| 11.4k| const char *remotenames[MAX_PROPOSED_ALGO]; 438| 11.4k| int ret = DROPBEAR_FAILURE; ------------------ | | 112| 11.4k|#define DROPBEAR_FAILURE -1 ------------------ 439| | 440| 11.4k| algolist = buf_getstring(buf, &len); 441| 11.4k| remotecount = MAX_PROPOSED_ALGO; ------------------ | | 237| 11.4k|#define MAX_PROPOSED_ALGO 50 ------------------ 442| 11.4k| get_algolist(algolist, len, remotenames, &remotecount); 443| 38.6k| for (i = 0; i < remotecount; i++) ------------------ | Branch (443:14): [True: 27.6k, False: 10.9k] ------------------ 444| 27.6k| { 445| 27.6k| if (strcmp(remotenames[i], algo) == 0) { ------------------ | Branch (445:7): [True: 479, False: 27.2k] ------------------ 446| 479| ret = DROPBEAR_SUCCESS; ------------------ | | 111| 479|#define DROPBEAR_SUCCESS 0 ------------------ 447| 479| break; 448| 479| } 449| 27.6k| } 450| 11.4k| if (algolist) { ------------------ | Branch (450:6): [True: 11.3k, False: 63] ------------------ 451| | m_free(algolist); ------------------ | | 24| 11.3k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 11.3k] | | ------------------ ------------------ 452| 11.3k| } 453| 11.4k| buf_setpos(buf, orig_pos); 454| 11.4k| return ret; 455| 11.4k|} buf_match_algo: 473| 53.7k| int kexguess2, int *goodguess) { 474| 53.7k| char * algolist = NULL; 475| 53.7k| const char *remotenames[MAX_PROPOSED_ALGO], *localnames[MAX_PROPOSED_ALGO]; 476| 53.7k| unsigned int len; 477| 53.7k| unsigned int remotecount, localcount, clicount, servcount, i, j; 478| 53.7k| algo_type * ret = NULL; 479| 53.7k| const char **clinames, **servnames; 480| | 481| 53.7k| if (goodguess) { ------------------ | Branch (481:6): [True: 13.7k, False: 40.0k] ------------------ 482| 13.7k| *goodguess = 0; 483| 13.7k| } 484| | 485| | /* get the comma-separated list from the buffer ie "algo1,algo2,algo3" */ 486| 53.7k| algolist = buf_getstring(buf, &len); 487| 53.7k| DEBUG3(("buf_match_algo: %s", algolist)) 488| 53.7k| remotecount = MAX_PROPOSED_ALGO; ------------------ | | 237| 53.7k|#define MAX_PROPOSED_ALGO 50 ------------------ 489| 53.7k| get_algolist(algolist, len, remotenames, &remotecount); 490| | 491| 271k| for (i = 0; localalgos[i].name != NULL; i++) { ------------------ | Branch (491:14): [True: 218k, False: 53.7k] ------------------ 492| 218k| if (localalgos[i].usable) { ------------------ | Branch (492:7): [True: 151k, False: 66.8k] ------------------ 493| 151k| localnames[i] = localalgos[i].name; 494| 151k| } else { 495| 66.8k| localnames[i] = NULL; 496| 66.8k| } 497| 218k| } 498| 53.7k| localcount = i; 499| | 500| 53.7k| if (IS_DROPBEAR_SERVER) { ------------------ | | 381| 53.7k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (381:28): [True: 53.7k, False: 74] | | ------------------ ------------------ 501| 53.7k| clinames = remotenames; 502| 53.7k| clicount = remotecount; 503| 53.7k| servnames = localnames; 504| 53.7k| servcount = localcount; 505| 53.7k| } else { 506| 74| clinames = localnames; 507| 74| clicount = localcount; 508| 74| servnames = remotenames; 509| 74| servcount = remotecount; 510| 74| } 511| | 512| | /* iterate and find the first match */ 513| 61.0k| for (i = 0; i < clicount; i++) { ------------------ | Branch (513:14): [True: 59.0k, False: 1.96k] ------------------ 514| 230k| for (j = 0; j < servcount; j++) { ------------------ | Branch (514:15): [True: 222k, False: 7.25k] ------------------ 515| 222k| if (!(servnames[j] && clinames[i])) { ------------------ | Branch (515:10): [True: 141k, False: 81.0k] | Branch (515:26): [True: 141k, False: 0] ------------------ 516| | /* unusable algos are NULL */ 517| 81.0k| continue; 518| 81.0k| } 519| 141k| if (strcmp(servnames[j], clinames[i]) == 0) { ------------------ | Branch (519:8): [True: 51.8k, False: 90.1k] ------------------ 520| | /* set if it was a good guess */ 521| 51.8k| if (goodguess != NULL) { ------------------ | Branch (521:9): [True: 13.4k, False: 38.3k] ------------------ 522| 13.4k| if (kexguess2) { ------------------ | Branch (522:10): [True: 554, False: 12.9k] ------------------ 523| 554| if (i == 0) { ------------------ | Branch (523:11): [True: 111, False: 443] ------------------ 524| 111| *goodguess = 1; 525| 111| } 526| 12.9k| } else { 527| 12.9k| if (i == 0 && j == 0) { ------------------ | Branch (527:11): [True: 10.1k, False: 2.74k] | Branch (527:21): [True: 4, False: 10.1k] ------------------ 528| 4| *goodguess = 1; 529| 4| } 530| 12.9k| } 531| 13.4k| } 532| | /* set the algo to return */ 533| 51.8k| if (IS_DROPBEAR_SERVER) { ------------------ | | 381| 51.8k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (381:28): [True: 51.8k, False: 0] | | ------------------ ------------------ 534| 51.8k| ret = &localalgos[j]; 535| 51.8k| } else { 536| 0| ret = &localalgos[i]; 537| 0| } 538| 51.8k| goto out; 539| 51.8k| } 540| 141k| } 541| 59.0k| } 542| | 543| 53.7k|out: 544| | m_free(algolist); ------------------ | | 24| 53.7k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 53.7k] | | ------------------ ------------------ 545| 53.7k| return ret; 546| 53.7k|} common-algo.c:void_start: 52| 6.16k| int UNUSED(keylen), int UNUSED(num_rounds), void* UNUSED(cipher_state)) { 53| 6.16k| return CRYPT_OK; 54| 6.16k|} common-algo.c:void_cipher: 43| 102k| unsigned long len, void* UNUSED(cipher_state)) { 44| 102k| if (in != out) { ------------------ | Branch (44:6): [True: 0, False: 102k] ------------------ 45| 0| memmove(out, in, len); 46| 0| } 47| 102k| return CRYPT_OK; 48| 102k|} common-algo.c:dropbear_big_endian_ctr_start: 93| 5.49k| int num_rounds, symmetric_CTR *ctr) { 94| 5.49k| return ctr_start(cipher, IV, key, keylen, num_rounds, CTR_COUNTER_BIG_ENDIAN, ctr); ------------------ | | 860| 5.49k|#define CTR_COUNTER_BIG_ENDIAN 0x1000 ------------------ 95| 5.49k|} common-algo.c:get_algolist: 396| 65.0k| const char* *ret_list, unsigned int *ret_count) { 397| 65.0k| unsigned int max_count = *ret_count; 398| 65.0k| unsigned int i; 399| | 400| 65.0k| if (*ret_count == 0) { ------------------ | Branch (400:6): [True: 0, False: 65.0k] ------------------ 401| 0| return; 402| 0| } 403| 65.0k| if (algolist_len > MAX_PROPOSED_ALGO*(MAX_NAME_LEN+1)) { ------------------ | | 237| 65.0k|#define MAX_PROPOSED_ALGO 50 ------------------ if (algolist_len > MAX_PROPOSED_ALGO*(MAX_NAME_LEN+1)) { ------------------ | | 233| 65.0k|#define MAX_NAME_LEN 64 /* maximum length of a protocol name, isn't ------------------ | Branch (403:6): [True: 17, False: 65.0k] ------------------ 404| 17| *ret_count = 0; 405| 17| } 406| | 407| | /* ret_list will contain a list of the strings parsed out. 408| | We will have at least one string (even if it's just "") */ 409| 65.0k| ret_list[0] = algolist; 410| 65.0k| *ret_count = 1; 411| 1.27M| for (i = 0; i < algolist_len; i++) { ------------------ | Branch (411:14): [True: 1.21M, False: 64.1k] ------------------ 412| 1.21M| if (algolist[i] == '\0') { ------------------ | Branch (412:7): [True: 871, False: 1.21M] ------------------ 413| | /* someone is trying something strange */ 414| 871| *ret_count = 0; 415| 871| return; 416| 871| } 417| | 418| 1.21M| if (algolist[i] == ',') { ------------------ | Branch (418:7): [True: 33.3k, False: 1.17M] ------------------ 419| 33.3k| if (*ret_count >= max_count) { ------------------ | Branch (419:8): [True: 6, False: 33.3k] ------------------ 420| 6| dropbear_exit("Too many remote algorithms"); 421| 0| *ret_count = 0; 422| 0| return; 423| 6| } 424| 33.3k| algolist[i] = '\0'; 425| 33.3k| ret_list[*ret_count] = &algolist[i+1]; 426| 33.3k| (*ret_count)++; 427| 33.3k| } 428| 1.21M| } 429| 65.0k|} chaninitialise: 70| 2.84k|void chaninitialise(const struct ChanType *chantypes[]) { 71| | 72| | /* may as well create space for a single channel */ 73| 2.84k| ses.channels = (struct Channel**)m_malloc(sizeof(struct Channel*)); 74| 2.84k| ses.chansize = 1; 75| 2.84k| ses.channels[0] = NULL; 76| 2.84k| ses.chancount = 0; 77| | 78| 2.84k| ses.chantypes = chantypes; 79| | 80| 2.84k|#if DROPBEAR_LISTENERS 81| 2.84k| listeners_initialise(); 82| 2.84k|#endif 83| | 84| 2.84k|} chancleanup: 87| 2.84k|void chancleanup() { 88| | 89| 2.84k| unsigned int i; 90| | 91| 2.84k| TRACE(("enter chancleanup")) 92| 5.68k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (92:14): [True: 2.84k, False: 2.84k] ------------------ 93| 2.84k| if (ses.channels[i] != NULL) { ------------------ | Branch (93:7): [True: 0, False: 2.84k] ------------------ 94| 0| TRACE(("channel %d closing", i)) 95| 0| remove_channel(ses.channels[i]); 96| 0| } 97| 2.84k| } 98| | m_free(ses.channels); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 99| 2.84k| TRACE(("leave chancleanup")) 100| 2.84k|} channelio: 199| 209k|void channelio(const fd_set *readfds, const fd_set *writefds) { 200| | 201| | /* Listeners such as TCP, X11, agent-auth */ 202| 209k| struct Channel *channel; 203| 209k| unsigned int i; 204| | 205| | /* foreach channel */ 206| 419k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (206:14): [True: 209k, False: 209k] ------------------ 207| | /* Close checking only needs to occur for channels that had IO events */ 208| 209k| int do_check_close = 0; 209| | 210| 209k| channel = ses.channels[i]; 211| 209k| if (channel == NULL) { ------------------ | Branch (211:7): [True: 209k, False: 0] ------------------ 212| | /* only process in-use channels */ 213| 209k| continue; 214| 209k| } 215| | 216| | /* read data and send it over the wire */ 217| 0| if (channel->readfd >= 0 && FD_ISSET(channel->readfd, readfds)) { ------------------ | Branch (217:7): [True: 0, False: 0] | Branch (217:31): [True: 0, False: 0] ------------------ 218| 0| TRACE(("send normal readfd")) 219| 0| send_msg_channel_data(channel, 0); 220| 0| do_check_close = 1; 221| 0| } 222| | 223| | /* read stderr data and send it over the wire */ 224| 0| if (ERRFD_IS_READ(channel) && channel->errfd >= 0 ------------------ | | 59| 0|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (59:32): [True: 0, False: 0] | | ------------------ ------------------ | Branch (224:33): [True: 0, False: 0] ------------------ 225| 0| && FD_ISSET(channel->errfd, readfds)) { ------------------ | Branch (225:7): [True: 0, False: 0] ------------------ 226| 0| TRACE(("send normal errfd")) 227| 0| send_msg_channel_data(channel, 1); 228| 0| do_check_close = 1; 229| 0| } 230| | 231| | /* write to program/pipe stdin */ 232| 0| if (channel->writefd >= 0 && FD_ISSET(channel->writefd, writefds)) { ------------------ | Branch (232:7): [True: 0, False: 0] | Branch (232:32): [True: 0, False: 0] ------------------ 233| 0| writechannel(channel, channel->writefd, channel->writebuf, NULL, NULL); 234| 0| do_check_close = 1; 235| 0| } 236| | 237| | /* stderr for client mode */ 238| 0| if (ERRFD_IS_WRITE(channel) ------------------ | | 60| 0|#define ERRFD_IS_WRITE(channel) (!ERRFD_IS_READ(channel)) | | ------------------ | | | | 59| 0|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (60:33): [True: 0, False: 0] | | ------------------ ------------------ 239| 0| && channel->errfd >= 0 && FD_ISSET(channel->errfd, writefds)) { ------------------ | Branch (239:8): [True: 0, False: 0] | Branch (239:31): [True: 0, False: 0] ------------------ 240| 0| writechannel(channel, channel->errfd, channel->extrabuf, NULL, NULL); 241| 0| do_check_close = 1; 242| 0| } 243| | 244| 0| if (ses.channel_signal_pending) { ------------------ | Branch (244:7): [True: 0, False: 0] ------------------ 245| | /* SIGCHLD can change channel state for server sessions */ 246| 0| do_check_close = 1; 247| 0| } 248| | 249| | /* handle any channel closing etc */ 250| 0| if (do_check_close) { ------------------ | Branch (250:7): [True: 0, False: 0] ------------------ 251| 0| check_close(channel); 252| 0| } 253| 0| } 254| | 255| 209k|#if DROPBEAR_LISTENERS 256| 209k| handle_listeners(readfds); 257| 209k|#endif 258| 209k|} setchannelfds: 542| 212k|void setchannelfds(fd_set *readfds, fd_set *writefds, int allow_reads) { 543| | 544| 212k| unsigned int i; 545| 212k| struct Channel * channel; 546| | 547| 424k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (547:14): [True: 212k, False: 212k] ------------------ 548| | 549| 212k| channel = ses.channels[i]; 550| 212k| if (channel == NULL) { ------------------ | Branch (550:7): [True: 212k, False: 0] ------------------ 551| 212k| continue; 552| 212k| } 553| | 554| | /* Stuff to put over the wire. 555| | Avoid queueing data to send if we're in the middle of a 556| | key re-exchange (!dataallowed), but still read from the 557| | FD if there's the possibility of "~."" to kill an 558| | interactive session (the read_mangler) */ 559| 0| if (channel->transwindow > 0 ------------------ | Branch (559:7): [True: 0, False: 0] ------------------ 560| 0| && ((ses.dataallowed && allow_reads) || channel->read_mangler)) { ------------------ | Branch (560:11): [True: 0, False: 0] | Branch (560:30): [True: 0, False: 0] | Branch (560:46): [True: 0, False: 0] ------------------ 561| | 562| 0| if (channel->readfd >= 0) { ------------------ | Branch (562:8): [True: 0, False: 0] ------------------ 563| 0| FD_SET(channel->readfd, readfds); 564| 0| } 565| | 566| 0| if (ERRFD_IS_READ(channel) && channel->errfd >= 0) { ------------------ | | 59| 0|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (59:32): [True: 0, False: 0] | | ------------------ ------------------ | Branch (566:34): [True: 0, False: 0] ------------------ 567| 0| FD_SET(channel->errfd, readfds); 568| 0| } 569| 0| } 570| | 571| | /* Stuff from the wire */ 572| 0| if (channel->writefd >= 0 && cbuf_getused(channel->writebuf) > 0) { ------------------ | Branch (572:7): [True: 0, False: 0] | Branch (572:32): [True: 0, False: 0] ------------------ 573| 0| FD_SET(channel->writefd, writefds); 574| 0| } 575| | 576| 0| if (ERRFD_IS_WRITE(channel) && channel->errfd >= 0 ------------------ | | 60| 0|#define ERRFD_IS_WRITE(channel) (!ERRFD_IS_READ(channel)) | | ------------------ | | | | 59| 0|#define ERRFD_IS_READ(channel) ((channel)->extrabuf == NULL) | | ------------------ | | | Branch (60:33): [True: 0, False: 0] | | ------------------ ------------------ | Branch (576:34): [True: 0, False: 0] ------------------ 577| 0| && cbuf_getused(channel->extrabuf) > 0) { ------------------ | Branch (577:8): [True: 0, False: 0] ------------------ 578| 0| FD_SET(channel->errfd, writefds); 579| 0| } 580| | 581| 0| } /* foreach channel */ 582| | 583| 212k|#if DROPBEAR_LISTENERS 584| 212k| set_listener_fds(readfds); 585| 212k|#endif 586| | 587| 212k|} send_msg_kexinit: 51| 7.66k|void send_msg_kexinit() { 52| | 53| 7.66k| CHECKCLEARTOWRITE(); 54| 7.66k| buf_putbyte(ses.writepayload, SSH_MSG_KEXINIT); ------------------ | | 36| 7.66k|#define SSH_MSG_KEXINIT 20 ------------------ 55| | 56| | /* cookie */ 57| 7.66k| genrandom(buf_getwriteptr(ses.writepayload, 16), 16); 58| 7.66k| buf_incrwritepos(ses.writepayload, 16); 59| | 60| | /* kex algos */ 61| 7.66k| buf_put_algolist(ses.writepayload, sshkex); 62| | 63| | /* server_host_key_algorithms */ 64| 7.66k| buf_put_algolist(ses.writepayload, sigalgs); 65| | 66| | /* encryption_algorithms_client_to_server */ 67| 7.66k| buf_put_algolist(ses.writepayload, sshciphers); 68| | 69| | /* encryption_algorithms_server_to_client */ 70| 7.66k| buf_put_algolist(ses.writepayload, sshciphers); 71| | 72| | /* mac_algorithms_client_to_server */ 73| 7.66k| buf_put_algolist(ses.writepayload, sshhashes); 74| | 75| | /* mac_algorithms_server_to_client */ 76| 7.66k| buf_put_algolist(ses.writepayload, sshhashes); 77| | 78| | 79| | /* compression_algorithms_client_to_server */ 80| 7.66k| buf_put_algolist(ses.writepayload, ses.compress_algos_c2s); 81| | 82| | /* compression_algorithms_server_to_client */ 83| 7.66k| buf_put_algolist(ses.writepayload, ses.compress_algos_s2c); 84| | 85| | /* languages_client_to_server */ 86| 7.66k| buf_putstring(ses.writepayload, "", 0); 87| | 88| | /* languages_server_to_client */ 89| 7.66k| buf_putstring(ses.writepayload, "", 0); 90| | 91| | /* first_kex_packet_follows */ 92| 7.66k| buf_putbyte(ses.writepayload, (ses.send_kex_first_guess != NULL)); 93| | 94| | /* reserved unit32 */ 95| 7.66k| buf_putint(ses.writepayload, 0); 96| | 97| | /* set up transmitted kex packet buffer for hashing. 98| | * This is freed after the end of the kex */ 99| 7.66k| ses.transkexinit = buf_newcopy(ses.writepayload); 100| | 101| 7.66k| encrypt_packet(); 102| 7.66k| ses.dataallowed = 0; /* don't send other packets during kex */ 103| | 104| 7.66k| ses.kexstate.sentkexinit = 1; 105| | 106| 7.66k| ses.newkeys = (struct key_context*)m_malloc(sizeof(struct key_context)); 107| | 108| 7.66k| if (ses.send_kex_first_guess) { ------------------ | Branch (108:6): [True: 0, False: 7.66k] ------------------ 109| 0| ses.newkeys->algo_kex = first_usable_algo(sshkex)->data; 110| 0| ses.newkeys->algo_signature = first_usable_algo(sigalgs)->val; 111| 0| ses.newkeys->algo_hostkey = signkey_type_from_signature(ses.newkeys->algo_signature); 112| 0| ses.send_kex_first_guess(); 113| 0| } 114| | 115| 7.66k| TRACE(("DATAALLOWED=0")) 116| 7.66k| TRACE(("-> KEXINIT")) 117| | 118| 7.66k|} send_msg_newkeys: 161| 6.16k|void send_msg_newkeys() { 162| | 163| 6.16k| TRACE(("enter send_msg_newkeys")) 164| | 165| | /* generate the kexinit request */ 166| 6.16k| CHECKCLEARTOWRITE(); 167| 6.16k| buf_putbyte(ses.writepayload, SSH_MSG_NEWKEYS); ------------------ | | 37| 6.16k|#define SSH_MSG_NEWKEYS 21 ------------------ 168| 6.16k| encrypt_packet(); 169| | 170| | 171| | /* set up our state */ 172| 6.16k| ses.kexstate.sentnewkeys = 1; 173| 6.16k| if (ses.kexstate.donefirstkex) { ------------------ | Branch (173:6): [True: 4.63k, False: 1.53k] ------------------ 174| 4.63k| ses.kexstate.donesecondkex = 1; 175| 4.63k| } 176| 6.16k| ses.kexstate.donefirstkex = 1; 177| 6.16k| ses.dataallowed = 1; /* we can send other packets again now */ 178| 6.16k| gen_new_keys(); 179| 6.16k| switch_keys(); 180| | 181| 6.16k| if (ses.kexstate.strict_kex) { ------------------ | Branch (181:6): [True: 461, False: 5.70k] ------------------ 182| 461| ses.transseq = 0; 183| 461| } 184| | 185| 6.16k| TRACE(("leave send_msg_newkeys")) 186| 6.16k|} recv_msg_newkeys: 189| 5.80k|void recv_msg_newkeys() { 190| | 191| 5.80k| TRACE(("enter recv_msg_newkeys")) 192| | 193| 5.80k| ses.kexstate.recvnewkeys = 1; 194| 5.80k| switch_keys(); 195| | 196| 5.80k| if (ses.kexstate.strict_kex) { ------------------ | Branch (196:6): [True: 444, False: 5.35k] ------------------ 197| 444| ses.recvseq = 0; 198| 444| } 199| 5.80k| ses.kexstate.recvfirstnewkeys = 1; 200| | 201| 5.80k| TRACE(("leave recv_msg_newkeys")) 202| 5.80k|} kexfirstinitialise: 230| 2.84k|void kexfirstinitialise() { 231| 2.84k| kex_setup_compress(); 232| 2.84k| kexinitialise(); 233| 2.84k|} recv_msg_kexinit: 492| 7.08k|void recv_msg_kexinit() { 493| | 494| 7.08k| unsigned int kexhashbuf_len = 0; 495| 7.08k| unsigned int remote_ident_len = 0; 496| 7.08k| unsigned int local_ident_len = 0; 497| | 498| 7.08k| TRACE(("<- KEXINIT")) 499| 7.08k| TRACE(("enter recv_msg_kexinit")) 500| | 501| 7.08k| if (!ses.kexstate.sentkexinit) { ------------------ | Branch (501:6): [True: 4.82k, False: 2.25k] ------------------ 502| | /* we need to send a kex packet */ 503| 4.82k| send_msg_kexinit(); 504| 4.82k| TRACE(("continue recv_msg_kexinit: sent kexinit")) 505| 4.82k| } 506| | 507| | /* "Once a party has sent a SSH_MSG_KEXINIT message ... 508| | further SSH_MSG_KEXINIT messages MUST NOT be sent" */ 509| 7.08k| if (ses.kexstate.recvkexinit) { ------------------ | Branch (509:6): [True: 0, False: 7.08k] ------------------ 510| 0| dropbear_exit("Unexpected KEXINIT"); 511| 0| } 512| | 513| | /* start the kex hash */ 514| 7.08k| local_ident_len = strlen(LOCAL_IDENT); ------------------ | | 14| 7.08k|#define LOCAL_IDENT "SSH-2.0-dropbear" IDENT_VERSION_PART | | ------------------ | | | | 12| 7.08k|#define IDENT_VERSION_PART "_" DROPBEAR_VERSION | | | | ------------------ | | | | | | 7| 7.08k|#define DROPBEAR_VERSION "2026.91" | | | | ------------------ | | ------------------ ------------------ 515| 7.08k| remote_ident_len = strlen(ses.remoteident); 516| | 517| 7.08k| kexhashbuf_len = local_ident_len + remote_ident_len 518| 7.08k| + ses.transkexinit->len + ses.payload->len 519| 7.08k| + KEXHASHBUF_MAX_INTS; ------------------ | | 290| 7.08k|#define KEXHASHBUF_MAX_INTS (MAX_PUBKEY_SIZE + MAX_KEX_PARTS) | | ------------------ | | | | 261| 7.08k|#define MAX_PUBKEY_SIZE 600 | | ------------------ | | #define KEXHASHBUF_MAX_INTS (MAX_PUBKEY_SIZE + MAX_KEX_PARTS) | | ------------------ | | | | 274| 7.08k|#define MAX_KEX_PARTS (2*4 + 1184 + 1088 + 32*2 + 68) | | ------------------ ------------------ 520| | 521| 7.08k| ses.kexhashbuf = buf_new(kexhashbuf_len); 522| | 523| 7.08k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 382| 7.08k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (382:28): [True: 0, False: 7.08k] | | ------------------ ------------------ 524| | 525| | /* read the peer's choice of algos */ 526| 0| read_kex_algos(); 527| | 528| | /* V_C, the client's version string (CR and NL excluded) */ 529| 0| buf_putstring(ses.kexhashbuf, LOCAL_IDENT, local_ident_len); ------------------ | | 14| 0|#define LOCAL_IDENT "SSH-2.0-dropbear" IDENT_VERSION_PART | | ------------------ | | | | 12| 0|#define IDENT_VERSION_PART "_" DROPBEAR_VERSION | | | | ------------------ | | | | | | 7| 0|#define DROPBEAR_VERSION "2026.91" | | | | ------------------ | | ------------------ ------------------ 530| | /* V_S, the server's version string (CR and NL excluded) */ 531| 0| buf_putstring(ses.kexhashbuf, ses.remoteident, remote_ident_len); 532| | 533| | /* I_C, the payload of the client's SSH_MSG_KEXINIT */ 534| 0| buf_putstring(ses.kexhashbuf, 535| 0| (const char*)ses.transkexinit->data, ses.transkexinit->len); 536| | /* I_S, the payload of the server's SSH_MSG_KEXINIT */ 537| 0| buf_setpos(ses.payload, ses.payload_beginning); 538| 0| buf_putstring(ses.kexhashbuf, 539| 0| (const char*)buf_getptr(ses.payload, ses.payload->len-ses.payload->pos), 540| 0| ses.payload->len-ses.payload->pos); 541| 0| ses.requirenext = SSH_MSG_KEXDH_REPLY; ------------------ | | 39| 0|#define SSH_MSG_KEXDH_REPLY 31 ------------------ 542| 7.08k| } else { 543| | /* SERVER */ 544| | 545| | /* read the peer's choice of algos */ 546| 7.08k| read_kex_algos(); 547| | /* V_C, the client's version string (CR and NL excluded) */ 548| 7.08k| buf_putstring(ses.kexhashbuf, ses.remoteident, remote_ident_len); 549| | /* V_S, the server's version string (CR and NL excluded) */ 550| 7.08k| buf_putstring(ses.kexhashbuf, LOCAL_IDENT, local_ident_len); ------------------ | | 14| 7.08k|#define LOCAL_IDENT "SSH-2.0-dropbear" IDENT_VERSION_PART | | ------------------ | | | | 12| 7.08k|#define IDENT_VERSION_PART "_" DROPBEAR_VERSION | | | | ------------------ | | | | | | 7| 7.08k|#define DROPBEAR_VERSION "2026.91" | | | | ------------------ | | ------------------ ------------------ 551| | 552| | /* I_C, the payload of the client's SSH_MSG_KEXINIT */ 553| 7.08k| buf_setpos(ses.payload, ses.payload_beginning); 554| 7.08k| buf_putstring(ses.kexhashbuf, 555| 7.08k| (const char*)buf_getptr(ses.payload, ses.payload->len-ses.payload->pos), 556| 7.08k| ses.payload->len-ses.payload->pos); 557| | 558| | /* I_S, the payload of the server's SSH_MSG_KEXINIT */ 559| 7.08k| buf_putstring(ses.kexhashbuf, 560| 7.08k| (const char*)ses.transkexinit->data, ses.transkexinit->len); 561| | 562| 7.08k| ses.requirenext = SSH_MSG_KEXDH_INIT; ------------------ | | 38| 7.08k|#define SSH_MSG_KEXDH_INIT 30 ------------------ 563| 7.08k| } 564| | 565| 7.08k| buf_free(ses.transkexinit); 566| 7.08k| ses.transkexinit = NULL; 567| | /* the rest of ses.kexhashbuf will be done after DH exchange */ 568| | 569| 7.08k| ses.kexstate.recvkexinit = 1; 570| | 571| 7.08k| if (ses.kexstate.strict_kex && !ses.kexstate.donefirstkex && ses.recvseq != 1) { ------------------ | Branch (571:6): [True: 480, False: 6.60k] | Branch (571:33): [True: 91, False: 389] | Branch (571:63): [True: 7, False: 84] ------------------ 572| 7| dropbear_exit("First packet wasn't kexinit"); 573| 7| } 574| | 575| 7.08k| TRACE(("leave recv_msg_kexinit")) 576| 7.08k|} finish_kexhashbuf: 579| 6.16k|void finish_kexhashbuf(void) { 580| 6.16k| hash_state hs; 581| 6.16k| const struct ltc_hash_descriptor *hash_desc = ses.newkeys->algo_kex->hash_desc; 582| | 583| 6.16k| hash_desc->init(&hs); 584| 6.16k| buf_setpos(ses.kexhashbuf, 0); 585| 6.16k| hash_desc->process(&hs, buf_getptr(ses.kexhashbuf, ses.kexhashbuf->len), 586| 6.16k| ses.kexhashbuf->len); 587| 6.16k| ses.hash = buf_new(hash_desc->hashsize); 588| 6.16k| hash_desc->done(&hs, buf_getwriteptr(ses.hash, hash_desc->hashsize)); 589| 6.16k| buf_setlen(ses.hash, hash_desc->hashsize); 590| | 591| |#if defined(DEBUG_KEXHASH) && DEBUG_TRACE 592| | if (!debug_trace) { 593| | printhex("kexhashbuf", ses.kexhashbuf->data, ses.kexhashbuf->len); 594| | printhex("kexhash", ses.hash->data, ses.hash->len); 595| | } 596| |#endif 597| | 598| 6.16k| buf_burn_free(ses.kexhashbuf); 599| 6.16k| m_burn(&hs, sizeof(hash_state)); 600| 6.16k| ses.kexhashbuf = NULL; 601| | 602| | /* first time around, we set the session_id to H */ 603| 6.16k| if (ses.session_id == NULL) { ------------------ | Branch (603:6): [True: 1.53k, False: 4.63k] ------------------ 604| | /* create the session_id, this never needs freeing */ 605| 1.53k| ses.session_id = buf_newcopy(ses.hash); 606| 1.53k| } 607| 6.16k|} common-kex.c:switch_keys: 120| 11.9k|static void switch_keys() { 121| 11.9k| TRACE2(("enter switch_keys")) 122| 11.9k| if (!(ses.kexstate.sentkexinit && ses.kexstate.recvkexinit)) { ------------------ | Branch (122:8): [True: 11.9k, False: 7] | Branch (122:36): [True: 11.9k, False: 0] ------------------ 123| 7| dropbear_exit("Unexpected newkeys message"); 124| 7| } 125| | 126| 11.9k| if (!ses.keys) { ------------------ | Branch (126:6): [True: 0, False: 11.9k] ------------------ 127| 0| ses.keys = m_malloc(sizeof(*ses.newkeys)); 128| 0| } 129| 11.9k| if (ses.kexstate.recvnewkeys && ses.newkeys->recv.valid) { ------------------ | Branch (129:6): [True: 5.79k, False: 6.16k] | Branch (129:34): [True: 5.79k, False: 0] ------------------ 130| 5.79k| TRACE(("switch_keys recv")) 131| |#ifndef DISABLE_ZLIB 132| | gen_new_zstream_recv(); 133| |#endif 134| 5.79k| ses.keys->recv = ses.newkeys->recv; 135| 5.79k| m_burn(&ses.newkeys->recv, sizeof(ses.newkeys->recv)); 136| 5.79k| ses.newkeys->recv.valid = 0; 137| 5.79k| } 138| 11.9k| if (ses.kexstate.sentnewkeys && ses.newkeys->trans.valid) { ------------------ | Branch (138:6): [True: 11.9k, False: 0] | Branch (138:34): [True: 6.16k, False: 5.79k] ------------------ 139| 6.16k| TRACE(("switch_keys trans")) 140| |#ifndef DISABLE_ZLIB 141| | gen_new_zstream_trans(); 142| |#endif 143| 6.16k| ses.keys->trans = ses.newkeys->trans; 144| 6.16k| m_burn(&ses.newkeys->trans, sizeof(ses.newkeys->trans)); 145| 6.16k| ses.newkeys->trans.valid = 0; 146| 6.16k| } 147| 11.9k| if (ses.kexstate.sentnewkeys && ses.kexstate.recvnewkeys) ------------------ | Branch (147:6): [True: 11.9k, False: 0] | Branch (147:34): [True: 5.79k, False: 6.16k] ------------------ 148| 5.79k| { 149| 5.79k| TRACE(("switch_keys done")) 150| 5.79k| ses.keys->algo_kex = ses.newkeys->algo_kex; 151| 5.79k| ses.keys->algo_hostkey = ses.newkeys->algo_hostkey; 152| 5.79k| ses.keys->algo_signature = ses.newkeys->algo_signature; 153| 5.79k| m_free(ses.newkeys); ------------------ | | 24| 5.79k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 5.79k] | | ------------------ ------------------ 154| | ses.newkeys = NULL; 155| 5.79k| kexinitialise(); 156| 5.79k| } 157| 11.9k| TRACE2(("leave switch_keys")) 158| 11.9k|} common-kex.c:kex_setup_compress: 204| 2.84k|static void kex_setup_compress(void) { 205| 2.84k|#ifdef DISABLE_ZLIB 206| 2.84k| ses.compress_algos_c2s = ssh_nocompress; 207| 2.84k| ses.compress_algos_s2c = ssh_nocompress; 208| |#else 209| | 210| | if (!opts.compression) { 211| | ses.compress_algos_c2s = ssh_nocompress; 212| | ses.compress_algos_s2c = ssh_nocompress; 213| | return; 214| | } 215| | 216| | if (IS_DROPBEAR_CLIENT) { 217| | /* TODO: should c2s in dbclient be disabled? 218| | * Current Dropbear server disables it. Disabling it also 219| | * lets DROPBEAR_CLI_IMMEDIATE_AUTH work (see comment there) */ 220| | ses.compress_algos_c2s = ssh_compress; 221| | ses.compress_algos_s2c = ssh_compress; 222| | } else { 223| | ses.compress_algos_c2s = ssh_nocompress; 224| | ses.compress_algos_s2c = ssh_compress; 225| | } 226| |#endif 227| 2.84k|} common-kex.c:kexinitialise: 236| 8.63k|static void kexinitialise() { 237| | 238| 8.63k| TRACE(("kexinitialise()")) 239| | 240| | /* sent/recv'd MSG_KEXINIT */ 241| 8.63k| ses.kexstate.sentkexinit = 0; 242| 8.63k| ses.kexstate.recvkexinit = 0; 243| | 244| | /* sent/recv'd MSG_NEWKEYS */ 245| 8.63k| ses.kexstate.recvnewkeys = 0; 246| 8.63k| ses.kexstate.sentnewkeys = 0; 247| | 248| | /* first_packet_follows */ 249| 8.63k| ses.kexstate.them_firstfollows = 0; 250| | 251| 8.63k| ses.kexstate.datatrans = 0; 252| 8.63k| ses.kexstate.datarecv = 0; 253| | 254| 8.63k| ses.kexstate.our_first_follows_matches = 0; 255| | 256| 8.63k| ses.kexstate.lastkextime = monotonic_now(); 257| | 258| 8.63k|} common-kex.c:gen_new_keys: 299| 6.16k|static void gen_new_keys() { 300| | 301| 6.16k| unsigned char C2S_IV[MAX_IV_LEN]; 302| 6.16k| unsigned char C2S_key[MAX_KEY_LEN]; 303| 6.16k| unsigned char S2C_IV[MAX_IV_LEN]; 304| 6.16k| unsigned char S2C_key[MAX_KEY_LEN]; 305| | /* unsigned char key[MAX_KEY_LEN]; */ 306| 6.16k| unsigned char *trans_IV, *trans_key, *recv_IV, *recv_key; 307| | 308| 6.16k| hash_state hs; 309| 6.16k| const struct ltc_hash_descriptor *hash_desc = ses.newkeys->algo_kex->hash_desc; 310| 6.16k| char mactransletter, macrecvletter; /* Client or server specific */ 311| | 312| 6.16k| TRACE(("enter gen_new_keys")) 313| | /* the dh_K and hash are the start of all hashes, we make use of that */ 314| | 315| 6.16k| hash_desc->init(&hs); 316| 6.16k| if (ses.dh_K) { ------------------ | Branch (316:6): [True: 6.16k, False: 0] ------------------ 317| 6.16k| hash_process_mp(hash_desc, &hs, ses.dh_K); 318| 6.16k| mp_clear(ses.dh_K); 319| 6.16k| m_free(ses.dh_K); ------------------ | | 24| 6.16k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 6.16k] | | ------------------ ------------------ 320| 6.16k| } 321| 6.16k| if (ses.dh_K_bytes) { ------------------ | Branch (321:6): [True: 0, False: 6.16k] ------------------ 322| 0| hash_desc->process(&hs, ses.dh_K_bytes->data, ses.dh_K_bytes->len); 323| 0| buf_burn_free(ses.dh_K_bytes); 324| 0| ses.dh_K_bytes = NULL; 325| 0| } 326| 6.16k| hash_desc->process(&hs, ses.hash->data, ses.hash->len); 327| 6.16k| buf_burn_free(ses.hash); 328| 6.16k| ses.hash = NULL; 329| | 330| 6.16k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 382| 6.16k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (382:28): [True: 0, False: 6.16k] | | ------------------ ------------------ 331| 0| trans_IV = C2S_IV; 332| 0| recv_IV = S2C_IV; 333| 0| trans_key = C2S_key; 334| 0| recv_key = S2C_key; 335| 0| mactransletter = 'E'; 336| 0| macrecvletter = 'F'; 337| 6.16k| } else { 338| 6.16k| trans_IV = S2C_IV; 339| 6.16k| recv_IV = C2S_IV; 340| 6.16k| trans_key = S2C_key; 341| 6.16k| recv_key = C2S_key; 342| 6.16k| mactransletter = 'F'; 343| 6.16k| macrecvletter = 'E'; 344| 6.16k| } 345| | 346| 6.16k| hashkeys(C2S_IV, sizeof(C2S_IV), &hs, 'A'); 347| 6.16k| hashkeys(S2C_IV, sizeof(S2C_IV), &hs, 'B'); 348| 6.16k| hashkeys(C2S_key, sizeof(C2S_key), &hs, 'C'); 349| 6.16k| hashkeys(S2C_key, sizeof(S2C_key), &hs, 'D'); 350| | 351| 6.16k| if (ses.newkeys->recv.algo_crypt->cipherdesc != NULL) { ------------------ | Branch (351:6): [True: 6.16k, False: 0] ------------------ 352| 6.16k| int recv_cipher = -1; 353| 6.16k| if (ses.newkeys->recv.algo_crypt->cipherdesc->name != NULL) { ------------------ | Branch (353:7): [True: 5.30k, False: 860] ------------------ 354| 5.30k| recv_cipher = find_cipher(ses.newkeys->recv.algo_crypt->cipherdesc->name); 355| 5.30k| if (recv_cipher < 0) { ------------------ | Branch (355:8): [True: 0, False: 5.30k] ------------------ 356| 0| dropbear_exit("Crypto error"); 357| 0| } 358| 5.30k| } 359| 6.16k| if (ses.newkeys->recv.crypt_mode->start(recv_cipher, ------------------ | Branch (359:7): [True: 0, False: 6.16k] ------------------ 360| 6.16k| recv_IV, recv_key, 361| 6.16k| ses.newkeys->recv.algo_crypt->keysize, 0, 362| 6.16k| &ses.newkeys->recv.cipher_state) != CRYPT_OK) { 363| 0| dropbear_exit("Crypto error"); 364| 0| } 365| 6.16k| } 366| | 367| 6.16k| if (ses.newkeys->trans.algo_crypt->cipherdesc != NULL) { ------------------ | Branch (367:6): [True: 6.16k, False: 0] ------------------ 368| 6.16k| int trans_cipher = -1; 369| 6.16k| if (ses.newkeys->trans.algo_crypt->cipherdesc->name != NULL) { ------------------ | Branch (369:7): [True: 5.49k, False: 675] ------------------ 370| 5.49k| trans_cipher = find_cipher(ses.newkeys->trans.algo_crypt->cipherdesc->name); 371| 5.49k| if (trans_cipher < 0) { ------------------ | Branch (371:8): [True: 0, False: 5.49k] ------------------ 372| 0| dropbear_exit("Crypto error"); 373| 0| } 374| 5.49k| } 375| 6.16k| if (ses.newkeys->trans.crypt_mode->start(trans_cipher, ------------------ | Branch (375:7): [True: 0, False: 6.16k] ------------------ 376| 6.16k| trans_IV, trans_key, 377| 6.16k| ses.newkeys->trans.algo_crypt->keysize, 0, 378| 6.16k| &ses.newkeys->trans.cipher_state) != CRYPT_OK) { 379| 0| dropbear_exit("Crypto error"); 380| 0| } 381| 6.16k| } 382| | 383| 6.16k| if (ses.newkeys->trans.algo_mac->hash_desc != NULL) { ------------------ | Branch (383:6): [True: 5.49k, False: 675] ------------------ 384| 5.49k| hashkeys(ses.newkeys->trans.mackey, 385| 5.49k| ses.newkeys->trans.algo_mac->keysize, &hs, mactransletter); 386| 5.49k| ses.newkeys->trans.hash_index = find_hash(ses.newkeys->trans.algo_mac->hash_desc->name); 387| 5.49k| } 388| | 389| 6.16k| if (ses.newkeys->recv.algo_mac->hash_desc != NULL) { ------------------ | Branch (389:6): [True: 0, False: 6.16k] ------------------ 390| 0| hashkeys(ses.newkeys->recv.mackey, 391| 0| ses.newkeys->recv.algo_mac->keysize, &hs, macrecvletter); 392| 0| ses.newkeys->recv.hash_index = find_hash(ses.newkeys->recv.algo_mac->hash_desc->name); 393| 0| } 394| | 395| | /* Ready to switch over */ 396| 6.16k| ses.newkeys->trans.valid = 1; 397| 6.16k| ses.newkeys->recv.valid = 1; 398| | 399| 6.16k| m_burn(C2S_IV, sizeof(C2S_IV)); 400| 6.16k| m_burn(C2S_key, sizeof(C2S_key)); 401| 6.16k| m_burn(S2C_IV, sizeof(S2C_IV)); 402| 6.16k| m_burn(S2C_key, sizeof(S2C_key)); 403| 6.16k| m_burn(&hs, sizeof(hash_state)); 404| | 405| 6.16k| TRACE(("leave gen_new_keys")) 406| 6.16k|} common-kex.c:hashkeys: 267| 30.1k| const hash_state * hs, const unsigned char X) { 268| | 269| 30.1k| const struct ltc_hash_descriptor *hash_desc = ses.newkeys->algo_kex->hash_desc; 270| 30.1k| hash_state hs2; 271| 30.1k| unsigned int offset; 272| 30.1k| unsigned char tmpout[MAX_HASH_SIZE]; 273| | 274| 30.1k| memcpy(&hs2, hs, sizeof(hash_state)); 275| 30.1k| hash_desc->process(&hs2, &X, 1); 276| 30.1k| hash_desc->process(&hs2, ses.session_id->data, ses.session_id->len); 277| 30.1k| hash_desc->done(&hs2, tmpout); 278| 30.1k| memcpy(out, tmpout, MIN(hash_desc->hashsize, outlen)); ------------------ | Branch (278:22): [True: 10.7k, False: 19.4k] ------------------ 279| 30.1k| for (offset = hash_desc->hashsize; 280| 40.9k| offset < outlen; ------------------ | Branch (280:4): [True: 10.7k, False: 30.1k] ------------------ 281| 30.1k| offset += hash_desc->hashsize) 282| 10.7k| { 283| | /* need to extend */ 284| 10.7k| memcpy(&hs2, hs, sizeof(hash_state)); 285| 10.7k| hash_desc->process(&hs2, out, offset); 286| 10.7k| hash_desc->done(&hs2, tmpout); 287| | memcpy(&out[offset], tmpout, MIN(outlen - offset, hash_desc->hashsize)); ------------------ | Branch (287:32): [True: 812, False: 9.94k] ------------------ 288| 10.7k| } 289| 30.1k| m_burn(&hs2, sizeof(hash_state)); 290| 30.1k|} common-kex.c:read_kex_algos: 611| 7.08k|static void read_kex_algos() { 612| | 613| | /* for asymmetry */ 614| 7.08k| algo_type * c2s_hash_algo = NULL; 615| 7.08k| algo_type * s2c_hash_algo = NULL; 616| 7.08k| algo_type * c2s_cipher_algo = NULL; 617| 7.08k| algo_type * s2c_cipher_algo = NULL; 618| 7.08k| algo_type * c2s_comp_algo = NULL; 619| 7.08k| algo_type * s2c_comp_algo = NULL; 620| | /* the generic one */ 621| 7.08k| algo_type * algo = NULL; 622| | 623| | /* which algo couldn't match */ 624| 7.08k| char * erralgo = NULL; 625| | 626| 7.08k| int goodguess = 0; 627| 7.08k| int allgood = 1; /* we AND this with each goodguess and see if its still 628| | true after */ 629| 7.08k| int kexguess2 = 0; 630| | 631| 7.08k| buf_incrpos(ses.payload, 16); /* start after the cookie */ 632| | 633| 7.08k| memset(ses.newkeys, 0x0, sizeof(*ses.newkeys)); 634| | 635| | /* kex_algorithms */ 636| 7.08k|#if DROPBEAR_KEXGUESS2 637| 7.08k| if (buf_has_algo(ses.payload, KEXGUESS2_ALGO_NAME) == DROPBEAR_SUCCESS) { ------------------ | | 137| 7.08k|#define KEXGUESS2_ALGO_NAME "kexguess2@matt.ucc.asn.au" ------------------ if (buf_has_algo(ses.payload, KEXGUESS2_ALGO_NAME) == DROPBEAR_SUCCESS) { ------------------ | | 111| 7.08k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (637:6): [True: 283, False: 6.79k] ------------------ 638| 283| kexguess2 = 1; 639| 283| } 640| 7.08k|#endif 641| | 642| 7.08k|#if DROPBEAR_EXT_INFO 643| | /* Determine if SSH_MSG_EXT_INFO messages should be sent. 644| | Should be done for the first key exchange. Only required on server side 645| | for server-sig-algs */ 646| 7.08k| if (IS_DROPBEAR_SERVER) { ------------------ | | 381| 7.08k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (381:28): [True: 6.97k, False: 106] | | ------------------ ------------------ 647| 6.97k| if (!ses.kexstate.donefirstkex) { ------------------ | Branch (647:7): [True: 2.19k, False: 4.78k] ------------------ 648| 2.19k| if (buf_has_algo(ses.payload, SSH_EXT_INFO_C) == DROPBEAR_SUCCESS) { ------------------ | | 100| 2.19k|#define SSH_EXT_INFO_C "ext-info-c" ------------------ if (buf_has_algo(ses.payload, SSH_EXT_INFO_C) == DROPBEAR_SUCCESS) { ------------------ | | 111| 2.19k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (648:8): [True: 102, False: 2.08k] ------------------ 649| 102| ses.allow_ext_info = 1; 650| 102| } 651| 2.19k| } 652| 6.97k| } 653| 7.08k|#endif 654| | 655| 7.08k| if (!ses.kexstate.donefirstkex) { ------------------ | Branch (655:6): [True: 2.19k, False: 4.89k] ------------------ 656| 2.19k| const char* strict_name; 657| 2.19k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 382| 2.19k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (382:28): [True: 0, False: 2.19k] | | ------------------ ------------------ 658| 0| strict_name = SSH_STRICT_KEX_S; ------------------ | | 104| 0|#define SSH_STRICT_KEX_S "kex-strict-s-v00@openssh.com" ------------------ 659| 2.19k| } else { 660| 2.19k| strict_name = SSH_STRICT_KEX_C; ------------------ | | 105| 2.19k|#define SSH_STRICT_KEX_C "kex-strict-c-v00@openssh.com" ------------------ 661| 2.19k| } 662| 2.19k| if (buf_has_algo(ses.payload, strict_name) == DROPBEAR_SUCCESS) { ------------------ | | 111| 2.19k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (662:7): [True: 94, False: 2.09k] ------------------ 663| 94| ses.kexstate.strict_kex = 1; 664| 94| } 665| 2.19k| } 666| | 667| 7.08k| algo = buf_match_algo(ses.payload, sshkex, kexguess2, &goodguess); 668| 7.08k| allgood &= goodguess; 669| 7.08k| if (algo == NULL || algo->data == NULL) { ------------------ | Branch (669:6): [True: 312, False: 6.77k] | Branch (669:22): [True: 9, False: 6.76k] ------------------ 670| | /* kexguess2, ext-info-c, ext-info-s should not match negotiation */ 671| 215| erralgo = "kex"; 672| 215| goto error; 673| 215| } 674| 6.86k| TRACE(("kexguess2 %d", kexguess2)) 675| 6.86k| DEBUG3(("kex algo %s", algo->name)) 676| 6.86k| ses.newkeys->algo_kex = algo->data; 677| | 678| | /* server_host_key_algorithms */ 679| 6.86k| algo = buf_match_algo(ses.payload, sigalgs, kexguess2, &goodguess); 680| 6.86k| allgood &= goodguess; 681| 6.86k| if (algo == NULL) { ------------------ | Branch (681:6): [True: 12, False: 6.85k] ------------------ 682| 12| erralgo = "hostkey"; 683| 12| goto error; 684| 12| } 685| 6.85k| DEBUG2(("hostkey algo %s", algo->name)) 686| 6.85k| ses.newkeys->algo_signature = algo->val; 687| 6.85k| ses.newkeys->algo_hostkey = signkey_type_from_signature(ses.newkeys->algo_signature); 688| | 689| | /* encryption_algorithms_client_to_server */ 690| 6.85k| c2s_cipher_algo = buf_match_algo(ses.payload, sshciphers, 0, NULL); 691| 6.85k| if (c2s_cipher_algo == NULL) { ------------------ | Branch (691:6): [True: 10, False: 6.84k] ------------------ 692| 10| erralgo = "enc c->s"; 693| 10| goto error; 694| 10| } 695| 6.84k| DEBUG2(("enc c2s is %s", c2s_cipher_algo->name)) 696| | 697| | /* encryption_algorithms_server_to_client */ 698| 6.84k| s2c_cipher_algo = buf_match_algo(ses.payload, sshciphers, 0, NULL); 699| 6.84k| if (s2c_cipher_algo == NULL) { ------------------ | Branch (699:6): [True: 16, False: 6.82k] ------------------ 700| 16| erralgo = "enc s->c"; 701| 16| goto error; 702| 16| } 703| 6.82k| DEBUG2(("enc s2c is %s", s2c_cipher_algo->name)) 704| | 705| | /* mac_algorithms_client_to_server */ 706| 6.82k| c2s_hash_algo = buf_match_algo(ses.payload, sshhashes, 0, NULL); 707| 6.82k|#if DROPBEAR_AEAD_MODE 708| 6.82k| if (((struct dropbear_cipher_mode*)c2s_cipher_algo->mode)->aead_crypt != NULL) { ------------------ | Branch (708:6): [True: 923, False: 5.90k] ------------------ 709| 923| c2s_hash_algo = NULL; 710| 923| } else 711| 5.90k|#endif 712| 5.90k| if (c2s_hash_algo == NULL) { ------------------ | Branch (712:6): [True: 3, False: 5.90k] ------------------ 713| 3| erralgo = "mac c->s"; 714| 3| goto error; 715| 3| } 716| 6.82k| DEBUG2(("hmac c2s is %s", c2s_hash_algo ? c2s_hash_algo->name : "")) 717| | 718| | /* mac_algorithms_server_to_client */ 719| 6.82k| s2c_hash_algo = buf_match_algo(ses.payload, sshhashes, 0, NULL); 720| 6.82k|#if DROPBEAR_AEAD_MODE 721| 6.82k| if (((struct dropbear_cipher_mode*)s2c_cipher_algo->mode)->aead_crypt != NULL) { ------------------ | Branch (721:6): [True: 720, False: 6.10k] ------------------ 722| 720| s2c_hash_algo = NULL; 723| 720| } else 724| 6.10k|#endif 725| 6.10k| if (s2c_hash_algo == NULL) { ------------------ | Branch (725:6): [True: 11, False: 6.09k] ------------------ 726| 11| erralgo = "mac s->c"; 727| 11| goto error; 728| 11| } 729| 6.81k| DEBUG2(("hmac s2c is %s", s2c_hash_algo ? s2c_hash_algo->name : "")) 730| | 731| | /* compression_algorithms_client_to_server */ 732| 6.81k| c2s_comp_algo = buf_match_algo(ses.payload, ses.compress_algos_c2s, 0, NULL); 733| 6.81k| if (c2s_comp_algo == NULL) { ------------------ | Branch (733:6): [True: 8, False: 6.80k] ------------------ 734| 8| erralgo = "comp c->s"; 735| 8| goto error; 736| 8| } 737| 6.80k| DEBUG2(("comp c2s is %s", c2s_comp_algo->name)) 738| | 739| | /* compression_algorithms_server_to_client */ 740| 6.80k| s2c_comp_algo = buf_match_algo(ses.payload, ses.compress_algos_s2c, 0, NULL); 741| 6.80k| if (s2c_comp_algo == NULL) { ------------------ | Branch (741:6): [True: 3, False: 6.80k] ------------------ 742| 3| erralgo = "comp s->c"; 743| 3| goto error; 744| 3| } 745| 6.80k| DEBUG2(("comp s2c is %s", s2c_comp_algo->name)) 746| | 747| | /* languages_client_to_server */ 748| 6.80k| buf_eatstring(ses.payload); 749| | 750| | /* languages_server_to_client */ 751| 6.80k| buf_eatstring(ses.payload); 752| | 753| | /* their first_kex_packet_follows */ 754| 6.80k| if (buf_getbool(ses.payload)) { ------------------ | Branch (754:6): [True: 225, False: 6.57k] ------------------ 755| 225| TRACE(("them kex firstfollows. allgood %d", allgood)) 756| 225| ses.kexstate.them_firstfollows = 1; 757| | /* if the guess wasn't good, we ignore the packet sent */ 758| 225| if (!allgood) { ------------------ | Branch (758:7): [True: 198, False: 27] ------------------ 759| 198| ses.ignorenext = 1; 760| 198| } 761| 225| } 762| | 763| | /* Handle the asymmetry */ 764| 6.80k| if (IS_DROPBEAR_CLIENT) { ------------------ | | 382| 6.80k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (382:28): [True: 0, False: 6.80k] | | ------------------ ------------------ 765| 0| ses.newkeys->recv.algo_crypt = 766| 0| (struct dropbear_cipher*)s2c_cipher_algo->data; 767| 0| ses.newkeys->trans.algo_crypt = 768| 0| (struct dropbear_cipher*)c2s_cipher_algo->data; 769| 0| ses.newkeys->recv.crypt_mode = 770| 0| (struct dropbear_cipher_mode*)s2c_cipher_algo->mode; 771| 0| ses.newkeys->trans.crypt_mode = 772| 0| (struct dropbear_cipher_mode*)c2s_cipher_algo->mode; 773| 0| ses.newkeys->recv.algo_mac = 774| 0|#if DROPBEAR_AEAD_MODE 775| 0| s2c_hash_algo == NULL ? ses.newkeys->recv.crypt_mode->aead_mac : ------------------ | Branch (775:4): [True: 0, False: 0] ------------------ 776| 0|#endif 777| 0| (struct dropbear_hash*)s2c_hash_algo->data; 778| 0| ses.newkeys->trans.algo_mac = 779| 0|#if DROPBEAR_AEAD_MODE 780| 0| c2s_hash_algo == NULL ? ses.newkeys->trans.crypt_mode->aead_mac : ------------------ | Branch (780:4): [True: 0, False: 0] ------------------ 781| 0|#endif 782| 0| (struct dropbear_hash*)c2s_hash_algo->data; 783| 0| ses.newkeys->recv.algo_comp = s2c_comp_algo->val; 784| 0| ses.newkeys->trans.algo_comp = c2s_comp_algo->val; 785| 6.80k| } else { 786| | /* SERVER */ 787| 6.80k| ses.newkeys->recv.algo_crypt = 788| 6.80k| (struct dropbear_cipher*)c2s_cipher_algo->data; 789| 6.80k| ses.newkeys->trans.algo_crypt = 790| 6.80k| (struct dropbear_cipher*)s2c_cipher_algo->data; 791| 6.80k| ses.newkeys->recv.crypt_mode = 792| 6.80k| (struct dropbear_cipher_mode*)c2s_cipher_algo->mode; 793| 6.80k| ses.newkeys->trans.crypt_mode = 794| 6.80k| (struct dropbear_cipher_mode*)s2c_cipher_algo->mode; 795| 6.80k| ses.newkeys->recv.algo_mac = 796| 6.80k|#if DROPBEAR_AEAD_MODE 797| 6.80k| c2s_hash_algo == NULL ? ses.newkeys->recv.crypt_mode->aead_mac : ------------------ | Branch (797:4): [True: 899, False: 5.90k] ------------------ 798| 6.80k|#endif 799| 6.80k| (struct dropbear_hash*)c2s_hash_algo->data; 800| 6.80k| ses.newkeys->trans.algo_mac = 801| 6.80k|#if DROPBEAR_AEAD_MODE 802| 6.80k| s2c_hash_algo == NULL ? ses.newkeys->trans.crypt_mode->aead_mac : ------------------ | Branch (802:4): [True: 707, False: 6.09k] ------------------ 803| 6.80k|#endif 804| 6.80k| (struct dropbear_hash*)s2c_hash_algo->data; 805| 6.80k| ses.newkeys->recv.algo_comp = c2s_comp_algo->val; 806| 6.80k| ses.newkeys->trans.algo_comp = s2c_comp_algo->val; 807| 6.80k| } 808| | 809| 6.80k|#if DROPBEAR_FUZZ 810| 6.80k| if (fuzz.fuzzing) { ------------------ | Branch (810:6): [True: 6.53k, False: 271] ------------------ 811| 6.53k| fuzz_kex_fakealgos(); 812| 6.53k| } 813| 6.80k|#endif 814| | 815| | /* reserved for future extensions */ 816| 6.80k| buf_getint(ses.payload); 817| | 818| 6.80k| if (ses.send_kex_first_guess && allgood) { ------------------ | Branch (818:6): [True: 0, False: 6.80k] | Branch (818:34): [True: 0, False: 0] ------------------ 819| 0| TRACE(("our_first_follows_matches 1")) 820| 0| ses.kexstate.our_first_follows_matches = 1; 821| 0| } 822| 6.80k| return; 823| | 824| 278|error: 825| 278| dropbear_exit("No matching algo %s", erralgo); 826| 6.80k|} common_session_init: 47| 2.84k|void common_session_init(int sock_in, int sock_out) { 48| 2.84k| time_t now; 49| | 50| |#if DEBUG_TRACE 51| | debug_start_net(); 52| |#endif 53| | 54| 2.84k| TRACE(("enter session_init")) 55| | 56| 2.84k| ses.sock_in = sock_in; 57| 2.84k| ses.sock_out = sock_out; 58| 2.84k| ses.maxfd = MAX(sock_in, sock_out); ------------------ | Branch (58:14): [True: 0, False: 2.84k] ------------------ 59| | 60| 2.84k| if (sock_in >= 0) { ------------------ | Branch (60:6): [True: 2.84k, False: 0] ------------------ 61| 2.84k| setnonblocking(sock_in); 62| 2.84k| } 63| 2.84k| if (sock_out >= 0) { ------------------ | Branch (63:6): [True: 2.84k, False: 0] ------------------ 64| 2.84k| setnonblocking(sock_out); 65| 2.84k| } 66| | 67| 2.84k| ses.socket_prio = DROPBEAR_PRIO_NORMAL; 68| | /* Sets it to lowdelay */ 69| 2.84k| update_channel_prio(); 70| | 71| |#if !DROPBEAR_SVR_MULTIUSER 72| | /* A sanity check to prevent an accidental configuration option 73| | leaving multiuser systems exposed */ 74| | { 75| | int ret; 76| | errno = 0; 77| | ret = getgroups(0, NULL); 78| | if (!(ret == -1 && errno == ENOSYS)) { 79| | dropbear_exit("Non-multiuser Dropbear requires a non-multiuser kernel"); 80| | } 81| | } 82| |#endif 83| | 84| 2.84k| now = monotonic_now(); 85| 2.84k| ses.connect_time = now; 86| 2.84k| ses.last_packet_time_keepalive_recv = now; 87| 2.84k| ses.last_packet_time_idle = now; 88| 2.84k| ses.last_packet_time_any_sent = 0; 89| 2.84k| ses.last_packet_time_keepalive_sent = 0; 90| | 91| 2.84k|#if DROPBEAR_FUZZ 92| 2.84k| if (!fuzz.fuzzing) ------------------ | Branch (92:6): [True: 0, False: 2.84k] ------------------ 93| 0|#endif 94| 0| { 95| 0| if (pipe(ses.signal_pipe) < 0) { ------------------ | Branch (95:6): [True: 0, False: 0] ------------------ 96| 0| dropbear_exit("Signal pipe failed"); 97| 0| } 98| 0| setnonblocking(ses.signal_pipe[0]); 99| 0| setnonblocking(ses.signal_pipe[1]); 100| 0| ses.maxfd = MAX(ses.maxfd, ses.signal_pipe[0]); ------------------ | Branch (100:14): [True: 0, False: 0] ------------------ 101| 0| ses.maxfd = MAX(ses.maxfd, ses.signal_pipe[1]); ------------------ | Branch (101:14): [True: 0, False: 0] ------------------ 102| 0| } 103| | 104| 2.84k| ses.writepayload = buf_new(TRANS_MAX_PAYLOAD_LEN); ------------------ | | 560| 2.84k|#define TRANS_MAX_PAYLOAD_LEN 16384 ------------------ 105| 2.84k| ses.transseq = 0; 106| | 107| 2.84k| ses.readbuf = NULL; 108| 2.84k| ses.payload = NULL; 109| 2.84k| ses.recvseq = 0; 110| | 111| 2.84k| initqueue(&ses.writequeue); 112| | 113| 2.84k| ses.requirenext = SSH_MSG_KEXINIT; ------------------ | | 36| 2.84k|#define SSH_MSG_KEXINIT 20 ------------------ 114| 2.84k| ses.dataallowed = 1; /* we can send data until we actually 115| | send the SSH_MSG_KEXINIT */ 116| 2.84k| ses.ignorenext = 0; 117| 2.84k| ses.lastpacket = 0; 118| 2.84k| ses.reply_queue_head = NULL; 119| 2.84k| ses.reply_queue_tail = NULL; 120| | 121| | /* set all the algos to none */ 122| 2.84k| ses.keys = (struct key_context*)m_malloc(sizeof(struct key_context)); 123| 2.84k| ses.newkeys = NULL; 124| 2.84k| ses.keys->recv.algo_crypt = &dropbear_nocipher; 125| 2.84k| ses.keys->trans.algo_crypt = &dropbear_nocipher; 126| 2.84k| ses.keys->recv.crypt_mode = &dropbear_mode_none; 127| 2.84k| ses.keys->trans.crypt_mode = &dropbear_mode_none; 128| | 129| 2.84k| ses.keys->recv.algo_mac = &dropbear_nohash; 130| 2.84k| ses.keys->trans.algo_mac = &dropbear_nohash; 131| | 132| 2.84k| ses.keys->algo_kex = NULL; 133| 2.84k| ses.keys->algo_hostkey = -1; 134| 2.84k| ses.keys->recv.algo_comp = DROPBEAR_COMP_NONE; 135| 2.84k| ses.keys->trans.algo_comp = DROPBEAR_COMP_NONE; 136| | 137| |#ifndef DISABLE_ZLIB 138| | ses.keys->recv.zstream = NULL; 139| | ses.keys->trans.zstream = NULL; 140| |#endif 141| | 142| | /* key exchange buffers */ 143| 2.84k| ses.session_id = NULL; 144| 2.84k| ses.kexhashbuf = NULL; 145| 2.84k| ses.transkexinit = NULL; 146| 2.84k| ses.dh_K = NULL; 147| 2.84k| ses.remoteident = NULL; 148| | 149| 2.84k| ses.chantypes = NULL; 150| | 151| 2.84k| ses.allowprivport = 0; 152| | 153| |#if DROPBEAR_PLUGIN 154| | ses.plugin_session = NULL; 155| |#endif 156| | 157| 2.84k| TRACE(("leave session_init")) 158| 2.84k|} session_loop: 160| 2.84k|void session_loop(void(*loophandler)(void)) { 161| | 162| 2.84k| fd_set readfd, writefd; 163| 2.84k| struct timeval timeout; 164| 2.84k| int val; 165| | 166| | /* main loop, select()s for all sockets in use */ 167| 212k| for(;;) { 168| 212k| const int writequeue_has_space = (ses.writequeue_len <= 2*TRANS_MAX_PAYLOAD_LEN); ------------------ | | 560| 212k|#define TRANS_MAX_PAYLOAD_LEN 16384 ------------------ 169| | 170| 212k| timeout.tv_sec = select_timeout(); 171| 212k| timeout.tv_usec = 0; 172| 212k| DROPBEAR_FD_ZERO(&writefd); ------------------ | | 106| 212k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ | Branch (172:3): [Folded, False: 212k] ------------------ 173| 212k| DROPBEAR_FD_ZERO(&readfd); ------------------ | | 106| 212k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ | Branch (173:3): [Folded, False: 212k] ------------------ 174| | 175| 212k| dropbear_assert(ses.payload == NULL); ------------------ | | 84| 212k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (84:37): [True: 0, False: 212k] | | | Branch (84:93): [Folded, False: 212k] | | ------------------ ------------------ 176| | 177| | /* We get woken up when signal handlers write to this pipe. 178| | SIGCHLD in svr-chansession is the only one currently. */ 179| 212k|#if DROPBEAR_FUZZ 180| 212k| if (!fuzz.fuzzing) ------------------ | Branch (180:7): [True: 0, False: 212k] ------------------ 181| 0|#endif 182| 0| { 183| 0| FD_SET(ses.signal_pipe[0], &readfd); 184| 0| } 185| | 186| | /* set up for channels which can be read/written */ 187| 212k| setchannelfds(&readfd, &writefd, writequeue_has_space); 188| | 189| | /* Pending connections to test */ 190| 212k| set_connect_fds(&writefd); 191| | 192| | /* We delay reading from the input socket during initial setup until 193| | after we have written out our initial KEXINIT packet (empty writequeue). 194| | This means our initial packet can be in-flight while we're doing a blocking 195| | read for the remote ident. 196| | We also avoid reading from the socket if the writequeue is full, that avoids 197| | replies backing up */ 198| 212k| if (ses.sock_in != -1 ------------------ | Branch (198:7): [True: 212k, False: 0] ------------------ 199| 212k| && (ses.remoteident || isempty(&ses.writequeue)) ------------------ | Branch (199:8): [True: 203k, False: 8.67k] | Branch (199:27): [True: 2.98k, False: 5.68k] ------------------ 200| 206k| && writequeue_has_space) { ------------------ | Branch (200:7): [True: 206k, False: 0] ------------------ 201| 206k| FD_SET(ses.sock_in, &readfd); 202| 206k| } 203| | 204| | /* Ordering is important, this test must occur after any other function 205| | might have queued packets (such as connection handlers) */ 206| 212k| if (ses.sock_out != -1 && !isempty(&ses.writequeue)) { ------------------ | Branch (206:7): [True: 212k, False: 0] | Branch (206:29): [True: 5.81k, False: 206k] ------------------ 207| 5.81k| FD_SET(ses.sock_out, &writefd); 208| 5.81k| } 209| | 210| 212k| val = select(ses.maxfd+1, &readfd, &writefd, NULL, &timeout); ------------------ | | 53| 212k| wrapfd_select(nfds, readfds, writefds, exceptfds, timeout) ------------------ 211| | 212| 212k| if (ses.exitflag) { ------------------ | Branch (212:7): [True: 0, False: 212k] ------------------ 213| 0| dropbear_exit("Terminated by signal"); 214| 0| } 215| | 216| 212k| if (val < 0 && errno != EINTR) { ------------------ | Branch (216:7): [True: 255, False: 212k] | Branch (216:18): [True: 0, False: 255] ------------------ 217| 0| dropbear_exit("Error in select"); 218| 0| } 219| | 220| 212k| if (val <= 0) { ------------------ | Branch (220:7): [True: 11.9k, False: 200k] ------------------ 221| | /* If we were interrupted or the select timed out, we still 222| | * want to iterate over channels etc for reading, to handle 223| | * server processes exiting etc. 224| | * We don't want to read/write FDs. */ 225| 11.9k| DROPBEAR_FD_ZERO(&writefd); ------------------ | | 106| 11.9k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ | Branch (225:4): [Folded, False: 11.9k] ------------------ 226| 11.9k| DROPBEAR_FD_ZERO(&readfd); ------------------ | | 106| 11.9k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ | Branch (226:4): [Folded, False: 11.9k] ------------------ 227| 11.9k| } 228| | 229| | /* We'll just empty out the pipe if required. We don't do 230| | any thing with the data, since the pipe's purpose is purely to 231| | wake up the select() above. */ 232| 212k| ses.channel_signal_pending = 0; 233| 212k| if (FD_ISSET(ses.signal_pipe[0], &readfd)) { ------------------ | Branch (233:7): [True: 0, False: 212k] ------------------ 234| 0| char x; 235| 0| TRACE(("signal pipe set")) 236| 0| while (read(ses.signal_pipe[0], &x, 1) > 0) {} ------------------ | | 55| 0|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ | Branch (236:11): [True: 0, False: 0] ------------------ 237| 0| ses.channel_signal_pending = 1; 238| 0| } 239| | 240| | /* check for auth timeout, rekeying required etc */ 241| 212k| checktimeouts(); 242| | 243| | /* process session socket's incoming data */ 244| 212k| if (ses.sock_in != -1) { ------------------ | Branch (244:7): [True: 212k, False: 0] ------------------ 245| 212k| if (FD_ISSET(ses.sock_in, &readfd)) { ------------------ | Branch (245:8): [True: 194k, False: 17.4k] ------------------ 246| 194k| if (!ses.remoteident) { ------------------ | Branch (246:9): [True: 2.84k, False: 192k] ------------------ 247| | /* blocking read of the version string */ 248| 2.84k| read_session_identification(); 249| 192k| } else { 250| 192k| read_packet(); 251| 192k| } 252| 194k| } 253| | 254| | /* Process the decrypted packet. After this, the read buffer 255| | * will be ready for a new packet */ 256| 212k| if (ses.payload != NULL) { ------------------ | Branch (256:8): [True: 42.3k, False: 170k] ------------------ 257| 42.3k| process_packet(); 258| 42.3k| } 259| 212k| } 260| | 261| | /* if required, flush out any queued reply packets that 262| | were being held up during a KEX */ 263| 212k| maybe_flush_reply_queue(); 264| | 265| 212k| handle_connect_fds(&writefd); 266| | 267| | /* loop handler prior to channelio, in case the server loophandler closes 268| | channels on process exit */ 269| 212k| loophandler(); 270| | 271| | /* process pipes etc for the channels, ses.dataallowed == 0 272| | * during rekeying ) */ 273| 212k| channelio(&readfd, &writefd); 274| | 275| | /* process session socket's outgoing data */ 276| 212k| if (ses.sock_out != -1) { ------------------ | Branch (276:7): [True: 209k, False: 2.84k] ------------------ 277| 209k| if (!isempty(&ses.writequeue)) { ------------------ | Branch (277:8): [True: 38.0k, False: 171k] ------------------ 278| 38.0k| write_packet(); 279| 38.0k| } 280| 209k| } 281| | 282| 212k| } /* for(;;) */ 283| | 284| | /* Not reached */ 285| 2.84k|} session_cleanup: 296| 2.84k|void session_cleanup() { 297| | 298| 2.84k| TRACE(("enter session_cleanup")) 299| | 300| | /* we can't cleanup if we don't know the session state */ 301| 2.84k| if (!ses.init_done) { ------------------ | Branch (301:6): [True: 0, False: 2.84k] ------------------ 302| 0| TRACE(("leave session_cleanup: !ses.init_done")) 303| 0| return; 304| 0| } 305| | 306| | /* BEWARE of changing order of functions here. */ 307| | 308| | /* Must be before extra_session_cleanup() */ 309| 2.84k| chancleanup(); 310| | 311| 2.84k| if (ses.extra_session_cleanup) { ------------------ | Branch (311:6): [True: 2.84k, False: 0] ------------------ 312| 2.84k| ses.extra_session_cleanup(); 313| 2.84k| } 314| | 315| | /* After these are freed most functions will fail */ 316| 2.84k|#if DROPBEAR_CLEANUP 317| | /* listeners call cleanup functions, this should occur before 318| | other session state is freed. */ 319| 2.84k| remove_all_listeners(); 320| | 321| 2.84k| remove_connect_pending(); 322| | 323| 3.02k| while (!isempty(&ses.writequeue)) { ------------------ | Branch (323:9): [True: 182, False: 2.84k] ------------------ 324| 182| buf_free(dequeue(&ses.writequeue)); 325| 182| } 326| | 327| 2.84k| m_free(ses.newkeys); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 328| |#ifndef DISABLE_ZLIB 329| | if (ses.keys->recv.zstream != NULL) { 330| | if (inflateEnd(ses.keys->recv.zstream) == Z_STREAM_ERROR) { 331| | dropbear_exit("Crypto error"); 332| | } 333| | m_free(ses.keys->recv.zstream); 334| | } 335| | if (ses.keys->trans.zstream != NULL) { 336| | if (deflateEnd(ses.keys->trans.zstream) == Z_STREAM_ERROR) { 337| | dropbear_exit("Crypto error"); 338| | } 339| | m_free(ses.keys->trans.zstream); 340| | } 341| |#endif 342| | 343| 2.84k| m_free(ses.remoteident); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 344| 2.84k| m_free(ses.authstate.pw_dir); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 345| 2.84k| m_free(ses.authstate.pw_name); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 346| 2.84k| m_free(ses.authstate.pw_shell); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 347| 2.84k| m_free(ses.authstate.pw_passwd); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 348| 2.84k| m_free(ses.authstate.username); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 349| 2.84k|#endif 350| | 351| 2.84k| cleanup_buf(&ses.session_id); 352| 2.84k| cleanup_buf(&ses.hash); 353| 2.84k| cleanup_buf(&ses.payload); 354| 2.84k| cleanup_buf(&ses.readbuf); 355| 2.84k| cleanup_buf(&ses.writepayload); 356| 2.84k| cleanup_buf(&ses.kexhashbuf); 357| 2.84k| cleanup_buf(&ses.transkexinit); 358| 2.84k| if (ses.dh_K) { ------------------ | Branch (358:6): [True: 0, False: 2.84k] ------------------ 359| 0| mp_clear(ses.dh_K); 360| 0| } 361| 2.84k| m_free(ses.dh_K); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 362| 2.84k| if (ses.dh_K_bytes) { ------------------ | Branch (362:6): [True: 0, False: 2.84k] ------------------ 363| 0| buf_burn_free(ses.dh_K_bytes); 364| 0| } 365| | 366| 2.84k| m_burn(ses.keys, sizeof(struct key_context)); 367| 2.84k| m_free(ses.keys); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 368| | 369| 2.84k| TRACE(("leave session_cleanup")) 370| 2.84k|} send_session_identification: 372| 2.84k|void send_session_identification() { 373| 2.84k| buffer *writebuf = buf_new(strlen(LOCAL_IDENT "\r\n") + 1); ------------------ | | 14| 2.84k|#define LOCAL_IDENT "SSH-2.0-dropbear" IDENT_VERSION_PART ------------------ 374| 2.84k| buf_putbytes(writebuf, (const unsigned char *) LOCAL_IDENT "\r\n", strlen(LOCAL_IDENT "\r\n")); ------------------ | | 14| 2.84k|#define LOCAL_IDENT "SSH-2.0-dropbear" IDENT_VERSION_PART ------------------ buf_putbytes(writebuf, (const unsigned char *) LOCAL_IDENT "\r\n", strlen(LOCAL_IDENT "\r\n")); ------------------ | | 14| 2.84k|#define LOCAL_IDENT "SSH-2.0-dropbear" IDENT_VERSION_PART ------------------ 375| 2.84k| writebuf_enqueue(writebuf); 376| 2.84k|} fill_passwd: 655| 483|void fill_passwd(const char* username) { 656| 483| struct passwd *pw = NULL; 657| 483| if (ses.authstate.pw_name) ------------------ | Branch (657:6): [True: 0, False: 483] ------------------ 658| 0| m_free(ses.authstate.pw_name); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 659| 483| if (ses.authstate.pw_dir) ------------------ | Branch (659:6): [True: 0, False: 483] ------------------ 660| 0| m_free(ses.authstate.pw_dir); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 661| 483| if (ses.authstate.pw_shell) ------------------ | Branch (661:6): [True: 0, False: 483] ------------------ 662| 0| m_free(ses.authstate.pw_shell); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 663| 483| if (ses.authstate.pw_passwd) ------------------ | Branch (663:6): [True: 0, False: 483] ------------------ 664| 0| m_free(ses.authstate.pw_passwd); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 665| | 666| 483| pw = getpwnam(username); ------------------ | | 108| 483|#define getpwnam(x) fuzz_getpwnam(x) ------------------ 667| 483| if (!pw) { ------------------ | Branch (667:6): [True: 478, False: 5] ------------------ 668| 478| return; 669| 478| } 670| 5| ses.authstate.pw_uid = pw->pw_uid; 671| 5| ses.authstate.pw_gid = pw->pw_gid; 672| 5| ses.authstate.pw_name = m_strdup(pw->pw_name); 673| 5| ses.authstate.pw_dir = m_strdup(pw->pw_dir); 674| 5| ses.authstate.pw_shell = m_strdup(pw->pw_shell); 675| 5| { 676| 5| char *passwd_crypt = pw->pw_passwd; 677| 5|#ifdef HAVE_SHADOW_H 678| | /* "x" for the passwd crypt indicates shadow should be used */ 679| 5| if (pw->pw_passwd && strcmp(pw->pw_passwd, "x") == 0) { ------------------ | Branch (679:7): [True: 5, False: 0] | Branch (679:24): [True: 0, False: 5] ------------------ 680| | /* get the shadow password */ 681| 0| struct spwd *spasswd = getspnam(ses.authstate.pw_name); 682| 0| if (spasswd && spasswd->sp_pwdp) { ------------------ | Branch (682:8): [True: 0, False: 0] | Branch (682:19): [True: 0, False: 0] ------------------ 683| 0| passwd_crypt = spasswd->sp_pwdp; 684| 0| } else { 685| | /* Fail if missing in /etc/shadow */ 686| 0| passwd_crypt = "!!"; 687| 0| } 688| 0| } 689| 5|#endif 690| 5| if (!passwd_crypt) { ------------------ | Branch (690:7): [True: 0, False: 5] ------------------ 691| | /* android supposedly returns NULL */ 692| 0| passwd_crypt = "!!"; 693| 0| } 694| 5| ses.authstate.pw_passwd = m_strdup(passwd_crypt); 695| 5| } 696| 5|} update_channel_prio: 699| 2.84k|void update_channel_prio() { 700| 2.84k| enum dropbear_prio new_prio; 701| 2.84k| int any = 0; 702| 2.84k| unsigned int i; 703| | 704| 2.84k| TRACE(("update_channel_prio")) 705| | 706| 2.84k| if (ses.sock_out < 0) { ------------------ | Branch (706:6): [True: 0, False: 2.84k] ------------------ 707| 0| TRACE(("leave update_channel_prio: no socket")) 708| 0| return; 709| 0| } 710| | 711| 2.84k| new_prio = DROPBEAR_PRIO_NORMAL; 712| 2.84k| for (i = 0; i < ses.chansize; i++) { ------------------ | Branch (712:14): [True: 0, False: 2.84k] ------------------ 713| 0| struct Channel *channel = ses.channels[i]; 714| 0| if (!channel) { ------------------ | Branch (714:7): [True: 0, False: 0] ------------------ 715| 0| continue; 716| 0| } 717| 0| any = 1; 718| 0| if (channel->prio == DROPBEAR_PRIO_LOWDELAY) { ------------------ | Branch (718:7): [True: 0, False: 0] ------------------ 719| 0| new_prio = DROPBEAR_PRIO_LOWDELAY; 720| 0| break; 721| 0| } 722| 0| } 723| | 724| 2.84k| if (any == 0) { ------------------ | Branch (724:6): [True: 2.84k, False: 0] ------------------ 725| | /* lowdelay during setup */ 726| 2.84k| TRACE(("update_channel_prio: not any")) 727| 2.84k| new_prio = DROPBEAR_PRIO_LOWDELAY; 728| 2.84k| } 729| | 730| 2.84k| if (new_prio != ses.socket_prio) { ------------------ | Branch (730:6): [True: 2.84k, False: 0] ------------------ 731| 2.84k| TRACE(("Dropbear priority transitioning %d -> %d", ses.socket_prio, new_prio)) 732| 2.84k| set_sock_priority(ses.sock_out, new_prio); 733| 2.84k| ses.socket_prio = new_prio; 734| 2.84k| } 735| 2.84k|} common-session.c:cleanup_buf: 287| 19.9k|static void cleanup_buf(buffer **buf) { 288| 19.9k| if (!*buf) { ------------------ | Branch (288:6): [True: 10.8k, False: 9.09k] ------------------ 289| 10.8k| return; 290| 10.8k| } 291| 9.09k| buf_burn_free(*buf); 292| | *buf = NULL; 293| 9.09k|} common-session.c:read_session_identification: 378| 2.84k|static void read_session_identification() { 379| | /* max length of 255 chars */ 380| 2.84k| char linebuf[256]; 381| 2.84k| int len = 0; 382| 2.84k| char done = 0; 383| 2.84k| int i; 384| | 385| | /* Servers may send other lines of data before sending the 386| | * version string, client must be able to process such lines. 387| | * If they send more than 50 lines, something is wrong */ 388| 2.96k| for (i = IS_DROPBEAR_CLIENT ? 50 : 1; i > 0; i--) { ------------------ | | 382| 2.84k|#define IS_DROPBEAR_CLIENT (ses.isserver == 0) | | ------------------ | | | Branch (382:28): [True: 0, False: 2.84k] | | ------------------ ------------------ | Branch (388:40): [True: 2.84k, False: 119] ------------------ 389| 2.84k| len = ident_readln(ses.sock_in, linebuf, sizeof(linebuf)); 390| | 391| 2.84k| if (len < 0 && errno != EINTR) { ------------------ | Branch (391:7): [True: 89, False: 2.75k] | Branch (391:18): [True: 11, False: 78] ------------------ 392| | /* It failed */ 393| 11| break; 394| 11| } 395| | 396| 2.83k| if (len >= 4 && memcmp(linebuf, "SSH-", 4) == 0) { ------------------ | Branch (396:7): [True: 2.74k, False: 84] | Branch (396:19): [True: 2.71k, False: 35] ------------------ 397| | /* start of line matches */ 398| 2.71k| done = 1; 399| 2.71k| break; 400| 2.71k| } 401| 2.83k| } 402| | 403| 2.84k| if (!done) { ------------------ | Branch (403:6): [True: 130, False: 2.71k] ------------------ 404| 130| TRACE(("error reading remote ident: %s\n", strerror(errno))) 405| 130| ses.remoteclosed(); 406| 2.71k| } else { 407| | /* linebuf is already null terminated */ 408| 2.71k| ses.remoteident = m_malloc(len); 409| 2.71k| memcpy(ses.remoteident, linebuf, len); 410| 2.71k| } 411| | 412| | /* Shall assume that 2.x will be backwards compatible. */ 413| 2.84k| if (strncmp(ses.remoteident, "SSH-2.", 6) != 0 ------------------ | Branch (413:6): [True: 63, False: 2.78k] ------------------ 414| 63| && strncmp(ses.remoteident, "SSH-1.99-", 9) != 0) { ------------------ | Branch (414:7): [True: 61, False: 2] ------------------ 415| 61| dropbear_exit("Incompatible remote version '%s'", ses.remoteident); 416| 61| } 417| | 418| 2.84k| DEBUG1(("remoteident: %s", ses.remoteident)) 419| | 420| 2.84k|} common-session.c:ident_readln: 424| 2.84k|static int ident_readln(int fd, char* buf, int count) { 425| | 426| 2.84k| char in; 427| 2.84k| int pos = 0; 428| 2.84k| int num = 0; 429| 2.84k| fd_set fds; 430| 2.84k| struct timeval timeout; 431| | 432| 2.84k| TRACE(("enter ident_readln")) 433| | 434| 2.84k| if (count < 1) { ------------------ | Branch (434:6): [True: 0, False: 2.84k] ------------------ 435| 0| return -1; 436| 0| } 437| | 438| 2.84k| DROPBEAR_FD_ZERO(&fds); ------------------ | | 106| 2.84k|#define DROPBEAR_FD_ZERO(fds) FD_ZERO(fds) ------------------ | Branch (438:2): [Folded, False: 2.84k] ------------------ 439| | 440| | /* select since it's a non-blocking fd */ 441| | 442| | /* leave space to null-terminate */ 443| 61.2k| while (pos < count-1) { ------------------ | Branch (443:9): [True: 61.2k, False: 1] ------------------ 444| | 445| 61.2k| FD_SET(fd, &fds); 446| | 447| 61.2k| timeout.tv_sec = 1; 448| 61.2k| timeout.tv_usec = 0; 449| 61.2k| if (select(fd+1, &fds, NULL, NULL, &timeout) < 0) { ------------------ | | 53| 61.2k| wrapfd_select(nfds, readfds, writefds, exceptfds, timeout) ------------------ | Branch (449:7): [True: 63, False: 61.1k] ------------------ 450| 63| if (errno == EINTR) { ------------------ | Branch (450:8): [True: 63, False: 0] ------------------ 451| 63| continue; 452| 63| } 453| 0| TRACE(("leave ident_readln: select error")) 454| 0| return -1; 455| 63| } 456| | 457| 61.1k| checktimeouts(); 458| | 459| | /* Have to go one byte at a time, since we don't want to read past 460| | * the end, and have to somehow shove bytes back into the normal 461| | * packet reader */ 462| 61.1k| if (FD_ISSET(fd, &fds)) { ------------------ | Branch (462:7): [True: 61.1k, False: 0] ------------------ 463| 61.1k| num = read(fd, &in, 1); ------------------ | | 55| 61.1k|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ 464| | /* a "\n" is a newline, "\r" we want to read in and keep going 465| | * so that it won't be read as part of the next line */ 466| 61.1k| if (num < 0) { ------------------ | Branch (466:8): [True: 102, False: 61.0k] ------------------ 467| | /* error */ 468| 102| if (errno == EINTR) { ------------------ | Branch (468:9): [True: 101, False: 1] ------------------ 469| 101| continue; /* not a real error */ 470| 101| } 471| 1| TRACE(("leave ident_readln: read error")) 472| 1| return -1; 473| 102| } 474| 61.0k| if (num == 0) { ------------------ | Branch (474:8): [True: 88, False: 61.0k] ------------------ 475| | /* EOF */ 476| 88| TRACE(("leave ident_readln: EOF")) 477| 88| return -1; 478| 88| } 479| | 480| 61.0k|#if DROPBEAR_FUZZ 481| 61.0k| fuzz_dump(&in, 1); 482| 61.0k|#endif 483| | 484| 61.0k| if (in == '\n') { ------------------ | Branch (484:8): [True: 2.75k, False: 58.2k] ------------------ 485| | /* end of ident string */ 486| 2.75k| break; 487| 2.75k| } 488| | /* we don't want to include '\r's */ 489| 58.2k| if (in != '\r') { ------------------ | Branch (489:8): [True: 41.5k, False: 16.6k] ------------------ 490| 41.5k| buf[pos] = in; 491| 41.5k| pos++; 492| 41.5k| } 493| 58.2k| } 494| 61.1k| } 495| | 496| 2.75k| buf[pos] = '\0'; 497| 2.75k| TRACE(("leave ident_readln: return %d", pos+1)) 498| 2.75k| return pos+1; 499| 2.84k|} common-session.c:checktimeouts: 545| 273k|static void checktimeouts() { 546| | 547| 273k| time_t now; 548| 273k| now = monotonic_now(); 549| | 550| 273k| if (IS_DROPBEAR_SERVER && ses.authstate.authdone != 1 ------------------ | | 381| 547k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (381:28): [True: 273k, False: 0] | | ------------------ ------------------ | Branch (550:28): [True: 273k, False: 0] ------------------ 551| 273k| && elapsed(now, ses.connect_time) >= AUTH_TIMEOUT) { ------------------ | | 35| 273k|#define AUTH_TIMEOUT 300 /* we choose 5 minutes */ ------------------ | Branch (551:6): [True: 0, False: 273k] ------------------ 552| 0| dropbear_close("Timeout before auth"); 553| 0| } 554| | 555| | /* we can't rekey if we haven't done remote ident exchange yet */ 556| 273k| if (ses.remoteident == NULL) { ------------------ | Branch (556:6): [True: 69.8k, False: 203k] ------------------ 557| 69.8k| return; 558| 69.8k| } 559| | 560| 203k| if (!ses.kexstate.sentkexinit ------------------ | Branch (560:6): [True: 62.4k, False: 141k] ------------------ 561| 62.4k| && (elapsed(now, ses.kexstate.lastkextime) >= KEX_REKEY_TIMEOUT ------------------ | | 28| 124k|#define KEX_REKEY_TIMEOUT (3600 * 8) ------------------ | Branch (561:8): [True: 0, False: 62.4k] ------------------ 562| 62.4k| || ses.kexstate.datarecv+ses.kexstate.datatrans >= KEX_REKEY_DATA ------------------ | | 31| 124k|#define KEX_REKEY_DATA (1<<30) /* 2^30 == 1GB, this value must be < INT_MAX */ ------------------ | Branch (562:7): [True: 0, False: 62.4k] ------------------ 563| 62.4k| || ses.kexstate.needrekey)) { ------------------ | Branch (563:7): [True: 0, False: 62.4k] ------------------ 564| 0| TRACE(("rekeying after timeout or max data reached")) 565| 0| ses.kexstate.needrekey = 0; 566| 0| send_msg_kexinit(); 567| 0| } 568| | 569| 203k| if (opts.keepalive_secs > 0 && ses.authstate.authdone) { ------------------ | Branch (569:6): [True: 0, False: 203k] | Branch (569:33): [True: 0, False: 0] ------------------ 570| | /* Avoid sending keepalives prior to auth - those are 571| | not valid pre-auth packet types */ 572| | 573| | /* Send keepalives if we've been idle */ 574| 0| if (elapsed(now, ses.last_packet_time_any_sent) >= opts.keepalive_secs) { ------------------ | Branch (574:7): [True: 0, False: 0] ------------------ 575| 0| send_msg_keepalive(); 576| 0| } 577| | 578| | /* Also send an explicit keepalive message to trigger a response 579| | if the remote end hasn't sent us anything */ 580| 0| if (elapsed(now, ses.last_packet_time_keepalive_recv) >= opts.keepalive_secs ------------------ | Branch (580:7): [True: 0, False: 0] ------------------ 581| 0| && elapsed(now, ses.last_packet_time_keepalive_sent) >= opts.keepalive_secs) { ------------------ | Branch (581:7): [True: 0, False: 0] ------------------ 582| 0| send_msg_keepalive(); 583| 0| } 584| | 585| 0| if (elapsed(now, ses.last_packet_time_keepalive_recv) ------------------ | Branch (585:7): [True: 0, False: 0] ------------------ 586| 0| >= opts.keepalive_secs * DEFAULT_KEEPALIVE_LIMIT) { ------------------ | | 573| 0|#define DEFAULT_KEEPALIVE_LIMIT 3 ------------------ 587| 0| dropbear_exit("Keepalive timeout"); 588| 0| } 589| 0| } 590| | 591| 203k| if (opts.idle_timeout_secs > 0 ------------------ | Branch (591:6): [True: 0, False: 203k] ------------------ 592| 0| && elapsed(now, ses.last_packet_time_idle) >= opts.idle_timeout_secs) { ------------------ | Branch (592:7): [True: 0, False: 0] ------------------ 593| 0| dropbear_close("Idle timeout"); 594| 0| } 595| | 596| 203k| if (opts.max_duration_secs > 0 ------------------ | Branch (596:6): [True: 0, False: 203k] ------------------ 597| 0| && elapsed(now, ses.connect_time) >= opts.max_duration_secs) { ------------------ | Branch (597:7): [True: 0, False: 0] ------------------ 598| 0| dropbear_close("Max duration reached"); 599| 0| } 600| 203k|} common-session.c:elapsed: 535| 1.43M|static long elapsed(time_t now, time_t prev) { 536| 1.43M| time_t del = now - prev; 537| 1.43M| if (del > LONG_MAX) { ------------------ | Branch (537:6): [True: 0, False: 1.43M] ------------------ 538| 0| return LONG_MAX; 539| 0| } 540| 1.43M| return (long)del; 541| 1.43M|} common-session.c:select_timeout: 613| 212k|static long select_timeout() { 614| | /* determine the minimum timeout that might be required, so 615| | as to avoid waking when unneccessary */ 616| 212k| long timeout = KEX_REKEY_TIMEOUT; ------------------ | | 28| 212k|#define KEX_REKEY_TIMEOUT (3600 * 8) ------------------ 617| 212k| time_t now = monotonic_now(); 618| | 619| 212k| if (!ses.kexstate.sentkexinit) { ------------------ | Branch (619:6): [True: 62.4k, False: 150k] ------------------ 620| 62.4k| update_timeout(KEX_REKEY_TIMEOUT, now, ses.kexstate.lastkextime, &timeout); ------------------ | | 28| 62.4k|#define KEX_REKEY_TIMEOUT (3600 * 8) ------------------ 621| 62.4k| } 622| 212k| if (ses.kexstate.needrekey) { ------------------ | Branch (622:6): [True: 0, False: 212k] ------------------ 623| 0| timeout = 0; 624| 0| } 625| | 626| 212k| if (ses.authstate.authdone != 1 && IS_DROPBEAR_SERVER) { ------------------ | | 381| 212k|#define IS_DROPBEAR_SERVER (ses.isserver == 1) | | ------------------ | | | Branch (381:28): [True: 212k, False: 0] | | ------------------ ------------------ | Branch (626:6): [True: 212k, False: 0] ------------------ 627| | /* AUTH_TIMEOUT is only relevant before authdone */ 628| 212k| update_timeout(AUTH_TIMEOUT, now, ses.connect_time, &timeout); ------------------ | | 35| 212k|#define AUTH_TIMEOUT 300 /* we choose 5 minutes */ ------------------ 629| 212k| } 630| | 631| 212k| if (ses.authstate.authdone) { ------------------ | Branch (631:6): [True: 0, False: 212k] ------------------ 632| 0| update_timeout(opts.keepalive_secs, now, 633| 0| MAX(ses.last_packet_time_keepalive_recv, ses.last_packet_time_keepalive_sent), ------------------ | Branch (633:4): [True: 0, False: 0] ------------------ 634| 0| &timeout); 635| 0| } 636| | 637| 212k| update_timeout(opts.idle_timeout_secs, now, ses.last_packet_time_idle, 638| 212k| &timeout); 639| | 640| 212k| update_timeout(opts.max_duration_secs, now, ses.connect_time, 641| 212k| &timeout); 642| | 643| | /* clamp negative timeouts to zero - event has already triggered */ 644| | return MAX(timeout, 0); ------------------ | Branch (644:9): [True: 212k, False: 0] ------------------ 645| 212k|} common-session.c:update_timeout: 602| 699k|static void update_timeout(long limit, time_t now, time_t last_event, long * timeout) { 603| 699k| TRACE2(("update_timeout limit %ld, now %llu, last %llu, timeout %ld", 604| 699k| limit, 605| 699k| (unsigned long long)now, 606| 699k| (unsigned long long)last_event, *timeout)) 607| 699k| if (last_event > 0 && limit > 0) { ------------------ | Branch (607:6): [True: 699k, False: 0] | Branch (607:24): [True: 274k, False: 424k] ------------------ 608| | *timeout = MIN(*timeout, MAX(0, limit - elapsed(now, last_event))); ------------------ | Branch (608:14): [True: 0, False: 274k] | Branch (608:14): [True: 0, False: 274k] | Branch (608:14): [True: 0, False: 274k] ------------------ 609| 274k| TRACE2(("new timeout %ld", *timeout)) 610| 274k| } 611| 699k|} crypto_init: 21| 1|void crypto_init() { 22| | 23| 1| const struct ltc_cipher_descriptor *regciphers[] = { 24| 1|#if DROPBEAR_AES 25| 1| &aes_desc, 26| 1|#endif 27| |#if DROPBEAR_3DES 28| | &des3_desc, 29| |#endif 30| 1| NULL 31| 1| }; 32| | 33| 1| const struct ltc_hash_descriptor *reghashes[] = { 34| |#if DROPBEAR_SHA1_HMAC 35| | &sha1_desc, 36| |#endif 37| 1|#if DROPBEAR_SHA256 38| 1| &sha256_desc, 39| 1|#endif 40| 1|#if DROPBEAR_SHA384 41| 1| &sha384_desc, 42| 1|#endif 43| 1|#if DROPBEAR_SHA512 44| 1| &sha512_desc, 45| 1|#endif 46| 1| NULL 47| 1| }; 48| 1| int i; 49| | 50| 2| for (i = 0; regciphers[i] != NULL; i++) { ------------------ | Branch (50:14): [True: 1, False: 1] ------------------ 51| 1| if (register_cipher(regciphers[i]) == -1) { ------------------ | Branch (51:7): [True: 0, False: 1] ------------------ 52| 0| dropbear_exit("Error registering crypto"); 53| 0| } 54| 1| } 55| | 56| 4| for (i = 0; reghashes[i] != NULL; i++) { ------------------ | Branch (56:14): [True: 3, False: 1] ------------------ 57| 3| if (register_hash(reghashes[i]) == -1) { ------------------ | Branch (57:7): [True: 0, False: 3] ------------------ 58| 0| dropbear_exit("Error registering crypto"); 59| 0| } 60| 3| } 61| | 62| 1|#if DROPBEAR_LTC_PRNG 63| 1| dropbear_ltc_prng = register_prng(&dropbear_prng_desc); 64| 1| if (dropbear_ltc_prng == -1) { ------------------ | Branch (64:6): [True: 0, False: 1] ------------------ 65| 0| dropbear_exit("Error registering crypto"); 66| 0| } 67| 1|#endif 68| | 69| 1| mp_rand_source(dropbear_rand_source); 70| | 71| 1|#if DROPBEAR_ECC 72| 1| ltc_mp = ltm_desc; 73| 1| dropbear_ecc_fill_dp(); 74| 1|#endif 75| 1|} m_burn: 5| 170k|void m_burn(void *data, unsigned int len) { 6| | 7| |#if defined(HAVE_MEMSET_S) 8| | memset_s(data, len, 0x0, len); 9| |#elif defined(HAVE_EXPLICIT_BZERO) 10| | explicit_bzero(data, len); 11| |#else 12| | /* This must be volatile to avoid compiler optimisation */ 13| | volatile void *p = data; 14| | memset((void*)p, 0x0, len); 15| |#endif 16| 170k|} m_calloc: 5| 14.1k|void * m_calloc(size_t nmemb, size_t size) { 6| 14.1k| if (SIZE_T_MAX / nmemb < size) { ------------------ | | 175| 14.1k|#define SIZE_T_MAX ULONG_MAX ------------------ | Branch (6:9): [True: 0, False: 14.1k] ------------------ 7| 0| dropbear_exit("m_calloc failed"); 8| 0| } 9| 14.1k| return m_malloc(nmemb*size); 10| 14.1k|} m_strdup: 12| 9.03k|void * m_strdup(const char * str) { 13| 9.03k| char* ret; 14| 9.03k| unsigned int len; 15| 9.03k| len = strlen(str); 16| | 17| 9.03k| ret = m_malloc(len+1); 18| 9.03k| if (ret == NULL) { ------------------ | Branch (18:9): [True: 0, False: 9.03k] ------------------ 19| 0| dropbear_exit("m_strdup failed"); 20| 0| } 21| 9.03k| memcpy(ret, str, len+1); 22| 9.03k| return ret; 23| 9.03k|} m_malloc_set_epoch: 76| 2.84k|void m_malloc_set_epoch(unsigned int epoch) { 77| 2.84k| current_epoch = epoch; 78| 2.84k|} m_malloc_free_epoch: 80| 2.84k|void m_malloc_free_epoch(unsigned int epoch, int dofree) { 81| 2.84k| struct dbmalloc_header* header; 82| 2.84k| struct dbmalloc_header* nextheader = NULL; 83| 2.84k| struct dbmalloc_header* oldstaple = staple; 84| 2.84k| staple = NULL; 85| | /* free allocations from this epoch, create a new staple-anchored list from 86| | the remainder */ 87| 2.96M| for (header = oldstaple; header; header = nextheader) ------------------ | Branch (87:30): [True: 2.95M, False: 2.84k] ------------------ 88| 2.95M| { 89| 2.95M| nextheader = header->next; 90| 2.95M| if (header->epoch == epoch) { ------------------ | Branch (90:13): [True: 904, False: 2.95M] ------------------ 91| 904| if (dofree) { ------------------ | Branch (91:17): [True: 904, False: 0] ------------------ 92| 904| free(header); 93| 904| } 94| 2.95M| } else { 95| 2.95M| header->prev = NULL; 96| | header->next = NULL; 97| 2.95M| put_alloc(header); 98| 2.95M| } 99| 2.95M| } 100| 2.84k|} m_malloc: 131| 297k|void * m_malloc(size_t size) { 132| 297k| char* mem = NULL; 133| 297k| struct dbmalloc_header* header = NULL; 134| | 135| 297k| if (size == 0 || size > 1e9) { ------------------ | Branch (135:9): [True: 0, False: 297k] | Branch (135:22): [True: 0, False: 297k] ------------------ 136| 0| dropbear_exit("m_malloc failed"); 137| 0| } 138| | 139| 297k| size = size + sizeof(struct dbmalloc_header); 140| | 141| 297k| mem = calloc(1, size); 142| 297k| if (mem == NULL) { ------------------ | Branch (142:9): [True: 0, False: 297k] ------------------ 143| 0| dropbear_exit("m_malloc failed"); 144| 0| } 145| 297k| header = (struct dbmalloc_header*)mem; 146| 297k| put_alloc(header); 147| 297k| header->epoch = current_epoch; 148| 297k| return &mem[sizeof(struct dbmalloc_header)]; 149| 297k|} m_realloc: 151| 8.55k|void * m_realloc(void* ptr, size_t size) { 152| 8.55k| char* mem = NULL; 153| 8.55k| struct dbmalloc_header* header = NULL; 154| 8.55k| if (size == 0 || size > 1e9) { ------------------ | Branch (154:9): [True: 0, False: 8.55k] | Branch (154:22): [True: 0, False: 8.55k] ------------------ 155| 0| dropbear_exit("m_realloc failed"); 156| 0| } 157| | 158| 8.55k| header = get_header(ptr); 159| 8.55k| remove_alloc(header); 160| | 161| 8.55k| size = size + sizeof(struct dbmalloc_header); 162| 8.55k| mem = realloc(header, size); 163| 8.55k| if (mem == NULL) { ------------------ | Branch (163:9): [True: 0, False: 8.55k] ------------------ 164| 0| dropbear_exit("m_realloc failed"); 165| 0| } 166| | 167| 8.55k| header = (struct dbmalloc_header*)mem; 168| 8.55k| put_alloc(header); 169| 8.55k| return &mem[sizeof(struct dbmalloc_header)]; 170| 8.55k|} m_free_direct: 172| 311k|void m_free_direct(void* ptr) { 173| 311k| struct dbmalloc_header* header = NULL; 174| 311k| if (!ptr) { ------------------ | Branch (174:9): [True: 17.6k, False: 294k] ------------------ 175| 17.6k| return; 176| 17.6k| } 177| 294k| header = get_header(ptr); 178| 294k| remove_alloc(header); 179| 294k| free(header); 180| 294k|} m_realloc_ltm: 184| 1.02k|void * m_realloc_ltm(void* ptr, size_t oldsize, size_t newsize) { 185| 1.02k| (void)oldsize; 186| 1.02k| return m_realloc(ptr, newsize); 187| 1.02k|} m_free_ltm: 189| 13.9k|void m_free_ltm(void *mem, size_t size) { 190| 13.9k| (void)size; 191| 13.9k| m_free_direct(mem); 192| 13.9k|} dbmalloc.c:put_alloc: 102| 3.26M|static void put_alloc(struct dbmalloc_header *header) { 103| 3.26M| assert(header->next == NULL); ------------------ | Branch (103:5): [True: 0, False: 3.26M] | Branch (103:5): [True: 3.26M, False: 0] ------------------ 104| 3.26M| assert(header->prev == NULL); ------------------ | Branch (104:5): [True: 0, False: 3.26M] | Branch (104:5): [True: 3.26M, False: 0] ------------------ 105| 3.26M| if (staple) { ------------------ | Branch (105:9): [True: 3.26M, False: 2.84k] ------------------ 106| 3.26M| staple->prev = header; 107| 3.26M| } 108| 3.26M| header->next = staple; 109| 3.26M| staple = header; 110| 3.26M|} dbmalloc.c:get_header: 126| 302k|static struct dbmalloc_header* get_header(void* ptr) { 127| 302k| char* bptr = ptr; 128| 302k| return (struct dbmalloc_header*)&bptr[-sizeof(struct dbmalloc_header)]; 129| 302k|} dbmalloc.c:remove_alloc: 112| 302k|static void remove_alloc(struct dbmalloc_header *header) { 113| 302k| if (header->prev) { ------------------ | Branch (113:9): [True: 133k, False: 169k] ------------------ 114| 133k| header->prev->next = header->next; 115| 133k| } 116| 302k| if (header->next) { ------------------ | Branch (116:9): [True: 302k, False: 0] ------------------ 117| 302k| header->next->prev = header->prev; 118| 302k| } 119| 302k| if (staple == header) { ------------------ | Branch (119:9): [True: 169k, False: 133k] ------------------ 120| 169k| staple = header->next; 121| 169k| } 122| 302k| header->prev = NULL; 123| | header->next = NULL; 124| 302k|} fuzz_seed: 153| 2.84k|void fuzz_seed(const unsigned char* dat, unsigned int len) { 154| 2.84k| hash_state hs; 155| 2.84k| sha256_init(&hs); 156| 2.84k| sha256_process(&hs, "fuzzfuzzfuzz", strlen("fuzzfuzzfuzz")); 157| 2.84k| sha256_process(&hs, dat, len); 158| 2.84k| sha256_done(&hs, hashpool); 159| 2.84k| counter = 0; 160| 2.84k| donerandinit = 1; 161| 2.84k|} genrandom: 313| 46.4k|void genrandom(unsigned char* buf, unsigned int len) { 314| | 315| 46.4k| hash_state hs; 316| 46.4k| unsigned char hash[SHA256_HASH_SIZE]; 317| 46.4k| unsigned int copylen; 318| | 319| 46.4k| if (!donerandinit) { ------------------ | Branch (319:6): [True: 0, False: 46.4k] ------------------ 320| 0| dropbear_exit("seedrandom not done"); 321| 0| } 322| | 323| 92.9k| while (len > 0) { ------------------ | Branch (323:9): [True: 46.4k, False: 46.4k] ------------------ 324| 46.4k| sha256_init(&hs); 325| 46.4k| sha256_process(&hs, (void*)hashpool, sizeof(hashpool)); 326| 46.4k| sha256_process(&hs, (void*)&counter, sizeof(counter)); 327| 46.4k| sha256_done(&hs, hash); 328| | 329| 46.4k| counter++; 330| 46.4k| if (counter > MAX_COUNTER) { ------------------ | | 35| 46.4k|#define MAX_COUNTER (1<<30) ------------------ | Branch (330:7): [True: 0, False: 46.4k] ------------------ 331| 0| seedrandom(); 332| 0| } 333| | 334| | copylen = MIN(len, SHA256_HASH_SIZE); ------------------ | Branch (334:13): [True: 46.4k, False: 0] ------------------ 335| 46.4k| memcpy(buf, hash, copylen); 336| 46.4k| len -= copylen; 337| 46.4k| buf += copylen; 338| 46.4k| } 339| 46.4k| m_burn(hash, sizeof(hash)); 340| 46.4k|} dropbear_close: 95| 1.24k|void dropbear_close(const char* format, ...) { 96| | 97| 1.24k| va_list param; 98| | 99| 1.24k| va_start(param, format); 100| 1.24k| _dropbear_exit(EXIT_SUCCESS, format, param); 101| 1.24k| va_end(param); 102| | 103| 0|} dropbear_exit: 105| 1.60k|void dropbear_exit(const char* format, ...) { 106| | 107| 1.60k| va_list param; 108| | 109| 1.60k| va_start(param, format); 110| 1.60k| _dropbear_exit(EXIT_FAILURE, format, param); 111| 1.60k| va_end(param); 112| 0|} dropbear_log: 148| 3.32k|void dropbear_log(int priority, const char* format, ...) { 149| | 150| 3.32k| va_list param; 151| | 152| 3.32k| va_start(param, format); 153| 3.32k| _dropbear_log(priority, format, param); 154| | va_end(param); 155| 3.32k|} m_close: 565| 1.24k|void m_close(int fd) { 566| 1.24k| int val; 567| | 568| 1.24k| if (fd < 0) { ------------------ | Branch (568:6): [True: 0, False: 1.24k] ------------------ 569| 0| return; 570| 0| } 571| | 572| 1.24k| do { 573| 1.24k| val = close(fd); ------------------ | | 56| 1.24k|#define close(fd) wrapfd_close(fd) ------------------ 574| 1.24k| } while (val < 0 && errno == EINTR); ------------------ | Branch (574:11): [True: 0, False: 1.24k] | Branch (574:22): [True: 0, False: 0] ------------------ 575| | 576| 1.24k| if (val < 0 && errno != EBADF) { ------------------ | Branch (576:6): [True: 0, False: 1.24k] | Branch (576:17): [True: 0, False: 0] ------------------ 577| | /* Linux says EIO can happen */ 578| | dropbear_exit("Error closing fd %d, %s", fd, strerror(errno)); 579| 0| } 580| 1.24k|} setnonblocking: 582| 5.68k|void setnonblocking(int fd) { 583| | 584| 5.68k| int fl = 0; 585| 5.68k| TRACE(("setnonblocking: %d", fd)) 586| | 587| 5.68k|#if DROPBEAR_FUZZ 588| 5.68k| if (fuzz.fuzzing) { ------------------ | Branch (588:6): [True: 5.68k, False: 0] ------------------ 589| 5.68k| return; 590| 5.68k| } 591| 0|#endif 592| 0| fl = fcntl(fd, F_GETFL, 0); 593| 0| if (fl == -1) { ------------------ | Branch (593:6): [True: 0, False: 0] ------------------ 594| | /* F_GETFL shouldn't fail */ 595| 0| dropbear_exit("Couldn't set nonblocking"); 596| 0| } 597| | 598| 0| if (fcntl(fd, F_SETFL, fl | O_NONBLOCK) == -1) { ------------------ | Branch (598:6): [True: 0, False: 0] ------------------ 599| 0| if (errno == ENODEV) { ------------------ | Branch (599:7): [True: 0, False: 0] ------------------ 600| | /* Some devices (like /dev/null redirected in) 601| | * can't be set to non-blocking */ 602| 0| TRACE(("ignoring ENODEV for setnonblocking")) 603| 0| } else { 604| 0| dropbear_exit("Couldn't set nonblocking"); 605| 0| } 606| 0| } 607| 0| TRACE(("leave setnonblocking")) 608| 0|} disallow_core: 610| 1|void disallow_core() { 611| 1| struct rlimit lim = {0}; 612| 1| if (getrlimit(RLIMIT_CORE, &lim) < 0) { ------------------ | Branch (612:6): [True: 0, False: 1] ------------------ 613| 0| TRACE(("getrlimit(RLIMIT_CORE) failed")); 614| 0| } 615| 1| lim.rlim_cur = 0; 616| 1| if (setrlimit(RLIMIT_CORE, &lim) < 0) { ------------------ | Branch (616:6): [True: 0, False: 1] ------------------ 617| 0| TRACE(("setrlimit(RLIMIT_CORE) failed")); 618| 0| } 619| 1|} expand_homedir_path_home: 647| 1|char * expand_homedir_path_home(const char *inpath, const char *homedir) { 648| 1| if (strncmp(inpath, "~/", 2) == 0 && homedir) { ------------------ | Branch (648:6): [True: 0, False: 1] | Branch (648:39): [True: 0, False: 0] ------------------ 649| 0| size_t len = strlen(inpath)-2 + strlen(homedir) + 2; 650| 0| char *buf = m_malloc(len); 651| 0| snprintf(buf, len, "%s/%s", homedir, inpath+2); 652| 0| return buf; 653| 0| } 654| | /* Fallback */ 655| 1| return m_strdup(inpath); 656| 1|} expand_homedir_path: 660| 1|char * expand_homedir_path(const char *inpath) { 661| 1| struct passwd *pw = NULL; 662| 1| char *homedir = getenv("HOME"); 663| | 664| 1| if (!homedir) { ------------------ | Branch (664:6): [True: 0, False: 1] ------------------ 665| 0| pw = getpwuid(getuid()); ------------------ | | 109| 0|#define getpwuid(x) fuzz_getpwuid(x) ------------------ 666| 0| if (pw) { ------------------ | Branch (666:7): [True: 0, False: 0] ------------------ 667| 0| homedir = pw->pw_dir; 668| 0| } 669| 0| } 670| 1| return expand_homedir_path_home(inpath, homedir); 671| 1|} gettime_wrapper: 686| 577k|void gettime_wrapper(struct timespec *now) { 687| 577k| struct timeval tv; 688| 577k|#if DROPBEAR_FUZZ 689| 577k| if (fuzz.fuzzing) { ------------------ | Branch (689:6): [True: 577k, False: 0] ------------------ 690| | /* time stands still when fuzzing */ 691| 577k| now->tv_sec = 5; 692| 577k| now->tv_nsec = 0; 693| 577k| } 694| 577k|#endif 695| | 696| 577k|#if defined(HAVE_CLOCK_GETTIME) && defined(CLOCK_MONOTONIC) 697| | /* POSIX monotonic clock. Newer Linux, BSD, MacOSX >10.12 */ 698| 577k| if (clock_gettime(CLOCK_MONOTONIC, now) == 0) { ------------------ | Branch (698:6): [True: 577k, False: 0] ------------------ 699| 577k| return; 700| 577k| } 701| 0|#endif 702| | 703| 0|#if defined(__linux__) && defined(SYS_clock_gettime) 704| 0| { 705| | /* Old linux toolchain - kernel might support it but not the build headers */ 706| | /* Also glibc <2.17 requires -lrt which we neglect to add */ 707| 0| static int linux_monotonic_failed = 0; 708| 0| if (!linux_monotonic_failed) { ------------------ | Branch (708:6): [True: 0, False: 0] ------------------ 709| | /* CLOCK_MONOTONIC isn't in some headers */ 710| 0| int clock_source_monotonic = 1; 711| 0| if (syscall(SYS_clock_gettime, clock_source_monotonic, now) == 0) { ------------------ | Branch (711:7): [True: 0, False: 0] ------------------ 712| 0| return; 713| 0| } else { 714| | /* Don't try again */ 715| 0| linux_monotonic_failed = 1; 716| 0| } 717| 0| } 718| 0| } 719| 0|#endif /* linux fallback clock_gettime */ 720| | 721| |#if defined(HAVE_MACH_ABSOLUTE_TIME) 722| | { 723| | /* OS X pre 10.12, see https://developer.apple.com/library/mac/qa/qa1398/_index.html */ 724| | static mach_timebase_info_data_t timebase_info; 725| | uint64_t scaled_time; 726| | if (timebase_info.denom == 0) { 727| | mach_timebase_info(&timebase_info); 728| | } 729| | scaled_time = mach_absolute_time() * timebase_info.numer / timebase_info.denom; 730| | now->tv_sec = scaled_time / 1000000000; 731| | now->tv_nsec = scaled_time % 1000000000; 732| | } 733| |#endif /* osx mach_absolute_time */ 734| | 735| | /* Fallback for everything else - this will sometimes go backwards */ 736| 0| gettimeofday(&tv, NULL); 737| 0| now->tv_sec = tv.tv_sec; 738| 0| now->tv_nsec = 1000*(long)tv.tv_usec; 739| 0|} monotonic_now: 742| 575k|time_t monotonic_now() { 743| 575k| struct timespec ts; 744| 575k| gettime_wrapper(&ts); 745| 575k| return ts.tv_sec; 746| 575k|} buf_get_dss_pub_key: 46| 1|int buf_get_dss_pub_key(buffer* buf, dropbear_dss_key *key) { 47| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ 48| | 49| 1| TRACE(("enter buf_get_dss_pub_key")) 50| 1| dropbear_assert(key != NULL); ------------------ | | 84| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (84:37): [True: 0, False: 1] | | | Branch (84:93): [Folded, False: 1] | | ------------------ ------------------ 51| 1| m_mp_alloc_init_multi(&key->p, &key->q, &key->g, &key->y, NULL); 52| 1| key->x = NULL; 53| | 54| 1| buf_incrpos(buf, 4+SSH_SIGNKEY_DSS_LEN); /* int + "ssh-dss" */ ------------------ | | 115| 1|#define SSH_SIGNKEY_DSS_LEN 7 ------------------ 55| 1| if (buf_getmpint(buf, key->p) == DROPBEAR_FAILURE ------------------ | | 112| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (55:6): [True: 0, False: 1] ------------------ 56| 1| || buf_getmpint(buf, key->q) == DROPBEAR_FAILURE ------------------ | | 112| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (56:6): [True: 0, False: 1] ------------------ 57| 1| || buf_getmpint(buf, key->g) == DROPBEAR_FAILURE ------------------ | | 112| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (57:6): [True: 0, False: 1] ------------------ 58| 1| || buf_getmpint(buf, key->y) == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (58:6): [True: 0, False: 1] ------------------ 59| 0| TRACE(("leave buf_get_dss_pub_key: failed reading mpints")) 60| 0| ret = DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 61| 0| goto out; 62| 0| } 63| | 64| 1| if (mp_count_bits(key->p) != DSS_P_BITS) { ------------------ | | 44| 1|#define DSS_P_BITS 1024 ------------------ | Branch (64:6): [True: 0, False: 1] ------------------ 65| 0| dropbear_log(LOG_WARNING, "Bad DSS p"); 66| 0| ret = DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 67| 0| goto out; 68| 0| } 69| | 70| 1| if (mp_count_bits(key->q) != DSS_Q_BITS) { ------------------ | | 45| 1|#define DSS_Q_BITS 160 ------------------ | Branch (70:6): [True: 0, False: 1] ------------------ 71| 0| dropbear_log(LOG_WARNING, "Bad DSS q"); 72| 0| ret = DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 73| 0| goto out; 74| 0| } 75| | 76| | /* test 1 < g < p */ 77| 1| if (mp_cmp_d(key->g, 1) != MP_GT) { ------------------ | | 156| 1|#define MP_GT 1 /* greater than */ ------------------ | Branch (77:6): [True: 0, False: 1] ------------------ 78| 0| dropbear_log(LOG_WARNING, "Bad DSS g"); 79| 0| ret = DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 80| 0| goto out; 81| 0| } 82| 1| if (mp_cmp(key->g, key->p) != MP_LT) { ------------------ | | 154| 1|#define MP_LT -1 /* less than */ ------------------ | Branch (82:6): [True: 0, False: 1] ------------------ 83| 0| dropbear_log(LOG_WARNING, "Bad DSS g"); 84| 0| ret = DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 85| 0| goto out; 86| 0| } 87| | 88| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 111| 1|#define DROPBEAR_SUCCESS 0 ------------------ 89| 1| TRACE(("leave buf_get_dss_pub_key: success")) 90| 1|out: 91| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (91:6): [True: 0, False: 1] ------------------ 92| | m_mp_free_multi(&key->p, &key->q, &key->g, &key->y, NULL); 93| 0| } 94| 1| return ret; 95| 1|} buf_get_dss_priv_key: 100| 1|int buf_get_dss_priv_key(buffer* buf, dropbear_dss_key *key) { 101| | 102| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ 103| | 104| 1| dropbear_assert(key != NULL); ------------------ | | 84| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (84:37): [True: 0, False: 1] | | | Branch (84:93): [Folded, False: 1] | | ------------------ ------------------ 105| | 106| 1| ret = buf_get_dss_pub_key(buf, key); 107| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (107:6): [True: 0, False: 1] ------------------ 108| 0| return DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 109| 0| } 110| | 111| 1| m_mp_alloc_init_multi(&key->x, NULL); 112| 1| ret = buf_getmpint(buf, key->x); 113| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (113:6): [True: 0, False: 1] ------------------ 114| 0| m_mp_free_multi(&key->x, NULL); 115| 0| } 116| | 117| 1| return ret; 118| 1|} dss_key_free: 122| 1|void dss_key_free(dropbear_dss_key *key) { 123| | 124| 1| TRACE2(("enter dsa_key_free")) 125| 1| if (key == NULL) { ------------------ | Branch (125:6): [True: 1, False: 0] ------------------ 126| 1| TRACE2(("enter dsa_key_free: key == NULL")) 127| 1| return; 128| 1| } 129| 0| m_mp_free_multi(&key->p, &key->q, &key->g, &key->y, &key->x, NULL); 130| | m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 131| 0| TRACE2(("leave dsa_key_free")) 132| 0|} dropbear_ecc_fill_dp: 47| 1|void dropbear_ecc_fill_dp() { 48| 1| struct dropbear_ecc_curve **curve; 49| | /* libtomcrypt guarantees they're ordered by size */ 50| 1| const ltc_ecc_set_type *dp = ltc_ecc_sets; 51| 4| for (curve = dropbear_ecc_curves; *curve; curve++) { ------------------ | Branch (51:36): [True: 3, False: 1] ------------------ 52| 5| for (;dp->size > 0; dp++) { ------------------ | Branch (52:9): [True: 5, False: 0] ------------------ 53| 5| if (dp->size == (*curve)->ltc_size) { ------------------ | Branch (53:8): [True: 3, False: 2] ------------------ 54| 3| (*curve)->dp = dp; 55| 3| break; 56| 3| } 57| 5| } 58| 3| if (!(*curve)->dp) { ------------------ | Branch (58:7): [True: 0, False: 3] ------------------ 59| 0| dropbear_exit("Missing ECC params %s", (*curve)->name); 60| 0| } 61| 3| } 62| 1|} new_ecc_key: 75| 1|ecc_key * new_ecc_key(void) { 76| 1| ecc_key *key = m_malloc(sizeof(*key)); 77| 1| m_mp_alloc_init_multi((mp_int**)&key->pubkey.x, (mp_int**)&key->pubkey.y, 78| | (mp_int**)&key->pubkey.z, (mp_int**)&key->k, NULL); 79| 1| return key; 80| 1|} buf_get_ecc_raw_pubkey: 147| 1|ecc_key * buf_get_ecc_raw_pubkey(buffer *buf, const struct dropbear_ecc_curve *curve) { 148| 1| ecc_key *key = NULL; 149| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ 150| 1| const unsigned int size = curve->dp->size; 151| 1| unsigned char first; 152| | 153| 1| TRACE(("enter buf_get_ecc_raw_pubkey")) 154| | 155| 1| buf_setpos(buf, 0); 156| 1| first = buf_getbyte(buf); 157| 1| if (first == 2 || first == 3) { ------------------ | Branch (157:6): [True: 0, False: 1] | Branch (157:20): [True: 0, False: 1] ------------------ 158| 0| dropbear_log(LOG_WARNING, "Dropbear doesn't support ECC point compression"); 159| 0| return NULL; 160| 0| } 161| 1| if (first != 4 || buf->len != 1+2*size) { ------------------ | Branch (161:6): [True: 0, False: 1] | Branch (161:20): [True: 0, False: 1] ------------------ 162| 0| TRACE(("leave, wrong size")) 163| 0| return NULL; 164| 0| } 165| | 166| 1| key = new_ecc_key(); 167| 1| key->dp = curve->dp; 168| | 169| 1| if (mp_from_ubin(key->pubkey.x, buf_getptr(buf, size), size) != MP_OKAY) { ------------------ | | 161| 1|#define MP_OKAY 0 /* no error */ ------------------ | Branch (169:6): [True: 0, False: 1] ------------------ 170| 0| TRACE(("failed to read x")) 171| 0| goto out; 172| 0| } 173| 1| buf_incrpos(buf, size); 174| | 175| 1| if (mp_from_ubin(key->pubkey.y, buf_getptr(buf, size), size) != MP_OKAY) { ------------------ | | 161| 1|#define MP_OKAY 0 /* no error */ ------------------ | Branch (175:6): [True: 0, False: 1] ------------------ 176| 0| TRACE(("failed to read y")) 177| 0| goto out; 178| 0| } 179| 1| buf_incrpos(buf, size); 180| | 181| 1| mp_set(key->pubkey.z, 1); 182| | 183| 1| if (ecc_is_point(key) != CRYPT_OK) { ------------------ | Branch (183:6): [True: 0, False: 1] ------------------ 184| 0| TRACE(("failed, not a point")) 185| 0| goto out; 186| 0| } 187| | 188| | /* SEC1 3.2.3.1 Check that Q != 0 */ 189| 1| if (mp_cmp_d(key->pubkey.x, 0) == LTC_MP_EQ) { ------------------ | | 13| 1|#define LTC_MP_EQ 0 ------------------ | Branch (189:6): [True: 0, False: 1] ------------------ 190| 0| TRACE(("failed, x == 0")) 191| 0| goto out; 192| 0| } 193| 1| if (mp_cmp_d(key->pubkey.y, 0) == LTC_MP_EQ) { ------------------ | | 13| 1|#define LTC_MP_EQ 0 ------------------ | Branch (193:6): [True: 0, False: 1] ------------------ 194| 0| TRACE(("failed, y == 0")) 195| 0| goto out; 196| 0| } 197| | 198| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 111| 1|#define DROPBEAR_SUCCESS 0 ------------------ 199| | 200| 1| out: 201| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (201:6): [True: 0, False: 1] ------------------ 202| 0| if (key) { ------------------ | Branch (202:7): [True: 0, False: 0] ------------------ 203| 0| ecc_free(key); 204| 0| m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 205| 0| key = NULL; 206| 0| } 207| 0| } 208| | 209| 1| return key; 210| | 211| 1|} ecc.c:ecc_is_point: 85| 1|{ 86| 1| mp_int *prime, *b, *t1, *t2; 87| 1| int err; 88| | 89| 1| m_mp_alloc_init_multi(&prime, &b, &t1, &t2, NULL); 90| | 91| | /* load prime and b */ 92| 1| if ((err = mp_read_radix(prime, key->dp->prime, 16)) != CRYPT_OK) { goto error; } ------------------ | Branch (92:6): [True: 0, False: 1] ------------------ 93| 1| if ((err = mp_read_radix(b, key->dp->B, 16)) != CRYPT_OK) { goto error; } ------------------ | Branch (93:6): [True: 0, False: 1] ------------------ 94| | 95| | /* compute y^2 */ 96| 1| if ((err = mp_sqr(key->pubkey.y, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (96:6): [True: 0, False: 1] ------------------ 97| | 98| | /* compute x^3 */ 99| 1| if ((err = mp_sqr(key->pubkey.x, t2)) != CRYPT_OK) { goto error; } ------------------ | Branch (99:6): [True: 0, False: 1] ------------------ 100| 1| if ((err = mp_mod(t2, prime, t2)) != CRYPT_OK) { goto error; } ------------------ | Branch (100:6): [True: 0, False: 1] ------------------ 101| 1| if ((err = mp_mul(key->pubkey.x, t2, t2)) != CRYPT_OK) { goto error; } ------------------ | Branch (101:6): [True: 0, False: 1] ------------------ 102| | 103| | /* compute y^2 - x^3 */ 104| 1| if ((err = mp_sub(t1, t2, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (104:6): [True: 0, False: 1] ------------------ 105| | 106| | /* compute y^2 - x^3 + 3x */ 107| 1| if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (107:6): [True: 0, False: 1] ------------------ 108| 1| if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (108:6): [True: 0, False: 1] ------------------ 109| 1| if ((err = mp_add(t1, key->pubkey.x, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (109:6): [True: 0, False: 1] ------------------ 110| 1| if ((err = mp_mod(t1, prime, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (110:6): [True: 0, False: 1] ------------------ 111| 1| while (mp_cmp_d(t1, 0) == LTC_MP_LT) { ------------------ | | 12| 1|#define LTC_MP_LT -1 ------------------ | Branch (111:9): [True: 0, False: 1] ------------------ 112| 0| if ((err = mp_add(t1, prime, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (112:7): [True: 0, False: 0] ------------------ 113| 0| } 114| 1| while (mp_cmp(t1, prime) != LTC_MP_LT) { ------------------ | | 12| 1|#define LTC_MP_LT -1 ------------------ | Branch (114:9): [True: 0, False: 1] ------------------ 115| 0| if ((err = mp_sub(t1, prime, t1)) != CRYPT_OK) { goto error; } ------------------ | Branch (115:7): [True: 0, False: 0] ------------------ 116| 0| } 117| | 118| | /* compare to b */ 119| 1| if (mp_cmp(t1, b) != LTC_MP_EQ) { ------------------ | | 13| 1|#define LTC_MP_EQ 0 ------------------ | Branch (119:6): [True: 0, False: 1] ------------------ 120| 0| err = CRYPT_INVALID_PACKET; 121| 1| } else { 122| 1| err = CRYPT_OK; 123| 1| } 124| | 125| 1| error: 126| 1| mp_clear_multi(prime, b, t1, t2, NULL); 127| 1| m_free(prime); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 1] | | ------------------ ------------------ 128| 1| m_free(b); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 1] | | ------------------ ------------------ 129| 1| m_free(t1); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 1] | | ------------------ ------------------ 130| | m_free(t2); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 1] | | ------------------ ------------------ 131| 1| return err; 132| 1|} signkey_is_ecdsa: 11| 4|{ 12| 4| return type == DROPBEAR_SIGNKEY_ECDSA_NISTP256 ------------------ | Branch (12:9): [True: 1, False: 3] ------------------ 13| 3| || type == DROPBEAR_SIGNKEY_ECDSA_NISTP384 ------------------ | Branch (13:6): [True: 0, False: 3] ------------------ 14| 3| || type == DROPBEAR_SIGNKEY_ECDSA_NISTP521; ------------------ | Branch (14:6): [True: 0, False: 3] ------------------ 15| 4|} buf_get_ecdsa_pub_key: 77| 1|ecc_key *buf_get_ecdsa_pub_key(buffer* buf) { 78| 1| unsigned char *key_ident = NULL, *identifier = NULL; 79| 1| unsigned int key_ident_len, identifier_len; 80| 1| buffer *q_buf = NULL; 81| 1| struct dropbear_ecc_curve **curve; 82| 1| ecc_key *new_key = NULL; 83| | 84| | /* string "ecdsa-sha2-[identifier]" or "sk-ecdsa-sha2-nistp256@openssh.com" */ 85| 1| key_ident = (unsigned char*)buf_getstring(buf, &key_ident_len); 86| | /* string "[identifier]" */ 87| 1| identifier = (unsigned char*)buf_getstring(buf, &identifier_len); 88| | 89| 1| if (strcmp (key_ident, "sk-ecdsa-sha2-nistp256@openssh.com") == 0) { ------------------ | Branch (89:6): [True: 0, False: 1] ------------------ 90| 0| if (strcmp (identifier, "nistp256") != 0) { ------------------ | Branch (90:7): [True: 0, False: 0] ------------------ 91| 0| TRACE(("mismatching identifiers")) 92| 0| goto out; 93| 0| } 94| 1| } else { 95| 1| if (key_ident_len != identifier_len + strlen ("ecdsa-sha2-")) { ------------------ | Branch (95:7): [True: 0, False: 1] ------------------ 96| 0| TRACE(("Bad identifier lengths")) 97| 0| goto out; 98| 0| } 99| 1| if (memcmp(&key_ident[strlen ("ecdsa-sha2-")], identifier, identifier_len) != 0) { ------------------ | Branch (99:7): [True: 0, False: 1] ------------------ 100| 0| TRACE(("mismatching identifiers")) 101| 0| goto out; 102| 0| } 103| 1| } 104| | 105| 1| for (curve = dropbear_ecc_curves; *curve; curve++) { ------------------ | Branch (105:36): [True: 1, False: 0] ------------------ 106| 1| if (memcmp(identifier, (char*)(*curve)->name, strlen((char*)(*curve)->name)) == 0) { ------------------ | Branch (106:7): [True: 1, False: 0] ------------------ 107| 1| break; 108| 1| } 109| 1| } 110| 1| if (!*curve) { ------------------ | Branch (110:6): [True: 0, False: 1] ------------------ 111| 0| TRACE(("couldn't match ecc curve")) 112| 0| goto out; 113| 0| } 114| | 115| | /* string Q */ 116| 1| q_buf = buf_getstringbuf(buf); 117| 1| new_key = buf_get_ecc_raw_pubkey(q_buf, *curve); 118| | 119| 1|out: 120| 1| m_free(key_ident); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 1] | | ------------------ ------------------ 121| 1| m_free(identifier); ------------------ | | 24| 1|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 1] | | ------------------ ------------------ 122| 1| if (q_buf) { ------------------ | Branch (122:6): [True: 1, False: 0] ------------------ 123| 1| buf_free(q_buf); 124| | q_buf = NULL; 125| 1| } 126| 1| TRACE(("leave buf_get_ecdsa_pub_key")) 127| 1| return new_key; 128| 1|} buf_get_ecdsa_priv_key: 130| 1|ecc_key *buf_get_ecdsa_priv_key(buffer *buf) { 131| 1| ecc_key *new_key = NULL; 132| 1| TRACE(("enter buf_get_ecdsa_priv_key")) 133| 1| new_key = buf_get_ecdsa_pub_key(buf); 134| 1| if (!new_key) { ------------------ | Branch (134:6): [True: 0, False: 1] ------------------ 135| 0| return NULL; 136| 0| } 137| | 138| 1| if (buf_getmpint(buf, new_key->k) != DROPBEAR_SUCCESS) { ------------------ | | 111| 1|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (138:6): [True: 0, False: 1] ------------------ 139| 0| ecc_free(new_key); 140| 0| m_free(new_key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 141| 0| return NULL; 142| 0| } 143| | 144| 1| return new_key; 145| 1|} buf_get_ed25519_priv_key: 78| 1|int buf_get_ed25519_priv_key(buffer *buf, dropbear_ed25519_key *key) { 79| | 80| 1| unsigned int len; 81| | 82| 1| TRACE(("enter buf_get_ed25519_priv_key")) 83| 1| dropbear_assert(key != NULL); ------------------ | | 84| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (84:37): [True: 0, False: 1] | | | Branch (84:93): [Folded, False: 1] | | ------------------ ------------------ 84| | 85| 1| buf_incrpos(buf, 4+SSH_SIGNKEY_ED25519_LEN); /* int + "ssh-ed25519" */ ------------------ | | 119| 1|#define SSH_SIGNKEY_ED25519_LEN 11 ------------------ 86| | 87| 1| len = buf_getint(buf); 88| 1| if (len != CURVE25519_LEN*2 || buf->len - buf->pos < len) { ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ | Branch (88:6): [True: 0, False: 1] | Branch (88:33): [True: 0, False: 1] ------------------ 89| 0| TRACE(("leave buf_get_ed25519_priv_key: failure")) 90| 0| return DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 91| 0| } 92| | 93| 1| memcpy(key->priv, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ memcpy(key->priv, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 94| 1| buf_incrpos(buf, CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 95| 1| memcpy(key->pub, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ memcpy(key->pub, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 96| 1| buf_incrpos(buf, CURVE25519_LEN); ------------------ | | 34| 1|#define CURVE25519_LEN 32 ------------------ 97| | 98| 1| TRACE(("leave buf_get_ed25519_priv_key: success")) 99| 1| return DROPBEAR_SUCCESS; ------------------ | | 111| 1|#define DROPBEAR_SUCCESS 0 ------------------ 100| 1|} ed25519_key_free: 103| 1|void ed25519_key_free(dropbear_ed25519_key *key) { 104| | 105| 1| TRACE2(("enter ed25519_key_free")) 106| | 107| 1| if (key == NULL) { ------------------ | Branch (107:6): [True: 1, False: 0] ------------------ 108| 1| TRACE2(("leave ed25519_key_free: key == NULL")) 109| 1| return; 110| 1| } 111| 0| m_burn(key->priv, CURVE25519_LEN); ------------------ | | 34| 0|#define CURVE25519_LEN 32 ------------------ 112| 0| m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 113| | 114| 0| TRACE2(("leave ed25519_key_free")) 115| 0|} listeners_initialise: 30| 2.84k|void listeners_initialise() { 31| | 32| | /* just one slot to start with */ 33| 2.84k| ses.listeners = (struct Listener**)m_malloc(sizeof(struct Listener*)); 34| 2.84k| ses.listensize = 1; 35| 2.84k| ses.listeners[0] = NULL; 36| | 37| 2.84k|} set_listener_fds: 39| 212k|void set_listener_fds(fd_set * readfds) { 40| | 41| 212k| unsigned int i, j; 42| 212k| struct Listener *listener; 43| | 44| | /* check each in turn */ 45| 424k| for (i = 0; i < ses.listensize; i++) { ------------------ | Branch (45:14): [True: 212k, False: 212k] ------------------ 46| 212k| listener = ses.listeners[i]; 47| 212k| if (listener != NULL) { ------------------ | Branch (47:7): [True: 0, False: 212k] ------------------ 48| 0| for (j = 0; j < listener->nsocks; j++) { ------------------ | Branch (48:16): [True: 0, False: 0] ------------------ 49| | FD_SET(listener->socks[j], readfds); 50| 0| } 51| 0| } 52| 212k| } 53| 212k|} handle_listeners: 56| 209k|void handle_listeners(const fd_set * readfds) { 57| | 58| 209k| unsigned int i, j; 59| 209k| struct Listener *listener; 60| 209k| int sock; 61| | 62| | /* check each in turn */ 63| 419k| for (i = 0; i < ses.listensize; i++) { ------------------ | Branch (63:14): [True: 209k, False: 209k] ------------------ 64| 209k| listener = ses.listeners[i]; 65| 209k| if (listener != NULL) { ------------------ | Branch (65:7): [True: 0, False: 209k] ------------------ 66| 0| for (j = 0; j < listener->nsocks; j++) { ------------------ | Branch (66:16): [True: 0, False: 0] ------------------ 67| 0| sock = listener->socks[j]; 68| 0| if (FD_ISSET(sock, readfds)) { ------------------ | Branch (68:9): [True: 0, False: 0] ------------------ 69| 0| listener->acceptor(listener, sock); 70| 0| } 71| 0| } 72| 0| } 73| 209k| } 74| 209k|} /* Woo brace matching */ remove_all_listeners: 166| 2.84k|void remove_all_listeners(void) { 167| 2.84k| unsigned int i; 168| 5.68k| for (i = 0; i < ses.listensize; i++) { ------------------ | Branch (168:14): [True: 2.84k, False: 2.84k] ------------------ 169| 2.84k| if (ses.listeners[i]) { ------------------ | Branch (169:7): [True: 0, False: 2.84k] ------------------ 170| 0| remove_listener(ses.listeners[i]); 171| 0| } 172| 2.84k| } 173| | m_free(ses.listeners); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 174| 2.84k|} remove_connect_pending: 291| 2.84k|void remove_connect_pending() { 292| 2.84k| while (ses.conn_pending.first) { ------------------ | Branch (292:9): [True: 0, False: 2.84k] ------------------ 293| 0| struct dropbear_progress_connection *c = ses.conn_pending.first->item; 294| 0| remove_connect(c, ses.conn_pending.first); 295| 0| } 296| 2.84k|} set_connect_fds: 299| 212k|void set_connect_fds(fd_set *writefd) { 300| 212k| m_list_elem *iter; 301| 212k| iter = ses.conn_pending.first; 302| 212k| while (iter) { ------------------ | Branch (302:9): [True: 0, False: 212k] ------------------ 303| 0| m_list_elem *next_iter = iter->next; 304| 0| struct dropbear_progress_connection *c = iter->item; 305| | /* Set one going */ 306| 0| while (c->res_iter && c->sock < 0) { ------------------ | Branch (306:10): [True: 0, False: 0] | Branch (306:25): [True: 0, False: 0] ------------------ 307| 0| connect_try_next(c); 308| 0| } 309| 0| if (c->sock >= 0) { ------------------ | Branch (309:7): [True: 0, False: 0] ------------------ 310| 0| FD_SET(c->sock, writefd); 311| 0| } else { 312| | /* Final failure */ 313| 0| if (!c->errstring) { ------------------ | Branch (313:8): [True: 0, False: 0] ------------------ 314| 0| c->errstring = m_strdup("unexpected failure"); 315| 0| } 316| 0| c->cb(DROPBEAR_FAILURE, -1, c->cb_data, c->errstring); ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 317| 0| remove_connect(c, iter); 318| 0| } 319| 0| iter = next_iter; 320| 0| } 321| 212k|} handle_connect_fds: 323| 209k|void handle_connect_fds(const fd_set *writefd) { 324| 209k| m_list_elem *iter; 325| 209k| for (iter = ses.conn_pending.first; iter; iter = iter->next) { ------------------ | Branch (325:38): [True: 0, False: 209k] ------------------ 326| 0| int val; 327| 0| socklen_t vallen = sizeof(val); 328| 0| struct dropbear_progress_connection *c = iter->item; 329| | 330| 0| if (c->sock < 0 || !FD_ISSET(c->sock, writefd)) { ------------------ | Branch (330:7): [True: 0, False: 0] | Branch (330:22): [True: 0, False: 0] ------------------ 331| 0| continue; 332| 0| } 333| | 334| 0| TRACE(("handling %s port %s socket %d", c->remotehost, c->remoteport, c->sock)); 335| | 336| 0| if (getsockopt(c->sock, SOL_SOCKET, SO_ERROR, &val, &vallen) != 0) { ------------------ | Branch (336:7): [True: 0, False: 0] ------------------ 337| 0| TRACE(("handle_connect_fds getsockopt(%d) SO_ERROR failed: %s", c->sock, strerror(errno))) 338| | /* This isn't expected to happen - Unix has surprises though, continue gracefully. */ 339| 0| m_close(c->sock); 340| 0| c->sock = -1; 341| 0| } else if (val != 0) { ------------------ | Branch (341:14): [True: 0, False: 0] ------------------ 342| | /* Connect failed */ 343| 0| TRACE(("connect to %s port %s failed.", c->remotehost, c->remoteport)) 344| 0| m_close(c->sock); 345| 0| c->sock = -1; 346| | 347| 0| m_free(c->errstring); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 348| 0| c->errstring = m_strdup(strerror(val)); 349| 0| } else { 350| | /* New connection has been established */ 351| 0| c->cb(DROPBEAR_SUCCESS, c->sock, c->cb_data, NULL); ------------------ | | 111| 0|#define DROPBEAR_SUCCESS 0 ------------------ 352| 0| remove_connect(c, iter); 353| 0| TRACE(("leave handle_connect_fds - success")) 354| | /* Must return here - remove_connect() invalidates iter */ 355| 0| return; 356| 0| } 357| 0| } 358| 209k|} packet_queue_to_iovec: 364| 38.0k|void packet_queue_to_iovec(const struct Queue *queue, struct iovec *iov, unsigned int *iov_count) { 365| 38.0k| struct Link *l; 366| 38.0k| unsigned int i; 367| 38.0k| int len; 368| 38.0k| buffer *writebuf; 369| | 370| |#ifndef IOV_MAX 371| | #if (defined(__CYGWIN__) || defined(__GNU__)) && !defined(UIO_MAXIOV) 372| | #define IOV_MAX 1024 373| | #elif defined(__sgi) 374| | #define IOV_MAX 512 375| | #else 376| | #define IOV_MAX UIO_MAXIOV 377| | #endif 378| |#endif 379| | 380| 38.0k| *iov_count = MIN(MIN(queue->count, IOV_MAX), *iov_count); ------------------ | Branch (380:15): [True: 38.0k, False: 0] | Branch (380:15): [True: 38.0k, False: 0] | Branch (380:15): [True: 38.0k, False: 0] ------------------ 381| | 382| 79.0k| for (l = queue->head, i = 0; i < *iov_count; l = l->link, i++) ------------------ | Branch (382:31): [True: 41.0k, False: 38.0k] ------------------ 383| 41.0k| { 384| 41.0k| writebuf = (buffer*)l->item; 385| 41.0k| len = writebuf->len - writebuf->pos; 386| 41.0k| dropbear_assert(len > 0); ------------------ | | 84| 41.0k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (84:37): [True: 0, False: 41.0k] | | | Branch (84:93): [Folded, False: 41.0k] | | ------------------ ------------------ 387| 41.0k| TRACE2(("write_packet writev #%d len %d/%d", i, 388| 41.0k| len, writebuf->len)) 389| 41.0k| iov[i].iov_base = buf_getptr(writebuf, len); 390| 41.0k| iov[i].iov_len = len; 391| 41.0k| } 392| 38.0k|} packet_queue_consume: 394| 38.0k|void packet_queue_consume(struct Queue *queue, ssize_t written) { 395| 38.0k| buffer *writebuf; 396| 38.0k| int len; 397| 76.1k| while (written > 0) { ------------------ | Branch (397:9): [True: 38.0k, False: 38.0k] ------------------ 398| 38.0k| writebuf = (buffer*)examine(queue); 399| 38.0k| len = writebuf->len - writebuf->pos; 400| 38.0k| if (len > written) { ------------------ | Branch (400:7): [True: 0, False: 38.0k] ------------------ 401| | /* partial buffer write */ 402| 0| buf_incrpos(writebuf, written); 403| 0| written = 0; 404| 38.0k| } else { 405| 38.0k| written -= len; 406| 38.0k| dequeue(queue); 407| 38.0k| buf_free(writebuf); 408| 38.0k| } 409| 38.0k| } 410| 38.0k|} set_sock_priority: 430| 2.84k|void set_sock_priority(int sock, enum dropbear_prio prio) { 431| | 432| 2.84k| int rc; 433| 2.84k| int val; 434| | 435| 2.84k|#if DROPBEAR_FUZZ 436| 2.84k| if (fuzz.fuzzing) { ------------------ | Branch (436:6): [True: 2.84k, False: 0] ------------------ 437| 2.84k| TRACE(("fuzzing skips set_sock_prio")) 438| 2.84k| return; 439| 2.84k| } 440| 0|#endif 441| | /* Don't log ENOTSOCK errors so that this can harmlessly be called 442| | * on a client '-J' proxy pipe */ 443| | 444| 0| if (opts.disable_ip_tos == 0) { ------------------ | Branch (444:6): [True: 0, False: 0] ------------------ 445| 0|#ifdef IP_TOS 446| | /* Set the DSCP field for outbound IP packet priority. 447| | rfc4594 has some guidance to meanings. 448| | 449| | We set AF21 as "Low-Latency" class for interactive (tty session, 450| | also handshake/setup packets). Other traffic is left at the default. 451| | 452| | OpenSSH at present uses AF21/CS1, rationale 453| | https://cvsweb.openbsd.org/src/usr.bin/ssh/readconf.c#rev1.284 454| | 455| | Old Dropbear/OpenSSH and Debian/Ubuntu OpenSSH (at Jan 2022) use 456| | IPTOS_LOWDELAY/IPTOS_THROUGHPUT 457| | 458| | DSCP constants are from Linux headers, applicable to other platforms 459| | such as macos. 460| | */ 461| 0| if (prio == DROPBEAR_PRIO_LOWDELAY) { ------------------ | Branch (461:6): [True: 0, False: 0] ------------------ 462| 0| val = 0x48; /* IPTOS_DSCP_AF21 */ 463| 0| } else { 464| 0| val = 0; /* default */ 465| 0| } 466| 0|#if defined(IPPROTO_IPV6) && defined(IPV6_TCLASS) 467| 0| rc = setsockopt(sock, IPPROTO_IPV6, IPV6_TCLASS, (void*)&val, sizeof(val)); 468| 0| if (rc < 0 && errno != ENOTSOCK) { ------------------ | Branch (468:6): [True: 0, False: 0] | Branch (468:16): [True: 0, False: 0] ------------------ 469| 0| TRACE(("Couldn't set IPV6_TCLASS (%s)", strerror(errno))); 470| 0| } 471| 0|#endif 472| 0| rc = setsockopt(sock, IPPROTO_IP, IP_TOS, (void*)&val, sizeof(val)); 473| 0| if (rc < 0 && errno != ENOTSOCK) { ------------------ | Branch (473:6): [True: 0, False: 0] | Branch (473:16): [True: 0, False: 0] ------------------ 474| 0| TRACE(("Couldn't set IP_TOS (%s)", strerror(errno))); 475| 0| } 476| 0|#endif /* IP_TOS */ 477| 0| } 478| | 479| 0|#ifdef HAVE_LINUX_PKT_SCHED_H 480| | /* Set scheduling priority within the local Linux network stack */ 481| 0| if (prio == DROPBEAR_PRIO_LOWDELAY) { ------------------ | Branch (481:6): [True: 0, False: 0] ------------------ 482| 0| val = TC_PRIO_INTERACTIVE; 483| 0| } else { 484| 0| val = 0; 485| 0| } 486| | /* linux specific, sets QoS class. see tc-prio(8) */ 487| 0| rc = setsockopt(sock, SOL_SOCKET, SO_PRIORITY, (void*) &val, sizeof(val)); 488| 0| if (rc < 0 && errno != ENOTSOCK) { ------------------ | Branch (488:6): [True: 0, False: 0] | Branch (488:16): [True: 0, False: 0] ------------------ 489| 0| TRACE(("Couldn't set SO_PRIORITY (%s)", strerror(errno))) 490| 0| } 491| 0|#endif 492| | 493| 0|} get_socket_address: 683| 5.68k|{ 684| 5.68k| struct sockaddr_storage addr; 685| 5.68k| socklen_t addrlen; 686| | 687| 5.68k|#if DROPBEAR_FUZZ 688| 5.68k| if (fuzz.fuzzing) { ------------------ | Branch (688:6): [True: 5.68k, False: 0] ------------------ 689| 5.68k| fuzz_get_socket_address(fd, local_host, local_port, remote_host, remote_port, host_lookup); 690| 5.68k| return; 691| 5.68k| } 692| 0|#endif 693| | 694| 0| if (local_host || local_port) { ------------------ | Branch (694:6): [True: 0, False: 0] | Branch (694:20): [True: 0, False: 0] ------------------ 695| 0| addrlen = sizeof(addr); 696| 0| if (getsockname(fd, (struct sockaddr*)&addr, &addrlen) < 0) { ------------------ | Branch (696:7): [True: 0, False: 0] ------------------ 697| 0| dropbear_exit("Failed socket address: %s", strerror(errno)); 698| 0| } 699| 0| getaddrstring(&addr, local_host, local_port, host_lookup); 700| 0| } 701| 0| if (remote_host || remote_port) { ------------------ | Branch (701:6): [True: 0, False: 0] | Branch (701:21): [True: 0, False: 0] ------------------ 702| 0| addrlen = sizeof(addr); 703| 0| if (getpeername(fd, (struct sockaddr*)&addr, &addrlen) < 0) { ------------------ | Branch (703:7): [True: 0, False: 0] ------------------ 704| 0| dropbear_exit("Failed socket address: %s", strerror(errno)); 705| 0| } 706| 0| getaddrstring(&addr, remote_host, remote_port, host_lookup); 707| 0| } 708| 0|} write_packet: 58| 38.0k|void write_packet() { 59| | 60| 38.0k| ssize_t written; 61| 38.0k|#if defined(HAVE_WRITEV) && (defined(IOV_MAX) || defined(UIO_MAXIOV)) 62| | /* 50 is somewhat arbitrary */ 63| 38.0k| unsigned int iov_count = 50; 64| 38.0k| struct iovec iov[50]; 65| |#else 66| | int len; 67| | buffer* writebuf; 68| |#endif 69| | 70| 38.0k| TRACE2(("enter write_packet")) 71| 38.0k| dropbear_assert(!isempty(&ses.writequeue)); ------------------ | | 84| 38.0k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (84:37): [True: 0, False: 38.0k] | | | Branch (84:93): [Folded, False: 38.0k] | | ------------------ ------------------ 72| | 73| 38.0k|#if defined(HAVE_WRITEV) && (defined(IOV_MAX) || defined(UIO_MAXIOV)) 74| | 75| 38.0k| packet_queue_to_iovec(&ses.writequeue, iov, &iov_count); 76| | /* This may return EAGAIN. The main loop sometimes 77| | calls write_packet() without bothering to test with select() since 78| | it's likely to be necessary */ 79| 38.0k|#if DROPBEAR_FUZZ 80| 38.0k| if (fuzz.fuzzing) { ------------------ | Branch (80:6): [True: 38.0k, False: 0] ------------------ 81| | /* pretend to write one packet at a time */ 82| | /* TODO(fuzz): randomise amount written based on the fuzz input */ 83| 38.0k| written = iov[0].iov_len; 84| 38.0k| } 85| 0| else 86| 0|#endif 87| 0| { 88| 0| written = writev(ses.sock_out, iov, iov_count); 89| 0| if (written < 0) { ------------------ | Branch (89:6): [True: 0, False: 0] ------------------ 90| 0| if (errno == EINTR || errno == EAGAIN) { ------------------ | Branch (90:7): [True: 0, False: 0] | Branch (90:25): [True: 0, False: 0] ------------------ 91| 0| TRACE2(("leave write_packet: EINTR")) 92| 0| return; 93| 0| } else { 94| 0| dropbear_exit("Error writing: %s", strerror(errno)); 95| 0| } 96| 0| } 97| 0| } 98| | 99| 38.0k| packet_queue_consume(&ses.writequeue, written); 100| 38.0k| ses.writequeue_len -= written; 101| | 102| 38.0k| if (written == 0) { ------------------ | Branch (102:6): [True: 0, False: 38.0k] ------------------ 103| 0| ses.remoteclosed(); 104| 0| } 105| | 106| |#else /* No writev () */ 107| |#if DROPBEAR_FUZZ 108| | _Static_assert(0, "No fuzzing code for no-writev writes"); 109| |#endif 110| | /* Get the next buffer in the queue of encrypted packets to write*/ 111| | writebuf = (buffer*)examine(&ses.writequeue); 112| | 113| | len = writebuf->len - writebuf->pos; 114| | dropbear_assert(len > 0); 115| | /* Try to write as much as possible */ 116| | written = write(ses.sock_out, buf_getptr(writebuf, len), len); 117| | 118| | if (written < 0) { 119| | if (errno == EINTR || errno == EAGAIN) { 120| | TRACE2(("leave writepacket: EINTR")) 121| | return; 122| | } else { 123| | dropbear_exit("Error writing: %s", strerror(errno)); 124| | } 125| | } 126| | 127| | if (written == 0) { 128| | ses.remoteclosed(); 129| | } 130| | 131| | ses.writequeue_len -= written; 132| | 133| | if (written == len) { 134| | /* We've finished with the packet, free it */ 135| | dequeue(&ses.writequeue); 136| | buf_free(writebuf); 137| | writebuf = NULL; 138| | } else { 139| | /* More packet left to write, leave it in the queue for later */ 140| | buf_incrpos(writebuf, written); 141| | } 142| |#endif /* writev */ 143| | 144| 38.0k| TRACE2(("leave write_packet")) 145| 38.0k|} read_packet: 150| 192k|void read_packet() { 151| | 152| 192k| int len; 153| 192k| unsigned int maxlen; 154| 192k| unsigned char blocksize; 155| | 156| 192k| TRACE2(("enter read_packet")) 157| 192k| blocksize = ses.keys->recv.algo_crypt->blocksize; 158| | 159| 192k| if (ses.readbuf == NULL || ses.readbuf->len < blocksize) { ------------------ | Branch (159:6): [True: 43.5k, False: 148k] | Branch (159:29): [True: 82.9k, False: 65.5k] ------------------ 160| 126k| int ret; 161| | /* In the first blocksize of a packet */ 162| | 163| | /* Read the first blocksize of the packet, so we can decrypt it and 164| | * find the length of the whole packet */ 165| 126k| ret = read_packet_init(); 166| | 167| 126k| if (ret == DROPBEAR_FAILURE) { ------------------ | | 112| 126k|#define DROPBEAR_FAILURE -1 ------------------ | Branch (167:7): [True: 82.9k, False: 43.5k] ------------------ 168| | /* didn't read enough to determine the length */ 169| 82.9k| TRACE2(("leave read_packet: packetinit done")) 170| 82.9k| return; 171| 82.9k| } 172| 126k| } 173| | 174| | /* Attempt to read the remainder of the packet, note that there 175| | * mightn't be any available (EAGAIN) */ 176| 109k| maxlen = ses.readbuf->len - ses.readbuf->pos; 177| 109k| if (maxlen == 0) { ------------------ | Branch (177:6): [True: 21.3k, False: 87.7k] ------------------ 178| | /* Occurs when the packet is only a single block long and has all 179| | * been read in read_packet_init(). Usually means that MAC is disabled 180| | */ 181| 21.3k| len = 0; 182| 87.7k| } else { 183| 87.7k| len = read(ses.sock_in, buf_getptr(ses.readbuf, maxlen), maxlen); ------------------ | | 55| 87.7k|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ 184| | 185| 87.7k| if (len == 0) { ------------------ | Branch (185:7): [True: 128, False: 87.5k] ------------------ 186| 128| ses.remoteclosed(); 187| 128| } 188| | 189| 87.7k| if (len < 0) { ------------------ | Branch (189:7): [True: 109, False: 87.5k] ------------------ 190| 109| if (errno == EINTR || errno == EAGAIN) { ------------------ | Branch (190:8): [True: 108, False: 1] | Branch (190:26): [True: 0, False: 1] ------------------ 191| 108| TRACE2(("leave read_packet: EINTR or EAGAIN")) 192| 108| return; 193| 108| } else { 194| 1| dropbear_exit("Error reading: %s", strerror(errno)); 195| 1| } 196| 109| } 197| | 198| 87.5k| buf_incrpos(ses.readbuf, len); 199| 87.5k| } 200| | 201| 108k| if ((unsigned int)len == maxlen) { ------------------ | Branch (201:6): [True: 42.3k, False: 66.6k] ------------------ 202| | /* The whole packet has been read */ 203| 42.3k| decrypt_packet(); 204| | /* The main select() loop process_packet() to 205| | * handle the packet contents... */ 206| 42.3k| } 207| 108k| TRACE2(("leave read_packet")) 208| 108k|} decrypt_packet: 298| 42.3k|void decrypt_packet() { 299| | 300| 42.3k| unsigned char blocksize; 301| 42.3k| unsigned char macsize; 302| 42.3k| unsigned int padlen; 303| 42.3k| unsigned int len; 304| | 305| 42.3k| TRACE2(("enter decrypt_packet")) 306| 42.3k| blocksize = ses.keys->recv.algo_crypt->blocksize; 307| 42.3k| macsize = ses.keys->recv.algo_mac->hashsize; 308| | 309| 42.3k| ses.kexstate.datarecv += ses.readbuf->len; 310| | 311| 42.3k|#if DROPBEAR_AEAD_MODE 312| 42.3k| if (ses.keys->recv.crypt_mode->aead_crypt) { ------------------ | Branch (312:6): [True: 0, False: 42.3k] ------------------ 313| | /* first blocksize is not decrypted yet */ 314| 0| buf_setpos(ses.readbuf, 0); 315| | 316| | /* decrypt it in-place */ 317| 0| len = ses.readbuf->len - macsize - ses.readbuf->pos; 318| 0| if (ses.keys->recv.crypt_mode->aead_crypt(ses.recvseq, ------------------ | Branch (318:7): [True: 0, False: 0] ------------------ 319| 0| buf_getptr(ses.readbuf, len + macsize), 320| 0| buf_getwriteptr(ses.readbuf, len), 321| 0| len, macsize, 322| 0| &ses.keys->recv.cipher_state, LTC_DECRYPT) != CRYPT_OK) { ------------------ | | 70| 0|#define LTC_DECRYPT 1 ------------------ 323| 0| dropbear_exit("Error decrypting"); 324| 0| } 325| 0| buf_incrpos(ses.readbuf, len); 326| 0| } else 327| 42.3k|#endif 328| 42.3k| { 329| | /* we've already decrypted the first blocksize in read_packet_init */ 330| 42.3k| buf_setpos(ses.readbuf, blocksize); 331| | 332| | /* decrypt it in-place */ 333| 42.3k| len = ses.readbuf->len - macsize - ses.readbuf->pos; 334| 42.3k| if (ses.keys->recv.crypt_mode->decrypt( ------------------ | Branch (334:7): [True: 0, False: 42.3k] ------------------ 335| 42.3k| buf_getptr(ses.readbuf, len), 336| 42.3k| buf_getwriteptr(ses.readbuf, len), 337| 42.3k| len, 338| 42.3k| &ses.keys->recv.cipher_state) != CRYPT_OK) { 339| 0| dropbear_exit("Error decrypting"); 340| 0| } 341| 42.3k| buf_incrpos(ses.readbuf, len); 342| | 343| | /* check the hmac */ 344| 42.3k| if (checkmac() != DROPBEAR_SUCCESS) { ------------------ | | 111| 42.3k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (344:7): [True: 0, False: 42.3k] ------------------ 345| 0| dropbear_exit("Integrity error"); 346| 0| } 347| | 348| 42.3k| } 349| | 350| 42.3k|#if DROPBEAR_FUZZ 351| 42.3k| fuzz_dump(ses.readbuf->data, ses.readbuf->len); 352| 42.3k|#endif 353| | 354| | /* get padding length */ 355| 42.3k| buf_setpos(ses.readbuf, PACKET_PADDING_OFF); ------------------ | | 48| 42.3k|#define PACKET_PADDING_OFF 4 ------------------ 356| 42.3k| padlen = buf_getbyte(ses.readbuf); 357| | 358| | /* payload length */ 359| | /* - 4 - 1 is for LEN and PADLEN values */ 360| 42.3k| len = ses.readbuf->len - padlen - 4 - 1 - macsize; 361| 42.3k| if ((len > RECV_MAX_PAYLOAD_LEN+ZLIB_COMPRESS_EXPANSION) || (len < 1)) { ------------------ | | 555| 42.3k|#define RECV_MAX_PAYLOAD_LEN 32768 ------------------ if ((len > RECV_MAX_PAYLOAD_LEN+ZLIB_COMPRESS_EXPANSION) || (len < 1)) { ------------------ | | 50| 42.3k|#define ZLIB_COMPRESS_EXPANSION (((RECV_MAX_PAYLOAD_LEN/16384)+1)*5 + 6) | | ------------------ | | | | 555| 42.3k|#define RECV_MAX_PAYLOAD_LEN 32768 | | ------------------ ------------------ | Branch (361:6): [True: 12, False: 42.3k] | Branch (361:62): [True: 1, False: 42.3k] ------------------ 362| 13| dropbear_exit("Bad packet size %u", len); 363| 13| } 364| | 365| 42.3k| buf_setpos(ses.readbuf, PACKET_PAYLOAD_OFF); ------------------ | | 49| 42.3k|#define PACKET_PAYLOAD_OFF 5 ------------------ 366| | 367| |#ifndef DISABLE_ZLIB 368| | if (is_compress_recv()) { 369| | /* decompress */ 370| | ses.payload = buf_decompress(ses.readbuf, len); 371| | buf_setpos(ses.payload, 0); 372| | ses.payload_beginning = 0; 373| | buf_free(ses.readbuf); 374| | } else 375| |#endif 376| 42.3k| { 377| 42.3k| ses.payload = ses.readbuf; 378| 42.3k| ses.payload_beginning = ses.payload->pos; 379| 42.3k| buf_setlen(ses.payload, ses.payload->pos + len); 380| 42.3k| } 381| 42.3k| ses.readbuf = NULL; 382| | 383| 42.3k| ses.recvseq++; 384| | 385| 42.3k| TRACE2(("leave decrypt_packet")) 386| 42.3k|} maybe_flush_reply_queue: 495| 209k|void maybe_flush_reply_queue() { 496| 209k| struct packetlist *tmp_item = NULL, *curr_item = NULL; 497| 209k| if (!ses.dataallowed) ------------------ | Branch (497:6): [True: 104k, False: 104k] ------------------ 498| 104k| { 499| 104k| TRACE(("maybe_empty_reply_queue - no data allowed")) 500| 104k| return; 501| 104k| } 502| | 503| 104k| for (curr_item = ses.reply_queue_head; curr_item; ) { ------------------ | Branch (503:41): [True: 0, False: 104k] ------------------ 504| 0| CHECKCLEARTOWRITE(); 505| 0| buf_putbytes(ses.writepayload, 506| 0| curr_item->payload->data, curr_item->payload->len); 507| | 508| 0| buf_free(curr_item->payload); 509| 0| tmp_item = curr_item; 510| 0| curr_item = curr_item->next; 511| 0| m_free(tmp_item); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 512| 0| encrypt_packet(); 513| 0| } 514| | ses.reply_queue_head = ses.reply_queue_tail = NULL; 515| 104k|} encrypt_packet: 519| 35.3k|void encrypt_packet() { 520| | 521| 35.3k| unsigned char padlen; 522| 35.3k| unsigned char blocksize, mac_size; 523| 35.3k| buffer * writebuf; /* the packet which will go on the wire. This is 524| | encrypted in-place. */ 525| 35.3k| unsigned char packet_type; 526| 35.3k| unsigned int len, encrypt_buf_size; 527| 35.3k| unsigned char mac_bytes[MAX_MAC_LEN]; 528| | 529| 35.3k| time_t now; 530| | 531| 35.3k| TRACE2(("enter encrypt_packet()")) 532| | 533| 35.3k| buf_setpos(ses.writepayload, 0); 534| 35.3k| packet_type = buf_getbyte(ses.writepayload); 535| 35.3k| buf_setpos(ses.writepayload, 0); 536| | 537| 35.3k| TRACE2(("encrypt_packet type is %d", packet_type)) 538| | 539| 35.3k| if ((!ses.dataallowed && !packet_is_okay_kex(packet_type))) { ------------------ | Branch (539:7): [True: 19.5k, False: 15.8k] | Branch (539:27): [True: 0, False: 19.5k] ------------------ 540| | /* During key exchange only particular packets are allowed. 541| | Since this packet_type isn't OK we just enqueue it to send 542| | after the KEX, see maybe_flush_reply_queue */ 543| 0| enqueue_reply_packet(); 544| 0| return; 545| 0| } 546| | 547| 35.3k| blocksize = ses.keys->trans.algo_crypt->blocksize; 548| 35.3k| mac_size = ses.keys->trans.algo_mac->hashsize; 549| | 550| | /* Encrypted packet len is payload+5. We need to then make sure 551| | * there is enough space for padding or MIN_PACKET_LEN. 552| | * Add extra 3 since we need at least 4 bytes of padding */ 553| 35.3k| encrypt_buf_size = (ses.writepayload->len+4+1) 554| 35.3k| + MAX(MIN_PACKET_LEN, blocksize) + 3 ------------------ | Branch (554:5): [True: 21.2k, False: 14.1k] ------------------ 555| | /* add space for the MAC at the end */ 556| 35.3k| + mac_size 557| |#ifndef DISABLE_ZLIB 558| | /* some extra in case 'compression' makes it larger */ 559| | + ZLIB_COMPRESS_EXPANSION 560| |#endif 561| | /* and an extra cleartext (stripped before transmission) byte for the 562| | * packet type */ 563| 35.3k| + 1; 564| | 565| 35.3k| writebuf = buf_new(encrypt_buf_size); 566| 35.3k| buf_setlen(writebuf, PACKET_PAYLOAD_OFF); ------------------ | | 49| 35.3k|#define PACKET_PAYLOAD_OFF 5 ------------------ 567| 35.3k| buf_setpos(writebuf, PACKET_PAYLOAD_OFF); ------------------ | | 49| 35.3k|#define PACKET_PAYLOAD_OFF 5 ------------------ 568| | 569| |#ifndef DISABLE_ZLIB 570| | /* compression */ 571| | if (is_compress_trans()) { 572| | buf_compress(writebuf, ses.writepayload, ses.writepayload->len); 573| | } else 574| |#endif 575| 35.3k| { 576| 35.3k| memcpy(buf_getwriteptr(writebuf, ses.writepayload->len), 577| 35.3k| buf_getptr(ses.writepayload, ses.writepayload->len), 578| 35.3k| ses.writepayload->len); 579| 35.3k| buf_incrwritepos(writebuf, ses.writepayload->len); 580| 35.3k| } 581| | 582| | /* finished with payload */ 583| 35.3k| buf_setpos(ses.writepayload, 0); 584| 35.3k| buf_setlen(ses.writepayload, 0); 585| | 586| | /* length of padding - packet length excluding the packetlength uint32 587| | * field in aead mode must be a multiple of blocksize, with a minimum of 588| | * 4 bytes of padding */ 589| 35.3k| len = writebuf->len; 590| 35.3k|#if DROPBEAR_AEAD_MODE 591| 35.3k| if (ses.keys->trans.crypt_mode->aead_crypt) { ------------------ | Branch (591:6): [True: 3.51k, False: 31.8k] ------------------ 592| 3.51k| len -= 4; 593| 3.51k| } 594| 35.3k|#endif 595| 35.3k| padlen = blocksize - len % blocksize; 596| 35.3k| if (padlen < 4) { ------------------ | Branch (596:6): [True: 11.2k, False: 24.1k] ------------------ 597| 11.2k| padlen += blocksize; 598| 11.2k| } 599| | /* check for min packet length */ 600| 35.3k| if (writebuf->len + padlen < MIN_PACKET_LEN) { ------------------ | | 241| 35.3k|#define MIN_PACKET_LEN 16 ------------------ | Branch (600:6): [True: 515, False: 34.8k] ------------------ 601| 515| padlen += blocksize; 602| 515| } 603| | 604| 35.3k| buf_setpos(writebuf, 0); 605| | /* packet length excluding the packetlength uint32 */ 606| 35.3k| buf_putint(writebuf, writebuf->len + padlen - 4); 607| | 608| | /* padding len */ 609| 35.3k| buf_putbyte(writebuf, padlen); 610| | /* actual padding */ 611| 35.3k| buf_setpos(writebuf, writebuf->len); 612| 35.3k| buf_incrlen(writebuf, padlen); 613| 35.3k| genrandom(buf_getptr(writebuf, padlen), padlen); 614| | 615| 35.3k|#if DROPBEAR_AEAD_MODE 616| 35.3k| if (ses.keys->trans.crypt_mode->aead_crypt) { ------------------ | Branch (616:6): [True: 3.51k, False: 31.8k] ------------------ 617| | /* do the actual encryption, in-place */ 618| 3.51k| buf_setpos(writebuf, 0); 619| | /* encrypt it in-place*/ 620| 3.51k| len = writebuf->len; 621| 3.51k| buf_incrlen(writebuf, mac_size); 622| 3.51k| if (ses.keys->trans.crypt_mode->aead_crypt(ses.transseq, ------------------ | Branch (622:7): [True: 0, False: 3.51k] ------------------ 623| 3.51k| buf_getptr(writebuf, len), 624| 3.51k| buf_getwriteptr(writebuf, len + mac_size), 625| 3.51k| len, mac_size, 626| 3.51k| &ses.keys->trans.cipher_state, LTC_ENCRYPT) != CRYPT_OK) { ------------------ | | 68| 3.51k|#define LTC_ENCRYPT 0 ------------------ 627| 0| dropbear_exit("Error encrypting"); 628| 0| } 629| 3.51k| buf_incrpos(writebuf, len + mac_size); 630| 3.51k| } else 631| 31.8k|#endif 632| 31.8k| { 633| 31.8k| make_mac(ses.transseq, &ses.keys->trans, writebuf, writebuf->len, mac_bytes); 634| | 635| | /* do the actual encryption, in-place */ 636| 31.8k| buf_setpos(writebuf, 0); 637| | /* encrypt it in-place*/ 638| 31.8k| len = writebuf->len; 639| 31.8k| if (ses.keys->trans.crypt_mode->encrypt( ------------------ | Branch (639:7): [True: 0, False: 31.8k] ------------------ 640| 31.8k| buf_getptr(writebuf, len), 641| 31.8k| buf_getwriteptr(writebuf, len), 642| 31.8k| len, 643| 31.8k| &ses.keys->trans.cipher_state) != CRYPT_OK) { 644| 0| dropbear_exit("Error encrypting"); 645| 0| } 646| 31.8k| buf_incrpos(writebuf, len); 647| | 648| | /* stick the MAC on it */ 649| 31.8k| buf_putbytes(writebuf, mac_bytes, mac_size); 650| 31.8k| } 651| | 652| | /* Update counts */ 653| 35.3k| ses.kexstate.datatrans += writebuf->len; 654| | 655| 35.3k| writebuf_enqueue(writebuf); 656| | 657| | /* Update counts */ 658| 35.3k| ses.transseq++; 659| | 660| 35.3k| now = monotonic_now(); 661| 35.3k| ses.last_packet_time_any_sent = now; 662| | /* idle timeout shouldn't be affected by responses to keepalives. 663| | send_msg_keepalive() itself also does tricks with 664| | ses.last_packet_idle_time - read that if modifying this code */ 665| 35.3k| if (packet_type != SSH_MSG_REQUEST_FAILURE ------------------ | | 65| 70.7k|#define SSH_MSG_REQUEST_FAILURE 82 ------------------ | Branch (665:6): [True: 35.3k, False: 0] ------------------ 666| 35.3k| && packet_type != SSH_MSG_UNIMPLEMENTED ------------------ | | 31| 70.7k|#define SSH_MSG_UNIMPLEMENTED 3 ------------------ | Branch (666:6): [True: 15.5k, False: 19.8k] ------------------ 667| 15.5k| && packet_type != SSH_MSG_IGNORE) { ------------------ | | 30| 15.5k|#define SSH_MSG_IGNORE 2 ------------------ | Branch (667:6): [True: 15.5k, False: 0] ------------------ 668| 15.5k| ses.last_packet_time_idle = now; 669| | 670| 15.5k| } 671| | 672| 35.3k| TRACE2(("leave encrypt_packet()")) 673| 35.3k|} writebuf_enqueue: 675| 38.2k|void writebuf_enqueue(buffer * writebuf) { 676| | /* enqueue the packet for sending. It will get freed after transmission. */ 677| 38.2k| buf_setpos(writebuf, 0); 678| 38.2k| enqueue(&ses.writequeue, (void*)writebuf); 679| 38.2k| ses.writequeue_len += writebuf->len; 680| 38.2k|} packet.c:read_packet_init: 214| 126k|static int read_packet_init() { 215| | 216| 126k| unsigned int maxlen; 217| 126k| int slen; 218| 126k| unsigned int len, plen; 219| 126k| unsigned int blocksize; 220| 126k| unsigned int macsize; 221| | 222| | 223| 126k| blocksize = ses.keys->recv.algo_crypt->blocksize; 224| 126k| macsize = ses.keys->recv.algo_mac->hashsize; 225| | 226| 126k| if (ses.readbuf == NULL) { ------------------ | Branch (226:6): [True: 43.5k, False: 82.9k] ------------------ 227| | /* start of a new packet */ 228| 43.5k| ses.readbuf = buf_new(INIT_READBUF); ------------------ | | 51| 43.5k|#define INIT_READBUF 128 ------------------ 229| 43.5k| } 230| | 231| 126k| maxlen = blocksize - ses.readbuf->pos; 232| | 233| | /* read the rest of the packet if possible */ 234| 126k| slen = read(ses.sock_in, buf_getwriteptr(ses.readbuf, maxlen), ------------------ | | 55| 126k|#define read(fd, buf, count) wrapfd_read(fd, buf, count) ------------------ 235| 126k| maxlen); 236| 126k| if (slen == 0) { ------------------ | Branch (236:6): [True: 982, False: 125k] ------------------ 237| 982| ses.remoteclosed(); 238| 982| } 239| 126k| if (slen < 0) { ------------------ | Branch (239:6): [True: 124, False: 126k] ------------------ 240| 124| if (errno == EINTR || errno == EAGAIN) { ------------------ | Branch (240:7): [True: 118, False: 6] | Branch (240:25): [True: 0, False: 6] ------------------ 241| 118| TRACE2(("leave read_packet_init: EINTR")) 242| 118| return DROPBEAR_FAILURE; ------------------ | | 112| 118|#define DROPBEAR_FAILURE -1 ------------------ 243| 118| } 244| 6| dropbear_exit("Error reading: %s", strerror(errno)); 245| 124| } 246| | 247| 126k| buf_incrwritepos(ses.readbuf, slen); 248| | 249| 126k| if ((unsigned int)slen != maxlen) { ------------------ | Branch (249:6): [True: 82.8k, False: 43.5k] ------------------ 250| | /* don't have enough bytes to determine length, get next time */ 251| 82.8k| return DROPBEAR_FAILURE; ------------------ | | 112| 82.8k|#define DROPBEAR_FAILURE -1 ------------------ 252| 82.8k| } 253| | 254| | /* now we have the first block, need to get packet length, so we decrypt 255| | * the first block (only need first 4 bytes) */ 256| 43.5k| buf_setpos(ses.readbuf, 0); 257| 43.5k|#if DROPBEAR_AEAD_MODE 258| 43.5k| if (ses.keys->recv.crypt_mode->aead_crypt) { ------------------ | Branch (258:6): [True: 0, False: 43.5k] ------------------ 259| 0| if (ses.keys->recv.crypt_mode->aead_getlength(ses.recvseq, ------------------ | Branch (259:7): [True: 0, False: 0] ------------------ 260| 0| buf_getptr(ses.readbuf, blocksize), &plen, 261| 0| blocksize, 262| 0| &ses.keys->recv.cipher_state) != CRYPT_OK) { 263| 0| dropbear_exit("Error decrypting"); 264| 0| } 265| 0| len = plen + 4 + macsize; 266| 0| } else 267| 43.5k|#endif 268| 43.5k| { 269| 43.5k| if (ses.keys->recv.crypt_mode->decrypt(buf_getptr(ses.readbuf, blocksize), ------------------ | Branch (269:7): [True: 0, False: 43.5k] ------------------ 270| 43.5k| buf_getwriteptr(ses.readbuf, blocksize), 271| 43.5k| blocksize, 272| 43.5k| &ses.keys->recv.cipher_state) != CRYPT_OK) { 273| 0| dropbear_exit("Error decrypting"); 274| 0| } 275| 43.5k| plen = buf_getint(ses.readbuf) + 4; 276| 43.5k| len = plen + macsize; 277| 43.5k| } 278| | 279| 43.5k| TRACE2(("packet size is %u, block %u mac %u", len, blocksize, macsize)) 280| | 281| | 282| | /* check packet length */ 283| 43.5k| if ((len > RECV_MAX_PACKET_LEN) || ------------------ | | 243| 43.5k|#define RECV_MAX_PACKET_LEN (MAX(35000, ((RECV_MAX_PAYLOAD_LEN)+100))) ------------------ | Branch (283:6): [True: 1.02k, False: 42.4k] | Branch (283:13): [True: 42.5k, Folded] ------------------ 284| 42.4k| (plen < blocksize) || ------------------ | Branch (284:3): [True: 4, False: 42.4k] ------------------ 285| 42.4k| (plen % blocksize != 0)) { ------------------ | Branch (285:3): [True: 27, False: 42.4k] ------------------ 286| 73| dropbear_exit("Integrity error (bad packet size %u)", len); 287| 73| } 288| | 289| 43.4k| if (len > ses.readbuf->size) { ------------------ | Branch (289:6): [True: 7.53k, False: 35.9k] ------------------ 290| 7.53k| ses.readbuf = buf_resize(ses.readbuf, len); 291| 7.53k| } 292| 43.4k| buf_setlen(ses.readbuf, len); 293| 43.4k| buf_setpos(ses.readbuf, blocksize); 294| 43.4k| return DROPBEAR_SUCCESS; ------------------ | | 111| 43.4k|#define DROPBEAR_SUCCESS 0 ------------------ 295| 43.5k|} packet.c:checkmac: 390| 42.3k|static int checkmac() { 391| | 392| 42.3k| unsigned char mac_bytes[MAX_MAC_LEN]; 393| 42.3k| unsigned int mac_size, contents_len; 394| | 395| 42.3k| mac_size = ses.keys->recv.algo_mac->hashsize; 396| 42.3k| contents_len = ses.readbuf->len - mac_size; 397| | 398| 42.3k| buf_setpos(ses.readbuf, 0); 399| 42.3k| make_mac(ses.recvseq, &ses.keys->recv, ses.readbuf, contents_len, mac_bytes); 400| | 401| 42.3k|#if DROPBEAR_FUZZ 402| 42.3k| if (fuzz.fuzzing) { ------------------ | Branch (402:6): [True: 42.3k, False: 0] ------------------ 403| | /* fail 1 in 2000 times to test error path. */ 404| 42.3k| unsigned int value = 0; 405| 42.3k| if (mac_size > sizeof(value)) { ------------------ | Branch (405:7): [True: 0, False: 42.3k] ------------------ 406| 0| memcpy(&value, mac_bytes, sizeof(value)); 407| 0| } 408| 42.3k| if (value % 2000 == 99) { ------------------ | Branch (408:7): [True: 0, False: 42.3k] ------------------ 409| 0| return DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 410| 0| } 411| 42.3k| return DROPBEAR_SUCCESS; ------------------ | | 111| 42.3k|#define DROPBEAR_SUCCESS 0 ------------------ 412| 42.3k| } 413| 0|#endif 414| | 415| | /* compare the hash */ 416| 0| buf_setpos(ses.readbuf, contents_len); 417| 0| if (constant_time_memcmp(mac_bytes, buf_getptr(ses.readbuf, mac_size), mac_size) != 0) { ------------------ | Branch (417:6): [True: 0, False: 0] ------------------ 418| 0| return DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 419| 0| } else { 420| 0| return DROPBEAR_SUCCESS; ------------------ | | 111| 0|#define DROPBEAR_SUCCESS 0 ------------------ 421| 0| } 422| 0|} packet.c:packet_is_okay_kex: 464| 19.5k|static int packet_is_okay_kex(unsigned char type) { 465| 19.5k| if (type >= SSH_MSG_USERAUTH_REQUEST) { ------------------ | | 42| 19.5k|#define SSH_MSG_USERAUTH_REQUEST 50 ------------------ | Branch (465:6): [True: 0, False: 19.5k] ------------------ 466| 0| return 0; 467| 0| } 468| 19.5k| if (type == SSH_MSG_SERVICE_REQUEST || type == SSH_MSG_SERVICE_ACCEPT) { ------------------ | | 33| 39.1k|#define SSH_MSG_SERVICE_REQUEST 5 ------------------ if (type == SSH_MSG_SERVICE_REQUEST || type == SSH_MSG_SERVICE_ACCEPT) { ------------------ | | 34| 19.5k|#define SSH_MSG_SERVICE_ACCEPT 6 ------------------ | Branch (468:6): [True: 0, False: 19.5k] | Branch (468:41): [True: 0, False: 19.5k] ------------------ 469| 0| return 0; 470| 0| } 471| 19.5k| if (type == SSH_MSG_KEXINIT) { ------------------ | | 36| 19.5k|#define SSH_MSG_KEXINIT 20 ------------------ | Branch (471:6): [True: 0, False: 19.5k] ------------------ 472| | /* XXX should this die horribly if !dataallowed ?? */ 473| 0| return 0; 474| 0| } 475| 19.5k| return 1; 476| 19.5k|} packet.c:make_mac: 687| 74.2k| unsigned char *output_mac) { 688| 74.2k| unsigned char seqbuf[4]; 689| 74.2k| unsigned long bufsize; 690| 74.2k| hmac_state hmac; 691| | 692| 74.2k| if (key_state->algo_mac->hashsize > 0) { ------------------ | Branch (692:6): [True: 14.1k, False: 60.0k] ------------------ 693| | /* calculate the mac */ 694| 14.1k| if (hmac_init(&hmac, ------------------ | Branch (694:7): [True: 0, False: 14.1k] ------------------ 695| 14.1k| key_state->hash_index, 696| 14.1k| key_state->mackey, 697| 14.1k| key_state->algo_mac->keysize) != CRYPT_OK) { 698| 0| dropbear_exit("HMAC error"); 699| 0| } 700| | 701| | /* sequence number */ 702| 14.1k| STORE32H(seqno, seqbuf); ------------------ | | 62| 14.1k|#define STORE32H(x, y) \ | | 63| 14.1k|do { ulong32 __t = __builtin_bswap32 ((x)); \ | | 64| 14.1k| XMEMCPY ((y), &__t, 4); } while(0) | | ------------------ | | | | 39| 14.1k|#define XMEMCPY memcpy | | ------------------ | | | Branch (64:39): [Folded, False: 14.1k] | | ------------------ ------------------ 703| 14.1k| if (hmac_process(&hmac, seqbuf, 4) != CRYPT_OK) { ------------------ | Branch (703:7): [True: 0, False: 14.1k] ------------------ 704| 0| dropbear_exit("HMAC error"); 705| 0| } 706| | 707| | /* the actual contents */ 708| 14.1k| buf_setpos(clear_buf, 0); 709| 14.1k| if (hmac_process(&hmac, ------------------ | Branch (709:7): [True: 0, False: 14.1k] ------------------ 710| 14.1k| buf_getptr(clear_buf, clear_len), 711| 14.1k| clear_len) != CRYPT_OK) { 712| 0| dropbear_exit("HMAC error"); 713| 0| } 714| | 715| 14.1k| bufsize = MAX_MAC_LEN; ------------------ | | 147| 14.1k|#define MAX_MAC_LEN 32 ------------------ 716| 14.1k| if (hmac_done(&hmac, output_mac, &bufsize) != CRYPT_OK) { ------------------ | Branch (716:7): [True: 0, False: 14.1k] ------------------ 717| 0| dropbear_exit("HMAC error"); 718| 0| } 719| 14.1k| } 720| 74.2k| TRACE2(("leave writemac")) 721| 74.2k|} process_packet: 43| 42.3k|void process_packet() { 44| | 45| 42.3k| unsigned char type; 46| 42.3k| unsigned int i; 47| 42.3k| unsigned int first_strict_kex = ses.kexstate.strict_kex && !ses.kexstate.recvfirstnewkeys; ------------------ | Branch (47:34): [True: 2.91k, False: 39.3k] | Branch (47:61): [True: 156, False: 2.76k] ------------------ 48| 42.3k| time_t now; 49| | 50| 42.3k| TRACE2(("enter process_packet")) 51| | 52| 42.3k| type = buf_getbyte(ses.payload); 53| 42.3k| TRACE(("process_packet: packet type = %d, len %d", type, ses.payload->len)) 54| | 55| 42.3k| now = monotonic_now(); 56| 42.3k| ses.last_packet_time_keepalive_recv = now; 57| | 58| | 59| 42.3k| if (type == SSH_MSG_DISCONNECT) { ------------------ | | 29| 42.3k|#define SSH_MSG_DISCONNECT 1 ------------------ | Branch (59:6): [True: 4, False: 42.3k] ------------------ 60| | /* Allowed at any time */ 61| 4| dropbear_close("Disconnect received"); 62| 4| } 63| | 64| | /* These packets may be received at any time, 65| | except during first kex with strict kex */ 66| 42.3k| if (!first_strict_kex) { ------------------ | Branch (66:6): [True: 42.1k, False: 160] ------------------ 67| 42.1k| switch(type) { ------------------ | Branch (67:10): [True: 763, False: 41.3k] ------------------ 68| 409| case SSH_MSG_IGNORE: ------------------ | | 30| 409|#define SSH_MSG_IGNORE 2 ------------------ | Branch (68:4): [True: 409, False: 41.7k] ------------------ 69| 409| goto out; 70| 156| case SSH_MSG_DEBUG: ------------------ | | 32| 156|#define SSH_MSG_DEBUG 4 ------------------ | Branch (70:4): [True: 156, False: 41.9k] ------------------ 71| 156| goto out; 72| 198| case SSH_MSG_UNIMPLEMENTED: ------------------ | | 31| 198|#define SSH_MSG_UNIMPLEMENTED 3 ------------------ | Branch (72:4): [True: 198, False: 41.9k] ------------------ 73| 198| TRACE(("SSH_MSG_UNIMPLEMENTED")) 74| 198| goto out; 75| 42.1k| } 76| 42.1k| } 77| | 78| | /* Ignore these packet types so that keepalives don't interfere with 79| | idle detection. This is slightly incorrect since a tcp forwarded 80| | global request with failure won't trigger the idle timeout, 81| | but that's probably acceptable */ 82| 41.5k| if (!(type == SSH_MSG_GLOBAL_REQUEST ------------------ | | 63| 83.0k|#define SSH_MSG_GLOBAL_REQUEST 80 ------------------ | Branch (82:8): [True: 6, False: 41.5k] ------------------ 83| 41.5k| || type == SSH_MSG_REQUEST_FAILURE ------------------ | | 65| 83.0k|#define SSH_MSG_REQUEST_FAILURE 82 ------------------ | Branch (83:6): [True: 1, False: 41.5k] ------------------ 84| 41.5k| || type == SSH_MSG_CHANNEL_FAILURE)) { ------------------ | | 76| 41.5k|#define SSH_MSG_CHANNEL_FAILURE 100 ------------------ | Branch (84:6): [True: 1, False: 41.5k] ------------------ 85| 41.5k| ses.last_packet_time_idle = now; 86| 41.5k| } 87| | 88| | /* This applies for KEX, where the spec says the next packet MUST be 89| | * NEWKEYS */ 90| 41.5k| if (ses.requirenext != 0) { ------------------ | Branch (90:6): [True: 32.7k, False: 8.75k] ------------------ 91| 32.7k| if (ses.requirenext == type) ------------------ | Branch (91:7): [True: 14.6k, False: 18.1k] ------------------ 92| 14.6k| { 93| | /* Got what we expected */ 94| 14.6k| TRACE(("got expected packet %d during kexinit", type)) 95| 14.6k| } 96| 18.1k| else 97| 18.1k| { 98| | /* RFC4253 7.1 - various messages are allowed at this point. 99| | The only ones we know about have already been handled though, 100| | so just return "unimplemented" */ 101| 18.1k| if (type >= 1 && type <= 49 ------------------ | Branch (101:8): [True: 18.1k, False: 15] | Branch (101:21): [True: 18.1k, False: 46] ------------------ 102| 18.1k| && type != SSH_MSG_SERVICE_REQUEST ------------------ | | 33| 36.3k|#define SSH_MSG_SERVICE_REQUEST 5 ------------------ | Branch (102:8): [True: 18.1k, False: 1] ------------------ 103| 18.1k| && type != SSH_MSG_SERVICE_ACCEPT ------------------ | | 34| 36.3k|#define SSH_MSG_SERVICE_ACCEPT 6 ------------------ | Branch (103:8): [True: 18.1k, False: 1] ------------------ 104| 18.1k| && type != SSH_MSG_KEXINIT ------------------ | | 36| 36.2k|#define SSH_MSG_KEXINIT 20 ------------------ | Branch (104:8): [True: 18.1k, False: 1] ------------------ 105| 18.1k| && !first_strict_kex) ------------------ | Branch (105:8): [True: 18.1k, False: 4] ------------------ 106| 18.1k| { 107| 18.1k| TRACE(("unknown allowed packet during kexinit")) 108| 18.1k| recv_unimplemented(); 109| 18.1k| goto out; 110| 18.1k| } 111| 68| else 112| 68| { 113| 68| TRACE(("disallowed packet during kexinit")) 114| 68| dropbear_exit("Unexpected packet type %d, expected %d", type, 115| 68| ses.requirenext); 116| 68| } 117| 18.1k| } 118| 32.7k| } 119| | 120| | /* Check if we should ignore this packet. Used currently only for 121| | * KEX code, with first_kex_packet_follows */ 122| 23.3k| if (ses.ignorenext) { ------------------ | Branch (122:6): [True: 158, False: 23.2k] ------------------ 123| 158| TRACE(("Ignoring packet, type = %d", type)) 124| 158| ses.ignorenext = 0; 125| 158| goto out; 126| 158| } 127| | 128| | /* Only clear the flag after we have checked ignorenext */ 129| 23.2k| if (ses.requirenext != 0 && ses.requirenext == type) ------------------ | Branch (129:6): [True: 14.4k, False: 8.75k] | Branch (129:30): [True: 14.4k, False: 0] ------------------ 130| 14.4k| { 131| 14.4k| ses.requirenext = 0; 132| 14.4k| } 133| | 134| | 135| | /* Kindly the protocol authors gave all the preauth packets type values 136| | * less-than-or-equal-to 60 ( == MAX_UNAUTH_PACKET_TYPE ). 137| | * NOTE: if the protocol changes and new types are added, revisit this 138| | * assumption */ 139| 23.2k| if ( !ses.authstate.authdone && type > MAX_UNAUTH_PACKET_TYPE ) { ------------------ | | 38| 23.2k|#define MAX_UNAUTH_PACKET_TYPE SSH_MSG_USERAUTH_PK_OK | | ------------------ | | | | 52| 23.2k|#define SSH_MSG_USERAUTH_PK_OK 60 | | ------------------ ------------------ | Branch (139:7): [True: 23.2k, False: 4] | Branch (139:34): [True: 3, False: 23.2k] ------------------ 140| 3| dropbear_exit("Received message %d before userauth", type); 141| 3| } 142| | 143| 154k| for (i = 0; ; i++) { 144| 154k| if (ses.packettypes[i].type == 0) { ------------------ | Branch (144:7): [True: 1.72k, False: 152k] ------------------ 145| | /* end of list */ 146| 1.72k| break; 147| 1.72k| } 148| | 149| 152k| if (ses.packettypes[i].type == type) { ------------------ | Branch (149:7): [True: 21.4k, False: 131k] ------------------ 150| 21.4k| ses.packettypes[i].handler(); 151| 21.4k| goto out; 152| 21.4k| } 153| 152k| } 154| | 155| | 156| | /* TODO do something more here? */ 157| 1.72k| TRACE(("preauth unknown packet")) 158| 1.72k| recv_unimplemented(); 159| | 160| 40.8k|out: 161| 40.8k| ses.lastpacket = type; 162| 40.8k| buf_free(ses.payload); 163| 40.8k| ses.payload = NULL; 164| | 165| 40.8k| TRACE2(("leave process_packet")) 166| 40.8k|} process-packet.c:recv_unimplemented: 174| 19.8k|static void recv_unimplemented() { 175| | 176| 19.8k| CHECKCLEARTOWRITE(); 177| | 178| 19.8k| buf_putbyte(ses.writepayload, SSH_MSG_UNIMPLEMENTED); ------------------ | | 31| 19.8k|#define SSH_MSG_UNIMPLEMENTED 3 ------------------ 179| | /* the decryption routine increments the sequence number, we must 180| | * decrement */ 181| 19.8k| buf_putint(ses.writepayload, ses.recvseq - 1); 182| | 183| 19.8k| encrypt_packet(); 184| 19.8k|} initqueue: 29| 2.84k|void initqueue(struct Queue* queue) { 30| | 31| 2.84k| queue->head = NULL; 32| | queue->tail = NULL; 33| 2.84k| queue->count = 0; 34| 2.84k|} isempty: 36| 548k|int isempty(const struct Queue* queue) { 37| | 38| | return (queue->head == NULL); 39| 548k|} dequeue: 41| 38.2k|void* dequeue(struct Queue* queue) { 42| | 43| 38.2k| void* ret; 44| 38.2k| struct Link* oldhead; 45| 38.2k| dropbear_assert(!isempty(queue)); ------------------ | | 84| 38.2k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (84:37): [True: 0, False: 38.2k] | | | Branch (84:93): [Folded, False: 38.2k] | | ------------------ ------------------ 46| | 47| 38.2k| ret = queue->head->item; 48| 38.2k| oldhead = queue->head; 49| | 50| 38.2k| if (oldhead->link != NULL) { ------------------ | Branch (50:6): [True: 2.97k, False: 35.2k] ------------------ 51| 2.97k| queue->head = oldhead->link; 52| 35.2k| } else { 53| 35.2k| queue->head = NULL; 54| 35.2k| queue->tail = NULL; 55| 35.2k| TRACE(("empty queue dequeing")) 56| 35.2k| } 57| | 58| | m_free(oldhead); ------------------ | | 24| 38.2k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 38.2k] | | ------------------ ------------------ 59| 38.2k| queue->count--; 60| 38.2k| return ret; 61| 38.2k|} examine: 63| 38.0k|void *examine(const struct Queue* queue) { 64| | 65| 38.0k| dropbear_assert(!isempty(queue)); ------------------ | | 84| 38.0k|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (84:37): [True: 0, False: 38.0k] | | | Branch (84:93): [Folded, False: 38.0k] | | ------------------ ------------------ 66| 38.0k| return queue->head->item; 67| 38.0k|} enqueue: 69| 38.2k|void enqueue(struct Queue* queue, void* item) { 70| | 71| 38.2k| struct Link* newlink; 72| | 73| 38.2k| newlink = (struct Link*)m_malloc(sizeof(struct Link)); 74| | 75| 38.2k| newlink->item = item; 76| 38.2k| newlink->link = NULL; 77| | 78| 38.2k| if (queue->tail != NULL) { ------------------ | Branch (78:6): [True: 2.97k, False: 35.2k] ------------------ 79| 2.97k| queue->tail->link = newlink; 80| 2.97k| } 81| 38.2k| queue->tail = newlink; 82| | 83| 38.2k| if (queue->head == NULL) { ------------------ | Branch (83:6): [True: 35.2k, False: 2.97k] ------------------ 84| 35.2k| queue->head = newlink; 85| 35.2k| } 86| 38.2k| queue->count++; 87| 38.2k|} buf_get_rsa_pub_key: 53| 1|int buf_get_rsa_pub_key(buffer* buf, dropbear_rsa_key *key) { 54| | 55| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ 56| 1| TRACE(("enter buf_get_rsa_pub_key")) 57| 1| dropbear_assert(key != NULL); ------------------ | | 84| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (84:37): [True: 0, False: 1] | | | Branch (84:93): [Folded, False: 1] | | ------------------ ------------------ 58| 1| m_mp_alloc_init_multi(&key->e, &key->n, NULL); 59| 1| key->d = NULL; 60| 1| key->p = NULL; 61| 1| key->q = NULL; 62| | 63| 1| buf_incrpos(buf, 4+SSH_SIGNKEY_RSA_LEN); /* int + "ssh-rsa" */ ------------------ | | 117| 1|#define SSH_SIGNKEY_RSA_LEN 7 ------------------ 64| | 65| 1| if (buf_getmpint(buf, key->e) == DROPBEAR_FAILURE ------------------ | | 112| 2|#define DROPBEAR_FAILURE -1 ------------------ | Branch (65:6): [True: 0, False: 1] ------------------ 66| 1| || buf_getmpint(buf, key->n) == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (66:6): [True: 0, False: 1] ------------------ 67| 0| TRACE(("leave buf_get_rsa_pub_key: failure")) 68| 0| goto out; 69| 0| } 70| | 71| 1| if (mp_count_bits(key->n) < MIN_RSA_KEYLEN) { ------------------ | | 69| 1|#define MIN_RSA_KEYLEN 1024 ------------------ | Branch (71:6): [True: 0, False: 1] ------------------ 72| 0| dropbear_log(LOG_WARNING, "RSA key too short"); 73| 0| goto out; 74| 0| } 75| | 76| | /* 64 bit is limit used by openssl, so we won't block any keys in the wild */ 77| 1| if (mp_count_bits(key->e) > 64) { ------------------ | Branch (77:6): [True: 0, False: 1] ------------------ 78| 0| dropbear_log(LOG_WARNING, "RSA key bad e"); 79| 0| goto out; 80| 0| } 81| | 82| 1| TRACE(("leave buf_get_rsa_pub_key: success")) 83| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 111| 1|#define DROPBEAR_SUCCESS 0 ------------------ 84| 1|out: 85| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (85:6): [True: 0, False: 1] ------------------ 86| | m_mp_free_multi(&key->e, &key->n, NULL); 87| 0| } 88| 1| return ret; 89| 1|} buf_get_rsa_priv_key: 94| 1|int buf_get_rsa_priv_key(buffer* buf, dropbear_rsa_key *key) { 95| 1| int ret = DROPBEAR_FAILURE; ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ 96| | 97| 1| TRACE(("enter buf_get_rsa_priv_key")) 98| 1| dropbear_assert(key != NULL); ------------------ | | 84| 1|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0) | | ------------------ | | | Branch (84:37): [True: 0, False: 1] | | | Branch (84:93): [Folded, False: 1] | | ------------------ ------------------ 99| | 100| 1| if (buf_get_rsa_pub_key(buf, key) == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (100:6): [True: 0, False: 1] ------------------ 101| 0| TRACE(("leave buf_get_rsa_priv_key: pub: ret == DROPBEAR_FAILURE")) 102| 0| return DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 103| 0| } 104| | 105| 1| key->d = NULL; 106| 1| key->p = NULL; 107| 1| key->q = NULL; 108| | 109| 1| m_mp_alloc_init_multi(&key->d, NULL); 110| 1| if (buf_getmpint(buf, key->d) == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (110:6): [True: 0, False: 1] ------------------ 111| 0| TRACE(("leave buf_get_rsa_priv_key: d: ret == DROPBEAR_FAILURE")) 112| 0| goto out; 113| 0| } 114| | 115| 1| if (buf->pos == buf->len) { ------------------ | Branch (115:6): [True: 0, False: 1] ------------------ 116| | /* Keys without p or q are prior to Dropbear 0.33 from 2003. */ 117| 0| dropbear_exit("RSA key format is ancient"); 118| 1| } else { 119| 1| m_mp_alloc_init_multi(&key->p, &key->q, NULL); 120| | 121| 1| if (buf_getmpint(buf, key->p) == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (121:7): [True: 0, False: 1] ------------------ 122| 0| TRACE(("leave buf_get_rsa_priv_key: p: ret == DROPBEAR_FAILURE")) 123| 0| goto out; 124| 0| } 125| | 126| 1| if (buf_getmpint(buf, key->q) == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (126:7): [True: 0, False: 1] ------------------ 127| 0| TRACE(("leave buf_get_rsa_priv_key: q: ret == DROPBEAR_FAILURE")) 128| 0| goto out; 129| 0| } 130| 1| } 131| | 132| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 111| 1|#define DROPBEAR_SUCCESS 0 ------------------ 133| 1|out: 134| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (134:6): [True: 0, False: 1] ------------------ 135| | m_mp_free_multi(&key->d, &key->p, &key->q, NULL); 136| 0| } 137| 1| TRACE(("leave buf_get_rsa_priv_key")) 138| 1| return ret; 139| 1|} rsa_key_free: 143| 1|void rsa_key_free(dropbear_rsa_key *key) { 144| | 145| 1| TRACE2(("enter rsa_key_free")) 146| | 147| 1| if (key == NULL) { ------------------ | Branch (147:6): [True: 1, False: 0] ------------------ 148| 1| TRACE2(("leave rsa_key_free: key == NULL")) 149| 1| return; 150| 1| } 151| 0| m_mp_free_multi(&key->d, &key->e, &key->p, &key->q, &key->n, NULL); 152| | m_free(key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 153| 0| TRACE2(("leave rsa_key_free")) 154| 0|} new_sign_key: 62| 1|sign_key * new_sign_key() { 63| | 64| 1| sign_key * ret; 65| | 66| 1| ret = (sign_key*)m_malloc(sizeof(sign_key)); 67| 1| ret->type = DROPBEAR_SIGNKEY_NONE; 68| 1| ret->source = SIGNKEY_SOURCE_INVALID; 69| 1| return ret; 70| 1|} signkey_type_from_name: 86| 7|enum signkey_type signkey_type_from_name(const char* name, unsigned int namelen) { 87| 7| int i; 88| 40| for (i = 0; i < DROPBEAR_SIGNKEY_NUM_NAMED; i++) { ------------------ | Branch (88:14): [True: 37, False: 3] ------------------ 89| 37| const char *fixed_name = signkey_names[i]; 90| 37| if (namelen == strlen(fixed_name) ------------------ | Branch (90:7): [True: 5, False: 32] ------------------ 91| 5| && memcmp(fixed_name, name, namelen) == 0) { ------------------ | Branch (91:7): [True: 4, False: 1] ------------------ 92| | 93| 4|#if DROPBEAR_ECDSA 94| | /* Some of the ECDSA key sizes are defined even if they're not compiled in */ 95| 4| if (0 ------------------ | Branch (95:8): [Folded, False: 4] ------------------ 96| |#if !DROPBEAR_ECC_256 97| | || i == DROPBEAR_SIGNKEY_ECDSA_NISTP256 98| |#endif 99| |#if !DROPBEAR_ECC_384 100| | || i == DROPBEAR_SIGNKEY_ECDSA_NISTP384 101| |#endif 102| |#if !DROPBEAR_ECC_521 103| | || i == DROPBEAR_SIGNKEY_ECDSA_NISTP521 104| |#endif 105| 4| ) { 106| 0| TRACE(("attempt to use ecdsa type %d not compiled in", i)) 107| 0| return DROPBEAR_SIGNKEY_NONE; 108| 0| } 109| 4|#endif 110| | 111| 4| return (enum signkey_type)i; 112| 4| } 113| 37| } 114| | 115| 3| TRACE(("signkey_type_from_name unexpected key type.")) 116| | 117| 3| return DROPBEAR_SIGNKEY_NONE; 118| 7|} signature_type_from_name: 145| 3|enum signature_type signature_type_from_name(const char* name, unsigned int namelen) { 146| 3|#if DROPBEAR_RSA 147| 3|#if DROPBEAR_RSA_SHA256 148| 3| if (namelen == strlen(SSH_SIGNATURE_RSA_SHA256) ------------------ | | 121| 3|#define SSH_SIGNATURE_RSA_SHA256 "rsa-sha2-256" ------------------ | Branch (148:6): [True: 0, False: 3] ------------------ 149| 0| && memcmp(name, SSH_SIGNATURE_RSA_SHA256, namelen) == 0) { ------------------ | | 121| 0|#define SSH_SIGNATURE_RSA_SHA256 "rsa-sha2-256" ------------------ | Branch (149:6): [True: 0, False: 0] ------------------ 150| 0| return DROPBEAR_SIGNATURE_RSA_SHA256; 151| 0| } 152| 3|#endif 153| 3|#if DROPBEAR_RSA_SHA1 154| 3| if (namelen == strlen(SSH_SIGNKEY_RSA) ------------------ | | 116| 3|#define SSH_SIGNKEY_RSA "ssh-rsa" ------------------ | Branch (154:6): [True: 0, False: 3] ------------------ 155| 0| && memcmp(name, SSH_SIGNKEY_RSA, namelen) == 0) { ------------------ | | 116| 0|#define SSH_SIGNKEY_RSA "ssh-rsa" ------------------ | Branch (155:6): [True: 0, False: 0] ------------------ 156| 0| return DROPBEAR_SIGNATURE_RSA_SHA1; 157| 0| } 158| 3|#endif 159| 3|#endif /* DROPBEAR_RSA */ 160| 3| return (enum signature_type)signkey_type_from_name(name, namelen); 161| 3|} signkey_type_from_signature: 173| 6.72k|enum signkey_type signkey_type_from_signature(enum signature_type sigtype) { 174| 6.72k|#if DROPBEAR_RSA 175| 6.72k|#if DROPBEAR_RSA_SHA256 176| 6.72k| if (sigtype == DROPBEAR_SIGNATURE_RSA_SHA256) { ------------------ | Branch (176:6): [True: 2, False: 6.72k] ------------------ 177| 2| return DROPBEAR_SIGNKEY_RSA; 178| 2| } 179| 6.72k|#endif 180| 6.72k|#if DROPBEAR_RSA_SHA1 181| 6.72k| if (sigtype == DROPBEAR_SIGNATURE_RSA_SHA1) { ------------------ | Branch (181:6): [True: 2, False: 6.72k] ------------------ 182| 2| return DROPBEAR_SIGNKEY_RSA; 183| 2| } 184| 6.72k|#endif 185| 6.72k|#endif /* DROPBEAR_RSA */ 186| 6.72k| assert((int)sigtype < (int)DROPBEAR_SIGNKEY_NUM_NAMED); ------------------ | Branch (186:2): [True: 0, False: 6.72k] | Branch (186:2): [True: 6.72k, False: 0] ------------------ 187| 6.72k| return (enum signkey_type)sigtype; 188| 6.72k|} signkey_key_ptr: 193| 1|signkey_key_ptr(sign_key *key, enum signkey_type type) { 194| 1| switch (type) { 195| 0|#if DROPBEAR_ED25519 196| 0| case DROPBEAR_SIGNKEY_ED25519: ------------------ | Branch (196:3): [True: 0, False: 1] ------------------ 197| 0|#if DROPBEAR_SK_ED25519 198| 0| case DROPBEAR_SIGNKEY_SK_ED25519: ------------------ | Branch (198:3): [True: 0, False: 1] ------------------ 199| 0|#endif 200| 0| return (void**)&key->ed25519key; 201| 0|#endif 202| 0|#if DROPBEAR_ECDSA 203| 0|#if DROPBEAR_ECC_256 204| 1| case DROPBEAR_SIGNKEY_ECDSA_NISTP256: ------------------ | Branch (204:3): [True: 1, False: 0] ------------------ 205| 1|#if DROPBEAR_SK_ECDSA 206| 1| case DROPBEAR_SIGNKEY_SK_ECDSA_NISTP256: ------------------ | Branch (206:3): [True: 0, False: 1] ------------------ 207| 1|#endif 208| 1| return (void**)&key->ecckey256; 209| 0|#endif 210| 0|#if DROPBEAR_ECC_384 211| 0| case DROPBEAR_SIGNKEY_ECDSA_NISTP384: ------------------ | Branch (211:3): [True: 0, False: 1] ------------------ 212| 0| return (void**)&key->ecckey384; 213| 0|#endif 214| 0|#if DROPBEAR_ECC_521 215| 0| case DROPBEAR_SIGNKEY_ECDSA_NISTP521: ------------------ | Branch (215:3): [True: 0, False: 1] ------------------ 216| 0| return (void**)&key->ecckey521; 217| 0|#endif 218| 0|#endif /* DROPBEAR_ECDSA */ 219| 0|#if DROPBEAR_RSA 220| 0| case DROPBEAR_SIGNKEY_RSA: ------------------ | Branch (220:3): [True: 0, False: 1] ------------------ 221| 0| return (void**)&key->rsakey; 222| 0|#endif 223| 0|#if DROPBEAR_DSS 224| 0| case DROPBEAR_SIGNKEY_DSS: ------------------ | Branch (224:3): [True: 0, False: 1] ------------------ 225| 0| return (void**)&key->dsskey; 226| 0|#endif 227| 0| default: ------------------ | Branch (227:3): [True: 0, False: 1] ------------------ 228| | return NULL; 229| 1| } 230| 1|} buf_get_priv_key: 339| 4|int buf_get_priv_key(buffer *buf, sign_key *key, enum signkey_type *type) { 340| | 341| 4| char *ident; 342| 4| unsigned int len; 343| 4| enum signkey_type keytype; 344| 4| int ret = DROPBEAR_FAILURE; ------------------ | | 112| 4|#define DROPBEAR_FAILURE -1 ------------------ 345| | 346| 4| TRACE2(("enter buf_get_priv_key")) 347| | 348| 4| ident = buf_getstring(buf, &len); 349| 4| keytype = signkey_type_from_name(ident, len); 350| 4| m_free(ident); ------------------ | | 24| 4|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 4] | | ------------------ ------------------ 351| | 352| 4| if (*type != DROPBEAR_SIGNKEY_ANY && *type != keytype) { ------------------ | Branch (352:6): [True: 4, False: 0] | Branch (352:39): [True: 0, False: 4] ------------------ 353| 0| TRACE(("wrong key type: %d %d", *type, keytype)) 354| 0| return DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 355| 0| } 356| | 357| 4| *type = keytype; 358| | 359| | /* Rewind the buffer back before "ssh-rsa" etc */ 360| 4| buf_decrpos(buf, len + 4); 361| | 362| 4|#if DROPBEAR_DSS 363| 4| if (keytype == DROPBEAR_SIGNKEY_DSS) { ------------------ | Branch (363:6): [True: 1, False: 3] ------------------ 364| 1| dss_key_free(key->dsskey); 365| 1| key->dsskey = m_malloc(sizeof(*key->dsskey)); 366| 1| ret = buf_get_dss_priv_key(buf, key->dsskey); 367| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (367:7): [True: 0, False: 1] ------------------ 368| 0| dss_key_free(key->dsskey); 369| 0| key->dsskey = NULL; 370| 0| } 371| 1| } 372| 4|#endif 373| 4|#if DROPBEAR_RSA 374| 4| if (keytype == DROPBEAR_SIGNKEY_RSA) { ------------------ | Branch (374:6): [True: 1, False: 3] ------------------ 375| 1| rsa_key_free(key->rsakey); 376| 1| key->rsakey = m_malloc(sizeof(*key->rsakey)); 377| 1| ret = buf_get_rsa_priv_key(buf, key->rsakey); 378| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (378:7): [True: 0, False: 1] ------------------ 379| 0| rsa_key_free(key->rsakey); 380| 0| key->rsakey = NULL; 381| 0| } 382| 1| } 383| 4|#endif 384| 4|#if DROPBEAR_ECDSA 385| 4| if (signkey_is_ecdsa(keytype)) { ------------------ | Branch (385:6): [True: 1, False: 3] ------------------ 386| 1| ecc_key **eck = (ecc_key**)signkey_key_ptr(key, keytype); 387| 1| if (eck) { ------------------ | Branch (387:7): [True: 1, False: 0] ------------------ 388| 1| if (*eck) { ------------------ | Branch (388:8): [True: 0, False: 1] ------------------ 389| 0| ecc_free(*eck); 390| 0| m_free(*eck); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 391| 0| *eck = NULL; 392| 0| } 393| 1| *eck = buf_get_ecdsa_priv_key(buf); 394| 1| if (*eck) { ------------------ | Branch (394:8): [True: 1, False: 0] ------------------ 395| 1| ret = DROPBEAR_SUCCESS; ------------------ | | 111| 1|#define DROPBEAR_SUCCESS 0 ------------------ 396| 1| } 397| 1| } 398| 1| } 399| 4|#endif 400| 4|#if DROPBEAR_ED25519 401| 4| if (keytype == DROPBEAR_SIGNKEY_ED25519) { ------------------ | Branch (401:6): [True: 1, False: 3] ------------------ 402| 1| ed25519_key_free(key->ed25519key); 403| 1| key->ed25519key = m_malloc(sizeof(*key->ed25519key)); 404| 1| ret = buf_get_ed25519_priv_key(buf, key->ed25519key); 405| 1| if (ret == DROPBEAR_FAILURE) { ------------------ | | 112| 1|#define DROPBEAR_FAILURE -1 ------------------ | Branch (405:7): [True: 0, False: 1] ------------------ 406| 0| m_free(key->ed25519key); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 407| 0| key->ed25519key = NULL; 408| 0| } 409| 1| } 410| 4|#endif 411| | 412| 4| TRACE2(("leave buf_get_priv_key")) 413| | 414| 4| return ret; 415| | 416| 4|} svr_authinitialise: 42| 2.84k|void svr_authinitialise() { 43| 2.84k| memset(&ses.authstate, 0, sizeof(ses.authstate)); 44| 2.84k|#if DROPBEAR_SVR_PUBKEY_AUTH 45| 2.84k| ses.authstate.authtypes |= AUTH_TYPE_PUBKEY; ------------------ | | 103| 2.84k|#define AUTH_TYPE_PUBKEY (1 << 1) ------------------ 46| 2.84k|#endif 47| 2.84k|#if DROPBEAR_SVR_PASSWORD_AUTH || DROPBEAR_SVR_PAM_AUTH 48| 2.84k| if (!svr_opts.noauthpass) { ------------------ | Branch (48:6): [True: 2.84k, False: 0] ------------------ 49| 2.84k| ses.authstate.authtypes |= AUTH_TYPE_PASSWORD; ------------------ | | 104| 2.84k|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ 50| 2.84k| } 51| 2.84k|#endif 52| 2.84k|} recv_msg_userauth_request: 73| 1.30k|void recv_msg_userauth_request() { 74| | 75| 1.30k| char *username = NULL, *servicename = NULL, *methodname = NULL; 76| 1.30k| unsigned int userlen, servicelen, methodlen; 77| 1.30k| int valid_user = 0; 78| | 79| 1.30k| TRACE(("enter recv_msg_userauth_request")) 80| | 81| | /* for compensating failure delay */ 82| 1.30k| gettime_wrapper(&ses.authstate.auth_starttime); 83| | 84| | /* ignore packets if auth is already done */ 85| 1.30k| if (ses.authstate.authdone == 1) { ------------------ | Branch (85:6): [True: 0, False: 1.30k] ------------------ 86| 0| TRACE(("leave recv_msg_userauth_request: authdone already")) 87| 0| return; 88| 0| } 89| | 90| | /* send the banner if it exists, it will only exist once */ 91| 1.30k| if (svr_opts.banner) { ------------------ | Branch (91:6): [True: 0, False: 1.30k] ------------------ 92| 0| send_msg_userauth_banner(svr_opts.banner); 93| 0| buf_free(svr_opts.banner); 94| 0| svr_opts.banner = NULL; 95| 0| } 96| | 97| 1.30k| username = buf_getstring(ses.payload, &userlen); 98| 1.30k| servicename = buf_getstring(ses.payload, &servicelen); 99| 1.30k| methodname = buf_getstring(ses.payload, &methodlen); 100| | 101| | /* only handle 'ssh-connection' currently */ 102| 1.30k| if (!(servicelen == SSH_SERVICE_CONNECTION_LEN ------------------ | | 111| 2.60k|#define SSH_SERVICE_CONNECTION_LEN 14 ------------------ | Branch (102:8): [True: 1.27k, False: 22] ------------------ 103| 1.27k| && (strncmp(servicename, SSH_SERVICE_CONNECTION, ------------------ | | 110| 1.27k|#define SSH_SERVICE_CONNECTION "ssh-connection" ------------------ | Branch (103:7): [True: 1.16k, False: 111] ------------------ 104| 1.27k| SSH_SERVICE_CONNECTION_LEN) == 0))) { ------------------ | | 111| 1.27k|#define SSH_SERVICE_CONNECTION_LEN 14 ------------------ 105| 123| m_free(username); ------------------ | | 24| 123|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 123] | | ------------------ ------------------ 106| 123| m_free(servicename); ------------------ | | 24| 123|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 123] | | ------------------ ------------------ 107| 123| m_free(methodname); ------------------ | | 24| 123|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 123] | | ------------------ ------------------ 108| 123| dropbear_exit("unknown service in auth"); 109| 123| } 110| | 111| | /* check username is good before continuing. 112| | * the 'incrfail' varies depending on the auth method to 113| | * avoid giving away which users exist on the system through 114| | * the time delay. */ 115| 1.17k| if (checkusername(username, userlen) == DROPBEAR_SUCCESS) { ------------------ | | 111| 1.17k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (115:6): [True: 7, False: 1.17k] ------------------ 116| 7| valid_user = 1; 117| 7| } 118| | 119| | /* user wants to know what methods are supported */ 120| 1.17k| if (methodlen == AUTH_METHOD_NONE_LEN && ------------------ | | 108| 2.35k|#define AUTH_METHOD_NONE_LEN 4 ------------------ | Branch (120:6): [True: 281, False: 896] ------------------ 121| 281| strncmp(methodname, AUTH_METHOD_NONE, ------------------ | | 107| 281|#define AUTH_METHOD_NONE "none" ------------------ | Branch (121:4): [True: 173, False: 108] ------------------ 122| 281| AUTH_METHOD_NONE_LEN) == 0) { ------------------ | | 108| 281|#define AUTH_METHOD_NONE_LEN 4 ------------------ 123| 173| TRACE(("recv_msg_userauth_request: 'none' request")) 124| 173| if (valid_user ------------------ | Branch (124:7): [True: 0, False: 173] ------------------ 125| 0| && svr_opts.allowblankpass ------------------ | Branch (125:8): [True: 0, False: 0] ------------------ 126| 0| && !svr_opts.noauthpass ------------------ | Branch (126:8): [True: 0, False: 0] ------------------ 127| 0| && !(svr_opts.norootpass && ses.authstate.pw_uid == 0) ------------------ | Branch (127:10): [True: 0, False: 0] | Branch (127:33): [True: 0, False: 0] ------------------ 128| 0| && ses.authstate.pw_passwd[0] == '\0') ------------------ | Branch (128:8): [True: 0, False: 0] ------------------ 129| 0| { 130| 0| dropbear_log(LOG_NOTICE, 131| 0| "Auth succeeded with blank password for '%s' from %s", 132| 0| ses.authstate.pw_name, 133| 0| svr_ses.addrstring); 134| 0| send_msg_userauth_success(); 135| 0| goto out; 136| 0| } 137| 173| else 138| 173| { 139| | /* 'none' has no failure delay */ 140| 173| send_msg_userauth_failure(0, 0); 141| 173| goto out; 142| 173| } 143| 173| } 144| | 145| 1.00k|#if DROPBEAR_SVR_PASSWORD_AUTH 146| 1.00k| if (!svr_opts.noauthpass && ------------------ | Branch (146:6): [True: 868, False: 136] ------------------ 147| 868| !(svr_opts.norootpass && ses.authstate.pw_uid == 0) ) { ------------------ | Branch (147:6): [True: 0, False: 868] | Branch (147:29): [True: 0, False: 0] ------------------ 148| | /* user wants to try password auth */ 149| 868| if (methodlen == AUTH_METHOD_PASSWORD_LEN && ------------------ | | 112| 1.73k|#define AUTH_METHOD_PASSWORD_LEN 8 ------------------ | Branch (149:7): [True: 189, False: 679] ------------------ 150| 189| strncmp(methodname, AUTH_METHOD_PASSWORD, ------------------ | | 111| 189|#define AUTH_METHOD_PASSWORD "password" ------------------ | Branch (150:5): [True: 74, False: 115] ------------------ 151| 189| AUTH_METHOD_PASSWORD_LEN) == 0) { ------------------ | | 112| 189|#define AUTH_METHOD_PASSWORD_LEN 8 ------------------ 152| 74| svr_auth_password(valid_user); 153| 74| goto out; 154| 74| } 155| 868| } 156| 930|#endif 157| | 158| |#if DROPBEAR_SVR_PAM_AUTH 159| | if (!svr_opts.noauthpass && 160| | !(svr_opts.norootpass && ses.authstate.pw_uid == 0) ) { 161| | /* user wants to try password auth */ 162| | if (methodlen == AUTH_METHOD_PASSWORD_LEN && 163| | strncmp(methodname, AUTH_METHOD_PASSWORD, 164| | AUTH_METHOD_PASSWORD_LEN) == 0) { 165| | svr_auth_pam(valid_user); 166| | goto out; 167| | } 168| | } 169| |#endif 170| | 171| 930|#if DROPBEAR_SVR_PUBKEY_AUTH 172| | /* user wants to try pubkey auth */ 173| 930| if (methodlen == AUTH_METHOD_PUBKEY_LEN && ------------------ | | 110| 1.86k|#define AUTH_METHOD_PUBKEY_LEN 9 ------------------ | Branch (173:6): [True: 487, False: 443] ------------------ 174| 487| strncmp(methodname, AUTH_METHOD_PUBKEY, ------------------ | | 109| 487|#define AUTH_METHOD_PUBKEY "publickey" ------------------ | Branch (174:4): [True: 267, False: 220] ------------------ 175| 487| AUTH_METHOD_PUBKEY_LEN) == 0) { ------------------ | | 110| 487|#define AUTH_METHOD_PUBKEY_LEN 9 ------------------ 176| 267| svr_auth_pubkey(valid_user); 177| 267| goto out; 178| 267| } 179| 663|#endif 180| | 181| | /* nothing matched, we just fail with a delay */ 182| 663| send_msg_userauth_failure(0, 1); 183| | 184| 960|out: 185| | 186| 960| m_free(username); ------------------ | | 24| 960|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 960] | | ------------------ ------------------ 187| 960| m_free(servicename); ------------------ | | 24| 960|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 960] | | ------------------ ------------------ 188| | m_free(methodname); ------------------ | | 24| 960|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 960] | | ------------------ ------------------ 189| 960|} send_msg_userauth_failure: 348| 962|void send_msg_userauth_failure(int partial, int incrfail) { 349| | 350| 962| buffer *typebuf = NULL; 351| | 352| 962| TRACE(("enter send_msg_userauth_failure")) 353| | 354| 962| CHECKCLEARTOWRITE(); 355| | 356| 962| buf_putbyte(ses.writepayload, SSH_MSG_USERAUTH_FAILURE); ------------------ | | 43| 962|#define SSH_MSG_USERAUTH_FAILURE 51 ------------------ 357| | 358| | /* put a list of allowed types */ 359| 962| typebuf = buf_new(30); /* long enough for PUBKEY and PASSWORD */ 360| | 361| 962| if (ses.authstate.authtypes & AUTH_TYPE_PUBKEY) { ------------------ | | 103| 962|#define AUTH_TYPE_PUBKEY (1 << 1) ------------------ | Branch (361:6): [True: 962, False: 0] ------------------ 362| 962| buf_putbytes(typebuf, (const unsigned char *)AUTH_METHOD_PUBKEY, AUTH_METHOD_PUBKEY_LEN); ------------------ | | 109| 962|#define AUTH_METHOD_PUBKEY "publickey" ------------------ buf_putbytes(typebuf, (const unsigned char *)AUTH_METHOD_PUBKEY, AUTH_METHOD_PUBKEY_LEN); ------------------ | | 110| 962|#define AUTH_METHOD_PUBKEY_LEN 9 ------------------ 363| 962| if (ses.authstate.authtypes & AUTH_TYPE_PASSWORD) { ------------------ | | 104| 962|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ | Branch (363:7): [True: 962, False: 0] ------------------ 364| 962| buf_putbyte(typebuf, ','); 365| 962| } 366| 962| } 367| | 368| 962| if (ses.authstate.authtypes & AUTH_TYPE_PASSWORD) { ------------------ | | 104| 962|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ | Branch (368:6): [True: 962, False: 0] ------------------ 369| 962| buf_putbytes(typebuf, (const unsigned char *)AUTH_METHOD_PASSWORD, AUTH_METHOD_PASSWORD_LEN); ------------------ | | 111| 962|#define AUTH_METHOD_PASSWORD "password" ------------------ buf_putbytes(typebuf, (const unsigned char *)AUTH_METHOD_PASSWORD, AUTH_METHOD_PASSWORD_LEN); ------------------ | | 112| 962|#define AUTH_METHOD_PASSWORD_LEN 8 ------------------ 370| 962| } 371| | 372| 962| buf_putbufstring(ses.writepayload, typebuf); 373| | 374| 962| TRACE(("auth fail: methods %d, '%.*s'", ses.authstate.authtypes, 375| 962| typebuf->len, typebuf->data)) 376| | 377| 962| buf_free(typebuf); 378| | 379| 962| buf_putbyte(ses.writepayload, partial ? 1 : 0); ------------------ | Branch (379:32): [True: 0, False: 962] ------------------ 380| 962| encrypt_packet(); 381| | 382| 962| if (incrfail) { ------------------ | Branch (382:6): [True: 597, False: 365] ------------------ 383| | /* The SSH_MSG_AUTH_FAILURE response is delayed to attempt to 384| | avoid user enumeration and slow brute force attempts. 385| | The delay is adjusted by the time already spent in processing 386| | authentication (ses.authstate.auth_starttime timestamp). */ 387| | 388| | /* Desired total delay 300ms +-50ms (in nanoseconds). 389| | Beware of integer overflow if increasing these values */ 390| 597| const uint32_t mindelay = 250000000; 391| 597| const uint32_t vardelay = 100000000; 392| 597| uint32_t rand_delay; 393| 597| struct timespec delay; 394| | 395| 597| gettime_wrapper(&delay); 396| 597| delay.tv_sec -= ses.authstate.auth_starttime.tv_sec; 397| 597| delay.tv_nsec -= ses.authstate.auth_starttime.tv_nsec; 398| | 399| | /* carry */ 400| 597| if (delay.tv_nsec < 0) { ------------------ | Branch (400:7): [True: 0, False: 597] ------------------ 401| 0| delay.tv_nsec += 1000000000; 402| 0| delay.tv_sec -= 1; 403| 0| } 404| | 405| 597| genrandom((unsigned char*)&rand_delay, sizeof(rand_delay)); 406| 597| rand_delay = mindelay + (rand_delay % vardelay); 407| | 408| 597| if (delay.tv_sec == 0 && delay.tv_nsec <= rand_delay) { ------------------ | Branch (408:7): [True: 597, False: 0] | Branch (408:28): [True: 597, False: 0] ------------------ 409| | /* Compensate for elapsed time */ 410| 597| delay.tv_nsec = rand_delay - delay.tv_nsec; 411| 597| } else { 412| | /* No time left or time went backwards, just delay anyway */ 413| 0| delay.tv_sec = 0; 414| 0| delay.tv_nsec = rand_delay; 415| 0| } 416| | 417| | 418| 597|#if DROPBEAR_FUZZ 419| 597| if (!fuzz.fuzzing) ------------------ | Branch (419:7): [True: 0, False: 597] ------------------ 420| 0|#endif 421| 0| { 422| 0| while (nanosleep(&delay, &delay) == -1 && errno == EINTR) { /* Go back to sleep */ } ------------------ | Branch (422:11): [True: 0, False: 0] | Branch (422:46): [True: 0, False: 0] ------------------ 423| 0| } 424| | 425| 597| ses.authstate.failcount++; 426| 597| } 427| | 428| 962| if (ses.authstate.failcount > svr_opts.maxauthtries) { ------------------ | Branch (428:6): [True: 2, False: 960] ------------------ 429| 2| char * userstr; 430| | /* XXX - send disconnect ? */ 431| 2| TRACE(("Max auth tries reached, exiting")) 432| | 433| 2| if (ses.authstate.pw_name == NULL) { ------------------ | Branch (433:7): [True: 2, False: 0] ------------------ 434| 2| userstr = "is invalid"; 435| 2| } else { 436| 0| userstr = ses.authstate.pw_name; 437| 0| } 438| 2| dropbear_exit("Max auth tries reached - user '%s'", 439| 2| userstr); 440| 2| } 441| | 442| 962| TRACE(("leave send_msg_userauth_failure")) 443| 962|} svr-auth.c:checkusername: 229| 1.16k|static int checkusername(const char *username, unsigned int userlen) { 230| | 231| 1.16k| char* listshell = NULL; 232| 1.16k| char* usershell = NULL; 233| 1.16k| uid_t uid; 234| | 235| 1.16k| TRACE(("enter checkusername")) 236| 1.16k| if (userlen > MAX_USERNAME_LEN) { ------------------ | | 100| 1.16k|#define MAX_USERNAME_LEN 100 /* arbitrary for the moment */ ------------------ | Branch (236:6): [True: 34, False: 1.13k] ------------------ 237| 34| return DROPBEAR_FAILURE; ------------------ | | 112| 34|#define DROPBEAR_FAILURE -1 ------------------ 238| 34| } 239| | 240| 1.13k| if (strlen(username) != userlen) { ------------------ | Branch (240:6): [True: 7, False: 1.12k] ------------------ 241| 7| dropbear_exit("Attempted username with a null byte"); 242| 7| } 243| | 244| 1.12k| if (ses.authstate.username == NULL) { ------------------ | Branch (244:6): [True: 483, False: 643] ------------------ 245| | /* first request */ 246| 483| fill_passwd(username); 247| 483| ses.authstate.username = m_strdup(username); 248| 643| } else { 249| | /* check username hasn't changed */ 250| 643| if (strcmp(username, ses.authstate.username) != 0) { ------------------ | Branch (250:7): [True: 119, False: 524] ------------------ 251| 119| dropbear_exit("Client trying multiple usernames"); 252| 119| } 253| 643| } 254| | 255| | /* avoids cluttering logs with repeated failure messages from 256| | consecutive authentication requests in a sesssion */ 257| 1.00k| if (ses.authstate.checkusername_failed) { ------------------ | Branch (257:6): [True: 522, False: 485] ------------------ 258| 522| TRACE(("checkusername: returning cached failure")) 259| 522| return DROPBEAR_FAILURE; ------------------ | | 112| 522|#define DROPBEAR_FAILURE -1 ------------------ 260| 522| } 261| | 262| | /* check that user exists */ 263| 485| if (!ses.authstate.pw_name) { ------------------ | Branch (263:6): [True: 478, False: 7] ------------------ 264| 478| TRACE(("leave checkusername: user '%s' doesn't exist", username)) 265| 478| dropbear_log(LOG_WARNING, 266| 478| "Login attempt for nonexistent user from %s", 267| 478| svr_ses.addrstring); 268| 478| ses.authstate.checkusername_failed = 1; 269| 478| return DROPBEAR_FAILURE; ------------------ | | 112| 478|#define DROPBEAR_FAILURE -1 ------------------ 270| 478| } 271| | 272| | /* check if we are running as non-root, and login user is different from the server */ 273| 7| uid = geteuid(); 274| 7| if (!(DROPBEAR_SVR_MULTIUSER && uid == 0) && uid != ses.authstate.pw_uid) { ------------------ | | 393| 14|#define DROPBEAR_SVR_MULTIUSER 1 | | ------------------ | | | Branch (393:32): [True: 7, Folded] | | ------------------ ------------------ | Branch (274:34): [True: 7, False: 0] | Branch (274:47): [True: 0, False: 0] ------------------ 275| 0| TRACE(("running as nonroot, only server uid is allowed")) 276| 0| dropbear_log(LOG_WARNING, 277| 0| "Login attempt with wrong user %s from %s", 278| 0| ses.authstate.pw_name, 279| 0| svr_ses.addrstring); 280| 0| ses.authstate.checkusername_failed = 1; 281| 0| return DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 282| 0| } 283| | 284| | /* check for non-root if desired */ 285| 7| if (svr_opts.norootlogin && ses.authstate.pw_uid == 0) { ------------------ | Branch (285:6): [True: 0, False: 7] | Branch (285:30): [True: 0, False: 0] ------------------ 286| 0| TRACE(("leave checkusername: root login disabled")) 287| 0| dropbear_log(LOG_WARNING, "root login rejected"); 288| 0| ses.authstate.checkusername_failed = 1; 289| 0| return DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 290| 0| } 291| | 292| | /* check for login restricted to certain group if desired */ 293| 7|#ifdef HAVE_GETGROUPLIST 294| 7| if (svr_opts.restrict_group) { ------------------ | Branch (294:6): [True: 0, False: 7] ------------------ 295| 0| if (check_group_membership(svr_opts.restrict_group_gid, ------------------ | Branch (295:7): [True: 0, False: 0] ------------------ 296| 0| ses.authstate.pw_name, ses.authstate.pw_gid) == DROPBEAR_FAILURE) { ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 297| 0| dropbear_log(LOG_WARNING, 298| 0| "Logins are restricted to the group %s but user '%s' is not a member", 299| 0| svr_opts.restrict_group, ses.authstate.pw_name); 300| 0| ses.authstate.checkusername_failed = 1; 301| 0| return DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 302| 0| } 303| 0| } 304| 7|#endif /* HAVE_GETGROUPLIST */ 305| | 306| 7| TRACE(("shell is %s", ses.authstate.pw_shell)) 307| | 308| | /* check that the shell is set */ 309| 7| usershell = ses.authstate.pw_shell; 310| 7| if (usershell[0] == '\0') { ------------------ | Branch (310:6): [True: 0, False: 7] ------------------ 311| | /* empty shell in /etc/passwd means /bin/sh according to passwd(5) */ 312| 0| usershell = "/bin/sh"; 313| 0| } 314| | 315| | /* check the shell is valid. If /etc/shells doesn't exist, getusershell() 316| | * should return some standard shells like "/bin/sh" and "/bin/csh" (this 317| | * is platform-specific) */ 318| 7| setusershell(); 319| 7| while ((listshell = getusershell()) != NULL) { ------------------ | Branch (319:9): [True: 7, False: 0] ------------------ 320| 7| TRACE(("test shell is '%s'", listshell)) 321| 7| if (strcmp(listshell, usershell) == 0) { ------------------ | Branch (321:7): [True: 7, False: 0] ------------------ 322| | /* have a match */ 323| 7| goto goodshell; 324| 7| } 325| 7| } 326| | /* no matching shell */ 327| 0| endusershell(); 328| 0| TRACE(("no matching shell")) 329| 0| ses.authstate.checkusername_failed = 1; 330| 0| dropbear_log(LOG_WARNING, "User '%s' has invalid shell, rejected", 331| 0| ses.authstate.pw_name); 332| 0| return DROPBEAR_FAILURE; ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ 333| | 334| 7|goodshell: 335| 7| endusershell(); 336| 7| TRACE(("matching shell")) 337| | 338| 7| TRACE(("uid = %d", ses.authstate.pw_uid)) 339| 7| TRACE(("leave checkusername")) 340| 7| return DROPBEAR_SUCCESS; ------------------ | | 111| 7|#define DROPBEAR_SUCCESS 0 ------------------ 341| 7|} svr_auth_password: 51| 74|void svr_auth_password(int valid_user) { 52| | 53| 74| char * passwdcrypt = NULL; /* the crypt from /etc/passwd or /etc/shadow */ 54| 74| char * testcrypt = NULL; /* crypt generated from the user's password sent */ 55| 74| char * password = NULL; 56| 74| unsigned int passwordlen; 57| 74| unsigned int changepw; 58| | 59| | /* check if client wants to change password */ 60| 74| changepw = buf_getbool(ses.payload); 61| 74| if (changepw) { ------------------ | Branch (61:6): [True: 45, False: 29] ------------------ 62| | /* not implemented by this server */ 63| 45| send_msg_userauth_failure(0, 1); 64| 45| return; 65| 45| } 66| | 67| 29| password = buf_getstring(ses.payload, &passwordlen); 68| 29| if (valid_user && passwordlen <= DROPBEAR_MAX_PASSWORD_LEN) { ------------------ | | 131| 0|#define DROPBEAR_MAX_PASSWORD_LEN 100 ------------------ | Branch (68:6): [True: 0, False: 29] | Branch (68:20): [True: 0, False: 0] ------------------ 69| | /* the first bytes of passwdcrypt are the salt */ 70| 0| passwdcrypt = ses.authstate.pw_passwd; 71| 0| testcrypt = crypt(password, passwdcrypt); 72| 0| } 73| 29| m_burn(password, passwordlen); 74| 29| m_free(password); ------------------ | | 24| 29|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 29] | | ------------------ ------------------ 75| | 76| | /* After we have got the payload contents we can exit if the username 77| | is invalid. Invalid users have already been logged. */ 78| 29| if (!valid_user) { ------------------ | Branch (78:6): [True: 25, False: 4] ------------------ 79| 25| send_msg_userauth_failure(0, 1); 80| 25| return; 81| 25| } 82| | 83| 4| if (passwordlen > DROPBEAR_MAX_PASSWORD_LEN) { ------------------ | | 131| 4|#define DROPBEAR_MAX_PASSWORD_LEN 100 ------------------ | Branch (83:6): [True: 0, False: 4] ------------------ 84| 0| dropbear_log(LOG_WARNING, 85| 0| "Too-long password attempt for '%s' from %s", 86| 0| ses.authstate.pw_name, 87| 0| svr_ses.addrstring); 88| 0| send_msg_userauth_failure(0, 1); 89| 0| return; 90| 0| } 91| | 92| 4| if (testcrypt == NULL) { ------------------ | Branch (92:6): [True: 0, False: 4] ------------------ 93| | /* crypt() with an invalid salt like "!!" */ 94| 0| dropbear_log(LOG_WARNING, "User account '%s' is locked", 95| 0| ses.authstate.pw_name); 96| 0| send_msg_userauth_failure(0, 1); 97| 0| return; 98| 0| } 99| | 100| | /* check for empty password */ 101| 4| if (passwdcrypt[0] == '\0') { ------------------ | Branch (101:6): [True: 0, False: 4] ------------------ 102| 0| dropbear_log(LOG_WARNING, "User '%s' has blank password, rejected", 103| 0| ses.authstate.pw_name); 104| 0| send_msg_userauth_failure(0, 1); 105| 0| return; 106| 0| } 107| | 108| 4| if (constant_time_strcmp(testcrypt, passwdcrypt) == 0) { ------------------ | Branch (108:6): [True: 0, False: 4] ------------------ 109| 0| if (svr_opts.multiauthmethod && (ses.authstate.authtypes & ~AUTH_TYPE_PASSWORD)) { ------------------ | | 104| 0|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ | Branch (109:7): [True: 0, False: 0] | Branch (109:35): [True: 0, False: 0] ------------------ 110| | /* successful password authentication, but extra auth required */ 111| 0| dropbear_log(LOG_NOTICE, 112| 0| "Password auth succeeded for '%s' from %s, extra auth required", 113| 0| ses.authstate.pw_name, 114| 0| svr_ses.addrstring); 115| 0| ses.authstate.authtypes &= ~AUTH_TYPE_PASSWORD; /* password auth ok, delete the method flag */ ------------------ | | 104| 0|#define AUTH_TYPE_PASSWORD (1 << 2) ------------------ 116| 0| send_msg_userauth_failure(1, 0); /* Send partial success */ 117| 0| } else { 118| | /* successful authentication */ 119| 0| dropbear_log(LOG_NOTICE, 120| 0| "Password auth succeeded for '%s' from %s", 121| 0| ses.authstate.pw_name, 122| 0| svr_ses.addrstring); 123| 0| send_msg_userauth_success(); 124| 0| } 125| 4| } else { 126| | dropbear_log(LOG_WARNING, 127| 4| "Bad password attempt for '%s' from %s", 128| 4| ses.authstate.pw_name, 129| 4| svr_ses.addrstring); 130| 4| send_msg_userauth_failure(0, 1); 131| 4| } 132| 4|} svr_auth_pubkey: 85| 267|void svr_auth_pubkey(int valid_user) { 86| | 87| 267| unsigned char testkey; /* whether we're just checking if a key is usable */ 88| 267| char* sigalgo = NULL; 89| 267| unsigned int sigalgolen; 90| 267| const char* keyalgo; 91| 267| unsigned int keyalgolen; 92| 267| unsigned char* keyblob = NULL; 93| 267| unsigned int keybloblen; 94| 267| unsigned int sign_payload_length; 95| 267| buffer * signbuf = NULL; 96| 267| sign_key * key = NULL; 97| 267| char* fp = NULL; 98| 267| enum signature_type sigtype; 99| 267| enum signkey_type keytype; 100| 267| int auth_failure = 1; 101| 267| struct PubKeyOptions *pubkey_options = NULL; 102| | 103| 267| TRACE(("enter pubkeyauth")) 104| | 105| | /* 0 indicates user just wants to check if key can be used, 1 is an 106| | * actual attempt*/ 107| 267| testkey = (buf_getbool(ses.payload) == 0); 108| | 109| 267| sigalgo = buf_getstring(ses.payload, &sigalgolen); 110| 267| keybloblen = buf_getint(ses.payload); 111| 267| keyblob = buf_getptr(ses.payload, keybloblen); 112| | 113| 267| if (!valid_user) { ------------------ | Branch (113:6): [True: 189, False: 78] ------------------ 114| | /* Return failure once we have read the contents of the packet 115| | required to validate a public key. 116| | Avoids blind user enumeration though it isn't possible to prevent 117| | testing for user existence if the public key is known */ 118| 189| send_msg_userauth_failure(0, 0); 119| 189| goto out; 120| 189| } 121| | 122| 78| sigtype = signature_type_from_name(sigalgo, sigalgolen); 123| 78| if (sigtype == DROPBEAR_SIGNATURE_NONE) { ------------------ | Branch (123:6): [True: 3, False: 75] ------------------ 124| 3| send_msg_userauth_failure(0, 0); 125| 3| goto out; 126| 3| } 127| | 128| 75| keytype = signkey_type_from_signature(sigtype); 129| 75| keyalgo = signkey_name_from_type(keytype, &keyalgolen); 130| | 131| |#if DROPBEAR_PLUGIN 132| | if (svr_ses.plugin_instance != NULL) { 133| | char *options_buf; 134| | if (svr_ses.plugin_instance->checkpubkey( 135| | svr_ses.plugin_instance, 136| | &ses.plugin_session, 137| | keyalgo, 138| | keyalgolen, 139| | keyblob, 140| | keybloblen, 141| | ses.authstate.username) == DROPBEAR_SUCCESS) { 142| | /* Success */ 143| | auth_failure = 0; 144| | 145| | /* Options provided? */ 146| | options_buf = ses.plugin_session->get_options(ses.plugin_session); 147| | if (options_buf) { 148| | struct buf temp_buf = { 149| | .data = (unsigned char *)options_buf, 150| | .len = strlen(options_buf), 151| | .pos = 0, 152| | .size = 0 153| | }; 154| | pubkey_options = svr_parse_pubkey_options(&temp_buf, 0, "plugin"); 155| | if (pubkey_options == NULL) { 156| | /* Fail immediately as the plugin provided wrong options */ 157| | send_msg_userauth_failure(0, 0); 158| | goto out; 159| | } 160| | } 161| | } 162| | } 163| |#endif 164| | /* check if the key is valid */ 165| 75| if (auth_failure) { ------------------ | Branch (165:6): [True: 0, False: 75] ------------------ 166| 0| int status = checkpubkey(keyalgo, keyalgolen, keyblob, keybloblen, &pubkey_options); 167| 0| auth_failure = (status != DROPBEAR_SUCCESS); ------------------ | | 111| 0|#define DROPBEAR_SUCCESS 0 ------------------ 168| 0| } 169| | 170| 75| if (auth_failure) { ------------------ | Branch (170:6): [True: 0, False: 75] ------------------ 171| | /* MAX_PUBKEY_QUERIES allows a greater limit of pubkey queries 172| | * than the standard maxauthtries. 173| | * Start counting failures (incrfail) only when it's reaching 174| | * the limit. 175| | */ 176| 0| unsigned int free_query_limit = 177| 0| MAX(0, MAX_PUBKEY_QUERIES - (int)svr_opts.maxauthtries); ------------------ | Branch (177:4): [True: 0, False: 0] ------------------ 178| 0| int incrfail = ses.authstate.serv_pubkey_query_count >= free_query_limit; 179| 0| send_msg_userauth_failure(0, incrfail); 180| 0| ses.authstate.serv_pubkey_query_count++; 181| 0| goto out; 182| 0| } 183| | 184| | /* let them know that the key is ok to use */ 185| 75| if (testkey) { ------------------ | Branch (185:6): [True: 0, False: 75] ------------------ 186| 0| send_msg_userauth_pk_ok(sigalgo, sigalgolen, keyblob, keybloblen); 187| 0| goto out; 188| 0| } 189| | 190| | /* now we can actually verify the signature */ 191| | 192| | /* get the key */ 193| 75| key = new_sign_key(); 194| 75| if (buf_get_pub_key(ses.payload, key, &keytype) == DROPBEAR_FAILURE) { ------------------ | | 112| 75|#define DROPBEAR_FAILURE -1 ------------------ | Branch (194:6): [True: 0, False: 75] ------------------ 195| 0| send_msg_userauth_failure(0, 1); 196| 0| goto out; 197| 0| } 198| | 199| 75|#if DROPBEAR_SK_ECDSA || DROPBEAR_SK_ED25519 200| 75| key->sk_flags_mask = SSH_SK_USER_PRESENCE_REQD; ------------------ | | 135| 75|#define SSH_SK_USER_PRESENCE_REQD 0x01 ------------------ 201| 75|#if DROPBEAR_SVR_PUBKEY_OPTIONS_BUILT 202| 75| if (pubkey_options->no_touch_required_flag) { ------------------ | Branch (202:6): [True: 0, False: 75] ------------------ 203| 0| key->sk_flags_mask &= ~SSH_SK_USER_PRESENCE_REQD; ------------------ | | 135| 0|#define SSH_SK_USER_PRESENCE_REQD 0x01 ------------------ 204| 0| } 205| 75| if (pubkey_options->verify_required_flag) { ------------------ | Branch (205:6): [True: 0, False: 75] ------------------ 206| 0| key->sk_flags_mask |= SSH_SK_USER_VERIFICATION_REQD; ------------------ | | 136| 0|#define SSH_SK_USER_VERIFICATION_REQD 0x04 ------------------ 207| 0| } 208| 75|#endif /* DROPBEAR_SVR_PUBKEY_OPTIONS_BUILT */ 209| 75|#endif 210| | 211| | /* create the data which has been signed - this a string containing 212| | * session_id, concatenated with the payload packet up to the signature */ 213| 75| assert(ses.payload_beginning <= ses.payload->pos); ------------------ | Branch (213:2): [True: 0, False: 75] | Branch (213:2): [True: 0, False: 75] ------------------ 214| 75| sign_payload_length = ses.payload->pos - ses.payload_beginning; 215| 0| signbuf = buf_new(ses.payload->pos + 4 + ses.session_id->len); 216| 0| buf_putbufstring(signbuf, ses.session_id); 217| | 218| | /* The entire contents of the payload prior. */ 219| 0| buf_setpos(ses.payload, ses.payload_beginning); 220| 0| buf_putbytes(signbuf, 221| 0| buf_getptr(ses.payload, sign_payload_length), 222| 0| sign_payload_length); 223| 0| buf_incrpos(ses.payload, sign_payload_length); 224| | 225| 0| buf_setpos(signbuf, 0); 226| | 227| | /* ... and finally verify the signature */ 228| 0| fp = sign_key_fingerprint(keyblob, keybloblen); 229| 0| if (buf_verify(ses.payload, key, sigtype, signbuf) == DROPBEAR_SUCCESS) { ------------------ | | 111| 0|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (229:6): [True: 0, False: 0] ------------------ 230| 0| if (ses.authstate.pubkey_options == NULL) { ------------------ | Branch (230:7): [True: 0, False: 0] ------------------ 231| 0| ses.authstate.pubkey_options = pubkey_options; 232| 0| pubkey_options = NULL; 233| 0| } 234| 0| if (svr_opts.multiauthmethod && (ses.authstate.authtypes & ~AUTH_TYPE_PUBKEY)) { ------------------ | | 103| 0|#define AUTH_TYPE_PUBKEY (1 << 1) ------------------ | Branch (234:7): [True: 0, False: 0] | Branch (234:35): [True: 0, False: 0] ------------------ 235| | /* successful pubkey authentication, but extra auth required */ 236| 0| dropbear_log(LOG_NOTICE, 237| 0| "Pubkey auth succeeded for '%s' with %s key %s from %s, extra auth required", 238| 0| ses.authstate.pw_name, 239| 0| signkey_name_from_type(keytype, NULL), fp, 240| 0| svr_ses.addrstring); 241| 0| ses.authstate.authtypes &= ~AUTH_TYPE_PUBKEY; /* pubkey auth ok, delete the method flag */ ------------------ | | 103| 0|#define AUTH_TYPE_PUBKEY (1 << 1) ------------------ 242| 0| send_msg_userauth_failure(1, 0); /* Send partial success */ 243| 0| } else { 244| | /* successful authentication */ 245| 0| dropbear_log(LOG_NOTICE, 246| 0| "Pubkey auth succeeded for '%s' with %s key %s from %s", 247| 0| ses.authstate.pw_name, 248| 0| signkey_name_from_type(keytype, NULL), fp, 249| 0| svr_ses.addrstring); 250| 0| send_msg_userauth_success(); 251| 0| } 252| |#if DROPBEAR_PLUGIN 253| | if ((ses.plugin_session != NULL) && (svr_ses.plugin_instance->auth_success != NULL)) { 254| | /* Was authenticated through the external plugin. tell plugin that signature verification was ok */ 255| | svr_ses.plugin_instance->auth_success(ses.plugin_session); 256| | } 257| |#endif 258| 0| } else { 259| 0| dropbear_log(LOG_WARNING, 260| 0| "Pubkey auth bad signature for '%s' with key %s from %s", 261| 0| ses.authstate.pw_name, fp, svr_ses.addrstring); 262| 0| send_msg_userauth_failure(0, 1); 263| 0| } 264| 0| m_free(fp); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 265| | 266| 192|out: 267| | /* cleanup stuff */ 268| 192| if (signbuf) { ------------------ | Branch (268:6): [True: 0, False: 192] ------------------ 269| 0| buf_free(signbuf); 270| 0| } 271| 192| if (sigalgo) { ------------------ | Branch (271:6): [True: 192, False: 0] ------------------ 272| 192| m_free(sigalgo); ------------------ | | 24| 192|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 192] | | ------------------ ------------------ 273| 192| } 274| 192| if (key) { ------------------ | Branch (274:6): [True: 0, False: 192] ------------------ 275| 0| sign_key_free(key); 276| 0| key = NULL; 277| 0| } 278| 192| if (pubkey_options) { ------------------ | Branch (278:6): [True: 0, False: 192] ------------------ 279| 0| svr_pubkey_options_cleanup(pubkey_options); 280| | pubkey_options = NULL; 281| 0| } 282| 192| TRACE(("leave pubkeyauth")) 283| 192|} svr_pubkey_options_cleanup: 165| 2.84k|void svr_pubkey_options_cleanup(struct PubKeyOptions *pubkey_options) { 166| 2.84k| if (pubkey_options) { ------------------ | Branch (166:6): [True: 0, False: 2.84k] ------------------ 167| 0| m_free(pubkey_options->forced_command); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 168| 0| if (pubkey_options->permit_open_destinations) { ------------------ | Branch (168:7): [True: 0, False: 0] ------------------ 169| 0| m_list_elem *iter = pubkey_options->permit_open_destinations->first; 170| 0| while (iter) { ------------------ | Branch (170:11): [True: 0, False: 0] ------------------ 171| 0| struct PermitTCPFwdEntry *entry = (struct PermitTCPFwdEntry*)list_remove(iter); 172| 0| m_free(entry->host); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 173| 0| m_free(entry); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 174| 0| iter = pubkey_options->permit_open_destinations->first; 175| 0| } 176| 0| m_free(pubkey_options->permit_open_destinations); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 177| 0| } 178| 0| if (pubkey_options->permit_listens) { ------------------ | Branch (178:7): [True: 0, False: 0] ------------------ 179| 0| m_list_elem *iter = pubkey_options->permit_listens->first; 180| 0| while (iter) { ------------------ | Branch (180:11): [True: 0, False: 0] ------------------ 181| 0| struct PermitTCPFwdEntry *entry = (struct PermitTCPFwdEntry*)list_remove(iter); 182| 0| m_free(entry->host); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 183| 0| m_free(entry); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 184| 0| iter = pubkey_options->permit_listens->first; 185| 0| } 186| 0| m_free(pubkey_options->permit_listens); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 187| 0| } 188| 0| m_free(pubkey_options->info_env); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 189| | m_free(pubkey_options); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 190| 0| } 191| 2.84k|} svr_chansess_checksignal: 95| 209k|void svr_chansess_checksignal(void) { 96| 209k| int status; 97| 209k| pid_t pid; 98| | 99| 209k| if (!ses.channel_signal_pending) { ------------------ | Branch (99:6): [True: 209k, False: 0] ------------------ 100| 209k| return; 101| 209k| } 102| | 103| 0| while ((pid = waitpid(-1, &status, WNOHANG)) > 0) { ------------------ | Branch (103:9): [True: 0, False: 0] ------------------ 104| 0| unsigned int i; 105| 0| struct exitinfo *ex = NULL; 106| 0| TRACE(("svr_chansess_checksignal : pid %d", pid)) 107| | 108| 0| ex = NULL; 109| | /* find the corresponding chansess */ 110| 0| for (i = 0; i < svr_ses.childpidsize; i++) { ------------------ | Branch (110:15): [True: 0, False: 0] ------------------ 111| 0| if (svr_ses.childpids[i].pid == pid) { ------------------ | Branch (111:8): [True: 0, False: 0] ------------------ 112| 0| TRACE(("found match session")); 113| 0| ex = &svr_ses.childpids[i].chansess->exit; 114| 0| break; 115| 0| } 116| 0| } 117| | 118| | /* If the pid wasn't matched, then we might have hit the race mentioned 119| | * above. So we just store the info for the parent to deal with */ 120| 0| if (ex == NULL) { ------------------ | Branch (120:7): [True: 0, False: 0] ------------------ 121| 0| TRACE(("using lastexit")); 122| 0| ex = &svr_ses.lastexit; 123| 0| } 124| | 125| 0| ex->exitpid = pid; 126| 0| if (WIFEXITED(status)) { ------------------ | Branch (126:7): [True: 0, False: 0] ------------------ 127| 0| ex->exitstatus = WEXITSTATUS(status); 128| 0| } 129| 0| if (WIFSIGNALED(status)) { ------------------ | Branch (129:7): [True: 0, False: 0] ------------------ 130| 0| ex->exitsignal = WTERMSIG(status); 131| 0|#if !defined(AIX) && defined(WCOREDUMP) 132| 0| ex->exitcore = WCOREDUMP(status); 133| |#else 134| | ex->exitcore = 0; 135| |#endif 136| 0| } else { 137| | /* we use this to determine how pid exited */ 138| 0| ex->exitsignal = -1; 139| 0| } 140| 0| } 141| 0|} svr_chansessinitialise: 1073| 2.84k|void svr_chansessinitialise() { 1074| | 1075| 2.84k| struct sigaction sa_chld; 1076| | 1077| | /* single child process intially */ 1078| 2.84k| svr_ses.childpids = (struct ChildPid*)m_malloc(sizeof(struct ChildPid)); 1079| 2.84k| svr_ses.childpids[0].pid = -1; /* unused */ 1080| 2.84k| svr_ses.childpids[0].chansess = NULL; 1081| 2.84k| svr_ses.childpidsize = 1; 1082| 2.84k| svr_ses.lastexit.exitpid = -1; /* Nothing has exited yet */ 1083| 2.84k| sa_chld.sa_handler = sesssigchild_handler; 1084| 2.84k| sa_chld.sa_flags = SA_NOCLDSTOP; 1085| 2.84k| sigemptyset(&sa_chld.sa_mask); 1086| 2.84k| if (sigaction(SIGCHLD, &sa_chld, NULL) < 0) { ------------------ | Branch (1086:6): [True: 0, False: 2.84k] ------------------ 1087| 0| dropbear_exit("signal() error"); 1088| 0| } 1089| | 1090| 2.84k|} recv_msg_kexdh_init: 49| 6.41k|void recv_msg_kexdh_init() { 50| 6.41k| DEF_MP_INT(dh_e); ------------------ | | 81| 6.41k|#define DEF_MP_INT(X) mp_int X = {0, 0, 0, NULL} ------------------ 51| 6.41k| buffer *q_c = NULL; 52| | 53| 6.41k| TRACE(("enter recv_msg_kexdh_init")) 54| 6.41k| if (!ses.kexstate.recvkexinit) { ------------------ | Branch (54:6): [True: 6, False: 6.40k] ------------------ 55| 6| dropbear_exit("Premature kexdh_init message received"); 56| 6| } 57| | 58| 6.40k| switch (ses.newkeys->algo_kex->mode) { ------------------ | Branch (58:10): [True: 6.40k, False: 0] ------------------ 59| 0|#if DROPBEAR_NORMAL_DH 60| 1.75k| case DROPBEAR_KEX_NORMAL_DH: ------------------ | Branch (60:3): [True: 1.75k, False: 4.64k] ------------------ 61| 1.75k| m_mp_init(&dh_e); 62| 1.75k| if (buf_getmpint(ses.payload, &dh_e) != DROPBEAR_SUCCESS) { ------------------ | | 111| 1.75k|#define DROPBEAR_SUCCESS 0 ------------------ | Branch (62:8): [True: 60, False: 1.69k] ------------------ 63| 60| dropbear_exit("Bad kex value"); 64| 60| } 65| 1.69k| break; 66| 1.69k|#endif 67| 1.69k|#if DROPBEAR_ECDH 68| 1.69k| case DROPBEAR_KEX_ECDH: ------------------ | Branch (68:3): [True: 1.20k, False: 5.20k] ------------------ 69| 1.20k|#endif 70| 1.20k|#if DROPBEAR_CURVE25519 71| 4.54k| case DROPBEAR_KEX_CURVE25519: ------------------ | Branch (71:3): [True: 3.34k, False: 3.05k] ------------------ 72| 4.54k|#endif 73| 4.54k|#if DROPBEAR_PQHYBRID 74| 4.64k| case DROPBEAR_KEX_PQHYBRID: ------------------ | Branch (74:3): [True: 101, False: 6.30k] ------------------ 75| 4.64k|#endif 76| 4.64k|#if DROPBEAR_ECDH || DROPBEAR_CURVE25519 || DROPBEAR_PQHYBRID 77| 4.64k| q_c = buf_getstringbuf(ses.payload); 78| 4.64k| break; 79| 6.40k|#endif 80| 6.40k| } 81| 6.24k| if (ses.payload->pos != ses.payload->len) { ------------------ | Branch (81:6): [True: 78, False: 6.16k] ------------------ 82| 78| dropbear_exit("Bad kex value"); 83| 78| } 84| | 85| 6.16k| send_msg_kexdh_reply(&dh_e, q_c); 86| | 87| 6.16k| mp_clear(&dh_e); 88| 6.16k| if (q_c) { ------------------ | Branch (88:6): [True: 4.54k, False: 1.62k] ------------------ 89| 4.54k| buf_free(q_c); 90| 4.54k| q_c = NULL; 91| 4.54k| } 92| | 93| 6.16k| send_msg_newkeys(); 94| | 95| 6.16k|#if DROPBEAR_EXT_INFO 96| | /* Only send it following the first newkeys */ 97| 6.16k| if (!ses.kexstate.donesecondkex && ses.allow_ext_info) { ------------------ | Branch (97:6): [True: 1.53k, False: 4.63k] | Branch (97:37): [True: 92, False: 1.44k] ------------------ 98| 92| send_msg_ext_info(); 99| 92| } 100| 6.16k|#endif 101| | 102| 6.16k| if (!ses.kexstate.donesecondkex) { ------------------ | Branch (102:6): [True: 1.53k, False: 4.63k] ------------------ 103| | /* Disable other signature types. 104| | * During future rekeying, privileges may have been dropped 105| | * so other keys won't be loadable. 106| | * This must occur after send_msg_ext_info() which uses the hostkey list */ 107| 1.53k| disable_sig_except(ses.newkeys->algo_signature); 108| 1.53k| } 109| | 110| 6.16k| ses.requirenext = SSH_MSG_NEWKEYS; ------------------ | | 37| 6.16k|#define SSH_MSG_NEWKEYS 21 ------------------ 111| 6.16k| TRACE(("leave recv_msg_kexdh_init")) 112| 6.16k|} svr-kex.c:send_msg_kexdh_reply: 200| 6.16k|static void send_msg_kexdh_reply(mp_int *dh_e, buffer *q_c) { 201| 6.16k| TRACE(("enter send_msg_kexdh_reply")) 202| | 203| | /* we can start creating the kexdh_reply packet */ 204| 6.16k| CHECKCLEARTOWRITE(); 205| | 206| 6.16k|#if DROPBEAR_DELAY_HOSTKEY 207| 6.16k| if (svr_opts.delay_hostkey) ------------------ | Branch (207:6): [True: 0, False: 6.16k] ------------------ 208| 0| { 209| 0| svr_ensure_hostkey(); 210| 0| } 211| 6.16k|#endif 212| | 213| 6.16k|#if DROPBEAR_FUZZ 214| 6.16k| if (fuzz.fuzzing && fuzz.skip_kexmaths) { ------------------ | Branch (214:6): [True: 6.16k, False: 0] | Branch (214:22): [True: 6.16k, False: 0] ------------------ 215| 6.16k| fuzz_fake_send_kexdh_reply(); 216| 6.16k| return; 217| 6.16k| } 218| 0|#endif 219| | 220| 0| buf_putbyte(ses.writepayload, SSH_MSG_KEXDH_REPLY); ------------------ | | 39| 0|#define SSH_MSG_KEXDH_REPLY 31 ------------------ 221| 0| buf_put_pub_key(ses.writepayload, svr_opts.hostkey, 222| 0| ses.newkeys->algo_hostkey); 223| | 224| 0| switch (ses.newkeys->algo_kex->mode) { ------------------ | Branch (224:10): [True: 0, False: 0] ------------------ 225| 0|#if DROPBEAR_NORMAL_DH 226| 0| case DROPBEAR_KEX_NORMAL_DH: ------------------ | Branch (226:3): [True: 0, False: 0] ------------------ 227| 0| { 228| 0| struct kex_dh_param * dh_param = gen_kexdh_param(); 229| 0| kexdh_comb_key(dh_param, dh_e, svr_opts.hostkey); 230| | 231| | /* put f */ 232| 0| buf_putmpint(ses.writepayload, &dh_param->pub); 233| 0| free_kexdh_param(dh_param); 234| 0| } 235| 0| break; 236| 0|#endif 237| 0|#if DROPBEAR_ECDH 238| 0| case DROPBEAR_KEX_ECDH: ------------------ | Branch (238:3): [True: 0, False: 0] ------------------ 239| 0| { 240| 0| struct kex_ecdh_param *ecdh_param = gen_kexecdh_param(); 241| 0| kexecdh_comb_key(ecdh_param, q_c, svr_opts.hostkey); 242| | 243| 0| buf_put_ecc_raw_pubkey_string(ses.writepayload, &ecdh_param->key); 244| 0| free_kexecdh_param(ecdh_param); 245| 0| } 246| 0| break; 247| 0|#endif 248| 0|#if DROPBEAR_CURVE25519 249| 0| case DROPBEAR_KEX_CURVE25519: ------------------ | Branch (249:3): [True: 0, False: 0] ------------------ 250| 0| { 251| 0| struct kex_curve25519_param *param = gen_kexcurve25519_param(); 252| 0| kexcurve25519_comb_key(param, q_c, svr_opts.hostkey); 253| | 254| 0| buf_putstring(ses.writepayload, param->pub, CURVE25519_LEN); ------------------ | | 122| 0|#define CURVE25519_LEN 32 ------------------ 255| 0| free_kexcurve25519_param(param); 256| 0| } 257| 0| break; 258| 0|#endif 259| 0|#if DROPBEAR_PQHYBRID 260| 0| case DROPBEAR_KEX_PQHYBRID: ------------------ | Branch (260:3): [True: 0, False: 0] ------------------ 261| 0| { 262| 0| struct kex_pqhybrid_param *param = gen_kexpqhybrid_param(); 263| 0| kexpqhybrid_comb_key(param, q_c, svr_opts.hostkey); 264| | 265| 0| buf_putbufstring(ses.writepayload, param->concat_public); 266| 0| free_kexpqhybrid_param(param); 267| 0| } 268| 0| break; 269| 0|#endif 270| 0| } 271| | 272| | /* calc the signature */ 273| 0| buf_put_sign(ses.writepayload, svr_opts.hostkey, 274| 0| ses.newkeys->algo_signature, ses.hash); 275| | 276| | /* the SSH_MSG_KEXDH_REPLY is done */ 277| 0| encrypt_packet(); 278| | 279| 0| TRACE(("leave send_msg_kexdh_reply")) 280| 0|} svr-kex.c:send_msg_ext_info: 284| 92|static void send_msg_ext_info(void) { 285| 92| TRACE(("enter send_msg_ext_info")) 286| | 287| 92| buf_putbyte(ses.writepayload, SSH_MSG_EXT_INFO); ------------------ | | 35| 92|#define SSH_MSG_EXT_INFO 7 ------------------ 288| | /* nr-extensions */ 289| 92| buf_putint(ses.writepayload, 1); 290| | 291| 92| buf_putstring(ses.writepayload, SSH_SERVER_SIG_ALGS, strlen(SSH_SERVER_SIG_ALGS)); ------------------ | | 101| 92|#define SSH_SERVER_SIG_ALGS "server-sig-algs" ------------------ buf_putstring(ses.writepayload, SSH_SERVER_SIG_ALGS, strlen(SSH_SERVER_SIG_ALGS)); ------------------ | | 101| 92|#define SSH_SERVER_SIG_ALGS "server-sig-algs" ------------------ 292| 92| buf_put_algolist_all(ses.writepayload, sigalgs, 1); 293| | 294| 92| encrypt_packet(); 295| | 296| 92| TRACE(("leave send_msg_ext_info")) 297| 92|} svr_getopts: 147| 1|void svr_getopts(int argc, char ** argv) { 148| | 149| 1| unsigned int i, j; 150| 1| char ** next = NULL; 151| 1| int nextisport = 0; 152| 1| char* recv_window_arg = NULL; 153| 1| char* keepalive_arg = NULL; 154| 1| char* idle_timeout_arg = NULL; 155| 1| char* max_duration_arg = NULL; 156| 1| char* maxauthtries_arg = NULL; 157| 1| char* reexec_fd_arg = NULL; 158| 1| char* keyfile = NULL; 159| 1| char *algo_print_arg = NULL; 160| 1| char c; 161| |#if DROPBEAR_PLUGIN 162| | char* pubkey_plugin = NULL; 163| |#endif 164| | 165| | 166| | /* see printhelp() for options */ 167| 1| svr_opts.bannerfile = NULL; 168| 1| svr_opts.banner = NULL; 169| 1| svr_opts.forced_command = NULL; 170| 1| svr_opts.forkbg = 1; 171| 1| svr_opts.norootlogin = 0; 172| 1|#ifdef HAVE_GETGROUPLIST 173| 1| svr_opts.restrict_group = NULL; 174| 1| svr_opts.restrict_group_gid = 0; 175| 1|#endif 176| 1| svr_opts.noauthpass = 0; 177| 1| svr_opts.norootpass = 0; 178| 1| svr_opts.allowblankpass = 0; 179| 1| svr_opts.multiauthmethod = 0; 180| 1| svr_opts.maxauthtries = MAX_AUTH_TRIES; ------------------ | | 463| 1|#define MAX_AUTH_TRIES 10 ------------------ 181| 1| svr_opts.inetdmode = 0; 182| 1| svr_opts.portcount = 0; 183| 1| svr_opts.hostkey = NULL; 184| 1| svr_opts.delay_hostkey = 0; 185| 1| svr_opts.pidfile = expand_homedir_path(DROPBEAR_PIDFILE); ------------------ | | 507| 1|#define DROPBEAR_PIDFILE "/var/run/dropbear.pid" ------------------ 186| 1| svr_opts.authorized_keys_dir = "~/.ssh"; 187| 1|#if DROPBEAR_SVR_LOCALANYFWD 188| 1| svr_opts.nolocaltcp = 0; 189| 1|#endif 190| 1|#if DROPBEAR_SVR_REMOTEANYFWD 191| 1| svr_opts.noremotefwd = 0; 192| 1|#endif 193| |#if DROPBEAR_PLUGIN 194| | svr_opts.pubkey_plugin = NULL; 195| | svr_opts.pubkey_plugin_options = NULL; 196| |#endif 197| 1| svr_opts.pass_on_env = 0; 198| 1| svr_opts.reexec_childpipe = -1; 199| | 200| |#ifndef DISABLE_ZLIB 201| | opts.compression = 1; 202| |#endif 203| | 204| | /* not yet 205| | opts.ipv4 = 1; 206| | opts.ipv6 = 1; 207| | */ 208| 1|#if DO_MOTD 209| 1| svr_opts.domotd = 1; 210| 1|#endif 211| 1|#ifndef DISABLE_SYSLOG 212| 1| opts.usingsyslog = 1; 213| 1|#endif 214| 1| opts.recv_window = DEFAULT_RECV_WINDOW; ------------------ | | 550| 1|#define DEFAULT_RECV_WINDOW 24576 ------------------ 215| 1| opts.keepalive_secs = DEFAULT_KEEPALIVE; ------------------ | | 566| 1|#define DEFAULT_KEEPALIVE 0 ------------------ 216| 1| opts.idle_timeout_secs = DEFAULT_IDLE_TIMEOUT; ------------------ | | 579| 1|#define DEFAULT_IDLE_TIMEOUT 0 ------------------ 217| 1| opts.max_duration_secs = DEFAULT_MAX_DURATION; ------------------ | | 585| 1|#define DEFAULT_MAX_DURATION 0 ------------------ 218| | 219| 1|#if DROPBEAR_SVR_REMOTETCPFWD 220| 1| opts.listen_fwd_all = 0; 221| 1|#endif 222| 1| opts.disable_ip_tos = 0; 223| | 224| 2| for (i = 1; i < (unsigned int)argc; i++) { ------------------ | Branch (224:14): [True: 1, False: 1] ------------------ 225| 1| if (argv[i][0] != '-' || argv[i][1] == '\0') ------------------ | Branch (225:7): [True: 0, False: 1] | Branch (225:28): [True: 0, False: 1] ------------------ 226| 0| dropbear_exit("Invalid argument: %s", argv[i]); 227| | 228| 2| for (j = 1; (c = argv[i][j]) != '\0' && !next && !nextisport; j++) { ------------------ | Branch (228:15): [True: 1, False: 1] | Branch (228:43): [True: 1, False: 0] | Branch (228:52): [True: 1, False: 0] ------------------ 229| 1| switch (c) { 230| 0| case 'b': ------------------ | Branch (230:5): [True: 0, False: 1] ------------------ 231| 0| next = &svr_opts.bannerfile; 232| 0| break; 233| 0| case 'c': ------------------ | Branch (233:5): [True: 0, False: 1] ------------------ 234| 0| next = &svr_opts.forced_command; 235| 0| break; 236| 0| case 'd': ------------------ | Branch (236:5): [True: 0, False: 1] ------------------ 237| 0| case 'r': ------------------ | Branch (237:5): [True: 0, False: 1] ------------------ 238| 0| next = &keyfile; 239| 0| break; 240| 0|#if DROPBEAR_SVR_PUBKEY_AUTH 241| 0| case 'D': ------------------ | Branch (241:5): [True: 0, False: 1] ------------------ 242| 0| next = &svr_opts.authorized_keys_dir; 243| 0| break; 244| 0|#endif 245| 0| case 'R': ------------------ | Branch (245:5): [True: 0, False: 1] ------------------ 246| 0| svr_opts.delay_hostkey = 1; 247| 0| break; 248| 0| case 'F': ------------------ | Branch (248:5): [True: 0, False: 1] ------------------ 249| 0| svr_opts.forkbg = 0; 250| 0| break; 251| 0|#ifndef DISABLE_SYSLOG 252| 1| case 'E': ------------------ | Branch (252:5): [True: 1, False: 0] ------------------ 253| 1| opts.usingsyslog = 0; 254| 1| break; 255| 0|#endif 256| 0| case 'e': ------------------ | Branch (256:5): [True: 0, False: 1] ------------------ 257| 0| svr_opts.pass_on_env = 1; 258| 0| break; 259| | 260| 0|#if DROPBEAR_SVR_LOCALANYFWD 261| 0| case 'j': ------------------ | Branch (261:5): [True: 0, False: 1] ------------------ 262| 0| svr_opts.nolocaltcp = 1; 263| 0| break; 264| |#else 265| | case 'j': 266| | /* Ignore the flag */ 267| | break; 268| |#endif 269| 0|#if DROPBEAR_SVR_REMOTEANYFWD 270| 0| case 'k': ------------------ | Branch (270:5): [True: 0, False: 1] ------------------ 271| 0| svr_opts.noremotefwd = 1; 272| 0| break; 273| |#else 274| | case 'k': 275| | /* Ignore the flag */ 276| | break; 277| |#endif 278| 0|#if DROPBEAR_SVR_REMOTETCPFWD 279| 0| case 'a': ------------------ | Branch (279:5): [True: 0, False: 1] ------------------ 280| 0| opts.listen_fwd_all = 1; 281| 0| break; 282| 0|#endif 283| 0|#if INETD_MODE 284| 0| case 'i': ------------------ | Branch (284:5): [True: 0, False: 1] ------------------ 285| 0| svr_opts.inetdmode = 1; 286| 0| break; 287| 0|#endif 288| 0|#if DROPBEAR_DO_REEXEC && NON_INETD_MODE 289| | /* For internal use by re-exec */ 290| 0| case '2': ------------------ | Branch (290:5): [True: 0, False: 1] ------------------ 291| 0| next = &reexec_fd_arg; 292| 0| break; 293| 0|#endif 294| 0| case 'p': ------------------ | Branch (294:5): [True: 0, False: 1] ------------------ 295| 0| nextisport = 1; 296| 0| break; 297| 0| case 'P': ------------------ | Branch (297:5): [True: 0, False: 1] ------------------ 298| 0| next = &svr_opts.pidfile; 299| 0| break; 300| 0|#ifdef SO_BINDTODEVICE 301| 0| case 'l': ------------------ | Branch (301:5): [True: 0, False: 1] ------------------ 302| 0| next = &svr_opts.interface; 303| 0| break; 304| 0|#endif 305| 0|#if DO_MOTD 306| | /* motd is displayed by default, -m turns it off */ 307| 0| case 'm': ------------------ | Branch (307:5): [True: 0, False: 1] ------------------ 308| 0| svr_opts.domotd = 0; 309| 0| break; 310| |#else 311| | case 'm': 312| | break; 313| |#endif 314| 0| case 'w': ------------------ | Branch (314:5): [True: 0, False: 1] ------------------ 315| 0| svr_opts.norootlogin = 1; 316| 0| break; 317| 0|#ifdef HAVE_GETGROUPLIST 318| 0| case 'G': ------------------ | Branch (318:5): [True: 0, False: 1] ------------------ 319| 0| next = &svr_opts.restrict_group; 320| 0| break; 321| 0|#endif 322| 0| case 'W': ------------------ | Branch (322:5): [True: 0, False: 1] ------------------ 323| 0| next = &recv_window_arg; 324| 0| break; 325| 0| case 'K': ------------------ | Branch (325:5): [True: 0, False: 1] ------------------ 326| 0| next = &keepalive_arg; 327| 0| break; 328| 0| case 'I': ------------------ | Branch (328:5): [True: 0, False: 1] ------------------ 329| 0| next = &idle_timeout_arg; 330| 0| break; 331| 0| case 'M': ------------------ | Branch (331:5): [True: 0, False: 1] ------------------ 332| 0| next = &max_duration_arg; 333| 0| break; 334| 0| case 'T': ------------------ | Branch (334:5): [True: 0, False: 1] ------------------ 335| 0| next = &maxauthtries_arg; 336| 0| break; 337| 0|#if DROPBEAR_SVR_PASSWORD_AUTH || DROPBEAR_SVR_PAM_AUTH 338| 0| case 's': ------------------ | Branch (338:5): [True: 0, False: 1] ------------------ 339| 0| svr_opts.noauthpass = 1; 340| 0| break; 341| 0| case 'g': ------------------ | Branch (341:5): [True: 0, False: 1] ------------------ 342| 0| svr_opts.norootpass = 1; 343| 0| break; 344| 0| case 'B': ------------------ | Branch (344:5): [True: 0, False: 1] ------------------ 345| 0| svr_opts.allowblankpass = 1; 346| 0| break; 347| 0| case 't': ------------------ | Branch (347:5): [True: 0, False: 1] ------------------ 348| 0| svr_opts.multiauthmethod = 1; 349| 0| break; 350| |#else 351| | case 's': 352| | case 'g': 353| | break; 354| |#endif 355| 0| case 'Q': ------------------ | Branch (355:5): [True: 0, False: 1] ------------------ 356| 0| next = &algo_print_arg; 357| 0| break; 358| 0| case 'h': ------------------ | Branch (358:5): [True: 0, False: 1] ------------------ 359| 0| printhelp(argv[0]); 360| 0| exit(EXIT_SUCCESS); 361| 0| break; 362| 0| case 'u': ------------------ | Branch (362:5): [True: 0, False: 1] ------------------ 363| | /* backwards compatibility with old urandom option */ 364| 0| break; 365| |#if DROPBEAR_PLUGIN 366| | case 'A': 367| | next = &pubkey_plugin; 368| | break; 369| |#endif 370| |#if DEBUG_TRACE 371| | case 'v': 372| | debug_trace++; 373| | break; 374| |#endif 375| 0| case 'V': ------------------ | Branch (375:5): [True: 0, False: 1] ------------------ 376| 0| print_version(); 377| 0| exit(EXIT_SUCCESS); 378| 0| break; 379| 0| case 'z': ------------------ | Branch (379:5): [True: 0, False: 1] ------------------ 380| 0| opts.disable_ip_tos = 1; 381| 0| break; 382| 0| default: ------------------ | Branch (382:5): [True: 0, False: 1] ------------------ 383| 0| fprintf(stderr, "Invalid option -%c\n", c); ------------------ | | 100| 0|#define stderr (fuzz.fake_stderr) ------------------ 384| 0| printhelp(argv[0]); 385| 0| exit(EXIT_FAILURE); 386| 0| break; 387| 1| } 388| 1| } 389| | 390| 1| if (!next && !nextisport) ------------------ | Branch (390:7): [True: 1, False: 0] | Branch (390:16): [True: 1, False: 0] ------------------ 391| 1| continue; 392| | 393| 0| if (c == '\0') { ------------------ | Branch (393:7): [True: 0, False: 0] ------------------ 394| 0| i++; 395| 0| j = 0; 396| 0| if (!argv[i]) { ------------------ | Branch (396:8): [True: 0, False: 0] ------------------ 397| 0| dropbear_exit("Missing argument"); 398| 0| } 399| 0| } 400| | 401| 0| if (nextisport) { ------------------ | Branch (401:7): [True: 0, False: 0] ------------------ 402| 0| addportandaddress(&argv[i][j]); 403| 0| nextisport = 0; 404| 0| } else if (next) { ------------------ | Branch (404:14): [True: 0, False: 0] ------------------ 405| 0| *next = &argv[i][j]; 406| 0| if (*next == NULL) { ------------------ | Branch (406:8): [True: 0, False: 0] ------------------ 407| 0| dropbear_exit("Invalid null argument"); 408| 0| } 409| 0| next = NULL; 410| | 411| 0| if (keyfile) { ------------------ | Branch (411:8): [True: 0, False: 0] ------------------ 412| 0| addhostkey(keyfile); 413| 0| keyfile = NULL; 414| 0| } 415| 0| } 416| 0| } 417| | 418| | /* Set up listening ports */ 419| 1| if (svr_opts.portcount == 0) { ------------------ | Branch (419:6): [True: 1, False: 0] ------------------ 420| 1| svr_opts.ports[0] = m_strdup(DROPBEAR_DEFPORT); ------------------ | | 25| 1|#define DROPBEAR_DEFPORT "22" ------------------ 421| 1| svr_opts.addresses[0] = m_strdup(DROPBEAR_DEFADDRESS); ------------------ | | 30| 1|#define DROPBEAR_DEFADDRESS "" ------------------ 422| 1| svr_opts.portcount = 1; 423| 1| } 424| | 425| 1| if (svr_opts.bannerfile) { ------------------ | Branch (425:6): [True: 0, False: 1] ------------------ 426| 0| load_banner(); 427| 0| } 428| | 429| 1|#ifdef HAVE_GETGROUPLIST 430| 1| if (svr_opts.restrict_group) { ------------------ | Branch (430:6): [True: 0, False: 1] ------------------ 431| 0| struct group *restrictedgroup = getgrnam(svr_opts.restrict_group); 432| | 433| 0| if (restrictedgroup){ ------------------ | Branch (433:7): [True: 0, False: 0] ------------------ 434| 0| svr_opts.restrict_group_gid = restrictedgroup->gr_gid; 435| 0| } else { 436| 0| dropbear_exit("Cannot restrict logins to group '%s' as the group does not exist", svr_opts.restrict_group); 437| 0| } 438| 0| } 439| 1|#endif 440| | 441| 1| if (recv_window_arg) { ------------------ | Branch (441:6): [True: 0, False: 1] ------------------ 442| 0| parse_recv_window(recv_window_arg); 443| 0| } 444| | 445| 1| if (maxauthtries_arg) { ------------------ | Branch (445:6): [True: 0, False: 1] ------------------ 446| 0| unsigned int val = 0; 447| 0| if (m_str_to_uint(maxauthtries_arg, &val) == DROPBEAR_FAILURE) { ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (447:7): [True: 0, False: 0] ------------------ 448| 0| dropbear_exit("Bad maxauthtries '%s'", maxauthtries_arg); 449| 0| } 450| 0| svr_opts.maxauthtries = val; 451| 0| } 452| | 453| | 454| 1| if (keepalive_arg) { ------------------ | Branch (454:6): [True: 0, False: 1] ------------------ 455| 0| unsigned int val; 456| 0| if (m_str_to_uint(keepalive_arg, &val) == DROPBEAR_FAILURE) { ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (456:7): [True: 0, False: 0] ------------------ 457| 0| dropbear_exit("Bad keepalive '%s'", keepalive_arg); 458| 0| } 459| 0| opts.keepalive_secs = val; 460| 0| } 461| | 462| 1| if (idle_timeout_arg) { ------------------ | Branch (462:6): [True: 0, False: 1] ------------------ 463| 0| unsigned int val; 464| 0| if (m_str_to_uint(idle_timeout_arg, &val) == DROPBEAR_FAILURE) { ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (464:7): [True: 0, False: 0] ------------------ 465| 0| dropbear_exit("Bad idle_timeout '%s'", idle_timeout_arg); 466| 0| } 467| 0| opts.idle_timeout_secs = val; 468| 0| } 469| | 470| 1| if (max_duration_arg) { ------------------ | Branch (470:6): [True: 0, False: 1] ------------------ 471| 0| unsigned int val; 472| 0| if (m_str_to_uint(max_duration_arg, &val) == DROPBEAR_FAILURE) { ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (472:7): [True: 0, False: 0] ------------------ 473| 0| dropbear_exit("Bad max_duration '%s'", max_duration_arg); 474| 0| } 475| 0| opts.max_duration_secs = val; 476| 0| } 477| | 478| 1| if (svr_opts.forced_command) { ------------------ | Branch (478:6): [True: 0, False: 1] ------------------ 479| 0| dropbear_log(LOG_INFO, "Forced command set to '%s'", svr_opts.forced_command); 480| 0| } 481| | 482| 1| if (svr_opts.interface) { ------------------ | Branch (482:6): [True: 0, False: 1] ------------------ 483| 0| dropbear_log(LOG_INFO, "Binding to interface '%s'", svr_opts.interface); 484| 0| } 485| | 486| 1| if (reexec_fd_arg) { ------------------ | Branch (486:6): [True: 0, False: 1] ------------------ 487| 0| if (m_str_to_uint(reexec_fd_arg, &svr_opts.reexec_childpipe) == DROPBEAR_FAILURE ------------------ | | 112| 0|#define DROPBEAR_FAILURE -1 ------------------ | Branch (487:7): [True: 0, False: 0] ------------------ 488| 0| || svr_opts.reexec_childpipe < 0) { ------------------ | Branch (488:7): [True: 0, False: 0] ------------------ 489| 0| dropbear_exit("Bad -2"); 490| 0| } 491| 0| } 492| | 493| 1| if (svr_opts.multiauthmethod && svr_opts.noauthpass) { ------------------ | Branch (493:6): [True: 0, False: 1] | Branch (493:34): [True: 0, False: 0] ------------------ 494| 0| dropbear_exit("-t and -s are incompatible"); 495| 0| } 496| | 497| 1| if (strlen(svr_opts.authorized_keys_dir) == 0) { ------------------ | Branch (497:6): [True: 0, False: 1] ------------------ 498| 0| dropbear_exit("Bad -D"); 499| 0| } 500| | 501| |#if DROPBEAR_PLUGIN 502| | if (pubkey_plugin) { 503| | svr_opts.pubkey_plugin = m_strdup(pubkey_plugin); 504| | char *args = strchr(svr_opts.pubkey_plugin, ','); 505| | if (args) { 506| | *args='\0'; 507| | ++args; 508| | } 509| | svr_opts.pubkey_plugin_options = args; 510| | } 511| |#endif 512| 1| if (algo_print_arg) { ------------------ | Branch (512:6): [True: 0, False: 1] ------------------ 513| 0| print_algos(algo_print_arg); 514| | /* No return */ 515| 0| } 516| 1|} disable_sig_except: 560| 1.53k|void disable_sig_except(enum signature_type allow_type) { 561| 1.53k| int i; 562| 1.53k| TRACE(("Disabling other sigs except %d", allow_type)); 563| 15.3k| for (i = 0; sigalgs[i].name != NULL; i++) { ------------------ | Branch (563:14): [True: 13.8k, False: 1.53k] ------------------ 564| 13.8k| enum signature_type sig_type = sigalgs[i].val; 565| 13.8k| if (sig_type != allow_type) { ------------------ | Branch (565:7): [True: 12.2k, False: 1.53k] ------------------ 566| 12.2k| sigalgs[i].usable = 0; 567| 12.2k| } 568| 13.8k| } 569| 1.53k|} recv_msg_service_request: 37| 884|void recv_msg_service_request() { 38| | 39| 884| char * name; 40| 884| unsigned int len; 41| | 42| 884| TRACE(("enter recv_msg_service_request")) 43| | 44| 884| name = buf_getstring(ses.payload, &len); 45| | 46| | /* ssh-userauth */ 47| 884| if (len == SSH_SERVICE_USERAUTH_LEN && ------------------ | | 109| 1.76k|#define SSH_SERVICE_USERAUTH_LEN 12 ------------------ | Branch (47:6): [True: 741, False: 143] ------------------ 48| 741| strncmp(SSH_SERVICE_USERAUTH, name, len) == 0) { ------------------ | | 108| 741|#define SSH_SERVICE_USERAUTH "ssh-userauth" ------------------ | Branch (48:4): [True: 664, False: 77] ------------------ 49| | 50| 664| send_msg_service_accept(name, len); 51| 664| m_free(name); ------------------ | | 24| 664|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 664] | | ------------------ ------------------ 52| 664| TRACE(("leave recv_msg_service_request: done ssh-userauth")) 53| 664| return; 54| 664| } 55| | 56| | /* ssh-connection */ 57| 220| if (len == SSH_SERVICE_CONNECTION_LEN && ------------------ | | 111| 440|#define SSH_SERVICE_CONNECTION_LEN 14 ------------------ | Branch (57:6): [True: 125, False: 95] ------------------ 58| 125| (strncmp(SSH_SERVICE_CONNECTION, name, len) == 0)) { ------------------ | | 110| 125|#define SSH_SERVICE_CONNECTION "ssh-connection" ------------------ | Branch (58:4): [True: 1, False: 124] ------------------ 59| 1| if (ses.authstate.authdone != 1) { ------------------ | Branch (59:7): [True: 1, False: 0] ------------------ 60| 1| dropbear_exit("Request for connection before auth"); 61| 1| } 62| | 63| 0| send_msg_service_accept(name, len); 64| 0| m_free(name); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 65| 0| TRACE(("leave recv_msg_service_request: done ssh-connection")) 66| 0| return; 67| 1| } 68| | 69| 219| m_free(name); ------------------ | | 24| 219|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 219] | | ------------------ ------------------ 70| | /* TODO this should be a MSG_DISCONNECT */ 71| 219| dropbear_exit("Unrecognised SSH_MSG_SERVICE_REQUEST"); 72| | 73| | 74| 220|} svr-service.c:send_msg_service_accept: 76| 664|static void send_msg_service_accept(const char *name, int len) { 77| | 78| 664| TRACE(("accepting service %s", name)) 79| | 80| 664| CHECKCLEARTOWRITE(); 81| | 82| 664| buf_putbyte(ses.writepayload, SSH_MSG_SERVICE_ACCEPT); ------------------ | | 34| 664|#define SSH_MSG_SERVICE_ACCEPT 6 ------------------ 83| 664| buf_putstring(ses.writepayload, name, len); 84| | 85| 664| encrypt_packet(); 86| | 87| 664|} svr_session: 108| 2.84k|void svr_session(int sock, int childpipe) { 109| 2.84k| char *host, *port; 110| 2.84k| size_t len; 111| | 112| 2.84k| common_session_init(sock, sock); 113| | 114| | /* Initialise server specific parts of the session */ 115| 2.84k| svr_ses.childpipe = childpipe; 116| |#if DROPBEAR_VFORK 117| | svr_ses.server_pid = getpid(); 118| |#endif 119| | 120| | /* for logging the remote address */ 121| 2.84k| get_socket_address(ses.sock_in, NULL, NULL, &host, &port, 0); 122| 2.84k| len = strlen(host) + strlen(port) + 2; 123| 2.84k| svr_ses.addrstring = m_malloc(len); 124| 2.84k| snprintf(svr_ses.addrstring, len, "%s:%s", host, port); 125| 2.84k| m_free(host); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 126| 2.84k| m_free(port); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 127| | 128| |#if DROPBEAR_PLUGIN 129| | /* Initializes the PLUGIN Plugin */ 130| | svr_ses.plugin_handle = NULL; 131| | svr_ses.plugin_instance = NULL; 132| | if (svr_opts.pubkey_plugin) { 133| |#if DEBUG_TRACE 134| | const int verbose = debug_trace; 135| |#else 136| | const int verbose = 0; 137| |#endif 138| | PubkeyExtPlugin_newFn pluginConstructor; 139| | 140| | /* RTLD_NOW: fails if not all the symbols are resolved now. Better fail now than at run-time */ 141| | svr_ses.plugin_handle = dlopen(svr_opts.pubkey_plugin, RTLD_NOW); 142| | if (svr_ses.plugin_handle == NULL) { 143| | dropbear_exit("failed to load external pubkey plugin '%s': %s", svr_opts.pubkey_plugin, dlerror()); 144| | } 145| | pluginConstructor = (PubkeyExtPlugin_newFn)dlsym(svr_ses.plugin_handle, DROPBEAR_PUBKEY_PLUGIN_FNNAME_NEW); 146| | if (!pluginConstructor) { 147| | dropbear_exit("plugin constructor method not found in external pubkey plugin"); 148| | } 149| | 150| | /* Create an instance of the plugin */ 151| | svr_ses.plugin_instance = pluginConstructor(verbose, svr_opts.pubkey_plugin_options, svr_ses.addrstring); 152| | if (svr_ses.plugin_instance == NULL) { 153| | dropbear_exit("external plugin initialization failed"); 154| | } 155| | /* Check if the plugin is compatible */ 156| | if ( (svr_ses.plugin_instance->api_version[0] != DROPBEAR_PLUGIN_VERSION_MAJOR) || 157| | (svr_ses.plugin_instance->api_version[1] < DROPBEAR_PLUGIN_VERSION_MINOR) ) { 158| | dropbear_exit("plugin version check failed: " 159| | "Dropbear=%d.%d, plugin=%d.%d", 160| | DROPBEAR_PLUGIN_VERSION_MAJOR, DROPBEAR_PLUGIN_VERSION_MINOR, 161| | svr_ses.plugin_instance->api_version[0], svr_ses.plugin_instance->api_version[1]); 162| | } 163| | if (svr_ses.plugin_instance->api_version[1] > DROPBEAR_PLUGIN_VERSION_MINOR) { 164| | dropbear_log(LOG_WARNING, "plugin API newer than dropbear API: " 165| | "Dropbear=%d.%d, plugin=%d.%d", 166| | DROPBEAR_PLUGIN_VERSION_MAJOR, DROPBEAR_PLUGIN_VERSION_MINOR, 167| | svr_ses.plugin_instance->api_version[0], svr_ses.plugin_instance->api_version[1]); 168| | } 169| | dropbear_log(LOG_INFO, "successfully loaded and initialized pubkey plugin '%s'", svr_opts.pubkey_plugin); 170| | } 171| |#endif 172| | 173| 2.84k| svr_authinitialise(); 174| 2.84k| chaninitialise(svr_chantypes); 175| 2.84k| svr_chansessinitialise(); 176| 2.84k| svr_algos_initialise(); 177| | 178| 2.84k| get_socket_address(ses.sock_in, NULL, NULL, 179| 2.84k| &svr_ses.remotehost, NULL, 1); 180| | 181| | /* set up messages etc */ 182| 2.84k| ses.remoteclosed = svr_remoteclosed; 183| 2.84k| ses.extra_session_cleanup = svr_session_cleanup; 184| | 185| | /* packet handlers */ 186| 2.84k| ses.packettypes = svr_packettypes; 187| | 188| 2.84k| ses.isserver = 1; 189| | 190| | /* We're ready to go now */ 191| 2.84k| ses.init_done = 1; 192| | 193| | /* exchange identification, version etc */ 194| 2.84k| send_session_identification(); 195| | 196| 2.84k| kexfirstinitialise(); /* initialise the kex state */ 197| | 198| | /* start off with key exchange */ 199| 2.84k| send_msg_kexinit(); 200| | 201| 2.84k|#if DROPBEAR_FUZZ 202| 2.84k| if (fuzz.fuzzing) { ------------------ | Branch (202:9): [True: 2.84k, False: 0] ------------------ 203| 2.84k| fuzz_svr_hook_preloop(); 204| 2.84k| } 205| 2.84k|#endif 206| | 207| | /* Run the main for-loop. */ 208| 2.84k| session_loop(svr_chansess_checksignal); 209| | 210| | /* Not reached */ 211| | 212| 2.84k|} svr_dropbear_exit: 215| 2.84k|void svr_dropbear_exit(int exitcode, const char* format, va_list param) { 216| 2.84k| char exitmsg[150]; 217| 2.84k| char fullmsg[300]; 218| 2.84k| char fromaddr[60]; 219| 2.84k| int i; 220| 2.84k| int add_delay = 0; 221| | 222| |#if DROPBEAR_PLUGIN 223| | if ((ses.plugin_session != NULL)) { 224| | svr_ses.plugin_instance->delete_session(ses.plugin_session); 225| | } 226| | ses.plugin_session = NULL; 227| | svr_opts.pubkey_plugin_options = NULL; 228| | m_free(svr_opts.pubkey_plugin); 229| |#endif 230| | 231| | /* Render the formatted exit message */ 232| 2.84k| vsnprintf(exitmsg, sizeof(exitmsg), format, param); 233| | 234| | /* svr_ses.addrstring may not be set for some early exits, or for 235| | the listener process */ 236| 2.84k| fromaddr[0] = '\0'; 237| 2.84k| if (svr_ses.addrstring) { ------------------ | Branch (237:6): [True: 2.84k, False: 0] ------------------ 238| 2.84k| snprintf(fromaddr, sizeof(fromaddr), " from <%s>", svr_ses.addrstring); 239| 2.84k| } 240| | 241| | /* Add the prefix depending on session/auth state */ 242| 2.84k| if (!ses.init_done) { ------------------ | Branch (242:6): [True: 0, False: 2.84k] ------------------ 243| | /* before session init */ 244| 0| snprintf(fullmsg, sizeof(fullmsg), "Early exit%s: %s", fromaddr, exitmsg); 245| 2.84k| } else if (ses.authstate.authdone) { ------------------ | Branch (245:13): [True: 0, False: 2.84k] ------------------ 246| | /* user has authenticated */ 247| 0| snprintf(fullmsg, sizeof(fullmsg), 248| 0| "Exit (%s)%s: %s", 249| 0| ses.authstate.pw_name, fromaddr, exitmsg); 250| 2.84k| } else if (ses.authstate.pw_name) { ------------------ | Branch (250:13): [True: 5, False: 2.83k] ------------------ 251| | /* we have a potential user */ 252| 5| snprintf(fullmsg, sizeof(fullmsg), 253| 5| "Exit before auth%s: (user '%s', %u fails): %s", 254| 5| fromaddr, ses.authstate.pw_name, ses.authstate.failcount, exitmsg); 255| 5| add_delay = 1; 256| 2.83k| } else { 257| | /* before userauth */ 258| 2.83k| snprintf(fullmsg, sizeof(fullmsg), "Exit before auth%s: %s", fromaddr, exitmsg); 259| 2.83k| add_delay = 1; 260| 2.83k| } 261| | 262| 2.84k| dropbear_log(LOG_INFO, "%s", fullmsg); 263| | 264| | /* To make it harder for attackers, introduce a delay to keep an 265| | * unauthenticated session open a bit longer, thus blocking a connection 266| | * slot until after the delay. Without this, while there is a limit on 267| | * the amount of attempts an attacker can make at the same time 268| | * (MAX_UNAUTH_PER_IP), the time taken by dropbear to handle one attempt 269| | * is still short and thus for each of the allowed parallel attempts 270| | * many attempts can be chained one after the other. The attempt rate is 271| | * then: 272| | * "MAX_UNAUTH_PER_IP / ". 273| | * With the delay, this rate becomes: 274| | * "MAX_UNAUTH_PER_IP / UNAUTH_CLOSE_DELAY". 275| | */ 276| 2.84k| if ((add_delay != 0) && (UNAUTH_CLOSE_DELAY > 0)) { ------------------ | | 499| 2.84k|#define UNAUTH_CLOSE_DELAY 0 ------------------ | Branch (276:6): [True: 2.84k, False: 0] | Branch (276:26): [Folded, False: 2.84k] ------------------ 277| 0| TRACE(("svr_dropbear_exit: start delay of %d seconds", UNAUTH_CLOSE_DELAY)); 278| 0| sleep(UNAUTH_CLOSE_DELAY); ------------------ | | 499| 0|#define UNAUTH_CLOSE_DELAY 0 ------------------ 279| 0| TRACE(("svr_dropbear_exit: end delay of %d seconds", UNAUTH_CLOSE_DELAY)); 280| 0| } 281| | 282| |#if DROPBEAR_VFORK 283| | /* For uclinux only the main server process should cleanup - we don't want 284| | * forked children doing that */ 285| | if (svr_ses.server_pid == getpid()) 286| |#endif 287| 2.84k| { 288| | /* must be after we've done with username etc */ 289| 2.84k| session_cleanup(); 290| 2.84k| } 291| | 292| 2.84k|#if DROPBEAR_FUZZ 293| | /* longjmp before cleaning up svr_opts */ 294| 2.84k| if (fuzz.do_jmp) { ------------------ | Branch (294:9): [True: 2.84k, False: 0] ------------------ 295| 2.84k| longjmp(fuzz.jmp, 1); 296| 2.84k| } 297| 0|#endif 298| | 299| 0| if (svr_opts.hostkey) { ------------------ | Branch (299:6): [True: 0, False: 0] ------------------ 300| 0| sign_key_free(svr_opts.hostkey); 301| 0| svr_opts.hostkey = NULL; 302| 0| } 303| 0| for (i = 0; i < DROPBEAR_MAX_PORTS; i++) { ------------------ | | 89| 0|#define DROPBEAR_MAX_PORTS 10 /* max number of ports which can be specified, ------------------ | Branch (303:14): [True: 0, False: 0] ------------------ 304| 0| m_free(svr_opts.addresses[i]); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 305| 0| m_free(svr_opts.ports[i]); ------------------ | | 24| 0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 0] | | ------------------ ------------------ 306| 0| } 307| | 308| | 309| 0| exit(exitcode); 310| | 311| 2.84k|} svr-session.c:svr_session_cleanup: 86| 2.84k|svr_session_cleanup(void) { 87| 2.84k| svr_pubkey_options_cleanup(ses.authstate.pubkey_options); 88| 2.84k| ses.authstate.pubkey_options = NULL; 89| | 90| 2.84k| m_free(svr_ses.addrstring); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 91| 2.84k| m_free(svr_ses.remotehost); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 92| 2.84k| m_free(svr_ses.childpids); ------------------ | | 24| 2.84k|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0) | | ------------------ | | | Branch (24:61): [Folded, False: 2.84k] | | ------------------ ------------------ 93| 2.84k| svr_ses.childpidsize = 0; 94| | 95| |#if DROPBEAR_PLUGIN 96| | if (svr_ses.plugin_handle != NULL) { 97| | if (svr_ses.plugin_instance) { 98| | svr_ses.plugin_instance->delete_plugin(svr_ses.plugin_instance); 99| | svr_ses.plugin_instance = NULL; 100| | } 101| | 102| | dlclose(svr_ses.plugin_handle); 103| | svr_ses.plugin_handle = NULL; 104| | } 105| |#endif 106| 2.84k|} svr-session.c:svr_remoteclosed: 351| 1.24k|static void svr_remoteclosed() { 352| | 353| 1.24k| m_close(ses.sock_in); 354| 1.24k| if (ses.sock_in != ses.sock_out) { ------------------ | Branch (354:6): [True: 0, False: 1.24k] ------------------ 355| 0| m_close(ses.sock_out); 356| 0| } 357| 1.24k| ses.sock_in = -1; 358| 1.24k| ses.sock_out = -1; 359| 1.24k| dropbear_close("Exited normally"); 360| | 361| 1.24k|} svr-session.c:svr_algos_initialise: 363| 2.84k|static void svr_algos_initialise(void) { 364| 2.84k| algo_type *algo; 365| 39.8k| for (algo = sshkex; algo->name; algo++) { ------------------ | Branch (365:22): [True: 36.9k, False: 2.84k] ------------------ 366| |#if DROPBEAR_DH_GROUP1 && DROPBEAR_DH_GROUP1_CLIENTONLY 367| | if (strcmp(algo->name, "diffie-hellman-group1-sha1") == 0) { 368| | algo->usable = 0; 369| | } 370| |#endif 371| 36.9k|#if DROPBEAR_EXT_INFO 372| 36.9k| if (strcmp(algo->name, SSH_EXT_INFO_C) == 0) { ------------------ | | 100| 36.9k|#define SSH_EXT_INFO_C "ext-info-c" ------------------ | Branch (372:7): [True: 2.84k, False: 34.1k] ------------------ 373| 2.84k| algo->usable = 0; 374| 2.84k| } 375| 36.9k|#endif 376| 36.9k| if (strcmp(algo->name, SSH_STRICT_KEX_C) == 0) { ------------------ | | 105| 36.9k|#define SSH_STRICT_KEX_C "kex-strict-c-v00@openssh.com" ------------------ | Branch (376:7): [True: 2.84k, False: 34.1k] ------------------ 377| 2.84k| algo->usable = 0; 378| 2.84k| } 379| 36.9k| } 380| 2.84k|}