fuzz_early_setup:
   23|      2|void fuzz_early_setup(void) {
   24|       |    /* Set stderr to point to normal stderr by default */
   25|       |    fuzz.fake_stderr = stderr;
   26|      2|}
fuzz_common_setup:
   28|      4|void fuzz_common_setup(void) {
   29|      4|	disallow_core();
   30|      4|    fuzz.fuzzing = 1;
   31|      4|    fuzz.wrapfds = 1;
   32|      4|    fuzz.do_jmp = 1;
   33|      4|    fuzz.input = m_malloc(sizeof(buffer));
   34|      4|    _dropbear_log = fuzz_dropbear_log;
   35|      4|    crypto_init();
   36|      4|    fuzz_seed("start", 5);
   37|       |    /* let any messages get flushed */
   38|      4|    setlinebuf(stdout);
   39|       |#if DEBUG_TRACE
   40|       |    if (debug_trace)
   41|       |    {
   42|       |        fprintf(stderr, "Dropbear fuzzer: -v specified, not disabling stderr output\n");
   43|       |    }
   44|       |    else
   45|       |#endif
   46|      4|    if (getenv("DROPBEAR_KEEP_STDERR")) {
  ------------------
  |  Branch (46:9): [True: 0, False: 4]
  ------------------
   47|      0|        fprintf(stderr, "Dropbear fuzzer: DROPBEAR_KEEP_STDERR, not disabling stderr output\n");
   48|      0|    } 
   49|      4|    else 
   50|      4|    {
   51|      4|        fprintf(stderr, "Dropbear fuzzer: Disabling stderr output\n");
   52|      4|        fuzz.fake_stderr = fopen("/dev/null", "w");
   53|       |        assert(fuzz.fake_stderr);
  ------------------
  |  Branch (53:9): [True: 0, False: 4]
  |  Branch (53:9): [True: 4, False: 0]
  ------------------
   54|      4|    }
   55|      4|}
fuzz_set_input:
   57|    169|int fuzz_set_input(const uint8_t *Data, size_t Size) {
   58|       |
   59|    169|    fuzz.input->data = (unsigned char*)Data;
   60|    169|    fuzz.input->size = Size;
   61|    169|    fuzz.input->len = Size;
   62|    169|    fuzz.input->pos = 0;
   63|       |
   64|    169|    memset(&ses, 0x0, sizeof(ses));
   65|    169|    memset(&svr_ses, 0x0, sizeof(svr_ses));
   66|    169|    memset(&cli_ses, 0x0, sizeof(cli_ses));
   67|    169|    wrapfd_setup(fuzz.input);
   68|       |    // printhex("input", fuzz.input->data, fuzz.input->len);
   69|       |
   70|    169|    fuzz_seed(fuzz.input->data, MIN(fuzz.input->len, 16));
  ------------------
  |  Branch (70:33): [True: 90, False: 79]
  ------------------
   71|       |
   72|    169|    return DROPBEAR_SUCCESS;
  ------------------
  |  |  111|    169|#define DROPBEAR_SUCCESS 0
  ------------------
   73|    169|}
fuzz_cli_setup:
  112|      2|void fuzz_cli_setup(void) {
  113|      2|    fuzz_common_setup();
  114|       |    
  115|      2|	_dropbear_exit = cli_dropbear_exit;
  116|      2|	_dropbear_log = cli_dropbear_log;
  117|       |
  118|      2|    char *argv[] = { 
  119|      2|		"dbclient",
  120|      2|		"-y",
  121|      2|        "localhost",
  122|      2|        "uptime"
  123|      2|    };
  124|       |
  125|      2|    int argc = sizeof(argv) / sizeof(*argv);
  126|      2|    cli_getopts(argc, argv);
  127|       |
  128|      2|    load_fixed_client_key();
  129|       |    /* Avoid password prompt */
  130|      2|    setenv(DROPBEAR_PASSWORD_ENV, "password", 1);
  ------------------
  |  |  114|      2|#define DROPBEAR_PASSWORD_ENV "DROPBEAR_PASSWORD"
  ------------------
  131|      2|}
fuzz_get_algo:
  335|      2|const void* fuzz_get_algo(const algo_type *algos, const char* name) {
  336|      2|    const algo_type *t;
  337|      2|    for (t = algos; t->name; t++) {
  ------------------
  |  Branch (337:21): [True: 2, False: 0]
  ------------------
  338|      2|        if (strcmp(t->name, name) == 0) {
  ------------------
  |  Branch (338:13): [True: 2, False: 0]
  ------------------
  339|      2|            return t->data;
  340|      2|        }
  341|      2|    }
  342|      2|    assert(0);
  ------------------
  |  Branch (342:5): [Folded, False: 0]
  |  Branch (342:5): [Folded, False: 0]
  ------------------
  343|      0|}
fuzz_getpwuid:
  386|      2|struct passwd* fuzz_getpwuid(uid_t uid) {
  387|      2|    if (!fuzz.fuzzing) {
  ------------------
  |  Branch (387:9): [True: 0, False: 2]
  ------------------
  388|      0|        return getpwuid(uid);
  389|      0|    }
  390|      2|    if (uid == pwd_other.pw_uid) {
  ------------------
  |  Branch (390:9): [True: 0, False: 2]
  ------------------
  391|      0|        return &pwd_other;
  392|      0|    }
  393|      2|    if (uid == pwd_root.pw_uid) {
  ------------------
  |  Branch (393:9): [True: 2, False: 0]
  ------------------
  394|      2|        return &pwd_root;
  395|      2|    }
  396|      0|    return NULL;
  397|      2|}
fuzz-common.c:load_fixed_client_key:
  135|      2|static void load_fixed_client_key(void) {
  136|       |
  137|      2|    buffer *b = buf_new(3000);
  138|      2|    sign_key *key;
  139|      2|    enum signkey_type keytype;
  140|       |
  141|      2|    key = new_sign_key();
  142|      2|    keytype = DROPBEAR_SIGNKEY_ANY;
  143|      2|    buf_putbytes(b, keyed25519, keyed25519_len);
  144|      2|    buf_setpos(b, 0);
  145|      2|    if (buf_get_priv_key(b, key, &keytype) == DROPBEAR_FAILURE) {
  ------------------
  |  |  112|      2|#define DROPBEAR_FAILURE -1
  ------------------
  |  Branch (145:9): [True: 0, False: 2]
  ------------------
  146|      0|        dropbear_exit("failed fixed ed25519 hostkey");
  147|      0|    }
  148|      2|    list_append(cli_opts.privkeys, key);
  149|       |
  150|      2|    buf_free(b);
  151|      2|}

wrapfd_setup:
   32|    169|void wrapfd_setup(buffer *buf) {
   33|    169|	TRACE(("wrapfd_setup"))
   34|       |
   35|       |	// clean old ones
   36|    169|	int i;
   37|    169|	for (i = 0; i <= wrapfd_maxfd; i++) {
  ------------------
  |  Branch (37:14): [True: 0, False: 169]
  ------------------
   38|      0|		if (wrap_fds[i].mode != UNUSED) {
  ------------------
  |  Branch (38:7): [True: 0, False: 0]
  ------------------
   39|      0|			wrapfd_remove(i);
   40|      0|		}
   41|      0|	}
   42|    169|	wrapfd_maxfd = -1;
   43|       |
   44|    169|	memset(rand_state, 0x0, sizeof(rand_state));
   45|    169|	wrapfd_setseed(50);
   46|    169|	input_buf = buf;
   47|    169|}
wrapfd_setseed:
   49|    169|void wrapfd_setseed(uint32_t seed) {
   50|    169|	memcpy(rand_state, &seed, sizeof(seed));
   51|    169|	nrand48(rand_state);
   52|    169|}

fuzzer-kexsntrup-cli.c:setup:
   11|      2|static void setup() {
   12|      2|	fuzz_common_setup();
   13|      2|	fuzz_cli_setup();
   14|       |
   15|      2|	keep_newkeys = (struct key_context*)m_malloc(sizeof(struct key_context));
   16|      2|	keep_newkeys->algo_kex = fuzz_get_algo(sshkex, "sntrup761x25519-sha512");
   17|      2|}
LLVMFuzzerTestOneInput:
   19|    169|int LLVMFuzzerTestOneInput(const uint8_t *Data, size_t Size) {
   20|    169|	if (fuzz_set_input(Data, Size) == DROPBEAR_FAILURE) {
  ------------------
  |  |  112|    169|#define DROPBEAR_FAILURE -1
  ------------------
  |  Branch (20:6): [True: 0, False: 169]
  ------------------
   21|      0|		return 0;
   22|      0|	}
   23|       |
   24|    169|	m_malloc_set_epoch(1);
   25|       |
   26|    169|	if (setjmp(fuzz.jmp) == 0) {
  ------------------
  |  Branch (26:6): [True: 169, False: 0]
  ------------------
   27|       |		/* Arbitrary key to write into a buffer */
   28|    169|		sign_key *hostkey = cli_opts.privkeys->first->item;
   29|    169|		ses.newkeys = keep_newkeys;
   30|       |
   31|    169|		struct kex_pqhybrid_param *param = gen_kexpqhybrid_param();
   32|       |
   33|    169|		buffer * q_s = buf_getstringbuf(fuzz.input);
   34|       |
   35|    169|		ses.kexhashbuf = buf_new(KEXHASHBUF_MAX_INTS);
  ------------------
  |  |  290|    169|#define KEXHASHBUF_MAX_INTS (MAX_PUBKEY_SIZE + MAX_KEX_PARTS)
  |  |  ------------------
  |  |  |  |  261|    169|#define MAX_PUBKEY_SIZE 600
  |  |  ------------------
  |  |               #define KEXHASHBUF_MAX_INTS (MAX_PUBKEY_SIZE + MAX_KEX_PARTS)
  |  |  ------------------
  |  |  |  |  274|    169|#define MAX_KEX_PARTS (2*4 + 1184 + 1088 + 32*2 + 68)
  |  |  ------------------
  ------------------
   36|    169|		kexpqhybrid_comb_key(param, q_s, hostkey);
   37|       |
   38|    169|		free_kexpqhybrid_param(param);
   39|       |
   40|    169|		buf_free(ses.dh_K_bytes);
   41|    169|		buf_free(q_s);
   42|       |
   43|    169|		buf_free(ses.hash);
   44|    169|		buf_free(ses.session_id);
   45|       |		/* kexhashbuf is freed in kexpqhybrid_comb_key */
   46|       |
   47|    169|		m_malloc_free_epoch(1, 0);
   48|    169|	} else {
   49|      0|		m_malloc_free_epoch(1, 1);
   50|      0|		TRACE(("dropbear_exit longjmped"))
   51|       |		/* dropbear_exit jumped here */
   52|      0|	}
   53|       |
   54|    169|	return 0;
   55|    169|}

sha256_init:
  205|   258k|{
  206|   258k|    LTC_ARGCHK(md != NULL);
  ------------------
  |  |   32|   258k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
  |  |  ------------------
  |  |  |  Branch (32:32): [True: 0, False: 258k]
  |  |  |  Branch (32:87): [Folded, False: 258k]
  |  |  ------------------
  ------------------
  207|       |
  208|   258k|    md->sha256.curlen = 0;
  209|   258k|    md->sha256.length = 0;
  210|   258k|    md->sha256.state[0] = 0x6A09E667UL;
  211|   258k|    md->sha256.state[1] = 0xBB67AE85UL;
  212|   258k|    md->sha256.state[2] = 0x3C6EF372UL;
  213|   258k|    md->sha256.state[3] = 0xA54FF53AUL;
  214|   258k|    md->sha256.state[4] = 0x510E527FUL;
  215|   258k|    md->sha256.state[5] = 0x9B05688CUL;
  216|   258k|    md->sha256.state[6] = 0x1F83D9ABUL;
  217|   258k|    md->sha256.state[7] = 0x5BE0CD19UL;
  218|   258k|    return CRYPT_OK;
  219|   258k|}
sha256_done:
  237|   258k|{
  238|   258k|    int i;
  239|       |
  240|   258k|    LTC_ARGCHK(md  != NULL);
  ------------------
  |  |   32|   258k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
  |  |  ------------------
  |  |  |  Branch (32:32): [True: 0, False: 258k]
  |  |  |  Branch (32:87): [Folded, False: 258k]
  |  |  ------------------
  ------------------
  241|   258k|    LTC_ARGCHK(out != NULL);
  ------------------
  |  |   32|   258k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
  |  |  ------------------
  |  |  |  Branch (32:32): [True: 0, False: 258k]
  |  |  |  Branch (32:87): [Folded, False: 258k]
  |  |  ------------------
  ------------------
  242|       |
  243|   258k|    if (md->sha256.curlen >= sizeof(md->sha256.buf)) {
  ------------------
  |  Branch (243:9): [True: 0, False: 258k]
  ------------------
  244|      0|       return CRYPT_INVALID_ARG;
  245|      0|    }
  246|       |
  247|       |
  248|       |    /* increase the length of the message */
  249|   258k|    md->sha256.length += md->sha256.curlen * 8;
  250|       |
  251|       |    /* append the '1' bit */
  252|   258k|    md->sha256.buf[md->sha256.curlen++] = (unsigned char)0x80;
  253|       |
  254|       |    /* if the length is currently above 56 bytes we append zeros
  255|       |     * then compress.  Then we can fall back to padding zeros and length
  256|       |     * encoding like normal.
  257|       |     */
  258|   258k|    if (md->sha256.curlen > 56) {
  ------------------
  |  Branch (258:9): [True: 0, False: 258k]
  ------------------
  259|      0|        while (md->sha256.curlen < 64) {
  ------------------
  |  Branch (259:16): [True: 0, False: 0]
  ------------------
  260|      0|            md->sha256.buf[md->sha256.curlen++] = (unsigned char)0;
  261|      0|        }
  262|      0|        sha256_compress(md, md->sha256.buf);
  263|      0|        md->sha256.curlen = 0;
  264|      0|    }
  265|       |
  266|       |    /* pad upto 56 bytes of zeroes */
  267|  5.17M|    while (md->sha256.curlen < 56) {
  ------------------
  |  Branch (267:12): [True: 4.91M, False: 258k]
  ------------------
  268|  4.91M|        md->sha256.buf[md->sha256.curlen++] = (unsigned char)0;
  269|  4.91M|    }
  270|       |
  271|       |    /* store length */
  272|   258k|    STORE64H(md->sha256.length, md->sha256.buf+56);
  ------------------
  |  |  101|   258k|#define STORE64H(x, y)                          \
  |  |  102|   258k|do { ulong64 __t = __builtin_bswap64 ((x));     \
  |  |  103|   258k|      XMEMCPY ((y), &__t, 8); } while(0)
  |  |  ------------------
  |  |  |  |   39|   258k|#define XMEMCPY  memcpy
  |  |  ------------------
  |  |  |  Branch (103:39): [Folded, False: 258k]
  |  |  ------------------
  ------------------
  273|   258k|    sha256_compress(md, md->sha256.buf);
  274|       |
  275|       |    /* copy output */
  276|  2.32M|    for (i = 0; i < 8; i++) {
  ------------------
  |  Branch (276:17): [True: 2.06M, False: 258k]
  ------------------
  277|  2.06M|        STORE32H(md->sha256.state[i], out+(4*i));
  ------------------
  |  |   62|  2.06M|#define STORE32H(x, y)                          \
  |  |   63|  2.06M|do { ulong32 __t = __builtin_bswap32 ((x));     \
  |  |   64|  2.06M|      XMEMCPY ((y), &__t, 4); } while(0)
  |  |  ------------------
  |  |  |  |   39|  2.06M|#define XMEMCPY  memcpy
  |  |  ------------------
  |  |  |  Branch (64:39): [Folded, False: 2.06M]
  |  |  ------------------
  ------------------
  278|  2.06M|    }
  279|       |#ifdef LTC_CLEAN_STACK
  280|       |    zeromem(md, sizeof(hash_state));
  281|       |#endif
  282|   258k|    return CRYPT_OK;
  283|   258k|}
sha256.c:sha256_compress:
   71|   258k|{
   72|   258k|    ulong32 S[8], W[64], t0, t1;
   73|   258k|#ifdef LTC_SMALL_CODE
   74|   258k|    ulong32 t;
   75|   258k|#endif
   76|   258k|    int i;
   77|       |
   78|       |    /* copy state into S */
   79|  2.32M|    for (i = 0; i < 8; i++) {
  ------------------
  |  Branch (79:17): [True: 2.06M, False: 258k]
  ------------------
   80|  2.06M|        S[i] = md->sha256.state[i];
   81|  2.06M|    }
   82|       |
   83|       |    /* copy the state into 512-bits into W[0..15] */
   84|  4.39M|    for (i = 0; i < 16; i++) {
  ------------------
  |  Branch (84:17): [True: 4.13M, False: 258k]
  ------------------
   85|  4.13M|        LOAD32H(W[i], buf + (4*i));
  ------------------
  |  |   66|  4.13M|#define LOAD32H(x, y)                           \
  |  |   67|  4.13M|do { XMEMCPY (&(x), (y), 4);                    \
  |  |  ------------------
  |  |  |  |   39|  4.13M|#define XMEMCPY  memcpy
  |  |  ------------------
  |  |   68|  4.13M|      (x) = __builtin_bswap32 ((x)); } while(0)
  |  |  ------------------
  |  |  |  Branch (68:46): [Folded, False: 4.13M]
  |  |  ------------------
  ------------------
   86|  4.13M|    }
   87|       |
   88|       |    /* fill W[16..63] */
   89|  12.6M|    for (i = 16; i < 64; i++) {
  ------------------
  |  Branch (89:18): [True: 12.4M, False: 258k]
  ------------------
   90|  12.4M|        W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16];
  ------------------
  |  |   63|  12.4M|#define Gamma1(x)       (S(x, 17) ^ S(x, 19) ^ R(x, 10))
  |  |  ------------------
  |  |  |  |   58|  12.4M|#define S(x, n)         RORc((x),(n))
  |  |  |  |  ------------------
  |  |  |  |  |  |  283|  12.4M|#define RORc(word,i) ({ \
  |  |  |  |  |  |  284|  12.4M|   ulong32 __RORc_tmp = (word); \
  |  |  |  |  |  |  285|  12.4M|   __asm__ ("rorl %2, %0" : \
  |  |  |  |  |  |  286|  12.4M|            "=r" (__RORc_tmp) : \
  |  |  |  |  |  |  287|  12.4M|            "0" (__RORc_tmp), \
  |  |  |  |  |  |  288|  12.4M|            "I" (i)); \
  |  |  |  |  |  |  289|  12.4M|            __RORc_tmp; \
  |  |  |  |  |  |  290|  12.4M|   })
  |  |  |  |  ------------------
  |  |  ------------------
  |  |               #define Gamma1(x)       (S(x, 17) ^ S(x, 19) ^ R(x, 10))
  |  |  ------------------
  |  |  |  |   58|  12.4M|#define S(x, n)         RORc((x),(n))
  |  |  |  |  ------------------
  |  |  |  |  |  |  283|  12.4M|#define RORc(word,i) ({ \
  |  |  |  |  |  |  284|  12.4M|   ulong32 __RORc_tmp = (word); \
  |  |  |  |  |  |  285|  12.4M|   __asm__ ("rorl %2, %0" : \
  |  |  |  |  |  |  286|  12.4M|            "=r" (__RORc_tmp) : \
  |  |  |  |  |  |  287|  12.4M|            "0" (__RORc_tmp), \
  |  |  |  |  |  |  288|  12.4M|            "I" (i)); \
  |  |  |  |  |  |  289|  12.4M|            __RORc_tmp; \
  |  |  |  |  |  |  290|  12.4M|   })
  |  |  |  |  ------------------
  |  |  ------------------
  |  |               #define Gamma1(x)       (S(x, 17) ^ S(x, 19) ^ R(x, 10))
  |  |  ------------------
  |  |  |  |   59|  12.4M|#define R(x, n)         (((x)&0xFFFFFFFFUL)>>(n))
  |  |  ------------------
  ------------------
                      W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16];
  ------------------
  |  |   62|  12.4M|#define Gamma0(x)       (S(x, 7) ^ S(x, 18) ^ R(x, 3))
  |  |  ------------------
  |  |  |  |   58|  12.4M|#define S(x, n)         RORc((x),(n))
  |  |  |  |  ------------------
  |  |  |  |  |  |  283|  12.4M|#define RORc(word,i) ({ \
  |  |  |  |  |  |  284|  12.4M|   ulong32 __RORc_tmp = (word); \
  |  |  |  |  |  |  285|  12.4M|   __asm__ ("rorl %2, %0" : \
  |  |  |  |  |  |  286|  12.4M|            "=r" (__RORc_tmp) : \
  |  |  |  |  |  |  287|  12.4M|            "0" (__RORc_tmp), \
  |  |  |  |  |  |  288|  12.4M|            "I" (i)); \
  |  |  |  |  |  |  289|  12.4M|            __RORc_tmp; \
  |  |  |  |  |  |  290|  12.4M|   })
  |  |  |  |  ------------------
  |  |  ------------------
  |  |               #define Gamma0(x)       (S(x, 7) ^ S(x, 18) ^ R(x, 3))
  |  |  ------------------
  |  |  |  |   58|  12.4M|#define S(x, n)         RORc((x),(n))
  |  |  |  |  ------------------
  |  |  |  |  |  |  283|  12.4M|#define RORc(word,i) ({ \
  |  |  |  |  |  |  284|  12.4M|   ulong32 __RORc_tmp = (word); \
  |  |  |  |  |  |  285|  12.4M|   __asm__ ("rorl %2, %0" : \
  |  |  |  |  |  |  286|  12.4M|            "=r" (__RORc_tmp) : \
  |  |  |  |  |  |  287|  12.4M|            "0" (__RORc_tmp), \
  |  |  |  |  |  |  288|  12.4M|            "I" (i)); \
  |  |  |  |  |  |  289|  12.4M|            __RORc_tmp; \
  |  |  |  |  |  |  290|  12.4M|   })
  |  |  |  |  ------------------
  |  |  ------------------
  |  |               #define Gamma0(x)       (S(x, 7) ^ S(x, 18) ^ R(x, 3))
  |  |  ------------------
  |  |  |  |   59|  12.4M|#define R(x, n)         (((x)&0xFFFFFFFFUL)>>(n))
  |  |  ------------------
  ------------------
   91|  12.4M|    }
   92|       |
   93|       |    /* Compress */
   94|   258k|#ifdef LTC_SMALL_CODE
   95|   258k|#define RND(a,b,c,d,e,f,g,h,i)                         \
   96|   258k|     t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i];   \
   97|   258k|     t1 = Sigma0(a) + Maj(a, b, c);                    \
   98|   258k|     d += t0;                                          \
   99|   258k|     h  = t0 + t1;
  100|       |
  101|  16.8M|     for (i = 0; i < 64; ++i) {
  ------------------
  |  Branch (101:18): [True: 16.5M, False: 258k]
  ------------------
  102|  16.5M|         RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i);
  ------------------
  |  |   96|  16.5M|     t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i];   \
  |  |  ------------------
  |  |  |  |   61|  16.5M|#define Sigma1(x)       (S(x, 6) ^ S(x, 11) ^ S(x, 25))
  |  |  |  |  ------------------
  |  |  |  |  |  |   58|  16.5M|#define S(x, n)         RORc((x),(n))
  |  |  |  |  |  |  ------------------
  |  |  |  |  |  |  |  |  283|  16.5M|#define RORc(word,i) ({ \
  |  |  |  |  |  |  |  |  284|  16.5M|   ulong32 __RORc_tmp = (word); \
  |  |  |  |  |  |  |  |  285|  16.5M|   __asm__ ("rorl %2, %0" : \
  |  |  |  |  |  |  |  |  286|  16.5M|            "=r" (__RORc_tmp) : \
  |  |  |  |  |  |  |  |  287|  16.5M|            "0" (__RORc_tmp), \
  |  |  |  |  |  |  |  |  288|  16.5M|            "I" (i)); \
  |  |  |  |  |  |  |  |  289|  16.5M|            __RORc_tmp; \
  |  |  |  |  |  |  |  |  290|  16.5M|   })
  |  |  |  |  |  |  ------------------
  |  |  |  |  ------------------
  |  |  |  |               #define Sigma1(x)       (S(x, 6) ^ S(x, 11) ^ S(x, 25))
  |  |  |  |  ------------------
  |  |  |  |  |  |   58|  16.5M|#define S(x, n)         RORc((x),(n))
  |  |  |  |  |  |  ------------------
  |  |  |  |  |  |  |  |  283|  16.5M|#define RORc(word,i) ({ \
  |  |  |  |  |  |  |  |  284|  16.5M|   ulong32 __RORc_tmp = (word); \
  |  |  |  |  |  |  |  |  285|  16.5M|   __asm__ ("rorl %2, %0" : \
  |  |  |  |  |  |  |  |  286|  16.5M|            "=r" (__RORc_tmp) : \
  |  |  |  |  |  |  |  |  287|  16.5M|            "0" (__RORc_tmp), \
  |  |  |  |  |  |  |  |  288|  16.5M|            "I" (i)); \
  |  |  |  |  |  |  |  |  289|  16.5M|            __RORc_tmp; \
  |  |  |  |  |  |  |  |  290|  16.5M|   })
  |  |  |  |  |  |  ------------------
  |  |  |  |  ------------------
  |  |  |  |               #define Sigma1(x)       (S(x, 6) ^ S(x, 11) ^ S(x, 25))
  |  |  |  |  ------------------
  |  |  |  |  |  |   58|  16.5M|#define S(x, n)         RORc((x),(n))
  |  |  |  |  |  |  ------------------
  |  |  |  |  |  |  |  |  283|  16.5M|#define RORc(word,i) ({ \
  |  |  |  |  |  |  |  |  284|  16.5M|   ulong32 __RORc_tmp = (word); \
  |  |  |  |  |  |  |  |  285|  16.5M|   __asm__ ("rorl %2, %0" : \
  |  |  |  |  |  |  |  |  286|  16.5M|            "=r" (__RORc_tmp) : \
  |  |  |  |  |  |  |  |  287|  16.5M|            "0" (__RORc_tmp), \
  |  |  |  |  |  |  |  |  288|  16.5M|            "I" (i)); \
  |  |  |  |  |  |  |  |  289|  16.5M|            __RORc_tmp; \
  |  |  |  |  |  |  |  |  290|  16.5M|   })
  |  |  |  |  |  |  ------------------
  |  |  |  |  ------------------
  |  |  ------------------
  |  |                    t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i];   \
  |  |  ------------------
  |  |  |  |   56|  16.5M|#define Ch(x,y,z)       (z ^ (x & (y ^ z)))
  |  |  ------------------
  |  |   97|  16.5M|     t1 = Sigma0(a) + Maj(a, b, c);                    \
  |  |  ------------------
  |  |  |  |   60|  16.5M|#define Sigma0(x)       (S(x, 2) ^ S(x, 13) ^ S(x, 22))
  |  |  |  |  ------------------
  |  |  |  |  |  |   58|  16.5M|#define S(x, n)         RORc((x),(n))
  |  |  |  |  |  |  ------------------
  |  |  |  |  |  |  |  |  283|  16.5M|#define RORc(word,i) ({ \
  |  |  |  |  |  |  |  |  284|  16.5M|   ulong32 __RORc_tmp = (word); \
  |  |  |  |  |  |  |  |  285|  16.5M|   __asm__ ("rorl %2, %0" : \
  |  |  |  |  |  |  |  |  286|  16.5M|            "=r" (__RORc_tmp) : \
  |  |  |  |  |  |  |  |  287|  16.5M|            "0" (__RORc_tmp), \
  |  |  |  |  |  |  |  |  288|  16.5M|            "I" (i)); \
  |  |  |  |  |  |  |  |  289|  16.5M|            __RORc_tmp; \
  |  |  |  |  |  |  |  |  290|  16.5M|   })
  |  |  |  |  |  |  ------------------
  |  |  |  |  ------------------
  |  |  |  |               #define Sigma0(x)       (S(x, 2) ^ S(x, 13) ^ S(x, 22))
  |  |  |  |  ------------------
  |  |  |  |  |  |   58|  16.5M|#define S(x, n)         RORc((x),(n))
  |  |  |  |  |  |  ------------------
  |  |  |  |  |  |  |  |  283|  16.5M|#define RORc(word,i) ({ \
  |  |  |  |  |  |  |  |  284|  16.5M|   ulong32 __RORc_tmp = (word); \
  |  |  |  |  |  |  |  |  285|  16.5M|   __asm__ ("rorl %2, %0" : \
  |  |  |  |  |  |  |  |  286|  16.5M|            "=r" (__RORc_tmp) : \
  |  |  |  |  |  |  |  |  287|  16.5M|            "0" (__RORc_tmp), \
  |  |  |  |  |  |  |  |  288|  16.5M|            "I" (i)); \
  |  |  |  |  |  |  |  |  289|  16.5M|            __RORc_tmp; \
  |  |  |  |  |  |  |  |  290|  16.5M|   })
  |  |  |  |  |  |  ------------------
  |  |  |  |  ------------------
  |  |  |  |               #define Sigma0(x)       (S(x, 2) ^ S(x, 13) ^ S(x, 22))
  |  |  |  |  ------------------
  |  |  |  |  |  |   58|  16.5M|#define S(x, n)         RORc((x),(n))
  |  |  |  |  |  |  ------------------
  |  |  |  |  |  |  |  |  283|  16.5M|#define RORc(word,i) ({ \
  |  |  |  |  |  |  |  |  284|  16.5M|   ulong32 __RORc_tmp = (word); \
  |  |  |  |  |  |  |  |  285|  16.5M|   __asm__ ("rorl %2, %0" : \
  |  |  |  |  |  |  |  |  286|  16.5M|            "=r" (__RORc_tmp) : \
  |  |  |  |  |  |  |  |  287|  16.5M|            "0" (__RORc_tmp), \
  |  |  |  |  |  |  |  |  288|  16.5M|            "I" (i)); \
  |  |  |  |  |  |  |  |  289|  16.5M|            __RORc_tmp; \
  |  |  |  |  |  |  |  |  290|  16.5M|   })
  |  |  |  |  |  |  ------------------
  |  |  |  |  ------------------
  |  |  ------------------
  |  |                    t1 = Sigma0(a) + Maj(a, b, c);                    \
  |  |  ------------------
  |  |  |  |   57|  16.5M|#define Maj(x,y,z)      (((x | y) & z) | (x & y))
  |  |  ------------------
  |  |   98|  16.5M|     d += t0;                                          \
  |  |   99|  16.5M|     h  = t0 + t1;
  ------------------
  103|  16.5M|         t = S[7]; S[7] = S[6]; S[6] = S[5]; S[5] = S[4];
  104|  16.5M|         S[4] = S[3]; S[3] = S[2]; S[2] = S[1]; S[1] = S[0]; S[0] = t;
  105|  16.5M|     }
  106|       |#else
  107|       |#define RND(a,b,c,d,e,f,g,h,i,ki)                    \
  108|       |     t0 = h + Sigma1(e) + Ch(e, f, g) + ki + W[i];   \
  109|       |     t1 = Sigma0(a) + Maj(a, b, c);                  \
  110|       |     d += t0;                                        \
  111|       |     h  = t0 + t1;
  112|       |
  113|       |    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],0,0x428a2f98);
  114|       |    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],1,0x71374491);
  115|       |    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],2,0xb5c0fbcf);
  116|       |    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],3,0xe9b5dba5);
  117|       |    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],4,0x3956c25b);
  118|       |    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],5,0x59f111f1);
  119|       |    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],6,0x923f82a4);
  120|       |    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],7,0xab1c5ed5);
  121|       |    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],8,0xd807aa98);
  122|       |    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],9,0x12835b01);
  123|       |    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],10,0x243185be);
  124|       |    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],11,0x550c7dc3);
  125|       |    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],12,0x72be5d74);
  126|       |    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],13,0x80deb1fe);
  127|       |    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],14,0x9bdc06a7);
  128|       |    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],15,0xc19bf174);
  129|       |    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],16,0xe49b69c1);
  130|       |    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],17,0xefbe4786);
  131|       |    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],18,0x0fc19dc6);
  132|       |    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],19,0x240ca1cc);
  133|       |    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],20,0x2de92c6f);
  134|       |    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],21,0x4a7484aa);
  135|       |    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],22,0x5cb0a9dc);
  136|       |    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],23,0x76f988da);
  137|       |    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],24,0x983e5152);
  138|       |    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],25,0xa831c66d);
  139|       |    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],26,0xb00327c8);
  140|       |    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],27,0xbf597fc7);
  141|       |    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],28,0xc6e00bf3);
  142|       |    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],29,0xd5a79147);
  143|       |    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],30,0x06ca6351);
  144|       |    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],31,0x14292967);
  145|       |    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],32,0x27b70a85);
  146|       |    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],33,0x2e1b2138);
  147|       |    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],34,0x4d2c6dfc);
  148|       |    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],35,0x53380d13);
  149|       |    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],36,0x650a7354);
  150|       |    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],37,0x766a0abb);
  151|       |    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],38,0x81c2c92e);
  152|       |    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],39,0x92722c85);
  153|       |    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],40,0xa2bfe8a1);
  154|       |    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],41,0xa81a664b);
  155|       |    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],42,0xc24b8b70);
  156|       |    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],43,0xc76c51a3);
  157|       |    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],44,0xd192e819);
  158|       |    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],45,0xd6990624);
  159|       |    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],46,0xf40e3585);
  160|       |    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],47,0x106aa070);
  161|       |    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],48,0x19a4c116);
  162|       |    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],49,0x1e376c08);
  163|       |    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],50,0x2748774c);
  164|       |    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],51,0x34b0bcb5);
  165|       |    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],52,0x391c0cb3);
  166|       |    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],53,0x4ed8aa4a);
  167|       |    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],54,0x5b9cca4f);
  168|       |    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],55,0x682e6ff3);
  169|       |    RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],56,0x748f82ee);
  170|       |    RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],57,0x78a5636f);
  171|       |    RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],58,0x84c87814);
  172|       |    RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],59,0x8cc70208);
  173|       |    RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],60,0x90befffa);
  174|       |    RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],61,0xa4506ceb);
  175|       |    RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],62,0xbef9a3f7);
  176|       |    RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],63,0xc67178f2);
  177|       |
  178|       |#undef RND
  179|       |
  180|       |#endif
  181|       |
  182|       |    /* feedback */
  183|  2.32M|    for (i = 0; i < 8; i++) {
  ------------------
  |  Branch (183:17): [True: 2.06M, False: 258k]
  ------------------
  184|  2.06M|        md->sha256.state[i] = md->sha256.state[i] + S[i];
  185|  2.06M|    }
  186|   258k|    return CRYPT_OK;
  187|   258k|}

sha512_init:
  174|    198|{
  175|    198|    LTC_ARGCHK(md != NULL);
  ------------------
  |  |   32|    198|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
  |  |  ------------------
  |  |  |  Branch (32:32): [True: 0, False: 198]
  |  |  |  Branch (32:87): [Folded, False: 198]
  |  |  ------------------
  ------------------
  176|    198|    md->sha512.curlen = 0;
  177|    198|    md->sha512.length = 0;
  178|    198|    md->sha512.state[0] = CONST64(0x6a09e667f3bcc908);
  ------------------
  |  |  200|    198|   #define CONST64(n) n ## ULL
  ------------------
  179|    198|    md->sha512.state[1] = CONST64(0xbb67ae8584caa73b);
  ------------------
  |  |  200|    198|   #define CONST64(n) n ## ULL
  ------------------
  180|    198|    md->sha512.state[2] = CONST64(0x3c6ef372fe94f82b);
  ------------------
  |  |  200|    198|   #define CONST64(n) n ## ULL
  ------------------
  181|    198|    md->sha512.state[3] = CONST64(0xa54ff53a5f1d36f1);
  ------------------
  |  |  200|    198|   #define CONST64(n) n ## ULL
  ------------------
  182|    198|    md->sha512.state[4] = CONST64(0x510e527fade682d1);
  ------------------
  |  |  200|    198|   #define CONST64(n) n ## ULL
  ------------------
  183|    198|    md->sha512.state[5] = CONST64(0x9b05688c2b3e6c1f);
  ------------------
  |  |  200|    198|   #define CONST64(n) n ## ULL
  ------------------
  184|    198|    md->sha512.state[6] = CONST64(0x1f83d9abfb41bd6b);
  ------------------
  |  |  200|    198|   #define CONST64(n) n ## ULL
  ------------------
  185|    198|    md->sha512.state[7] = CONST64(0x5be0cd19137e2179);
  ------------------
  |  |  200|    198|   #define CONST64(n) n ## ULL
  ------------------
  186|    198|    return CRYPT_OK;
  187|    198|}
sha512_done:
  205|    198|{
  206|    198|    int i;
  207|       |
  208|    198|    LTC_ARGCHK(md  != NULL);
  ------------------
  |  |   32|    198|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
  |  |  ------------------
  |  |  |  Branch (32:32): [True: 0, False: 198]
  |  |  |  Branch (32:87): [Folded, False: 198]
  |  |  ------------------
  ------------------
  209|    198|    LTC_ARGCHK(out != NULL);
  ------------------
  |  |   32|    198|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
  |  |  ------------------
  |  |  |  Branch (32:32): [True: 0, False: 198]
  |  |  |  Branch (32:87): [Folded, False: 198]
  |  |  ------------------
  ------------------
  210|       |
  211|    198|    if (md->sha512.curlen >= sizeof(md->sha512.buf)) {
  ------------------
  |  Branch (211:9): [True: 0, False: 198]
  ------------------
  212|      0|       return CRYPT_INVALID_ARG;
  213|      0|    }
  214|       |
  215|       |    /* increase the length of the message */
  216|    198|    md->sha512.length += md->sha512.curlen * CONST64(8);
  ------------------
  |  |  200|    198|   #define CONST64(n) n ## ULL
  ------------------
  217|       |
  218|       |    /* append the '1' bit */
  219|    198|    md->sha512.buf[md->sha512.curlen++] = (unsigned char)0x80;
  220|       |
  221|       |    /* if the length is currently above 112 bytes we append zeros
  222|       |     * then compress.  Then we can fall back to padding zeros and length
  223|       |     * encoding like normal.
  224|       |     */
  225|    198|    if (md->sha512.curlen > 112) {
  ------------------
  |  Branch (225:9): [True: 0, False: 198]
  ------------------
  226|      0|        while (md->sha512.curlen < 128) {
  ------------------
  |  Branch (226:16): [True: 0, False: 0]
  ------------------
  227|      0|            md->sha512.buf[md->sha512.curlen++] = (unsigned char)0;
  228|      0|        }
  229|      0|        sha512_compress(md, md->sha512.buf);
  230|      0|        md->sha512.curlen = 0;
  231|      0|    }
  232|       |
  233|       |    /* pad upto 120 bytes of zeroes
  234|       |     * note: that from 112 to 120 is the 64 MSB of the length.  We assume that you won't hash
  235|       |     * > 2^64 bits of data... :-)
  236|       |     */
  237|  20.8k|    while (md->sha512.curlen < 120) {
  ------------------
  |  Branch (237:12): [True: 20.6k, False: 198]
  ------------------
  238|  20.6k|        md->sha512.buf[md->sha512.curlen++] = (unsigned char)0;
  239|  20.6k|    }
  240|       |
  241|       |    /* store length */
  242|    198|    STORE64H(md->sha512.length, md->sha512.buf+120);
  ------------------
  |  |  101|    198|#define STORE64H(x, y)                          \
  |  |  102|    198|do { ulong64 __t = __builtin_bswap64 ((x));     \
  |  |  103|    198|      XMEMCPY ((y), &__t, 8); } while(0)
  |  |  ------------------
  |  |  |  |   39|    198|#define XMEMCPY  memcpy
  |  |  ------------------
  |  |  |  Branch (103:39): [Folded, False: 198]
  |  |  ------------------
  ------------------
  243|    198|    sha512_compress(md, md->sha512.buf);
  244|       |
  245|       |    /* copy output */
  246|  1.78k|    for (i = 0; i < 8; i++) {
  ------------------
  |  Branch (246:17): [True: 1.58k, False: 198]
  ------------------
  247|  1.58k|        STORE64H(md->sha512.state[i], out+(8*i));
  ------------------
  |  |  101|  1.58k|#define STORE64H(x, y)                          \
  |  |  102|  1.58k|do { ulong64 __t = __builtin_bswap64 ((x));     \
  |  |  103|  1.58k|      XMEMCPY ((y), &__t, 8); } while(0)
  |  |  ------------------
  |  |  |  |   39|  1.58k|#define XMEMCPY  memcpy
  |  |  ------------------
  |  |  |  Branch (103:39): [Folded, False: 1.58k]
  |  |  ------------------
  ------------------
  248|  1.58k|    }
  249|       |#ifdef LTC_CLEAN_STACK
  250|       |    zeromem(md, sizeof(hash_state));
  251|       |#endif
  252|    198|    return CRYPT_OK;
  253|    198|}
sha512.c:sha512_compress:
   96|  1.77k|{
   97|  1.77k|    ulong64 S[8], W[80], t0, t1;
   98|  1.77k|    int i;
   99|       |
  100|       |    /* copy state into S */
  101|  16.0k|    for (i = 0; i < 8; i++) {
  ------------------
  |  Branch (101:17): [True: 14.2k, False: 1.77k]
  ------------------
  102|  14.2k|        S[i] = md->sha512.state[i];
  103|  14.2k|    }
  104|       |
  105|       |    /* copy the state into 1024-bits into W[0..15] */
  106|  30.2k|    for (i = 0; i < 16; i++) {
  ------------------
  |  Branch (106:17): [True: 28.4k, False: 1.77k]
  ------------------
  107|  28.4k|        LOAD64H(W[i], buf + (8*i));
  ------------------
  |  |  105|  28.4k|#define LOAD64H(x, y)                           \
  |  |  106|  28.4k|do { XMEMCPY (&(x), (y), 8);                    \
  |  |  ------------------
  |  |  |  |   39|  28.4k|#define XMEMCPY  memcpy
  |  |  ------------------
  |  |  107|  28.4k|      (x) = __builtin_bswap64 ((x)); } while(0)
  |  |  ------------------
  |  |  |  Branch (107:46): [Folded, False: 28.4k]
  |  |  ------------------
  ------------------
  108|  28.4k|    }
  109|       |
  110|       |    /* fill W[16..79] */
  111|   115k|    for (i = 16; i < 80; i++) {
  ------------------
  |  Branch (111:18): [True: 113k, False: 1.77k]
  ------------------
  112|   113k|        W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16];
  ------------------
  |  |   88|   113k|#define Gamma1(x)       (S(x, 19) ^ S(x, 61) ^ R(x, 6))
  |  |  ------------------
  |  |  |  |   83|   113k|#define S(x, n)         ROR64c(x, n)
  |  |  |  |  ------------------
  |  |  |  |  |  |  384|   113k|#define ROR64c(word,i) ({ \
  |  |  |  |  |  |  385|   113k|   ulong64 __ROR64c_tmp = word; \
  |  |  |  |  |  |  386|   113k|   __asm__ ("rorq %2, %0" : \
  |  |  |  |  |  |  387|   113k|            "=r" (__ROR64c_tmp) : \
  |  |  |  |  |  |  388|   113k|            "0" (__ROR64c_tmp), \
  |  |  |  |  |  |  389|   113k|            "J" (i)); \
  |  |  |  |  |  |  390|   113k|            __ROR64c_tmp; \
  |  |  |  |  |  |  391|   113k|   })
  |  |  |  |  ------------------
  |  |  ------------------
  |  |               #define Gamma1(x)       (S(x, 19) ^ S(x, 61) ^ R(x, 6))
  |  |  ------------------
  |  |  |  |   83|   113k|#define S(x, n)         ROR64c(x, n)
  |  |  |  |  ------------------
  |  |  |  |  |  |  384|   113k|#define ROR64c(word,i) ({ \
  |  |  |  |  |  |  385|   113k|   ulong64 __ROR64c_tmp = word; \
  |  |  |  |  |  |  386|   113k|   __asm__ ("rorq %2, %0" : \
  |  |  |  |  |  |  387|   113k|            "=r" (__ROR64c_tmp) : \
  |  |  |  |  |  |  388|   113k|            "0" (__ROR64c_tmp), \
  |  |  |  |  |  |  389|   113k|            "J" (i)); \
  |  |  |  |  |  |  390|   113k|            __ROR64c_tmp; \
  |  |  |  |  |  |  391|   113k|   })
  |  |  |  |  ------------------
  |  |  ------------------
  |  |               #define Gamma1(x)       (S(x, 19) ^ S(x, 61) ^ R(x, 6))
  |  |  ------------------
  |  |  |  |   84|   113k|#define R(x, n)         (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n))
  |  |  |  |  ------------------
  |  |  |  |  |  |  200|   113k|   #define CONST64(n) n ## ULL
  |  |  |  |  ------------------
  |  |  ------------------
  ------------------
                      W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) + W[i - 16];
  ------------------
  |  |   87|   113k|#define Gamma0(x)       (S(x, 1) ^ S(x, 8) ^ R(x, 7))
  |  |  ------------------
  |  |  |  |   83|   113k|#define S(x, n)         ROR64c(x, n)
  |  |  |  |  ------------------
  |  |  |  |  |  |  384|   113k|#define ROR64c(word,i) ({ \
  |  |  |  |  |  |  385|   113k|   ulong64 __ROR64c_tmp = word; \
  |  |  |  |  |  |  386|   113k|   __asm__ ("rorq %2, %0" : \
  |  |  |  |  |  |  387|   113k|            "=r" (__ROR64c_tmp) : \
  |  |  |  |  |  |  388|   113k|            "0" (__ROR64c_tmp), \
  |  |  |  |  |  |  389|   113k|            "J" (i)); \
  |  |  |  |  |  |  390|   113k|            __ROR64c_tmp; \
  |  |  |  |  |  |  391|   113k|   })
  |  |  |  |  ------------------
  |  |  ------------------
  |  |               #define Gamma0(x)       (S(x, 1) ^ S(x, 8) ^ R(x, 7))
  |  |  ------------------
  |  |  |  |   83|   113k|#define S(x, n)         ROR64c(x, n)
  |  |  |  |  ------------------
  |  |  |  |  |  |  384|   113k|#define ROR64c(word,i) ({ \
  |  |  |  |  |  |  385|   113k|   ulong64 __ROR64c_tmp = word; \
  |  |  |  |  |  |  386|   113k|   __asm__ ("rorq %2, %0" : \
  |  |  |  |  |  |  387|   113k|            "=r" (__ROR64c_tmp) : \
  |  |  |  |  |  |  388|   113k|            "0" (__ROR64c_tmp), \
  |  |  |  |  |  |  389|   113k|            "J" (i)); \
  |  |  |  |  |  |  390|   113k|            __ROR64c_tmp; \
  |  |  |  |  |  |  391|   113k|   })
  |  |  |  |  ------------------
  |  |  ------------------
  |  |               #define Gamma0(x)       (S(x, 1) ^ S(x, 8) ^ R(x, 7))
  |  |  ------------------
  |  |  |  |   84|   113k|#define R(x, n)         (((x)&CONST64(0xFFFFFFFFFFFFFFFF))>>((ulong64)n))
  |  |  |  |  ------------------
  |  |  |  |  |  |  200|   113k|   #define CONST64(n) n ## ULL
  |  |  |  |  ------------------
  |  |  ------------------
  ------------------
  113|   113k|    }
  114|       |
  115|       |    /* Compress */
  116|  1.77k|#ifdef LTC_SMALL_CODE
  117|   144k|    for (i = 0; i < 80; i++) {
  ------------------
  |  Branch (117:17): [True: 142k, False: 1.77k]
  ------------------
  118|   142k|        t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i];
  ------------------
  |  |   86|   142k|#define Sigma1(x)       (S(x, 14) ^ S(x, 18) ^ S(x, 41))
  |  |  ------------------
  |  |  |  |   83|   142k|#define S(x, n)         ROR64c(x, n)
  |  |  |  |  ------------------
  |  |  |  |  |  |  384|   142k|#define ROR64c(word,i) ({ \
  |  |  |  |  |  |  385|   142k|   ulong64 __ROR64c_tmp = word; \
  |  |  |  |  |  |  386|   142k|   __asm__ ("rorq %2, %0" : \
  |  |  |  |  |  |  387|   142k|            "=r" (__ROR64c_tmp) : \
  |  |  |  |  |  |  388|   142k|            "0" (__ROR64c_tmp), \
  |  |  |  |  |  |  389|   142k|            "J" (i)); \
  |  |  |  |  |  |  390|   142k|            __ROR64c_tmp; \
  |  |  |  |  |  |  391|   142k|   })
  |  |  |  |  ------------------
  |  |  ------------------
  |  |               #define Sigma1(x)       (S(x, 14) ^ S(x, 18) ^ S(x, 41))
  |  |  ------------------
  |  |  |  |   83|   142k|#define S(x, n)         ROR64c(x, n)
  |  |  |  |  ------------------
  |  |  |  |  |  |  384|   142k|#define ROR64c(word,i) ({ \
  |  |  |  |  |  |  385|   142k|   ulong64 __ROR64c_tmp = word; \
  |  |  |  |  |  |  386|   142k|   __asm__ ("rorq %2, %0" : \
  |  |  |  |  |  |  387|   142k|            "=r" (__ROR64c_tmp) : \
  |  |  |  |  |  |  388|   142k|            "0" (__ROR64c_tmp), \
  |  |  |  |  |  |  389|   142k|            "J" (i)); \
  |  |  |  |  |  |  390|   142k|            __ROR64c_tmp; \
  |  |  |  |  |  |  391|   142k|   })
  |  |  |  |  ------------------
  |  |  ------------------
  |  |               #define Sigma1(x)       (S(x, 14) ^ S(x, 18) ^ S(x, 41))
  |  |  ------------------
  |  |  |  |   83|   142k|#define S(x, n)         ROR64c(x, n)
  |  |  |  |  ------------------
  |  |  |  |  |  |  384|   142k|#define ROR64c(word,i) ({ \
  |  |  |  |  |  |  385|   142k|   ulong64 __ROR64c_tmp = word; \
  |  |  |  |  |  |  386|   142k|   __asm__ ("rorq %2, %0" : \
  |  |  |  |  |  |  387|   142k|            "=r" (__ROR64c_tmp) : \
  |  |  |  |  |  |  388|   142k|            "0" (__ROR64c_tmp), \
  |  |  |  |  |  |  389|   142k|            "J" (i)); \
  |  |  |  |  |  |  390|   142k|            __ROR64c_tmp; \
  |  |  |  |  |  |  391|   142k|   })
  |  |  |  |  ------------------
  |  |  ------------------
  ------------------
                      t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i];
  ------------------
  |  |   81|   142k|#define Ch(x,y,z)       (z ^ (x & (y ^ z)))
  ------------------
  119|   142k|        t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]);
  ------------------
  |  |   85|   142k|#define Sigma0(x)       (S(x, 28) ^ S(x, 34) ^ S(x, 39))
  |  |  ------------------
  |  |  |  |   83|   142k|#define S(x, n)         ROR64c(x, n)
  |  |  |  |  ------------------
  |  |  |  |  |  |  384|   142k|#define ROR64c(word,i) ({ \
  |  |  |  |  |  |  385|   142k|   ulong64 __ROR64c_tmp = word; \
  |  |  |  |  |  |  386|   142k|   __asm__ ("rorq %2, %0" : \
  |  |  |  |  |  |  387|   142k|            "=r" (__ROR64c_tmp) : \
  |  |  |  |  |  |  388|   142k|            "0" (__ROR64c_tmp), \
  |  |  |  |  |  |  389|   142k|            "J" (i)); \
  |  |  |  |  |  |  390|   142k|            __ROR64c_tmp; \
  |  |  |  |  |  |  391|   142k|   })
  |  |  |  |  ------------------
  |  |  ------------------
  |  |               #define Sigma0(x)       (S(x, 28) ^ S(x, 34) ^ S(x, 39))
  |  |  ------------------
  |  |  |  |   83|   142k|#define S(x, n)         ROR64c(x, n)
  |  |  |  |  ------------------
  |  |  |  |  |  |  384|   142k|#define ROR64c(word,i) ({ \
  |  |  |  |  |  |  385|   142k|   ulong64 __ROR64c_tmp = word; \
  |  |  |  |  |  |  386|   142k|   __asm__ ("rorq %2, %0" : \
  |  |  |  |  |  |  387|   142k|            "=r" (__ROR64c_tmp) : \
  |  |  |  |  |  |  388|   142k|            "0" (__ROR64c_tmp), \
  |  |  |  |  |  |  389|   142k|            "J" (i)); \
  |  |  |  |  |  |  390|   142k|            __ROR64c_tmp; \
  |  |  |  |  |  |  391|   142k|   })
  |  |  |  |  ------------------
  |  |  ------------------
  |  |               #define Sigma0(x)       (S(x, 28) ^ S(x, 34) ^ S(x, 39))
  |  |  ------------------
  |  |  |  |   83|   142k|#define S(x, n)         ROR64c(x, n)
  |  |  |  |  ------------------
  |  |  |  |  |  |  384|   142k|#define ROR64c(word,i) ({ \
  |  |  |  |  |  |  385|   142k|   ulong64 __ROR64c_tmp = word; \
  |  |  |  |  |  |  386|   142k|   __asm__ ("rorq %2, %0" : \
  |  |  |  |  |  |  387|   142k|            "=r" (__ROR64c_tmp) : \
  |  |  |  |  |  |  388|   142k|            "0" (__ROR64c_tmp), \
  |  |  |  |  |  |  389|   142k|            "J" (i)); \
  |  |  |  |  |  |  390|   142k|            __ROR64c_tmp; \
  |  |  |  |  |  |  391|   142k|   })
  |  |  |  |  ------------------
  |  |  ------------------
  ------------------
                      t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]);
  ------------------
  |  |   82|   142k|#define Maj(x,y,z)      (((x | y) & z) | (x & y))
  ------------------
  120|   142k|        S[7] = S[6];
  121|   142k|        S[6] = S[5];
  122|   142k|        S[5] = S[4];
  123|   142k|        S[4] = S[3] + t0;
  124|   142k|        S[3] = S[2];
  125|   142k|        S[2] = S[1];
  126|   142k|        S[1] = S[0];
  127|   142k|        S[0] = t0 + t1;
  128|   142k|    }
  129|       |#else
  130|       |#define RND(a,b,c,d,e,f,g,h,i)                    \
  131|       |     t0 = h + Sigma1(e) + Ch(e, f, g) + K[i] + W[i];   \
  132|       |     t1 = Sigma0(a) + Maj(a, b, c);                  \
  133|       |     d += t0;                                        \
  134|       |     h  = t0 + t1;
  135|       |
  136|       |    for (i = 0; i < 80; i += 8) {
  137|       |        RND(S[0],S[1],S[2],S[3],S[4],S[5],S[6],S[7],i+0);
  138|       |        RND(S[7],S[0],S[1],S[2],S[3],S[4],S[5],S[6],i+1);
  139|       |        RND(S[6],S[7],S[0],S[1],S[2],S[3],S[4],S[5],i+2);
  140|       |        RND(S[5],S[6],S[7],S[0],S[1],S[2],S[3],S[4],i+3);
  141|       |        RND(S[4],S[5],S[6],S[7],S[0],S[1],S[2],S[3],i+4);
  142|       |        RND(S[3],S[4],S[5],S[6],S[7],S[0],S[1],S[2],i+5);
  143|       |        RND(S[2],S[3],S[4],S[5],S[6],S[7],S[0],S[1],i+6);
  144|       |        RND(S[1],S[2],S[3],S[4],S[5],S[6],S[7],S[0],i+7);
  145|       |    }
  146|       |#endif
  147|       |
  148|       |
  149|       |    /* feedback */
  150|  16.0k|    for (i = 0; i < 8; i++) {
  ------------------
  |  Branch (150:17): [True: 14.2k, False: 1.77k]
  ------------------
  151|  14.2k|        md->sha512.state[i] = md->sha512.state[i] + S[i];
  152|  14.2k|    }
  153|       |
  154|  1.77k|    return CRYPT_OK;
  155|  1.77k|}

sha256_process:
  491|   517k|int func_name (hash_state * md, const unsigned char *in, unsigned long inlen)               \
  492|   517k|{                                                                                           \
  493|   517k|    unsigned long n;                                                                        \
  494|   517k|    int           err;                                                                      \
  495|   517k|    LTC_ARGCHK(md != NULL);                                                                 \
  ------------------
  |  |   32|   517k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
  |  |  ------------------
  |  |  |  Branch (32:32): [True: 0, False: 517k]
  |  |  |  Branch (32:87): [Folded, False: 517k]
  |  |  ------------------
  ------------------
  496|   517k|    LTC_ARGCHK(in != NULL);                                                                 \
  ------------------
  |  |   32|   517k|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
  |  |  ------------------
  |  |  |  Branch (32:32): [True: 0, False: 517k]
  |  |  |  Branch (32:87): [Folded, False: 517k]
  |  |  ------------------
  ------------------
  497|   517k|    if (md-> state_var .curlen > sizeof(md-> state_var .buf)) {                             \
  ------------------
  |  Branch (497:9): [True: 0, False: 517k]
  ------------------
  498|      0|       return CRYPT_INVALID_ARG;                                                            \
  499|      0|    }                                                                                       \
  500|   517k|    if ((md-> state_var .length + inlen) < md-> state_var .length) {                        \
  ------------------
  |  Branch (500:9): [True: 0, False: 517k]
  ------------------
  501|      0|      return CRYPT_HASH_OVERFLOW;                                                           \
  502|      0|    }                                                                                       \
  503|  1.03M|    while (inlen > 0) {                                                                     \
  ------------------
  |  Branch (503:12): [True: 517k, False: 517k]
  ------------------
  504|   517k|        if (md-> state_var .curlen == 0 && inlen >= block_size) {                           \
  ------------------
  |  Branch (504:13): [True: 258k, False: 258k]
  |  Branch (504:44): [True: 0, False: 258k]
  ------------------
  505|      0|           if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) {               \
  ------------------
  |  Branch (505:16): [True: 0, False: 0]
  ------------------
  506|      0|              return err;                                                                   \
  507|      0|           }                                                                                \
  508|      0|           md-> state_var .length += block_size * 8;                                        \
  509|      0|           in             += block_size;                                                    \
  510|      0|           inlen          -= block_size;                                                    \
  511|   517k|        } else {                                                                            \
  512|   517k|           n = MIN(inlen, (block_size - md-> state_var .curlen));                           \
  ------------------
  |  |  425|   517k|   #define MIN(x, y) ( ((x)<(y))?(x):(y) )
  |  |  ------------------
  |  |  |  Branch (425:24): [True: 517k, False: 0]
  |  |  ------------------
  ------------------
  513|   517k|           XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n);             \
  ------------------
  |  |   39|   517k|#define XMEMCPY  memcpy
  ------------------
  514|   517k|           md-> state_var .curlen += n;                                                     \
  515|   517k|           in             += n;                                                             \
  516|   517k|           inlen          -= n;                                                             \
  517|   517k|           if (md-> state_var .curlen == block_size) {                                      \
  ------------------
  |  Branch (517:16): [True: 0, False: 517k]
  ------------------
  518|      0|              if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) {            \
  ------------------
  |  Branch (518:19): [True: 0, False: 0]
  ------------------
  519|      0|                 return err;                                                                \
  520|      0|              }                                                                             \
  521|      0|              md-> state_var .length += 8*block_size;                                       \
  522|      0|              md-> state_var .curlen = 0;                                                   \
  523|      0|           }                                                                                \
  524|   517k|       }                                                                                    \
  525|   517k|    }                                                                                       \
  526|   517k|    return CRYPT_OK;                                                                        \
  527|   517k|}
sha512_process:
  491|    198|int func_name (hash_state * md, const unsigned char *in, unsigned long inlen)               \
  492|    198|{                                                                                           \
  493|    198|    unsigned long n;                                                                        \
  494|    198|    int           err;                                                                      \
  495|    198|    LTC_ARGCHK(md != NULL);                                                                 \
  ------------------
  |  |   32|    198|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
  |  |  ------------------
  |  |  |  Branch (32:32): [True: 0, False: 198]
  |  |  |  Branch (32:87): [Folded, False: 198]
  |  |  ------------------
  ------------------
  496|    198|    LTC_ARGCHK(in != NULL);                                                                 \
  ------------------
  |  |   32|    198|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
  |  |  ------------------
  |  |  |  Branch (32:32): [True: 0, False: 198]
  |  |  |  Branch (32:87): [Folded, False: 198]
  |  |  ------------------
  ------------------
  497|    198|    if (md-> state_var .curlen > sizeof(md-> state_var .buf)) {                             \
  ------------------
  |  Branch (497:9): [True: 0, False: 198]
  ------------------
  498|      0|       return CRYPT_INVALID_ARG;                                                            \
  499|      0|    }                                                                                       \
  500|    198|    if ((md-> state_var .length + inlen) < md-> state_var .length) {                        \
  ------------------
  |  Branch (500:9): [True: 0, False: 198]
  ------------------
  501|      0|      return CRYPT_HASH_OVERFLOW;                                                           \
  502|      0|    }                                                                                       \
  503|  1.97k|    while (inlen > 0) {                                                                     \
  ------------------
  |  Branch (503:12): [True: 1.77k, False: 198]
  ------------------
  504|  1.77k|        if (md-> state_var .curlen == 0 && inlen >= block_size) {                           \
  ------------------
  |  Branch (504:13): [True: 1.77k, False: 0]
  |  Branch (504:44): [True: 1.58k, False: 198]
  ------------------
  505|  1.58k|           if ((err = compress_name (md, (unsigned char *)in)) != CRYPT_OK) {               \
  ------------------
  |  Branch (505:16): [True: 0, False: 1.58k]
  ------------------
  506|      0|              return err;                                                                   \
  507|      0|           }                                                                                \
  508|  1.58k|           md-> state_var .length += block_size * 8;                                        \
  509|  1.58k|           in             += block_size;                                                    \
  510|  1.58k|           inlen          -= block_size;                                                    \
  511|  1.58k|        } else {                                                                            \
  512|    198|           n = MIN(inlen, (block_size - md-> state_var .curlen));                           \
  ------------------
  |  |  425|    198|   #define MIN(x, y) ( ((x)<(y))?(x):(y) )
  |  |  ------------------
  |  |  |  Branch (425:24): [True: 198, False: 0]
  |  |  ------------------
  ------------------
  513|    198|           XMEMCPY(md-> state_var .buf + md-> state_var.curlen, in, (size_t)n);             \
  ------------------
  |  |   39|    198|#define XMEMCPY  memcpy
  ------------------
  514|    198|           md-> state_var .curlen += n;                                                     \
  515|    198|           in             += n;                                                             \
  516|    198|           inlen          -= n;                                                             \
  517|    198|           if (md-> state_var .curlen == block_size) {                                      \
  ------------------
  |  Branch (517:16): [True: 0, False: 198]
  ------------------
  518|      0|              if ((err = compress_name (md, md-> state_var .buf)) != CRYPT_OK) {            \
  ------------------
  |  Branch (518:19): [True: 0, False: 0]
  ------------------
  519|      0|                 return err;                                                                \
  520|      0|              }                                                                             \
  521|      0|              md-> state_var .length += 8*block_size;                                       \
  522|      0|              md-> state_var .curlen = 0;                                                   \
  523|      0|           }                                                                                \
  524|    198|       }                                                                                    \
  525|  1.77k|    }                                                                                       \
  526|    198|    return CRYPT_OK;                                                                        \
  527|    198|}

register_cipher:
   22|      4|{
   23|      4|   int x;
   24|       |
   25|      4|   LTC_ARGCHK(cipher != NULL);
  ------------------
  |  |   32|      4|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
  |  |  ------------------
  |  |  |  Branch (32:32): [True: 0, False: 4]
  |  |  |  Branch (32:87): [Folded, False: 4]
  |  |  ------------------
  ------------------
   26|       |
   27|       |   /* is it already registered? */
   28|      4|   LTC_MUTEX_LOCK(&ltc_cipher_mutex);
   29|     14|   for (x = 0; x < TAB_SIZE; x++) {
  ------------------
  |  |   14|     14|#define TAB_SIZE      5
  ------------------
  |  Branch (29:16): [True: 12, False: 2]
  ------------------
   30|     12|       if (cipher_descriptor[x].name != NULL && cipher_descriptor[x].ID == cipher->ID) {
  ------------------
  |  Branch (30:12): [True: 2, False: 10]
  |  Branch (30:49): [True: 2, False: 0]
  ------------------
   31|      2|          LTC_MUTEX_UNLOCK(&ltc_cipher_mutex);
   32|      2|          return x;
   33|      2|       }
   34|     12|   }
   35|       |
   36|       |   /* find a blank spot */
   37|      2|   for (x = 0; x < TAB_SIZE; x++) {
  ------------------
  |  |   14|      2|#define TAB_SIZE      5
  ------------------
  |  Branch (37:16): [True: 2, False: 0]
  ------------------
   38|      2|       if (cipher_descriptor[x].name == NULL) {
  ------------------
  |  Branch (38:12): [True: 2, False: 0]
  ------------------
   39|      2|          XMEMCPY(&cipher_descriptor[x], cipher, sizeof(struct ltc_cipher_descriptor));
  ------------------
  |  |   39|      2|#define XMEMCPY  memcpy
  ------------------
   40|      2|          LTC_MUTEX_UNLOCK(&ltc_cipher_mutex);
   41|      2|          return x;
   42|      2|       }
   43|      2|   }
   44|       |
   45|       |   /* no spot */
   46|      0|   LTC_MUTEX_UNLOCK(&ltc_cipher_mutex);
   47|      0|   return -1;
   48|      2|}

register_hash:
   22|     12|{
   23|     12|   int x;
   24|       |
   25|     12|   LTC_ARGCHK(hash != NULL);
  ------------------
  |  |   32|     12|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
  |  |  ------------------
  |  |  |  Branch (32:32): [True: 0, False: 12]
  |  |  |  Branch (32:87): [Folded, False: 12]
  |  |  ------------------
  ------------------
   26|       |
   27|       |   /* is it already registered? */
   28|     12|   LTC_MUTEX_LOCK(&ltc_hash_mutex);
   29|     48|   for (x = 0; x < TAB_SIZE; x++) {
  ------------------
  |  |   14|     48|#define TAB_SIZE      5
  ------------------
  |  Branch (29:16): [True: 42, False: 6]
  ------------------
   30|     42|       if (XMEMCMP(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor)) == 0) {
  ------------------
  |  |   45|     42|#define XMEMCMP  memcmp
  ------------------
  |  Branch (30:12): [True: 6, False: 36]
  ------------------
   31|      6|          LTC_MUTEX_UNLOCK(&ltc_hash_mutex);
   32|      6|          return x;
   33|      6|       }
   34|     42|   }
   35|       |
   36|       |   /* find a blank spot */
   37|     12|   for (x = 0; x < TAB_SIZE; x++) {
  ------------------
  |  |   14|     12|#define TAB_SIZE      5
  ------------------
  |  Branch (37:16): [True: 12, False: 0]
  ------------------
   38|     12|       if (hash_descriptor[x].name == NULL) {
  ------------------
  |  Branch (38:12): [True: 6, False: 6]
  ------------------
   39|      6|          XMEMCPY(&hash_descriptor[x], hash, sizeof(struct ltc_hash_descriptor));
  ------------------
  |  |   39|      6|#define XMEMCPY  memcpy
  ------------------
   40|      6|          LTC_MUTEX_UNLOCK(&ltc_hash_mutex);
   41|      6|          return x;
   42|      6|       }
   43|     12|   }
   44|       |
   45|       |   /* no spot */
   46|      0|   LTC_MUTEX_UNLOCK(&ltc_hash_mutex);
   47|      0|   return -1;
   48|      6|}

register_prng:
   22|      4|{
   23|      4|   int x;
   24|       |
   25|      4|   LTC_ARGCHK(prng != NULL);
  ------------------
  |  |   32|      4|#define LTC_ARGCHK(x) do { if (!(x)) { crypt_argchk(#x, __FILE__, __LINE__); } }while(0)
  |  |  ------------------
  |  |  |  Branch (32:32): [True: 0, False: 4]
  |  |  |  Branch (32:87): [Folded, False: 4]
  |  |  ------------------
  ------------------
   26|       |
   27|       |   /* is it already registered? */
   28|      4|   LTC_MUTEX_LOCK(&ltc_prng_mutex);
   29|     14|   for (x = 0; x < TAB_SIZE; x++) {
  ------------------
  |  |   14|     14|#define TAB_SIZE      5
  ------------------
  |  Branch (29:16): [True: 12, False: 2]
  ------------------
   30|     12|       if (XMEMCMP(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor)) == 0) {
  ------------------
  |  |   45|     12|#define XMEMCMP  memcmp
  ------------------
  |  Branch (30:12): [True: 2, False: 10]
  ------------------
   31|      2|          LTC_MUTEX_UNLOCK(&ltc_prng_mutex);
   32|      2|          return x;
   33|      2|       }
   34|     12|   }
   35|       |
   36|       |   /* find a blank spot */
   37|      2|   for (x = 0; x < TAB_SIZE; x++) {
  ------------------
  |  |   14|      2|#define TAB_SIZE      5
  ------------------
  |  Branch (37:16): [True: 2, False: 0]
  ------------------
   38|      2|       if (prng_descriptor[x].name == NULL) {
  ------------------
  |  Branch (38:12): [True: 2, False: 0]
  ------------------
   39|      2|          XMEMCPY(&prng_descriptor[x], prng, sizeof(struct ltc_prng_descriptor));
  ------------------
  |  |   39|      2|#define XMEMCPY  memcpy
  ------------------
   40|      2|          LTC_MUTEX_UNLOCK(&ltc_prng_mutex);
   41|      2|          return x;
   42|      2|       }
   43|      2|   }
   44|       |
   45|       |   /* no spot */
   46|      0|   LTC_MUTEX_UNLOCK(&ltc_prng_mutex);
   47|      0|   return -1;
   48|      2|}

mp_rand_source:
   10|      4|{
   11|       |   /* Dropbear, don't reset to platform if source==NULL */
   12|      4|   s_mp_rand_source = source;
   13|      4|}

buf_new:
   41|    581|buffer* buf_new(unsigned int size) {
   42|    581|	buffer* buf;
   43|    581|	if (size > BUF_MAX_SIZE) {
  ------------------
  |  |   35|    581|#define BUF_MAX_SIZE 1000000000
  ------------------
  |  Branch (43:6): [True: 0, False: 581]
  ------------------
   44|      0|		dropbear_exit("buf->size too big");
   45|      0|	}
   46|       |
   47|    581|	buf = (buffer*)m_malloc(sizeof(buffer)+size);
   48|    581|	buf->data = (unsigned char*)buf + sizeof(buffer);
   49|    581|	buf->size = size;
   50|    581|	return buf;
   51|    581|}
buf_free:
   54|      2|void buf_free(buffer* buf) {
   55|       |	m_free(buf);
  ------------------
  |  |   24|      2|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 2]
  |  |  ------------------
  ------------------
   56|      2|}
buf_burn_free:
   59|      8|void buf_burn_free(buffer* buf) {
   60|      8|	m_burn(buf->data, buf->size);
   61|       |	m_free(buf);
  ------------------
  |  |   24|      8|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 8]
  |  |  ------------------
  ------------------
   62|      8|}
buf_incrlen:
  104|     70|void buf_incrlen(buffer* buf, unsigned int incr) {
  105|     70|	if (incr > BUF_MAX_INCR || buf->len + incr > buf->size) {
  ------------------
  |  |   34|    140|#define BUF_MAX_INCR 1000000000
  ------------------
  |  Branch (105:6): [True: 0, False: 70]
  |  Branch (105:29): [True: 0, False: 70]
  ------------------
  106|      0|		dropbear_exit("Bad buf_incrlen");
  107|      0|	}
  108|     70|	buf->len += incr;
  109|     70|}
buf_setpos:
  111|    269|void buf_setpos(buffer* buf, unsigned int pos) {
  112|       |
  113|    269|	if (pos > buf->len) {
  ------------------
  |  Branch (113:6): [True: 0, False: 269]
  ------------------
  114|      0|		dropbear_exit("Bad buf_setpos");
  115|      0|	}
  116|    269|	buf->pos = pos;
  117|    269|}
buf_incrwritepos:
  120|    558|void buf_incrwritepos(buffer* buf, unsigned int incr) {
  121|    558|	if (incr > BUF_MAX_INCR || buf->pos + incr > buf->size) {
  ------------------
  |  |   34|  1.11k|#define BUF_MAX_INCR 1000000000
  ------------------
  |  Branch (121:6): [True: 0, False: 558]
  |  Branch (121:29): [True: 0, False: 558]
  ------------------
  122|      0|		dropbear_exit("Bad buf_incrwritepos");
  123|      0|	}
  124|    558|	buf->pos += incr;
  125|    558|	if (buf->pos > buf->len) {
  ------------------
  |  Branch (125:6): [True: 558, False: 0]
  ------------------
  126|    558|		buf->len = buf->pos;
  127|    558|	}
  128|    558|}
buf_incrpos:
  131|    314|void buf_incrpos(buffer* buf, unsigned int incr) {
  132|    314|	if (incr > BUF_MAX_INCR 
  ------------------
  |  |   34|    628|#define BUF_MAX_INCR 1000000000
  ------------------
  |  Branch (132:6): [True: 0, False: 314]
  ------------------
  133|    314|		|| (buf->pos + incr) > buf->len) {
  ------------------
  |  Branch (133:6): [True: 0, False: 314]
  ------------------
  134|      0|		dropbear_exit("Bad buf_incrpos");
  135|      0|	}
  136|    314|	buf->pos += incr;
  137|    314|}
buf_decrpos:
  140|      2|void buf_decrpos(buffer* buf, unsigned int decr) {
  141|      2|	if (decr > buf->pos) {
  ------------------
  |  Branch (141:6): [True: 0, False: 2]
  ------------------
  142|      0|		dropbear_exit("Bad buf_decrpos");
  143|      0|	}
  144|      2|	buf->pos -= decr;
  145|      2|}
buf_getptr:
  180|    418|unsigned char* buf_getptr(const buffer* buf, unsigned int len) {
  181|       |
  182|    418|	if (len > BUF_MAX_INCR || buf->pos + len > buf->len) {
  ------------------
  |  |   34|    836|#define BUF_MAX_INCR 1000000000
  ------------------
  |  Branch (182:6): [True: 0, False: 418]
  |  Branch (182:28): [True: 100, False: 318]
  ------------------
  183|    100|		dropbear_exit("Bad buf_getptr");
  184|    100|	}
  185|    318|	return &buf->data[buf->pos];
  186|    418|}
buf_getwriteptr:
  190|    684|unsigned char* buf_getwriteptr(const buffer* buf, unsigned int len) {
  191|       |
  192|    684|	if (len > BUF_MAX_INCR || buf->pos + len > buf->size) {
  ------------------
  |  |   34|  1.36k|#define BUF_MAX_INCR 1000000000
  ------------------
  |  Branch (192:6): [True: 0, False: 684]
  |  Branch (192:28): [True: 0, False: 684]
  ------------------
  193|      0|		dropbear_exit("Bad buf_getwriteptr");
  194|      0|	}
  195|    684|	return &buf->data[buf->pos];
  196|    684|}
buf_getstring:
  201|      2|char* buf_getstring(buffer* buf, unsigned int *retlen) {
  202|       |
  203|      2|	unsigned int len;
  204|      2|	char* ret;
  205|      2|	void* src = NULL;
  206|      2|	len = buf_getint(buf);
  207|      2|	if (len > MAX_STRING_LEN) {
  ------------------
  |  |  253|      2|#define MAX_STRING_LEN (MAX(MAX_CMD_LEN, 2400)) /* Sun SSH needs 2400 for algos,
  ------------------
  |  Branch (207:6): [True: 0, False: 2]
  |  Branch (207:12): [True: 2, Folded]
  ------------------
  208|      0|		dropbear_exit("String too long");
  209|      0|	}
  210|       |
  211|      2|	if (retlen != NULL) {
  ------------------
  |  Branch (211:6): [True: 2, False: 0]
  ------------------
  212|      2|		*retlen = len;
  213|      2|	}
  214|      2|	src = buf_getptr(buf, len);
  215|      2|	ret = m_malloc(len+1);
  216|      2|	memcpy(ret, src, len);
  217|      2|	buf_incrpos(buf, len);
  218|      2|	ret[len] = '\0';
  219|       |
  220|      2|	return ret;
  221|      2|}
buf_getstringbuf:
  246|    169|buffer * buf_getstringbuf(buffer *buf) {
  247|    169|	return buf_getstringbuf_int(buf, 0);
  248|    169|}
buf_getptrcopy:
  256|     38|buffer * buf_getptrcopy(const buffer* buf, unsigned int len) {
  257|     38|	unsigned char *src = buf_getptr(buf, len);
  258|     38|	buffer *ret = buf_new(len);
  259|     38|	buf_putbytes(ret, src, len);
  260|     38|	buf_setpos(ret, 0);
  261|     38|	return ret;
  262|     38|}
buf_getint:
  272|    173|unsigned int buf_getint(buffer* buf) {
  273|    173|	unsigned int ret;
  274|       |
  275|    173|	LOAD32H(ret, buf_getptr(buf, 4));
  ------------------
  |  |   66|    173|#define LOAD32H(x, y)                           \
  |  |   67|    173|do { XMEMCPY (&(x), (y), 4);                    \
  |  |  ------------------
  |  |  |  |   39|    173|#define XMEMCPY  memcpy
  |  |  ------------------
  |  |   68|    173|      (x) = __builtin_bswap32 ((x)); } while(0)
  |  |  ------------------
  |  |  |  Branch (68:46): [Folded, False: 173]
  |  |  ------------------
  ------------------
  276|    173|	buf_incrpos(buf, 4);
  277|    173|	return ret;
  278|    173|}
buf_putint:
  281|      5|void buf_putint(buffer* buf, int unsigned val) {
  282|       |
  283|      5|	STORE32H(val, buf_getwriteptr(buf, 4));
  ------------------
  |  |   62|      5|#define STORE32H(x, y)                          \
  |  |   63|      5|do { ulong32 __t = __builtin_bswap32 ((x));     \
  |  |   64|      5|      XMEMCPY ((y), &__t, 4); } while(0)
  |  |  ------------------
  |  |  |  |   39|      5|#define XMEMCPY  memcpy
  |  |  ------------------
  |  |  |  Branch (64:39): [Folded, False: 5]
  |  |  ------------------
  ------------------
  284|      5|	buf_incrwritepos(buf, 4);
  285|       |
  286|      5|}
buf_putbytes:
  303|    199|void buf_putbytes(buffer *buf, const unsigned char *bytes, unsigned int len) {
  304|    199|	memcpy(buf_getwriteptr(buf, len), bytes, len);
  305|    199|	buf_incrwritepos(buf, len);
  306|    199|}
buffer.c:buf_getstringbuf_int:
  224|    169|static buffer * buf_getstringbuf_int(buffer *buf, int incllen) {
  225|    169|	buffer *ret = NULL;
  226|    169|	unsigned int len = buf_getint(buf);
  227|    169|	int extra = 0;
  228|    169|	if (len > MAX_STRING_LEN) {
  ------------------
  |  |  253|    169|#define MAX_STRING_LEN (MAX(MAX_CMD_LEN, 2400)) /* Sun SSH needs 2400 for algos,
  ------------------
  |  Branch (228:6): [True: 41, False: 128]
  |  Branch (228:12): [True: 166, Folded]
  ------------------
  229|     41|		dropbear_exit("String too long");
  230|     41|	}
  231|    128|	if (incllen) {
  ------------------
  |  Branch (231:6): [True: 0, False: 128]
  ------------------
  232|      0|		extra = 4;
  233|      0|	}
  234|    128|	ret = buf_new(len+extra);
  235|    128|	if (incllen) {
  ------------------
  |  Branch (235:6): [True: 0, False: 128]
  ------------------
  236|      0|		buf_putint(ret, len);
  237|      0|	}
  238|    128|	memcpy(buf_getwriteptr(ret, len), buf_getptr(buf, len), len);
  239|    128|	buf_incrpos(buf, len);
  240|    128|	buf_incrlen(ret, len);
  241|    128|	buf_setpos(ret, 0);
  242|    128|	return ret;
  243|    169|}

cli_getopts:
  114|      2|void cli_getopts(int argc, char ** argv) {
  115|      2|	unsigned int i, j;
  116|      2|	const char ** next = NULL;
  117|      2|	enum {
  118|      2|		OPT_EXTENDED_OPTIONS,
  119|      2|#if DROPBEAR_CLI_PUBKEY_AUTH
  120|      2|		OPT_AUTHKEY,
  121|      2|#endif
  122|      2|#if DROPBEAR_CLI_LOCALTCPFWD
  123|      2|		OPT_LOCALTCPFWD,
  124|      2|#endif
  125|      2|#if DROPBEAR_CLI_REMOTETCPFWD
  126|      2|		OPT_REMOTETCPFWD,
  127|      2|#endif
  128|      2|#if DROPBEAR_CLI_NETCAT
  129|      2|		OPT_NETCAT,
  130|      2|#endif
  131|       |		/* a flag (no arg) if 'next' is NULL, a string-valued option otherwise */
  132|      2|		OPT_OTHER
  133|      2|	} opt;
  134|      2|	unsigned int cmdlen;
  135|       |
  136|      2|	const char* recv_window_arg = NULL;
  137|      2|	const char* idle_timeout_arg = NULL;
  138|      2|	const char* max_duration_arg = NULL;
  139|      2|	const char *host_arg = NULL;
  140|      2|	const char *proxycmd_arg = NULL;
  141|      2|	const char *remoteport_arg = NULL;
  142|      2|	const char *username_arg = NULL;
  143|      2|	const char *algo_print_arg = NULL;
  144|      2|	char c;
  145|       |
  146|       |	/* see printhelp() for options */
  147|      2|	cli_opts.progname = argv[0];
  148|      2|	cli_opts.remotehost = NULL;
  149|      2|	cli_opts.remotehostfixed = 0;
  150|      2|	cli_opts.remoteport = NULL;
  151|      2|	cli_opts.username = NULL;
  152|      2|	cli_opts.cmd = NULL;
  153|      2|	cli_opts.no_cmd = 0;
  154|      2|	cli_opts.quiet = 0;
  155|      2|	cli_opts.backgrounded = 0;
  156|      2|	cli_opts.wantpty = 9; /* 9 means "it hasn't been touched", gets set later */
  157|      2|	cli_opts.always_accept_key = 0;
  158|      2|	cli_opts.ask_hostkey = 1;
  159|      2|	cli_opts.no_hostkey_check = 0;
  160|      2|	cli_opts.is_subsystem = 0;
  161|      2|#if DROPBEAR_CLI_PUBKEY_AUTH
  162|      2|	cli_opts.privkeys = list_new();
  163|      2|#endif
  164|      2|#if DROPBEAR_CLI_ANYTCPFWD
  165|      2|	cli_opts.exit_on_fwd_failure = 0;
  166|      2|#endif
  167|      2|	cli_opts.disable_trivial_auth = 0;
  168|      2|	cli_opts.password_authentication = 1;
  169|      2|	cli_opts.batch_mode = 0;
  170|      2|#if DROPBEAR_CLI_LOCALTCPFWD
  171|      2|	cli_opts.localfwds = list_new();
  172|      2|	opts.listen_fwd_all = 0;
  173|      2|#endif
  174|      2|#if DROPBEAR_CLI_REMOTETCPFWD
  175|      2|	cli_opts.remotefwds = list_new();
  176|      2|#endif
  177|      2|#if DROPBEAR_CLI_AGENTFWD
  178|      2|	cli_opts.agent_fwd = 0;
  179|      2|	cli_opts.agent_fd = -1;
  180|      2|	cli_opts.agent_keys_loaded = 0;
  181|      2|#endif
  182|      2|#if DROPBEAR_CLI_PROXYCMD
  183|      2|	cli_opts.proxycmd = NULL;
  184|      2|#endif
  185|      2|	cli_opts.bind_arg = NULL;
  186|      2|	cli_opts.bind_address = NULL;
  187|      2|	cli_opts.bind_port = NULL;
  188|      2|	cli_opts.keepalive_arg = NULL;
  189|       |#ifndef DISABLE_ZLIB
  190|       |	opts.compression = DROPBEAR_CLI_COMPRESSION;
  191|       |#endif
  192|      2|#if DROPBEAR_USER_ALGO_LIST
  193|      2|	opts.cipher_list = NULL;
  194|      2|	opts.mac_list = NULL;
  195|      2|#endif
  196|      2|#ifndef DISABLE_SYSLOG
  197|      2|	opts.usingsyslog = 0;
  198|      2|#endif
  199|       |	/* not yet
  200|       |	opts.ipv4 = 1;
  201|       |	opts.ipv6 = 1;
  202|       |	*/
  203|      2|	opts.recv_window = DEFAULT_RECV_WINDOW;
  ------------------
  |  |  550|      2|#define DEFAULT_RECV_WINDOW 24576
  ------------------
  204|      2|	opts.keepalive_secs = DEFAULT_KEEPALIVE;
  ------------------
  |  |  566|      2|#define DEFAULT_KEEPALIVE 0
  ------------------
  205|      2|	opts.idle_timeout_secs = DEFAULT_IDLE_TIMEOUT;
  ------------------
  |  |  579|      2|#define DEFAULT_IDLE_TIMEOUT 0
  ------------------
  206|      2|	opts.max_duration_secs = DEFAULT_MAX_DURATION;
  ------------------
  |  |  585|      2|#define DEFAULT_MAX_DURATION 0
  ------------------
  207|       |
  208|      2|	fill_own_user();
  209|       |
  210|      6|	for (i = 1; i < (unsigned int)argc; i++) {
  ------------------
  |  Branch (210:14): [True: 6, False: 0]
  ------------------
  211|       |		/* Handle non-flag arguments such as hostname or commands for the remote host */
  212|      6|		if (argv[i][0] != '-')
  ------------------
  |  Branch (212:7): [True: 4, False: 2]
  ------------------
  213|      4|		{
  214|      4|			if (host_arg == NULL) {
  ------------------
  |  Branch (214:8): [True: 2, False: 2]
  ------------------
  215|      2|				host_arg = argv[i];
  216|      2|				continue;
  217|      2|			}
  218|       |			/* Commands to pass to the remote host. No more flag handling,
  219|       |			commands are consumed below */
  220|      2|			break;
  221|      4|		}
  222|       |
  223|       |		/* Begins with '-' */
  224|      2|		opt = OPT_OTHER;
  225|      4|		for (j = 1; (c = argv[i][j]) != '\0' && !next && opt == OPT_OTHER; j++) {
  ------------------
  |  Branch (225:15): [True: 2, False: 2]
  |  Branch (225:43): [True: 2, False: 0]
  |  Branch (225:52): [True: 2, False: 0]
  ------------------
  226|      2|			switch (c) {
  227|      2|				case 'y':
  ------------------
  |  Branch (227:5): [True: 2, False: 0]
  ------------------
  228|       |					/* once is always accept the remote hostkey,
  229|       |					 * the same as stricthostkeychecking=accept-new */
  230|      2|					if (cli_opts.always_accept_key) {
  ------------------
  |  Branch (230:10): [True: 0, False: 2]
  ------------------
  231|       |						/* twice means no checking at all
  232|       |						 * (stricthostkeychecking=no) */
  233|      0|						cli_opts.no_hostkey_check = 1;
  234|      0|					}
  235|      2|					cli_opts.always_accept_key = 1;
  236|      2|					break;
  237|      0|				case 'q': /* quiet */
  ------------------
  |  Branch (237:5): [True: 0, False: 2]
  ------------------
  238|      0|					cli_opts.quiet = 1;
  239|      0|					break;
  240|      0|				case 'p': /* remoteport */
  ------------------
  |  Branch (240:5): [True: 0, False: 2]
  ------------------
  241|      0|					next = &remoteport_arg;
  242|      0|					break;
  243|      0|#if DROPBEAR_CLI_PUBKEY_AUTH
  244|      0|				case 'i': /* an identityfile */
  ------------------
  |  Branch (244:5): [True: 0, False: 2]
  ------------------
  245|      0|					opt = OPT_AUTHKEY;
  246|      0|					break;
  247|      0|#endif
  248|      0|				case 't': /* we want a pty */
  ------------------
  |  Branch (248:5): [True: 0, False: 2]
  ------------------
  249|      0|					cli_opts.wantpty = 1;
  250|      0|					break;
  251|      0|				case 'T': /* don't want a pty */
  ------------------
  |  Branch (251:5): [True: 0, False: 2]
  ------------------
  252|      0|					cli_opts.wantpty = 0;
  253|      0|					break;
  254|      0|				case 'N':
  ------------------
  |  Branch (254:5): [True: 0, False: 2]
  ------------------
  255|      0|					cli_opts.no_cmd = 1;
  256|      0|					break;
  257|      0|				case 'f':
  ------------------
  |  Branch (257:5): [True: 0, False: 2]
  ------------------
  258|      0|					cli_opts.backgrounded = 1;
  259|      0|					break;
  260|      0|				case 's':
  ------------------
  |  Branch (260:5): [True: 0, False: 2]
  ------------------
  261|      0|					cli_opts.is_subsystem = 1;
  262|      0|					break;
  263|      0|				case 'o':
  ------------------
  |  Branch (263:5): [True: 0, False: 2]
  ------------------
  264|      0|					opt = OPT_EXTENDED_OPTIONS;
  265|      0|					break;
  266|      0|#if DROPBEAR_CLI_LOCALTCPFWD
  267|      0|				case 'L':
  ------------------
  |  Branch (267:5): [True: 0, False: 2]
  ------------------
  268|      0|					opt = OPT_LOCALTCPFWD;
  269|      0|					break;
  270|      0|				case 'g':
  ------------------
  |  Branch (270:5): [True: 0, False: 2]
  ------------------
  271|      0|					opts.listen_fwd_all = 1;
  272|      0|					break;
  273|      0|#endif
  274|      0|#if DROPBEAR_CLI_REMOTETCPFWD
  275|      0|				case 'R':
  ------------------
  |  Branch (275:5): [True: 0, False: 2]
  ------------------
  276|      0|					opt = OPT_REMOTETCPFWD;
  277|      0|					break;
  278|      0|#endif
  279|      0|#if DROPBEAR_CLI_NETCAT
  280|      0|				case 'B':
  ------------------
  |  Branch (280:5): [True: 0, False: 2]
  ------------------
  281|      0|					opt = OPT_NETCAT;
  282|      0|					break;
  283|      0|#endif
  284|      0|#if DROPBEAR_CLI_PROXYCMD
  285|      0|				case 'J':
  ------------------
  |  Branch (285:5): [True: 0, False: 2]
  ------------------
  286|      0|					next = &proxycmd_arg;
  287|      0|					break;
  288|      0|#endif
  289|      0|				case 'l':
  ------------------
  |  Branch (289:5): [True: 0, False: 2]
  ------------------
  290|      0|					next = &username_arg;
  291|      0|					break;
  292|      0|				case 'Q':
  ------------------
  |  Branch (292:5): [True: 0, False: 2]
  ------------------
  293|      0|					next = &algo_print_arg;
  294|      0|					break;
  295|      0|				case 'h':
  ------------------
  |  Branch (295:5): [True: 0, False: 2]
  ------------------
  296|      0|					printhelp();
  297|      0|					exit(EXIT_SUCCESS);
  298|      0|					break;
  299|      0|				case 'u':
  ------------------
  |  Branch (299:5): [True: 0, False: 2]
  ------------------
  300|       |					/* backwards compatibility with old urandom option */
  301|      0|					break;
  302|      0|				case 'W':
  ------------------
  |  Branch (302:5): [True: 0, False: 2]
  ------------------
  303|      0|					next = &recv_window_arg;
  304|      0|					break;
  305|      0|				case 'K':
  ------------------
  |  Branch (305:5): [True: 0, False: 2]
  ------------------
  306|      0|					next = &cli_opts.keepalive_arg;
  307|      0|					break;
  308|      0|				case 'I':
  ------------------
  |  Branch (308:5): [True: 0, False: 2]
  ------------------
  309|      0|					next = &idle_timeout_arg;
  310|      0|					break;
  311|      0|				case 'M':
  ------------------
  |  Branch (311:5): [True: 0, False: 2]
  ------------------
  312|      0|					next = &max_duration_arg;
  313|      0|					break;
  314|      0|#if DROPBEAR_CLI_AGENTFWD
  315|      0|				case 'A':
  ------------------
  |  Branch (315:5): [True: 0, False: 2]
  ------------------
  316|      0|					cli_opts.agent_fwd = 1;
  317|      0|					break;
  318|      0|#endif
  319|      0|#if DROPBEAR_USER_ALGO_LIST
  320|      0|				case 'c':
  ------------------
  |  Branch (320:5): [True: 0, False: 2]
  ------------------
  321|      0|					next = &opts.cipher_list;
  322|      0|					break;
  323|      0|				case 'm':
  ------------------
  |  Branch (323:5): [True: 0, False: 2]
  ------------------
  324|      0|					next = &opts.mac_list;
  325|      0|					break;
  326|      0|#endif
  327|       |#if DEBUG_TRACE
  328|       |				case 'v':
  329|       |					debug_trace++;
  330|       |					break;
  331|       |#endif
  332|      0|				case 'F':
  ------------------
  |  Branch (332:5): [True: 0, False: 2]
  ------------------
  333|      0|				case 'e':
  ------------------
  |  Branch (333:5): [True: 0, False: 2]
  ------------------
  334|       |#if !DROPBEAR_USER_ALGO_LIST
  335|       |				case 'c':
  336|       |				case 'm':
  337|       |#endif
  338|      0|				case 'D':
  ------------------
  |  Branch (338:5): [True: 0, False: 2]
  ------------------
  339|       |#if !DROPBEAR_CLI_REMOTETCPFWD
  340|       |				case 'R':
  341|       |#endif
  342|       |#if !DROPBEAR_CLI_LOCALTCPFWD
  343|       |				case 'L':
  344|       |#endif
  345|      0|				case 'V':
  ------------------
  |  Branch (345:5): [True: 0, False: 2]
  ------------------
  346|      0|					print_version();
  347|      0|					exit(EXIT_SUCCESS);
  348|      0|					break;
  349|      0|				case 'b':
  ------------------
  |  Branch (349:5): [True: 0, False: 2]
  ------------------
  350|      0|					next = &cli_opts.bind_arg;
  351|      0|					break;
  352|      0|				case 'z':
  ------------------
  |  Branch (352:5): [True: 0, False: 2]
  ------------------
  353|      0|					opts.disable_ip_tos = 1;
  354|      0|					break;
  355|      0|				default:
  ------------------
  |  Branch (355:5): [True: 0, False: 2]
  ------------------
  356|      0|					fprintf(stderr,
  ------------------
  |  |  100|      0|#define stderr (fuzz.fake_stderr)
  ------------------
  357|      0|						"WARNING: Ignoring unknown option -%c\n", c);
  358|      0|					break;
  359|      2|			} /* Switch */
  360|      2|		}
  361|       |
  362|      2|		if (!next && opt == OPT_OTHER) /* got a flag */
  ------------------
  |  Branch (362:7): [True: 2, False: 0]
  |  Branch (362:16): [True: 2, False: 0]
  ------------------
  363|      2|			continue;
  364|       |
  365|      0|		if (c == '\0') {
  ------------------
  |  Branch (365:7): [True: 0, False: 0]
  ------------------
  366|      0|			i++;
  367|      0|			j = 0;
  368|      0|			if (!argv[i])
  ------------------
  |  Branch (368:8): [True: 0, False: 0]
  ------------------
  369|      0|				dropbear_exit("Missing argument");
  370|      0|		}
  371|       |
  372|      0|		if (opt == OPT_EXTENDED_OPTIONS) {
  ------------------
  |  Branch (372:7): [True: 0, False: 0]
  ------------------
  373|      0|			TRACE(("opt extended"))
  374|      0|			add_extendedopt(&argv[i][j]);
  375|      0|		}
  376|      0|		else
  377|      0|#if DROPBEAR_CLI_PUBKEY_AUTH
  378|      0|		if (opt == OPT_AUTHKEY) {
  ------------------
  |  Branch (378:7): [True: 0, False: 0]
  ------------------
  379|      0|			TRACE(("opt authkey"))
  380|      0|			loadidentityfile(&argv[i][j], 1);
  381|      0|		}
  382|      0|		else
  383|      0|#endif
  384|      0|#if DROPBEAR_CLI_REMOTETCPFWD
  385|      0|		if (opt == OPT_REMOTETCPFWD) {
  ------------------
  |  Branch (385:7): [True: 0, False: 0]
  ------------------
  386|      0|			TRACE(("opt remotetcpfwd"))
  387|      0|			addforward(&argv[i][j], cli_opts.remotefwds);
  388|      0|		}
  389|      0|		else
  390|      0|#endif
  391|      0|#if DROPBEAR_CLI_LOCALTCPFWD
  392|      0|		if (opt == OPT_LOCALTCPFWD) {
  ------------------
  |  Branch (392:7): [True: 0, False: 0]
  ------------------
  393|      0|			TRACE(("opt localtcpfwd"))
  394|      0|			addforward(&argv[i][j], cli_opts.localfwds);
  395|      0|		}
  396|      0|		else
  397|      0|#endif
  398|      0|#if DROPBEAR_CLI_NETCAT
  399|      0|		if (opt == OPT_NETCAT) {
  ------------------
  |  Branch (399:7): [True: 0, False: 0]
  ------------------
  400|      0|			TRACE(("opt netcat"))
  401|      0|			add_netcat(&argv[i][j]);
  402|      0|		}
  403|      0|		else
  404|      0|#endif
  405|      0|		if (next) {
  ------------------
  |  Branch (405:7): [True: 0, False: 0]
  ------------------
  406|       |			/* The previous flag set a value to assign */
  407|      0|			*next = &argv[i][j];
  408|      0|			if (*next == NULL)
  ------------------
  |  Branch (408:8): [True: 0, False: 0]
  ------------------
  409|      0|				dropbear_exit("Invalid null argument");
  410|      0|			next = NULL;
  411|      0|		}
  412|      0|	}
  413|       |
  414|      2|#if DROPBEAR_USER_ALGO_LIST
  415|       |	/* -c help doesn't need a hostname */
  416|      2|	parse_ciphers_macs();
  417|      2|#endif
  418|       |
  419|      2|	if (algo_print_arg) {
  ------------------
  |  Branch (419:6): [True: 0, False: 2]
  ------------------
  420|      0|		print_algos(algo_print_arg);
  421|       |		/* No return */
  422|      0|	}
  423|       |
  424|      2|	if (host_arg == NULL) { /* missing hostname */
  ------------------
  |  Branch (424:6): [True: 0, False: 2]
  ------------------
  425|      0|		printhelp();
  426|      0|		dropbear_exit("Remote host needs to provided.");
  427|      0|	}
  428|      2|	TRACE(("host is: %s", host_arg))
  429|       |
  430|      2|#if DROPBEAR_USE_SSH_CONFIG
  431|      2|	apply_config_settings(host_arg);
  432|      2|#endif
  433|       |
  434|       |	/* Apply needed defaults if missing from command line or config file. */
  435|      2|	if (remoteport_arg) {
  ------------------
  |  Branch (435:6): [True: 0, False: 2]
  ------------------
  436|      0|		m_free(cli_opts.remoteport);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  437|      0|		cli_opts.remoteport = m_strdup(remoteport_arg);
  438|      2|	} else if (!cli_opts.remoteport) {
  ------------------
  |  Branch (438:13): [True: 2, False: 0]
  ------------------
  439|      2|		cli_opts.remoteport = m_strdup("22");
  440|      2|	}
  441|       |
  442|      2|	if (username_arg) {
  ------------------
  |  Branch (442:6): [True: 0, False: 2]
  ------------------
  443|      0|		m_free(cli_opts.username);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  444|      0|		cli_opts.username = m_strdup(username_arg);
  445|      2|	} else if(!cli_opts.username) {
  ------------------
  |  Branch (445:12): [True: 2, False: 0]
  ------------------
  446|      2|		cli_opts.username = m_strdup(cli_opts.own_user);
  447|      2|	}
  448|       |
  449|       |	/* Done with options/flags; now handle the hostname (which may not
  450|       |	 * start with a hyphen) and optional command */
  451|       |
  452|      2|	if (i < (unsigned int)argc) {
  ------------------
  |  Branch (452:6): [True: 2, False: 0]
  ------------------
  453|       |		/* Build the command to send */
  454|      2|		cmdlen = 0;
  455|      4|		for (j = i; j < (unsigned int)argc; j++)
  ------------------
  |  Branch (455:15): [True: 2, False: 2]
  ------------------
  456|      2|			cmdlen += strlen(argv[j]) + 1; /* +1 for spaces */
  457|       |
  458|       |		/* Allocate the space */
  459|      2|		cli_opts.cmd = (char*)m_malloc(cmdlen);
  460|      2|		cli_opts.cmd[0] = '\0';
  461|       |
  462|       |		/* Append all the bits */
  463|      4|		for (j = i; j < (unsigned int)argc; j++) {
  ------------------
  |  Branch (463:15): [True: 2, False: 2]
  ------------------
  464|      2|			strlcat(cli_opts.cmd, argv[j], cmdlen);
  465|      2|			strlcat(cli_opts.cmd, " ", cmdlen);
  466|      2|		}
  467|       |		/* It'll be null-terminated here */
  468|      2|		TRACE(("cmd is: %s", cli_opts.cmd))
  469|      2|	}
  470|       |
  471|       |	/* And now a few sanity checks and setup */
  472|       |
  473|      2|#if DROPBEAR_CLI_PROXYCMD
  474|      2|	if (proxycmd_arg) {
  ------------------
  |  Branch (474:6): [True: 0, False: 2]
  ------------------
  475|       |		/* To match the common path of m_freeing it */
  476|      0|		cli_opts.proxycmd = m_strdup(proxycmd_arg);
  477|      0|	}
  478|      2|#endif
  479|       |
  480|      2|	if (cli_opts.bind_arg) {
  ------------------
  |  Branch (480:6): [True: 0, False: 2]
  ------------------
  481|      0|		if (split_address_port(cli_opts.bind_arg,
  ------------------
  |  Branch (481:7): [True: 0, False: 0]
  ------------------
  482|      0|			&cli_opts.bind_address, &cli_opts.bind_port)
  483|      0|				== DROPBEAR_FAILURE) {
  ------------------
  |  |  112|      0|#define DROPBEAR_FAILURE -1
  ------------------
  484|      0|			dropbear_exit("Bad -b argument");
  485|      0|		}
  486|      0|	}
  487|       |
  488|       |	/* If not explicitly specified with -t or -T, we don't want a pty if
  489|       |	 * there's a command, but we do otherwise */
  490|      2|	if (cli_opts.wantpty == 9) {
  ------------------
  |  Branch (490:6): [True: 2, False: 0]
  ------------------
  491|      2|		if (cli_opts.cmd == NULL) {
  ------------------
  |  Branch (491:7): [True: 0, False: 2]
  ------------------
  492|      0|			if (isatty(STDIN_FILENO)) {
  ------------------
  |  Branch (492:8): [True: 0, False: 0]
  ------------------
  493|      0|				cli_opts.wantpty = 1;
  494|      0|			} else {
  495|      0|				TRACE(("Not a TTY"));
  496|      0|				cli_opts.wantpty = 0;
  497|      0|			}
  498|      2|		} else {
  499|      2|			cli_opts.wantpty = 0;
  500|      2|		}
  501|      2|	}
  502|       |
  503|      2|	if (cli_opts.backgrounded && cli_opts.cmd == NULL
  ------------------
  |  Branch (503:6): [True: 0, False: 2]
  |  Branch (503:31): [True: 0, False: 0]
  ------------------
  504|      0|			&& cli_opts.no_cmd == 0) {
  ------------------
  |  Branch (504:7): [True: 0, False: 0]
  ------------------
  505|      0|		dropbear_exit("Command required for -f");
  506|      0|	}
  507|       |
  508|      2|	if (recv_window_arg) {
  ------------------
  |  Branch (508:6): [True: 0, False: 2]
  ------------------
  509|      0|		parse_recv_window(recv_window_arg);
  510|      0|	}
  511|      2|	if (cli_opts.keepalive_arg) {
  ------------------
  |  Branch (511:6): [True: 0, False: 2]
  ------------------
  512|      0|		unsigned int val;
  513|      0|		if (m_str_to_uint(cli_opts.keepalive_arg, &val) == DROPBEAR_FAILURE) {
  ------------------
  |  |  112|      0|#define DROPBEAR_FAILURE -1
  ------------------
  |  Branch (513:7): [True: 0, False: 0]
  ------------------
  514|      0|			dropbear_exit("Bad keepalive '%s'", cli_opts.keepalive_arg);
  515|      0|		}
  516|      0|		opts.keepalive_secs = val;
  517|      0|	}
  518|       |
  519|      2|	if (idle_timeout_arg) {
  ------------------
  |  Branch (519:6): [True: 0, False: 2]
  ------------------
  520|      0|		unsigned int val;
  521|      0|		if (m_str_to_uint(idle_timeout_arg, &val) == DROPBEAR_FAILURE) {
  ------------------
  |  |  112|      0|#define DROPBEAR_FAILURE -1
  ------------------
  |  Branch (521:7): [True: 0, False: 0]
  ------------------
  522|      0|			dropbear_exit("Bad idle_timeout '%s'", idle_timeout_arg);
  523|      0|		}
  524|      0|		opts.idle_timeout_secs = val;
  525|      0|	}
  526|       |
  527|      2|	if (max_duration_arg) {
  ------------------
  |  Branch (527:6): [True: 0, False: 2]
  ------------------
  528|      0|		unsigned int val;
  529|      0|		if (m_str_to_uint(max_duration_arg, &val) == DROPBEAR_FAILURE) {
  ------------------
  |  |  112|      0|#define DROPBEAR_FAILURE -1
  ------------------
  |  Branch (529:7): [True: 0, False: 0]
  ------------------
  530|      0|			dropbear_exit("Bad max_duration '%s'", max_duration_arg);
  531|      0|		}
  532|      0|		opts.max_duration_secs = val;
  533|      0|	}
  534|       |
  535|      2|#if DROPBEAR_CLI_NETCAT
  536|      2|	if (cli_opts.cmd && cli_opts.netcat_host) {
  ------------------
  |  Branch (536:6): [True: 2, False: 0]
  |  Branch (536:22): [True: 0, False: 2]
  ------------------
  537|      0|		dropbear_log(LOG_INFO, "Ignoring command '%s' in netcat mode", cli_opts.cmd);
  538|      0|	}
  539|      2|#endif
  540|       |
  541|       |	/* The hostname gets set up last, since
  542|       |	 * in multi-hop mode it will require knowledge
  543|       |	 * of other flags such as -i */
  544|      2|#if DROPBEAR_CLI_MULTIHOP
  545|      2|	parse_multihop_hostname(host_arg, argv[0]);
  546|       |#else
  547|       |	parse_hostname(host_arg);
  548|       |#endif
  549|       |
  550|       |	/* We don't want to include default id_dropbear as a
  551|       |	   -i argument for multihop, so handle it later. */
  552|      2|#if (DROPBEAR_CLI_PUBKEY_AUTH)
  553|      2|	{
  554|      2|		loadidentityfile(DROPBEAR_DEFAULT_CLI_AUTHKEY, 0);
  ------------------
  |  |  408|      2|#define DROPBEAR_DEFAULT_CLI_AUTHKEY "~/.ssh/id_dropbear"
  ------------------
  555|      2|	}
  556|      2|#endif
  557|      2|}
loadidentityfile:
  560|      2|void loadidentityfile(const char* filename, int warnfail) {
  561|      2|	sign_key *key;
  562|      2|	enum signkey_type keytype;
  563|       |
  564|      2|	char *id_key_path = expand_homedir_path(filename);
  565|      2|	TRACE(("loadidentityfile %s", id_key_path))
  566|       |
  567|      2|	key = new_sign_key();
  568|      2|	keytype = DROPBEAR_SIGNKEY_ANY;
  569|      2|	if ( readhostkey(id_key_path, key, &keytype) != DROPBEAR_SUCCESS ) {
  ------------------
  |  |  111|      2|#define DROPBEAR_SUCCESS 0
  ------------------
  |  Branch (569:7): [True: 2, False: 0]
  ------------------
  570|      2|		if (warnfail) {
  ------------------
  |  Branch (570:7): [True: 0, False: 2]
  ------------------
  571|      0|			dropbear_log(LOG_WARNING, "Failed loading keyfile '%s'\n", id_key_path);
  572|      0|		}
  573|      2|		sign_key_free(key);
  574|      2|		m_free(id_key_path);
  ------------------
  |  |   24|      2|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 2]
  |  |  ------------------
  ------------------
  575|      2|	} else {
  576|      0|		key->type = keytype;
  577|      0|		key->source = SIGNKEY_SOURCE_RAW_FILE;
  578|      0|		key->filename = id_key_path;
  579|      0|		list_append(cli_opts.privkeys, key);
  580|      0|	}
  581|      2|}
cli-runopts.c:parse_multihop_hostname:
  697|      2|static void parse_multihop_hostname(const char* orighostarg, const char* argv0) {
  698|      2|	char *userhostarg = NULL;
  699|      2|	char *hostbuf = NULL;
  700|      2|	char *last_hop = NULL;
  701|      2|	char *prior_hops = NULL;
  702|       |
  703|       |	/* both scp and rsync parse a user@host argument
  704|       |	 * and turn it into "-l user host". This breaks
  705|       |	 * for our multihop syntax, so we suture it back together.
  706|       |	 * This will break usernames that have both '@' and ',' in them,
  707|       |	 * though that should be fairly uncommon. */
  708|      2|	if (cli_opts.username
  ------------------
  |  Branch (708:6): [True: 2, False: 0]
  ------------------
  709|      2|			&& strchr(cli_opts.username, ',')
  ------------------
  |  Branch (709:7): [True: 0, False: 2]
  ------------------
  710|      0|			&& strchr(cli_opts.username, '@')) {
  ------------------
  |  Branch (710:7): [True: 0, False: 0]
  ------------------
  711|      0|		unsigned int len = strlen(orighostarg) + strlen(cli_opts.username) + 2;
  712|      0|		hostbuf = m_malloc(len);
  713|      0|		m_snprintf(hostbuf, len, "%s@%s", cli_opts.username, orighostarg);
  714|      2|	} else {
  715|      2|		hostbuf = m_strdup(orighostarg);
  716|      2|	}
  717|      2|	userhostarg = hostbuf;
  718|       |
  719|       |	/* Split off any last hostname and use that as remotehost/remoteport.
  720|       |	 * That is used for authorized_keys checking etc */
  721|      2|	last_hop = strrchr(userhostarg, ',');
  722|      2|	if (last_hop) {
  ------------------
  |  Branch (722:6): [True: 0, False: 2]
  ------------------
  723|      0|		if (last_hop == userhostarg) {
  ------------------
  |  Branch (723:7): [True: 0, False: 0]
  ------------------
  724|      0|			dropbear_exit("Bad multi-hop hostnames");
  725|      0|		}
  726|      0|		*last_hop = '\0';
  727|      0|		last_hop++;
  728|      0|		prior_hops = userhostarg;
  729|      0|		userhostarg = last_hop;
  730|      0|	}
  731|       |
  732|       |	/* Update cli_opts.remotehost and cli_opts.remoteport */
  733|      2|	parse_hostname(userhostarg);
  734|       |
  735|       |	/* Construct any multihop proxy command. Use proxyexec to
  736|       |	 * avoid worrying about shell escaping. */
  737|      2|	if (prior_hops) {
  ------------------
  |  Branch (737:6): [True: 0, False: 2]
  ------------------
  738|      0|		cli_opts.proxyexec = multihop_args(argv0, prior_hops);
  739|       |		/* Any -J argument has been copied to proxyexec */
  740|      0|		if (cli_opts.proxycmd) {
  ------------------
  |  Branch (740:7): [True: 0, False: 0]
  ------------------
  741|      0|			m_free(cli_opts.proxycmd);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  742|      0|		}
  743|       |
  744|       |#ifndef DISABLE_ZLIB
  745|       |		/* This outer stream will be incompressible since it's encrypted. */
  746|       |		opts.compression = 0;
  747|       |#endif
  748|      0|	}
  749|       |
  750|       |	m_free(hostbuf);
  ------------------
  |  |   24|      2|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 2]
  |  |  ------------------
  ------------------
  751|      2|}
cli-runopts.c:parse_hostname:
  755|      2|static void parse_hostname(const char* orighostarg) {
  756|      2|	char *userhostarg = NULL;
  757|      2|	char *port = NULL;
  758|      2|	char* remotehost = NULL;
  759|       |
  760|      2|	userhostarg = m_strdup(orighostarg);
  761|       |
  762|      2|	remotehost = strchr(userhostarg, '@');
  763|      2|	if (remotehost == NULL) {
  ------------------
  |  Branch (763:6): [True: 2, False: 0]
  ------------------
  764|       |		/* no username portion, the cli-auth.c code can figure the
  765|       |		 * local user's name */
  766|      2|		remotehost = userhostarg;
  767|      2|	} else {
  768|      0|		remotehost[0] = '\0'; /* Split the user/host */
  769|      0|		remotehost++;
  770|      0|		cli_opts.username = m_strdup(userhostarg);
  771|      0|	}
  772|       |
  773|      2|	port = strchr(remotehost, '^');
  774|      2|	if (!port)  {
  ------------------
  |  Branch (774:6): [True: 2, False: 0]
  ------------------
  775|       |		/* legacy separator */
  776|      2|		port = strchr(remotehost, '/');
  777|      2|	}
  778|      2|	if (port) {
  ------------------
  |  Branch (778:6): [True: 0, False: 2]
  ------------------
  779|      0|		*port = '\0';
  780|      0|		cli_opts.remoteport = m_strdup(port+1);
  781|      0|	}
  782|       |
  783|      2|	if (remotehost[0] == '\0') {
  ------------------
  |  Branch (783:6): [True: 0, False: 2]
  ------------------
  784|      0|		dropbear_exit("Bad hostname.");
  785|      0|	}
  786|       |
  787|      2|	if (!cli_opts.remotehostfixed) {
  ------------------
  |  Branch (787:6): [True: 2, False: 0]
  ------------------
  788|      2|		cli_opts.remotehost = m_strdup(remotehost);
  789|      2|	}
  790|       |	m_free(userhostarg);
  ------------------
  |  |   24|      2|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 2]
  |  |  ------------------
  ------------------
  791|      2|}
cli-runopts.c:fill_own_user:
  830|      2|static void fill_own_user() {
  831|      2|	uid_t uid;
  832|      2|	struct passwd *pw = NULL;
  833|       |
  834|      2|	uid = getuid();
  835|       |
  836|      2|	pw = getpwuid(uid);
  ------------------
  |  |  109|      2|#define getpwuid(x) fuzz_getpwuid(x)
  ------------------
  837|      2|	if (pw && pw->pw_name != NULL) {
  ------------------
  |  Branch (837:6): [True: 2, False: 0]
  |  Branch (837:12): [True: 2, False: 0]
  ------------------
  838|      2|		cli_opts.own_user = m_strdup(pw->pw_name);
  839|      2|	} else {
  840|      0|		dropbear_log(LOG_INFO, "Warning: failed to identify current user. Trying anyway.");
  841|      0|		cli_opts.own_user = m_strdup("unknown");
  842|      0|	}
  843|       |
  844|      2|}
cli-runopts.c:apply_config_settings:
 1140|      2|static void apply_config_settings(const char* cli_host_arg) {
 1141|      2|	char* is_multi_hop_host_target = strchr(cli_host_arg, ',');
 1142|      2|	if (!is_multi_hop_host_target) {
  ------------------
  |  Branch (1142:6): [True: 2, False: 0]
  ------------------
 1143|      2|		char* config_path = expand_homedir_path(DROPBEAR_DEFAULT_SSH_CONFIG);
  ------------------
  |  |  118|      2|#define DROPBEAR_DEFAULT_SSH_CONFIG "~/.ssh/dropbear_config"
  ------------------
 1144|      2|		FILE* f;
 1145|      2|		if ((f = fopen(config_path, "r")) == NULL) {
  ------------------
  |  Branch (1145:7): [True: 2, False: 0]
  ------------------
 1146|      2|			DEBUG1(("Configuration file '%.200s' not found.", config_path));
 1147|      2|		}
 1148|      0|		else {
 1149|      0|			parse_hostname(cli_host_arg); /* Needed as key into the config. */
 1150|      0|			read_config_file(config_path, f, &cli_opts);
 1151|      0|			fclose(f);
 1152|      0|		}
 1153|       |		m_free(config_path);
  ------------------
  |  |   24|      2|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 2]
  |  |  ------------------
  ------------------
 1154|      2|	}
 1155|      2|}

cli_dropbear_exit:
  433|    169|void cli_dropbear_exit(int exitcode, const char* format, va_list param) {
  434|    169|	char exitmsg[400];
  435|    169|	char fullmsg[550];
  436|       |
  437|       |	/* Note that exit message must be rendered before session cleanup */
  438|       |
  439|       |	/* Render the formatted exit message */
  440|    169|	vsnprintf(exitmsg, sizeof(exitmsg), format, param);
  441|    169|	TRACE(("Exited, cleaning up: %s", exitmsg))
  442|       |
  443|       |	/* Add the prefix depending on session/auth state */
  444|    169|	if (!ses.init_done) {
  ------------------
  |  Branch (444:6): [True: 169, False: 0]
  ------------------
  445|    169|		snprintf(fullmsg, sizeof(fullmsg), "Exited: %s", exitmsg);
  446|    169|	} else {
  447|      0|		snprintf(fullmsg, sizeof(fullmsg), 
  448|      0|				"Connection to %s@%s:%s exited: %s", 
  449|      0|				cli_opts.username, cli_opts.remotehost, 
  450|      0|				cli_opts.remoteport, exitmsg);
  451|      0|	}
  452|       |
  453|       |	/* Do the cleanup first, since then the terminal will be reset */
  454|    169|	session_cleanup();
  455|       |	
  456|    169|#if DROPBEAR_FUZZ
  457|    169|    if (fuzz.do_jmp) {
  ------------------
  |  Branch (457:9): [True: 169, False: 0]
  ------------------
  458|    169|        longjmp(fuzz.jmp, 1);
  459|    169|    }
  460|      0|#endif
  461|       |
  462|       |	/* Avoid printing onwards from terminal cruft */
  463|      0|	fprintf(stderr, "\n");
  ------------------
  |  |  100|      0|#define stderr (fuzz.fake_stderr)
  ------------------
  464|       |
  465|      0|	dropbear_log(LOG_INFO, "%s", fullmsg);
  466|       |
  467|      0|	exit(exitcode);
  468|    169|}

readhostkey:
   39|      2|	enum signkey_type *type) {
   40|       |
   41|      2|	int ret = DROPBEAR_FAILURE;
  ------------------
  |  |  112|      2|#define DROPBEAR_FAILURE -1
  ------------------
   42|      2|	buffer *buf;
   43|       |
   44|      2|	buf = buf_new(MAX_PRIVKEY_SIZE);
  ------------------
  |  |  262|      2|#define MAX_PRIVKEY_SIZE 1700
  ------------------
   45|       |
   46|      2|	if (buf_readfile(buf, filename) == DROPBEAR_FAILURE) {
  ------------------
  |  |  112|      2|#define DROPBEAR_FAILURE -1
  ------------------
  |  Branch (46:6): [True: 2, False: 0]
  ------------------
   47|      2|		goto out;
   48|      2|	}
   49|      0|	buf_setpos(buf, 0);
   50|       |
   51|      0|	addrandom(buf_getptr(buf, buf->len), buf->len);
   52|       |
   53|      0|	if (buf_get_priv_key(buf, hostkey, type) == DROPBEAR_FAILURE) {
  ------------------
  |  |  112|      0|#define DROPBEAR_FAILURE -1
  ------------------
  |  Branch (53:6): [True: 0, False: 0]
  ------------------
   54|      0|		goto out;
   55|      0|	}
   56|       |
   57|      0|	ret = DROPBEAR_SUCCESS;
  ------------------
  |  |  111|      0|#define DROPBEAR_SUCCESS 0
  ------------------
   58|      2|out:
   59|       |
   60|      2|	buf_burn_free(buf);
   61|      2|	return ret;
   62|      0|}
parse_ciphers_macs:
   66|      2|parse_ciphers_macs() {
   67|      2|	int printed_help = 0;
   68|      2|	if (opts.cipher_list) {
  ------------------
  |  Branch (68:6): [True: 0, False: 2]
  ------------------
   69|      0|		if (strcmp(opts.cipher_list, "help") == 0) {
  ------------------
  |  Branch (69:7): [True: 0, False: 0]
  ------------------
   70|      0|			char *ciphers = algolist_string(sshciphers);
   71|      0|			dropbear_log(LOG_INFO, "Available ciphers: %s", ciphers);
   72|      0|			m_free(ciphers);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
   73|      0|			printed_help = 1;
   74|      0|		} else {
   75|      0|			if (check_user_algos(opts.cipher_list, sshciphers, "cipher") == 0) {
  ------------------
  |  Branch (75:8): [True: 0, False: 0]
  ------------------
   76|      0|				dropbear_exit("No valid ciphers specified for '-c'");
   77|      0|			}
   78|      0|		}
   79|      0|	}
   80|       |
   81|      2|	if (opts.mac_list) {
  ------------------
  |  Branch (81:6): [True: 0, False: 2]
  ------------------
   82|      0|		if (strcmp(opts.mac_list, "help") == 0) {
  ------------------
  |  Branch (82:7): [True: 0, False: 0]
  ------------------
   83|      0|			char *macs = algolist_string(sshhashes);
   84|      0|			dropbear_log(LOG_INFO, "Available MACs: %s", macs);
   85|      0|			m_free(macs);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
   86|      0|			printed_help = 1;
   87|      0|		} else {
   88|      0|			if (check_user_algos(opts.mac_list, sshhashes, "MAC") == 0) {
  ------------------
  |  Branch (88:8): [True: 0, False: 0]
  ------------------
   89|      0|				dropbear_exit("No valid MACs specified for '-m'");
   90|      0|			}
   91|      0|		}
   92|      0|	}
   93|      2|	if (printed_help) {
  ------------------
  |  Branch (93:6): [True: 0, False: 2]
  ------------------
   94|      0|		dropbear_exit(".");
   95|      0|	}
   96|      2|}

session_cleanup:
  296|    169|void session_cleanup() {
  297|       |	
  298|    169|	TRACE(("enter session_cleanup"))
  299|       |	
  300|       |	/* we can't cleanup if we don't know the session state */
  301|    169|	if (!ses.init_done) {
  ------------------
  |  Branch (301:6): [True: 169, False: 0]
  ------------------
  302|    169|		TRACE(("leave session_cleanup: !ses.init_done"))
  303|    169|		return;
  304|    169|	}
  305|       |
  306|       |	/* BEWARE of changing order of functions here. */
  307|       |
  308|       |	/* Must be before extra_session_cleanup() */
  309|      0|	chancleanup();
  310|       |
  311|      0|	if (ses.extra_session_cleanup) {
  ------------------
  |  Branch (311:6): [True: 0, False: 0]
  ------------------
  312|      0|		ses.extra_session_cleanup();
  313|      0|	}
  314|       |
  315|       |	/* After these are freed most functions will fail */
  316|      0|#if DROPBEAR_CLEANUP
  317|       |	/* listeners call cleanup functions, this should occur before
  318|       |	other session state is freed. */
  319|      0|	remove_all_listeners();
  320|       |
  321|      0|	remove_connect_pending();
  322|       |
  323|      0|	while (!isempty(&ses.writequeue)) {
  ------------------
  |  Branch (323:9): [True: 0, False: 0]
  ------------------
  324|      0|		buf_free(dequeue(&ses.writequeue));
  325|      0|	}
  326|       |
  327|      0|	m_free(ses.newkeys);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  328|       |#ifndef DISABLE_ZLIB
  329|       |	if (ses.keys->recv.zstream != NULL) {
  330|       |		if (inflateEnd(ses.keys->recv.zstream) == Z_STREAM_ERROR) {
  331|       |			dropbear_exit("Crypto error");
  332|       |		}
  333|       |		m_free(ses.keys->recv.zstream);
  334|       |	}
  335|       |	if (ses.keys->trans.zstream != NULL) {
  336|       |		if (deflateEnd(ses.keys->trans.zstream) == Z_STREAM_ERROR) {
  337|       |			dropbear_exit("Crypto error");
  338|       |		}
  339|       |		m_free(ses.keys->trans.zstream);
  340|       |	}
  341|       |#endif
  342|       |
  343|      0|	m_free(ses.remoteident);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  344|      0|	m_free(ses.authstate.pw_dir);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  345|      0|	m_free(ses.authstate.pw_name);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  346|      0|	m_free(ses.authstate.pw_shell);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  347|      0|	m_free(ses.authstate.pw_passwd);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  348|      0|	m_free(ses.authstate.username);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  349|      0|#endif
  350|       |
  351|      0|	cleanup_buf(&ses.session_id);
  352|      0|	cleanup_buf(&ses.hash);
  353|      0|	cleanup_buf(&ses.payload);
  354|      0|	cleanup_buf(&ses.readbuf);
  355|      0|	cleanup_buf(&ses.writepayload);
  356|      0|	cleanup_buf(&ses.kexhashbuf);
  357|      0|	cleanup_buf(&ses.transkexinit);
  358|      0|	if (ses.dh_K) {
  ------------------
  |  Branch (358:6): [True: 0, False: 0]
  ------------------
  359|      0|		mp_clear(ses.dh_K);
  360|      0|	}
  361|      0|	m_free(ses.dh_K);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  362|      0|	if (ses.dh_K_bytes) {
  ------------------
  |  Branch (362:6): [True: 0, False: 0]
  ------------------
  363|      0|		buf_burn_free(ses.dh_K_bytes);
  364|      0|	}
  365|       |
  366|      0|	m_burn(ses.keys, sizeof(struct key_context));
  367|      0|	m_free(ses.keys);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  368|       |
  369|      0|	TRACE(("leave session_cleanup"))
  370|      0|}

strlcat:
  128|      4|{
  129|      4|	char *d = dst;
  130|      4|	const char *s = src;
  131|      4|	size_t n = siz;
  132|      4|	size_t dlen;
  133|       |
  134|       |	/* Find the end of dst and adjust bytes left but don't go past end */
  135|     16|	while (n-- != 0 && *d != '\0')
  ------------------
  |  Branch (135:9): [True: 16, False: 0]
  |  Branch (135:21): [True: 12, False: 4]
  ------------------
  136|     12|		d++;
  137|      4|	dlen = d - dst;
  138|      4|	n = siz - dlen;
  139|       |
  140|      4|	if (n == 0)
  ------------------
  |  Branch (140:6): [True: 0, False: 4]
  ------------------
  141|      0|		return(dlen + strlen(s));
  142|     18|	while (*s != '\0') {
  ------------------
  |  Branch (142:9): [True: 14, False: 4]
  ------------------
  143|     14|		if (n != 1) {
  ------------------
  |  Branch (143:7): [True: 12, False: 2]
  ------------------
  144|     12|			*d++ = *s;
  145|     12|			n--;
  146|     12|		}
  147|     14|		s++;
  148|     14|	}
  149|      4|	*d = '\0';
  150|       |
  151|      4|	return(dlen + (s - src));	/* count does not include NUL */
  152|      4|}

crypto_init:
   21|      4|void crypto_init() {
   22|       |
   23|      4|	const struct ltc_cipher_descriptor *regciphers[] = {
   24|      4|#if DROPBEAR_AES
   25|      4|		&aes_desc,
   26|      4|#endif
   27|       |#if DROPBEAR_3DES
   28|       |		&des3_desc,
   29|       |#endif
   30|      4|		NULL
   31|      4|	};
   32|       |
   33|      4|	const struct ltc_hash_descriptor *reghashes[] = {
   34|       |#if DROPBEAR_SHA1_HMAC
   35|       |		&sha1_desc,
   36|       |#endif
   37|      4|#if DROPBEAR_SHA256
   38|      4|		&sha256_desc,
   39|      4|#endif
   40|      4|#if DROPBEAR_SHA384
   41|      4|		&sha384_desc,
   42|      4|#endif
   43|      4|#if DROPBEAR_SHA512
   44|      4|		&sha512_desc,
   45|      4|#endif
   46|      4|		NULL
   47|      4|	};
   48|      4|	int i;
   49|       |
   50|      8|	for (i = 0; regciphers[i] != NULL; i++) {
  ------------------
  |  Branch (50:14): [True: 4, False: 4]
  ------------------
   51|      4|		if (register_cipher(regciphers[i]) == -1) {
  ------------------
  |  Branch (51:7): [True: 0, False: 4]
  ------------------
   52|      0|			dropbear_exit("Error registering crypto");
   53|      0|		}
   54|      4|	}
   55|       |
   56|     16|	for (i = 0; reghashes[i] != NULL; i++) {
  ------------------
  |  Branch (56:14): [True: 12, False: 4]
  ------------------
   57|     12|		if (register_hash(reghashes[i]) == -1) {
  ------------------
  |  Branch (57:7): [True: 0, False: 12]
  ------------------
   58|      0|			dropbear_exit("Error registering crypto");
   59|      0|		}
   60|     12|	}
   61|       |
   62|      4|#if DROPBEAR_LTC_PRNG
   63|      4|	dropbear_ltc_prng = register_prng(&dropbear_prng_desc);
   64|      4|	if (dropbear_ltc_prng == -1) {
  ------------------
  |  Branch (64:6): [True: 0, False: 4]
  ------------------
   65|      0|		dropbear_exit("Error registering crypto");
   66|      0|	}
   67|      4|#endif
   68|       |
   69|      4|	mp_rand_source(dropbear_rand_source);
   70|       |
   71|      4|#if DROPBEAR_ECC
   72|      4|	ltc_mp = ltm_desc;
   73|      4|	dropbear_ecc_fill_dp();
   74|      4|#endif
   75|      4|}

dropbear_curve25519_scalarmult:
  214|    175|{
  215|    175|  u8 z[32];
  216|    175|  i64 x[80],r,i;
  217|    175|  gf a,b,c,d,e,f;
  218|  5.42k|  FOR(i,31) z[i]=n[i];
  ------------------
  |  |   34|  5.60k|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 5.42k, False: 175]
  |  |  ------------------
  ------------------
  219|    175|  z[31]=(n[31]&127)|64;
  220|    175|  z[0]&=248;
  221|    175|  unpack25519(x,p);
  222|  2.80k|  FOR(i,16) {
  ------------------
  |  |   34|  2.97k|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 2.80k, False: 175]
  |  |  ------------------
  ------------------
  223|  2.80k|    b[i]=x[i];
  224|  2.80k|    d[i]=a[i]=c[i]=0;
  225|  2.80k|  }
  226|    175|  a[0]=d[0]=1;
  227|  44.8k|  for(i=254;i>=0;--i) {
  ------------------
  |  Branch (227:13): [True: 44.6k, False: 175]
  ------------------
  228|  44.6k|    r=(z[i>>3]>>(i&7))&1;
  229|  44.6k|    sel25519(a,b,r);
  230|  44.6k|    sel25519(c,d,r);
  231|  44.6k|    A(e,a,c);
  232|  44.6k|    Z(a,a,c);
  233|  44.6k|    A(c,b,d);
  234|  44.6k|    Z(b,b,d);
  235|  44.6k|    S(d,e);
  236|  44.6k|    S(f,a);
  237|  44.6k|    M(a,c,a);
  238|  44.6k|    M(c,b,e);
  239|  44.6k|    A(e,a,c);
  240|  44.6k|    Z(a,a,c);
  241|  44.6k|    S(b,a);
  242|  44.6k|    Z(c,d,f);
  243|  44.6k|    M(a,c,_121665);
  244|  44.6k|    A(a,a,d);
  245|  44.6k|    M(c,c,a);
  246|  44.6k|    M(a,d,f);
  247|  44.6k|    M(d,b,x);
  248|  44.6k|    S(b,e);
  249|  44.6k|    sel25519(a,b,r);
  250|  44.6k|    sel25519(c,d,r);
  251|  44.6k|  }
  252|  2.80k|  FOR(i,16) {
  ------------------
  |  |   34|  2.97k|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 2.80k, False: 175]
  |  |  ------------------
  ------------------
  253|  2.80k|    x[i+16]=a[i];
  254|  2.80k|    x[i+32]=c[i];
  255|  2.80k|    x[i+48]=b[i];
  256|  2.80k|    x[i+64]=d[i];
  257|  2.80k|  }
  258|    175|  inv25519(x+32,x+32);
  259|    175|  M(x+16,x+16,x+32);
  260|    175|  pack25519(q,x+16);
  261|    175|}
curve25519.c:unpack25519:
  152|    175|{
  153|    175|  int i;
  154|  2.80k|  FOR(i,16) o[i]=n[2*i]+((i64)n[2*i+1]<<8);
  ------------------
  |  |   34|  2.97k|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 2.80k, False: 175]
  |  |  ------------------
  ------------------
  155|    175|  o[15]&=0x7fff;
  156|    175|}
curve25519.c:sel25519:
   98|   178k|{
   99|   178k|  i64 t,i,c=~(b-1);
  100|  2.86M|  FOR(i,16) {
  ------------------
  |  |   34|  3.04M|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 2.86M, False: 178k]
  |  |  ------------------
  ------------------
  101|  2.86M|    t= c&(p[i]^q[i]);
  102|  2.86M|    p[i]^=t;
  103|  2.86M|    q[i]^=t;
  104|  2.86M|  }
  105|   178k|}
curve25519.c:A:
  159|   178k|{
  160|   178k|  int i;
  161|  2.85M|  FOR(i,16) o[i]=a[i]+b[i];
  ------------------
  |  |   34|  3.03M|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 2.85M, False: 178k]
  |  |  ------------------
  ------------------
  162|   178k|}
curve25519.c:Z:
  165|   178k|{
  166|   178k|  int i;
  167|  2.85M|  FOR(i,16) o[i]=a[i]-b[i];
  ------------------
  |  |   34|  3.03M|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 2.85M, False: 178k]
  |  |  ------------------
  ------------------
  168|   178k|}
curve25519.c:S:
  182|   222k|{
  183|   222k|  M(o,a,a);
  184|   222k|}
curve25519.c:M:
  171|   534k|{
  172|   534k|  i64 i,j,t[31];
  173|  16.5M|  FOR(i,31) t[i]=0;
  ------------------
  |  |   34|  17.1M|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 16.5M, False: 534k]
  |  |  ------------------
  ------------------
  174|   136M|  FOR(i,16) FOR(j,16) t[i+j]+=a[i]*b[j];
  ------------------
  |  |   34|  9.09M|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 8.55M, False: 534k]
  |  |  ------------------
  ------------------
                FOR(i,16) FOR(j,16) t[i+j]+=a[i]*b[j];
  ------------------
  |  |   34|   145M|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 136M, False: 8.55M]
  |  |  ------------------
  ------------------
  175|  8.02M|  FOR(i,15) t[i]+=38*t[i+16];
  ------------------
  |  |   34|  8.55M|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 8.02M, False: 534k]
  |  |  ------------------
  ------------------
  176|  8.55M|  FOR(i,16) o[i]=t[i];
  ------------------
  |  |   34|  9.09M|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 8.55M, False: 534k]
  |  |  ------------------
  ------------------
  177|   534k|  car25519(o);
  178|   534k|  car25519(o);
  179|   534k|}
curve25519.c:car25519:
   86|  1.07M|{
   87|  1.07M|  int i;
   88|  1.07M|  i64 c;
   89|  17.1M|  FOR(i,16) {
  ------------------
  |  |   34|  18.1M|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 17.1M, False: 1.07M]
  |  |  ------------------
  ------------------
   90|  17.1M|    o[i]+=(1LL<<16);
   91|  17.1M|    c=o[i]>>16;
   92|  17.1M|    o[(i+1)*(i<15)]+=c-1+37*(c-1)*(i==15);
   93|  17.1M|    o[i]-=((u64)c)<<16;
   94|  17.1M|  }
   95|  1.07M|}
curve25519.c:inv25519:
  187|    175|{
  188|    175|  gf c;
  189|    175|  int a;
  190|  2.80k|  FOR(a,16) c[a]=i[a];
  ------------------
  |  |   34|  2.97k|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 2.80k, False: 175]
  |  |  ------------------
  ------------------
  191|  44.6k|  for(a=253;a>=0;a--) {
  ------------------
  |  Branch (191:13): [True: 44.4k, False: 175]
  ------------------
  192|  44.4k|    S(c,c);
  193|  44.4k|    if(a!=2&&a!=4) M(c,c,i);
  ------------------
  |  Branch (193:8): [True: 44.2k, False: 175]
  |  Branch (193:14): [True: 44.1k, False: 175]
  ------------------
  194|  44.4k|  }
  195|  2.80k|  FOR(a,16) o[a]=c[a];
  ------------------
  |  |   34|  2.97k|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 2.80k, False: 175]
  |  |  ------------------
  ------------------
  196|    175|}
curve25519.c:pack25519:
  108|    175|{
  109|    175|  int i,j,b;
  110|    175|  gf m,t;
  111|  2.80k|  FOR(i,16) t[i]=n[i];
  ------------------
  |  |   34|  2.97k|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 2.80k, False: 175]
  |  |  ------------------
  ------------------
  112|    175|  car25519(t);
  113|    175|  car25519(t);
  114|    175|  car25519(t);
  115|    350|  FOR(j,2) {
  ------------------
  |  |   34|    525|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 350, False: 175]
  |  |  ------------------
  ------------------
  116|    350|    m[0]=t[0]-0xffed;
  117|  5.25k|    for(i=1;i<15;i++) {
  ------------------
  |  Branch (117:13): [True: 4.90k, False: 350]
  ------------------
  118|  4.90k|      m[i]=t[i]-0xffff-((m[i-1]>>16)&1);
  119|  4.90k|      m[i-1]&=0xffff;
  120|  4.90k|    }
  121|    350|    m[15]=t[15]-0x7fff-((m[14]>>16)&1);
  122|    350|    b=(m[15]>>16)&1;
  123|    350|    m[14]&=0xffff;
  124|    350|    sel25519(t,m,1-b);
  125|    350|  }
  126|  2.80k|  FOR(i,16) {
  ------------------
  |  |   34|  2.97k|#define FOR(i,n) for (i = 0;i < n;++i)
  |  |  ------------------
  |  |  |  Branch (34:29): [True: 2.80k, False: 175]
  |  |  ------------------
  ------------------
  127|  2.80k|    o[2*i]=t[i]&0xff;
  128|  2.80k|    o[2*i+1]=t[i]>>8;
  129|  2.80k|  }
  130|    175|}

m_burn:
    5|   257k|void m_burn(void *data, unsigned int len) {
    6|       |
    7|       |#if defined(HAVE_MEMSET_S)
    8|       |	memset_s(data, len, 0x0, len);
    9|       |#elif defined(HAVE_EXPLICIT_BZERO)
   10|       |	explicit_bzero(data, len);
   11|       |#else
   12|       |	/* This must be volatile to avoid compiler optimisation */
   13|       |	volatile void *p = data;
   14|       |	memset((void*)p, 0x0, len);
   15|       |#endif
   16|   257k|}

m_strdup:
   12|     12|void * m_strdup(const char * str) {
   13|     12|    char* ret;
   14|     12|    unsigned int len;
   15|     12|    len = strlen(str);
   16|       |
   17|     12|    ret = m_malloc(len+1);
   18|     12|    if (ret == NULL) {
  ------------------
  |  Branch (18:9): [True: 0, False: 12]
  ------------------
   19|      0|        dropbear_exit("m_strdup failed");
   20|      0|    }
   21|     12|    memcpy(ret, str, len+1);
   22|     12|    return ret;
   23|     12|}
m_malloc_set_epoch:
   76|    169|void m_malloc_set_epoch(unsigned int epoch) {
   77|    169|    current_epoch = epoch;
   78|    169|}
m_malloc_free_epoch:
   80|    169|void m_malloc_free_epoch(unsigned int epoch, int dofree) {
   81|    169|    struct dbmalloc_header* header;
   82|    169|    struct dbmalloc_header* nextheader = NULL;
   83|    169|    struct dbmalloc_header* oldstaple = staple;
   84|    169|    staple = NULL;
   85|       |    /* free allocations from this epoch, create a new staple-anchored list from
   86|       |    the remainder */
   87|  3.44k|    for (header = oldstaple; header; header = nextheader)
  ------------------
  |  Branch (87:30): [True: 3.27k, False: 169]
  ------------------
   88|  3.27k|    {
   89|  3.27k|        nextheader = header->next;
   90|  3.27k|        if (header->epoch == epoch) {
  ------------------
  |  Branch (90:13): [True: 909, False: 2.36k]
  ------------------
   91|    909|            if (dofree) {
  ------------------
  |  Branch (91:17): [True: 909, False: 0]
  ------------------
   92|    909|                free(header);
   93|    909|            }
   94|  2.36k|        } else {
   95|  2.36k|            header->prev = NULL;
   96|       |            header->next = NULL;
   97|  2.36k|            put_alloc(header);
   98|  2.36k|        }
   99|  3.27k|    }
  100|    169|}
m_malloc:
  131|    959|void * m_malloc(size_t size) {
  132|    959|    char* mem = NULL;
  133|    959|    struct dbmalloc_header* header = NULL;
  134|       |
  135|    959|    if (size == 0 || size > 1e9) {
  ------------------
  |  Branch (135:9): [True: 0, False: 959]
  |  Branch (135:22): [True: 0, False: 959]
  ------------------
  136|      0|        dropbear_exit("m_malloc failed");
  137|      0|    }
  138|       |
  139|    959|    size = size + sizeof(struct dbmalloc_header);
  140|       |
  141|    959|    mem = calloc(1, size);
  142|    959|    if (mem == NULL) {
  ------------------
  |  Branch (142:9): [True: 0, False: 959]
  ------------------
  143|      0|        dropbear_exit("m_malloc failed");
  144|      0|    }
  145|    959|    header = (struct dbmalloc_header*)mem;
  146|    959|    put_alloc(header);
  147|    959|    header->epoch = current_epoch;
  148|    959|    return &mem[sizeof(struct dbmalloc_header)];
  149|    959|}
m_free_direct:
  172|     24|void m_free_direct(void* ptr) {
  173|     24|    struct dbmalloc_header* header = NULL;
  174|     24|    if (!ptr) {
  ------------------
  |  Branch (174:9): [True: 2, False: 22]
  ------------------
  175|      2|        return;
  176|      2|    }
  177|     22|    header = get_header(ptr);
  178|     22|    remove_alloc(header);
  179|     22|    free(header);
  180|     22|}
dbmalloc.c:put_alloc:
  102|  3.32k|static void put_alloc(struct dbmalloc_header *header) {
  103|  3.32k|    assert(header->next == NULL);
  ------------------
  |  Branch (103:5): [True: 0, False: 3.32k]
  |  Branch (103:5): [True: 3.32k, False: 0]
  ------------------
  104|  3.32k|    assert(header->prev == NULL);
  ------------------
  |  Branch (104:5): [True: 0, False: 3.32k]
  |  Branch (104:5): [True: 3.32k, False: 0]
  ------------------
  105|  3.32k|    if (staple) {
  ------------------
  |  Branch (105:9): [True: 3.15k, False: 171]
  ------------------
  106|  3.15k|        staple->prev = header;
  107|  3.15k|    }
  108|  3.32k|    header->next = staple;
  109|  3.32k|    staple = header;
  110|  3.32k|}
dbmalloc.c:get_header:
  126|     22|static struct dbmalloc_header* get_header(void* ptr) {
  127|     22|    char* bptr = ptr;
  128|     22|    return (struct dbmalloc_header*)&bptr[-sizeof(struct dbmalloc_header)];
  129|     22|}
dbmalloc.c:remove_alloc:
  112|     22|static void remove_alloc(struct dbmalloc_header *header) {
  113|     22|    if (header->prev) {
  ------------------
  |  Branch (113:9): [True: 12, False: 10]
  ------------------
  114|     12|        header->prev->next = header->next;
  115|     12|    }
  116|     22|    if (header->next) {
  ------------------
  |  Branch (116:9): [True: 22, False: 0]
  ------------------
  117|     22|        header->next->prev = header->prev;
  118|     22|    }
  119|     22|    if (staple == header) {
  ------------------
  |  Branch (119:9): [True: 10, False: 12]
  ------------------
  120|     10|        staple = header->next;
  121|     10|    }
  122|     22|    header->prev = NULL;
  123|       |    header->next = NULL;
  124|     22|}

fuzz_seed:
  153|    173|void fuzz_seed(const unsigned char* dat, unsigned int len) {
  154|    173|	hash_state hs;
  155|    173|	sha256_init(&hs);
  156|    173|	sha256_process(&hs, "fuzzfuzzfuzz", strlen("fuzzfuzzfuzz"));
  157|    173|	sha256_process(&hs, dat, len);
  158|    173|	sha256_done(&hs, hashpool);
  159|    173|	counter = 0;
  160|    173|	donerandinit = 1;
  161|    173|}
genrandom:
  313|   257k|void genrandom(unsigned char* buf, unsigned int len) {
  314|       |
  315|   257k|	hash_state hs;
  316|   257k|	unsigned char hash[SHA256_HASH_SIZE];
  317|   257k|	unsigned int copylen;
  318|       |
  319|   257k|	if (!donerandinit) {
  ------------------
  |  Branch (319:6): [True: 0, False: 257k]
  ------------------
  320|      0|		dropbear_exit("seedrandom not done");
  321|      0|	}
  322|       |
  323|   515k|	while (len > 0) {
  ------------------
  |  Branch (323:9): [True: 258k, False: 257k]
  ------------------
  324|   258k|		sha256_init(&hs);
  325|   258k|		sha256_process(&hs, (void*)hashpool, sizeof(hashpool));
  326|   258k|		sha256_process(&hs, (void*)&counter, sizeof(counter));
  327|   258k|		sha256_done(&hs, hash);
  328|       |
  329|   258k|		counter++;
  330|   258k|		if (counter > MAX_COUNTER) {
  ------------------
  |  |   35|   258k|#define MAX_COUNTER (1<<30)
  ------------------
  |  Branch (330:7): [True: 0, False: 258k]
  ------------------
  331|      0|			seedrandom();
  332|      0|		}
  333|       |
  334|       |		copylen = MIN(len, SHA256_HASH_SIZE);
  ------------------
  |  Branch (334:13): [True: 257k, False: 1.01k]
  ------------------
  335|   258k|		memcpy(buf, hash, copylen);
  336|   258k|		len -= copylen;
  337|   258k|		buf += copylen;
  338|   258k|	}
  339|   257k|	m_burn(hash, sizeof(hash));
  340|   257k|}

dropbear_exit:
  105|    169|void dropbear_exit(const char* format, ...) {
  106|       |
  107|    169|	va_list param;
  108|       |
  109|    169|	va_start(param, format);
  110|    169|	_dropbear_exit(EXIT_FAILURE, format, param);
  111|    169|	va_end(param);
  112|      0|}
fail_assert:
  132|      5|void fail_assert(const char* expr, const char* file, int line) {
  133|      5|	dropbear_exit("Failed assertion (%s:%d): `%s'", file, line, expr);
  134|      5|}
buf_readfile:
  489|      2|int buf_readfile(buffer* buf, const char* filename) {
  490|       |
  491|      2|	int fd = -1;
  492|      2|	int len;
  493|      2|	int maxlen;
  494|      2|	int ret = DROPBEAR_FAILURE;
  ------------------
  |  |  112|      2|#define DROPBEAR_FAILURE -1
  ------------------
  495|       |
  496|      2|	fd = open(filename, O_RDONLY);
  497|       |
  498|      2|	if (fd < 0) {
  ------------------
  |  Branch (498:6): [True: 2, False: 0]
  ------------------
  499|      2|		goto out;
  500|      2|	}
  501|       |	
  502|      0|	do {
  503|      0|		maxlen = buf->size - buf->pos;
  504|      0|		len = read(fd, buf_getwriteptr(buf, maxlen), maxlen);
  ------------------
  |  |   55|      0|#define read(fd, buf, count) wrapfd_read(fd, buf, count)
  ------------------
  505|      0|		if (len < 0) {
  ------------------
  |  Branch (505:7): [True: 0, False: 0]
  ------------------
  506|      0|			if (errno == EINTR || errno == EAGAIN) {
  ------------------
  |  Branch (506:8): [True: 0, False: 0]
  |  Branch (506:26): [True: 0, False: 0]
  ------------------
  507|      0|				continue;
  508|      0|			}
  509|      0|			goto out;
  510|      0|		}
  511|      0|		buf_incrwritepos(buf, len);
  512|      0|	} while (len < maxlen && len > 0);
  ------------------
  |  Branch (512:11): [True: 0, False: 0]
  |  Branch (512:27): [True: 0, False: 0]
  ------------------
  513|       |
  514|      0|	ret = DROPBEAR_SUCCESS;
  ------------------
  |  |  111|      0|#define DROPBEAR_SUCCESS 0
  ------------------
  515|       |
  516|      2|out:
  517|      2|	if (fd >= 0) {
  ------------------
  |  Branch (517:6): [True: 0, False: 2]
  ------------------
  518|      0|		m_close(fd);
  519|      0|	}
  520|      2|	return ret;
  521|      0|}
disallow_core:
  610|      4|void disallow_core() {
  611|      4|	struct rlimit lim = {0};
  612|      4|	if (getrlimit(RLIMIT_CORE, &lim) < 0) {
  ------------------
  |  Branch (612:6): [True: 0, False: 4]
  ------------------
  613|      0|		TRACE(("getrlimit(RLIMIT_CORE) failed"));
  614|      0|	}
  615|      4|	lim.rlim_cur = 0;
  616|      4|	if (setrlimit(RLIMIT_CORE, &lim) < 0) {
  ------------------
  |  Branch (616:6): [True: 0, False: 4]
  ------------------
  617|      0|		TRACE(("setrlimit(RLIMIT_CORE) failed"));
  618|      0|	}
  619|      4|}
expand_homedir_path_home:
  647|      4|char * expand_homedir_path_home(const char *inpath, const char *homedir) {
  648|      4|	if (strncmp(inpath, "~/", 2) == 0 && homedir) {
  ------------------
  |  Branch (648:6): [True: 4, False: 0]
  |  Branch (648:39): [True: 4, False: 0]
  ------------------
  649|      4|		size_t len = strlen(inpath)-2 + strlen(homedir) + 2;
  650|      4|		char *buf = m_malloc(len);
  651|      4|		snprintf(buf, len, "%s/%s", homedir, inpath+2);
  652|      4|		return buf;
  653|      4|	}
  654|       |	/* Fallback */
  655|      0|	return m_strdup(inpath);
  656|      4|}
expand_homedir_path:
  660|      4|char * expand_homedir_path(const char *inpath) {
  661|      4|	struct passwd *pw = NULL;
  662|      4|	char *homedir = getenv("HOME");
  663|       |
  664|      4|	if (!homedir) {
  ------------------
  |  Branch (664:6): [True: 0, False: 4]
  ------------------
  665|      0|		pw = getpwuid(getuid());
  ------------------
  |  |  109|      0|#define getpwuid(x) fuzz_getpwuid(x)
  ------------------
  666|      0|		if (pw) {
  ------------------
  |  Branch (666:7): [True: 0, False: 0]
  ------------------
  667|      0|			homedir = pw->pw_dir;
  668|      0|		}
  669|      0|	}
  670|      4|	return expand_homedir_path_home(inpath, homedir);
  671|      4|}
constant_time_memcmp:
  674|      6|{
  675|      6|	const char *xa = a, *xb = b;
  676|      6|	uint8_t c = 0;
  677|      6|	size_t i;
  678|    198|	for (i = 0; i < n; i++)
  ------------------
  |  Branch (678:14): [True: 192, False: 6]
  ------------------
  679|    192|	{
  680|    192|		c |= (xa[i] ^ xb[i]);
  681|    192|	}
  682|      6|	return c;
  683|      6|}

dss_key_free:
  122|      2|void dss_key_free(dropbear_dss_key *key) {
  123|       |
  124|      2|	TRACE2(("enter dsa_key_free"))
  125|      2|	if (key == NULL) {
  ------------------
  |  Branch (125:6): [True: 2, False: 0]
  ------------------
  126|      2|		TRACE2(("enter dsa_key_free: key == NULL"))
  127|      2|		return;
  128|      2|	}
  129|      0|	m_mp_free_multi(&key->p, &key->q, &key->g, &key->y, &key->x, NULL);
  130|       |	m_free(key);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  131|      0|	TRACE2(("leave dsa_key_free"))
  132|      0|}

dropbear_ecc_fill_dp:
   47|      4|void dropbear_ecc_fill_dp() {
   48|      4|	struct dropbear_ecc_curve **curve;
   49|       |	/* libtomcrypt guarantees they're ordered by size */
   50|      4|	const ltc_ecc_set_type *dp = ltc_ecc_sets;
   51|     16|	for (curve = dropbear_ecc_curves; *curve; curve++) {
  ------------------
  |  Branch (51:36): [True: 12, False: 4]
  ------------------
   52|     20|		for (;dp->size > 0; dp++) {
  ------------------
  |  Branch (52:9): [True: 20, False: 0]
  ------------------
   53|     20|			if (dp->size == (*curve)->ltc_size) {
  ------------------
  |  Branch (53:8): [True: 12, False: 8]
  ------------------
   54|     12|				(*curve)->dp = dp;
   55|     12|				break;
   56|     12|			}
   57|     20|		}
   58|     12|		if (!(*curve)->dp) {
  ------------------
  |  Branch (58:7): [True: 0, False: 12]
  ------------------
   59|      0|			dropbear_exit("Missing ECC params %s", (*curve)->name);
   60|      0|		}
   61|     12|	}
   62|      4|}

signkey_is_ecdsa:
   11|      2|{
   12|      2|	return type == DROPBEAR_SIGNKEY_ECDSA_NISTP256
  ------------------
  |  Branch (12:9): [True: 0, False: 2]
  ------------------
   13|      2|		|| type == DROPBEAR_SIGNKEY_ECDSA_NISTP384
  ------------------
  |  Branch (13:6): [True: 0, False: 2]
  ------------------
   14|      2|		|| type == DROPBEAR_SIGNKEY_ECDSA_NISTP521;
  ------------------
  |  Branch (14:6): [True: 0, False: 2]
  ------------------
   15|      2|}

buf_get_ed25519_priv_key:
   78|      2|int buf_get_ed25519_priv_key(buffer *buf, dropbear_ed25519_key *key) {
   79|       |
   80|      2|	unsigned int len;
   81|       |
   82|      2|	TRACE(("enter buf_get_ed25519_priv_key"))
   83|      2|	dropbear_assert(key != NULL);
  ------------------
  |  |   84|      2|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0)
  |  |  ------------------
  |  |  |  Branch (84:37): [True: 0, False: 2]
  |  |  |  Branch (84:93): [Folded, False: 2]
  |  |  ------------------
  ------------------
   84|       |
   85|      2|	buf_incrpos(buf, 4+SSH_SIGNKEY_ED25519_LEN); /* int + "ssh-ed25519" */
  ------------------
  |  |  119|      2|#define SSH_SIGNKEY_ED25519_LEN 11
  ------------------
   86|       |
   87|      2|	len = buf_getint(buf);
   88|      2|	if (len != CURVE25519_LEN*2 || buf->len - buf->pos < len) {
  ------------------
  |  |   34|      2|#define CURVE25519_LEN 32
  ------------------
  |  Branch (88:6): [True: 0, False: 2]
  |  Branch (88:33): [True: 0, False: 2]
  ------------------
   89|      0|		TRACE(("leave buf_get_ed25519_priv_key: failure"))
   90|      0|		return DROPBEAR_FAILURE;
  ------------------
  |  |  112|      0|#define DROPBEAR_FAILURE -1
  ------------------
   91|      0|	}
   92|       |
   93|      2|	memcpy(key->priv, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN);
  ------------------
  |  |   34|      2|#define CURVE25519_LEN 32
  ------------------
              	memcpy(key->priv, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN);
  ------------------
  |  |   34|      2|#define CURVE25519_LEN 32
  ------------------
   94|      2|	buf_incrpos(buf, CURVE25519_LEN);
  ------------------
  |  |   34|      2|#define CURVE25519_LEN 32
  ------------------
   95|      2|	memcpy(key->pub, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN);
  ------------------
  |  |   34|      2|#define CURVE25519_LEN 32
  ------------------
              	memcpy(key->pub, buf_getptr(buf, CURVE25519_LEN), CURVE25519_LEN);
  ------------------
  |  |   34|      2|#define CURVE25519_LEN 32
  ------------------
   96|      2|	buf_incrpos(buf, CURVE25519_LEN);
  ------------------
  |  |   34|      2|#define CURVE25519_LEN 32
  ------------------
   97|       |
   98|      2|	TRACE(("leave buf_get_ed25519_priv_key: success"))
   99|      2|	return DROPBEAR_SUCCESS;
  ------------------
  |  |  111|      2|#define DROPBEAR_SUCCESS 0
  ------------------
  100|      2|}
ed25519_key_free:
  103|      4|void ed25519_key_free(dropbear_ed25519_key *key) {
  104|       |
  105|      4|	TRACE2(("enter ed25519_key_free"))
  106|       |
  107|      4|	if (key == NULL) {
  ------------------
  |  Branch (107:6): [True: 4, False: 0]
  ------------------
  108|      4|		TRACE2(("leave ed25519_key_free: key == NULL"))
  109|      4|		return;
  110|      4|	}
  111|      0|	m_burn(key->priv, CURVE25519_LEN);
  ------------------
  |  |   34|      0|#define CURVE25519_LEN 32
  ------------------
  112|      0|	m_free(key);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  113|       |
  114|      0|	TRACE2(("leave ed25519_key_free"))
  115|      0|}

gen_kexpqhybrid_param:
   13|    169|struct kex_pqhybrid_param *gen_kexpqhybrid_param() {
   14|    169|    struct kex_pqhybrid_param *param = m_malloc(sizeof(*param));
   15|    169|    const struct dropbear_kem_desc *kem = ses.newkeys->algo_kex->details;
   16|       |
   17|    169|    param->curve25519 = gen_kexcurve25519_param();
   18|       |
   19|    169|    if (IS_DROPBEAR_CLIENT) {
  ------------------
  |  |  382|    169|#define IS_DROPBEAR_CLIENT (ses.isserver == 0)
  |  |  ------------------
  |  |  |  Branch (382:28): [True: 169, False: 0]
  |  |  ------------------
  ------------------
   20|    169|        param->kem_cli_secret = buf_new(kem->secret_len);
   21|    169|        param->concat_public = buf_new(kem->public_len + CURVE25519_LEN);
  ------------------
  |  |  122|    169|#define CURVE25519_LEN 32
  ------------------
   22|    169|        kem->kem_gen(
   23|    169|            buf_getwriteptr(param->concat_public, kem->public_len),
   24|    169|            buf_getwriteptr(param->kem_cli_secret, kem->secret_len));
   25|    169|        buf_incrwritepos(param->concat_public, kem->public_len);
   26|    169|        buf_incrwritepos(param->kem_cli_secret, kem->secret_len);
   27|    169|        buf_setpos(param->kem_cli_secret, 0);
   28|       |        /* Append the curve25519 parameter */
   29|    169|        buf_putbytes(param->concat_public, param->curve25519->pub, CURVE25519_LEN);
  ------------------
  |  |  122|    169|#define CURVE25519_LEN 32
  ------------------
   30|    169|    }
   31|       |
   32|    169|    return param;
   33|    169|}
kexpqhybrid_comb_key:
   46|     70|    buffer *buf_pub, sign_key *hostkey) {
   47|       |
   48|     70|    const struct dropbear_kem_desc *kem = ses.newkeys->algo_kex->details;
   49|     70|    const struct ltc_hash_descriptor *hash_desc
   50|     70|        = ses.newkeys->algo_kex->hash_desc;
   51|       |
   52|       |    /* Either public key (from client) or ciphertext (from server) */
   53|     70|    unsigned char *remote_pub_kem = NULL;
   54|     70|    buffer *pub_25519 = NULL;
   55|     70|    buffer *k_out = NULL;
   56|     70|    unsigned int remote_len;
   57|     70|    hash_state hs;
   58|     70|    const buffer * Q_C = NULL;
   59|     70|    const buffer * Q_S = NULL;
   60|       |
   61|       |    /* Extract input parts from the remote peer */
   62|     70|    if (IS_DROPBEAR_CLIENT) {
  ------------------
  |  |  382|     70|#define IS_DROPBEAR_CLIENT (ses.isserver == 0)
  |  |  ------------------
  |  |  |  Branch (382:28): [True: 70, False: 0]
  |  |  ------------------
  ------------------
   63|       |        /* S_REPLY = S_CT2 || S_PK1 */
   64|     70|        remote_len = kem->ciphertext_len;
   65|     70|    } else {
   66|       |        /* C_INIT = C_PK2 || C_PK1 */
   67|      0|        remote_len = kem->public_len;
   68|      0|    }
   69|     70|    remote_pub_kem = buf_getptr(buf_pub, remote_len);
   70|     70|    buf_incrpos(buf_pub, remote_len);
   71|     70|    pub_25519 = buf_getptrcopy(buf_pub, CURVE25519_LEN);
  ------------------
  |  |  122|     70|#define CURVE25519_LEN 32
  ------------------
   72|     70|    buf_incrpos(buf_pub, CURVE25519_LEN);
  ------------------
  |  |  122|     70|#define CURVE25519_LEN 32
  ------------------
   73|       |    /* Check all is consumed */
   74|     70|    if (buf_pub->pos != buf_pub->len) {
  ------------------
  |  Branch (74:9): [True: 22, False: 48]
  ------------------
   75|     22|        dropbear_exit("Bad sntrup");
   76|     22|    }
   77|       |
   78|       |    /* k_out = K_PQ || K_CL */
   79|     48|    k_out = buf_new(kem->output_len + CURVE25519_LEN);
  ------------------
  |  |  122|     48|#define CURVE25519_LEN 32
  ------------------
   80|       |
   81|       |    /* Derive pq kem part (K_PQ) */
   82|     48|    if (IS_DROPBEAR_CLIENT) {
  ------------------
  |  |  382|     48|#define IS_DROPBEAR_CLIENT (ses.isserver == 0)
  |  |  ------------------
  |  |  |  Branch (382:28): [True: 6, False: 42]
  |  |  ------------------
  ------------------
   83|      6|        kem->kem_dec(
   84|      6|            buf_getwriteptr(k_out, kem->output_len),
   85|      6|            remote_pub_kem,
   86|      6|            buf_getptr(param->kem_cli_secret, kem->secret_len));
   87|      6|        buf_burn_free(param->kem_cli_secret);
   88|      6|        param->kem_cli_secret = NULL;
   89|     42|    } else {
   90|       |        /* Server returns ciphertext */
   91|     42|        assert(param->concat_public == NULL);
  ------------------
  |  Branch (91:9): [True: 0, False: 42]
  |  Branch (91:9): [True: 0, False: 42]
  ------------------
   92|     42|        param->concat_public = buf_new(kem->ciphertext_len + CURVE25519_LEN);
  ------------------
  |  |  122|      0|#define CURVE25519_LEN 32
  ------------------
   93|      0|        kem->kem_enc(
   94|      0|            buf_getwriteptr(param->concat_public, kem->ciphertext_len),
   95|      0|            buf_getwriteptr(k_out, kem->output_len),
   96|      0|            remote_pub_kem);
   97|      0|        buf_incrwritepos(param->concat_public, kem->ciphertext_len);
   98|       |        /* Append the curve25519 parameter */
   99|      0|        buf_putbytes(param->concat_public, param->curve25519->pub, CURVE25519_LEN);
  ------------------
  |  |  122|      0|#define CURVE25519_LEN 32
  ------------------
  100|      0|    }
  101|     48|    buf_incrwritepos(k_out, kem->output_len);
  102|       |
  103|       |    /* Derive ec part (K_CL) */
  104|      6|    kexcurve25519_derive(param->curve25519, pub_25519,
  105|      6|        buf_getwriteptr(k_out, CURVE25519_LEN));
  ------------------
  |  |  122|      6|#define CURVE25519_LEN 32
  ------------------
  106|      6|    buf_incrwritepos(k_out, CURVE25519_LEN);
  ------------------
  |  |  122|      6|#define CURVE25519_LEN 32
  ------------------
  107|       |
  108|       |    /* dh_K_bytes = HASH(k_out)
  109|       |       dh_K_bytes is a SSH string with length prefix, since
  110|       |       that is what needs to be hashed in gen_new_keys() */
  111|      6|    ses.dh_K_bytes = buf_new(4 + hash_desc->hashsize);
  112|      6|    buf_putint(ses.dh_K_bytes, hash_desc->hashsize);
  113|      6|    hash_desc->init(&hs);
  114|      6|    hash_desc->process(&hs, k_out->data, k_out->len);
  115|      6|    hash_desc->done(&hs, buf_getwriteptr(ses.dh_K_bytes, hash_desc->hashsize));
  116|      6|    m_burn(&hs, sizeof(hash_state));
  117|      6|    buf_incrwritepos(ses.dh_K_bytes, hash_desc->hashsize);
  118|       |
  119|       |    /* Create the remainder of the hash buffer */
  120|      6|    if (IS_DROPBEAR_CLIENT) {
  ------------------
  |  |  382|      6|#define IS_DROPBEAR_CLIENT (ses.isserver == 0)
  |  |  ------------------
  |  |  |  Branch (382:28): [True: 5, False: 1]
  |  |  ------------------
  ------------------
  121|      5|        Q_C = param->concat_public;
  122|      5|        Q_S = buf_pub;
  123|      5|    } else {
  124|      1|        Q_S = param->concat_public;
  125|      1|        Q_C = buf_pub;
  126|      1|    }
  127|       |
  128|       |    /* K_S, the host key */
  129|      6|    buf_put_pub_key(ses.kexhashbuf, hostkey, ses.newkeys->algo_hostkey);
  130|      6|    buf_putbufstring(ses.kexhashbuf, Q_C);
  131|      6|    buf_putbufstring(ses.kexhashbuf, Q_S);
  132|       |    /* K, the shared secret */
  133|      6|    buf_putbytes(ses.kexhashbuf, ses.dh_K_bytes->data, ses.dh_K_bytes->len);
  134|       |
  135|       |    /* calculate the hash H to sign */
  136|      6|    finish_kexhashbuf();
  137|       |
  138|      6|    buf_burn_free(k_out);
  139|      6|    buf_free(pub_25519);
  140|      6|}

gen_kexcurve25519_param:
   14|    169|struct kex_curve25519_param *gen_kexcurve25519_param() {
   15|       |    /* Per http://cr.yp.to/ecdh.html */
   16|    169|    struct kex_curve25519_param *param = m_malloc(sizeof(*param));
   17|    169|    const unsigned char basepoint[32] = {9};
   18|       |
   19|    169|    genrandom(param->priv, CURVE25519_LEN);
  ------------------
  |  |  122|    169|#define CURVE25519_LEN 32
  ------------------
   20|    169|    dropbear_curve25519_scalarmult(param->pub, param->priv, basepoint);
   21|       |
   22|    169|    return param;
   23|    169|}
kexcurve25519_derive:
   32|      6|    unsigned char *out) {
   33|      6|    char zeroes[CURVE25519_LEN] = {0};
   34|      6|    if (buf_pub_them->len != CURVE25519_LEN)
  ------------------
  |  |  122|      6|#define CURVE25519_LEN 32
  ------------------
  |  Branch (34:9): [True: 0, False: 6]
  ------------------
   35|      0|    {
   36|      0|        dropbear_exit("Bad curve25519");
   37|      0|    }
   38|       |
   39|      6|    dropbear_curve25519_scalarmult(out, param->priv, buf_pub_them->data);
   40|       |
   41|      6|    if (constant_time_memcmp(zeroes, out, CURVE25519_LEN) == 0) {
  ------------------
  |  |  122|      6|#define CURVE25519_LEN 32
  ------------------
  |  Branch (41:9): [True: 1, False: 5]
  ------------------
   42|      1|        dropbear_exit("Bad curve25519");
   43|      1|    }
   44|      6|}

list_append:
    5|      2|void list_append(m_list *list, void *item) {
    6|      2|	m_list_elem *elem;
    7|       |	
    8|      2|	elem = m_malloc(sizeof(*elem));
    9|      2|	elem->item = item;
   10|      2|	elem->list = list;
   11|      2|	elem->next = NULL;
   12|      2|	if (!list->first) {
  ------------------
  |  Branch (12:6): [True: 2, False: 0]
  ------------------
   13|      2|		list->first = elem;
   14|      2|		elem->prev = NULL;
   15|      2|	} else {
   16|      0|		elem->prev = list->last;
   17|      0|		list->last->next = elem;
   18|      0|	}
   19|      2|	list->last = elem;
   20|      2|}
list_new:
   22|      6|m_list * list_new() {
   23|      6|	m_list *ret = m_malloc(sizeof(m_list));
   24|       |	ret->first = ret->last = NULL;
   25|      6|	return ret;
   26|      6|}

rsa_key_free:
  143|      2|void rsa_key_free(dropbear_rsa_key *key) {
  144|       |
  145|      2|	TRACE2(("enter rsa_key_free"))
  146|       |
  147|      2|	if (key == NULL) {
  ------------------
  |  Branch (147:6): [True: 2, False: 0]
  ------------------
  148|      2|		TRACE2(("leave rsa_key_free: key == NULL"))
  149|      2|		return;
  150|      2|	}
  151|      0|	m_mp_free_multi(&key->d, &key->e, &key->p, &key->q, &key->n, NULL);
  152|       |	m_free(key);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  153|      0|	TRACE2(("leave rsa_key_free"))
  154|      0|}
buf_put_rsa_pub_key:
  162|      5|void buf_put_rsa_pub_key(buffer* buf, const dropbear_rsa_key *key) {
  163|       |
  164|      5|	TRACE(("enter buf_put_rsa_pub_key"))
  165|      5|	dropbear_assert(key != NULL);
  ------------------
  |  |   84|      5|#define dropbear_assert(X) do { if (!(X)) { fail_assert(#X, __FILE__, __LINE__); } } while (0)
  |  |  ------------------
  |  |  |  Branch (84:37): [True: 5, False: 0]
  |  |  |  Branch (84:93): [Folded, False: 0]
  |  |  ------------------
  ------------------
  166|       |
  167|      0|	buf_putstring(buf, SSH_SIGNKEY_RSA, SSH_SIGNKEY_RSA_LEN);
  ------------------
  |  |  116|      0|#define SSH_SIGNKEY_RSA "ssh-rsa"
  ------------------
              	buf_putstring(buf, SSH_SIGNKEY_RSA, SSH_SIGNKEY_RSA_LEN);
  ------------------
  |  |  117|      0|#define SSH_SIGNKEY_RSA_LEN 7
  ------------------
  168|      0|	buf_putmpint(buf, key->e);
  169|      0|	buf_putmpint(buf, key->n);
  170|       |
  171|      0|	TRACE(("leave buf_put_rsa_pub_key"))
  172|       |
  173|      0|}

new_sign_key:
   62|      4|sign_key * new_sign_key() {
   63|       |
   64|      4|	sign_key * ret;
   65|       |
   66|      4|	ret = (sign_key*)m_malloc(sizeof(sign_key));
   67|      4|	ret->type = DROPBEAR_SIGNKEY_NONE;
   68|      4|	ret->source = SIGNKEY_SOURCE_INVALID;
   69|      4|	return ret;
   70|      4|}
signkey_type_from_name:
   86|      2|enum signkey_type signkey_type_from_name(const char* name, unsigned int namelen) {
   87|      2|	int i;
   88|     14|	for (i = 0; i < DROPBEAR_SIGNKEY_NUM_NAMED; i++) {
  ------------------
  |  Branch (88:14): [True: 14, False: 0]
  ------------------
   89|     14|		const char *fixed_name = signkey_names[i];
   90|     14|		if (namelen == strlen(fixed_name)
  ------------------
  |  Branch (90:7): [True: 2, False: 12]
  ------------------
   91|      2|			&& memcmp(fixed_name, name, namelen) == 0) {
  ------------------
  |  Branch (91:7): [True: 2, False: 0]
  ------------------
   92|       |
   93|      2|#if DROPBEAR_ECDSA
   94|       |			/* Some of the ECDSA key sizes are defined even if they're not compiled in */
   95|      2|			if (0
  ------------------
  |  Branch (95:8): [Folded, False: 2]
  ------------------
   96|       |#if !DROPBEAR_ECC_256
   97|       |				|| i == DROPBEAR_SIGNKEY_ECDSA_NISTP256
   98|       |#endif
   99|       |#if !DROPBEAR_ECC_384
  100|       |				|| i == DROPBEAR_SIGNKEY_ECDSA_NISTP384
  101|       |#endif
  102|       |#if !DROPBEAR_ECC_521
  103|       |				|| i == DROPBEAR_SIGNKEY_ECDSA_NISTP521
  104|       |#endif
  105|      2|				) {
  106|      0|				TRACE(("attempt to use ecdsa type %d not compiled in", i))
  107|      0|				return DROPBEAR_SIGNKEY_NONE;
  108|      0|			}
  109|      2|#endif
  110|       |
  111|      2|			return (enum signkey_type)i;
  112|      2|		}
  113|     14|	}
  114|       |
  115|      0|	TRACE(("signkey_type_from_name unexpected key type."))
  116|       |
  117|      0|	return DROPBEAR_SIGNKEY_NONE;
  118|      2|}
buf_get_priv_key:
  339|      2|int buf_get_priv_key(buffer *buf, sign_key *key, enum signkey_type *type) {
  340|       |
  341|      2|	char *ident;
  342|      2|	unsigned int len;
  343|      2|	enum signkey_type keytype;
  344|      2|	int ret = DROPBEAR_FAILURE;
  ------------------
  |  |  112|      2|#define DROPBEAR_FAILURE -1
  ------------------
  345|       |
  346|      2|	TRACE2(("enter buf_get_priv_key"))
  347|       |
  348|      2|	ident = buf_getstring(buf, &len);
  349|      2|	keytype = signkey_type_from_name(ident, len);
  350|      2|	m_free(ident);
  ------------------
  |  |   24|      2|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 2]
  |  |  ------------------
  ------------------
  351|       |
  352|      2|	if (*type != DROPBEAR_SIGNKEY_ANY && *type != keytype) {
  ------------------
  |  Branch (352:6): [True: 0, False: 2]
  |  Branch (352:39): [True: 0, False: 0]
  ------------------
  353|      0|		TRACE(("wrong key type: %d %d", *type, keytype))
  354|      0|		return DROPBEAR_FAILURE;
  ------------------
  |  |  112|      0|#define DROPBEAR_FAILURE -1
  ------------------
  355|      0|	}
  356|       |
  357|      2|	*type = keytype;
  358|       |
  359|       |	/* Rewind the buffer back before "ssh-rsa" etc */
  360|      2|	buf_decrpos(buf, len + 4);
  361|       |
  362|      2|#if DROPBEAR_DSS
  363|      2|	if (keytype == DROPBEAR_SIGNKEY_DSS) {
  ------------------
  |  Branch (363:6): [True: 0, False: 2]
  ------------------
  364|      0|		dss_key_free(key->dsskey);
  365|      0|		key->dsskey = m_malloc(sizeof(*key->dsskey));
  366|      0|		ret = buf_get_dss_priv_key(buf, key->dsskey);
  367|      0|		if (ret == DROPBEAR_FAILURE) {
  ------------------
  |  |  112|      0|#define DROPBEAR_FAILURE -1
  ------------------
  |  Branch (367:7): [True: 0, False: 0]
  ------------------
  368|      0|			dss_key_free(key->dsskey);
  369|      0|			key->dsskey = NULL;
  370|      0|		}
  371|      0|	}
  372|      2|#endif
  373|      2|#if DROPBEAR_RSA
  374|      2|	if (keytype == DROPBEAR_SIGNKEY_RSA) {
  ------------------
  |  Branch (374:6): [True: 0, False: 2]
  ------------------
  375|      0|		rsa_key_free(key->rsakey);
  376|      0|		key->rsakey = m_malloc(sizeof(*key->rsakey));
  377|      0|		ret = buf_get_rsa_priv_key(buf, key->rsakey);
  378|      0|		if (ret == DROPBEAR_FAILURE) {
  ------------------
  |  |  112|      0|#define DROPBEAR_FAILURE -1
  ------------------
  |  Branch (378:7): [True: 0, False: 0]
  ------------------
  379|      0|			rsa_key_free(key->rsakey);
  380|      0|			key->rsakey = NULL;
  381|      0|		}
  382|      0|	}
  383|      2|#endif
  384|      2|#if DROPBEAR_ECDSA
  385|      2|	if (signkey_is_ecdsa(keytype)) {
  ------------------
  |  Branch (385:6): [True: 0, False: 2]
  ------------------
  386|      0|		ecc_key **eck = (ecc_key**)signkey_key_ptr(key, keytype);
  387|      0|		if (eck) {
  ------------------
  |  Branch (387:7): [True: 0, False: 0]
  ------------------
  388|      0|			if (*eck) {
  ------------------
  |  Branch (388:8): [True: 0, False: 0]
  ------------------
  389|      0|				ecc_free(*eck);
  390|      0|				m_free(*eck);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  391|      0|				*eck = NULL;
  392|      0|			}
  393|      0|			*eck = buf_get_ecdsa_priv_key(buf);
  394|      0|			if (*eck) {
  ------------------
  |  Branch (394:8): [True: 0, False: 0]
  ------------------
  395|      0|				ret = DROPBEAR_SUCCESS;
  ------------------
  |  |  111|      0|#define DROPBEAR_SUCCESS 0
  ------------------
  396|      0|			}
  397|      0|		}
  398|      0|	}
  399|      2|#endif
  400|      2|#if DROPBEAR_ED25519
  401|      2|	if (keytype == DROPBEAR_SIGNKEY_ED25519) {
  ------------------
  |  Branch (401:6): [True: 2, False: 0]
  ------------------
  402|      2|		ed25519_key_free(key->ed25519key);
  403|      2|		key->ed25519key = m_malloc(sizeof(*key->ed25519key));
  404|      2|		ret = buf_get_ed25519_priv_key(buf, key->ed25519key);
  405|      2|		if (ret == DROPBEAR_FAILURE) {
  ------------------
  |  |  112|      2|#define DROPBEAR_FAILURE -1
  ------------------
  |  Branch (405:7): [True: 0, False: 2]
  ------------------
  406|      0|			m_free(key->ed25519key);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  407|      0|			key->ed25519key = NULL;
  408|      0|		}
  409|      2|	}
  410|      2|#endif
  411|       |
  412|      2|	TRACE2(("leave buf_get_priv_key"))
  413|       |
  414|      2|	return ret;
  415|       |	
  416|      2|}
buf_put_pub_key:
  419|      5|void buf_put_pub_key(buffer* buf, sign_key *key, enum signkey_type type) {
  420|       |
  421|      5|	buffer *pubkeys;
  422|       |
  423|      5|	TRACE2(("enter buf_put_pub_key"))
  424|      5|	pubkeys = buf_new(MAX_PUBKEY_SIZE);
  ------------------
  |  |  261|      5|#define MAX_PUBKEY_SIZE 600
  ------------------
  425|       |	
  426|      5|#if DROPBEAR_DSS
  427|      5|	if (type == DROPBEAR_SIGNKEY_DSS) {
  ------------------
  |  Branch (427:6): [True: 0, False: 5]
  ------------------
  428|      0|		buf_put_dss_pub_key(pubkeys, key->dsskey);
  429|      0|	}
  430|      5|#endif
  431|      5|#if DROPBEAR_RSA
  432|      5|	if (type == DROPBEAR_SIGNKEY_RSA) {
  ------------------
  |  Branch (432:6): [True: 5, False: 0]
  ------------------
  433|      5|		buf_put_rsa_pub_key(pubkeys, key->rsakey);
  434|      5|	}
  435|      5|#endif
  436|      5|#if DROPBEAR_ECDSA
  437|      5|	if (signkey_is_ecdsa(type)
  ------------------
  |  Branch (437:6): [True: 5, False: 0]
  ------------------
  438|      0|#if DROPBEAR_SK_ECDSA
  439|      0|		|| type == DROPBEAR_SIGNKEY_SK_ECDSA_NISTP256
  ------------------
  |  Branch (439:6): [True: 0, False: 0]
  ------------------
  440|      5|#endif
  441|      5|		) {
  442|      0|		ecc_key **eck = (ecc_key**)signkey_key_ptr(key, type);
  443|      0|		if (eck && *eck) {
  ------------------
  |  Branch (443:7): [True: 0, False: 0]
  |  Branch (443:14): [True: 0, False: 0]
  ------------------
  444|      0|			buf_put_ecdsa_pub_key(pubkeys, *eck);
  445|      0|		}
  446|      0|	}
  447|      5|#endif
  448|      5|#if DROPBEAR_ED25519
  449|      5|	if (type == DROPBEAR_SIGNKEY_ED25519
  ------------------
  |  Branch (449:6): [True: 5, False: 0]
  ------------------
  450|      0|#if DROPBEAR_SK_ED25519
  451|      0|		|| type == DROPBEAR_SIGNKEY_SK_ED25519
  ------------------
  |  Branch (451:6): [True: 0, False: 0]
  ------------------
  452|      5|#endif
  453|      5|	) {
  454|      0|		buf_put_ed25519_pub_key(pubkeys, key->ed25519key);
  455|      0|	}
  456|      5|#endif
  457|      5|	if (pubkeys->len == 0) {
  ------------------
  |  Branch (457:6): [True: 0, False: 5]
  ------------------
  458|      0|		dropbear_exit("Bad key types in buf_put_pub_key");
  459|      0|	}
  460|       |
  461|      5|	buf_putbufstring(buf, pubkeys);
  462|      5|	buf_free(pubkeys);
  463|      5|	TRACE2(("leave buf_put_pub_key"))
  464|      5|}
sign_key_free:
  506|      2|void sign_key_free(sign_key *key) {
  507|       |
  508|      2|	TRACE2(("enter sign_key_free"))
  509|       |
  510|      2|#if DROPBEAR_DSS
  511|      2|	dss_key_free(key->dsskey);
  512|      2|	key->dsskey = NULL;
  513|      2|#endif
  514|      2|#if DROPBEAR_RSA
  515|      2|	rsa_key_free(key->rsakey);
  516|      2|	key->rsakey = NULL;
  517|      2|#endif
  518|      2|#if DROPBEAR_ECDSA
  519|      2|#if DROPBEAR_ECC_256
  520|      2|	if (key->ecckey256) {
  ------------------
  |  Branch (520:6): [True: 0, False: 2]
  ------------------
  521|      0|		ecc_free(key->ecckey256);
  522|      0|		m_free(key->ecckey256);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  523|      0|		key->ecckey256 = NULL;
  524|      0|	}
  525|      2|#endif
  526|      2|#if DROPBEAR_ECC_384
  527|      2|	if (key->ecckey384) {
  ------------------
  |  Branch (527:6): [True: 0, False: 2]
  ------------------
  528|      0|		ecc_free(key->ecckey384);
  529|      0|		m_free(key->ecckey384);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  530|      0|		key->ecckey384 = NULL;
  531|      0|	}
  532|      2|#endif
  533|      2|#if DROPBEAR_ECC_521
  534|      2|	if (key->ecckey521) {
  ------------------
  |  Branch (534:6): [True: 0, False: 2]
  ------------------
  535|      0|		ecc_free(key->ecckey521);
  536|      0|		m_free(key->ecckey521);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  537|      0|		key->ecckey521 = NULL;
  538|      0|	}
  539|      2|#endif
  540|      2|#endif
  541|      2|#if DROPBEAR_ED25519
  542|      2|	ed25519_key_free(key->ed25519key);
  543|      2|	key->ed25519key = NULL;
  544|      2|#endif
  545|       |
  546|      2|	m_free(key->filename);
  ------------------
  |  |   24|      2|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 2]
  |  |  ------------------
  ------------------
  547|      2|#if DROPBEAR_SK_ECDSA || DROPBEAR_SK_ED25519
  548|      2|	if (key->sk_app) {
  ------------------
  |  Branch (548:6): [True: 0, False: 2]
  ------------------
  549|      0|		m_free(key->sk_app);
  ------------------
  |  |   24|      0|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 0]
  |  |  ------------------
  ------------------
  550|      0|	}
  551|      2|#endif
  552|       |
  553|       |	m_free(key);
  ------------------
  |  |   24|      2|#define m_free(X) do {m_free_direct(X); (X) = NULL;} while (0)
  |  |  ------------------
  |  |  |  Branch (24:61): [Folded, False: 2]
  |  |  ------------------
  ------------------
  554|      2|	TRACE2(("leave sign_key_free"))
  555|      2|}

crypto_kem_sntrup761_keypair:
 2170|    169|int crypto_kem_sntrup761_keypair(unsigned char *pk, unsigned char *sk) {
 2171|    169|  int i;
 2172|    169|  ZKeyGen(pk, sk);
 2173|    169|  sk += SecretKeys_bytes;
  ------------------
  |  | 1763|    169|#define SecretKeys_bytes (2 * Small_bytes)
  |  |  ------------------
  |  |  |  | 1761|    169|#define Small_bytes ((p + 3) / 4)
  |  |  |  |  ------------------
  |  |  |  |  |  | 1754|    169|#define p 761
  |  |  |  |  ------------------
  |  |  ------------------
  ------------------
 2174|   195k|  for (i = 0; i < crypto_kem_sntrup761_PUBLICKEYBYTES; ++i) *sk++ = pk[i];
  ------------------
  |  |    4|   195k|#define crypto_kem_sntrup761_PUBLICKEYBYTES 1158
  ------------------
  |  Branch (2174:15): [True: 195k, False: 169]
  ------------------
 2175|    169|  randombytes(sk, Small_bytes);
  ------------------
  |  | 1761|    169|#define Small_bytes ((p + 3) / 4)
  |  |  ------------------
  |  |  |  | 1754|    169|#define p 761
  |  |  ------------------
  ------------------
 2176|    169|  Hash_prefix(sk + Small_bytes, 4, pk, crypto_kem_sntrup761_PUBLICKEYBYTES);
  ------------------
  |  | 1761|    169|#define Small_bytes ((p + 3) / 4)
  |  |  ------------------
  |  |  |  | 1754|    169|#define p 761
  |  |  ------------------
  ------------------
                Hash_prefix(sk + Small_bytes, 4, pk, crypto_kem_sntrup761_PUBLICKEYBYTES);
  ------------------
  |  |    4|    169|#define crypto_kem_sntrup761_PUBLICKEYBYTES 1158
  ------------------
 2177|    169|  return 0;
 2178|    169|}
crypto_kem_sntrup761_dec:
 2203|      6|int crypto_kem_sntrup761_dec(unsigned char *k, const unsigned char *c, const unsigned char *sk) {
 2204|      6|  const unsigned char *pk = sk + SecretKeys_bytes;
  ------------------
  |  | 1763|      6|#define SecretKeys_bytes (2 * Small_bytes)
  |  |  ------------------
  |  |  |  | 1761|      6|#define Small_bytes ((p + 3) / 4)
  |  |  |  |  ------------------
  |  |  |  |  |  | 1754|      6|#define p 761
  |  |  |  |  ------------------
  |  |  ------------------
  ------------------
 2205|      6|  const unsigned char *rho = pk + crypto_kem_sntrup761_PUBLICKEYBYTES;
  ------------------
  |  |    4|      6|#define crypto_kem_sntrup761_PUBLICKEYBYTES 1158
  ------------------
 2206|      6|  const unsigned char *cache = rho + Small_bytes;
  ------------------
  |  | 1761|      6|#define Small_bytes ((p + 3) / 4)
  |  |  ------------------
  |  |  |  | 1754|      6|#define p 761
  |  |  ------------------
  ------------------
 2207|      6|  Inputs r;
 2208|      6|  unsigned char r_enc[Small_bytes], cnew[crypto_kem_sntrup761_CIPHERTEXTBYTES];
 2209|      6|  int mask, i;
 2210|      6|  ZDecrypt(r, c, sk);
 2211|      6|  Hide(cnew, r_enc, r, pk, cache);
 2212|      6|  mask = Ciphertexts_diff_mask(c, cnew);
 2213|  1.15k|  for (i = 0; i < Small_bytes; ++i) r_enc[i] ^= mask & (r_enc[i] ^ rho[i]);
  ------------------
  |  | 1761|  1.15k|#define Small_bytes ((p + 3) / 4)
  |  |  ------------------
  |  |  |  | 1754|  1.15k|#define p 761
  |  |  ------------------
  ------------------
  |  Branch (2213:15): [True: 1.14k, False: 6]
  ------------------
 2214|      6|  HashSession(k, 1 + mask, r_enc, c);
 2215|      6|  return 0;
 2216|      6|}
sntrup761.c:ZKeyGen:
 2129|    169|static void ZKeyGen(unsigned char *pk, unsigned char *sk) {
 2130|    169|  Fq h[p];
 2131|    169|  small f[p], v[p];
 2132|    169|  KeyGen(h, f, v);
 2133|    169|  Rq_encode(pk, h);
 2134|    169|  Small_encode(sk, f);
 2135|    169|  Small_encode(sk + Small_bytes, v);
  ------------------
  |  | 1761|    169|#define Small_bytes ((p + 3) / 4)
  |  |  ------------------
  |  |  |  | 1754|    169|#define p 761
  |  |  ------------------
  ------------------
 2136|    169|}
sntrup761.c:KeyGen:
 2044|    169|static void KeyGen(Fq *h, small *f, small *ginv) {
 2045|    169|  small g[p];
 2046|    169|  Fq finv[p];
 2047|    169|  for (;;) {
 2048|    169|    int result;
 2049|    169|    Small_random(g);
 2050|    169|    result = R3_recip(ginv, g);
 2051|    169|    crypto_declassify(&result, sizeof result);
  ------------------
  |  |   14|    169|#define crypto_declassify(x, y) do {} while (0)
  |  |  ------------------
  |  |  |  Branch (14:46): [Folded, False: 169]
  |  |  ------------------
  ------------------
 2052|    169|    if (result == 0) break;
  ------------------
  |  Branch (2052:9): [True: 169, False: 0]
  ------------------
 2053|    169|  }
 2054|    169|  Short_random(f);
 2055|    169|  Rq_recip3(finv, f);
 2056|    169|  Rq_mult_small(h, finv, g);
 2057|    169|}
sntrup761.c:Small_random:
 2039|    169|static void Small_random(small *out) {
 2040|    169|  int i;
 2041|   128k|  for (i = 0; i < p; ++i) out[i] = (((urandom32() & 0x3fffffff) * 3) >> 30) - 1;
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
  |  Branch (2041:15): [True: 128k, False: 169]
  ------------------
 2042|    169|}
sntrup761.c:urandom32:
 2023|   257k|static uint32_t urandom32(void) {
 2024|   257k|  unsigned char c[4];
 2025|   257k|  uint32_t result = 0;
 2026|   257k|  int i;
 2027|   257k|  randombytes(c, 4);
 2028|  1.28M|  for (i = 0; i < 4; ++i) result += ((uint32_t)c[i]) << (8 * i);
  ------------------
  |  Branch (2028:15): [True: 1.02M, False: 257k]
  ------------------
 2029|   257k|  return result;
 2030|   257k|}
sntrup761.c:R3_recip:
 1900|    169|static int R3_recip(small *out, const small *in) {
 1901|    169|  small f[p + 1], g[p + 1], v[p + 1], r[p + 1];
 1902|    169|  int sign, swap, t, i, loop, delta = 1;
 1903|   128k|  for (i = 0; i < p + 1; ++i) v[i] = 0;
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
  |  Branch (1903:15): [True: 128k, False: 169]
  ------------------
 1904|   128k|  for (i = 0; i < p + 1; ++i) r[i] = 0;
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
  |  Branch (1904:15): [True: 128k, False: 169]
  ------------------
 1905|    169|  r[0] = 1;
 1906|   128k|  for (i = 0; i < p; ++i) f[i] = 0;
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
  |  Branch (1906:15): [True: 128k, False: 169]
  ------------------
 1907|    169|  f[0] = 1;
 1908|    169|  f[p - 1] = f[p] = -1;
  ------------------
  |  | 1754|    169|#define p 761
  ------------------
                f[p - 1] = f[p] = -1;
  ------------------
  |  | 1754|    169|#define p 761
  ------------------
 1909|   128k|  for (i = 0; i < p; ++i) g[p - 1 - i] = in[i];
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
                for (i = 0; i < p; ++i) g[p - 1 - i] = in[i];
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
  |  Branch (1909:15): [True: 128k, False: 169]
  ------------------
 1910|    169|  g[p] = 0;
  ------------------
  |  | 1754|    169|#define p 761
  ------------------
 1911|   257k|  for (loop = 0; loop < 2 * p - 1; ++loop) {
  ------------------
  |  | 1754|   257k|#define p 761
  ------------------
  |  Branch (1911:18): [True: 257k, False: 169]
  ------------------
 1912|   195M|    for (i = p; i > 0; --i) v[i] = v[i - 1];
  ------------------
  |  | 1754|   257k|#define p 761
  ------------------
  |  Branch (1912:17): [True: 195M, False: 257k]
  ------------------
 1913|   257k|    v[0] = 0;
 1914|   257k|    sign = -g[0] * f[0];
 1915|   257k|    swap = crypto_int16_negative_mask(-delta) & crypto_int16_nonzero_mask(g[0]);
 1916|   257k|    delta ^= swap & (delta ^ -delta);
 1917|   257k|    delta += 1;
 1918|   196M|    for (i = 0; i < p + 1; ++i) {
  ------------------
  |  | 1754|   196M|#define p 761
  ------------------
  |  Branch (1918:17): [True: 195M, False: 257k]
  ------------------
 1919|   195M|      t = swap & (f[i] ^ g[i]);
 1920|   195M|      f[i] ^= t;
 1921|   195M|      g[i] ^= t;
 1922|   195M|      t = swap & (v[i] ^ r[i]);
 1923|   195M|      v[i] ^= t;
 1924|   195M|      r[i] ^= t;
 1925|   195M|    }
 1926|   196M|    for (i = 0; i < p + 1; ++i) g[i] = F3_freeze(g[i] + sign * f[i]);
  ------------------
  |  | 1754|   196M|#define p 761
  ------------------
  |  Branch (1926:17): [True: 195M, False: 257k]
  ------------------
 1927|   196M|    for (i = 0; i < p + 1; ++i) r[i] = F3_freeze(r[i] + sign * v[i]);
  ------------------
  |  | 1754|   196M|#define p 761
  ------------------
  |  Branch (1927:17): [True: 195M, False: 257k]
  ------------------
 1928|   195M|    for (i = 0; i < p; ++i) g[i] = g[i + 1];
  ------------------
  |  | 1754|   195M|#define p 761
  ------------------
  |  Branch (1928:17): [True: 195M, False: 257k]
  ------------------
 1929|   257k|    g[p] = 0;
  ------------------
  |  | 1754|   257k|#define p 761
  ------------------
 1930|   257k|  }
 1931|    169|  sign = f[0];
 1932|   128k|  for (i = 0; i < p; ++i) out[i] = sign * v[p - 1 - i];
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
                for (i = 0; i < p; ++i) out[i] = sign * v[p - 1 - i];
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
  |  Branch (1932:15): [True: 128k, False: 169]
  ------------------
 1933|    169|  return crypto_int16_nonzero_mask(delta);
 1934|    169|}
sntrup761.c:crypto_int16_negative_mask:
   74|   514k|crypto_int16 crypto_int16_negative_mask(crypto_int16 crypto_int16_x) {
   75|   514k|#if defined(__GNUC__) && defined(__x86_64__)
   76|   514k|  __asm__ ("sarw $15,%0" : "+r"(crypto_int16_x) : : "cc");
   77|   514k|  return crypto_int16_x;
   78|       |#elif defined(__GNUC__) && defined(__aarch64__)
   79|       |  crypto_int16 crypto_int16_y;
   80|       |  __asm__ ("sbfx %w0,%w1,15,1" : "=r"(crypto_int16_y) : "r"(crypto_int16_x) : );
   81|       |  return crypto_int16_y;
   82|       |#else
   83|       |  crypto_int16_x >>= 16-6;
   84|       |  crypto_int16_x += crypto_int16_optblocker;
   85|       |  crypto_int16_x >>= 5;
   86|       |  return crypto_int16_x;
   87|       |#endif
   88|   514k|}
sntrup761.c:crypto_int16_nonzero_mask:
  232|   514k|crypto_int16 crypto_int16_nonzero_mask(crypto_int16 crypto_int16_x) {
  233|   514k|#if defined(__GNUC__) && defined(__x86_64__)
  234|   514k|  crypto_int16 crypto_int16_q,crypto_int16_z;
  ------------------
  |  |   35|   514k|#define crypto_int16 int16_t
  ------------------
  235|   514k|  __asm__ ("xorw %0,%0\n movw $-1,%1\n testw %2,%2\n cmovnew %1,%0" : "=&r"(crypto_int16_z), "=&r"(crypto_int16_q) : "r"(crypto_int16_x) : "cc");
  236|   514k|  return crypto_int16_z;
  237|       |#elif defined(__GNUC__) && defined(__aarch64__)
  238|       |  crypto_int16 crypto_int16_z;
  239|       |  __asm__ ("tst %w1,65535\n csetm %w0,ne" : "=r"(crypto_int16_z) : "r"(crypto_int16_x) : "cc");
  240|       |  return crypto_int16_z;
  241|       |#else
  242|       |  crypto_int16_x |= -crypto_int16_x;
  243|       |  return crypto_int16_negative_mask(crypto_int16_x);
  244|       |#endif
  245|   514k|}
sntrup761.c:F3_freeze:
 1766|   391M|static small F3_freeze(int16_t x) { return x - 3 * ((10923 * x + 16384) >> 15); }
sntrup761.c:Rq_recip3:
 1962|    169|static int Rq_recip3(Fq *out, const small *in) {
 1963|    169|  Fq f[p + 1], g[p + 1], v[p + 1], r[p + 1], scale;
 1964|    169|  int swap, t, i, loop, delta = 1;
 1965|    169|  int32_t f0, g0;
 1966|   128k|  for (i = 0; i < p + 1; ++i) v[i] = 0;
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
  |  Branch (1966:15): [True: 128k, False: 169]
  ------------------
 1967|   128k|  for (i = 0; i < p + 1; ++i) r[i] = 0;
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
  |  Branch (1967:15): [True: 128k, False: 169]
  ------------------
 1968|    169|  r[0] = Fq_recip(3);
 1969|   128k|  for (i = 0; i < p; ++i) f[i] = 0;
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
  |  Branch (1969:15): [True: 128k, False: 169]
  ------------------
 1970|    169|  f[0] = 1;
 1971|    169|  f[p - 1] = f[p] = -1;
  ------------------
  |  | 1754|    169|#define p 761
  ------------------
                f[p - 1] = f[p] = -1;
  ------------------
  |  | 1754|    169|#define p 761
  ------------------
 1972|   128k|  for (i = 0; i < p; ++i) g[p - 1 - i] = in[i];
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
                for (i = 0; i < p; ++i) g[p - 1 - i] = in[i];
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
  |  Branch (1972:15): [True: 128k, False: 169]
  ------------------
 1973|    169|  g[p] = 0;
  ------------------
  |  | 1754|    169|#define p 761
  ------------------
 1974|   257k|  for (loop = 0; loop < 2 * p - 1; ++loop) {
  ------------------
  |  | 1754|   257k|#define p 761
  ------------------
  |  Branch (1974:18): [True: 257k, False: 169]
  ------------------
 1975|   195M|    for (i = p; i > 0; --i) v[i] = v[i - 1];
  ------------------
  |  | 1754|   257k|#define p 761
  ------------------
  |  Branch (1975:17): [True: 195M, False: 257k]
  ------------------
 1976|   257k|    v[0] = 0;
 1977|   257k|    swap = crypto_int16_negative_mask(-delta) & crypto_int16_nonzero_mask(g[0]);
 1978|   257k|    delta ^= swap & (delta ^ -delta);
 1979|   257k|    delta += 1;
 1980|   196M|    for (i = 0; i < p + 1; ++i) {
  ------------------
  |  | 1754|   196M|#define p 761
  ------------------
  |  Branch (1980:17): [True: 195M, False: 257k]
  ------------------
 1981|   195M|      t = swap & (f[i] ^ g[i]);
 1982|   195M|      f[i] ^= t;
 1983|   195M|      g[i] ^= t;
 1984|   195M|      t = swap & (v[i] ^ r[i]);
 1985|   195M|      v[i] ^= t;
 1986|   195M|      r[i] ^= t;
 1987|   195M|    }
 1988|   257k|    f0 = f[0];
 1989|   257k|    g0 = g[0];
 1990|   196M|    for (i = 0; i < p + 1; ++i) g[i] = Fq_freeze(f0 * g[i] - g0 * f[i]);
  ------------------
  |  | 1754|   196M|#define p 761
  ------------------
  |  Branch (1990:17): [True: 195M, False: 257k]
  ------------------
 1991|   196M|    for (i = 0; i < p + 1; ++i) r[i] = Fq_freeze(f0 * r[i] - g0 * v[i]);
  ------------------
  |  | 1754|   196M|#define p 761
  ------------------
  |  Branch (1991:17): [True: 195M, False: 257k]
  ------------------
 1992|   195M|    for (i = 0; i < p; ++i) g[i] = g[i + 1];
  ------------------
  |  | 1754|   195M|#define p 761
  ------------------
  |  Branch (1992:17): [True: 195M, False: 257k]
  ------------------
 1993|   257k|    g[p] = 0;
  ------------------
  |  | 1754|   257k|#define p 761
  ------------------
 1994|   257k|  }
 1995|    169|  scale = Fq_recip(f[0]);
 1996|   128k|  for (i = 0; i < p; ++i) out[i] = Fq_freeze(scale * (int32_t)v[p - 1 - i]);
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
                for (i = 0; i < p; ++i) out[i] = Fq_freeze(scale * (int32_t)v[p - 1 - i]);
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
  |  Branch (1996:15): [True: 128k, False: 169]
  ------------------
 1997|    169|  return crypto_int16_nonzero_mask(delta);
 1998|    169|}
sntrup761.c:Fq_recip:
 1952|    338|static Fq Fq_recip(Fq a1) {
 1953|    338|  int i = 1;
 1954|    338|  Fq ai = a1;
 1955|  1.55M|  while (i < q - 2) {
  ------------------
  |  | 1755|  1.55M|#define q 4591
  ------------------
  |  Branch (1955:10): [True: 1.55M, False: 338]
  ------------------
 1956|  1.55M|    ai = Fq_freeze(a1 * (int32_t)ai);
 1957|  1.55M|    i += 1;
 1958|  1.55M|  }
 1959|    338|  return ai;
 1960|    338|}
sntrup761.c:Fq_freeze:
 1768|   393M|static Fq Fq_freeze(int32_t x) {
 1769|   393M|  const int32_t q16 = (0x10000 + q / 2) / q;
  ------------------
  |  | 1755|   393M|#define q 4591
  ------------------
                const int32_t q16 = (0x10000 + q / 2) / q;
  ------------------
  |  | 1755|   393M|#define q 4591
  ------------------
 1770|   393M|  const int32_t q20 = (0x100000 + q / 2) / q;
  ------------------
  |  | 1755|   393M|#define q 4591
  ------------------
                const int32_t q20 = (0x100000 + q / 2) / q;
  ------------------
  |  | 1755|   393M|#define q 4591
  ------------------
 1771|   393M|  const int32_t q28 = (0x10000000 + q / 2) / q;
  ------------------
  |  | 1755|   393M|#define q 4591
  ------------------
                const int32_t q28 = (0x10000000 + q / 2) / q;
  ------------------
  |  | 1755|   393M|#define q 4591
  ------------------
 1772|   393M|  x -= q * ((q16 * x) >> 16);
  ------------------
  |  | 1755|   393M|#define q 4591
  ------------------
 1773|   393M|  x -= q * ((q20 * x) >> 20);
  ------------------
  |  | 1755|   393M|#define q 4591
  ------------------
 1774|   393M|  return x - q * ((q28 * x + 0x8000000) >> 28);
  ------------------
  |  | 1755|   393M|#define q 4591
  ------------------
 1775|   393M|}
sntrup761.c:Rq_mult_small:
 1936|    181|static void Rq_mult_small(Fq *h, const Fq *f, const small *g) {
 1937|    181|  int32_t fg[p + p - 1];
 1938|    181|  int i, j;
 1939|   275k|  for (i = 0; i < p + p - 1; ++i) fg[i] = 0;
  ------------------
  |  | 1754|   275k|#define p 761
  ------------------
                for (i = 0; i < p + p - 1; ++i) fg[i] = 0;
  ------------------
  |  | 1754|   275k|#define p 761
  ------------------
  |  Branch (1939:15): [True: 275k, False: 181]
  ------------------
 1940|   137k|  for (i = 0; i < p; ++i)
  ------------------
  |  | 1754|   137k|#define p 761
  ------------------
  |  Branch (1940:15): [True: 137k, False: 181]
  ------------------
 1941|   104M|    for (j = 0; j < p; ++j) fg[i + j] += f[i] * (int32_t)g[j];
  ------------------
  |  | 1754|   104M|#define p 761
  ------------------
  |  Branch (1941:17): [True: 104M, False: 137k]
  ------------------
 1942|   137k|  for (i = p; i < p + p - 1; ++i) fg[i - p] += fg[i];
  ------------------
  |  | 1754|    181|#define p 761
  ------------------
                for (i = p; i < p + p - 1; ++i) fg[i - p] += fg[i];
  ------------------
  |  | 1754|   137k|#define p 761
  ------------------
                for (i = p; i < p + p - 1; ++i) fg[i - p] += fg[i];
  ------------------
  |  | 1754|   137k|#define p 761
  ------------------
                for (i = p; i < p + p - 1; ++i) fg[i - p] += fg[i];
  ------------------
  |  | 1754|   137k|#define p 761
  ------------------
  |  Branch (1942:15): [True: 137k, False: 181]
  ------------------
 1943|   137k|  for (i = p; i < p + p - 1; ++i) fg[i - p + 1] += fg[i];
  ------------------
  |  | 1754|    181|#define p 761
  ------------------
                for (i = p; i < p + p - 1; ++i) fg[i - p + 1] += fg[i];
  ------------------
  |  | 1754|   137k|#define p 761
  ------------------
                for (i = p; i < p + p - 1; ++i) fg[i - p + 1] += fg[i];
  ------------------
  |  | 1754|   137k|#define p 761
  ------------------
                for (i = p; i < p + p - 1; ++i) fg[i - p + 1] += fg[i];
  ------------------
  |  | 1754|   137k|#define p 761
  ------------------
  |  Branch (1943:15): [True: 137k, False: 181]
  ------------------
 1944|   137k|  for (i = 0; i < p; ++i) h[i] = Fq_freeze(fg[i]);
  ------------------
  |  | 1754|   137k|#define p 761
  ------------------
  |  Branch (1944:15): [True: 137k, False: 181]
  ------------------
 1945|    181|}
sntrup761.c:Rq_encode:
 2097|    169|static void Rq_encode(unsigned char *s, const Fq *r) {
 2098|    169|  uint16_t R[p], M[p];
 2099|    169|  int i;
 2100|   128k|  for (i = 0; i < p; ++i) R[i] = r[i] + q12;
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
                for (i = 0; i < p; ++i) R[i] = r[i] + q12;
  ------------------
  |  | 1757|   128k|#define q12 ((q - 1) / 2)
  |  |  ------------------
  |  |  |  | 1755|   128k|#define q 4591
  |  |  ------------------
  ------------------
  |  Branch (2100:15): [True: 128k, False: 169]
  ------------------
 2101|   128k|  for (i = 0; i < p; ++i) M[i] = q;
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
                for (i = 0; i < p; ++i) M[i] = q;
  ------------------
  |  | 1755|   128k|#define q 4591
  ------------------
  |  Branch (2101:15): [True: 128k, False: 169]
  ------------------
 2102|    169|  Encode(s, R, M, p);
  ------------------
  |  | 1754|    169|#define p 761
  ------------------
 2103|    169|}
sntrup761.c:Encode:
 1806|  1.92k|static void Encode(unsigned char *out, const uint16_t *R, const uint16_t *M, long long len) {
 1807|  1.92k|  if (len == 1) {
  ------------------
  |  Branch (1807:7): [True: 175, False: 1.75k]
  ------------------
 1808|    175|    uint16_t r = R[0], m = M[0];
 1809|    525|    while (m > 1) {
  ------------------
  |  Branch (1809:12): [True: 350, False: 175]
  ------------------
 1810|    350|      *out++ = r;
 1811|    350|      r >>= 8;
 1812|    350|      m = (m + 255) >> 8;
 1813|    350|    }
 1814|    175|  }
 1815|  1.92k|  if (len > 1) {
  ------------------
  |  Branch (1815:7): [True: 1.75k, False: 175]
  ------------------
 1816|  1.75k|    uint16_t R2[(len + 1) / 2], M2[(len + 1) / 2];
 1817|  1.75k|    long long i;
 1818|   134k|    for (i = 0; i < len - 1; i += 2) {
  ------------------
  |  Branch (1818:17): [True: 133k, False: 1.75k]
  ------------------
 1819|   133k|      uint32_t m0 = M[i];
 1820|   133k|      uint32_t r = R[i] + R[i + 1] * m0;
 1821|   133k|      uint32_t m = M[i + 1] * m0;
 1822|   334k|      while (m >= 16384) {
  ------------------
  |  Branch (1822:14): [True: 201k, False: 133k]
  ------------------
 1823|   201k|        *out++ = r;
 1824|   201k|        r >>= 8;
 1825|   201k|        m = (m + 255) >> 8;
 1826|   201k|      }
 1827|   133k|      R2[i / 2] = r;
 1828|   133k|      M2[i / 2] = m;
 1829|   133k|    }
 1830|  1.75k|    if (i < len) {
  ------------------
  |  Branch (1830:9): [True: 700, False: 1.05k]
  ------------------
 1831|    700|      R2[i / 2] = R[i];
 1832|    700|      M2[i / 2] = M[i];
 1833|    700|    }
 1834|  1.75k|    Encode(out, R2, M2, (len + 1) / 2);
 1835|  1.75k|  }
 1836|  1.92k|}
sntrup761.c:Small_encode:
 2078|    344|static void Small_encode(unsigned char *s, const small *f) {
 2079|    344|  int i, j;
 2080|  65.7k|  for (i = 0; i < p / 4; ++i) {
  ------------------
  |  | 1754|  65.7k|#define p 761
  ------------------
  |  Branch (2080:15): [True: 65.3k, False: 344]
  ------------------
 2081|  65.3k|    small x = 0;
 2082|   326k|    for (j = 0;j < 4;++j) x += (*f++ + 1) << (2 * j);
  ------------------
  |  Branch (2082:16): [True: 261k, False: 65.3k]
  ------------------
 2083|  65.3k|    *s++ = x;
 2084|  65.3k|  }
 2085|    344|  *s = *f++ + 1;
 2086|    344|}
sntrup761.c:Hash_prefix:
 2014|    193|static void Hash_prefix(unsigned char *out, int b, const unsigned char *in, int inlen) {
 2015|    193|  unsigned char x[inlen + 1], h[64];
 2016|    193|  int i;
 2017|    193|  x[0] = b;
 2018|   204k|  for (i = 0; i < inlen; ++i) x[i + 1] = in[i];
  ------------------
  |  Branch (2018:15): [True: 204k, False: 193]
  ------------------
 2019|    193|  crypto_hash_sha512(h, x, inlen + 1);
 2020|  6.36k|  for (i = 0; i < 32; ++i) out[i] = h[i];
  ------------------
  |  Branch (2020:15): [True: 6.17k, False: 193]
  ------------------
 2021|    193|}
sntrup761.c:Short_random:
 2032|    169|static void Short_random(small *out) {
 2033|    169|  uint32_t L[p];
 2034|    169|  int i;
 2035|   128k|  for (i = 0; i < p; ++i) L[i] = urandom32();
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
  |  Branch (2035:15): [True: 128k, False: 169]
  ------------------
 2036|    169|  Short_fromlist(out, L);
 2037|    169|}
sntrup761.c:Short_fromlist:
 2005|    169|static void Short_fromlist(small *out, const uint32_t *in) {
 2006|    169|  uint32_t L[p];
 2007|    169|  int i;
 2008|  48.5k|  for (i = 0; i < w; ++i) L[i] = in[i] & (uint32_t)-2;
  ------------------
  |  | 1756|  48.5k|#define w 286
  ------------------
  |  Branch (2008:15): [True: 48.3k, False: 169]
  ------------------
 2009|  80.4k|  for (i = w; i < p; ++i) L[i] = (in[i] & (uint32_t)-3) | 1;
  ------------------
  |  | 1756|    169|#define w 286
  ------------------
                for (i = w; i < p; ++i) L[i] = (in[i] & (uint32_t)-3) | 1;
  ------------------
  |  | 1754|  80.4k|#define p 761
  ------------------
  |  Branch (2009:15): [True: 80.2k, False: 169]
  ------------------
 2010|    169|  crypto_sort_uint32(L, p);
  ------------------
  |  | 1754|    169|#define p 761
  ------------------
 2011|   128k|  for (i = 0; i < p; ++i) out[i] = (L[i] & 3) - 1;
  ------------------
  |  | 1754|   128k|#define p 761
  ------------------
  |  Branch (2011:15): [True: 128k, False: 169]
  ------------------
 2012|    169|}
sntrup761.c:crypto_sort_uint32:
 1743|    169|{
 1744|    169|  crypto_uint32 *x = array;
 1745|    169|  long long j;
 1746|   128k|  for (j = 0;j < n;++j) x[j] ^= 0x80000000;
  ------------------
  |  Branch (1746:14): [True: 128k, False: 169]
  ------------------
 1747|    169|  crypto_sort_int32(array,n);
 1748|   128k|  for (j = 0;j < n;++j) x[j] ^= 0x80000000;
  ------------------
  |  Branch (1748:14): [True: 128k, False: 169]
  ------------------
 1749|    169|}
sntrup761.c:crypto_sort_int32:
 1680|    169|{
 1681|    169|  long long top,p,q,r,i,j;
 1682|    169|  int32 *x = array;
  ------------------
  |  |   20|    169|#define int32 crypto_int32
  |  |  ------------------
  |  |  |  |  574|    169|#define crypto_int32 int32_t
  |  |  ------------------
  ------------------
 1683|       |
 1684|    169|  if (n < 2) return;
  ------------------
  |  Branch (1684:7): [True: 0, False: 169]
  ------------------
 1685|    169|  top = 1;
 1686|  1.69k|  while (top < n - top) top += top;
  ------------------
  |  Branch (1686:10): [True: 1.52k, False: 169]
  ------------------
 1687|       |
 1688|  1.85k|  for (p = top;p >= 1;p >>= 1) {
  ------------------
  |  Branch (1688:16): [True: 1.69k, False: 169]
  ------------------
 1689|  1.69k|    i = 0;
 1690|   129k|    while (i + 2 * p <= n) {
  ------------------
  |  Branch (1690:12): [True: 127k, False: 1.69k]
  ------------------
 1691|   645k|      for (j = i;j < i + p;++j)
  ------------------
  |  Branch (1691:18): [True: 518k, False: 127k]
  ------------------
 1692|   518k|        int32_MINMAX(x[j],x[j+p]);
  ------------------
  |  | 1677|   518k|#define int32_MINMAX(a,b) crypto_int32_minmax(&a,&b)
  ------------------
 1693|   127k|      i += 2 * p;
 1694|   127k|    }
 1695|  79.7k|    for (j = i;j < n - p;++j)
  ------------------
  |  Branch (1695:16): [True: 78.0k, False: 1.69k]
  ------------------
 1696|  78.0k|      int32_MINMAX(x[j],x[j+p]);
  ------------------
  |  | 1677|  78.0k|#define int32_MINMAX(a,b) crypto_int32_minmax(&a,&b)
  ------------------
 1697|       |
 1698|  1.69k|    i = 0;
 1699|  1.69k|    j = 0;
 1700|  9.29k|    for (q = top;q > p;q >>= 1) {
  ------------------
  |  Branch (1700:18): [True: 7.60k, False: 1.69k]
  ------------------
 1701|  7.60k|      if (j != i) for (;;) {
  ------------------
  |  Branch (1701:11): [True: 2.19k, False: 5.40k]
  ------------------
 1702|  4.22k|        if (j == n - q) goto done;
  ------------------
  |  Branch (1702:13): [True: 0, False: 4.22k]
  ------------------
 1703|  4.22k|        int32 a = x[j + p];
  ------------------
  |  |   20|  4.22k|#define int32 crypto_int32
  |  |  ------------------
  |  |  |  |  574|  4.22k|#define crypto_int32 int32_t
  |  |  ------------------
  ------------------
 1704|  19.6k|        for (r = q;r > p;r >>= 1)
  ------------------
  |  Branch (1704:20): [True: 15.3k, False: 4.22k]
  ------------------
 1705|  15.3k|          int32_MINMAX(a,x[j + r]);
  ------------------
  |  | 1677|  19.6k|#define int32_MINMAX(a,b) crypto_int32_minmax(&a,&b)
  ------------------
 1706|  4.22k|        x[j + p] = a;
 1707|  4.22k|        ++j;
 1708|  4.22k|        if (j == i + p) {
  ------------------
  |  Branch (1708:13): [True: 2.19k, False: 2.02k]
  ------------------
 1709|  2.19k|          i += 2 * p;
 1710|  2.19k|          break;
 1711|  2.19k|        }
 1712|  4.22k|      }
 1713|   132k|      while (i + p <= n - q) {
  ------------------
  |  Branch (1713:14): [True: 124k, False: 7.60k]
  ------------------
 1714|   592k|        for (j = i;j < i + p;++j) {
  ------------------
  |  Branch (1714:20): [True: 467k, False: 124k]
  ------------------
 1715|   467k|          int32 a = x[j + p];
  ------------------
  |  |   20|   467k|#define int32 crypto_int32
  |  |  ------------------
  |  |  |  |  574|   467k|#define crypto_int32 int32_t
  |  |  ------------------
  ------------------
 1716|  2.63M|          for (r = q;r > p;r >>= 1)
  ------------------
  |  Branch (1716:22): [True: 2.16M, False: 467k]
  ------------------
 1717|  2.16M|            int32_MINMAX(a,x[j+r]);
  ------------------
  |  | 1677|  2.16M|#define int32_MINMAX(a,b) crypto_int32_minmax(&a,&b)
  ------------------
 1718|   467k|          x[j + p] = a;
 1719|   467k|        }
 1720|   124k|        i += 2 * p;
 1721|   124k|      }
 1722|       |      /* now i + p > n - q */
 1723|  7.60k|      j = i;
 1724|  52.2k|      while (j < n - q) {
  ------------------
  |  Branch (1724:14): [True: 44.6k, False: 7.60k]
  ------------------
 1725|  44.6k|        int32 a = x[j + p];
  ------------------
  |  |   20|  44.6k|#define int32 crypto_int32
  |  |  ------------------
  |  |  |  |  574|  44.6k|#define crypto_int32 int32_t
  |  |  ------------------
  ------------------
 1726|  97.5k|        for (r = q;r > p;r >>= 1)
  ------------------
  |  Branch (1726:20): [True: 52.8k, False: 44.6k]
  ------------------
 1727|  52.8k|          int32_MINMAX(a,x[j+r]);
  ------------------
  |  | 1677|  52.8k|#define int32_MINMAX(a,b) crypto_int32_minmax(&a,&b)
  ------------------
 1728|  44.6k|        x[j + p] = a;
 1729|  44.6k|        ++j;
 1730|  44.6k|      }
 1731|       |
 1732|  7.60k|      done: ;
 1733|  7.60k|    }
 1734|  1.69k|  }
 1735|    169|}
sntrup761.c:crypto_int32_minmax:
  981|  2.83M|void crypto_int32_minmax(crypto_int32 *crypto_int32_p,crypto_int32 *crypto_int32_q) {
  982|  2.83M|  crypto_int32 crypto_int32_x = *crypto_int32_p;
  ------------------
  |  |  574|  2.83M|#define crypto_int32 int32_t
  ------------------
  983|  2.83M|  crypto_int32 crypto_int32_y = *crypto_int32_q;
  ------------------
  |  |  574|  2.83M|#define crypto_int32 int32_t
  ------------------
  984|  2.83M|#if defined(__GNUC__) && defined(__x86_64__)
  985|  2.83M|  crypto_int32 crypto_int32_z;
  ------------------
  |  |  574|  2.83M|#define crypto_int32 int32_t
  ------------------
  986|  2.83M|  __asm__ ("cmpl %2,%1\n movl %1,%0\n cmovgl %2,%1\n cmovgl %0,%2" : "=&r"(crypto_int32_z), "+&r"(crypto_int32_x), "+r"(crypto_int32_y) : : "cc");
  987|  2.83M|  *crypto_int32_p = crypto_int32_x;
  988|  2.83M|  *crypto_int32_q = crypto_int32_y;
  989|       |#elif defined(__GNUC__) && defined(__aarch64__)
  990|       |  crypto_int32 crypto_int32_r, crypto_int32_s;
  991|       |  __asm__ ("cmp %w2,%w3\n csel %w0,%w2,%w3,lt\n csel %w1,%w3,%w2,lt" : "=&r"(crypto_int32_r), "=r"(crypto_int32_s) : "r"(crypto_int32_x), "r"(crypto_int32_y) : "cc");
  992|       |  *crypto_int32_p = crypto_int32_r;
  993|       |  *crypto_int32_q = crypto_int32_s;
  994|       |#else
  995|       |  crypto_int64 crypto_int32_r = (crypto_int64)crypto_int32_y ^ (crypto_int64)crypto_int32_x;
  996|       |  crypto_int64 crypto_int32_z = (crypto_int64)crypto_int32_y - (crypto_int64)crypto_int32_x;
  997|       |  crypto_int32_z ^= crypto_int32_r & (crypto_int32_z ^ crypto_int32_y);
  998|       |  crypto_int32_z = crypto_int32_negative_mask(crypto_int32_z);
  999|       |  crypto_int32_z &= crypto_int32_r;
 1000|       |  crypto_int32_x ^= crypto_int32_z;
 1001|       |  crypto_int32_y ^= crypto_int32_z;
 1002|       |  *crypto_int32_p = crypto_int32_x;
 1003|       |  *crypto_int32_q = crypto_int32_y;
 1004|       |#endif
 1005|  2.83M|}
sntrup761.c:Hide:
 2180|      6|static void Hide(unsigned char *c, unsigned char *r_enc, const Inputs r, const unsigned char *pk, const unsigned char *cache) {
 2181|      6|  Small_encode(r_enc, r);
 2182|      6|  ZEncrypt(c, r, pk);
 2183|      6|  HashConfirm(c + crypto_kem_sntrup761_CIPHERTEXTBYTES - Confirm_bytes, r_enc, cache);
  ------------------
  |  |    6|      6|#define crypto_kem_sntrup761_CIPHERTEXTBYTES 1039
  ------------------
                HashConfirm(c + crypto_kem_sntrup761_CIPHERTEXTBYTES - Confirm_bytes, r_enc, cache);
  ------------------
  |  | 1764|      6|#define Confirm_bytes 32
  ------------------
 2184|      6|}
sntrup761.c:ZEncrypt:
 2138|      6|static void ZEncrypt(unsigned char *C, const Inputs r, const unsigned char *pk) {
 2139|      6|  Fq h[p], c[p];
 2140|      6|  Rq_decode(h, pk);
 2141|      6|  Encrypt(c, r, h);
 2142|      6|  Rounded_encode(C, c);
 2143|      6|}
sntrup761.c:Rq_decode:
 2105|      6|static void Rq_decode(Fq *r, const unsigned char *s) {
 2106|      6|  uint16_t R[p], M[p];
 2107|      6|  int i;
 2108|  4.57k|  for (i = 0; i < p; ++i) M[i] = q;
  ------------------
  |  | 1754|  4.57k|#define p 761
  ------------------
                for (i = 0; i < p; ++i) M[i] = q;
  ------------------
  |  | 1755|  4.56k|#define q 4591
  ------------------
  |  Branch (2108:15): [True: 4.56k, False: 6]
  ------------------
 2109|      6|  Decode(R, s, M, p);
  ------------------
  |  | 1754|      6|#define p 761
  ------------------
 2110|  4.57k|  for (i = 0; i < p; ++i) r[i] = ((Fq)R[i]) - q12;
  ------------------
  |  | 1754|  4.57k|#define p 761
  ------------------
                for (i = 0; i < p; ++i) r[i] = ((Fq)R[i]) - q12;
  ------------------
  |  | 1757|  4.56k|#define q12 ((q - 1) / 2)
  |  |  ------------------
  |  |  |  | 1755|  4.56k|#define q 4591
  |  |  ------------------
  ------------------
  |  Branch (2110:15): [True: 4.56k, False: 6]
  ------------------
 2111|      6|}
sntrup761.c:Decode:
 1838|    132|static void Decode(uint16_t *out, const unsigned char *S, const uint16_t *M, long long len) {
 1839|    132|  if (len == 1) {
  ------------------
  |  Branch (1839:7): [True: 12, False: 120]
  ------------------
 1840|     12|    if (M[0] == 1)
  ------------------
  |  Branch (1840:9): [True: 0, False: 12]
  ------------------
 1841|      0|      *out = 0;
 1842|     12|    else if (M[0] <= 256)
  ------------------
  |  Branch (1842:14): [True: 0, False: 12]
  ------------------
 1843|      0|      *out = uint32_mod_uint14(S[0], M[0]);
 1844|     12|    else
 1845|     12|      *out = uint32_mod_uint14(S[0] + (((uint16_t)S[1]) << 8), M[0]);
 1846|     12|  }
 1847|    132|  if (len > 1) {
  ------------------
  |  Branch (1847:7): [True: 120, False: 12]
  ------------------
 1848|    120|    uint16_t R2[(len + 1) / 2], M2[(len + 1) / 2], bottomr[len / 2];
 1849|    120|    uint32_t bottomt[len / 2];
 1850|    120|    long long i;
 1851|  9.24k|    for (i = 0; i < len - 1; i += 2) {
  ------------------
  |  Branch (1851:17): [True: 9.12k, False: 120]
  ------------------
 1852|  9.12k|      uint32_t m = M[i] * (uint32_t)M[i + 1];
 1853|  9.12k|      if (m > 256 * 16383) {
  ------------------
  |  Branch (1853:11): [True: 3.84k, False: 5.27k]
  ------------------
 1854|  3.84k|        bottomt[i / 2] = 256 * 256;
 1855|  3.84k|        bottomr[i / 2] = S[0] + 256 * S[1];
 1856|  3.84k|        S += 2;
 1857|  3.84k|        M2[i / 2] = (((m + 255) >> 8) + 255) >> 8;
 1858|  5.27k|      } else if (m >= 16384) {
  ------------------
  |  Branch (1858:18): [True: 5.27k, False: 0]
  ------------------
 1859|  5.27k|        bottomt[i / 2] = 256;
 1860|  5.27k|        bottomr[i / 2] = S[0];
 1861|  5.27k|        S += 1;
 1862|  5.27k|        M2[i / 2] = (m + 255) >> 8;
 1863|  5.27k|      } else {
 1864|      0|        bottomt[i / 2] = 1;
 1865|      0|        bottomr[i / 2] = 0;
 1866|      0|        M2[i / 2] = m;
 1867|      0|      }
 1868|  9.12k|    }
 1869|    120|    if (i < len) M2[i / 2] = M[i];
  ------------------
  |  Branch (1869:9): [True: 48, False: 72]
  ------------------
 1870|    120|    Decode(R2, S, M2, (len + 1) / 2);
 1871|  9.24k|    for (i = 0; i < len - 1; i += 2) {
  ------------------
  |  Branch (1871:17): [True: 9.12k, False: 120]
  ------------------
 1872|  9.12k|      uint32_t r1, r = bottomr[i / 2];
 1873|  9.12k|      uint16_t r0;
 1874|  9.12k|      r += bottomt[i / 2] * R2[i / 2];
 1875|  9.12k|      uint32_divmod_uint14(&r1, &r0, r, M[i]);
 1876|  9.12k|      r1 = uint32_mod_uint14(r1, M[i + 1]);
 1877|  9.12k|      *out++ = r0;
 1878|  9.12k|      *out++ = r1;
 1879|  9.12k|    }
 1880|    120|    if (i < len) *out++ = R2[i / 2];
  ------------------
  |  Branch (1880:9): [True: 48, False: 72]
  ------------------
 1881|    120|  }
 1882|    132|}
sntrup761.c:uint32_mod_uint14:
 1799|  9.13k|static uint16_t uint32_mod_uint14(uint32_t x, uint16_t m) {
 1800|  9.13k|  uint32_t Q;
 1801|  9.13k|  uint16_t r;
 1802|  9.13k|  uint32_divmod_uint14(&Q, &r, x, m);
 1803|  9.13k|  return r;
 1804|  9.13k|}
sntrup761.c:uint32_divmod_uint14:
 1783|  18.2k|static void uint32_divmod_uint14(uint32_t *Q, uint16_t *r, uint32_t x, uint16_t m) {
 1784|  18.2k|  uint32_t qpart, mask, v = 0x80000000 / m;
 1785|  18.2k|  qpart = (x * (uint64_t)v) >> 31;
 1786|  18.2k|  x -= qpart * m;
 1787|  18.2k|  *Q = qpart;
 1788|  18.2k|  qpart = (x * (uint64_t)v) >> 31;
 1789|  18.2k|  x -= qpart * m;
 1790|  18.2k|  *Q += qpart;
 1791|  18.2k|  x -= m;
 1792|  18.2k|  *Q += 1;
 1793|  18.2k|  mask = crypto_int32_negative_mask(x);
 1794|  18.2k|  x += mask & (uint32_t)m;
 1795|  18.2k|  *Q += mask;
 1796|  18.2k|  *r = x;
 1797|  18.2k|}
sntrup761.c:crypto_int32_negative_mask:
  621|  18.2k|crypto_int32 crypto_int32_negative_mask(crypto_int32 crypto_int32_x) {
  622|  18.2k|#if defined(__GNUC__) && defined(__x86_64__)
  623|  18.2k|  __asm__ ("sarl $31,%0" : "+r"(crypto_int32_x) : : "cc");
  624|  18.2k|  return crypto_int32_x;
  625|       |#elif defined(__GNUC__) && defined(__aarch64__)
  626|       |  crypto_int32 crypto_int32_y;
  627|       |  __asm__ ("asr %w0,%w1,31" : "=r"(crypto_int32_y) : "r"(crypto_int32_x) : );
  628|       |  return crypto_int32_y;
  629|       |#else
  630|       |  crypto_int32_x >>= 32-6;
  631|       |  crypto_int32_x += crypto_int32_optblocker;
  632|       |  crypto_int32_x >>= 5;
  633|       |  return crypto_int32_x;
  634|       |#endif
  635|  18.2k|}
sntrup761.c:Encrypt:
 2059|      6|static void Encrypt(Fq *c, const small *r, const Fq *h) {
 2060|      6|  Fq hr[p];
 2061|      6|  Rq_mult_small(hr, h, r);
 2062|      6|  Round(c, hr);
 2063|      6|}
sntrup761.c:Round:
 2000|      6|static void Round(Fq *out, const Fq *a) {
 2001|      6|  int i;
 2002|  4.57k|  for (i = 0; i < p; ++i) out[i] = a[i] - F3_freeze(a[i]);
  ------------------
  |  | 1754|  4.57k|#define p 761
  ------------------
  |  Branch (2002:15): [True: 4.56k, False: 6]
  ------------------
 2003|      6|}
sntrup761.c:Rounded_encode:
 2113|      6|static void Rounded_encode(unsigned char *s, const Fq *r) {
 2114|      6|  uint16_t R[p], M[p];
 2115|      6|  int i;
 2116|  4.57k|  for (i = 0; i < p; ++i) R[i] = ((r[i] + q12) * 10923) >> 15;
  ------------------
  |  | 1754|  4.57k|#define p 761
  ------------------
                for (i = 0; i < p; ++i) R[i] = ((r[i] + q12) * 10923) >> 15;
  ------------------
  |  | 1757|  4.56k|#define q12 ((q - 1) / 2)
  |  |  ------------------
  |  |  |  | 1755|  4.56k|#define q 4591
  |  |  ------------------
  ------------------
  |  Branch (2116:15): [True: 4.56k, False: 6]
  ------------------
 2117|  4.57k|  for (i = 0; i < p; ++i) M[i] = (q + 2) / 3;
  ------------------
  |  | 1754|  4.57k|#define p 761
  ------------------
                for (i = 0; i < p; ++i) M[i] = (q + 2) / 3;
  ------------------
  |  | 1755|  4.56k|#define q 4591
  ------------------
  |  Branch (2117:15): [True: 4.56k, False: 6]
  ------------------
 2118|      6|  Encode(s, R, M, p);
  ------------------
  |  | 1754|      6|#define p 761
  ------------------
 2119|      6|}
sntrup761.c:HashConfirm:
 2154|      6|static void HashConfirm(unsigned char *h, const unsigned char *r, const unsigned char *cache) {
 2155|      6|  unsigned char x[Hash_bytes * 2];
 2156|      6|  int i;
 2157|      6|  Hash_prefix(x, 3, r, Small_bytes);
  ------------------
  |  | 1761|      6|#define Small_bytes ((p + 3) / 4)
  |  |  ------------------
  |  |  |  | 1754|      6|#define p 761
  |  |  ------------------
  ------------------
 2158|    198|  for (i = 0; i < Hash_bytes; ++i) x[Hash_bytes + i] = cache[i];
  ------------------
  |  | 1760|    198|#define Hash_bytes 32
  ------------------
                for (i = 0; i < Hash_bytes; ++i) x[Hash_bytes + i] = cache[i];
  ------------------
  |  | 1760|    192|#define Hash_bytes 32
  ------------------
  |  Branch (2158:15): [True: 192, False: 6]
  ------------------
 2159|      6|  Hash_prefix(h, 2, x, sizeof x);
 2160|      6|}
sntrup761.c:HashSession:
 2162|      6|static void HashSession(unsigned char *k, int b, const unsigned char *y, const unsigned char *z) {
 2163|      6|  unsigned char x[Hash_bytes + crypto_kem_sntrup761_CIPHERTEXTBYTES];
 2164|      6|  int i;
 2165|      6|  Hash_prefix(x, 3, y, Small_bytes);
  ------------------
  |  | 1761|      6|#define Small_bytes ((p + 3) / 4)
  |  |  ------------------
  |  |  |  | 1754|      6|#define p 761
  |  |  ------------------
  ------------------
 2166|  6.24k|  for (i = 0; i < crypto_kem_sntrup761_CIPHERTEXTBYTES; ++i) x[Hash_bytes + i] = z[i];
  ------------------
  |  |    6|  6.24k|#define crypto_kem_sntrup761_CIPHERTEXTBYTES 1039
  ------------------
                for (i = 0; i < crypto_kem_sntrup761_CIPHERTEXTBYTES; ++i) x[Hash_bytes + i] = z[i];
  ------------------
  |  | 1760|  6.23k|#define Hash_bytes 32
  ------------------
  |  Branch (2166:15): [True: 6.23k, False: 6]
  ------------------
 2167|      6|  Hash_prefix(k, b, x, sizeof x);
 2168|      6|}
sntrup761.c:ZDecrypt:
 2145|      6|static void ZDecrypt(Inputs r, const unsigned char *C, const unsigned char *sk) {
 2146|      6|  small f[p], v[p];
 2147|      6|  Fq c[p];
 2148|      6|  Small_decode(f, sk);
 2149|      6|  Small_decode(v, sk + Small_bytes);
  ------------------
  |  | 1761|      6|#define Small_bytes ((p + 3) / 4)
  |  |  ------------------
  |  |  |  | 1754|      6|#define p 761
  |  |  ------------------
  ------------------
 2150|      6|  Rounded_decode(c, C);
 2151|      6|  Decrypt(r, c, f, v);
 2152|      6|}
sntrup761.c:Small_decode:
 2088|     12|static void Small_decode(small *f, const unsigned char *s) {
 2089|     12|  int i, j;
 2090|  2.29k|  for (i = 0; i < p / 4; ++i) {
  ------------------
  |  | 1754|  2.29k|#define p 761
  ------------------
  |  Branch (2090:15): [True: 2.28k, False: 12]
  ------------------
 2091|  2.28k|    unsigned char x = *s++;
 2092|  11.4k|    for (j = 0;j < 4;++j) *f++ = ((small)((x >> (2 * j)) & 3)) - 1;
  ------------------
  |  Branch (2092:16): [True: 9.12k, False: 2.28k]
  ------------------
 2093|  2.28k|  }
 2094|     12|  *f++ = ((small)(*s & 3)) - 1;
 2095|     12|}
sntrup761.c:Rounded_decode:
 2121|      6|static void Rounded_decode(Fq *r, const unsigned char *s) {
 2122|      6|  uint16_t R[p], M[p];
 2123|      6|  int i;
 2124|  4.57k|  for (i = 0; i < p; ++i) M[i] = (q + 2) / 3;
  ------------------
  |  | 1754|  4.57k|#define p 761
  ------------------
                for (i = 0; i < p; ++i) M[i] = (q + 2) / 3;
  ------------------
  |  | 1755|  4.56k|#define q 4591
  ------------------
  |  Branch (2124:15): [True: 4.56k, False: 6]
  ------------------
 2125|      6|  Decode(R, s, M, p);
  ------------------
  |  | 1754|      6|#define p 761
  ------------------
 2126|  4.57k|  for (i = 0; i < p; ++i) r[i] = R[i] * 3 - q12;
  ------------------
  |  | 1754|  4.57k|#define p 761
  ------------------
                for (i = 0; i < p; ++i) r[i] = R[i] * 3 - q12;
  ------------------
  |  | 1757|  4.56k|#define q12 ((q - 1) / 2)
  |  |  ------------------
  |  |  |  | 1755|  4.56k|#define q 4591
  |  |  ------------------
  ------------------
  |  Branch (2126:15): [True: 4.56k, False: 6]
  ------------------
 2127|      6|}
sntrup761.c:Decrypt:
 2065|      6|static void Decrypt(small *r, const Fq *c, const small *f, const small *ginv) {
 2066|      6|  Fq cf[p], cf3[p];
 2067|      6|  small e[p], ev[p];
 2068|      6|  int mask, i;
 2069|      6|  Rq_mult_small(cf, c, f);
 2070|      6|  Rq_mult3(cf3, cf);
 2071|      6|  R3_fromRq(e, cf3);
 2072|      6|  R3_mult(ev, e, ginv);
 2073|      6|  mask = Weightw_mask(ev);
 2074|  1.72k|  for (i = 0; i < w; ++i) r[i] = ((ev[i] ^ 1) & ~mask) ^ 1;
  ------------------
  |  | 1756|  1.72k|#define w 286
  ------------------
  |  Branch (2074:15): [True: 1.71k, False: 6]
  ------------------
 2075|  2.85k|  for (i = w; i < p; ++i) r[i] = ev[i] & ~mask;
  ------------------
  |  | 1756|      6|#define w 286
  ------------------
                for (i = w; i < p; ++i) r[i] = ev[i] & ~mask;
  ------------------
  |  | 1754|  2.85k|#define p 761
  ------------------
  |  Branch (2075:15): [True: 2.85k, False: 6]
  ------------------
 2076|      6|}
sntrup761.c:Rq_mult3:
 1947|      6|static void Rq_mult3(Fq *h, const Fq *f) {
 1948|      6|  int i;
 1949|  4.57k|  for (i = 0; i < p; ++i) h[i] = Fq_freeze(3 * f[i]);
  ------------------
  |  | 1754|  4.57k|#define p 761
  ------------------
  |  Branch (1949:15): [True: 4.56k, False: 6]
  ------------------
 1950|      6|}
sntrup761.c:R3_fromRq:
 1884|      6|static void R3_fromRq(small *out, const Fq *r) {
 1885|      6|  int i;
 1886|  4.57k|  for (i = 0; i < p; ++i) out[i] = F3_freeze(r[i]);
  ------------------
  |  | 1754|  4.57k|#define p 761
  ------------------
  |  Branch (1886:15): [True: 4.56k, False: 6]
  ------------------
 1887|      6|}
sntrup761.c:R3_mult:
 1889|      6|static void R3_mult(small *h, const small *f, const small *g) {
 1890|      6|  int16_t fg[p + p - 1];
 1891|      6|  int i, j;
 1892|  9.13k|  for (i = 0; i < p + p - 1; ++i) fg[i] = 0;
  ------------------
  |  | 1754|  9.13k|#define p 761
  ------------------
                for (i = 0; i < p + p - 1; ++i) fg[i] = 0;
  ------------------
  |  | 1754|  9.13k|#define p 761
  ------------------
  |  Branch (1892:15): [True: 9.12k, False: 6]
  ------------------
 1893|  4.57k|  for (i = 0; i < p; ++i)
  ------------------
  |  | 1754|  4.57k|#define p 761
  ------------------
  |  Branch (1893:15): [True: 4.56k, False: 6]
  ------------------
 1894|  3.47M|    for (j = 0; j < p; ++j) fg[i + j] += f[i] * (int16_t)g[j];
  ------------------
  |  | 1754|  3.47M|#define p 761
  ------------------
  |  Branch (1894:17): [True: 3.47M, False: 4.56k]
  ------------------
 1895|  4.56k|  for (i = p; i < p + p - 1; ++i) fg[i - p] += fg[i];
  ------------------
  |  | 1754|      6|#define p 761
  ------------------
                for (i = p; i < p + p - 1; ++i) fg[i - p] += fg[i];
  ------------------
  |  | 1754|  4.56k|#define p 761
  ------------------
                for (i = p; i < p + p - 1; ++i) fg[i - p] += fg[i];
  ------------------
  |  | 1754|  4.56k|#define p 761
  ------------------
                for (i = p; i < p + p - 1; ++i) fg[i - p] += fg[i];
  ------------------
  |  | 1754|  4.56k|#define p 761
  ------------------
  |  Branch (1895:15): [True: 4.56k, False: 6]
  ------------------
 1896|  4.56k|  for (i = p; i < p + p - 1; ++i) fg[i - p + 1] += fg[i];
  ------------------
  |  | 1754|      6|#define p 761
  ------------------
                for (i = p; i < p + p - 1; ++i) fg[i - p + 1] += fg[i];
  ------------------
  |  | 1754|  4.56k|#define p 761
  ------------------
                for (i = p; i < p + p - 1; ++i) fg[i - p + 1] += fg[i];
  ------------------
  |  | 1754|  4.56k|#define p 761
  ------------------
                for (i = p; i < p + p - 1; ++i) fg[i - p + 1] += fg[i];
  ------------------
  |  | 1754|  4.56k|#define p 761
  ------------------
  |  Branch (1896:15): [True: 4.56k, False: 6]
  ------------------
 1897|  4.57k|  for (i = 0; i < p; ++i) h[i] = F3_freeze(fg[i]);
  ------------------
  |  | 1754|  4.57k|#define p 761
  ------------------
  |  Branch (1897:15): [True: 4.56k, False: 6]
  ------------------
 1898|      6|}
sntrup761.c:Weightw_mask:
 1777|      6|static int Weightw_mask(small *r) {
 1778|      6|  int i, weight = 0;
 1779|  4.57k|  for (i = 0; i < p; ++i) weight += crypto_int64_bottombit_01(r[i]);
  ------------------
  |  | 1754|  4.57k|#define p 761
  ------------------
  |  Branch (1779:15): [True: 4.56k, False: 6]
  ------------------
 1780|      6|  return crypto_int16_nonzero_mask(weight - w);
  ------------------
  |  | 1756|      6|#define w 286
  ------------------
 1781|      6|}
sntrup761.c:crypto_int64_bottombit_01:
 1253|  4.57k|crypto_int64 crypto_int64_bottombit_01(crypto_int64 crypto_int64_x) {
 1254|  4.57k|#if defined(__GNUC__) && defined(__x86_64__)
 1255|  4.57k|  __asm__ ("andq $1,%0" : "+r"(crypto_int64_x) : : "cc");
 1256|  4.57k|  return crypto_int64_x;
 1257|       |#elif defined(__GNUC__) && defined(__aarch64__)
 1258|       |  crypto_int64 crypto_int64_y;
 1259|       |  __asm__ ("ubfx %0,%1,0,1" : "=r"(crypto_int64_y) : "r"(crypto_int64_x) : );
 1260|       |  return crypto_int64_y;
 1261|       |#else
 1262|       |  crypto_int64_x &= 1 + crypto_int64_optblocker;
 1263|       |  return crypto_int64_x;
 1264|       |#endif
 1265|  4.57k|}
sntrup761.c:Ciphertexts_diff_mask:
 2196|      6|static int Ciphertexts_diff_mask(const unsigned char *c, const unsigned char *c2) {
 2197|      6|  uint16_t differentbits = 0;
 2198|      6|  int len = crypto_kem_sntrup761_CIPHERTEXTBYTES;
  ------------------
  |  |    6|      6|#define crypto_kem_sntrup761_CIPHERTEXTBYTES 1039
  ------------------
 2199|  6.24k|  while (len-- > 0) differentbits |= (*c++) ^ (*c2++);
  ------------------
  |  Branch (2199:10): [True: 6.23k, False: 6]
  ------------------
 2200|      6|  return (crypto_int64_bitmod_01((differentbits - 1),8)) - 1;
 2201|      6|}
sntrup761.c:crypto_int64_bitmod_01:
 1332|      6|crypto_int64 crypto_int64_bitmod_01(crypto_int64 crypto_int64_x,crypto_int64 crypto_int64_s) {
 1333|      6|  crypto_int64_x = crypto_int64_shrmod(crypto_int64_x,crypto_int64_s);
 1334|      6|  return crypto_int64_bottombit_01(crypto_int64_x);
 1335|      6|}
sntrup761.c:crypto_int64_shrmod:
 1310|      6|crypto_int64 crypto_int64_shrmod(crypto_int64 crypto_int64_x,crypto_int64 crypto_int64_s) {
 1311|      6|#if defined(__GNUC__) && defined(__x86_64__)
 1312|      6|  __asm__ ("sarq %%cl,%0" : "+r"(crypto_int64_x) : "c"(crypto_int64_s) : "cc");
 1313|       |#elif defined(__GNUC__) && defined(__aarch64__)
 1314|       |  __asm__ ("asr %0,%0,%1" : "+r"(crypto_int64_x) : "r"(crypto_int64_s) : );
 1315|       |#else
 1316|       |  int crypto_int64_k, crypto_int64_l;
 1317|       |  for (crypto_int64_l = 0,crypto_int64_k = 1;crypto_int64_k < 64;++crypto_int64_l,crypto_int64_k *= 2)
 1318|       |    crypto_int64_x ^= (crypto_int64_x ^ (crypto_int64_x >> crypto_int64_k)) & crypto_int64_bitinrangepublicpos_mask(crypto_int64_s,crypto_int64_l);
 1319|       |#endif
 1320|      6|  return crypto_int64_x;
 1321|      6|}

sntrup761.c:randombytes:
   24|   257k|static inline void randombytes(unsigned char* buf, unsigned int len) {
   25|   257k|    genrandom(buf, len);
   26|   257k|}
sntrup761.c:crypto_hash_sha512:
   36|    193|{
   37|    193|  hash_state hs;
   38|       |
   39|    193|  sha512_init(&hs);
   40|    193|  sha512_process(&hs, m, n);
   41|    193|  return sha512_done(&hs, out);
   42|    193|}

